feat(components): add large set of new UI components and demos, reorganize groups, and bump a few dependencies

ts_web/elements/00group-layout/dees-chips/dees-chips.demo.ts

@@ -0,0 +1,112 @@
+import { html, cssManager } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+  <style>
+    .demoContainer {
+      display: flex;
+      flex-direction: column;
+      gap: 32px;
+      padding: 48px;
+      background: ${cssManager.bdTheme('#f8f9fa', '#0a0a0a')};
+      min-height: 100vh;
+    }
+    
+    .section {
+      background: ${cssManager.bdTheme('#ffffff', '#18181b')};
+      border: 1px solid ${cssManager.bdTheme('#e5e7eb', '#27272a')};
+      border-radius: 8px;
+      padding: 24px;
+      box-shadow: 0 1px 3px rgba(0, 0, 0, 0.1);
+    }
+    
+    .section-title {
+      font-size: 18px;
+      font-weight: 600;
+      margin-bottom: 16px;
+      color: ${cssManager.bdTheme('#09090b', '#fafafa')};
+    }
+    
+    .section-description {
+      font-size: 14px;
+      color: ${cssManager.bdTheme('#71717a', '#a1a1aa')};
+      margin-bottom: 16px;
+    }
+  </style>
+  <div class="demoContainer">
+    <div class="section">
+      <div class="section-title">Non-Selectable Chips</div>
+      <div class="section-description">Basic chips without selection capability. Use for display-only tags.</div>
+      <dees-chips
+        selectionMode="none"
+        .selectableChips=${[
+          { key: 'status', value: 'Active' },
+          { key: 'tier', value: 'Premium' },
+          { key: 'region', value: 'EU-West' },
+          { key: 'type', value: 'Enterprise' },
+        ]}
+      ></dees-chips>
+    </div>
+    
+    <div class="section">
+      <div class="section-title">Single Selection Chips</div>
+      <div class="section-description">Click to select one chip at a time. Useful for filters and options.</div>
+      <dees-chips
+        selectionMode="single"
+        .selectableChips=${[
+          { key: 'all', value: 'All Projects' },
+          { key: 'active', value: 'Active' },
+          { key: 'archived', value: 'Archived' },
+          { key: 'drafts', value: 'Drafts' },
+        ]}
+      ></dees-chips>
+    </div>
+    
+    <div class="section">
+      <div class="section-title">Multiple Selection Chips</div>
+      <div class="section-description">Select multiple chips simultaneously. Great for tag selection.</div>
+      <dees-chips
+        selectionMode="multiple"
+        .selectableChips=${[
+          { key: 'js', value: 'JavaScript' },
+          { key: 'ts', value: 'TypeScript' },
+          { key: 'react', value: 'React' },
+          { key: 'vue', value: 'Vue' },
+          { key: 'angular', value: 'Angular' },
+          { key: 'node', value: 'Node.js' },
+        ]}
+      ></dees-chips>
+    </div>
+    
+    <div class="section">
+      <div class="section-title">Removable Chips with Keys</div>
+      <div class="section-description">Chips with remove buttons and key-value pairs. Perfect for dynamic lists.</div>
+      <dees-chips
+        selectionMode="single"
+        chipsAreRemovable
+        .selectableChips=${[
+          { key: 'env', value: 'Production' },
+          { key: 'version', value: '2.4.1' },
+          { key: 'branch', value: 'main' },
+          { key: 'author', value: 'John Doe' },
+        ]}
+      ></dees-chips>
+    </div>
+    
+    <div class="section">
+      <div class="section-title">Mixed Content Example</div>
+      <div class="section-description">Combining different chip types for complex UIs.</div>
+      <dees-chips
+        selectionMode="multiple"
+        chipsAreRemovable
+        .selectableChips=${[
+          { key: 'priority', value: 'High' },
+          { key: 'status', value: 'In Progress' },
+          { key: 'bug', value: 'Bug' },
+          { key: 'feature', value: 'Feature' },
+          { key: 'sprint', value: 'Sprint 23' },
+          { key: 'assignee', value: 'Alice' },
+        ]}
+      ></dees-chips>
+    </div>
+  </div>
+`;

ts_web/elements/00group-layout/dees-chips/dees-chips.ts

@@ -0,0 +1,246 @@
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { demoFunc } from './dees-chips.demo.js';
+import { themeDefaultStyles } from '../../00theme.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-chips': DeesChips;
+  }
+}
+
+type Tag = { key: string; value: string };
+
+@customElement('dees-chips')
+export class DeesChips extends DeesElement {
+  public static demo = demoFunc;
+  public static demoGroups = ['Layout'];
+
+  @property()
+  accessor selectionMode: 'none' | 'single' | 'multiple' = 'single';
+
+  @property({
+    type: Boolean,
+  })
+  accessor chipsAreRemovable: boolean = false;
+
+  @property({
+    type: Array,
+  })
+  accessor selectableChips: Tag[] = [];
+
+  @property()
+  accessor selectedChip: Tag = null;
+
+  @property({
+    type: Array,
+  })
+  accessor selectedChips: Tag[] = [];
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    themeDefaultStyles,
+    cssManager.defaultStyles,
+    css`
+      /* TODO: Migrate hardcoded values to --dees-* CSS variables */
+      :host {
+        display: block;
+        box-sizing: border-box;
+      }
+
+      .mainbox {
+        user-select: none;
+        display: flex;
+        flex-wrap: wrap;
+        gap: 8px;
+      }
+
+      .chip {
+        background: ${cssManager.bdTheme('#f4f4f5', '#27272a')};
+        border: 1px solid ${cssManager.bdTheme('#e5e7eb', '#3f3f46')};
+        display: inline-flex;
+        align-items: center;
+        height: 32px;
+        padding: 0px 12px;
+        font-size: 14px;
+        font-weight: 500;
+        color: ${cssManager.bdTheme('#09090b', '#fafafa')};
+        border-radius: 6px;
+        position: relative;
+        cursor: pointer;
+        transition: all 0.15s ease;
+        box-shadow: 0 1px 2px 0 rgba(0, 0, 0, 0.05);
+      }
+
+      .chip:hover {
+        background: ${cssManager.bdTheme('#e5e7eb', '#3f3f46')};
+        border-color: ${cssManager.bdTheme('#d1d5db', '#52525b')};
+      }
+
+      .chip:active {
+        transform: scale(0.98);
+      }
+
+      .chip.selected {
+        background: ${cssManager.bdTheme('#3b82f6', '#3b82f6')};
+        border-color: ${cssManager.bdTheme('#3b82f6', '#3b82f6')};
+        color: #ffffff;
+      }
+
+      .chip.selected:hover {
+        background: ${cssManager.bdTheme('#2563eb', '#2563eb')};
+        border-color: ${cssManager.bdTheme('#2563eb', '#2563eb')};
+      }
+
+      .chipKey {
+        background: ${cssManager.bdTheme('rgba(0, 0, 0, 0.06)', 'rgba(255, 255, 255, 0.1)')};
+        height: 20px;
+        line-height: 20px;
+        display: inline-flex;
+        align-items: center;
+        margin-left: -8px;
+        padding: 0px 8px;
+        margin-right: 8px;
+        border-radius: 4px;
+        font-size: 12px;
+        font-weight: 600;
+        color: ${cssManager.bdTheme('#71717a', '#a1a1aa')};
+      }
+
+      .chip.selected .chipKey {
+        background: rgba(255, 255, 255, 0.2);
+        color: rgba(255, 255, 255, 0.9);
+      }
+
+      dees-icon {
+        display: flex;
+        align-items: center;
+        justify-content: center;
+        width: 16px;
+        height: 16px;
+        margin-left: 8px;
+        margin-right: -6px;
+        border-radius: 3px;
+        transition: all 0.15s ease;
+        color: ${cssManager.bdTheme('#71717a', '#a1a1aa')};
+      }
+
+      .chip.selected dees-icon {
+        color: rgba(255, 255, 255, 0.8);
+      }
+
+      dees-icon:hover {
+        background: ${cssManager.bdTheme('rgba(0, 0, 0, 0.1)', 'rgba(255, 255, 255, 0.1)')};
+        color: ${cssManager.bdTheme('#ef4444', '#ef4444')};
+      }
+
+      .chip.selected dees-icon:hover {
+        background: rgba(255, 255, 255, 0.2);
+        color: #ffffff;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="mainbox">
+        ${this.selectableChips.map(
+          (chip) => html`
+            <div
+              @click=${() => this.selectChip(chip)}
+              class="chip ${this.isSelected(chip) ? 'selected' : ''}"
+            >
+              ${chip.key ? html`<div class="chipKey">${chip.key}</div>` : html``} ${chip.value}
+              ${this.chipsAreRemovable
+                ? html`
+                    <dees-icon
+                      @click=${(event: Event) => {
+                        event.stopPropagation(); // prevent the selectChip event from being triggered
+                        this.removeChip(chip);
+                      }}
+                      .icon=${'fa:xmark'}
+                    ></dees-icon>
+                  `
+                : html``}
+            </div>
+          `
+        )}
+      </div>
+    `;
+  }
+
+  public async firstUpdated() {
+    // Component initialized
+  }
+
+  private isSelected(chip: Tag): boolean {
+    if (this.selectionMode === 'single') {
+      return this.selectedChip ? this.isSameChip(this.selectedChip, chip) : false;
+    } else {
+      return this.selectedChips.some((selected) => this.isSameChip(selected, chip));
+    }
+  }
+  
+  private isSameChip(chip1: Tag, chip2: Tag): boolean {
+    // If both have keys, compare by key
+    if (chip1.key && chip2.key) {
+      return chip1.key === chip2.key;
+    }
+    // Otherwise compare by value (and key if present)
+    return chip1.value === chip2.value && chip1.key === chip2.key;
+  }
+
+  public async selectChip(chip: Tag) {
+    if (this.selectionMode === 'none') {
+      return;
+    }
+
+    if (this.selectionMode === 'single') {
+      if (this.isSelected(chip)) {
+        this.selectedChip = null;
+        this.selectedChips = [];
+      } else {
+        this.selectedChip = chip;
+        this.selectedChips = [chip];
+      }
+    } else if (this.selectionMode === 'multiple') {
+      if (this.isSelected(chip)) {
+        this.selectedChips = this.selectedChips.filter((selected) => !this.isSameChip(selected, chip));
+      } else {
+        this.selectedChips = [...this.selectedChips, chip];
+      }
+      this.requestUpdate();
+    }
+    console.log(this.selectedChips);
+  }
+
+  public removeChip(chipToRemove: Tag): void {
+    // Remove the chip from selectableChips
+    this.selectableChips = this.selectableChips.filter((chip) => !this.isSameChip(chip, chipToRemove));
+
+    // Remove the chip from selectedChips if present
+    this.selectedChips = this.selectedChips.filter((chip) => !this.isSameChip(chip, chipToRemove));
+
+    // If the removed chip was the selectedChip, set selectedChip to null
+    if (this.selectedChip && this.isSameChip(this.selectedChip, chipToRemove)) {
+      this.selectedChip = null;
+    }
+
+    // Trigger an update to re-render the component
+    this.requestUpdate();
+  }
+}

ts_web/elements/00group-layout/dees-chips/index.ts

@@ -0,0 +1 @@
+export * from './dees-chips.js';

ts_web/elements/00group-layout/dees-dashboardgrid/README.md

@@ -0,0 +1,47 @@
+# dees-dashboardgrid
+
+`<dees-dashboardgrid>` renders a configurable dashboard layout with draggable and resizable tiles. The component is now grouped in its own folder alongside supporting utilities and styles.
+
+## Key Features
+
+- Pointer-driven drag and resize interactions with keyboard fallbacks (arrow keys to move, `Shift` + arrows to resize).
+- Collision-aware placement that swaps compatible tiles or displaces blocking tiles into the next free slot.
+- Context menu (right-click on a tile header) that exposes destructive actions such as tile removal via `dees-contextmenu`.
+- Layout persistence helpers via `getLayout()`, `setLayout(...)`, and the `layout-change` event.
+- Responsive presets through the `layouts` map and `applyBreakpointLayout(...)` helper to hydrate per-breakpoint arrangements.
+
+## Public API Highlights
+
+| Property | Description |
+| --- | --- |
+| `widgets` | Array of tile descriptors (`DashboardWidget`). |
+| `columns` | Number of grid columns. |
+| `layouts` | Optional record of named layout definitions. |
+| `activeBreakpoint` | Name of the currently applied breakpoint layout. |
+| `editable` | Toggles drag/resize affordances. |
+
+| Method | Description |
+| --- | --- |
+| `addWidget(widget, autoPosition?)` | Adds a tile, optionally auto-placing it into the next free slot. |
+| `removeWidget(id)` | Removes a tile and emits `widget-remove`. |
+| `applyBreakpointLayout(name)` | Applies a layout from the `layouts` map. |
+| `getLayout()` / `setLayout(layout)` | Retrieve or apply persisted layouts. |
+| `compact(direction?)` | Densifies the grid vertically (default) or horizontally. |
+
+| Event | Detail payload |
+| --- | --- |
+| `widget-move` | `{ widget, displaced, swappedWith }` |
+| `widget-resize` | `{ widget, displaced, swappedWith }` |
+| `widget-remove` | `{ widget }` |
+| `layout-change` | `{ layout }` |
+
+## Usage Notes
+
+- **Right-click** a tile header to open the contextual menu and delete the tile.
+- When resizing, blocking tiles will automatically reflow into free space once the interaction completes.
+- Listen to `layout-change` to persist layouts to storage; rehydrate using `setLayout` or the `layouts` map.
+- For responsive dashboards, populate `grid.layouts = { base: [...], mobile: [...] }` and call `applyBreakpointLayout` based on your own breakpoint logic (see the co-located demo for an example).
+
+## Demo
+
+The updated `dees-dashboardgrid.demo.ts` showcases live breakpoint switching, layout persistence, and the context menu. Run the demo gallery to explore the interactions end-to-end.

