Compare commits
100 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
| 3f5cb4570b | |||
| 428d2741d1 | |||
| 2f4c47f0d2 | |||
| 2be1ce6908 | |||
| c0375508f0 | |||
| 3e86ba034b | |||
| 05e74cbe2e | |||
| 8fbdbf9f64 | |||
| bfbc0f108e | |||
| bab7528f0b | |||
| 6047705e7d | |||
| ab19b561c4 | |||
| 7ef3613e91 | |||
| 940eebe29f | |||
| 8ecaffe165 | |||
| e5cb31ffb1 | |||
| 7c2635fc13 | |||
| eb3d396c68 | |||
| 13ba5670f0 | |||
| 961b811b7a | |||
| cd491e1517 | |||
| b8a03def79 | |||
| 2b6798083d | |||
| 3c7b5dc690 | |||
| 2f4afddf73 | |||
| 212a46894e | |||
| 653ef109be | |||
| a0b17132ad | |||
| 486ec11ce6 | |||
| a24d28d4e0 | |||
| 8cc45a53e9 | |||
| edf7a86f07 | |||
| 8b8a8ff943 | |||
| 59610f463e | |||
| c1672bb8ae | |||
| 3e101840a6 | |||
| e87898ab82 | |||
| 8a1be59a51 | |||
| a3b2ace88d | |||
| c34037265e | |||
| 8c230fe3af | |||
| a695d60770 | |||
| ea30cbd381 | |||
| 39a4bf0dd3 | |||
| d5c9bc69b3 | |||
| 27f8ab752d | |||
| 5948fc83ea | |||
| 72e3d6a09e | |||
| de6f4a3ac5 | |||
| eecdc51557 | |||
| c841c49e1e | |||
| 2595d822d0 | |||
| 3ae0541065 | |||
| 4b735b768a | |||
| 9422edbfa1 | |||
| 37c5e92d6d | |||
| c7503de11e | |||
| 408362f3be | |||
| b3f5ab3d31 | |||
| 8d954b17ad | |||
| ac9cc8cfed | |||
| a1e808345e | |||
| efea2d62d9 | |||
| 2f95979cc6 | |||
| b3f098b41e | |||
| a0d5462ff1 | |||
| f1c204f790 | |||
| e806c9bce6 | |||
| fa56c7cce8 | |||
| 3601651e10 | |||
| b5055b0696 | |||
| a5f7a7ecee | |||
| dede3216fb | |||
| 5ee89b31b1 | |||
| 2d354ace55 | |||
| 34f5239607 | |||
| d17bdcbaad | |||
| dc8a3b620b | |||
| 9b96949a76 | |||
| 931797466a | |||
| 9bfb6446af | |||
| 976039798a | |||
| 0e2176ec7d | |||
| cada1a4234 | |||
| 465f7585ac | |||
| a7a710b320 | |||
| b1c174a4e2 | |||
| 395e0fa3da | |||
| f52b9d8b72 | |||
| 561d1b15d9 | |||
| 0722f362f3 | |||
| 2104b3bdce | |||
| e2d03107df | |||
| 54a87a5cc0 | |||
| 9bfbfcbb95 | |||
| 3505c390d8 | |||
| ff32470d8a | |||
| 4dba14060e | |||
| 31d728ec49 | |||
| ca290d1267 |
+315
@@ -1,5 +1,320 @@
|
||||
# Changelog
|
||||
|
||||
## 2026-04-16 - 3.80.0 - feat(stepper,updater)
|
||||
add progress-aware stepper flows and updater countdown states
|
||||
|
||||
- extend dees-stepper with embedded progressbar rendering, progress state helpers, and automatic progression for async validation steps
|
||||
- rework dees-updater to run as a non-cancelable two-step flow with live progress updates, optional external links, and configurable close or reload completion actions
|
||||
- refresh stepper and updater demos plus documentation to showcase auto-advancing progress steps and ready-state countdown behavior
|
||||
|
||||
## 2026-04-16 - 3.79.0 - feat(dees-progressbar)
|
||||
add status panels, terminal output, and legacy progress input support
|
||||
|
||||
- Extend dees-progressbar with label, statusText, terminalLines, statusRows, indeterminate, and showPercentage properties.
|
||||
- Support legacy value input and normalized progress values while clamping and formatting percentages consistently.
|
||||
- Add fixed-height status and terminal-style output with spinner animation and auto-scroll behavior for live activity updates.
|
||||
- Refresh the progressbar demo and readme examples to showcase determinate, indeterminate, terminal, and compatibility usage patterns.
|
||||
|
||||
## 2026-04-14 - 3.78.3 - fix(dees-table)
|
||||
stabilize live updates by reusing row DOM and avoiding redundant layout recalculations
|
||||
|
||||
- reuse keyed table rows across live-sorted updates so existing row elements persist while cells reorder
|
||||
- limit flash animation restarts to changed cells by tracking per-cell flash tokens
|
||||
- avoid repeated column width measurements unless table layout inputs actually change
|
||||
- replace async header and footer action rendering with direct mapped output to prevent comment node growth during updates
|
||||
- add Chromium live update tests covering width measurement stability, comment growth, and row DOM reuse
|
||||
|
||||
## 2026-04-12 - 3.78.2 - fix(deps)
|
||||
bump @design.estate/dees-wcctools to ^3.9.0
|
||||
|
||||
- Updates the @design.estate/dees-wcctools dependency from ^3.8.4 to ^3.9.0 in package.json.
|
||||
|
||||
## 2026-04-12 - 3.78.1 - fix(dees-simple-login)
|
||||
use dees-tile for the login credentials container
|
||||
|
||||
- replace the custom login card wrapper with a dees-tile component
|
||||
- update styles to target dees-tile and its content part while preserving form layout
|
||||
- add a credentials heading to the login tile
|
||||
|
||||
## 2026-04-12 - 3.78.0 - feat(dees-settings)
|
||||
add dees-settings layout component for displaying read-only settings with footer actions
|
||||
|
||||
- introduces a new dees-settings element with heading, description, settings field grid, and footer action support
|
||||
- exports dees-settings from the 00group-layout module index
|
||||
- adds demo examples covering populated, empty, and multi-action states
|
||||
|
||||
## 2026-04-12 - 3.77.0 - feat(dees-table)
|
||||
add configurable cell flash comparison and border highlight mode
|
||||
|
||||
- adds column-level flashCompare support so update highlighting can detect meaningful changes for custom cell values
|
||||
- adds flashBorder styling for cells with badges, icons, or custom rendered content where text-color flashing is not visible
|
||||
- avoids false-positive flash animations for non-primitive cell values unless a custom comparator is provided
|
||||
|
||||
## 2026-04-12 - 3.76.1 - fix(demo-inputs)
|
||||
wrap input component demos in dees-form containers for consistent form integration
|
||||
|
||||
- Adds dees-form wrappers across multiple input demo pages including checkbox, dropdown, file upload, iban, list, multitoggle, phone, quantity selector, radio group, tags, text, toggle, and typelist demos
|
||||
- Keeps horizontal and grid example layouts intact while nesting them inside form containers
|
||||
- Cleans up file upload and text demo markup to better match expected dees-form structure
|
||||
|
||||
## 2026-04-12 - 3.76.0 - feat(input)
|
||||
separate label info tooltips from description text across input components
|
||||
|
||||
- adds a dedicated infoText property for dees-label tooltips while keeping description available for helper text rendered below inputs
|
||||
- introduces a shared renderDescription() helper in the input base component and updates multiple input components to use the unified description styling
|
||||
- updates demos and consuming components to migrate tooltip content from description to infoText where appropriate
|
||||
|
||||
## 2026-04-12 - 3.75.0 - feat(dees-tile)
|
||||
add configurable overscroll handling to tile content and use it in modals
|
||||
|
||||
- introduces a reflected overscroll property on dees-tile with contain, auto, and none options
|
||||
- moves tile content scrolling and scrollbar styling into dees-tile instead of modal-specific styling
|
||||
- updates dees-modal to enable contained overscroll through the new dees-tile API
|
||||
|
||||
## 2026-04-12 - 3.74.2 - fix(modal,tile,input-text)
|
||||
move scroll handling from tile content to modal and update input text demo to use changeSubject subscriptions
|
||||
|
||||
- bump @design.estate/dees-wcctools from ^3.8.2 to ^3.8.4
|
||||
- set dees-tile content overflow to hidden and apply scroll styling through dees-modal part selectors
|
||||
- simplify the interactive dees-input-text demo by subscribing directly to changeSubject for live value updates
|
||||
|
||||
## 2026-04-12 - 3.74.1 - fix(dees-input-text)
|
||||
adjust password toggle and validation icon alignment in text input
|
||||
|
||||
- positions the password toggle and validation icon with fixed top offsets for improved vertical alignment
|
||||
- updates the validation icon styling to use a larger themed icon without the circular background
|
||||
|
||||
## 2026-04-12 - 3.74.0 - feat(input-text)
|
||||
add validated success state and text editing context menu to text inputs
|
||||
|
||||
- show a delayed checkmark confirmation for successful validation and hide inline validation text afterward
|
||||
- move IBAN validation handling into the shared text input validation function
|
||||
- improve the email validation demo to use a stricter regex-based check
|
||||
- add cut, copy, paste, and select-all context menu actions for text inputs
|
||||
|
||||
## 2026-04-12 - 3.73.2 - fix(input,label)
|
||||
correct validation state attribute handling in text inputs and refine label description icon styling
|
||||
|
||||
- Change dees-input-text validationState to reflect as a string attribute and align validation selectors with the emitted host attribute
|
||||
- Wrap the dees-label description icon in a dedicated container to improve sizing, hover feedback, and alignment
|
||||
|
||||
## 2026-04-12 - 3.73.1 - fix(dees-label)
|
||||
align label content and icon consistently using inline flex layout
|
||||
|
||||
- change the label container from inline-block to inline-flex with centered alignment
|
||||
- remove icon-specific vertical transform in favor of layout-based alignment
|
||||
|
||||
## 2026-04-12 - 3.73.0 - feat(dees-label)
|
||||
expand dees-label demo coverage and update supporting dependencies
|
||||
|
||||
- replace the minimal dees-label demo with a structured showcase for basic, required, description, combined, and empty-label states
|
||||
- add themed demo styling and inline annotations to better document component behavior
|
||||
- update @design.estate/dees-wcctools, lucide, and @types/node dependency versions
|
||||
|
||||
## 2026-04-12 - 3.72.1 - fix(dees-stepper)
|
||||
improve stepper exit animation timing for cancel confirmation flow
|
||||
|
||||
- Animate step tiles downward with fade-out during teardown instead of only fading the container
|
||||
- Delay stepper destruction briefly after dismissing the confirmation modal so both exit transitions render smoothly
|
||||
- Increase teardown delay to match the updated exit animation duration
|
||||
|
||||
## 2026-04-11 - 3.72.0 - feat(dees-stepper)
|
||||
add configurable cancellation flow with confirmation modal
|
||||
|
||||
- adds a cancelable option to control whether steppers can be dismissed
|
||||
- shows a confirmation modal when canceling via the new Cancel button or overlay backdrop
|
||||
- updates footer button rendering and separators to support the new cancel action consistently
|
||||
|
||||
## 2026-04-11 - 3.71.1 - fix(dees-modal)
|
||||
move modal content scrolling into dees-tile so long content stays scrollable with pinned header and actions
|
||||
|
||||
- Update dees-tile content area to use vertical scrolling when constrained by a max-height while keeping horizontal overflow clipped.
|
||||
- Remove duplicate scrolling styles from dees-modal and rely on the shared tile container behavior.
|
||||
- Add modal demo cases for long article, list, and form content to verify internal scrolling.
|
||||
|
||||
## 2026-04-11 - 3.71.0 - feat(dees-stepper)
|
||||
add footer menu actions with form-aware step validation
|
||||
|
||||
- replace step footer submit handling with configurable menuOptions actions
|
||||
- disable the primary footer action until required form fields are completed and show a completion hint
|
||||
- dispatch form data before running primary step actions and clean up form subscriptions on destroy
|
||||
- adjust overlay host positioning so the stepper container controls viewport layering correctly
|
||||
|
||||
## 2026-04-11 - 3.70.1 - fix(dees-modal)
|
||||
use icon font sizing for modal header buttons
|
||||
|
||||
- replace fixed width and height on header button icons with font-size to align dees-icon rendering
|
||||
|
||||
## 2026-04-08 - 3.70.0 - feat(dees-table)
|
||||
add opt-in flash highlighting for updated table cells
|
||||
|
||||
- introduces highlight-updates and highlight-duration properties for diff-based cell update highlighting
|
||||
- adds a warning banner when flash highlighting is enabled without rowKey
|
||||
- keeps selection stable across data refreshes and avoids flashing user-edited cells
|
||||
- includes a live demo showcasing flashing updates and reduced-motion support
|
||||
|
||||
## 2026-04-08 - 3.69.1 - fix(ui)
|
||||
refine heading emphasis and animate app dashboard subview expansion
|
||||
|
||||
- Adjust heading color hierarchy so h1-h2 use primary text while h3-h6 use secondary text, and reduce h1 font weight for better visual balance
|
||||
- Replace app dashboard subview conditional rendering with animated expand/collapse behavior using grid transitions and inert state handling
|
||||
|
||||
## 2026-04-08 - 3.69.0 - feat(dees-heading)
|
||||
add numeric aliases for horizontal rule heading levels and refine heading spacing styles
|
||||
|
||||
- Support level="7" as an alias for "hr" and level="8" as an alias for "hr-small".
|
||||
- Update heading and hr variant styles to use design tokens for spacing and colors, with per-level margin tuning.
|
||||
- Extend the demo to show both named and numeric hr heading level variants.
|
||||
|
||||
## 2026-04-08 - 3.68.0 - feat(dees-simple-appdash)
|
||||
add nested sidebar subviews and preserve submit labels from slotted text
|
||||
|
||||
- support grouped navigation items with expandable subviews and parent-to-first-subview fallback in the app dashboard
|
||||
- allow dees-form-submit to derive its button text from light DOM content when no explicit text property is set
|
||||
|
||||
## 2026-04-07 - 3.67.1 - fix(repo)
|
||||
no changes to commit
|
||||
|
||||
|
||||
## 2026-04-07 - 3.67.0 - feat(dees-table)
|
||||
improve inline cell editors with integrated input styling and auto-open dropdowns
|
||||
|
||||
- add a visually integrated mode to dees-input-text and dees-input-dropdown for table cell editing
|
||||
- auto-open dropdown editors when a table cell enters edit mode
|
||||
- refine table editing cell outline and dropdown value matching for inline editors
|
||||
|
||||
## 2026-04-07 - 3.66.0 - feat(dees-table)
|
||||
add virtualized row rendering for large tables and optimize table rendering performance
|
||||
|
||||
- add a virtualized mode with configurable overscan to render only visible rows while preserving scroll height
|
||||
- improve table render performance with memoized column and view-data computation plus deferred floating header rendering
|
||||
- update the dees-table demo to showcase virtualized scrolling in the fixed-height example
|
||||
|
||||
## 2026-04-07 - 3.65.0 - feat(dees-table)
|
||||
add schema-based in-cell editing with keyboard navigation and cell edit events
|
||||
|
||||
- replace editableFields with per-column editor configuration for text, number, checkbox, dropdown, date, and tags inputs
|
||||
- add focused/editing cell state with arrow key navigation plus Enter, Tab, Shift+Tab, F2, and Escape editing controls
|
||||
- dispatch cellEdit and cellEditError events with typed payloads and support column-level format, parse, validate, and editorOptions hooks
|
||||
- update table styles and demos to reflect editable cell behavior and rename sticky header usage to fixedHeight
|
||||
|
||||
## 2026-04-07 - 3.64.0 - feat(dees-table)
|
||||
add file-manager style row selection and JSON copy support
|
||||
|
||||
- adds optional selection checkbox rendering via the show-selection-checkbox property
|
||||
- supports plain, ctrl/cmd, and shift-click row selection with range selection behavior
|
||||
- adds Ctrl/Cmd+C and context menu actions to copy selected rows as formatted JSON
|
||||
- updates row selection styling to prevent native text selection during range selection
|
||||
|
||||
## 2026-04-07 - 3.63.0 - feat(dees-table)
|
||||
add floating header support with fixed-height table mode
|
||||
|
||||
- replace the sticky-header option with a fixed-height mode for internal scrolling
|
||||
- add a JS-managed floating header so column headers remain visible when tables scroll inside ancestor containers
|
||||
- sync floating header column widths and filter rows with the rendered table
|
||||
|
||||
## 2026-04-07 - 3.62.0 - feat(dees-table)
|
||||
add multi-column sorting with header menu controls and priority indicators
|
||||
|
||||
- replace single-column sort state with ordered sort descriptors for cascading client-side sorting
|
||||
- add Shift+click header sorting, context menu actions, and confirmation before replacing an active sort cascade
|
||||
- show multi-sort direction and priority badges in table headers and add a demo showcasing the new behavior
|
||||
|
||||
## 2026-04-06 - 3.61.2 - fix(dees-input-list,dees-icon)
|
||||
preserve input focus after list updates and make icons ignore pointer events
|
||||
|
||||
- Delays refocusing the add input in dees-input-list until after Lit re-renders complete when adding or removing entries.
|
||||
- Adds pointer-events: none to dees-icon so icons do not block click interactions on surrounding controls.
|
||||
|
||||
## 2026-04-05 - 3.61.1 - fix(dees-input-list)
|
||||
align list input with dees-tile styling and improve item affordances
|
||||
|
||||
- wrap the list in dees-tile with a dynamic item count heading and move the add-item controls into the tile footer
|
||||
- replace custom container styling with shared tile and theme tokens for hover, focus, row, and disabled states
|
||||
- show a bullet icon for non-sortable or disabled items when no candidate state icon is present
|
||||
|
||||
## 2026-04-05 - 3.61.0 - feat(dees-input-list)
|
||||
allow freeform entries alongside candidate suggestions in dees-input-list
|
||||
|
||||
- adds an allowFreeform option so Enter can add values that do not exactly match the candidate list
|
||||
- shows check and question-mark indicators to distinguish known candidates from custom freeform items
|
||||
- updates the component demo with a freeform-plus-candidates example
|
||||
|
||||
## 2026-04-05 - 3.60.0 - feat(dees-input-list)
|
||||
add candidate autocomplete with tab completion and payload retrieval
|
||||
|
||||
- Adds terminal-style inline autocomplete with ghost text, Tab accept, Shift+Tab cycling, and Escape clearing for candidate-based input.
|
||||
- Introduces candidate payload support with APIs to retrieve selected candidate objects after items are added.
|
||||
- Updates the dees-input-list demo with candidate selection examples for team members and technology stacks.
|
||||
|
||||
## 2026-04-05 - 3.59.1 - fix(project)
|
||||
no changes to commit
|
||||
|
||||
|
||||
## 2026-04-05 - 3.59.0 - feat(input)
|
||||
extract datepicker popup into a window-layer overlay and enhance the code editor modal status UI
|
||||
|
||||
- move the datepicker calendar, time, timezone, and event rendering into a dedicated popup component exported from the input module
|
||||
- render the datepicker popup in a window-layer overlay with reposition and cleanup handling for scroll, resize, and close events
|
||||
- preserve timezone-aware value formatting for selected dates
|
||||
- add a footer to the code editor modal showing cursor position, line count, and selected language
|
||||
- apply modal-specific Monaco background themes that react to light and dark mode
|
||||
|
||||
## 2026-04-05 - 3.58.0 - feat(dees-input-code)
|
||||
add editor status footer with cursor position, line count, and language display
|
||||
|
||||
- Tracks and displays the current cursor line and column in the code editor footer
|
||||
- Shows dynamic line count updates as editor content changes
|
||||
- Aligns the Monaco editor background with the surrounding tile theme, including light and dark mode updates
|
||||
|
||||
## 2026-04-05 - 3.57.0 - feat(dees-input-fileupload)
|
||||
redesign the file upload dropzone with dees-tile integration and themed file list styling
|
||||
|
||||
- Replace the custom dropzone container with dees-tile and move actions and metadata into header and footer slots
|
||||
- Add an explicit empty state for the file list and simplify file list layout and interaction handling
|
||||
- Adopt shared theme tokens in the file upload styles and introduce a reusable row hover color token
|
||||
|
||||
## 2026-04-04 - 3.56.1 - fix(dees-input-dropdown)
|
||||
improve dropdown popup lifecycle with window layer overlay and animated visibility transitions
|
||||
|
||||
- use a window layer to handle outside-click closing instead of document-level mousedown listeners
|
||||
- await popup show and search focus to keep popup initialization and overlay setup in sync
|
||||
- add guarded async hide logic with animated teardown and cleanup of scroll/resize listeners
|
||||
|
||||
## 2026-04-04 - 3.56.0 - feat(dees-input-dropdown)
|
||||
extract dropdown popup into a floating overlay component with search, keyboard navigation, and viewport repositioning
|
||||
|
||||
- adds a new dees-input-dropdown-popup export for rendering the menu as a fixed overlay attached to document.body
|
||||
- keeps the dropdown aligned to its trigger on scroll and resize, and closes it when the trigger moves off-screen
|
||||
- moves option filtering and keyboard selection handling into the popup component while preserving selection events
|
||||
|
||||
## 2026-04-04 - 3.55.6 - fix(dees-heading)
|
||||
adjust heading hr text color to use muted theme values
|
||||
|
||||
- Updates the dees-heading horizontal rule variant to use softer light and dark theme text colors instead of pure black and white.
|
||||
|
||||
## 2026-04-04 - 3.55.5 - fix(chart)
|
||||
refine ECharts series styling and legend color handling across bar, donut, and radar charts
|
||||
|
||||
- switch chart series palettes to hex colors and add rgba conversion to prevent black flashes during ECharts hover and emphasis animations
|
||||
- explicitly provide legend item colors and solid tooltip markers so translucent fills render consistently across chart types
|
||||
- deep-merge legend theme options in the shared ECharts base component to preserve nested legend text styling
|
||||
- adjust donut chart spacing and shared chart container styling for improved layout
|
||||
|
||||
## 2026-04-04 - 3.55.4 - fix(chart)
|
||||
align ECharts components with theme tokens and load the full ECharts ESM bundle
|
||||
|
||||
- replace hardcoded chart colors with centralized themeDefaults-based ECharts theme helpers across bar, donut, gauge, and radar components
|
||||
- improve donut label styling to use theme-aware text colors
|
||||
- switch CDN loading to the pre-built echarts.esm.min.js bundle so all chart types and components are available
|
||||
|
||||
## 2026-04-04 - 3.55.3 - fix(theme)
|
||||
align component styles with shared theme CSS variables
|
||||
|
||||
- replace hardcoded bdTheme color usages across chart, dataview, input, layout, modal, media, simple, and workspace components with shared --dees-* theme tokens
|
||||
- add themeDefaultStyles to components and style modules that were not yet inheriting the shared theme defaults
|
||||
- standardize hover, border, background, text, and scrollbar colors for more consistent theming across the catalog
|
||||
|
||||
## 2026-04-04 - 3.55.2 - fix(dees-simple-appdash,dees-simple-login)
|
||||
migrate app dashboard and login styles to shared theme CSS variables
|
||||
|
||||
|
||||
+6
-5
@@ -1,6 +1,6 @@
|
||||
{
|
||||
"name": "@design.estate/dees-catalog",
|
||||
"version": "3.55.2",
|
||||
"version": "3.80.0",
|
||||
"private": false,
|
||||
"description": "A comprehensive library that provides dynamic web components for building sophisticated and modern web applications using JavaScript and TypeScript.",
|
||||
"main": "dist_ts_web/index.js",
|
||||
@@ -18,7 +18,7 @@
|
||||
"dependencies": {
|
||||
"@design.estate/dees-domtools": "^2.5.4",
|
||||
"@design.estate/dees-element": "^2.2.4",
|
||||
"@design.estate/dees-wcctools": "^3.8.0",
|
||||
"@design.estate/dees-wcctools": "^3.9.0",
|
||||
"@fortawesome/fontawesome-svg-core": "^7.2.0",
|
||||
"@fortawesome/free-brands-svg-icons": "^7.2.0",
|
||||
"@fortawesome/free-regular-svg-icons": "^7.2.0",
|
||||
@@ -34,10 +34,11 @@
|
||||
"@tiptap/extension-underline": "^2.23.0",
|
||||
"@tiptap/starter-kit": "^2.23.0",
|
||||
"@tsclass/tsclass": "^9.5.0",
|
||||
"lightweight-charts": "^5.1.0",
|
||||
"echarts": "^5.6.0",
|
||||
"highlight.js": "11.11.1",
|
||||
"ibantools": "^4.5.1",
|
||||
"lucide": "^0.577.0",
|
||||
"lightweight-charts": "^5.1.0",
|
||||
"lucide": "^1.8.0",
|
||||
"monaco-editor": "0.55.1",
|
||||
"pdfjs-dist": "^4.10.38",
|
||||
"xterm": "^5.3.0",
|
||||
@@ -49,7 +50,7 @@
|
||||
"@git.zone/tstest": "^3.6.3",
|
||||
"@git.zone/tswatch": "^3.3.2",
|
||||
"@push.rocks/projectinfo": "^5.1.0",
|
||||
"@types/node": "^25.5.0"
|
||||
"@types/node": "^25.6.0"
|
||||
},
|
||||
"files": [
|
||||
"ts/**/*",
|
||||
|
||||
Generated
+79
-30
@@ -15,8 +15,8 @@ importers:
|
||||
specifier: ^2.2.4
|
||||
version: 2.2.4
|
||||
'@design.estate/dees-wcctools':
|
||||
specifier: ^3.8.0
|
||||
version: 3.8.0
|
||||
specifier: ^3.9.0
|
||||
version: 3.9.0
|
||||
'@fortawesome/fontawesome-svg-core':
|
||||
specifier: ^7.2.0
|
||||
version: 7.2.0
|
||||
@@ -62,6 +62,9 @@ importers:
|
||||
'@tsclass/tsclass':
|
||||
specifier: ^9.5.0
|
||||
version: 9.5.0
|
||||
echarts:
|
||||
specifier: ^5.6.0
|
||||
version: 5.6.0
|
||||
highlight.js:
|
||||
specifier: 11.11.1
|
||||
version: 11.11.1
|
||||
@@ -72,8 +75,8 @@ importers:
|
||||
specifier: ^5.1.0
|
||||
version: 5.1.0
|
||||
lucide:
|
||||
specifier: ^0.577.0
|
||||
version: 0.577.0
|
||||
specifier: ^1.8.0
|
||||
version: 1.8.0
|
||||
monaco-editor:
|
||||
specifier: 0.55.1
|
||||
version: 0.55.1
|
||||
@@ -103,8 +106,8 @@ importers:
|
||||
specifier: ^5.1.0
|
||||
version: 5.1.0
|
||||
'@types/node':
|
||||
specifier: ^25.5.0
|
||||
version: 25.5.0
|
||||
specifier: ^25.6.0
|
||||
version: 25.6.0
|
||||
|
||||
packages:
|
||||
|
||||
@@ -320,8 +323,8 @@ packages:
|
||||
'@design.estate/dees-element@2.2.4':
|
||||
resolution: {integrity: sha512-O9cA6flBMMd+pBwMQrZXwAWel9yVxgokolb+Em6gvkXxPJ0P/B5UDn4Vc2d4ts3ta55PTBm+l2dPeDVGx/bl7Q==}
|
||||
|
||||
'@design.estate/dees-wcctools@3.8.0':
|
||||
resolution: {integrity: sha512-CC14iVKUrguzD9jIrdPBd9fZ4egVJEZMxl5y8iy0l7WLumeoYvGsoXj5INVkRPLRVLqziIdi4Je1hXqHt2NU+g==}
|
||||
'@design.estate/dees-wcctools@3.9.0':
|
||||
resolution: {integrity: sha512-0vZBaGBEGIbl8hx+8BezIIea3U5T7iSHHF9VqlJZGf+nOFIW4zBAxcCljH8YzZ1Yayp6BEjxp/pQXjHN2YB3Jg==}
|
||||
|
||||
'@emnapi/core@1.8.1':
|
||||
resolution: {integrity: sha512-AvT9QFpxK0Zd8J0jopedNm+w/2fIzvtPKPjqyw9jwvBaReTTqPBk9Hixaz7KbjimP+QNz605/XnjFcDAL2pqBg==}
|
||||
@@ -2067,6 +2070,12 @@ packages:
|
||||
'@types/debug@4.1.12':
|
||||
resolution: {integrity: sha512-vIChWdVG3LG1SMxEvI/AK+FWJthlrqlTu7fbrlywTkkaONwk/UAGaULXRlf8vkzFBLVm0zkMdCquhL5aOjhXPQ==}
|
||||
|
||||
'@types/dom-mediacapture-transform@0.1.11':
|
||||
resolution: {integrity: sha512-Y2p+nGf1bF2XMttBnsVPHUWzRRZzqUoJAKmiP10b5umnO6DDrWI0BrGDJy1pOHoOULVmGSfFNkQrAlC5dcj6nQ==}
|
||||
|
||||
'@types/dom-webcodecs@0.1.13':
|
||||
resolution: {integrity: sha512-O5hkiFIcjjszPIYyUSyvScyvrBoV3NOEEZx/pMlsu44TKzWNkLVBBxnxJz42in5n3QIolYOcBYFCPZZ0h8SkwQ==}
|
||||
|
||||
'@types/fs-extra@11.0.4':
|
||||
resolution: {integrity: sha512-yTbItCNreRooED33qjunPthRcSjERP1r4MqCZc7wv0u2sUkzTFp45tgUfS5+r7FrZPdmCCNflLhVSP/o+SemsQ==}
|
||||
|
||||
@@ -2118,11 +2127,11 @@ packages:
|
||||
'@types/node@16.9.1':
|
||||
resolution: {integrity: sha512-QpLcX9ZSsq3YYUUnD3nFDY8H7wctAhQj/TFKL8Ya8v5fMm3CFXxo8zStsLAl780ltoYoo1WvKUVGBQK+1ifr7g==}
|
||||
|
||||
'@types/node@22.19.15':
|
||||
resolution: {integrity: sha512-F0R/h2+dsy5wJAUe3tAU6oqa2qbWY5TpNfL/RGmo1y38hiyO1w3x2jPtt76wmuaJI4DQnOBu21cNXQ2STIUUWg==}
|
||||
'@types/node@22.19.17':
|
||||
resolution: {integrity: sha512-wGdMcf+vPYM6jikpS/qhg6WiqSV/OhG+jeeHT/KlVqxYfD40iYJf9/AE1uQxVWFvU7MipKRkRv8NSHiCGgPr8Q==}
|
||||
|
||||
'@types/node@25.5.0':
|
||||
resolution: {integrity: sha512-jp2P3tQMSxWugkCUKLRPVUpGaL5MVFwF8RDuSRztfwgN1wmqJeMSbKlnEtQqU8UrhTmzEmZdu2I6v2dpp7XIxw==}
|
||||
'@types/node@25.6.0':
|
||||
resolution: {integrity: sha512-+qIYRKdNYJwY3vRCZMdJbPLJAtGjQBudzZzdzwQYkEPQd+PJGixUL5QfvCLDaULoLv+RhT3LDkwEfKaAkgSmNQ==}
|
||||
|
||||
'@types/randomatic@3.1.5':
|
||||
resolution: {integrity: sha512-VCwCTw6qh1pRRw+5rNTAwqPmf6A+hdrkdM7dBpZVmhl7g+em3ONXlYK/bWPVKqVGMWgP0d1bog8Vc/X6zRwRRQ==}
|
||||
@@ -2534,6 +2543,9 @@ packages:
|
||||
resolution: {integrity: sha512-KIN/nDJBQRcXw0MLVhZE9iQHmG68qAVIBg9CqmUYjmQIhgij9U5MFvrqkUL5FbtyyzZuOeOt0zdeRe4UY7ct+A==}