ts_web/elements/00group-layout/dees-dashboardgrid/contextmenu.ts

@@ -0,0 +1,29 @@
+import type { DashboardWidget } from './types.js';
+import { DeesContextmenu } from '../../00group-overlay/dees-contextmenu/dees-contextmenu.js';
+import type { DeesDashboardgrid } from './dees-dashboardgrid.js';
+import * as plugins from '../../00plugins.js';
+
+export interface WidgetContextMenuOptions {
+  widget: DashboardWidget;
+  host: DeesDashboardgrid;
+  event: MouseEvent;
+}
+
+export const openWidgetContextMenu = ({
+  widget,
+  host,
+  event,
+}: WidgetContextMenuOptions) => {
+  const items: (plugins.tsclass.website.IMenuItem | { divider: true })[] = [
+    {
+      name: 'Delete tile',
+      iconName: 'lucide:trash2' as any,
+      action: async () => {
+        host.removeWidget(widget.id);
+        return null;
+      },
+    },
+  ];
+
+  DeesContextmenu.openContextMenuWithOptions(event, items as any);
+};

ts_web/elements/00group-layout/dees-dashboardgrid/dees-dashboardgrid.demo.ts

@@ -0,0 +1,405 @@
+import { html, css, cssManager } from '@design.estate/dees-element';
+import type { DeesDashboardgrid } from './dees-dashboardgrid.js';
+import '@design.estate/dees-wcctools/demotools';
+
+export const demoFunc = () => {
+  return html`
+    <dees-demowrapper .runAfterRender=${async (elementArg: HTMLElement) => {
+      const grid = elementArg.querySelector('#dashboardGrid') as DeesDashboardgrid;
+
+      const seedWidgets = [
+        {
+          id: 'metrics1',
+          x: 0,
+          y: 0,
+          w: 3,
+          h: 2,
+          title: 'Revenue',
+          icon: 'lucide:dollarSign',
+          content: html`
+            <div style="padding: 20px;">
+              <div style="font-size: 32px; font-weight: 700; color: ${cssManager.bdTheme('#09090b', '#fafafa')};">$124,563</div>
+              <div style="color: #22c55e; font-size: 14px; margin-top: 8px;">↑ 12.5% from last month</div>
+            </div>
+          `,
+        },
+        {
+          id: 'metrics2',
+          x: 3,
+          y: 0,
+          w: 3,
+          h: 2,
+          title: 'Users',
+          icon: 'lucide:users',
+          content: html`
+            <div style="padding: 20px;">
+              <div style="font-size: 32px; font-weight: 700; color: ${cssManager.bdTheme('#09090b', '#fafafa')};">8,234</div>
+              <div style="color: #3b82f6; font-size: 14px; margin-top: 8px;">↑ 5.2% from last week</div>
+            </div>
+          `,
+        },
+        {
+          id: 'chart1',
+          x: 6,
+          y: 0,
+          w: 6,
+          h: 4,
+          title: 'Analytics',
+          icon: 'lucide:lineChart',
+          content: html`
+            <div style="padding: 20px; height: 100%; display: flex; align-items: center; justify-content: center;">
+              <div style="text-align: center; color: #71717a;">
+                <dees-icon .icon=${'lucide:lineChart'} style="font-size: 48px; margin-bottom: 16px;"></dees-icon>
+                <div>Chart visualization area</div>
+              </div>
+            </div>
+          `,
+        },
+      ];
+
+      grid.widgets = seedWidgets.map(widget => ({ ...widget }));
+      grid.cellHeight = 80;
+      grid.margin = { top: 10, right: 10, bottom: 10, left: 10 };
+      grid.enableAnimation = true;
+      grid.showGridLines = false;
+
+      const baseLayout = grid.getLayout().map(item => ({ ...item }));
+      const mobileLayout = grid.widgets.map((widget, index) => ({
+        id: widget.id,
+        x: 0,
+        y: index === 0 ? 0 : grid.widgets.slice(0, index).reduce((acc, prev) => acc + prev.h, 0),
+        w: grid.columns,
+        h: widget.h,
+      }));
+
+      grid.layouts = {
+        base: baseLayout,
+        mobile: mobileLayout,
+      };
+
+      const statusEl = elementArg.querySelector('#dashboardLayoutStatus') as HTMLElement;
+      const updateStatus = () => {
+        const layout = grid.getLayout();
+        statusEl.textContent = `Active breakpoint: ${grid.activeBreakpoint} • Tiles: ${layout.length}`;
+      };
+
+      const mediaQuery = window.matchMedia('(max-width: 768px)');
+      const handleBreakpoint = () => {
+        const target = mediaQuery.matches ? 'mobile' : 'base';
+        grid.applyBreakpointLayout(target);
+        updateStatus();
+      };
+      if (typeof mediaQuery.addEventListener === 'function') {
+        mediaQuery.addEventListener('change', handleBreakpoint);
+      } else {
+        (mediaQuery as MediaQueryList & {
+          addListener?: (listener: (this: MediaQueryList, ev: MediaQueryListEvent) => void) => void;
+        }).addListener?.(handleBreakpoint);
+      }
+      handleBreakpoint();
+
+      let widgetCounter = 4;
+
+      const buttons = elementArg.querySelectorAll('dees-button');
+      buttons.forEach(button => {
+        const text = button.textContent?.trim();
+
+        switch (text) {
+          case 'Toggle Animation':
+            button.addEventListener('click', () => {
+              grid.enableAnimation = !grid.enableAnimation;
+            });
+            break;
+          case 'Toggle Grid Lines':
+            button.addEventListener('click', () => {
+              grid.showGridLines = !grid.showGridLines;
+            });
+            break;
+          case 'Add Widget':
+            button.addEventListener('click', () => {
+              const newWidget = {
+                id: `widget${widgetCounter++}`,
+                x: 0,
+                y: 0,
+                w: 3,
+                h: 2,
+                autoPosition: true,
+                title: `Widget ${widgetCounter - 1}`,
+                icon: 'lucide:package',
+                content: html`
+                  <div style="padding: 20px; text-align: center;">
+                    <div style="color: #71717a;">New widget content</div>
+                    <div style="margin-top: 8px; font-size: 24px; font-weight: 600; color: ${cssManager.bdTheme('#09090b', '#fafafa')};">${Math.floor(
+                      Math.random() * 1000,
+                    )}</div>
+                  </div>
+                `,
+              };
+              grid.addWidget(newWidget, true);
+            });
+            break;
+          case 'Compact Grid':
+            button.addEventListener('click', () => {
+              grid.compact();
+            });
+            break;
+          case 'Toggle Edit Mode':
+            button.addEventListener('click', () => {
+              grid.editable = !grid.editable;
+              button.textContent = grid.editable ? 'Lock Grid' : 'Unlock Grid';
+            });
+            break;
+          case 'Reset Layout':
+            button.addEventListener('click', () => {
+              grid.applyBreakpointLayout(grid.activeBreakpoint);
+            });
+            break;
+          default:
+            break;
+        }
+      });
+
+      // Enhanced logging for reflow events
+      let lastPlaceholderPosition = null;
+      let moveEventCounter = 0;
+
+      // Helper function to log grid state
+      const logGridState = (eventName: string, details?: any) => {
+        const layout = grid.getLayout();
+        console.group(`🔄 ${eventName} [Event #${++moveEventCounter}]`);
+        console.log('Timestamp:', new Date().toISOString());
+        console.log('Grid Configuration:', {
+          columns: grid.columns,
+          cellHeight: grid.cellHeight,
+          margin: grid.margin,
+          editable: grid.editable,
+          activeBreakpoint: grid.activeBreakpoint
+        });
+        console.log('Current Layout:', layout);
+        console.log('Widget Count:', layout.length);
+        console.log('Grid Bounds:', {
+          totalWidgets: grid.widgets.length,
+          maxY: Math.max(...layout.map(w => w.y + w.h)),
+          occupied: layout.map(w => `${w.id}: (${w.x},${w.y}) ${w.w}x${w.h}`).join(', ')
+        });
+        if (details) {
+          console.log('Event Details:', details);
+        }
+        console.groupEnd();
+      };
+
+      // Monitor placeholder position changes using MutationObserver
+      const placeholderObserver = new MutationObserver(() => {
+        const placeholder = grid.shadowRoot?.querySelector('.placeholder') as HTMLElement;
+        if (placeholder) {
+          const currentPosition = {
+            left: placeholder.style.left,
+            top: placeholder.style.top,
+            width: placeholder.style.width,
+            height: placeholder.style.height
+          };
+
+          if (JSON.stringify(currentPosition) !== JSON.stringify(lastPlaceholderPosition)) {
+            console.group('📍 Placeholder Position Changed');
+            console.log('Previous:', lastPlaceholderPosition);
+            console.log('Current:', currentPosition);
+
+            // Extract grid coordinates from style
+            const gridInfo = grid.shadowRoot?.querySelector('.grid-container');
+            if (gridInfo) {
+              console.log('Grid Container Dimensions:', {
+                width: gridInfo.clientWidth,
+                height: gridInfo.clientHeight
+              });
+            }
+            console.groupEnd();
+            lastPlaceholderPosition = currentPosition;
+          }
+        }
+      });
+
+      // Start observing the shadow DOM for placeholder changes
+      if (grid.shadowRoot) {
+        placeholderObserver.observe(grid.shadowRoot, {
+          childList: true,
+          subtree: true,
+          attributes: true,
+          attributeFilter: ['style']
+        });
+      }
+
+      // Log initial state
+      logGridState('Initial Grid State');
+
+      grid.addEventListener('widget-move', (e: CustomEvent) => {
+        logGridState('Widget Move', {
+          widget: e.detail.widget,
+          displaced: e.detail.displaced,
+          swappedWith: e.detail.swappedWith
+        });
+      });
+
+      grid.addEventListener('widget-resize', (e: CustomEvent) => {
+        logGridState('Widget Resize', {
+          widget: e.detail.widget,
+          displaced: e.detail.displaced,
+          swappedWith: e.detail.swappedWith
+        });
+      });
+
+      grid.addEventListener('widget-remove', (e: CustomEvent) => {
+        logGridState('Widget Remove', {
+          removedWidget: e.detail.widget
+        });
+        updateStatus();
+      });
+
+      grid.addEventListener('layout-change', () => {
+        logGridState('Layout Change');
+        updateStatus();
+      });
+
+      // Monitor during drag/resize operations using pointer events
+      grid.addEventListener('pointerdown', (e: PointerEvent) => {
+        const isHeader = (e.target as HTMLElement).closest('.widget-header');
+        const isResizeHandle = (e.target as HTMLElement).closest('.resize-handle');
+
+        if (isHeader || isResizeHandle) {
+          console.group(`🎯 Interaction Started: ${isHeader ? 'Drag' : 'Resize'}`);
+          console.log('Target Widget:', (e.target as HTMLElement).closest('.widget')?.getAttribute('data-widget-id'));
+          console.log('Pointer Position:', { x: e.clientX, y: e.clientY });
+          console.groupEnd();
+
+          // Track pointer move during interaction
+          const handlePointerMove = (moveEvent: PointerEvent) => {
+            const widget = (e.target as HTMLElement).closest('.widget');
+            if (widget) {
+              console.log(`↔️ Pointer Move:`, {
+                widgetId: widget.getAttribute('data-widget-id'),
+                position: { x: moveEvent.clientX, y: moveEvent.clientY },
+                delta: {
+                  x: moveEvent.clientX - e.clientX,
+                  y: moveEvent.clientY - e.clientY
+                }
+              });
+            }
+          };
+
+          const handlePointerUp = () => {
+            console.group('🏁 Interaction Ended');
+            logGridState('Final State After Interaction');
+            console.groupEnd();
+            document.removeEventListener('pointermove', handlePointerMove);
+            document.removeEventListener('pointerup', handlePointerUp);
+          };
+
+          document.addEventListener('pointermove', handlePointerMove);
+          document.addEventListener('pointerup', handlePointerUp);
+        }
+      });
+
+      // Log when widgets are added
+      const originalAddWidget = grid.addWidget.bind(grid);
+      grid.addWidget = (widget: any, autoPosition?: boolean) => {
+        console.group('➕ Adding Widget');
+        console.log('New Widget:', widget);
+        console.log('Auto Position:', autoPosition);
+        const result = originalAddWidget(widget, autoPosition);
+        logGridState('After Widget Added');
+        console.groupEnd();
+        return result;
+      };
+
+      // Log compact operations
+      const originalCompact = grid.compact.bind(grid);
+      grid.compact = (direction?: string) => {
+        console.group('🗜️ Compacting Grid');
+        console.log('Direction:', direction || 'vertical');
+        logGridState('Before Compact');
+        const result = originalCompact(direction);
+        logGridState('After Compact');
+        console.groupEnd();
+        return result;
+      };
+
+      updateStatus();
+    }}>
+      <style>
+        ${css`
+          .demoBox {
+            position: relative;
+            background: ${cssManager.bdTheme('#f4f4f5', '#09090b')};
+            height: 100%;
+            width: 100%;
+            padding: 40px;
+            box-sizing: border-box;
+            display: flex;
+            flex-direction: column;
+            gap: 24px;
+          }
+
+          .demo-controls {
+            display: flex;
+            flex-wrap: wrap;
+            gap: 12px;
+          }
+
+          .demo-controls dees-button {
+            flex-shrink: 0;
+          }
+
+          .grid-container-wrapper {
+            flex: 1;
+            min-height: 600px;
+            position: relative;
+          }
+
+          .info {
+            color: ${cssManager.bdTheme('#71717a', '#71717a')};
+            font-size: 12px;
+            font-family: 'Geist Sans', sans-serif;
+            text-align: center;
+            display: flex;
+            flex-direction: column;
+            gap: 6px;
+          }
+
+          #dashboardLayoutStatus {
+            font-weight: 600;
+            color: ${cssManager.bdTheme('#3b82f6', '#60a5fa')};
+          }
+        `}
+      </style>
+      <div class="demoBox">
+        <div class="demo-controls">
+          <dees-button-group label="Animation:">
+            <dees-button>Toggle Animation</dees-button>
+          </dees-button-group>
+
+          <dees-button-group label="Display:">
+            <dees-button>Toggle Grid Lines</dees-button>
+          </dees-button-group>
+
+          <dees-button-group label="Actions:">
+            <dees-button>Add Widget</dees-button>
+            <dees-button>Compact Grid</dees-button>
+            <dees-button>Reset Layout</dees-button>
+          </dees-button-group>
+
+          <dees-button-group label="Mode:">
+            <dees-button>Toggle Edit Mode</dees-button>
+          </dees-button-group>
+        </div>
+
+        <div class="grid-container-wrapper">
+          <dees-dashboardgrid id="dashboardGrid"></dees-dashboardgrid>
+        </div>
+
+        <div class="info">
+          <div>Drag to reposition, resize from handles, or right-click a header to delete a tile.</div>
+          <div id="dashboardLayoutStatus"></div>
+        </div>
+      </div>
+    </dees-demowrapper>
+  `;
+};