|
||||
engines: {node: '>= 0.4'}
|
||||
|
||||
echarts@5.6.0:
|
||||
resolution: {integrity: sha512-oTbVTsXfKuEhxftHqL5xprgLoc0k7uScAwtryCgWF6hPYFLRwOUHiFmHGCBKP5NPFNkDVopOieyUqYGH8Fa3kA==}
|
||||
|
||||
emoji-regex@8.0.0:
|
||||
resolution: {integrity: sha512-MSjYzcWNOA0ewAHpz0MxpYFvwg6yjy1NG3xteoqz644VCo/RPgnr1/GGt+ic3iJTzQ8Eu3TdM14SawnVUmGE6A==}
|
||||
|
||||
@@ -3048,6 +3060,9 @@ packages:
|
||||
lucide@0.577.0:
|
||||
resolution: {integrity: sha512-PpC/m5eOItp/WU/GlQPFBXDOhq6HibL73KzYP37OX3LM7VmzWQF8voEj8QRWUFvy9FIKfeDQkWYoyS1D/MdWFA==}
|
||||
|
||||
lucide@1.8.0:
|
||||
resolution: {integrity: sha512-JjV/QnadgFLj1Pyu9IKl0lknrolFEzo04B64QcYLLeRzZl/iEHpdbSrRRKbyXcv45SZNv+WGjIUCT33e7xHO6Q==}
|
||||
|
||||
make-dir@3.1.0:
|
||||
resolution: {integrity: sha512-g3FeP20LNwhALb/6Cz6Dd4F2ngze0jz7tbzrD2wAV+o9FeNHe4rL+yK2md0J/fiSf1sa1ADhXqi5+oVwOM/eGw==}
|
||||
engines: {node: '>=8'}
|
||||
@@ -3127,6 +3142,9 @@ packages:
|
||||
mdurl@2.0.0:
|
||||
resolution: {integrity: sha512-Lf+9+2r+Tdp5wXDXC4PcIBjTDtq4UKjCPMQhKIuzpJNW0b96kVqSwW0bT7FhRSfmAiFYgP+SCRvdrDozfh0U5w==}
|
||||
|
||||
mediabunny@1.40.1:
|
||||
resolution: {integrity: sha512-HU/stGzAkdWaJIly6ypbUVgAUvT9kt39DIg0IaErR7/1fwtTmgUYs4i8uEPYcgcjPjbB9gtBmUXOLnXi6J2LDw==}
|
||||
|
||||
memory-pager@1.5.0:
|
||||
resolution: {integrity: sha512-ZS4Bp4r/Zoeq6+NLJpP+0Zzm0pR8whtGPf1XExKLJBAczGMnSi3It14OiNCStjQjM6NU1okjQGSxgEZN8eBYKg==}
|
||||
|
||||
@@ -3936,6 +3954,9 @@ packages:
|
||||
tslib@1.14.1:
|
||||
resolution: {integrity: sha512-Xni35NKzjgMrwevysHTCArtLDpPvye8zV/0E4EyYn43P7/7qvQwPh9BGkHewbMulVntbigmcT7rdX3BNo9wRJg==}
|
||||
|
||||
tslib@2.3.0:
|
||||
resolution: {integrity: sha512-N82ooyxVNm6h1riLCoyS9e3fuJ3AMG2zIZs2Gd1ATcSFjSA23Q0fzjjZeh0jbJvWVDZ0cJT8yaNNaaXHzueNjg==}
|
||||
|
||||
tslib@2.8.1:
|
||||
resolution: {integrity: sha512-oJFu94HQb+KVduSUQL7wnpmqnfmLsOA/nAh6b6EH0wCEoK0/mPeXU6c3wKDV83MkOuHPRHtSXKKU99IBazS/2w==}
|
||||
|
||||
@@ -3993,8 +4014,8 @@ packages:
|
||||
undici-types@6.21.0:
|
||||
resolution: {integrity: sha512-iwDZqg0QAGrg9Rav5H4n0M64c3mkR59cJ6wQp+7C4nI0gsmExaedaYLNO44eT4AtBBwjbTiGPMlt2Md0T9H9JQ==}
|
||||
|
||||
undici-types@7.18.2:
|
||||
resolution: {integrity: sha512-AsuCzffGHJybSaRrmr5eHr81mwJU3kjw6M+uprWvCXiNeN9SOGwQ3Jn8jb8m3Z6izVgknn1R0FTCEAP2QrLY/w==}
|
||||
undici-types@7.19.2:
|
||||
resolution: {integrity: sha512-qYVnV5OEm2AW8cJMCpdV20CDyaN3g0AjDlOGf1OW4iaDEx8MwdtChUp4zu4H0VP3nDRF/8RKWH+IPp9uW0YGZg==}
|
||||
|
||||
unified@11.0.5:
|
||||
resolution: {integrity: sha512-xKvGhPWw3k84Qjh8bI3ZeJjqnyadK+GEFtazSfZv/rKeTkTjOJho6mFqh2SM96iIcZokxiOpg78GazTSg8+KHA==}
|
||||
@@ -4149,6 +4170,9 @@ packages:
|
||||
zod@3.25.76:
|
||||
resolution: {integrity: sha512-gzUt/qt81nXsFGKIFcC3YnfEAx5NkunCfnDlvuBSSFS02bcXu4Lmea0AFIUwbLWxWPx3d9p8S5QoaujKcNQxcQ==}
|
||||
|
||||
zrender@5.6.1:
|
||||
resolution: {integrity: sha512-OFXkDJKcrlx5su2XbzJvj/34Q3m6PvyCZkVPHGYpcCJ52ek4U/ymZyfuV1nKE23AyBJ51E/6Yr0mhZ7xGTO4ag==}
|
||||
|
||||
zwitch@2.0.4:
|
||||
resolution: {integrity: sha512-bXE4cR/kVZhKZX/RjPEflHaKVhUVl85noU3v6b8apfQEc1x4A+zBxjZ4lN8LqGd6WZ3dl98pY4o717VFmoPp+A==}
|
||||
|
||||
@@ -4696,7 +4720,7 @@ snapshots:
|
||||
dependencies:
|
||||
'@design.estate/dees-domtools': 2.5.4
|
||||
'@design.estate/dees-element': 2.2.4
|
||||
'@design.estate/dees-wcctools': 3.8.0
|
||||
'@design.estate/dees-wcctools': 3.9.0
|
||||
'@fortawesome/fontawesome-svg-core': 7.2.0
|
||||
'@fortawesome/free-brands-svg-icons': 7.2.0
|
||||
'@fortawesome/free-regular-svg-icons': 7.2.0
|
||||
@@ -4772,12 +4796,13 @@ snapshots:
|
||||
- supports-color
|
||||
- vue
|
||||
|
||||
'@design.estate/dees-wcctools@3.8.0':
|
||||
'@design.estate/dees-wcctools@3.9.0':
|
||||
dependencies:
|
||||
'@design.estate/dees-domtools': 2.5.4
|
||||
'@design.estate/dees-element': 2.2.4
|
||||
'@push.rocks/smartdelay': 3.0.5
|
||||
lit: 3.3.2
|
||||
mediabunny: 1.40.1
|
||||
transitivePeerDependencies:
|
||||
- '@nuxt/kit'
|
||||
- react
|
||||
@@ -5245,7 +5270,7 @@ snapshots:
|
||||
'@inquirer/figures': 1.0.15
|
||||
'@inquirer/type': 2.0.0
|
||||
'@types/mute-stream': 0.0.4
|
||||
'@types/node': 22.19.15
|
||||
'@types/node': 22.19.17
|
||||
'@types/wrap-ansi': 3.0.0
|
||||
ansi-escapes: 4.3.2
|
||||
cli-width: 4.1.0
|
||||
@@ -7223,17 +7248,23 @@ snapshots:
|
||||
|
||||
'@types/clean-css@4.2.11':
|
||||
dependencies:
|
||||
'@types/node': 25.5.0
|
||||
'@types/node': 25.6.0
|
||||
source-map: 0.6.1
|
||||
|
||||
'@types/debug@4.1.12':
|
||||
dependencies:
|
||||
'@types/ms': 2.1.0
|
||||
|
||||
'@types/dom-mediacapture-transform@0.1.11':
|
||||
dependencies:
|
||||
'@types/dom-webcodecs': 0.1.13
|
||||
|
||||
'@types/dom-webcodecs@0.1.13': {}
|
||||
|
||||
'@types/fs-extra@11.0.4':
|
||||
dependencies:
|
||||
'@types/jsonfile': 6.1.4
|
||||
'@types/node': 25.5.0
|
||||
'@types/node': 25.6.0
|
||||
|
||||
'@types/hast@3.0.4':
|
||||
dependencies:
|
||||
@@ -7253,7 +7284,7 @@ snapshots:
|
||||
|
||||
'@types/jsonfile@6.1.4':
|
||||
dependencies:
|
||||
'@types/node': 25.5.0
|
||||
'@types/node': 25.6.0
|
||||
|
||||
'@types/linkify-it@5.0.0': {}
|
||||
|
||||
@@ -7276,21 +7307,21 @@ snapshots:
|
||||
|
||||
'@types/mute-stream@0.0.4':
|
||||
dependencies:
|
||||
'@types/node': 25.5.0
|
||||
'@types/node': 25.6.0
|
||||
|
||||
'@types/node-forge@1.3.14':
|
||||
dependencies:
|
||||
'@types/node': 25.5.0
|
||||
'@types/node': 25.6.0
|
||||
|
||||
'@types/node@16.9.1': {}
|
||||
|
||||
'@types/node@22.19.15':
|
||||
'@types/node@22.19.17':
|
||||
dependencies:
|
||||
undici-types: 6.21.0
|
||||
|
||||
'@types/node@25.5.0':
|
||||
'@types/node@25.6.0':
|
||||
dependencies:
|
||||
undici-types: 7.18.2
|
||||
undici-types: 7.19.2
|
||||
|
||||
'@types/randomatic@3.1.5': {}
|
||||
|
||||
@@ -7302,11 +7333,11 @@ snapshots:
|
||||
|
||||
'@types/tar-stream@3.1.4':
|
||||
dependencies:
|
||||
'@types/node': 25.5.0
|
||||
'@types/node': 25.6.0
|
||||
|
||||
'@types/through2@2.0.41':
|
||||
dependencies:
|
||||
'@types/node': 25.5.0
|
||||
'@types/node': 25.6.0
|
||||
|
||||
'@types/trusted-types@2.0.7': {}
|
||||
|
||||
@@ -7332,11 +7363,11 @@ snapshots:
|
||||
|
||||
'@types/ws@8.18.1':
|
||||
dependencies:
|
||||
'@types/node': 25.5.0
|
||||
'@types/node': 25.6.0
|
||||
|
||||
'@types/yauzl@2.10.3':
|
||||
dependencies:
|
||||
'@types/node': 25.5.0
|
||||
'@types/node': 25.6.0
|
||||
optional: true
|
||||
|
||||
'@ungap/structured-clone@1.3.0': {}
|
||||
@@ -7671,6 +7702,11 @@ snapshots:
|
||||
es-errors: 1.3.0
|
||||
gopd: 1.2.0
|
||||
|
||||
echarts@5.6.0:
|
||||
dependencies:
|
||||
tslib: 2.3.0
|
||||
zrender: 5.6.1
|
||||
|
||||
emoji-regex@8.0.0: {}
|
||||
|
||||
end-of-stream@1.4.5:
|
||||
@@ -8283,6 +8319,8 @@ snapshots:
|
||||
|
||||
lucide@0.577.0: {}
|
||||
|
||||
lucide@1.8.0: {}
|
||||
|
||||
make-dir@3.1.0:
|
||||
dependencies:
|
||||
semver: 6.3.1
|
||||
@@ -8446,6 +8484,11 @@ snapshots:
|
||||
|
||||
mdurl@2.0.0: {}
|
||||
|
||||
mediabunny@1.40.1:
|
||||
dependencies:
|
||||
'@types/dom-mediacapture-transform': 0.1.11
|
||||
'@types/dom-webcodecs': 0.1.13
|
||||
|
||||
memory-pager@1.5.0: {}
|
||||
|
||||
micromark-core-commonmark@2.0.3:
|
||||
@@ -9510,6 +9553,8 @@ snapshots:
|
||||
|
||||
tslib@1.14.1: {}
|
||||
|
||||
tslib@2.3.0: {}
|
||||
|
||||
tslib@2.8.1: {}
|
||||
|
||||
tsx@4.21.0:
|
||||
@@ -9551,7 +9596,7 @@ snapshots:
|
||||
|
||||
undici-types@6.21.0: {}
|
||||
|
||||
undici-types@7.18.2: {}
|
||||
undici-types@7.19.2: {}
|
||||
|
||||
unified@11.0.5:
|
||||
dependencies:
|
||||
@@ -9699,4 +9744,8 @@ snapshots:
|
||||
|
||||
zod@3.25.76: {}
|
||||
|
||||
zrender@5.6.1:
|
||||
dependencies:
|
||||
tslib: 2.3.0
|
||||
|
||||
zwitch@2.0.4: {}
|
||||
|
||||
@@ -59,8 +59,8 @@ For developers working on this library, please refer to the [UI Components Playb
|
||||
| **Forms** | [`DeesForm`](#deesform), [`DeesInputText`](#deesinputtext), [`DeesInputCheckbox`](#deesinputcheckbox), [`DeesInputDropdown`](#deesinputdropdown), [`DeesInputRadiogroup`](#deesinputradiogroup), [`DeesInputFileupload`](#deesinputfileupload), [`DeesInputIban`](#deesinputiban), [`DeesInputPhone`](#deesinputphone), [`DeesInputQuantitySelector`](#deesinputquantityselector), [`DeesInputMultitoggle`](#deesinputmultitoggle), [`DeesInputToggle`](#deesinputtoggle), [`DeesInputTags`](#deesinputtags), [`DeesInputTypelist`](#deesinputtypelist), [`DeesInputList`](#deesinputlist), [`DeesInputProfilepicture`](#deesinputprofilepicture), [`DeesInputRichtext`](#deesinputrichtext), [`DeesInputWysiwyg`](#deesinputwysiwyg), [`DeesInputDatepicker`](#deesinputdatepicker), [`DeesInputSearchselect`](#deesinputsearchselect), [`DeesInputCode`](#deesinputcode), [`DeesFormSubmit`](#deesformsubmit) |
|
||||
| **App Shell (Layout)** | [`DeesAppui`](#deesappui-️), [`DeesAppuiMainmenu`](#deesappuimainmenu), [`DeesAppuiSecondarymenu`](#deesappuisecondarymenu), [`DeesAppuiMaincontent`](#deesappuimaincontent), [`DeesAppuiAppbar`](#deesappuiappbar), [`DeesAppuiActivitylog`](#deesappuiactivitylog), [`DeesAppuiBottombar`](#deesappuibottombar), [`DeesAppuiProfiledropdown`](#deesappuiprofiledropdown), [`DeesAppuiTabs`](#deesappuitabs), [`DeesMobileNavigation`](#deesmobilenavigation), [`DeesDashboardGrid`](#deesdashboardgrid) |
|
||||
| **Data Display** | [`DeesTable`](#deestable), [`DeesDataviewCodebox`](#deesdataviewcodebox), [`DeesDataviewStatusobject`](#deesdataviewstatusobject), [`DeesPdf`](#deespdf), [`DeesStatsGrid`](#deesstatsgrid), [`DeesPagination`](#deespagination), [`DeesStorageBrowser`](#deesstorgebrowser) |
|
||||
| **Media & Tiles** | [`DeesTilePdf`](#deestilepdf), [`DeesTileImage`](#deestileimage), [`DeesTileAudio`](#deestileaudio), [`DeesTileVideo`](#deestilevideo), [`DeesTileNote`](#deestilenote), [`DeesTileFolder`](#deestilefolder), [`DeesPreview`](#deespreview), [`DeesPdfViewer`](#deespdfviewer), [`DeesPdfPreview`](#deespdfpreview), [`DeesImageViewer`](#deesimageviewer), [`DeesAudioViewer`](#deesaudioviewer), [`DeesVideoViewer`](#deesvideoviewer) |
|
||||
| **Visualization** | [`DeesChartArea`](#deeschartarea), [`DeesChartLog`](#deeschartlog) |
|
||||
| **Media & Thumbnails** | [`DeesThumbnailPdf`](#deesthumbnailpdf), [`DeesThumbnailImage`](#deesthumbnailimage), [`DeesThumbnailAudio`](#deesthumbnailaudio), [`DeesThumbnailVideo`](#deesthumbnalvideo), [`DeesThumbnailNote`](#deesthumbnailnote), [`DeesThumbnailFolder`](#deesthumbnailfolder), [`DeesPreview`](#deespreview), [`DeesPdfViewer`](#deespdfviewer), [`DeesImageViewer`](#deesimageviewer), [`DeesAudioViewer`](#deesaudioviewer), [`DeesVideoViewer`](#deesvideoviewer) |
|
||||
| **Visualization** | [`DeesChartArea`](#deeschartarea), [`DeesChartBar`](#deeschartbar), [`DeesChartDonut`](#deeschartdonut), [`DeesChartGauge`](#deeschartgauge), [`DeesChartRadar`](#deeschartradar), [`DeesChartLog`](#deeschartlog) |
|
||||
| **Dialogs & Overlays** | [`DeesModal`](#deesmodal), [`DeesContextmenu`](#deescontextmenu), [`DeesSpeechbubble`](#deesspeechbubble), [`DeesWindowlayer`](#deeswindowlayer) |
|
||||
| **Navigation** | [`DeesStepper`](#deesstepper), [`DeesProgressbar`](#deesprogressbar) |
|
||||
| **Workspace / IDE** | [`DeesWorkspace`](#deesworkspace), [`DeesWorkspaceMonaco`](#deesworkspacemonaco), [`DeesWorkspaceDiffEditor`](#deesworkspacediffeditor), [`DeesWorkspaceFiletree`](#deesworkspacefiletree), [`DeesWorkspaceTerminal`](#deesworkspaceterminal), [`DeesWorkspaceTerminalPreview`](#deesworkspaceterminalpreview), [`DeesWorkspaceMarkdown`](#deesworkspacemarkdown), [`DeesWorkspaceMarkdownoutlet`](#deesworkspacemarkdownoutlet), [`DeesWorkspaceBottombar`](#deesworkspacebottombar) |
|
||||
@@ -143,14 +143,13 @@ Display icons from FontAwesome and Lucide icon libraries with library prefixes.
|
||||
```
|
||||
|
||||
#### `DeesLabel`
|
||||
Text label component with optional icon and status indicators.
|
||||
Text label component with optional required indicator and info tooltip. Used internally by all input components.
|
||||
|
||||
```typescript
|
||||
<dees-label
|
||||
text="Status" // Label text
|
||||
icon="info-circle" // Optional: icon name
|
||||
type="info" // Options: default, info, success, warning, error
|
||||
size="medium" // Options: small, medium, large
|
||||
.label=${'Email Address'} // Label text
|
||||
.required=${true} // Optional: shows red asterisk
|
||||
.infoText=${'We will never share your email'} // Optional: shows hover info icon with tooltip
|
||||
></dees-label>
|
||||
```
|
||||
|
||||
@@ -321,7 +320,7 @@ Container component for form elements with built-in validation and data handling
|
||||
```
|
||||
|
||||
#### `DeesInputText`
|
||||
Text input field with validation and formatting options.
|
||||
Text input field with validation, info tooltips, description text, and context menu (Cut/Copy/Paste/Select All).
|
||||
|
||||
```typescript
|
||||
<dees-input-text
|
||||
@@ -330,10 +329,20 @@ Text input field with validation and formatting options.
|
||||
value="initial@value.com" // Initial value
|
||||
required // Makes the field required
|
||||
disabled // Disables the input
|
||||
placeholder="Enter your email"
|
||||
.infoText=${'Hover icon tooltip text'} // Shows ⓘ icon on label with hover tooltip
|
||||
.description=${'Permanent help text below the input'} // Small text below the input
|
||||
.validationFunction=${(value) => { // Auto-validates on every keystroke
|
||||
const emailRegex = /^[^\s@]+@[^\s@]+\.[^\s@]+$/;
|
||||
if (emailRegex.test(value)) {
|
||||
return { valid: true, message: 'Email is valid' };
|
||||
}
|
||||
return { valid: false, message: 'Please enter a valid email' };
|
||||
}}
|
||||
></dees-input-text>
|
||||
```
|
||||
|
||||
> 💡 **All input components** share these common properties from `DeesInputBase`: `key`, `label`, `required`, `disabled`, `infoText`, `description`, `layoutMode`, `labelPosition`.
|
||||
|
||||
#### `DeesInputCheckbox`
|
||||
Checkbox input component for boolean values.
|
||||
|
||||
@@ -1499,31 +1508,56 @@ const layer = await DeesWindowLayer.createAndShow({
|
||||
### Navigation Components
|
||||
|
||||
#### `DeesStepper`
|
||||
Multi-step navigation component for guided user flows.
|
||||
Multi-step navigation component for guided user flows, including optional auto-advancing progress steps that can render `dees-progressbar` status output between form steps.
|
||||
|
||||
```typescript
|
||||
<dees-stepper
|
||||
.steps=${[
|
||||
{ key: 'personal', label: 'Personal Info', content: html`<div>Form 1</div>` },
|
||||
{ key: 'address', label: 'Address', content: html`<div>Form 2</div>` },
|
||||
{ key: 'confirm', label: 'Confirmation', content: html`<div>Review</div>` }
|
||||
{
|
||||
title: 'Account Setup',
|
||||
content: html`<dees-form>...</dees-form>`,
|
||||
menuOptions: [{ name: 'Continue', action: async (stepper) => stepper?.goNext() }]
|
||||
},
|
||||
{
|
||||
title: 'Provision Workspace',
|
||||
content: html`<p>Preparing your environment...</p>`,
|
||||
progressStep: {
|
||||
label: 'Workspace setup',
|
||||
indeterminate: true,
|
||||
statusRows: 4,
|
||||
terminalLines: ['Allocating workspace']
|
||||
},
|
||||
validationFunc: async (stepper, _element, signal) => {
|
||||
stepper.updateProgressStep({ percentage: 35, statusText: 'Installing dependencies...' });
|
||||
stepper.appendProgressStepLine('Installing dependencies');
|
||||
if (signal?.aborted) return;
|
||||
stepper.updateProgressStep({ percentage: 100, indeterminate: false, statusText: 'Workspace ready.' });
|
||||
}
|
||||
}
|
||||
]}
|
||||
currentStep="personal"
|
||||
@step-change=${handleStepChange}
|
||||
@complete=${handleComplete}
|
||||
></dees-stepper>
|
||||
```
|
||||
|
||||
#### `DeesProgressbar`
|
||||
Progress indicator component for tracking completion status.
|
||||
Progress indicator component for tracking completion status, with optional fixed-height status text or terminal-style recent activity output.
|
||||
|
||||
```typescript
|
||||
<dees-progressbar
|
||||
value={75}
|
||||
.percentage=${75}
|
||||
label="Uploading"
|
||||
showPercentage
|
||||
type="determinate" // Options: determinate, indeterminate
|
||||
status="normal" // Options: normal, success, warning, error
|
||||
statusText="Uploading thumbnails to edge cache..."
|
||||
.statusRows=${2}
|
||||
></dees-progressbar>
|
||||
|
||||
<dees-progressbar
|
||||
label="Installing dependencies"
|
||||
.indeterminate=${true}
|
||||
.statusRows=${4}
|
||||
.terminalLines=${[
|
||||
'Resolving workspace packages',
|
||||
'Downloading tarballs',
|
||||
'Linking local binaries'
|
||||
]}
|
||||
></dees-progressbar>
|
||||
```
|
||||
|
||||
@@ -1561,6 +1595,33 @@ Theme provider component that wraps children and provides CSS custom properties
|
||||
- Works with dark/light mode
|
||||
- Overrides cascade to all child components
|
||||
|
||||
#### `DeesUpdater`
|
||||
Updater controller that opens a non-cancelable `dees-stepper` flow with a progress step and a ready step.
|
||||
|
||||
```typescript
|
||||
const updater = await DeesUpdater.createAndShow({
|
||||
currentVersion: '3.79.0',
|
||||
updatedVersion: '3.80.0',
|
||||
moreInfoUrl: 'https://code.foss.global/design.estate/dees-catalog',
|
||||
changelogUrl: 'https://code.foss.global/design.estate/dees-catalog/-/blob/main/changelog.md',
|
||||
successAction: 'reload',
|
||||
successDelayMs: 10000,
|
||||
});
|
||||
|
||||
updater.updateProgress({
|
||||
percentage: 35,
|
||||
statusText: 'Downloading signed bundle...',
|
||||
terminalLines: ['Checking release manifest', 'Downloading signed bundle']
|
||||
});
|
||||
|
||||
updater.appendProgressLine('Verifying checksum');
|
||||
updater.updateProgress({ percentage: 72, statusText: 'Verifying checksum...' });
|
||||
|
||||
await updater.markUpdateReady();
|
||||
```
|
||||
|
||||
After `markUpdateReady()`, the updater switches to a second countdown step with a determinate progress bar and runs the configured success action when the timer reaches zero.
|
||||
|
||||
---
|
||||
|
||||
### Workspace / IDE Components 💻
|
||||
@@ -1780,7 +1841,7 @@ interface ITileFolderItem {
|
||||
|
||||
## License and Legal Information
|
||||
|
||||
This repository contains open-source code licensed under the MIT License. A copy of the license can be found in the [LICENSE](./license) file.
|
||||
This repository contains open-source code licensed under the MIT License. A copy of the license can be found in the [LICENSE](./LICENSE) file.
|
||||
|
||||
**Please note:** The MIT License does not grant permission to use the trade names, trademarks, service marks, or product names of the project, except as required for reasonable and customary use in describing the origin of the work and reproducing the content of the NOTICE file.
|
||||
|
||||
@@ -1798,5 +1859,3 @@ Registered at District Court Bremen HRB 35230 HB, Germany
|
||||
For any legal inquiries or further information, please contact us via email at hello@task.vc.
|
||||
|
||||
By using this repository, you acknowledge that you have read this section, agree to comply with its terms, and understand that the licensing of the code does not imply endorsement by Task Venture Capital GmbH of any derivative works.
|
||||
|
||||
By using this repository, you acknowledge that you have read this section, agree to comply with its terms, and understand that the licensing of the code does not imply endorsement by Task Venture Capital GmbH of any derivative works.
|
||||
|
||||
+352
@@ -0,0 +1,352 @@
|
||||
# Plan: dees-stepper — adopt dees-tile + optional overlay window layer
|
||||
|
||||
> First line (per CLAUDE.md): Please reread `/home/philkunz/.claude/CLAUDE.md` before continuing.
|
||||
|
||||
## Context
|
||||
|
||||
Today `dees-stepper` is an inline-only layout component: it hard-codes each step as a custom `.step` `<div>` with its own border / background / box-shadow / border-radius, and its `:host` is `position: absolute; width: 100%; height: 100%;` so it can only live inside a bounded parent container.
|
||||
|
||||
The user wants it to behave more like `dees-modal`:
|
||||
|
||||
1. Each step should be wrapped in a `<dees-tile>` — the unified "rounded on rounded" frame used by modals and panels — rather than a bespoke `.step` div.
|
||||
2. A `DeesWindowLayer` should be added behind the stepper, the same way `DeesModal.createAndShow` does, so the stepper can appear as an overlay on top of the page.
|
||||
|
||||
User has confirmed (via AskUserQuestion in this session):
|
||||
- **API**: keep the current inline usage working AND add a static `createAndShow()` like dees-modal.
|
||||
- **Layout**: keep the current vertical stack + SweetScroll behavior inside the overlay (don't switch to single-tile swap).
|
||||
- **Nav placement**: split header/footer — goBack + step counter go into the `dees-tile` header slot; the title stays in the content area; the tile footer is used for optional next/submit buttons supplied per-step.
|
||||
|
||||
No external consumers of `dees-stepper` were found inside this package (`grep dees-stepper|DeesStepper` only matches its own source, demo, index, changelog, readme). External consumers in dependent projects may exist — the refactor is kept backward-compatible for the inline path.
|
||||
|
||||
## Current state (reference)
|
||||
|
||||
**File:** `ts_web/elements/00group-layout/dees-stepper/dees-stepper.ts` (lines 20–299)
|
||||
|
||||
- `IStep` interface — `title`, `content: TemplateResult`, `validationFunc`, `onReturnToStepFunc`, internal flags (lines 20–27).
|
||||
- `:host { position: absolute; width: 100%; height: 100%; }` (lines 59–63).
|
||||
- `.stepperContainer` — absolute, 100% w/h, `overflow: hidden`, holds SweetScroll (lines 64–69).
|
||||
- `.step` — max-width 500, min-height 300, `border-radius: 12px`, theme background, theme border, `box-shadow: 0 8px 32px rgba(0,0,0,0.4)`, `filter: opacity(0.55) saturate(0.85)`, transform transition (lines 71–97). **These frame styles overlap with what `dees-tile` already provides.**
|
||||
- `.step.selected` — `filter: opacity(1) saturate(1)` (lines 89–93). **Scroll-through visual cue, keep.**
|
||||
- `.step.hiddenStep` — `filter: opacity(0)` (line 95). **Keep.**
|
||||
- `.step.entrance` — faster transition variant for first-render (lines 99–105). **Keep.**
|
||||
- `.step .stepCounter` — `position: absolute; top: 12px; right: 12px;` pill (lines 111–121). **Move into header slot as a flex child.**
|
||||
- `.step .goBack` — `position: absolute; top: 12px; left: 12px;` pill + icon + hover (lines 123–161). **Move into header slot as a flex child.**
|
||||
- `.step .title` — centered, 24px, 64px top padding (lines 163–171). **Keep inside the tile's content slot; remove the 64px top padding since goBack/counter no longer overlap it.**
|
||||
- `.step .content` — 32px padding (lines 173–175). **Keep.**
|
||||
- `render()` (lines 179–204) — maps `steps` to `.step` divs.
|
||||
- `setScrollStatus()` (lines 226–263) — SweetScroll container setup + step validation kick-off. **Keep mostly as-is; selectors still target `.step`/`.selected` so rename cautiously.**
|
||||
- `firstUpdated` (lines 210–218), `updated` (lines 220–222), `goBack` (lines 265–282), `goNext` (lines 284–298) — untouched in behavior, only DOM selectors may need adjusting.
|
||||
|
||||
**Reference files (read, do not modify):**
|
||||
- `ts_web/elements/00group-overlay/dees-modal/dees-modal.ts` — canonical `createAndShow` + `destroy` + window-layer coordination + z-index registry usage.
|
||||
- `ts_web/elements/00group-layout/dees-tile/dees-tile.ts` — slot API: `slot="header"`, default slot, `slot="footer"`. Auto-hides footer when slotted nodes are empty. Uses `part="outer"`, `part="header"`, `part="content"`, `part="footer"` for external shadow-part styling.
|
||||
- `ts_web/elements/00group-overlay/dees-windowlayer/dees-windowlayer.ts` — `createAndShow({ blur })`, `destroy()`, dispatches `clicked` event on backdrop click, uses `zIndexRegistry`.
|
||||
- `ts_web/elements/00group-layout/dees-stepper/dees-stepper.demo.ts` — existing inline demo.
|
||||
|
||||
## Target state
|
||||
|
||||
### 1. IStep interface — add one optional field
|
||||
|
||||
```ts
|
||||
export interface IStep {
|
||||
title: string;
|
||||
content: TemplateResult;
|
||||
footerContent?: TemplateResult; // NEW: optional, rendered in dees-tile footer slot
|
||||
validationFunc?: (stepper: DeesStepper, htmlElement: HTMLElement, signal?: AbortSignal) => Promise<any>;
|
||||
onReturnToStepFunc?: (stepper: DeesStepper, htmlElement: HTMLElement) => Promise<any>;
|
||||
validationFuncCalled?: boolean;
|
||||
abortController?: AbortController;
|
||||
}
|
||||
```
|
||||
|
||||
Form-based steps don't need `footerContent` — their `dees-form-submit` stays inside the form in the content slot (as today). `footerContent` is for non-form steps that need an explicit primary action, or for any step that wants buttons in the conventional tile footer location.
|
||||
|
||||
### 2. New overlay-mode state + API on DeesStepper
|
||||
|
||||
```ts
|
||||
@state() accessor overlay: boolean = false;
|
||||
@state() accessor stepperZIndex: number = 1000;
|
||||
private windowLayer?: DeesWindowLayer;
|
||||
|
||||
public static async createAndShow(optionsArg: {
|
||||
steps: IStep[];
|
||||
}): Promise<DeesStepper> {
|
||||
const body = document.body;
|
||||
const stepper = new DeesStepper();
|
||||
stepper.steps = optionsArg.steps;
|
||||
stepper.overlay = true;
|
||||
stepper.windowLayer = await DeesWindowLayer.createAndShow({ blur: true });
|
||||
stepper.windowLayer.addEventListener('click', async () => {
|
||||
await stepper.destroy();
|
||||
});
|
||||
body.append(stepper.windowLayer); // (already appended inside createAndShow, but mirror dees-modal's pattern; see note)
|
||||
body.append(stepper);
|
||||
stepper.stepperZIndex = zIndexRegistry.getNextZIndex();
|
||||
zIndexRegistry.register(stepper, stepper.stepperZIndex);
|
||||
return stepper;
|
||||
}
|
||||
|
||||
public async destroy() {
|
||||
const domtools = await this.domtoolsPromise;
|
||||
const container = this.shadowRoot!.querySelector('.stepperContainer');
|
||||
container?.classList.add('predestroy');
|
||||
await domtools.convenience.smartdelay.delayFor(200);
|
||||
if (this.parentElement) this.parentElement.removeChild(this);
|
||||
if (this.windowLayer) await this.windowLayer.destroy();
|
||||
zIndexRegistry.unregister(this);
|
||||
}
|
||||
```
|
||||
|
||||
**Note on `body.append(windowLayer)`:** `DeesWindowLayer.createAndShow` already appends the window layer to `document.body` (line 27 of `dees-windowlayer.ts`). `dees-modal.ts:71` still calls `body.append(modal.windowLayer)` — that's either a no-op (already-attached nodes) or a re-parent to keep ordering. I will match dees-modal's exact sequence verbatim to avoid introducing subtle differences; if it's a bug in dees-modal it is out of scope for this task.