ts_web/elements/00group-layout/dees-dashboardgrid/dees-dashboardgrid.ts

@@ -0,0 +1,797 @@
+import {
+  DeesElement,
+  customElement,
+  property,
+  state,
+  html,
+  type TemplateResult,
+} from '@design.estate/dees-element';
+
+import '../../00group-utility/dees-icon/dees-icon.js';
+import '../../00group-overlay/dees-contextmenu/dees-contextmenu.js';
+import { demoFunc } from './dees-dashboardgrid.demo.js';
+import { dashboardGridStyles } from './styles.js';
+import {
+  resolveMargins,
+  calculateCellMetrics,
+  calculateGridHeight,
+  findAvailablePosition,
+  compactLayout,
+  applyLayout,
+  resolveWidgetPlacement,
+  type PlacementResult,
+} from './layout.js';
+import {
+  computeGridCoordinates,
+  computeResizeDimensions,
+  type PointerPosition,
+} from './interaction.js';
+import { openWidgetContextMenu } from './contextmenu.js';
+import type {
+  DashboardWidget,
+  DashboardMargin,
+  DashboardResolvedMargins,
+  GridCellMetrics,
+  DashboardLayoutItem,
+  LayoutDirection,
+  CellHeightUnit,
+} from './types.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-dashboardgrid': DeesDashboardgrid;
+  }
+}
+
+type DragState = {
+  widgetId: string;
+  pointerId: number;
+  offsetX: number;
+  offsetY: number;
+  start: DashboardLayoutItem;
+  previousPosition: DashboardLayoutItem;
+  currentPointer: PointerPosition;
+  lastPlacement: PlacementResult | null;
+};
+
+type ResizeState = {
+  widgetId: string;
+  pointerId: number;
+  handler: 'e' | 's' | 'se';
+  startPointer: PointerPosition;
+  start: DashboardLayoutItem;
+  startWidth: number;
+  startHeight: number;
+  lastPlacement: PlacementResult | null;
+};
+
+@customElement('dees-dashboardgrid')
+export class DeesDashboardgrid extends DeesElement {
+  public static demo = demoFunc;
+  public static demoGroups = ['Layout'];
+  public static styles = dashboardGridStyles;
+
+  @property({ type: Array })
+  accessor widgets: DashboardWidget[] = [];
+
+  @property({ type: Number })
+  accessor cellHeight: number = 80;
+
+  @property({ type: Object })
+  accessor margin: DashboardMargin = 10;
+
+  @property({ type: Number })
+  accessor columns: number = 12;
+
+  @property({ type: Boolean })
+  accessor editable: boolean = true;
+
+  @property({ type: Boolean, reflect: true })
+  accessor enableAnimation: boolean = true;
+
+  @property({ type: String })
+  accessor cellHeightUnit: CellHeightUnit = 'px';
+
+  @property({ type: Boolean })
+  accessor rtl: boolean = false;
+
+  @property({ type: Boolean })
+  accessor showGridLines: boolean = false;
+
+  @property({ attribute: false })
+  accessor layouts: Record<string, DashboardLayoutItem[]> | undefined = undefined;
+
+  @property({ type: String })
+  accessor activeBreakpoint: string = 'base';
+
+  @state()
+  accessor placeholderPosition: DashboardLayoutItem | null = null;
+
+  @state()
+  accessor metrics: GridCellMetrics | null = null;
+
+  @state()
+  accessor resolvedMargins: DashboardResolvedMargins | null = null;
+
+  @state()
+  accessor previewWidgets: DashboardWidget[] | null = null;
+
+  private containerBounds: DOMRect | null = null;
+  private dragState: DragState | null = null;
+  private resizeState: ResizeState | null = null;
+  private resizeObserver?: ResizeObserver;
+  private interactionActive = false;
+
+  public override async connectedCallback(): Promise<void> {
+    await super.connectedCallback();
+    this.computeMetrics();
+    this.observeResize();
+  }
+
+  public override async disconnectedCallback(): Promise<void> {
+    await super.disconnectedCallback();
+    this.disconnectResizeObserver();
+    this.releasePointerEvents();
+  }
+
+  protected updated(changed: Map<string, unknown>): void {
+    if (
+      changed.has('margin') ||
+      changed.has('columns') ||
+      changed.has('cellHeight') ||
+      changed.has('cellHeightUnit')
+    ) {
+      this.computeMetrics();
+    }
+
+    if (changed.has('widgets') && !this.interactionActive) {
+      this.notifyLayoutChange();
+    }
+  }
+
+  public render(): TemplateResult {
+    const baseWidgets = this.widgets;
+    if (baseWidgets.length === 0) {
+      return html`
+        <div class="empty-state">
+          <dees-icon .icon=${'lucide:layoutGrid'}></dees-icon>
+          <div>No widgets configured</div>
+          <div style="font-size: 14px; margin-top: 8px;">Add widgets to populate the dashboard</div>
+        </div>
+      `;
+    }
+
+    const metrics = this.ensureMetrics();
+    const margins = this.resolvedMargins ?? resolveMargins(this.margin);
+    const cellHeight = metrics.cellHeightPx;
+    const layoutForHeight = this.previewWidgets ?? this.widgets;
+    const gridHeight = calculateGridHeight(layoutForHeight, margins, cellHeight);
+    const previewMap = this.previewWidgets ? new Map(this.previewWidgets.map(widget => [widget.id, widget])) : null;
+
+    return html`
+      <div class="grid-container" style="height: ${gridHeight}px;">
+        ${this.showGridLines ? this.renderGridLines(metrics, gridHeight) : null}
+        ${baseWidgets.map(widget => this.renderWidget(widget, metrics, margins, previewMap))}
+        ${this.placeholderPosition ? this.renderPlaceholder(metrics, margins) : null}
+      </div>
+    `;
+  }
+
+  private renderGridLines(metrics: GridCellMetrics, gridHeight: number): TemplateResult {
+    const vertical: TemplateResult[] = [];
+    const horizontal: TemplateResult[] = [];
+    const cellPlusMarginX = metrics.cellWidthPx + metrics.marginHorizontalPx;
+    const cellPlusMarginY = metrics.cellHeightPx + metrics.marginVerticalPx;
+
+    for (let i = 0; i <= this.columns; i++) {
+      const leftPx = i * cellPlusMarginX + metrics.marginHorizontalPx;
+      const leftPercent = this.pxToPercent(leftPx, metrics.containerWidth);
+      vertical.push(html`<div class="grid-line-vertical" style="left: ${leftPercent}%;"></div>`);
+    }
+
+    const rows = Math.ceil(gridHeight / cellPlusMarginY);
+    for (let row = 0; row <= rows; row++) {
+      const top = row * cellPlusMarginY;
+      horizontal.push(html`<div class="grid-line-horizontal" style="top: ${top}px;"></div>`);
+    }
+
+    return html`
+      <div class="grid-lines">
+        ${vertical}
+        ${horizontal}
+      </div>
+    `;
+  }
+
+  private renderWidget(
+    widget: DashboardWidget,
+    metrics: GridCellMetrics,
+    margins: DashboardResolvedMargins,
+    previewMap: Map<string, DashboardWidget> | null,
+  ): TemplateResult {
+    const isDragging = this.dragState?.widgetId === widget.id;
+    const isResizing = this.resizeState?.widgetId === widget.id;
+    const isLocked = widget.locked || !this.editable;
+    const previewWidget = previewMap?.get(widget.id) ?? null;
+    const layoutForRender = isDragging ? widget : previewWidget ?? widget;
+    const rect = this.computeWidgetRect(layoutForRender, metrics, margins);
+
+    const sideProperty = this.rtl ? 'right' : 'left';
+    const sideValue = this.pxToPercent(rect.left, metrics.containerWidth);
+    const widthPercent = this.pxToPercent(rect.width, metrics.containerWidth);
+
+    let transform = '';
+    if (isDragging && this.dragState?.currentPointer) {
+      const pointer = this.dragState.currentPointer;
+      const bounds = this.containerBounds ?? this.getBoundingClientRect();
+      const translateX = pointer.clientX - bounds.left - this.dragState.offsetX - rect.left;
+      const translateY = pointer.clientY - bounds.top - this.dragState.offsetY - rect.top;
+      transform = `transform: translate(${translateX}px, ${translateY}px);`;
+    }
+
+    return html`
+      <div
+        class="grid-widget ${isDragging ? 'dragging' : ''} ${isResizing ? 'resizing' : ''}"
+        style="
+          ${sideProperty}: ${sideValue}%;
+          top: ${rect.top}px;
+          width: ${widthPercent}%;
+          height: ${rect.height}px;
+          ${transform}
+        "
+        data-widget-id=${widget.id}
+      >
+        <div class="widget-content">
+          ${widget.title
+            ? html`
+                <div
+                  class="widget-header ${isLocked ? 'locked' : ''}"
+                  @pointerdown=${!isLocked && !widget.noMove
+                    ? (evt: PointerEvent) => this.startDrag(evt, widget)
+                    : null}
+                  @contextmenu=${(evt: MouseEvent) => this.handleWidgetContextMenu(evt, widget)}
+                  tabindex=${!isLocked && !widget.noMove ? 0 : -1}
+                  @keydown=${(evt: KeyboardEvent) => this.handleHeaderKeydown(evt, widget)}
+                >
+                  ${widget.icon ? html`<dees-icon .icon=${widget.icon}></dees-icon>` : null}
+                  ${widget.title}
+                </div>
+              `
+            : null}
+          <div class="widget-body ${widget.title ? 'has-header' : ''}">
+            ${widget.content}
+          </div>
+          ${!isLocked && !widget.noResize
+            ? html`
+                <div
+                  class="resize-handle resize-handle-e"
+                  @pointerdown=${(evt: PointerEvent) => this.startResize(evt, widget, 'e')}
+                ></div>
+                <div
+                  class="resize-handle resize-handle-s"
+                  @pointerdown=${(evt: PointerEvent) => this.startResize(evt, widget, 's')}
+                ></div>
+                <div
+                  class="resize-handle resize-handle-se"
+                  @pointerdown=${(evt: PointerEvent) => this.startResize(evt, widget, 'se')}
+                ></div>
+              `
+            : null}
+        </div>
+      </div>
+    `;
+  }
+
+  private renderPlaceholder(
+    metrics: GridCellMetrics,
+    margins: DashboardResolvedMargins,
+  ): TemplateResult {
+    if (!this.placeholderPosition) {
+      return html``;
+    }
+
+    const rect = this.computeWidgetRect(this.placeholderPosition, metrics, margins);
+    const sideProperty = this.rtl ? 'right' : 'left';
+    const sideValue = this.pxToPercent(rect.left, metrics.containerWidth);
+    const widthPercent = this.pxToPercent(rect.width, metrics.containerWidth);
+
+    return html`
+      <div
+        class="grid-widget placeholder"
+        style="
+          ${sideProperty}: ${sideValue}%;
+          top: ${rect.top}px;
+          width: ${widthPercent}%;
+          height: ${rect.height}px;
+        "
+      >
+        <div class="widget-content"></div>
+      </div>
+    `;
+  }
+
+  private startDrag(event: PointerEvent, widget: DashboardWidget): void {
+    if (!this.editable || widget.noMove || widget.locked) {
+      return;
+    }
+
+    event.preventDefault();
+    event.stopPropagation();
+
+    const widgetElement = (event.currentTarget as HTMLElement).closest('.grid-widget') as HTMLElement | null;
+    if (!widgetElement) {
+      return;
+    }
+
+    const widgetRect = widgetElement.getBoundingClientRect();
+    this.containerBounds = this.getBoundingClientRect();
+    this.ensureMetrics();
+
+    this.dragState = {
+      widgetId: widget.id,
+      pointerId: event.pointerId,
+      offsetX: event.clientX - widgetRect.left,
+      offsetY: event.clientY - widgetRect.top,
+      start: { id: widget.id, x: widget.x, y: widget.y, w: widget.w, h: widget.h },
+      previousPosition: { id: widget.id, x: widget.x, y: widget.y, w: widget.w, h: widget.h },
+      currentPointer: { clientX: event.clientX, clientY: event.clientY },
+      lastPlacement: null,
+    };
+
+    this.interactionActive = true;
+    (event.currentTarget as HTMLElement).setPointerCapture(event.pointerId);
+    document.addEventListener('pointermove', this.handleDragMove);
+    document.addEventListener('pointerup', this.handleDragEnd);
+
+    this.placeholderPosition = { id: widget.id, x: widget.x, y: widget.y, w: widget.w, h: widget.h };
+  }
+
+  private handleDragMove = (event: PointerEvent): void => {
+    if (!this.dragState) return;
+    const metrics = this.ensureMetrics();
+    const activeWidgets = this.widgets;
+    const widget = activeWidgets.find(item => item.id === this.dragState!.widgetId);
+    if (!widget) return;
+
+    event.preventDefault();
+
+    const previousPosition = this.dragState.previousPosition;
+
+    const coords = computeGridCoordinates({
+      pointer: { clientX: event.clientX, clientY: event.clientY },
+      containerRect: this.containerBounds ?? this.getBoundingClientRect(),
+      metrics,
+      columns: this.columns,
+      widget,
+      rtl: this.rtl,
+      dragOffsetX: this.dragState.offsetX,
+      dragOffsetY: this.dragState.offsetY,
+    });
+
+    const placement = resolveWidgetPlacement(
+      activeWidgets,
+      widget.id,
+      { x: coords.x, y: coords.y },
+      this.columns,
+      previousPosition,
+    );
+    if (placement) {
+      const updatedWidget = placement.widgets.find(item => item.id === widget.id);
+      this.dragState = {
+        ...this.dragState,
+        currentPointer: { clientX: event.clientX, clientY: event.clientY },
+        lastPlacement: placement,
+        previousPosition: updatedWidget
+          ? { id: updatedWidget.id, x: updatedWidget.x, y: updatedWidget.y, w: updatedWidget.w, h: updatedWidget.h }
+          : { id: widget.id, x: coords.x, y: coords.y, w: widget.w, h: widget.h },
+      };
+      this.previewWidgets = placement.widgets;
+      const previewWidget = placement.widgets.find(item => item.id === widget.id);
+      if (previewWidget) {
+        this.placeholderPosition = {
+          id: previewWidget.id,
+          x: previewWidget.x,
+          y: previewWidget.y,
+          w: previewWidget.w,
+          h: previewWidget.h,
+        };
+      } else {
+        this.placeholderPosition = { id: widget.id, x: coords.x, y: coords.y, w: widget.w, h: widget.h };
+      }
+    } else {
+      this.previewWidgets = null;
+      this.placeholderPosition = null;
+    }
+
+    this.requestUpdate();
+  };
+
+  private handleDragEnd = (event: PointerEvent): void => {
+    const dragState = this.dragState;
+    if (!dragState || event.pointerId !== dragState.pointerId) {
+      return;
+    }
+
+    const layoutSource = this.widgets;
+    this.previewWidgets = null;
+
+    // Always validate the final position, don't rely on lastPlacement from drag
+    const target = this.placeholderPosition ?? dragState.start;
+    const placement = resolveWidgetPlacement(
+      layoutSource,
+      dragState.widgetId,
+      { x: target.x, y: target.y },
+      this.columns,
+      dragState.previousPosition,
+    );
+
+    if (placement) {
+      // Verify that the placement doesn't result in overlapping widgets
+      const finalWidget = placement.widgets.find(w => w.id === dragState.widgetId);
+      if (finalWidget) {
+        const hasOverlap = placement.widgets.some(w => {
+          if (w.id === dragState.widgetId) return false;
+          return (
+            finalWidget.x < w.x + w.w &&
+            finalWidget.x + finalWidget.w > w.x &&
+            finalWidget.y < w.y + w.h &&
+            finalWidget.y + finalWidget.h > w.y
+          );
+        });
+
+        if (!hasOverlap) {
+          this.commitPlacement(placement, dragState.widgetId, 'widget-move');
+        } else {
+          // Return to start position if overlap detected
+          this.widgets = this.widgets.map(widget =>
+            widget.id === dragState.widgetId ? { ...widget, x: dragState.start.x, y: dragState.start.y } : widget,
+          );
+        }
+      }
+    } else {
+      // Return to start position if no valid placement
+      this.widgets = this.widgets.map(widget =>
+        widget.id === dragState.widgetId ? { ...widget, x: dragState.start.x, y: dragState.start.y } : widget,
+      );
+    }
+
+    this.placeholderPosition = null;
+    this.dragState = null;
+    this.interactionActive = false;
+    this.releasePointerEvents();
+  };
+
+  private startResize(event: PointerEvent, widget: DashboardWidget, handler: 'e' | 's' | 'se'): void {
+    if (!this.editable || widget.noResize || widget.locked) {
+      return;
+    }
+
+    event.preventDefault();
+    event.stopPropagation();
+
+    this.ensureMetrics();
+
+    this.resizeState = {
+      widgetId: widget.id,
+      pointerId: event.pointerId,
+      handler,
+      startPointer: { clientX: event.clientX, clientY: event.clientY },
+      start: { id: widget.id, x: widget.x, y: widget.y, w: widget.w, h: widget.h },
+      startWidth: widget.w,
+      startHeight: widget.h,
+      lastPlacement: null,
+    };
+
+    this.interactionActive = true;
+    (event.currentTarget as HTMLElement).setPointerCapture(event.pointerId);
+    document.addEventListener('pointermove', this.handleResizeMove);
+    document.addEventListener('pointerup', this.handleResizeEnd);
+
+    this.placeholderPosition = { id: widget.id, x: widget.x, y: widget.y, w: widget.w, h: widget.h };
+  }
+
+  private handleResizeMove = (event: PointerEvent): void => {
+    if (!this.resizeState) return;
+    const metrics = this.ensureMetrics();
+    const activeWidgets = this.widgets;
+    const widget = activeWidgets.find(item => item.id === this.resizeState!.widgetId);
+    if (!widget) return;
+
+    event.preventDefault();
+
+    const nextSize = computeResizeDimensions({
+      pointer: { clientX: event.clientX, clientY: event.clientY },
+      containerRect: this.containerBounds ?? this.getBoundingClientRect(),
+      metrics,
+      startWidth: this.resizeState.startWidth,
+      startHeight: this.resizeState.startHeight,
+      startPointer: this.resizeState.startPointer,
+      handler: this.resizeState.handler,
+      widget,
+      columns: this.columns,
+    });
+
+    const placement = resolveWidgetPlacement(
+      activeWidgets,
+      widget.id,
+      { x: widget.x, y: widget.y, w: nextSize.width, h: nextSize.height },
+      this.columns,
+      this.resizeState.start,
+    );
+
+    if (placement) {
+      this.resizeState = { ...this.resizeState, lastPlacement: placement };
+      this.previewWidgets = placement.widgets;
+      const previewWidget = placement.widgets.find(item => item.id === widget.id);
+      if (previewWidget) {
+        this.placeholderPosition = {
+          id: previewWidget.id,
+          x: previewWidget.x,
+          y: previewWidget.y,
+          w: previewWidget.w,
+          h: previewWidget.h,
+        };
+      } else {
+        this.placeholderPosition = {
+          id: widget.id,
+          x: widget.x,
+          y: widget.y,
+          w: nextSize.width,
+          h: nextSize.height,
+        };
+      }
+    } else {
+      this.previewWidgets = null;
+      this.placeholderPosition = null;
+    }
+
+    this.requestUpdate();
+  };
+
+  private handleResizeEnd = (event: PointerEvent): void => {
+    const resizeState = this.resizeState;
+    if (!resizeState || event.pointerId !== resizeState.pointerId) {
+      return;
+    }
+
+    const layoutSource = this.widgets;
+    this.previewWidgets = null;
+    const placement =
+      resizeState.lastPlacement ??
+      resolveWidgetPlacement(
+        layoutSource,
+        resizeState.widgetId,
+        {
+          x: this.placeholderPosition?.x ?? resizeState.start.x,
+          y: this.placeholderPosition?.y ?? resizeState.start.y,
+          w: this.placeholderPosition?.w ?? resizeState.start.w,
+          h: this.placeholderPosition?.h ?? resizeState.start.h,
+        },
+        this.columns,
+        resizeState.start,
+      );
+
+    if (placement) {
+      this.commitPlacement(placement, resizeState.widgetId, 'widget-resize');
+    } else {
+      this.widgets = this.widgets.map(widget =>
+        widget.id === resizeState.widgetId ? { ...widget, w: resizeState.start.w, h: resizeState.start.h } : widget,
+      );
+    }
+
+    this.placeholderPosition = null;
+    this.resizeState = null;
+    this.interactionActive = false;
+    this.releasePointerEvents();
+  };
+
+  private handleHeaderKeydown(event: KeyboardEvent, widget: DashboardWidget): void {
+    if (!this.editable || widget.noMove || widget.locked) {
+      return;
+    }
+
+    const key = event.key;
+    const isResize = event.shiftKey;
+    let placement: PlacementResult | null = null;
+
+    if (isResize && ['ArrowLeft', 'ArrowRight', 'ArrowUp', 'ArrowDown'].includes(key)) {
+      event.preventDefault();
+      const delta = key === 'ArrowRight' || key === 'ArrowDown' ? 1 : -1;
+
+      if (key === 'ArrowLeft' || key === 'ArrowRight') {
+        const maxWidth = widget.maxW ?? this.columns - widget.x;
+        const nextWidth = Math.max(widget.minW ?? 1, Math.min(maxWidth, widget.w + delta));
+        placement = resolveWidgetPlacement(
+          this.widgets,
+          widget.id,
+          { x: widget.x, y: widget.y, w: nextWidth, h: widget.h },
+          this.columns,
+        );
+      } else {
+        const maxHeight = widget.maxH ?? Number.POSITIVE_INFINITY;
+        const nextHeight = Math.max(widget.minH ?? 1, Math.min(maxHeight, widget.h + delta));
+        placement = resolveWidgetPlacement(
+          this.widgets,
+          widget.id,
+          { x: widget.x, y: widget.y, w: widget.w, h: nextHeight },
+          this.columns,
+        );
+      }
+
+      if (placement) {
+        this.commitPlacement(placement, widget.id, 'widget-resize');
+      }
+      return;
+    }
+
+    const moveMap: Record<string, { dx: number; dy: number }> = {
+      ArrowLeft: { dx: -1, dy: 0 },
+      ArrowRight: { dx: 1, dy: 0 },
+      ArrowUp: { dx: 0, dy: -1 },
+      ArrowDown: { dx: 0, dy: 1 },
+    };
+
+    const delta = moveMap[key];
+    if (!delta) {
+      return;
+    }
+
+    event.preventDefault();
+    const targetX = Math.max(0, Math.min(this.columns - widget.w, widget.x + delta.dx));
+    const targetY = Math.max(0, widget.y + delta.dy);
+
+    placement = resolveWidgetPlacement(this.widgets, widget.id, { x: targetX, y: targetY }, this.columns);
+    if (placement) {
+      this.commitPlacement(placement, widget.id, 'widget-move');
+    }
+  }
+
+  private handleWidgetContextMenu(event: MouseEvent, widget: DashboardWidget): void {
+    event.preventDefault();
+    event.stopPropagation();
+    openWidgetContextMenu({ widget, host: this, event });
+  }
+
+  private commitPlacement(result: PlacementResult, widgetId: string, type: 'widget-move' | 'widget-resize'): void {
+    this.previewWidgets = null;
+    this.widgets = result.widgets;
+    const subject = this.widgets.find(item => item.id === widgetId);
+    if (subject) {
+      this.dispatchEvent(
+        new CustomEvent(type, {
+          detail: {
+            widget: subject,
+            displaced: result.movedWidgets.filter(id => id !== widgetId),
+            swappedWith: result.swappedWith,
+          },
+          bubbles: true,
+          composed: true,
+        }),
+      );
+    }
+  }
+
+  public removeWidget(widgetId: string): void {
+    const target = this.widgets.find(widget => widget.id === widgetId);
+    if (!target) return;
+    this.widgets = this.widgets.filter(widget => widget.id !== widgetId);
+    this.dispatchEvent(
+      new CustomEvent('widget-remove', {
+        detail: { widget: target },
+        bubbles: true,
+        composed: true,
+      }),
+    );
+  }
+
+  public updateWidget(widgetId: string, updates: Partial<DashboardWidget>): void {
+    this.widgets = this.widgets.map(widget => (widget.id === widgetId ? { ...widget, ...updates } : widget));
+  }
+
+  public getLayout(): DashboardLayoutItem[] {
+    return this.widgets.map(({ id, x, y, w, h }) => ({ id, x, y, w, h }));
+  }
+
+  public setLayout(layout: DashboardLayoutItem[]): void {
+    this.widgets = applyLayout(this.widgets, layout);
+  }
+
+  public lockGrid(): void {
+    this.editable = false;
+  }
+
+  public unlockGrid(): void {
+    this.editable = true;
+  }
+
+  public addWidget(widget: DashboardWidget, autoPosition = false): void {
+    const nextWidget = { ...widget };
+    if (autoPosition || nextWidget.autoPosition) {
+      const position = findAvailablePosition(this.widgets, nextWidget.w, nextWidget.h, this.columns);
+      nextWidget.x = position.x;
+      nextWidget.y = position.y;
+    }
+
+    this.widgets = [...this.widgets, nextWidget];
+  }
+
+  public compact(direction: LayoutDirection = 'vertical'): void {
+    const nextWidgets = this.widgets.map(widget => ({ ...widget }));
+    compactLayout(nextWidgets, direction);
+    this.widgets = nextWidgets;
+  }
+
+  public applyBreakpointLayout(breakpoint: string): void {
+    this.activeBreakpoint = breakpoint;
+    const layout = this.layouts?.[breakpoint];
+    if (layout) {
+      this.setLayout(layout);
+    }
+  }
+
+  public notifyLayoutChange(): void {
+    this.dispatchEvent(
+      new CustomEvent('layout-change', {
+        detail: { layout: this.getLayout() },
+        bubbles: true,
+        composed: true,
+      }),
+    );
+  }
+
+  private ensureMetrics(): GridCellMetrics {
+    if (!this.metrics) {
+      this.computeMetrics();
+    }
+    return this.metrics!;
+  }
+
+  private computeMetrics(): void {
+    if (!this.isConnected) return;
+    const bounds = this.getBoundingClientRect();
+    this.containerBounds = bounds;
+    const margins = resolveMargins(this.margin);
+    this.resolvedMargins = margins;
+    this.metrics = calculateCellMetrics(bounds.width, this.columns, margins, this.cellHeight, this.cellHeightUnit);
+  }
+
+  private observeResize(): void {
+    if (this.resizeObserver) return;
+    this.resizeObserver = new ResizeObserver(() => {
+      this.computeMetrics();
+    });
+    this.resizeObserver.observe(this);
+  }
+
+  private disconnectResizeObserver(): void {
+    this.resizeObserver?.disconnect();
+    this.resizeObserver = undefined;
+  }
+
+  private releasePointerEvents(): void {
+    document.removeEventListener('pointermove', this.handleDragMove);
+    document.removeEventListener('pointerup', this.handleDragEnd);
+    document.removeEventListener('pointermove', this.handleResizeMove);
+    document.removeEventListener('pointerup', this.handleResizeEnd);
+  }
+
+  private pxToPercent(value: number, container: number): number {
+    if (!container) return 0;
+    return Number(((value / container) * 100).toFixed(4));
+  }
+
+  private computeWidgetRect(
+    widget: Pick<DashboardWidget, 'x' | 'y' | 'w' | 'h'>,
+    metrics: GridCellMetrics,
+    margins: DashboardResolvedMargins,
+  ) {
+    const cellWidth = metrics.cellWidthPx;
+    const cellHeight = metrics.cellHeightPx;
+    const left = widget.x * (cellWidth + margins.horizontal) + margins.horizontal;
+    const top = widget.y * (cellHeight + margins.vertical) + margins.vertical;
+    const width = widget.w * cellWidth + Math.max(0, widget.w - 1) * margins.horizontal;
+    const height = widget.h * cellHeight + Math.max(0, widget.h - 1) * margins.vertical;
+
+    return { left, top, width, height };
+  }
+}