|
||||
|
||||
**Minimum new scope for createAndShow:** just `steps` for now. No `onComplete`, no `showCloseButton`, no width options. Future-proofing via additional options is an explicit follow-up — this plan keeps scope razor-sharp (per CLAUDE.md). The caller can already wire completion via the last step's `validationFunc` calling back into their own code.
|
||||
|
||||
### 3. Render template — wrap each step in `<dees-tile>`
|
||||
|
||||
```ts
|
||||
public render() {
|
||||
return html`
|
||||
<div class="stepperContainer ${this.overlay ? 'overlay' : ''}" style="${this.overlay ? `z-index: ${this.stepperZIndex}` : ''}">
|
||||
${this.steps.map((stepArg, i) => {
|
||||
const isSelected = stepArg === this.selectedStep;
|
||||
const isHidden = this.getIndexOfStep(stepArg) > this.getIndexOfStep(this.selectedStep);
|
||||
const isFirst = i === 0;
|
||||
const stepNumber = i + 1;
|
||||
return html`
|
||||
<dees-tile
|
||||
class="step ${isSelected ? 'selected' : ''} ${isHidden ? 'hiddenStep' : ''} ${isFirst ? 'entrance' : ''}"
|
||||
>
|
||||
<div slot="header" class="step-header">
|
||||
${!isFirst
|
||||
? html`<div class="goBack" @click=${this.goBack}>
|
||||
<span>←</span> go to previous step
|
||||
</div>`
|
||||
: html`<div class="goBack-spacer"></div>`}
|
||||
<div class="stepCounter">Step ${stepNumber} of ${this.steps.length}</div>
|
||||
</div>
|
||||
<div class="step-body">
|
||||
<div class="title">${stepArg.title}</div>
|
||||
<div class="content">${stepArg.content}</div>
|
||||
</div>
|
||||
${stepArg.footerContent
|
||||
? html`<div slot="footer" class="step-footer">${stepArg.footerContent}</div>`
|
||||
: ''}
|
||||
</dees-tile>
|
||||
`;
|
||||
})}
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
```
|
||||
|
||||
**Key detail:** on the first step, render a `.goBack-spacer` (empty div) in the header instead of nothing — so the `stepCounter` stays right-aligned via `justify-content: space-between`. Without a spacer, flex would left-align the counter on step 1.
|
||||
|
||||
### 4. CSS changes
|
||||
|
||||
**Remove from `.step`:**
|
||||
- `border-radius: 12px;`
|
||||
- `background: ${cssManager.bdTheme(...)};`
|
||||
- `border: 1px solid ${cssManager.bdTheme(...)};`
|
||||
- `color: ${cssManager.bdTheme(...)};`
|
||||
- `box-shadow: 0 8px 32px rgba(0, 0, 0, 0.4);`
|
||||
- `overflow: hidden;`
|
||||
|
||||
**Why:** `dees-tile` owns all of these now. The `.step` selector still exists (since `dees-tile` has `class="step ..."` on it), but it only controls the outer animation wrapper: `max-width`, `min-height`, `margin`, `filter`, `transform`, `transition`, `user-select`, `pointer-events`.
|
||||
|
||||
**Keep on `.step`:**
|
||||
- `position: relative;`
|
||||
- `pointer-events: none;` + `.step.selected { pointer-events: all; }`
|
||||
- `max-width: 500px;` / `min-height: 300px;`
|
||||
- `margin: auto; margin-bottom: 20px;`
|
||||
- `filter: opacity(0.55) saturate(0.85);` + `.selected { filter: opacity(1) saturate(1); }`
|
||||
- `.hiddenStep { filter: opacity(0); }`
|
||||
- All the cubic-bezier transitions (transform/filter/box-shadow — but box-shadow is now a no-op since dees-tile provides the shadow; leave the transition spec in so we don't have to re-check browser parsing; or just drop `box-shadow` from the transition list — I'll drop it for cleanliness).
|
||||
- `.step.entrance` + `.step.entrance.hiddenStep { transform: translateY(16px); }`
|
||||
- `.step:last-child { margin-bottom: 100vh; }`
|
||||
|
||||
**Add for dees-tile shadow enhancement:** use `::part(outer)` to apply the modal-style elevated shadow only when in overlay mode (optional polish — inline mode stays flat):
|
||||
```css
|
||||
.stepperContainer.overlay dees-tile.step::part(outer) {
|
||||
box-shadow:
|
||||
0 0 0 1px ${cssManager.bdTheme('hsl(0 0% 0% / 0.03)', 'hsl(0 0% 100% / 0.03)')},
|
||||
0 8px 40px ${cssManager.bdTheme('hsl(0 0% 0% / 0.12)', 'hsl(0 0% 0% / 0.5)')},
|
||||
0 2px 8px ${cssManager.bdTheme('hsl(0 0% 0% / 0.06)', 'hsl(0 0% 0% / 0.25)')};
|
||||
}
|
||||
```
|
||||
This exactly mirrors the dees-modal::part(outer) shadow stack (dees-modal.ts:157–161) so the overlay stepper reads as "same visual language as modal."
|
||||
|
||||
**Restyle `.step-header` (NEW — the `<div slot="header">`):**
|
||||
```css
|
||||
.step-header {
|
||||
height: 48px;
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: space-between;
|
||||
padding: 8px 12px;
|
||||
gap: 12px;
|
||||
}
|
||||
```
|
||||
|
||||
**Restyle `.step .stepCounter` → `.step-header .stepCounter` (move from absolute to flex child):**
|
||||
- Drop `position: absolute; top: 12px; right: 12px;`
|
||||
- Keep everything else (padding, font-size, border-radius, background, border).
|
||||
|
||||
**Restyle `.step .goBack` → `.step-header .goBack` (move from absolute to flex child):**
|
||||
- Drop `position: absolute; top: 12px; left: 12px;`
|
||||
- Keep everything else (padding, font-size, border-radius, background, border, hover/active states).
|
||||
|
||||
**Add `.goBack-spacer`:**
|
||||
```css
|
||||
.goBack-spacer { width: 1px; } /* placeholder so flex space-between works on step 1 */
|
||||
```
|
||||
|
||||
**Restyle `.step .title`:**
|
||||
- Drop `padding-top: 64px;` — no longer overlaps anything since header is in its own slot.
|
||||
- Keep `text-align: center; font-family: 'Geist Sans', sans-serif; font-size: 24px; font-weight: 600; letter-spacing: -0.01em; color: inherit;`
|
||||
- Add `padding-top: 32px;` (or similar) so there's consistent breathing room above the title inside the tile content.
|
||||
|
||||
**Add `.step-footer` (new container for `stepArg.footerContent`):**
|
||||
```css
|
||||
.step-footer {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: flex-end;
|
||||
gap: 8px;
|
||||
padding: 12px 16px;
|
||||
}
|
||||
```
|
||||
|
||||
**Add overlay-mode positioning:**
|
||||
```css
|
||||
.stepperContainer {
|
||||
position: absolute;
|
||||
width: 100%;
|
||||
height: 100%;
|
||||
overflow: hidden;
|
||||
}
|
||||
.stepperContainer.overlay {
|
||||
position: fixed;
|
||||
top: 0;
|
||||
left: 0;
|
||||
width: 100vw;
|
||||
height: 100vh;
|
||||
}
|
||||
.stepperContainer.predestroy {
|
||||
opacity: 0;
|
||||
transition: opacity 0.2s ease-in;
|
||||
}
|
||||
```
|
||||
|
||||
**Adjust `:host` for dual-mode:**
|
||||
```css
|
||||
:host {
|
||||
position: absolute; /* inline default */
|
||||
width: 100%;
|
||||
height: 100%;
|
||||
font-family: ${cssGeistFontFamily};
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
:host([overlay]) {
|
||||
position: fixed; /* overlay mode */
|
||||
top: 0;
|
||||
left: 0;
|
||||
width: 100vw;
|
||||
height: 100vh;
|
||||
}
|
||||
```
|
||||
|
||||
The `overlay` @state needs to reflect to an attribute for the `:host([overlay])` selector to work. Since `@state` doesn't reflect attributes, use `@property({ type: Boolean, reflect: true })` instead — change the decorator accordingly.
|
||||
|
||||
### 5. Imports to add in `dees-stepper.ts`
|
||||
|
||||
```ts
|
||||
import { DeesWindowLayer } from '../../00group-overlay/dees-windowlayer/dees-windowlayer.js';
|
||||
import { zIndexRegistry } from '../../00zindex.js';
|
||||
import { cssGeistFontFamily } from '../../00fonts.js';
|
||||
import '../../00group-layout/dees-tile/dees-tile.js';
|
||||
```
|
||||
|
||||
`dees-tile` side-effect import registers the custom element. `cssGeistFontFamily` is only needed if I add it to `:host` (which I want, to match modal).
|
||||
|
||||
### 6. SweetScroll selector stability
|
||||
|
||||
`setScrollStatus()` selectors target `.step` and `.selected` (lines 228–229). These continue to match since I'm keeping those class names on the `<dees-tile>` elements. **No selector changes needed.**
|
||||
|
||||
One subtlety: `offsetTop` / `offsetHeight` on `<dees-tile>` should still work — the tile's `:host` is `display: flex; flex-direction: column;` which participates in layout. I'll verify visually in the demo.
|
||||
|
||||
### 7. Demo update
|
||||
|
||||
**File:** `ts_web/elements/00group-layout/dees-stepper/dees-stepper.demo.ts`
|
||||
|
||||
Current demo renders one inline stepper directly. I'll keep that and add an **overlay launcher button** above it:
|
||||
|
||||
```ts
|
||||
export const stepperDemo = () => html`
|
||||
<div style="padding: 16px;">
|
||||
<dees-button @click=${async () => {
|
||||
const stepper = await DeesStepper.createAndShow({
|
||||
steps: [/* same steps as inline demo */],
|
||||
});
|
||||
}}>Open stepper as overlay</dees-button>
|
||||
</div>
|
||||
<dees-stepper .steps=${[/* ... existing inline demo steps ... */]}></dees-stepper>
|
||||
`;
|
||||
```
|
||||
|
||||
Extract the step definitions into a `const demoSteps = [...]` above the template so both the inline and overlay paths reuse them (DRY). Import `DeesStepper` at the top of the demo file.
|
||||
|
||||
## Files to modify
|
||||
|
||||
1. **`ts_web/elements/00group-layout/dees-stepper/dees-stepper.ts`** — main refactor (IStep, imports, render, styles, createAndShow, destroy, overlay state).
|
||||
2. **`ts_web/elements/00group-layout/dees-stepper/dees-stepper.demo.ts`** — add overlay launcher button, extract shared `demoSteps` const, import `DeesStepper`.
|
||||
|
||||
**Files explicitly NOT modified:**
|
||||
- `dees-tile.ts` — used as-is via its slot API.
|
||||
- `dees-windowlayer.ts` — used as-is via `createAndShow` / `destroy` / `click` event.
|
||||
- `dees-modal.ts` — reference only.
|
||||
- `00zindex.ts` — reference only.
|
||||
|
||||
## Verification
|
||||
|
||||
1. **Build**: `pnpm run build` — must pass with no TS errors. Pure refactor, no new dependencies, no lib-check regressions expected.
|
||||
|
||||
2. **Inline demo (backward compat)**:
|
||||
- Start the demo server (port 8080 is already running) and navigate to the dees-stepper demo page.
|
||||
- Confirm the stepper renders inline exactly like before: first step centered, subsequent steps dimmed below, scroll-through animation on goNext / goBack.
|
||||
- Fill out the first form, submit → stepper scrolls to step 2. Click goBack → scrolls back.
|
||||
- Confirm the `dees-tile` frame is visible on each step (rounded, bordered, themed) and that the title + form are inside the tile's content area.
|
||||
- Confirm goBack button + step counter sit in the tile's header row, space-between, left/right respectively.
|
||||
|
||||
3. **Overlay demo (new path)**:
|
||||
- Click the "Open stepper as overlay" button.
|
||||
- Confirm a `dees-windowlayer` with blur appears behind the stepper.
|
||||
- Confirm the stepper fills the viewport (fixed, 100vw×100vh).
|
||||
- Confirm z-index stacking: stepper above window layer above page content.
|
||||
- Click the window layer (outside the tile) → stepper animates out, then destroys along with the window layer.
|
||||
- Re-open and step through forward & back — behavior identical to inline mode.
|
||||
|
||||
4. **Playwright visual check** (per CLAUDE.md: screenshots MUST go in `.playwright-mcp/`):
|
||||
- `.playwright-mcp/dees-stepper-inline.png` — inline mode, step 1 with form.
|
||||
- `.playwright-mcp/dees-stepper-overlay.png` — overlay mode, same step.
|
||||
- `.playwright-mcp/dees-stepper-overlay-step3.png` — overlay mode mid-flow, to verify scroll-stack visual.
|
||||
- Both light and dark themes if the demo has a theme toggle.
|
||||
|
||||
5. **Grep sanity**:
|
||||
- Confirm `dees-stepper` has no new unexpected match locations: `grep dees-stepper ts_web/` should still only match stepper's own files.
|
||||
- Confirm no `.step` class collisions elsewhere (unlikely — `.step` is a plain class name; all usages should be shadow-scoped to `dees-stepper`).
|
||||
|
||||
## Open assumptions & deferred scope
|
||||
|
||||
These are explicit defaults in this plan. If the user wants different behavior for any of them, they should flag it on review — each is a simple follow-up but not in scope right now (CLAUDE.md: stay focused, no "while we're at it"):
|
||||
|
||||
- **No close button on overlay stepper.** Clicking the window layer backdrop is the only way to dismiss. Matches how dees-modal with `showCloseButton: false` behaves. Can add a close button in a follow-up.
|
||||
- **No `onComplete` callback in `createAndShow`.** The last step doesn't auto-destroy the overlay — the app controls it via the step's `validationFunc`. Can add a callback option in a follow-up.
|
||||
- **No width/size options in `createAndShow`.** The step tile continues to use the stepper's existing `max-width: 500px`. Can parameterize in a follow-up.
|
||||
- **Box-shadow in the `.step` transition list** is dropped from the transition for cleanliness — the box-shadow is now on `dees-tile::part(outer)` and doesn't change between selected/hiddenStep, so transitioning it was already a no-op.
|
||||
- **`pnpm start` / dev server path**: I'll reuse the existing server on port 8080 that was already listening when this session began; if that server doesn't serve the stepper demo, I'll start wcctools manually.
|
||||
|
||||
## Risk
|
||||
|
||||
- **Low-medium.** The change is localized to one component and its demo. No API removal, only an additive `createAndShow` + an optional `footerContent` field. External consumers of the inline API continue to work if they only set `steps` + `selectedStep`.
|
||||
- **Biggest risk:** SweetScroll's `offsetTop` / `offsetHeight` measurements on `<dees-tile>` may compute differently than on the former `<div class="step">` because `dees-tile` has an internal `display: flex; flex-direction: column;` host and a `.tile-outer { flex: 1; min-height: 0; }` inner frame. If the scroll math drifts, the mitigation is to keep the `.step` wrapper as an outer `<div>` that **contains** a `<dees-tile>`, rather than putting the class directly on `<dees-tile>`. That preserves the exact box model SweetScroll was measuring. I'll try the direct-class approach first (simpler) and fall back to the wrapper approach if the scroll target looks off in the demo.
|
||||
- **Second risk:** The `:host([overlay])` attribute selector requires `overlay` to be a reflected `@property`, not `@state`. I've already accounted for this in the plan (decorator change).
|
||||
@@ -0,0 +1,167 @@
|
||||
import { expect, tap } from '@git.zone/tstest/tapbundle';
|
||||
import * as deesCatalog from '../ts_web/index.js';
|
||||
import type {
|
||||
Column,
|
||||
ISortDescriptor,
|
||||
} from '../ts_web/elements/00group-dataview/dees-table/index.js';
|
||||
|
||||
interface ITestRow {
|
||||
id: string;
|
||||
score: number;
|
||||
label: string;
|
||||
}
|
||||
|
||||
const testColumns: Column<ITestRow>[] = [
|
||||
{ key: 'id', header: 'ID' },
|
||||
{ key: 'score', header: 'Score' },
|
||||
{ key: 'label', header: 'Label' },
|
||||
];
|
||||
|
||||
const scoreSort: ISortDescriptor[] = [{ key: 'score', dir: 'desc' }];
|
||||
|
||||
const waitForNextFrame = async () => {
|
||||
await new Promise<void>((resolve) => {
|
||||
requestAnimationFrame(() => resolve());
|
||||
});
|
||||
};
|
||||
|
||||
const waitForMacrotask = async () => {
|
||||
await new Promise<void>((resolve) => {
|
||||
window.setTimeout(() => resolve(), 0);
|
||||
});
|
||||
};
|
||||
|
||||
const settleTable = async (table: deesCatalog.DeesTable<ITestRow>) => {
|
||||
await table.updateComplete;
|
||||
await waitForNextFrame();
|
||||
await waitForMacrotask();
|
||||
await table.updateComplete;
|
||||
};
|
||||
|
||||
const createRows = (iteration: number): ITestRow[] => {
|
||||
const cycle = iteration % 3;
|
||||
|
||||
if (cycle === 0) {
|
||||
return [
|
||||
{ id: 'alpha', score: 60, label: `Alpha ${iteration}` },
|
||||
{ id: 'beta', score: 20, label: `Beta ${iteration}` },
|
||||
{ id: 'gamma', score: 40, label: `Gamma ${iteration}` },
|
||||
];
|
||||
}
|
||||
|
||||
if (cycle === 1) {
|
||||
return [
|
||||
{ id: 'alpha', score: 30, label: `Alpha ${iteration}` },
|
||||
{ id: 'beta', score: 70, label: `Beta ${iteration}` },
|
||||
{ id: 'gamma', score: 50, label: `Gamma ${iteration}` },
|
||||
];
|
||||
}
|
||||
|
||||
return [
|
||||
{ id: 'alpha', score: 55, label: `Alpha ${iteration}` },
|
||||
{ id: 'beta', score: 35, label: `Beta ${iteration}` },
|
||||
{ id: 'gamma', score: 75, label: `Gamma ${iteration}` },
|
||||
];
|
||||
};
|
||||
|
||||
const createTable = (
|
||||
rows: ITestRow[],
|
||||
highlightUpdates: 'none' | 'flash'
|
||||
): deesCatalog.DeesTable<ITestRow> => {
|
||||
const table = new deesCatalog.DeesTable<ITestRow>();
|
||||
table.searchable = false;
|
||||
table.columns = testColumns;
|
||||
table.rowKey = 'id';
|
||||
table.sortBy = scoreSort;
|
||||
table.highlightUpdates = highlightUpdates;
|
||||
table.data = rows;
|
||||
document.body.appendChild(table);
|
||||
return table;
|
||||
};
|
||||
|
||||
const countComments = (root: Node): number => {
|
||||
const walker = document.createTreeWalker(root, NodeFilter.SHOW_COMMENT);
|
||||
let count = 0;
|
||||
while (walker.nextNode()) count++;
|
||||
return count;
|
||||
};
|
||||
|
||||
const getBodyRows = (table: deesCatalog.DeesTable<ITestRow>): HTMLTableRowElement[] =>
|
||||
Array.from(
|
||||
table.shadowRoot?.querySelectorAll('tbody tr[data-row-idx]') ?? []
|
||||
) as HTMLTableRowElement[];
|
||||
|
||||
const getRenderedRowIds = (table: deesCatalog.DeesTable<ITestRow>): string[] =>
|
||||
getBodyRows(table).map((row) => row.cells[0]?.textContent?.trim() ?? '');
|
||||
|
||||
const getRenderedRowMap = (
|
||||
table: deesCatalog.DeesTable<ITestRow>
|
||||
): Map<string, HTMLTableRowElement> => {
|
||||
const rowMap = new Map<string, HTMLTableRowElement>();
|
||||
for (const row of getBodyRows(table)) {
|
||||
const rowId = row.cells[0]?.textContent?.trim() ?? '';
|
||||
if (rowId) rowMap.set(rowId, row);
|
||||
}
|
||||
return rowMap;
|
||||
};
|
||||
|
||||
tap.test('dees-table avoids repeated width measurement and comment growth on live updates', async () => {
|
||||
const table = new deesCatalog.DeesTable<ITestRow>();
|
||||
let widthMeasureCalls = 0;
|
||||
const originalDetermineColumnWidths = table.determineColumnWidths.bind(table);
|
||||
table.determineColumnWidths = (async () => {
|
||||
widthMeasureCalls++;
|
||||
await originalDetermineColumnWidths();
|
||||
}) as typeof table.determineColumnWidths;
|
||||
|
||||
table.searchable = false;
|
||||
table.columns = testColumns;
|
||||
table.rowKey = 'id';
|
||||
table.sortBy = scoreSort;
|
||||
table.highlightUpdates = 'none';
|
||||
table.data = createRows(0);
|
||||
document.body.appendChild(table);
|
||||
|
||||
try {
|
||||
await settleTable(table);
|
||||
|
||||
const initialWidthMeasureCalls = widthMeasureCalls;
|
||||
const initialCommentCount = countComments(table.shadowRoot!);
|
||||
|
||||
expect(initialWidthMeasureCalls).toBeGreaterThan(0);
|
||||
|
||||
for (let iteration = 1; iteration <= 10; iteration++) {
|
||||
table.data = createRows(iteration);
|
||||
await settleTable(table);
|
||||
}
|
||||
|
||||
expect(widthMeasureCalls).toEqual(initialWidthMeasureCalls);
|
||||
expect(countComments(table.shadowRoot!)).toEqual(initialCommentCount);
|
||||
} finally {
|
||||
table.remove();
|
||||
}
|
||||
});
|
||||
|
||||
tap.test('dees-table reuses row DOM while flashing live-sorted updates', async () => {
|
||||
const table = createTable(createRows(0), 'flash');
|
||||
|
||||
try {
|
||||
await settleTable(table);
|
||||
|
||||
const initialRowMap = getRenderedRowMap(table);
|
||||
|
||||
table.data = createRows(1);
|
||||
await settleTable(table);
|
||||
|
||||
const updatedRowMap = getRenderedRowMap(table);
|
||||
|
||||
expect(getRenderedRowIds(table)).toEqual(['beta', 'gamma', 'alpha']);
|
||||
expect(updatedRowMap.get('alpha')).toEqual(initialRowMap.get('alpha'));
|
||||
expect(updatedRowMap.get('beta')).toEqual(initialRowMap.get('beta'));
|
||||
expect(updatedRowMap.get('gamma')).toEqual(initialRowMap.get('gamma'));
|
||||
} finally {
|
||||
table.remove();
|
||||
}
|
||||
});
|
||||
|
||||
export default tap.start();
|
||||
@@ -3,6 +3,6 @@
|
||||
*/
|
||||
export const commitinfo = {
|
||||
name: '@design.estate/dees-catalog',
|
||||
version: '3.55.2',
|
||||
version: '3.80.0',
|
||||
description: 'A comprehensive library that provides dynamic web components for building sophisticated and modern web applications using JavaScript and TypeScript.'
|
||||
}
|
||||
|
||||
@@ -1,13 +1,15 @@
|
||||
import { css, cssManager } from '@design.estate/dees-element';
|
||||
import { themeDefaultStyles } from '../../00theme.js';
|
||||
|
||||
export const chartAreaStyles = [
|
||||
themeDefaultStyles,
|
||||
cssManager.defaultStyles,
|
||||
css`
|
||||
:host {
|
||||
display: block;
|
||||
height: 400px;
|
||||
font-family: -apple-system, BlinkMacSystemFont, 'Segoe UI', 'Roboto', sans-serif;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 3.9%)', 'hsl(0 0% 98%)')};
|
||||
color: var(--dees-color-text-primary);
|
||||
font-size: 14px;
|
||||
}
|
||||
dees-tile {
|
||||
@@ -24,7 +26,7 @@ export const chartAreaStyles = [
|
||||
font-size: 14px;
|
||||
font-weight: 500;
|
||||
letter-spacing: -0.01em;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 20%)', 'hsl(0 0% 63.9%)')};
|
||||
color: var(--dees-color-text-secondary);
|
||||
}
|
||||
.expandBtn {
|
||||
display: flex;
|
||||
@@ -36,13 +38,13 @@ export const chartAreaStyles = [
|
||||
border-radius: 4px;
|
||||
background: transparent;
|
||||
cursor: pointer;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 55%)', 'hsl(0 0% 45%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
transition: all 0.15s ease;
|
||||
padding: 0;
|
||||
}
|
||||
.expandBtn:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 93%)', 'hsl(0 0% 12%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 20%)', 'hsl(0 0% 90%)')};
|
||||
background: var(--dees-color-hover);
|
||||
color: var(--dees-color-text-secondary);
|
||||
}
|
||||
.chartContainer {
|
||||
position: absolute;
|
||||
@@ -64,7 +66,7 @@ export const chartAreaStyles = [
|
||||
}
|
||||
.statsSeries + .statsSeries {
|
||||
padding-left: 24px;
|
||||
border-left: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border-left: 1px solid var(--dees-color-border-default);
|
||||
}
|
||||
.statsColor {
|
||||
width: 8px;
|
||||
@@ -75,15 +77,15 @@ export const chartAreaStyles = [
|
||||
.statsName {
|
||||
font-weight: 500;
|
||||
font-size: 11px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 20%)', 'hsl(0 0% 80%)')};
|
||||
color: var(--dees-color-text-secondary);
|
||||
margin-right: 4px;
|
||||
}
|
||||
.statsItem {
|
||||
font-size: 11px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45%)', 'hsl(0 0% 55%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
}
|
||||
.statsItem strong {
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 90%)')};
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
.lw-tooltip {
|
||||
position: absolute;
|
||||
|
||||
@@ -0,0 +1,158 @@
|
||||
import {
|
||||
customElement,
|
||||
property,
|
||||
type TemplateResult,
|
||||
} from '@design.estate/dees-element';
|
||||
|
||||
import { DeesChartEchartsBase } from '../dees-chart-echarts-base.js';
|
||||
import { demoFunc } from './demo.js';
|
||||
import { barStyles } from './styles.js';
|
||||
import { renderChartBar } from './template.js';
|
||||
import { getEchartsSeriesColors, getThemeColors, hexToRgba } from '../dees-chart-echarts-theme.js';
|
||||
|
||||
export interface IBarSeriesItem {
|
||||
name: string;
|
||||
data: number[];
|
||||
color?: string;
|
||||
}
|
||||
|
||||
declare global {
|
||||
interface HTMLElementTagNameMap {
|
||||
'dees-chart-bar': DeesChartBar;
|
||||
}
|
||||
}
|
||||
|
||||
@customElement('dees-chart-bar')
|
||||
export class DeesChartBar extends DeesChartEchartsBase {
|
||||
public static demo = demoFunc;
|
||||
public static demoGroups = ['Chart'];
|
||||
|
||||
@property({ type: Array })
|
||||
accessor categories: string[] = [];
|
||||
|
||||
@property({ type: Array })
|
||||
accessor series: IBarSeriesItem[] = [];
|
||||
|
||||
@property({ type: Boolean })
|
||||
accessor horizontal: boolean = false;
|
||||
|
||||
@property({ type: Boolean })
|
||||
accessor stacked: boolean = false;
|
||||
|
||||
@property({ type: Boolean })
|
||||
accessor showLegend: boolean = true;
|
||||
|
||||
@property({ attribute: false })
|
||||
accessor valueFormatter: (value: number) => string = (val) => `${val}`;
|
||||
|
||||
public static styles = barStyles;
|
||||
|
||||
public render(): TemplateResult {
|
||||
return renderChartBar(this);
|
||||
}
|
||||
|
||||
public async updated(changedProperties: Map<string, any>) {
|
||||
super.updated(changedProperties);
|
||||
if (
|
||||
this.chartInstance &&
|
||||
(changedProperties.has('categories') ||
|
||||
changedProperties.has('series') ||
|
||||
changedProperties.has('horizontal') ||
|
||||
changedProperties.has('stacked') ||
|
||||
changedProperties.has('showLegend'))
|
||||
) {
|
||||
this.updateChart();
|
||||
}
|
||||
}
|
||||
|
||||
protected buildOption(): Record<string, any> {
|
||||
const colors = getThemeColors(this.goBright);
|
||||
const seriesColors = getEchartsSeriesColors(this.goBright);
|
||||
const formatter = this.valueFormatter;
|
||||
|
||||
const categoryAxis: Record<string, any> = {
|
||||
type: 'category',
|
||||
data: this.categories,
|
||||
axisLine: { lineStyle: { color: colors.borderStrong } },
|
||||
axisLabel: { color: colors.textMuted },
|
||||
};
|
||||
|
||||
const valueAxis: Record<string, any> = {
|
||||
type: 'value',
|
||||
axisLine: { show: false },
|
||||
axisLabel: {
|
||||
color: colors.textMuted,
|
||||
formatter: (val: number) => formatter(val),
|
||||
},
|
||||
splitLine: { lineStyle: { color: colors.borderSubtle } },
|
||||
};
|
||||
|
||||
const fillAlpha = this.goBright ? 0.15 : 0.25;
|
||||
const borderRadius = this.horizontal ? [0, 4, 4, 0] : [4, 4, 0, 0];
|
||||
const noBorderRadius = [0, 0, 0, 0];
|
||||
|
||||
const legendData: Array<{ name: string; itemStyle: { color: string } }> = [];
|
||||
|
||||
const seriesData = this.series.map((s, index) => {
|
||||
const color = s.color || seriesColors[index % seriesColors.length];
|
||||
legendData.push({ name: s.name, itemStyle: { color } });
|
||||
return {
|
||||
name: s.name,
|
||||
type: 'bar' as const,
|
||||
data: s.data,
|
||||
stack: this.stacked ? 'total' : undefined,
|
||||
itemStyle: {
|
||||
color: hexToRgba(color, fillAlpha),
|
||||
borderColor: color,
|
||||
borderWidth: 1,
|
||||
borderRadius: this.stacked ? noBorderRadius : borderRadius,
|
||||
},
|
||||
barMaxWidth: 40,
|
||||
barGap: '20%',
|
||||
emphasis: {
|
||||
itemStyle: {
|
||||
color: hexToRgba(color, fillAlpha + 0.15),
|
||||
borderColor: color,
|
||||
borderWidth: 1.5,
|
||||
},
|
||||
},
|
||||
};
|
||||
});
|
||||
|
||||
// For stacked bars, round the top corners of the last visible series
|
||||
if (this.stacked && seriesData.length > 0) {
|
||||
const last = seriesData[seriesData.length - 1];
|
||||
last.itemStyle.borderRadius = borderRadius;
|
||||
}
|
||||
|
||||
return {
|
||||
tooltip: {
|
||||
trigger: 'axis',
|
||||
axisPointer: { type: 'shadow' },
|
||||
formatter: (params: any) => {
|
||||
const items = Array.isArray(params) ? params : [params];
|
||||
let result = `<strong>${items[0].axisValueLabel}</strong><br/>`;
|
||||
for (const p of items) {
|
||||
const solidColor = p.borderColor || p.color;
|
||||
const marker = `<span style="display:inline-block;margin-right:4px;border-radius:10px;width:10px;height:10px;background-color:${solidColor};"></span>`;
|
||||
result += `${marker}${p.seriesName}: <strong>${formatter(p.value)}</strong><br/>`;
|
||||
}
|
||||
return result;
|
||||
},
|
||||
},
|
||||
legend: this.showLegend && this.series.length > 1
|
||||
? { bottom: 8, itemWidth: 10, itemHeight: 10, data: legendData }
|
||||
: { show: false },
|
||||
grid: {
|
||||
left: 16,
|
||||
right: 16,
|
||||
top: 16,
|
||||
bottom: this.showLegend && this.series.length > 1 ? 40 : 16,
|
||||
containLabel: true,
|
||||
},
|
||||
xAxis: this.horizontal ? valueAxis : categoryAxis,
|
||||
yAxis: this.horizontal ? categoryAxis : valueAxis,
|
||||
series: seriesData,
|
||||
};
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,120 @@
|
||||
import { html, css, cssManager } from '@design.estate/dees-element';
|
||||
import type { DeesChartBar } from './component.js';
|
||||
import '@design.estate/dees-wcctools/demotools';
|
||||
import './component.js';
|
||||
|
||||
export const demoFunc = () => {
|
||||
const endpointCategories = ['/api/users', '/api/orders', '/api/products', '/api/auth', '/api/search'];