ts_web/elements/00group-layout/dees-dashboardgrid/index.ts

@@ -0,0 +1 @@
+export * from './dees-dashboardgrid.js';

ts_web/elements/00group-layout/dees-dashboardgrid/interaction.ts

@@ -0,0 +1,105 @@
+import type { DashboardWidget, GridCellMetrics } from './types.js';
+
+export interface PointerPosition {
+  clientX: number;
+  clientY: number;
+}
+
+export interface DragComputationArgs {
+  pointer: PointerPosition;
+  containerRect: DOMRect;
+  metrics: GridCellMetrics;
+  columns: number;
+  widget: DashboardWidget;
+  rtl: boolean;
+  dragOffsetX?: number;
+  dragOffsetY?: number;
+}
+
+export const computeGridCoordinates = ({
+  pointer,
+  containerRect,
+  metrics,
+  columns,
+  widget,
+  rtl,
+  dragOffsetX = 0,
+  dragOffsetY = 0,
+}: DragComputationArgs): { x: number; y: number } => {
+  const relativeX = pointer.clientX - containerRect.left - dragOffsetX;
+  const relativeY = pointer.clientY - containerRect.top - dragOffsetY;
+
+  const marginX = metrics.marginHorizontalPx;
+  const marginY = metrics.marginVerticalPx;
+  const cellWidth = metrics.cellWidthPx;
+  const cellHeight = metrics.cellHeightPx;
+
+  const clamp = (value: number, min: number, max: number) => Math.max(min, Math.min(max, value));
+
+  const adjustedX = clamp(relativeX - marginX, 0, containerRect.width - marginX);
+  const adjustedY = clamp(relativeY - marginY, 0, Number.POSITIVE_INFINITY);
+
+  const cellPlusMarginX = cellWidth + marginX;
+  const cellPlusMarginY = cellHeight + marginY;
+
+  let gridX = Math.round(adjustedX / cellPlusMarginX);
+  if (rtl) {
+    gridX = columns - widget.w - gridX;
+  }
+  gridX = clamp(gridX, 0, columns - widget.w);
+
+  const gridY = clamp(Math.round(adjustedY / cellPlusMarginY), 0, Number.MAX_SAFE_INTEGER);
+
+  return { x: gridX, y: gridY };
+};
+
+export interface ResizeComputationArgs {
+  pointer: PointerPosition;
+  containerRect: DOMRect;
+  metrics: GridCellMetrics;
+  startWidth: number;
+  startHeight: number;
+  startPointer: PointerPosition;
+  handler: 'e' | 's' | 'se';
+  widget: DashboardWidget;
+  columns: number;
+}
+
+export const computeResizeDimensions = ({
+  pointer,
+  containerRect,
+  metrics,
+  startWidth,
+  startHeight,
+  startPointer,
+  handler,
+  widget,
+  columns,
+}: ResizeComputationArgs): { width: number; height: number } => {
+  const deltaX = pointer.clientX - startPointer.clientX;
+  const deltaY = pointer.clientY - startPointer.clientY;
+
+  let width = startWidth;
+  let height = startHeight;
+
+  const cellPlusMarginX = metrics.cellWidthPx + metrics.marginHorizontalPx;
+  const cellPlusMarginY = metrics.cellHeightPx + metrics.marginVerticalPx;
+
+  if (handler.includes('e')) {
+    const deltaCols = Math.round(deltaX / cellPlusMarginX);
+    width = startWidth + deltaCols;
+  }
+
+  if (handler.includes('s')) {
+    const deltaRows = Math.round(deltaY / cellPlusMarginY);
+    height = startHeight + deltaRows;
+  }
+
+  const clampedWidth = Math.max(widget.minW || 1, Math.min(width, widget.maxW || columns - widget.x));
+  const clampedHeight = Math.max(widget.minH || 1, Math.min(height, widget.maxH || Number.MAX_SAFE_INTEGER));
+
+  return {
+    width: clampedWidth,
+    height: clampedHeight,
+  };
+};