|
||||
const endpointSeries = [
|
||||
{ name: 'GET', data: [1240, 890, 720, 2100, 560] },
|
||||
{ name: 'POST', data: [320, 450, 180, 890, 40] },
|
||||
{ name: 'PUT', data: [90, 210, 150, 30, 10] },
|
||||
];
|
||||
|
||||
const regionCategories = ['US-East', 'US-West', 'EU', 'Asia', 'Other'];
|
||||
const regionSeries = [
|
||||
{ name: 'Requests', data: [4500, 3200, 2800, 1900, 600] },
|
||||
];
|
||||
|
||||
return html`
|
||||
<dees-demowrapper .runAfterRender=${async (elementArg: HTMLElement) => {
|
||||
const vertChart = elementArg.querySelector('#vert-chart') as DeesChartBar;
|
||||
const horizChart = elementArg.querySelector('#horiz-chart') as DeesChartBar;
|
||||
const stackChart = elementArg.querySelector('#stack-chart') as DeesChartBar;
|
||||
|
||||
const buttons = elementArg.querySelectorAll('dees-button');
|
||||
buttons.forEach((button: any) => {
|
||||
const text = button.text?.trim();
|
||||
if (text === 'Randomize') {
|
||||
button.addEventListener('click', () => {
|
||||
vertChart.series = endpointSeries.map((s) => ({
|
||||
...s,
|
||||
data: s.data.map((v) => Math.round(v * (0.5 + Math.random()))),
|
||||
}));
|
||||
horizChart.series = regionSeries.map((s) => ({
|
||||
...s,
|
||||
data: s.data.map((v) => Math.round(v * (0.5 + Math.random()))),
|
||||
}));
|
||||
stackChart.series = endpointSeries.map((s) => ({
|
||||
...s,
|
||||
data: s.data.map((v) => Math.round(v * (0.5 + Math.random()))),
|
||||
}));
|
||||
});
|
||||
}
|
||||
});
|
||||
}}>
|
||||
<style>
|
||||
${css`
|
||||
.demoBox {
|
||||
position: relative;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95%)', 'hsl(0 0% 9%)')};
|
||||
height: 100%;
|
||||
width: 100%;
|
||||
padding: 40px;
|
||||
box-sizing: border-box;
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 24px;
|
||||
}
|
||||
.chartRow {
|
||||
display: grid;
|
||||
grid-template-columns: 1fr 1fr;
|
||||
gap: 24px;
|
||||
}
|
||||
.controls {
|
||||
display: flex;
|
||||
gap: 12px;
|
||||
margin-bottom: 8px;
|
||||
}
|
||||
.info {
|
||||
color: ${cssManager.bdTheme('hsl(215.4 16.3% 56.9%)', 'hsl(215 20.2% 55.1%)')};
|
||||
font-size: 12px;
|
||||
font-family: -apple-system, BlinkMacSystemFont, 'Segoe UI', 'Geist Sans', sans-serif;
|
||||
text-align: center;
|
||||
margin-top: 8px;
|
||||
}
|
||||
`}
|
||||
</style>
|
||||
<div class="demoBox">
|
||||
<div class="controls">
|
||||
<dees-button-group label="Actions:">
|
||||
<dees-button>Randomize</dees-button>
|
||||
</dees-button-group>
|
||||
</div>
|
||||
|
||||
<div class="chartRow">
|
||||
<dees-chart-bar
|
||||
id="vert-chart"
|
||||
.label=${'Requests by Endpoint'}
|
||||
.categories=${endpointCategories}
|
||||
.series=${endpointSeries}
|
||||
.valueFormatter=${(val: number) => `${val} req`}
|
||||
></dees-chart-bar>
|
||||
|
||||
<dees-chart-bar
|
||||
id="horiz-chart"
|
||||
.label=${'Traffic by Region'}
|
||||
.categories=${regionCategories}
|
||||
.series=${regionSeries}
|
||||
.horizontal=${true}
|
||||
.valueFormatter=${(val: number) => `${(val / 1000).toFixed(1)}k`}
|
||||
></dees-chart-bar>
|
||||
</div>
|
||||
|
||||
<dees-chart-bar
|
||||
id="stack-chart"
|
||||
.label=${'Stacked: Requests by Endpoint'}
|
||||
.categories=${endpointCategories}
|
||||
.series=${endpointSeries}
|
||||
.stacked=${true}
|
||||
.valueFormatter=${(val: number) => `${val} req`}
|
||||
></dees-chart-bar>
|
||||
|
||||
<div class="info">
|
||||
Bar chart with vertical, horizontal, and stacked modes •
|
||||
Click 'Randomize' to update data with animation
|
||||
</div>
|
||||
</div>
|
||||
</dees-demowrapper>
|
||||
`;
|
||||
};
|
||||
@@ -0,0 +1 @@
|
||||
export * from './component.js';
|
||||
@@ -0,0 +1,7 @@
|
||||
import { css } from '@design.estate/dees-element';
|
||||
import { echartsBaseStyles } from '../dees-chart-echarts-styles.js';
|
||||
|
||||
export const barStyles = [
|
||||
...echartsBaseStyles,
|
||||
css``,
|
||||
];
|
||||
@@ -0,0 +1,13 @@
|
||||
import { html, type TemplateResult } from '@design.estate/dees-element';
|
||||
import type { DeesChartBar } from './component.js';
|
||||
|
||||
export const renderChartBar = (component: DeesChartBar): TemplateResult => {
|
||||
return html`
|
||||
<dees-tile>
|
||||
<div slot="header" class="chartHeader">
|
||||
<span class="chartLabel">${component.label}</span>
|
||||
</div>
|
||||
<div class="chartContainer"></div>
|
||||
</dees-tile>
|
||||
`;
|
||||
};
|
||||
@@ -0,0 +1,142 @@
|
||||
import {
|
||||
customElement,
|
||||
property,
|
||||
type TemplateResult,
|
||||
} from '@design.estate/dees-element';
|
||||
|
||||
import { DeesChartEchartsBase } from '../dees-chart-echarts-base.js';
|
||||
import { demoFunc } from './demo.js';
|
||||
import { donutStyles } from './styles.js';
|
||||
import { renderChartDonut } from './template.js';
|
||||
import { getEchartsSeriesColors, getThemeColors, hexToRgba } from '../dees-chart-echarts-theme.js';
|
||||
|
||||
export interface IDonutDataItem {
|
||||
name: string;
|
||||
value: number;
|
||||
color?: string;
|
||||
}
|
||||
|
||||
declare global {
|
||||
interface HTMLElementTagNameMap {
|
||||
'dees-chart-donut': DeesChartDonut;
|
||||
}
|
||||
}
|
||||
|
||||
@customElement('dees-chart-donut')
|
||||
export class DeesChartDonut extends DeesChartEchartsBase {
|
||||
public static demo = demoFunc;
|
||||
public static demoGroups = ['Chart'];
|
||||
|
||||
@property({ type: Array })
|
||||
accessor data: IDonutDataItem[] = [];
|
||||
|
||||
@property({ type: Boolean })
|
||||
accessor showLegend: boolean = true;
|
||||
|
||||
@property({ type: Boolean })
|
||||
accessor showLabels: boolean = true;
|
||||
|
||||
@property({ type: String })
|
||||
accessor innerRadiusPercent: string = '55%';
|
||||
|
||||
@property({ attribute: false })
|
||||
accessor valueFormatter: (value: number) => string = (val) => `${val}`;
|
||||
|
||||
public static styles = donutStyles;
|
||||
|
||||
public render(): TemplateResult {
|
||||
return renderChartDonut(this);
|
||||
}
|
||||
|
||||
public async updated(changedProperties: Map<string, any>) {
|
||||
super.updated(changedProperties);
|
||||
if (
|
||||
this.chartInstance &&
|
||||
(changedProperties.has('data') ||
|
||||
changedProperties.has('showLegend') ||
|
||||
changedProperties.has('showLabels') ||
|
||||
changedProperties.has('innerRadiusPercent'))
|
||||
) {
|
||||
this.updateChart();
|
||||
}
|
||||
}
|
||||
|
||||
protected buildOption(): Record<string, any> {
|
||||
const themeColors = getThemeColors(this.goBright);
|
||||
const seriesColors = getEchartsSeriesColors(this.goBright);
|
||||
const fillAlpha = this.goBright ? 0.15 : 0.2;
|
||||
|
||||
const legendData: Array<{ name: string; itemStyle: { color: string } }> = [];
|
||||
|
||||
const data = this.data.map((item, index) => {
|
||||
const color = item.color || seriesColors[index % seriesColors.length];
|
||||
legendData.push({ name: item.name, itemStyle: { color } });
|
||||
return {
|
||||
name: item.name,
|
||||
value: item.value,
|
||||
itemStyle: {
|
||||
color: hexToRgba(color, fillAlpha),
|
||||
borderColor: color,
|
||||
borderWidth: 1,
|
||||
},
|
||||
emphasis: {
|
||||
itemStyle: {
|
||||
color: hexToRgba(color, fillAlpha + 0.15),
|
||||
borderColor: color,
|
||||
borderWidth: 1.5,
|
||||
},
|
||||
},
|
||||
};
|
||||
});
|
||||
|
||||
const formatter = this.valueFormatter;
|
||||
|
||||
return {
|
||||
tooltip: {
|
||||
trigger: 'item',
|
||||
formatter: (params: any) => {
|
||||
const solidColor = params.data?.itemStyle?.borderColor || params.color;
|
||||
const marker = `<span style="display:inline-block;margin-right:4px;border-radius:10px;width:10px;height:10px;background-color:${solidColor};"></span>`;
|
||||
return `${marker}${params.name}: <strong>${formatter(params.value)}</strong> (${params.percent}%)`;
|
||||
},
|
||||
},
|
||||
legend: this.showLegend
|
||||
? {
|
||||
orient: 'vertical',
|
||||
right: 16,
|
||||
top: 'center',
|
||||
itemWidth: 10,
|
||||
itemHeight: 10,
|
||||
itemGap: 12,
|
||||
data: legendData,
|
||||
formatter: (name: string) => {
|
||||
const item = this.data.find((d) => d.name === name);
|
||||
return item ? `${name} ${formatter(item.value)}` : name;
|
||||
},
|
||||
}
|
||||
: { show: false },
|
||||
series: [
|
||||
{
|
||||
type: 'pie',
|
||||
radius: [this.innerRadiusPercent, '85%'],
|
||||
center: this.showLegend ? ['35%', '50%'] : ['50%', '50%'],
|
||||
avoidLabelOverlap: true,
|
||||
padAngle: 2,
|
||||
itemStyle: {
|
||||
borderRadius: 4,
|
||||
},
|
||||
label: this.showLabels
|
||||
? {
|
||||
show: true,
|
||||
formatter: '{b}: {d}%',
|
||||
fontSize: 11,
|
||||
color: themeColors.textSecondary,
|
||||
textBorderColor: 'transparent',
|
||||
}
|
||||
: { show: false },
|
||||
data,
|
||||
},
|
||||
],
|
||||
};
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,127 @@
|
||||
import { html, css, cssManager } from '@design.estate/dees-element';
|
||||
import type { DeesChartDonut } from './component.js';
|
||||
import '@design.estate/dees-wcctools/demotools';
|
||||
import './component.js';
|
||||
|
||||
export const demoFunc = () => {
|
||||
const diskData = [
|
||||
{ name: 'Documents', value: 42 },
|
||||
{ name: 'Media', value: 28 },
|
||||
{ name: 'Applications', value: 15 },
|
||||
{ name: 'System', value: 10 },
|
||||
{ name: 'Other', value: 5 },
|
||||
];
|
||||
|
||||
const statusData = [
|
||||
{ name: 'Healthy', value: 156 },
|
||||
{ name: 'Warning', value: 23 },
|
||||
{ name: 'Critical', value: 8 },
|
||||
{ name: 'Unknown', value: 3 },
|
||||
];
|
||||
|
||||
const trafficData = [
|
||||
{ name: 'API', value: 45200 },
|
||||
{ name: 'Static Assets', value: 23100 },
|
||||
{ name: 'WebSocket', value: 12800 },
|
||||
{ name: 'GraphQL', value: 8900 },
|
||||
];
|
||||
|
||||
return html`
|
||||
<dees-demowrapper .runAfterRender=${async (elementArg: HTMLElement) => {
|
||||
const diskChart = elementArg.querySelector('#disk-chart') as DeesChartDonut;
|
||||
const statusChart = elementArg.querySelector('#status-chart') as DeesChartDonut;
|
||||
const trafficChart = elementArg.querySelector('#traffic-chart') as DeesChartDonut;
|
||||
|
||||
// Wire up buttons
|
||||
const buttons = elementArg.querySelectorAll('dees-button');
|
||||
buttons.forEach((button: any) => {
|
||||
const text = button.text?.trim();
|
||||
if (text === 'Randomize') {
|
||||
button.addEventListener('click', () => {
|
||||
diskChart.data = diskData.map((d) => ({
|
||||
...d,
|
||||
value: Math.round(d.value * (0.5 + Math.random())),
|
||||
}));
|
||||
statusChart.data = statusData.map((d) => ({
|
||||
...d,
|
||||
value: Math.round(d.value * (0.3 + Math.random() * 1.4)),
|
||||
}));
|
||||
trafficChart.data = trafficData.map((d) => ({
|
||||
...d,
|
||||
value: Math.round(d.value * (0.5 + Math.random())),
|
||||
}));
|
||||
});
|
||||
}
|
||||
});
|
||||
}}>
|
||||
<style>
|
||||
${css`
|
||||
.demoBox {
|
||||
position: relative;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95%)', 'hsl(0 0% 9%)')};
|
||||
height: 100%;
|
||||
width: 100%;
|
||||
padding: 40px;
|
||||
box-sizing: border-box;
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 24px;
|
||||
}
|
||||
.chartRow {
|
||||
display: grid;
|
||||
grid-template-columns: 1fr 1fr;
|
||||
gap: 24px;
|
||||
}
|
||||
.controls {
|
||||
display: flex;
|
||||
gap: 12px;
|
||||
margin-bottom: 8px;
|
||||
}
|
||||
.info {
|
||||
color: ${cssManager.bdTheme('hsl(215.4 16.3% 56.9%)', 'hsl(215 20.2% 55.1%)')};
|
||||
font-size: 12px;
|
||||
font-family: -apple-system, BlinkMacSystemFont, 'Segoe UI', 'Geist Sans', sans-serif;
|
||||
text-align: center;
|
||||
margin-top: 8px;
|
||||
}
|
||||
`}
|
||||
</style>
|
||||
<div class="demoBox">
|
||||
<div class="controls">
|
||||
<dees-button-group label="Actions:">
|
||||
<dees-button>Randomize</dees-button>
|
||||
</dees-button-group>
|
||||
</div>
|
||||
|
||||
<div class="chartRow">
|
||||
<dees-chart-donut
|
||||
id="disk-chart"
|
||||
.label=${'Disk Usage (GB)'}
|
||||
.data=${diskData}
|
||||
.valueFormatter=${(val: number) => `${val} GB`}
|
||||
></dees-chart-donut>
|
||||
|
||||
<dees-chart-donut
|
||||
id="status-chart"
|
||||
.label=${'Service Status'}
|
||||
.data=${statusData}
|
||||
.valueFormatter=${(val: number) => `${val} services`}
|
||||
.innerRadiusPercent=${'0%'}
|
||||
></dees-chart-donut>
|
||||
</div>
|
||||
|
||||
<dees-chart-donut
|
||||
id="traffic-chart"
|
||||
.label=${'Traffic Distribution'}
|
||||
.data=${trafficData}
|
||||
.valueFormatter=${(val: number) => `${(val / 1000).toFixed(1)}k req`}
|
||||
></dees-chart-donut>
|
||||
|
||||
<div class="info">
|
||||
Donut chart with configurable inner radius (set to 0% for full pie) •
|
||||
Click 'Randomize' to update data with animation
|
||||
</div>
|
||||
</div>
|
||||
</dees-demowrapper>
|
||||
`;
|
||||
};
|
||||
@@ -0,0 +1 @@
|
||||
export * from './component.js';
|
||||
@@ -0,0 +1,14 @@
|
||||
import { css, cssManager } from '@design.estate/dees-element';
|
||||
import { echartsBaseStyles } from '../dees-chart-echarts-styles.js';
|
||||
|
||||
export const donutStyles = [
|
||||
...echartsBaseStyles,
|
||||
css`
|
||||
:host {
|
||||
height: 360px;
|
||||
}
|
||||
.chartContainer {
|
||||
inset: 12px 0;
|
||||
}
|
||||
`,
|
||||
];
|
||||
@@ -0,0 +1,13 @@
|
||||
import { html, type TemplateResult } from '@design.estate/dees-element';
|
||||
import type { DeesChartDonut } from './component.js';
|
||||
|
||||
export const renderChartDonut = (component: DeesChartDonut): TemplateResult => {
|
||||
return html`
|
||||
<dees-tile>
|
||||
<div slot="header" class="chartHeader">
|
||||
<span class="chartLabel">${component.label}</span>
|
||||
</div>
|
||||
<div class="chartContainer"></div>
|
||||
</dees-tile>
|
||||
`;
|
||||
};
|
||||
@@ -0,0 +1,112 @@
|
||||
import {
|
||||
DeesElement,
|
||||
property,
|
||||
html,
|
||||
type TemplateResult,
|
||||
} from '@design.estate/dees-element';
|
||||
|
||||
import * as domtools from '@design.estate/dees-domtools';
|
||||
import { DeesServiceLibLoader, type IEchartsBundle, type IEchartsInstance } from '../../services/index.js';
|
||||
import { getEchartsThemeOptions } from './dees-chart-echarts-theme.js';
|
||||
import '../00group-layout/dees-tile/dees-tile.js';
|
||||
|
||||
/**
|
||||
* Abstract base class for ECharts-based chart components.