ts_web/elements/00group-layout/dees-dashboardgrid/layout.ts

@@ -0,0 +1,246 @@
+import type {
+  DashboardResolvedMargins,
+  DashboardMargin,
+  DashboardWidget,
+  DashboardLayoutItem,
+  GridCellMetrics,
+  LayoutDirection,
+} from './types.js';
+
+export const DEFAULT_MARGIN = 10;
+
+export const resolveMargins = (margin: DashboardMargin): DashboardResolvedMargins => {
+  if (typeof margin === 'number') {
+    return {
+      horizontal: margin,
+      vertical: margin,
+      top: margin,
+      right: margin,
+      bottom: margin,
+      left: margin,
+    };
+  }
+
+  const resolved = {
+    top: margin.top ?? DEFAULT_MARGIN,
+    right: margin.right ?? DEFAULT_MARGIN,
+    bottom: margin.bottom ?? DEFAULT_MARGIN,
+    left: margin.left ?? DEFAULT_MARGIN,
+  };
+
+  return {
+    ...resolved,
+    horizontal: (resolved.left + resolved.right) / 2,
+    vertical: (resolved.top + resolved.bottom) / 2,
+  };
+};
+
+export const calculateCellMetrics = (
+  containerWidth: number,
+  columns: number,
+  margins: DashboardResolvedMargins,
+  cellHeight: number,
+  cellHeightUnit: string,
+): GridCellMetrics => {
+  const totalMarginWidth = margins.horizontal * (columns + 1);
+  const availableWidth = Math.max(containerWidth - totalMarginWidth, 0);
+  const cellWidthPx = columns > 0 ? availableWidth / columns : 0;
+  const cellHeightPx = cellHeightUnit === 'auto' ? cellWidthPx : cellHeight;
+
+  return {
+    containerWidth,
+    cellWidthPx,
+    marginHorizontalPx: margins.horizontal,
+    cellHeightPx,
+    marginVerticalPx: margins.vertical,
+  };
+};
+
+export const calculateGridHeight = (
+  widgets: DashboardWidget[],
+  margins: DashboardResolvedMargins,
+  cellHeight: number,
+): number => {
+  if (widgets.length === 0) return 0;
+  const maxY = Math.max(...widgets.map(widget => widget.y + widget.h), 0);
+  return maxY * cellHeight + (maxY + 1) * margins.vertical;
+};
+
+const overlaps = (
+  widget: DashboardWidget,
+  x: number,
+  y: number,
+  w: number,
+  h: number,
+) => x < widget.x + widget.w && x + w > widget.x && y < widget.y + widget.h && y + h > widget.y;
+
+export const collectCollisions = (
+  widgets: DashboardWidget[],
+  target: DashboardWidget,
+  nextX: number,
+  nextY: number,
+  nextW: number = target.w,
+  nextH: number = target.h,
+): DashboardWidget[] => {
+  return widgets.filter(widget => {
+    if (widget.id === target.id) return false;
+    return overlaps(widget, nextX, nextY, nextW, nextH);
+  });
+};
+
+export const checkCollision = (
+  widgets: DashboardWidget[],
+  target: DashboardWidget,
+  nextX: number,
+  nextY: number,
+): boolean => collectCollisions(widgets, target, nextX, nextY).length > 0;
+
+export const cloneWidget = (widget: DashboardWidget): DashboardWidget => ({ ...widget });
+
+export const cloneWidgets = (widgets: DashboardWidget[]): DashboardWidget[] => widgets.map(cloneWidget);
+
+export const findAvailablePosition = (
+  widgets: DashboardWidget[],
+  width: number,
+  height: number,
+  columns: number,
+): { x: number; y: number } => {
+  for (let y = 0; y < 200; y++) {
+    for (let x = 0; x <= columns - width; x++) {
+      const isFree = !widgets.some(widget => overlaps(widget, x, y, width, height));
+      if (isFree) {
+        return { x, y };
+      }
+    }
+  }
+
+  const maxY = widgets.reduce((acc, widget) => Math.max(acc, widget.y + widget.h), 0);
+  return { x: 0, y: maxY };
+};
+
+export interface PlacementResult {
+  widgets: DashboardWidget[];
+  movedWidgets: string[];
+  swappedWith?: string;
+}
+
+export const resolveWidgetPlacement = (
+  widgets: DashboardWidget[],
+  widgetId: string,
+  next: { x: number; y: number; w?: number; h?: number },
+  columns: number,
+  previousPosition?: DashboardLayoutItem,
+): PlacementResult | null => {
+  const sourceWidgets = cloneWidgets(widgets);
+  const moving = sourceWidgets.find(widget => widget.id === widgetId);
+  const original = widgets.find(widget => widget.id === widgetId);
+  if (!moving || !original) {
+    return null;
+  }
+
+  const target = {
+    x: next.x,
+    y: next.y,
+    w: next.w ?? moving.w,
+    h: next.h ?? moving.h,
+  };
+
+  moving.x = target.x;
+  moving.y = target.y;
+  moving.w = target.w;
+  moving.h = target.h;
+
+  const collisions = collectCollisions(sourceWidgets, moving, target.x, target.y, target.w, target.h);
+
+  if (collisions.length === 0) {
+    return { widgets: sourceWidgets, movedWidgets: [moving.id] };
+  }
+
+  if (collisions.length === 1) {
+    const other = collisions[0];
+    if (!other.locked && !other.noMove && other.w === moving.w && other.h === moving.h) {
+      const otherClone = sourceWidgets.find(widget => widget.id === other.id);
+      if (otherClone) {
+        // Use the original position of the moving widget for a clean swap
+        // This prevents the "snapping together" issue where both widgets end up at the same position
+        const swapTarget = original;
+        const previousOtherPosition = { x: otherClone.x, y: otherClone.y };
+        otherClone.x = swapTarget.x;
+        otherClone.y = swapTarget.y;
+
+        const swapValid =
+          collectCollisions(sourceWidgets, moving, moving.x, moving.y, moving.w, moving.h).length === 0 &&
+          collectCollisions(sourceWidgets, otherClone, otherClone.x, otherClone.y, otherClone.w, otherClone.h).length === 0;
+
+        if (swapValid) {
+          return { widgets: sourceWidgets, movedWidgets: [moving.id, otherClone.id], swappedWith: otherClone.id };
+        }
+
+        otherClone.x = previousOtherPosition.x;
+        otherClone.y = previousOtherPosition.y;
+      }
+    }
+  }
+
+  // attempt displacement cascade
+  const movedIds = new Set<string>([moving.id]);
+  for (const offending of collisions) {
+    if (offending.locked || offending.noMove) {
+      return null;
+    }
+    const clone = sourceWidgets.find(widget => widget.id === offending.id);
+    if (!clone) continue;
+    const remaining = sourceWidgets.filter(widget => widget.id !== offending.id);
+    const position = findAvailablePosition(remaining, clone.w, clone.h, columns);
+    clone.x = position.x;
+    clone.y = position.y;
+    movedIds.add(clone.id);
+  }
+
+  // verify no overlaps remain
+  const verify = collectCollisions(sourceWidgets, moving, moving.x, moving.y, moving.w, moving.h);
+  if (verify.length > 0) {
+    return null;
+  }
+
+  return { widgets: sourceWidgets, movedWidgets: Array.from(movedIds) };
+};
+
+export const compactLayout = (
+  widgets: DashboardWidget[],
+  direction: LayoutDirection = 'vertical',
+) => {
+  const sorted = [...widgets].sort((a, b) => {
+    if (direction === 'vertical') {
+      if (a.y !== b.y) return a.y - b.y;
+      return a.x - b.x;
+    }
+
+    if (a.x !== b.x) return a.x - b.x;
+    return a.y - b.y;
+  });
+
+  for (const widget of sorted) {
+    if (widget.locked || widget.noMove) continue;
+
+    if (direction === 'vertical') {
+      while (widget.y > 0 && !checkCollision(widgets, widget, widget.x, widget.y - 1)) {
+        widget.y -= 1;
+      }
+    } else {
+      while (widget.x > 0 && !checkCollision(widgets, widget, widget.x - 1, widget.y)) {
+        widget.x -= 1;
+      }
+    }
+  }
+};
+
+export const applyLayout = (
+  widgets: DashboardWidget[],
+  layout: DashboardLayoutItem[],
+): DashboardWidget[] => {
+  return widgets.map(widget => {
+    const layoutItem = layout.find(item => item.id === widget.id);
+    return layoutItem ? { ...widget, ...layoutItem } : widget;
+  });
+};

ts_web/elements/00group-layout/dees-dashboardgrid/styles.ts

@@ -0,0 +1,249 @@
+import { css, cssManager } from '@design.estate/dees-element';
+
+export const dashboardGridStyles = [
+  cssManager.defaultStyles,
+  css`
+      :host {
+        display: block;
+        width: 100%;
+        height: 100%;
+        position: relative;
+      }
+
+      .grid-container {
+        position: relative;
+        width: 100%;
+        min-height: 400px;
+        box-sizing: border-box;
+      }
+
+      .grid-widget {
+        position: absolute;
+        will-change: auto;
+      }
+      
+      :host([enableanimation]) .grid-widget {
+        transition: all 0.3s cubic-bezier(0.4, 0, 0.2, 1);
+      }
+
+      .grid-widget.dragging {
+        z-index: 1000;
+        transition: none !important;
+        opacity: 0.8;
+        cursor: grabbing;
+        pointer-events: none;
+        will-change: transform;
+      }
+      
+      .grid-widget.placeholder {
+        pointer-events: none;
+        z-index: 1;
+      }
+      
+      .grid-widget.placeholder .widget-content {
+        background: ${cssManager.bdTheme('rgba(59, 130, 246, 0.1)', 'rgba(59, 130, 246, 0.1)')};
+        border: 2px dashed ${cssManager.bdTheme('#3b82f6', '#3b82f6')};
+        box-shadow: none;
+      }
+
+      .grid-widget.resizing {
+        transition: none !important;
+      }
+
+      .widget-content {
+        position: absolute;
+        left: 0;
+        right: 0;
+        top: 0;
+        bottom: 0;
+        overflow: hidden;
+        background: ${cssManager.bdTheme('#ffffff', '#09090b')};
+        border: 1px solid ${cssManager.bdTheme('#e5e7eb', '#27272a')};
+        border-radius: 8px;
+        box-shadow: ${cssManager.bdTheme(
+          '0 1px 3px rgba(0, 0, 0, 0.1)',
+          '0 1px 3px rgba(0, 0, 0, 0.3)'
+        )};
+        transition: box-shadow 0.2s ease;
+      }
+
+      .grid-widget:hover .widget-content {
+        box-shadow: ${cssManager.bdTheme(
+          '0 4px 12px rgba(0, 0, 0, 0.15)',
+          '0 4px 12px rgba(0, 0, 0, 0.4)'
+        )};
+      }
+
+      .grid-widget.dragging .widget-content {
+        box-shadow: ${cssManager.bdTheme(
+          '0 16px 48px rgba(0, 0, 0, 0.25)',
+          '0 16px 48px rgba(0, 0, 0, 0.6)'
+        )};
+        transform: scale(1.05);
+      }
+
+      .widget-header {
+        padding: 12px 16px;
+        border-bottom: 1px solid ${cssManager.bdTheme('#e5e7eb', '#27272a')};
+        display: flex;
+        align-items: center;
+        gap: 8px;
+        font-size: 14px;
+        font-weight: 600;
+        color: ${cssManager.bdTheme('#09090b', '#fafafa')};
+        background: ${cssManager.bdTheme('#f9fafb', '#0a0a0a')};
+        cursor: grab;
+        user-select: none;
+      }
+      
+      .widget-header:hover {
+        background: ${cssManager.bdTheme('#f4f4f5', '#18181b')};
+      }
+      
+      .widget-header:active {
+        cursor: grabbing;
+      }
+
+      .widget-header.locked {
+        cursor: default;
+      }
+      
+      .widget-header.locked:hover {
+        background: ${cssManager.bdTheme('#f9fafb', '#0a0a0a')};
+      }
+
+      .widget-header dees-icon {
+        font-size: 16px;
+        color: ${cssManager.bdTheme('#71717a', '#71717a')};
+      }
+
+      .widget-body {
+        position: absolute;
+        top: 0;
+        left: 0;
+        right: 0;
+        bottom: 0;
+        overflow: auto;
+        color: ${cssManager.bdTheme('#09090b', '#fafafa')};
+      }
+
+      .widget-body.has-header {
+        top: 45px;
+      }
+
+      .resize-handle {
+        position: absolute;
+        background: transparent;
+        z-index: 10;
+      }
+
+      .resize-handle:hover {
+        background: ${cssManager.bdTheme('#3b82f6', '#3b82f6')};
+        opacity: 0.3;
+      }
+
+      .resize-handle-e {
+        cursor: ew-resize;
+        width: 12px;
+        right: -6px;
+        top: 10%;
+        height: 80%;
+      }
+
+      .resize-handle-s {
+        cursor: ns-resize;
+        height: 12px;
+        width: 80%;
+        bottom: -6px;
+        left: 10%;
+      }
+
+      .resize-handle-se {
+        cursor: se-resize;
+        width: 20px;
+        height: 20px;
+        right: -2px;
+        bottom: -2px;
+        opacity: 0;
+        transition: opacity 0.2s ease;
+      }
+      
+      .resize-handle-se::after {
+        content: '';
+        position: absolute;
+        right: 4px;
+        bottom: 4px;
+        width: 6px;
+        height: 6px;
+        border-right: 2px solid ${cssManager.bdTheme('#71717a', '#71717a')};
+        border-bottom: 2px solid ${cssManager.bdTheme('#71717a', '#71717a')};
+      }
+
+      .grid-widget:hover .resize-handle-se {
+        opacity: 0.7;
+      }
+
+      .resize-handle-se:hover {
+        opacity: 1 !important;
+      }
+      
+      .resize-handle-se:hover::after {
+        border-color: ${cssManager.bdTheme('#3b82f6', '#3b82f6')};
+      }
+
+      .grid-placeholder {
+        position: absolute;
+        background: ${cssManager.bdTheme('#3b82f6', '#3b82f6')};
+        opacity: 0.1;
+        border-radius: 8px;
+        border: 2px dashed ${cssManager.bdTheme('#3b82f6', '#3b82f6')};
+        transition: all 0.2s ease;
+        pointer-events: none;
+      }
+
+      .empty-state {
+        display: flex;
+        flex-direction: column;
+        align-items: center;
+        justify-content: center;
+        height: 400px;
+        color: ${cssManager.bdTheme('#71717a', '#71717a')};
+        text-align: center;
+        padding: 32px;
+      }
+
+      .empty-state dees-icon {
+        font-size: 48px;
+        margin-bottom: 16px;
+        opacity: 0.5;
+      }
+      
+      .grid-lines {
+        position: absolute;
+        top: 0;
+        left: 0;
+        right: 0;
+        bottom: 0;
+        pointer-events: none;
+        z-index: -1;
+      }
+      
+      .grid-line-vertical {
+        position: absolute;
+        top: 0;
+        bottom: 0;
+        width: 1px;
+        background: ${cssManager.bdTheme('#e5e7eb', '#27272a')};
+        opacity: 0.3;
+      }
+      
+      .grid-line-horizontal {
+        position: absolute;
+        left: 0;
+        right: 0;
+        height: 1px;
+        background: ${cssManager.bdTheme('#e5e7eb', '#27272a')};
+        opacity: 0.3;
+      }
+  `,
+];

ts_web/elements/00group-layout/dees-dashboardgrid/types.ts

@@ -0,0 +1,53 @@
+import type { TemplateResult } from '@design.estate/dees-element';
+
+export type CellHeightUnit = 'px' | 'em' | 'rem' | 'auto';
+
+export interface DashboardMarginObject {
+  top?: number;
+  right?: number;
+  bottom?: number;
+  left?: number;
+}
+
+export type DashboardMargin = number | DashboardMarginObject;
+
+export interface DashboardResolvedMargins {
+  horizontal: number;
+  vertical: number;
+  top: number;
+  right: number;
+  bottom: number;
+  left: number;
+}
+
+export interface DashboardLayoutItem {
+  id: string;
+  x: number;
+  y: number;
+  w: number;
+  h: number;
+}
+
+export interface DashboardWidget extends DashboardLayoutItem {
+  minW?: number;
+  minH?: number;
+  maxW?: number;
+  maxH?: number;
+  content: TemplateResult | string;
+  title?: string;
+  icon?: string;
+  noMove?: boolean;
+  noResize?: boolean;
+  locked?: boolean;
+  autoPosition?: boolean;
+}
+
+export type LayoutDirection = 'vertical' | 'horizontal';
+
+export interface GridCellMetrics {
+  containerWidth: number;
+  cellWidthPx: number;
+  marginHorizontalPx: number;
+  cellHeightPx: number;
+  marginVerticalPx: number;
+}

ts_web/elements/00group-layout/dees-heading/dees-heading.demo.ts

@@ -0,0 +1,14 @@
+import { html } from '@design.estate/dees-element';
+
+export function demoFunc() {
+  return html`
+    <dees-heading level="1">This is a H1 heading</dees-heading>
+    <dees-heading level="2">This is a H2 heading</dees-heading>
+    <dees-heading level="3">This is a H3 heading</dees-heading>
+    <dees-heading level="4">This is a H4 heading</dees-heading>
+    <dees-heading level="5">This is a H5 heading</dees-heading>
+    <dees-heading level="6">This is a H6 heading</dees-heading>
+    <dees-heading level="hr">This is an hr heading</dees-heading>
+    <dees-heading level="hr-small">This is an hr small heading</dees-heading>
+  `;
+}

ts_web/elements/00group-layout/dees-heading/dees-heading.ts

@@ -0,0 +1,120 @@
+import {
+  customElement,
+  html,
+  css,
+  property,
+  cssManager,
+  type TemplateResult,
+  DeesElement,
+  type CSSResult,
+} from '@design.estate/dees-element';
+
+import { demoFunc } from './dees-heading.demo.js';
+import { cssCalSansFontFamily } from '../../00fonts.js';
+import { themeDefaultStyles } from '../../00theme.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-heading': DeesHeading;
+  }
+}
+
+@customElement('dees-heading')
+export class DeesHeading extends DeesElement {
+  // demo
+  public static demo = demoFunc;
+  public static demoGroups = ['Layout'];
+
+  // properties
+  /**
+   * Heading level: 1-6 for h1-h6, or 'hr' for horizontal rule style
+   */
+  @property({ type: String, reflect: true })
+  accessor level: '1' | '2' | '3' | '4' | '5' | '6' | 'hr' | 'hr-small' = '1';
+
+  // STATIC STYLES
+  public static styles: CSSResult[] = [
+    themeDefaultStyles,
+    cssManager.defaultStyles,
+    css`
+      /* TODO: Migrate hardcoded values to --dees-* CSS variables */
+      /* Heading styles */
+      h1, h2, h3, h4, h5, h6 {
+        margin: 16px 0 8px;
+        font-weight: 600;
+        color: ${cssManager.bdTheme('#000', '#fff')};
+      }
+      h1 { font-size: 32px; font-family: ${cssCalSansFontFamily}; letter-spacing: 0.025em;}
+      h2 { font-size: 28px; }
+      h3 { font-size: 24px; }
+      h4 { font-size: 20px; }
+      h5 { font-size: 16px; }
+      h6 { font-size: 14px; }
+      /* Horizontal rule style heading */
+      .heading-hr {
+        display: flex;
+        align-items: center;
+        text-align: center;
+        margin: 16px 0;
+        color: ${cssManager.bdTheme('#000', '#fff')};
+      }
+      /* Fade lines toward and away from text for hr style */
+      .heading-hr::before {
+        content: '';
+        flex: 1;
+        height: 1px;
+        /* fade in toward center */
+        background: ${cssManager.bdTheme(
+          'linear-gradient(to right, transparent, #ccc)',
+          'linear-gradient(to right, transparent, #333)'
+        )};
+        margin: 0 8px;
+      }
+      .heading-hr::after {
+        content: '';
+        flex: 1;
+        height: 1px;
+        /* fade out away from center */
+        background: ${cssManager.bdTheme(
+          'linear-gradient(to right, #ccc, transparent)',
+          'linear-gradient(to right, #333, transparent)'
+        )};
+        margin: 0 8px;
+      }
+      /* Small hr variant with reduced margins */
+      .heading-hr.heading-hr-small {
+        margin: 8px 0;
+        font-size: 12px;
+      }
+      .heading-hr.heading-hr-small::before,
+      .heading-hr.heading-hr-small::after {
+        margin: 0 8px;
+      }
+    `,
+  ];
+
+
+  // INSTANCE
+  public render(): TemplateResult {
+    switch (this.level) {
+      case '1':
+        return html`<h1><slot></slot></h1>`;
+      case '2':
+        return html`<h2><slot></slot></h2>`;
+      case '3':
+        return html`<h3><slot></slot></h3>`;
+      case '4':
+        return html`<h4><slot></slot></h4>`;
+      case '5':
+        return html`<h5><slot></slot></h5>`;
+      case '6':
+        return html`<h6><slot></slot></h6>`;
+      case 'hr':
+        return html`<div class="heading-hr"><slot></slot></div>`;
+      case 'hr-small':
+        return html`<div class="heading-hr heading-hr-small"><slot></slot></div>`;
+      default:
+        return html`<h1><slot></slot></h1>`;
+    }
+  }
+}

ts_web/elements/00group-layout/dees-heading/index.ts

@@ -0,0 +1 @@
+export * from './dees-heading.js';

ts_web/elements/00group-layout/dees-label/dees-label.demo.ts

@@ -0,0 +1,7 @@
+import { html, cssManager } from '@design.estate/dees-element';
+
+export const demoFunc = () => {
+  return html`
+    <dees-label .label=${'a label'}></dees-label>
+  `;
+}

ts_web/elements/00group-layout/dees-label/dees-label.ts

@@ -0,0 +1,98 @@
+import * as plugins from '../../00plugins.js';
+import * as colors from '../../00colors.js';
+
+import {
+  customElement,
+  html,
+  css,
+  cssManager,
+  DeesElement,
+  property,
+  unsafeCSS,
+  query,
+} from '@design.estate/dees-element';
+
+import { demoFunc } from './dees-label.demo.js';
+import { themeDefaultStyles } from '../../00theme.js';
+
+@customElement('dees-label')
+export class DeesLabel extends DeesElement {
+  public static demo = demoFunc;
+  public static demoGroups = ['Layout', 'Input'];
+
+  // INSTANCE
+
+  @property({
+    type: String,
+    reflect: true,
+  })
+  accessor label = '';
+
+  @property({
+    type: String,
+    reflect: true,
+  })
+  accessor description: string;
+
+  @property({
+    type: Boolean,
+    reflect: true,
+  })
+  accessor required: boolean = false;
+
+  public static styles = [
+    themeDefaultStyles,
+    cssManager.defaultStyles,
+    css`
+      /* TODO: Migrate hardcoded values to --dees-* CSS variables */
+      :host {
+        font-family: -apple-system, BlinkMacSystemFont, 'Segoe UI', 'Roboto', sans-serif;
+      }
+
+      .label {
+        display: inline-block;
+        color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 90%)')};
+        font-size: 14px;
+        font-weight: 500;
+        line-height: 1.5;
+        margin-bottom: 6px;
+        cursor: default;
+        user-select: none;
+        letter-spacing: -0.01em;
+      }
+
+      .required {
+        color: ${cssManager.bdTheme('hsl(0 84.2% 60.2%)', 'hsl(0 72.2% 50.6%)')};
+        margin-left: 2px;
+      }
+
+      dees-icon {
+        display: inline-block;
+        font-size: 12px;
+        transform: translateY(1px);
+        margin-left: 4px;
+        color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
+        cursor: help;
+      }
+    `,
+  ];
+
+  public render() {
+    return html`
+      ${this.label
+        ? html`
+            <div class="label">
+              ${this.label}
+              ${this.required ? html`<span class="required">*</span>` : ''}
+              ${this.description
+                ? html`
+                    <dees-icon .icon=${'lucide:info'}></dees-icon>
+                    <dees-speechbubble .text=${this.description}></dees-speechbubble>
+                  `
+                : html``}
+            </div>
+          `
+        : html``}
+    `;
+  }
+}

ts_web/elements/00group-layout/dees-label/index.ts

@@ -0,0 +1 @@
+export * from './dees-label.js';

ts_web/elements/00group-layout/dees-pagination/dees-pagination.demo.ts

@@ -0,0 +1,28 @@
+import { html } from '@design.estate/dees-element';
+
+/**
+ * Demo for dees-pagination component
+ */
+export const demoFunc = () => html`
+  <div style="display: flex; align-items: center; gap: 16px;">
+    <!-- Small set of pages -->
+    <div style="display: flex; flex-direction: column; gap: 4px;">
+      <span>5 pages, starting at 1:</span>
+      <dees-pagination
+        .total=${5}
+        .page=${1}
+        @page-change=${(e: CustomEvent) => console.log('Page changed to', e.detail.page)}
+      ></dees-pagination>
+    </div>
+
+    <!-- Larger set of pages -->
+    <div style="display: flex; flex-direction: column; gap: 4px;">
+      <span>15 pages, starting at 8:</span>
+      <dees-pagination
+        .total=${15}
+        .page=${8}
+        @page-change=${(e: CustomEvent) => console.log('Page changed to', e.detail.page)}
+      ></dees-pagination>
+    </div>
+  </div>
+`;

ts_web/elements/00group-layout/dees-pagination/dees-pagination.ts

@@ -0,0 +1,137 @@
+import { customElement, html, DeesElement, property, css, cssManager, type TemplateResult } from '@design.estate/dees-element';
+import { demoFunc } from './dees-pagination.demo.js';
+import { themeDefaultStyles } from '../../00theme.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-pagination': DeesPagination;
+  }
+}
+
+/**
+ * A simple pagination component.
+ * @fires page-change - Emitted when the page is changed. detail: { page: number }
+ */
+@customElement('dees-pagination')
+export class DeesPagination extends DeesElement {
+  public static demo = demoFunc;
+  public static demoGroups = ['Layout'];
+  /** Current page (1-based) */
+  @property({ type: Number, reflect: true })
+  accessor page = 1;
+
+  /** Total number of pages */
+  @property({ type: Number, reflect: true })
+  accessor total = 1;
+
+  public static styles = [
+    themeDefaultStyles,
+    cssManager.defaultStyles,
+    css`
+      /* TODO: Migrate hardcoded values to --dees-* CSS variables */
+      :host {
+        display: inline-flex;
+        align-items: center;
+      }
+      button {
+        background: none;
+        border: none;
+        margin: 0 2px;
+        padding: 6px 10px;
+        font-size: 14px;
+        cursor: pointer;
+        color: ${cssManager.bdTheme('#333', '#ccc')};
+        border-radius: 3px;
+        transition: background 0.2s;
+      }
+      button:hover:not(:disabled) {
+        background: ${cssManager.bdTheme('#eee', '#444')};
+      }
+      button:disabled {
+        cursor: default;
+        color: ${cssManager.bdTheme('#aaa', '#666')};
+      }
+      button.current {
+        background: #0050b9;
+        color: #fff;
+        cursor: default;
+      }
+      span.ellipsis {
+        margin: 0 4px;
+        color: ${cssManager.bdTheme('#333', '#ccc')};
+      }
+    `,
+  ];
+
+  private get pages(): (number | string)[] {
+    const pages: (number | string)[] = [];
+    const total = this.total;
+    const current = this.page;
+    if (total <= 7) {
+      for (let i = 1; i <= total; i++) {
+        pages.push(i);
+      }
+    } else {
+      pages.push(1);
+      if (current > 4) {
+        pages.push('...');
+      }
+      const start = Math.max(2, current - 2);
+      const end = Math.min(total - 1, current + 2);
+      for (let i = start; i <= end; i++) {
+        pages.push(i);
+      }
+      if (current < total - 3) {
+        pages.push('...');
+      }
+      pages.push(total);
+    }
+    return pages;
+  }
+
+  public render(): TemplateResult {
+    return html`
+      <button
+        @click=${() => this.changePage(this.page - 1)}
+        ?disabled=${this.page <= 1}
+        aria-label="Previous page"
+      >
+        ‹
+      </button>
+      ${this.pages.map((p) =>
+        p === '...'
+          ? html`<span class="ellipsis">…</span>`
+          : html`
+              <button
+                class="${p === this.page ? 'current' : ''}"
+                @click=${() => this.changePage(p as number)}
+                ?disabled=${p === this.page}
+                aria-label="Page ${p}"
+              >
+                ${p}
+              </button>
+            `
+      )}
+      <button
+        @click=${() => this.changePage(this.page + 1)}
+        ?disabled=${this.page >= this.total}
+        aria-label="Next page"
+      >
+        ›
+      </button>
+    `;
+  }
+
+  private changePage(newPage: number) {
+    if (newPage < 1 || newPage > this.total || newPage === this.page) {
+      return;
+    }
+    this.page = newPage;
+    this.dispatchEvent(
+      new CustomEvent('page-change', {
+        detail: { page: this.page },
+        bubbles: true,
+      })
+    );
+  }
+}

ts_web/elements/00group-layout/dees-pagination/index.ts

@@ -0,0 +1 @@
+export * from './dees-pagination.js';

ts_web/elements/00group-layout/dees-panel/dees-panel.demo.ts

@@ -0,0 +1,172 @@
+import { html, css, cssManager } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+  <style>
+    ${css`
+      .demo-background {
+        padding: 24px;
+        background: ${cssManager.bdTheme('hsl(0 0% 95%)', 'hsl(0 0% 5%)')};
+        min-height: 100vh;
+      }
+      
+      .demo-container {
+        max-width: 1200px;
+        margin: 0 auto;
+        display: flex;
+        flex-direction: column;
+        gap: 24px;
+      }
+      
+      .section-title {
+        font-size: 24px;
+        font-weight: 700;
+        margin: 32px 0 16px 0;
+        color: ${cssManager.bdTheme('hsl(0 0% 9%)', 'hsl(0 0% 95%)')};
+        letter-spacing: -0.025em;
+      }
+      
+      .section-title:first-child {
+        margin-top: 0;
+      }
+      
+      .grid-layout {
+        display: grid;
+        grid-template-columns: 1fr 1fr;
+        gap: 24px;
+      }
+      
+      .grid-3col {
+        display: grid;
+        grid-template-columns: 1fr 1fr 1fr;
+        gap: 24px;
+      }
+      
+      @media (max-width: 968px) {
+        .grid-3col {
+          grid-template-columns: 1fr;
+        }
+      }
+      
+      @media (max-width: 768px) {
+        .grid-layout {
+          grid-template-columns: 1fr;
+        }
+      }
+      
+      code {
+        background: ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
+        padding: 2px 6px;
+        border-radius: 3px;
+        font-size: 13px;
+      }
+    `}
+  </style>
+  
+  <div class="demo-background">
+    <div class="demo-container">
+      <h2 class="section-title">Default Panels</h2>
+      
+      <dees-panel .title=${'Panel Component'} .subtitle=${'The default panel variant with shadcn-inspired styling'}>
+        <p>The panel component automatically follows the theme and provides consistent styling for grouped content.</p>
+        <p>It's perfect for creating sections in your application with proper spacing and borders.</p>
+      </dees-panel>
+      
+      <div class="grid-layout">
+        <dees-panel .title=${'Feature Overview'} .subtitle=${'Key capabilities'}>
+          <p>Grid layouts work great with panels for creating dashboards and feature sections.</p>
+          <dees-button>Learn More</dees-button>
+        </dees-panel>
+        
+        <dees-panel .title=${'Quick Actions'} .subtitle=${'Common tasks'}>
+          <p>Each panel maintains consistent spacing and styling across your application.</p>
+          <dees-button>Get Started</dees-button>
+        </dees-panel>
+      </div>
+      
+      <h2 class="section-title">Panel Variants</h2>
+      
+      <dees-panel .title=${'Default Variant'} .variant=${'default'}>
+        <p>The default variant has a white background, subtle border, and minimal shadow. It's the standard choice for most content.</p>
+        <p>Use <code>variant="default"</code> or omit the variant property.</p>
+      </dees-panel>
+      
+      <dees-panel .title=${'Outline Variant'} .subtitle=${'Transparent background with border'} .variant=${'outline'}>
+        <p>The outline variant removes the background color and shadow, keeping only the border.</p>
+        <p>Use <code>variant="outline"</code> for a lighter visual weight.</p>
+      </dees-panel>
+      
+      <dees-panel .title=${'Ghost Variant'} .subtitle=${'Minimal styling for subtle sections'} .variant=${'ghost'}>
+        <p>The ghost variant has no border or background by default, only showing a subtle background on hover.</p>
+        <p>Use <code>variant="ghost"</code> for the most minimal appearance.</p>
+      </dees-panel>
+      
+      <h2 class="section-title">Panel Sizes</h2>
+      
+      <div class="grid-3col">
+        <dees-panel .title=${'Small Panel'} .size=${'sm'}>
+          <p>Compact padding for dense layouts.</p>
+          <p>Use <code>size="sm"</code></p>
+        </dees-panel>
+        
+        <dees-panel .title=${'Medium Panel'} .size=${'md'}>
+          <p>Default size with balanced spacing.</p>
+          <p>Use <code>size="md"</code> or omit.</p>
+        </dees-panel>
+        
+        <dees-panel .title=${'Large Panel'} .size=${'lg'}>
+          <p>Generous padding for prominent sections.</p>
+          <p>Use <code>size="lg"</code></p>
+        </dees-panel>
+      </div>
+      
+      <h2 class="section-title">Complex Examples</h2>
+      
+      <dees-panel .title=${'Form Example'} .subtitle=${'Panels work great for organizing form sections'}>
+        <dees-form>
+          <dees-input-text .label=${'Project Name'} .required=${true}></dees-input-text>
+          <dees-input-text .label=${'Description'} .inputType=${'textarea'}></dees-input-text>
+          <dees-input-dropdown 
+            .label=${'Category'} 
+            .options=${[
+              { option: 'Web Development', key: 'web' },
+              { option: 'Mobile App', key: 'mobile' },
+              { option: 'Desktop Software', key: 'desktop' }
+            ]}
+          ></dees-input-dropdown>
+          <dees-form-submit>Create Project</dees-form-submit>
+        </dees-form>
+      </dees-panel>
+      
+      <dees-panel .title=${'Nested Panels'} .subtitle=${'Panels can be nested for hierarchical organization'}>
+        <p>You can nest panels to create more complex layouts:</p>
+        
+        <dees-panel .title=${'Nested Panel 1'} .variant=${'outline'} .size=${'sm'}>
+          <p>This is a nested panel with outline variant and small size.</p>
+        </dees-panel>
+        
+        <dees-panel .title=${'Nested Panel 2'} .variant=${'ghost'} .size=${'sm'}>
+          <p>This is another nested panel with ghost variant.</p>
+        </dees-panel>
+      </dees-panel>
+      
+      <h2 class="section-title">Untitled Panels</h2>
+      
+      <dees-panel>
+        <p>Panels work great even without a title for simple content grouping.</p>
+        <p>They provide visual separation and consistent padding throughout your interface.</p>
+      </dees-panel>
+      
+      <div class="grid-layout">
+        <dees-panel .variant=${'outline'}>
+          <h4 style="margin-top: 0;">Custom Content</h4>
+          <p>You can add your own headings and structure within untitled panels.</p>
+        </dees-panel>
+        
+        <dees-panel .variant=${'ghost'}>
+          <h4 style="margin-top: 0;">Minimal Style</h4>
+          <p>Ghost panels without titles create very subtle content sections.</p>
+        </dees-panel>
+      </div>
+    </div>
+  </div>
+`;

ts_web/elements/00group-layout/dees-panel/dees-panel.ts

@@ -0,0 +1,203 @@
+import {
+  customElement,
+  DeesElement,
+  html,
+  css,
+  cssManager,
+  property,
+  type TemplateResult,
+} from '@design.estate/dees-element';
+import { demoFunc } from './dees-panel.demo.js';
+import { cssGeistFontFamily } from '../../00fonts.js';
+import { themeDefaultStyles } from '../../00theme.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-panel': DeesPanel;
+  }
+}
+
+@customElement('dees-panel')
+export class DeesPanel extends DeesElement {
+  public static demo = demoFunc;
+  public static demoGroups = ['Layout'];
+
+  @property({ type: String })
+  accessor title: string = '';
+
+  @property({ type: String })
+  accessor subtitle: string = '';
+
+  @property({ type: String })
+  accessor variant: 'default' | 'outline' | 'ghost' = 'default';
+
+  @property({ type: String })
+  accessor size: 'sm' | 'md' | 'lg' = 'md';
+
+  @property({ attribute: false })
+  accessor runAfterRender: ((elementArg: HTMLElement) => void | Promise<void>) | undefined = undefined;
+
+  public static styles = [
+    themeDefaultStyles,
+    cssManager.defaultStyles,
+    css`
+      /* TODO: Migrate hardcoded values to --dees-* CSS variables */
+      :host {
+        display: block;
+        font-family: ${cssGeistFontFamily};
+        background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 3.9%)')};
+        border-radius: 6px;
+        padding: 24px;
+        border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
+        transition: all 0.2s cubic-bezier(0.4, 0, 0.2, 1);
+      }
+
+      /* Variant: default */
+      :host([variant="default"]) {
+        box-shadow: 0 1px 2px 0 hsl(0 0% 0% / 0.05);
+      }
+
+      /* Variant: outline */
+      :host([variant="outline"]) {
+        background: transparent;
+        box-shadow: none;
+      }
+
+      /* Variant: ghost */
+      :host([variant="ghost"]) {
+        background: transparent;
+        border-color: transparent;
+        box-shadow: none;
+        padding: 16px;
+      }
+
+      /* Size variations */
+      :host([size="sm"]) {
+        padding: 16px;
+      }
+
+      :host([size="lg"]) {
+        padding: 32px;
+      }
+
+      .header {
+        margin-bottom: 16px;
+      }
+
+      .header:empty {
+        display: none;
+      }
+
+      .title {
+        margin: 0;
+        font-size: 18px;
+        font-weight: 600;
+        color: ${cssManager.bdTheme('hsl(0 0% 9%)', 'hsl(0 0% 95%)')};
+        letter-spacing: -0.025em;
+        line-height: 1.5;
+      }
+
+      /* Title size variations */
+      :host([size="sm"]) .title {
+        font-size: 16px;
+      }
+
+      :host([size="lg"]) .title {
+        font-size: 20px;
+      }
+
+      .subtitle {
+        margin: 4px 0 0 0;
+        font-size: 14px;
+        color: ${cssManager.bdTheme('hsl(215.4 16.3% 56.9%)', 'hsl(215 20.2% 55.1%)')};
+        letter-spacing: -0.006em;
+        line-height: 1.5;
+      }
+
+      /* Subtitle size variations */
+      :host([size="sm"]) .subtitle {
+        font-size: 13px;
+      }
+
+      :host([size="lg"]) .subtitle {
+        font-size: 15px;
+        margin-top: 6px;
+      }
+
+      .content {
+        color: ${cssManager.bdTheme('hsl(215.3 25% 26.7%)', 'hsl(217.9 10.6% 84.9%)')};
+        font-size: 14px;
+        line-height: 1.6;
+      }
+
+      /* Content size variations */
+      :host([size="sm"]) .content {
+        font-size: 13px;
+      }
+
+      :host([size="lg"]) .content {
+        font-size: 15px;
+      }
+
+      /* Remove margins from first and last children */
+      .content ::slotted(*:first-child) {
+        margin-top: 0;
+      }
+
+      .content ::slotted(*:last-child) {
+        margin-bottom: 0;
+      }
+
+      /* Interactive states for default variant */
+      :host([variant="default"]:hover) {
+        border-color: ${cssManager.bdTheme('hsl(0 0% 79.8%)', 'hsl(0 0% 20.9%)')};
+        box-shadow: 0 4px 6px -1px hsl(0 0% 0% / 0.1), 0 2px 4px -2px hsl(0 0% 0% / 0.1);
+      }
+
+      /* Interactive states for outline variant */
+      :host([variant="outline"]:hover) {
+        border-color: ${cssManager.bdTheme('hsl(0 0% 79.8%)', 'hsl(0 0% 20.9%)')};
+        background: ${cssManager.bdTheme('hsl(0 0% 98%)', 'hsl(0 0% 7.8%)')};
+      }
+
+      /* Interactive states for ghost variant */
+      :host([variant="ghost"]:hover) {
+        background: ${cssManager.bdTheme('hsl(0 0% 95.1%)', 'hsl(0 0% 14.9%)')};
+      }
+
+      /* Focus states */
+      :host(:focus-within) {
+        outline: none;
+        border-color: ${cssManager.bdTheme('hsl(222.2 47.4% 51.2%)', 'hsl(217.2 91.2% 59.8%)')};
+        box-shadow: 0 0 0 3px ${cssManager.bdTheme('hsl(222.2 47.4% 51.2% / 0.1)', 'hsl(217.2 91.2% 59.8% / 0.1)')};
+      }
+
+      /* Nested panels spacing */
+      ::slotted(dees-panel) {
+        margin-top: 16px;
+      }
+
+      ::slotted(dees-panel:first-child) {
+        margin-top: 0;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="header">
+        ${this.title ? html`<h3 class="title">${this.title}</h3>` : ''}
+        ${this.subtitle ? html`<p class="subtitle">${this.subtitle}</p>` : ''}
+      </div>
+      <div class="content">
+        <slot></slot>
+      </div>
+    `;
+  }
+
+  public async firstUpdated() {
+    if (this.runAfterRender) {
+      await this.runAfterRender(this);
+    }
+  }
+}

ts_web/elements/00group-layout/dees-panel/index.ts

@@ -0,0 +1 @@
+export * from './dees-panel.js';

ts_web/elements/00group-layout/dees-stepper/dees-stepper.demo.ts

@@ -0,0 +1,134 @@
+import { html } from '@design.estate/dees-element';
+
+export const stepperDemo = () => html`
+  <dees-stepper
+    .steps=${[
+      {
+        title: 'Account Setup',
+        content: html`
+          <dees-form>
+            <dees-input-text key="email" label="Work Email" required></dees-input-text>
+            <dees-input-text key="password" label="Create Password" type="password" required></dees-input-text>
+            <dees-form-submit>Continue</dees-form-submit>
+          </dees-form>
+        `,
+        validationFunc: async (stepperArg, elementArg) => {
+          const deesForm = elementArg.querySelector('dees-form');
+          deesForm.addEventListener('formData', () => stepperArg.goNext(), { once: true });
+        },
+      },
+      {
+        title: 'Profile Details',
+        content: html`
+          <dees-form>
+            <dees-input-text key="firstName" label="First Name" required></dees-input-text>
+            <dees-input-text key="lastName" label="Last Name" required></dees-input-text>
+            <dees-form-submit>Continue</dees-form-submit>
+          </dees-form>
+        `,
+        validationFunc: async (stepperArg, elementArg) => {
+          const deesForm = elementArg.querySelector('dees-form');
+          deesForm.addEventListener('formData', () => stepperArg.goNext(), { once: true });
+        },
+      },
+      {
+        title: 'Contact Information',
+        content: html`
+          <dees-form>
+            <dees-input-phone key="phone" label="Mobile Number" required></dees-input-phone>
+            <dees-input-text key="company" label="Company"></dees-input-text>
+            <dees-form-submit>Continue</dees-form-submit>
+          </dees-form>
+        `,
+        validationFunc: async (stepperArg, elementArg) => {
+          const deesForm = elementArg.querySelector('dees-form');
+          deesForm.addEventListener('formData', () => stepperArg.goNext(), { once: true });
+        },
+      },
+      {
+        title: 'Team Size',
+        content: html`
+          <dees-form>
+            <dees-input-dropdown
+              key="teamSize"
+              label="How big is your team?"
+              .options=${[
+                { label: '1-5', value: '1-5' },
+                { label: '6-20', value: '6-20' },
+                { label: '21-50', value: '21-50' },
+                { label: '51+', value: '51+' },
+              ]}
+              required
+            ></dees-input-dropdown>
+            <dees-form-submit>Continue</dees-form-submit>
+          </dees-form>
+        `,
+        validationFunc: async (stepperArg, elementArg) => {
+          const deesForm = elementArg.querySelector('dees-form');
+          deesForm.addEventListener('formData', () => stepperArg.goNext(), { once: true });
+        },
+      },
+      {
+        title: 'Goals',
+        content: html`
+          <dees-form>
+            <dees-input-multitoggle
+              key="goal"
+              label="Main objective"
+              .options=${[
+                { label: 'Onboarding', value: 'onboarding' },
+                { label: 'Analytics', value: 'analytics' },
+                { label: 'Automation', value: 'automation' },
+              ]}
+              required
+            ></dees-input-multitoggle>
+            <dees-form-submit>Continue</dees-form-submit>
+          </dees-form>
+        `,
+        validationFunc: async (stepperArg, elementArg) => {
+          const deesForm = elementArg.querySelector('dees-form');
+          deesForm.addEventListener('formData', () => stepperArg.goNext(), { once: true });
+        },
+      },
+      {
+        title: 'Brand Preferences',
+        content: html`
+          <dees-form>
+            <dees-input-text key="brandColor" label="Primary brand color"></dees-input-text>
+            <dees-input-text key="tone" label="Preferred tone (e.g. friendly, formal)"></dees-input-text>
+            <dees-form-submit>Continue</dees-form-submit>
+          </dees-form>
+        `,
+        validationFunc: async (stepperArg, elementArg) => {
+          const deesForm = elementArg.querySelector('dees-form');
+          deesForm.addEventListener('formData', () => stepperArg.goNext(), { once: true });
+        },
+      },
+      {
+        title: 'Integrations',
+        content: html`
+          <dees-form>
+            <dees-input-list
+              key="integrations"
+              label="Integrations in use"
+              placeholder="Add integration"
+            ></dees-input-list>
+            <dees-form-submit>Continue</dees-form-submit>
+          </dees-form>
+        `,
+        validationFunc: async (stepperArg, elementArg) => {
+          const deesForm = elementArg.querySelector('dees-form');
+          deesForm.addEventListener('formData', () => stepperArg.goNext(), { once: true });
+        },
+      },
+      {
+        title: 'Review & Launch',
+        content: html`
+          <dees-panel>
+            <p>Almost there! Review your selections and launch whenever you're ready.</p>
+          </dees-panel>
+        `,
+      },
+    ] as const}
+  ></dees-stepper>
+`;

ts_web/elements/00group-layout/dees-stepper/dees-stepper.ts

@@ -0,0 +1,299 @@
+import * as plugins from '../../00plugins.js';
+import * as colors from '../../00colors.js';
+
+import {
+  DeesElement,
+  customElement,
+  html,
+  css,
+  unsafeCSS,
+  type CSSResult,
+  cssManager,
+  property,
+  type TemplateResult,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { stepperDemo } from './dees-stepper.demo.js';
+import { themeDefaultStyles } from '../../00theme.js';
+
+export interface IStep {
+  title: string;
+  content: TemplateResult;
+  validationFunc?: (stepper: DeesStepper, htmlElement: HTMLElement, signal?: AbortSignal) => Promise<any>;
+  onReturnToStepFunc?: (stepper: DeesStepper, htmlElement: HTMLElement) => Promise<any>;
+  validationFuncCalled?: boolean;
+  abortController?: AbortController;
+}
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-stepper': DeesStepper;
+  }
+}
+
+@customElement('dees-stepper')
+export class DeesStepper extends DeesElement {
+  public static demo = stepperDemo;
+  public static demoGroups = ['Layout', 'Form'];
+
+  @property({
+    type: Array,
+  })
+  accessor steps: IStep[] = [];
+
+  @property({
+    type: Object,
+  })
+  accessor selectedStep: IStep;
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    themeDefaultStyles,
+    cssManager.defaultStyles,
+    css`
+      /* TODO: Migrate hardcoded values to --dees-* CSS variables */
+      :host {
+        position: absolute;
+        width: 100%;
+        height: 100%;
+      }
+      .stepperContainer {
+        position: absolute;
+        width: 100%;
+        height: 100%;
+        overflow: hidden;
+      }
+
+      .step {
+        position: relative;
+        pointer-events: none;
+        overflow: hidden;
+        transition: transform 0.7s cubic-bezier(0.87, 0, 0.13, 1), box-shadow 0.7s cubic-bezier(0.87, 0, 0.13, 1), filter 0.7s cubic-bezier(0.87, 0, 0.13, 1), border 0.7s cubic-bezier(0.87, 0, 0.13, 1);
+        max-width: 500px;
+        min-height: 300px;
+        border-radius: 12px;
+        background: ${cssManager.bdTheme('#ffffff', '#0f0f11')};
+        border: 1px solid ${cssManager.bdTheme('#e2e8f0', '#272729')};
+        color: ${cssManager.bdTheme('#0f172a', '#f5f5f5')};
+        margin: auto;
+        margin-bottom: 20px;
+        filter: opacity(0.55) saturate(0.85);
+        box-shadow: 0 8px 32px rgba(0, 0, 0, 0.4);
+        user-select: none;
+      }
+
+      .step.selected {
+        pointer-events: all;
+        filter: opacity(1) saturate(1);
+        user-select: auto;
+      }
+
+      .step.hiddenStep {
+        filter: opacity(0);
+      }
+
+      .step.entrance {
+        transition: transform 0.35s ease, box-shadow 0.35s ease, filter 0.35s ease, border 0.35s ease;
+      }
+
+      .step.entrance.hiddenStep {
+        transform: translateY(16px);
+      }
+
+      .step:last-child {
+        margin-bottom: 100vh;
+      }
+
+      .step .stepCounter {
+        color: ${cssManager.bdTheme('#64748b', '#a1a1aa')};
+        position: absolute;
+        top: 12px;
+        right: 12px;
+        padding: 6px 14px;
+        font-size: 12px;
+        border-radius: 999px;
+        background: ${cssManager.bdTheme('rgba(226, 232, 240, 0.5)', 'rgba(63, 63, 70, 0.45)')};
+        border: 1px solid ${cssManager.bdTheme('rgba(226, 232, 240, 0.7)', 'rgba(63, 63, 70, 0.6)')};
+      }
+
+      .step .goBack {
+        position: absolute;
+        top: 12px;
+        left: 12px;
+        display: inline-flex;
+        align-items: center;
+        gap: 6px;
+        padding: 6px 12px;
+        font-size: 12px;
+        font-weight: 500;
+        border-radius: 999px;
+        border: 1px solid ${cssManager.bdTheme('rgba(226, 232, 240, 0.9)', 'rgba(63, 63, 70, 0.85)')};
+        background: ${cssManager.bdTheme('rgba(255, 255, 255, 0.9)', 'rgba(39, 39, 42, 0.85)')};
+        color: ${cssManager.bdTheme('#475569', '#d4d4d8')};
+        cursor: pointer;
+        transition: border 0.2s ease, color 0.2s ease, background 0.2s ease, transform 0.2s ease;
+      }
+
+      .step .goBack:hover {
+        color: ${cssManager.bdTheme('#0f172a', '#fafafa')};
+        border-color: ${cssManager.bdTheme(colors.dark.blue, colors.dark.blue)};
+        background: ${cssManager.bdTheme('rgba(226, 232, 240, 0.95)', 'rgba(63, 63, 70, 0.7)')};
+        transform: translateX(-2px);
+      }
+
+      .step .goBack:active {
+        color: ${cssManager.bdTheme('#0f172a', '#fafafa')};
+        border-color: ${cssManager.bdTheme(colors.dark.blueActive, colors.dark.blueActive)};
+        background: ${cssManager.bdTheme('rgba(226, 232, 240, 0.85)', 'rgba(63, 63, 70, 0.6)')};
+      }
+
+      .step .goBack span {
+        transition: transform 0.2s ease;
+        display: inline-block;
+      }
+
+      .step .goBack:hover span {
+        transform: translateX(-2px);
+      }
+
+      .step .title {
+        text-align: center;
+        padding-top: 64px;
+        font-family: 'Geist Sans', sans-serif;
+        font-size: 24px;
+        font-weight: 600;
+        letter-spacing: -0.01em;
+        color: inherit;
+      }
+
+      .step .content {
+        padding: 32px;
+      }
+    `,
+  ];
+
+  public render() {
+    return html`
+      <div class="stepperContainer">
+        ${this.steps.map(
+          (stepArg) =>
+            html`<div
+              class="step ${stepArg === this.selectedStep
+                ? 'selected'
+                : null} ${this.getIndexOfStep(stepArg) > this.getIndexOfStep(this.selectedStep)
+                ? 'hiddenStep'
+                : ''} ${this.getIndexOfStep(stepArg) === 0 ? 'entrance' : ''}"
+            >
+              ${this.getIndexOfStep(stepArg) > 0
+                ? html`<div class="goBack" @click=${this.goBack}><span style="font-family: Inter"><-</span> go to previous step</div>`
+                : ``}
+              <div class="stepCounter">
+                Step ${this.steps.findIndex((elementArg) => elementArg === stepArg) + 1} of
+                ${this.steps.length}
+              </div>
+              <div class="title">${stepArg.title}</div>
+              <div class="content">${stepArg.content}</div>
+            </div> `
+        )}
+      </div>
+    `;
+  }
+
+  public getIndexOfStep = (stepArg: IStep): number => {
+    return this.steps.findIndex((stepArg2) => stepArg === stepArg2);
+  };
+
+  public async firstUpdated() {
+    await this.domtoolsPromise;
+    await this.domtools.convenience.smartdelay.delayFor(0);
+    this.selectedStep = this.steps[0];
+    this.setScrollStatus();
+    // Remove entrance class after initial animation completes
+    await this.domtools.convenience.smartdelay.delayFor(350);
+    this.shadowRoot.querySelector('.step.entrance')?.classList.remove('entrance');
+  }
+
+  public async updated() {
+    this.setScrollStatus();
+  }
+
+  public scroller: typeof domtools.plugins.SweetScroll.prototype;
+
+  public async setScrollStatus() {
+    const stepperContainer: HTMLElement = this.shadowRoot.querySelector('.stepperContainer');
+    const firstStepElement: HTMLElement = this.shadowRoot.querySelector('.step');
+    const selectedStepElement: HTMLElement = this.shadowRoot.querySelector('.selected');
+    if (!selectedStepElement) {
+      return;
+    }
+    if (!stepperContainer.style.paddingTop) {
+      stepperContainer.style.paddingTop = `${
+        stepperContainer.offsetHeight / 2 - selectedStepElement.offsetHeight / 2
+      }px`;
+    }
+    console.log('Setting scroll status');
+    console.log(selectedStepElement);
+    const scrollPosition =
+      selectedStepElement.offsetTop -
+      stepperContainer.offsetHeight / 2 +
+      selectedStepElement.offsetHeight / 2;
+    console.log(scrollPosition);
+    const domtoolsInstance = await domtools.DomTools.setupDomTools();
+    if (!this.scroller) {
+      this.scroller = new domtools.plugins.SweetScroll(
+        {
+          vertical: true,
+          horizontal: false,
+          easing: 'easeInOutExpo',
+          duration: 700,
+        },
+        stepperContainer
+      );
+    }
+    if (!this.selectedStep.validationFuncCalled && this.selectedStep.validationFunc) {
+      this.selectedStep.abortController = new AbortController();
+      this.selectedStep.validationFuncCalled = true;
+      await this.selectedStep.validationFunc(this, selectedStepElement, this.selectedStep.abortController.signal);
+    }
+    this.scroller.to(scrollPosition);
+  }
+
+  public async goBack() {
+    const currentIndex = this.steps.findIndex((stepArg) => stepArg === this.selectedStep);
+    if (currentIndex <= 0) {
+      return;
+    }
+    // Abort any active listeners on current step
+    if (this.selectedStep.abortController) {
+      this.selectedStep.abortController.abort();
+    }
+    const currentStep = this.steps[currentIndex];
+    currentStep.validationFuncCalled = false;
+    const previousStep = this.steps[currentIndex - 1];
+    previousStep.validationFuncCalled = false;
+    this.selectedStep = previousStep;
+    await this.domtoolsPromise;
+    await this.domtools.convenience.smartdelay.delayFor(100);
+    this.selectedStep.onReturnToStepFunc?.(this, this.shadowRoot.querySelector('.selected'));
+  }
+
+  public goNext() {
+    const currentIndex = this.steps.findIndex((stepArg) => stepArg === this.selectedStep);
+    if (currentIndex < 0 || currentIndex >= this.steps.length - 1) {
+      return;
+    }
+    // Abort any active listeners on current step
+    if (this.selectedStep.abortController) {
+      this.selectedStep.abortController.abort();
+    }
+    const currentStep = this.steps[currentIndex];
+    currentStep.validationFuncCalled = false;
+    const nextStep = this.steps[currentIndex + 1];
+    nextStep.validationFuncCalled = false;
+    this.selectedStep = nextStep;
+  }
+}

ts_web/elements/00group-layout/dees-stepper/index.ts

@@ -0,0 +1 @@
+export * from './dees-stepper.js';

ts_web/elements/00group-layout/index.ts

@@ -0,0 +1,8 @@
+// Layout Components
+export * from './dees-chips/index.js';
+export * from './dees-dashboardgrid/index.js';
+export * from './dees-heading/index.js';
+export * from './dees-label/index.js';
+export * from './dees-pagination/index.js';
+export * from './dees-panel/index.js';
+export * from './dees-stepper/index.js';