|
||||
* Handles library loading, chart lifecycle, resize observation, and theme switching.
|
||||
* Subclasses implement `buildOption()` to define their chart configuration.
|
||||
*/
|
||||
export abstract class DeesChartEchartsBase extends DeesElement {
|
||||
@property()
|
||||
accessor label: string = 'Untitled Chart';
|
||||
|
||||
protected chartInstance: IEchartsInstance | null = null;
|
||||
protected echartsBundle: IEchartsBundle | null = null;
|
||||
private resizeObserver: ResizeObserver | null = null;
|
||||
|
||||
constructor() {
|
||||
super();
|
||||
domtools.elementBasic.setup();
|
||||
this.registerGarbageFunction(async () => {
|
||||
if (this.resizeObserver) {
|
||||
this.resizeObserver.disconnect();
|
||||
this.resizeObserver = null;
|
||||
}
|
||||
if (this.chartInstance) {
|
||||
try {
|
||||
this.chartInstance.dispose();
|
||||
this.chartInstance = null;
|
||||
} catch (e) {
|
||||
console.error('Error disposing ECharts instance:', e);
|
||||
}
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
public render(): TemplateResult {
|
||||
return html`
|
||||
<dees-tile>
|
||||
<div slot="header" class="chartHeader">
|
||||
<span class="chartLabel">${this.label}</span>
|
||||
</div>
|
||||
<div class="chartContainer"></div>
|
||||
</dees-tile>
|
||||
`;
|
||||
}
|
||||
|
||||
public async firstUpdated() {
|
||||
await this.domtoolsPromise;
|
||||
this.echartsBundle = await DeesServiceLibLoader.getInstance().loadEcharts();
|
||||
await new Promise(resolve => requestAnimationFrame(resolve));
|
||||
|
||||
const chartContainer = this.shadowRoot!.querySelector('.chartContainer') as HTMLDivElement;
|
||||
if (!chartContainer) return;
|
||||
|
||||
try {
|
||||
this.chartInstance = this.echartsBundle.init(chartContainer, null, { renderer: 'svg' });
|
||||
this.updateChart();
|
||||
|
||||
this.resizeObserver = new ResizeObserver(() => {
|
||||
this.chartInstance?.resize();
|
||||
});
|
||||
this.resizeObserver.observe(chartContainer);
|
||||
} catch (error) {
|
||||
console.error('Failed to initialize ECharts:', error);
|
||||
}
|
||||
}
|
||||
|
||||
public async updated(changedProperties: Map<string, any>) {
|
||||
super.updated(changedProperties);
|
||||
if (changedProperties.has('goBright') && this.chartInstance) {
|
||||
this.applyTheme();
|
||||
}
|
||||
}
|
||||
|
||||
protected abstract buildOption(): Record<string, any>;
|
||||
|
||||
protected updateChart(): void {
|
||||
if (!this.chartInstance) return;
|
||||
const themeOptions = getEchartsThemeOptions(this.goBright);
|
||||
const chartOption = this.buildOption();
|
||||
// Deep-merge theme defaults with chart-specific options for nested objects
|
||||
const merged = {
|
||||
...themeOptions,
|
||||
...chartOption,
|
||||
textStyle: { ...themeOptions.textStyle, ...(chartOption.textStyle || {}) },
|
||||
tooltip: { ...themeOptions.tooltip, ...(chartOption.tooltip || {}) },
|
||||
legend: {
|
||||
...themeOptions.legend,
|
||||
...(chartOption.legend || {}),
|
||||
textStyle: { ...(themeOptions.legend?.textStyle || {}), ...(chartOption.legend?.textStyle || {}) },
|
||||
},
|
||||
};
|
||||
this.chartInstance.setOption(merged, true);
|
||||
}
|
||||
|
||||
protected applyTheme(): void {
|
||||
this.updateChart();
|
||||
}
|
||||
|
||||
public async forceResize(): Promise<void> {
|
||||
this.chartInstance?.resize();
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,36 @@
|
||||
import { css, cssManager } from '@design.estate/dees-element';
|
||||
import { themeDefaultStyles } from '../00theme.js';
|
||||
|
||||
export const echartsBaseStyles = [
|
||||
themeDefaultStyles,
|
||||
cssManager.defaultStyles,
|
||||
css`
|
||||
:host {
|
||||
display: block;
|
||||
height: 400px;
|
||||
font-family: -apple-system, BlinkMacSystemFont, 'Segoe UI', 'Roboto', sans-serif;
|
||||
color: var(--dees-color-text-primary);
|
||||
font-size: 14px;
|
||||
}
|
||||
dees-tile {
|
||||
height: 100%;
|
||||
}
|
||||
.chartHeader {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
height: 32px;
|
||||
padding: 0 8px 0 16px;
|
||||
}
|
||||
.chartLabel {
|
||||
flex: 1;
|
||||
font-size: 14px;
|
||||
font-weight: 500;
|
||||
letter-spacing: -0.01em;
|
||||
color: var(--dees-color-text-secondary);
|
||||
}
|
||||
.chartContainer {
|
||||
position: absolute;
|
||||
inset: 0;
|
||||
}
|
||||
`,
|
||||
];
|
||||
@@ -0,0 +1,91 @@
|
||||
/**
|
||||
* Shared theme utilities for ECharts-based chart components.
|
||||
* Uses the centralized themeDefaults tokens so chart colors stay in sync
|
||||
* with the rest of the dees-catalog design system.
|
||||
*
|
||||
* ECharts renders on <svg> and cannot read CSS custom properties,
|
||||
* so we reference the TypeScript source-of-truth (themeDefaults) directly.
|
||||
*
|
||||
* IMPORTANT: All colors passed to ECharts for data series must be hex or rgb/rgba.
|
||||
* ECharts cannot interpolate HSL strings during hover/emphasis animations,
|
||||
* causing them to flash black.
|
||||
*/
|
||||
|
||||
import { themeDefaults } from '../00theme.js';
|
||||
|
||||
const light = themeDefaults.colors.light;
|
||||
const dark = themeDefaults.colors.dark;
|
||||
|
||||
/**
|
||||
* Series color palette for ECharts charts.
|
||||
* Aligned with the Tailwind/shadcn-inspired palette used throughout the codebase.
|
||||
* All values are hex — ECharts requires this for animation interpolation.
|
||||
*/
|
||||
const SERIES_COLORS = {
|
||||
dark: [
|
||||
'#60a5fa', // blue-400 — softer in dark mode
|
||||
'#2dd4bf', // teal-400
|
||||
'#a78bfa', // violet-400
|
||||
'#fbbf24', // amber-400
|
||||
'#34d399', // emerald-400
|
||||
'#fb7185', // rose-400
|
||||
],
|
||||
light: [
|
||||
'#3b82f6', // blue-500
|
||||
'#14b8a6', // teal-500
|
||||
'#8b5cf6', // violet-500
|
||||
'#f59e0b', // amber-500
|
||||
'#10b981', // emerald-500
|
||||
'#f43f5e', // rose-500
|
||||
],
|
||||
};
|
||||
|
||||
export function getEchartsSeriesColors(goBright: boolean): string[] {
|
||||
return goBright ? SERIES_COLORS.light : SERIES_COLORS.dark;
|
||||
}
|
||||
|
||||
/**
|
||||
* Convert a hex color to an rgba string with the given alpha.
|
||||
*/
|
||||
export function hexToRgba(hex: string, alpha: number): string {
|
||||
const r = parseInt(hex.slice(1, 3), 16);
|
||||
const g = parseInt(hex.slice(3, 5), 16);
|
||||
const b = parseInt(hex.slice(5, 7), 16);
|
||||
return `rgba(${r}, ${g}, ${b}, ${alpha})`;
|
||||
}
|
||||
|
||||
export function getEchartsThemeOptions(goBright: boolean): Record<string, any> {
|
||||
const colors = goBright ? light : dark;
|
||||
return {
|
||||
backgroundColor: 'transparent',
|
||||
textStyle: {
|
||||
color: colors.textSecondary,
|
||||
fontFamily: '-apple-system, BlinkMacSystemFont, "Segoe UI", sans-serif',
|
||||
fontSize: 12,
|
||||
},
|
||||
// No global `color` array — each component sets per-item/per-series
|
||||
// colors explicitly to avoid conflicts during emphasis animations.
|
||||
tooltip: {
|
||||
backgroundColor: colors.bgPrimary,
|
||||
borderColor: colors.borderDefault,
|
||||
textStyle: {
|
||||
color: colors.textPrimary,
|
||||
fontSize: 12,
|
||||
},
|
||||
confine: true,
|
||||
},
|
||||
legend: {
|
||||
textStyle: {
|
||||
color: colors.textSecondary,
|
||||
fontSize: 12,
|
||||
},
|
||||
},
|
||||
};
|
||||
}
|
||||
|
||||
/**
|
||||
* Helper to get the resolved theme colors object for use in buildOption().
|
||||
*/
|
||||
export function getThemeColors(goBright: boolean) {
|
||||
return goBright ? light : dark;
|
||||
}
|
||||
@@ -0,0 +1,161 @@
|
||||
import {
|
||||
customElement,
|
||||
property,
|
||||
type TemplateResult,
|
||||
} from '@design.estate/dees-element';
|
||||
|
||||
import { DeesChartEchartsBase } from '../dees-chart-echarts-base.js';
|
||||
import { demoFunc } from './demo.js';
|
||||
import { gaugeStyles } from './styles.js';
|
||||
import { renderChartGauge } from './template.js';
|
||||
import { getEchartsSeriesColors, getThemeColors } from '../dees-chart-echarts-theme.js';
|
||||
|
||||
export interface IGaugeThreshold {
|
||||
value: number;
|
||||
color: string;
|
||||
}
|
||||
|
||||
declare global {
|
||||
interface HTMLElementTagNameMap {
|
||||
'dees-chart-gauge': DeesChartGauge;
|
||||
}
|
||||
}
|
||||
|
||||
@customElement('dees-chart-gauge')
|
||||
export class DeesChartGauge extends DeesChartEchartsBase {
|
||||
public static demo = demoFunc;
|
||||
public static demoGroups = ['Chart'];
|
||||
|
||||
@property({ type: Number })
|
||||
accessor value: number = 0;
|
||||
|
||||
@property({ type: Number })
|
||||
accessor min: number = 0;
|
||||
|
||||
@property({ type: Number })
|
||||
accessor max: number = 100;
|
||||
|
||||
@property({ type: String })
|
||||
accessor unit: string = '%';
|
||||
|
||||
@property({ type: Array })
|
||||
accessor thresholds: IGaugeThreshold[] = [];
|
||||
|
||||
@property({ type: Boolean })
|
||||
accessor showTicks: boolean = true;
|
||||
|
||||
public static styles = gaugeStyles;
|
||||
|
||||
public render(): TemplateResult {
|
||||
return renderChartGauge(this);
|
||||
}
|
||||
|
||||
public async updated(changedProperties: Map<string, any>) {
|
||||
super.updated(changedProperties);
|
||||
if (
|
||||
this.chartInstance &&
|
||||
(changedProperties.has('value') ||
|
||||
changedProperties.has('min') ||
|
||||
changedProperties.has('max') ||
|
||||
changedProperties.has('unit') ||
|
||||
changedProperties.has('thresholds') ||
|
||||
changedProperties.has('showTicks'))
|
||||
) {
|
||||
this.updateChart();
|
||||
}
|
||||
}
|
||||
|
||||
protected buildOption(): Record<string, any> {
|
||||
const colors = getThemeColors(this.goBright);
|
||||
const seriesColors = getEchartsSeriesColors(this.goBright);
|
||||
const primaryColor = seriesColors[0];
|
||||
|
||||
// Build axis line color stops from thresholds
|
||||
let axisLineColors: Array<[number, string]>;
|
||||
if (this.thresholds.length > 0) {
|
||||
const sorted = [...this.thresholds].sort((a, b) => a.value - b.value);
|
||||
axisLineColors = sorted.map((t) => [
|
||||
(t.value - this.min) / (this.max - this.min),
|
||||
t.color,
|
||||
]);
|
||||
// Ensure we end at 1
|
||||
if (axisLineColors[axisLineColors.length - 1][0] < 1) {
|
||||
axisLineColors.push([1, sorted[sorted.length - 1].color]);
|
||||
}
|
||||
} else {
|
||||
axisLineColors = [[1, primaryColor]];
|
||||
}
|
||||
|
||||
return {
|
||||
series: [
|
||||
{
|
||||
type: 'gauge',
|
||||
min: this.min,
|
||||
max: this.max,
|
||||
startAngle: 220,
|
||||
endAngle: -40,
|
||||
progress: {
|
||||
show: true,
|
||||
width: 14,
|
||||
roundCap: true,
|
||||
},
|
||||
pointer: {
|
||||
show: true,
|
||||
length: '60%',
|
||||
width: 5,
|
||||
itemStyle: {
|
||||
color: 'auto',
|
||||
},
|
||||
},
|
||||
axisLine: {
|
||||
lineStyle: {
|
||||
width: 14,
|
||||
color: axisLineColors,
|
||||
opacity: 0.3,
|
||||
},
|
||||
},
|
||||
axisTick: {
|
||||
show: this.showTicks,
|
||||
distance: -20,
|
||||
length: 6,
|
||||
lineStyle: {
|
||||
color: colors.borderStrong,
|
||||
width: 1,
|
||||
},
|
||||
},
|
||||
splitLine: {
|
||||
show: this.showTicks,
|
||||
distance: -24,
|
||||
length: 10,
|
||||
lineStyle: {
|
||||
color: colors.textMuted,
|
||||
width: 2,
|
||||
},
|
||||
},
|
||||
axisLabel: {
|
||||
show: this.showTicks,
|
||||
distance: 30,
|
||||
color: colors.textMuted,
|
||||
fontSize: 11,
|
||||
},
|
||||
detail: {
|
||||
valueAnimation: true,
|
||||
fontSize: 28,
|
||||
fontWeight: 600,
|
||||
offsetCenter: [0, '65%'],
|
||||
color: colors.textPrimary,
|
||||
formatter: `{value}${this.unit}`,
|
||||
},
|
||||
title: {
|
||||
show: false,
|
||||
},
|
||||
data: [
|
||||
{
|
||||
value: this.value,
|
||||
},
|
||||
],
|
||||
},
|
||||
],
|
||||
};
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,125 @@
|
||||
import { html, css, cssManager } from '@design.estate/dees-element';
|
||||
import type { DeesChartGauge } from './component.js';
|
||||
import '@design.estate/dees-wcctools/demotools';
|
||||
import './component.js';
|
||||
|
||||
export const demoFunc = () => {
|
||||
const defaultThresholds = [
|
||||
{ value: 60, color: 'hsl(142 76% 36%)' },
|
||||
{ value: 80, color: 'hsl(38 92% 50%)' },
|
||||
{ value: 100, color: 'hsl(0 72% 50%)' },
|
||||
];
|
||||
|
||||
return html`
|
||||
<dees-demowrapper .runAfterRender=${async (elementArg: HTMLElement) => {
|
||||
const cpuGauge = elementArg.querySelector('#cpu-gauge') as DeesChartGauge;
|
||||
const memGauge = elementArg.querySelector('#mem-gauge') as DeesChartGauge;
|
||||
const slaGauge = elementArg.querySelector('#sla-gauge') as DeesChartGauge;
|
||||
|
||||
let animInterval: number | null = null;
|
||||
|
||||
const buttons = elementArg.querySelectorAll('dees-button');
|
||||
buttons.forEach((button: any) => {
|
||||
const text = button.text?.trim();
|
||||
if (text === 'Animate') {
|
||||
button.addEventListener('click', () => {
|
||||
if (animInterval) return;
|
||||
animInterval = window.setInterval(() => {
|
||||
cpuGauge.value = Math.round(30 + Math.random() * 60);
|
||||
memGauge.value = Math.round(40 + Math.random() * 50);
|
||||
slaGauge.value = Math.round((95 + Math.random() * 5) * 100) / 100;
|
||||
}, 2000);
|
||||
});
|
||||
} else if (text === 'Stop') {
|
||||
button.addEventListener('click', () => {
|
||||
if (animInterval) {
|
||||
window.clearInterval(animInterval);
|
||||
animInterval = null;
|
||||
}
|
||||
});
|
||||
} else if (text === 'Spike') {
|
||||
button.addEventListener('click', () => {
|
||||
cpuGauge.value = 95;
|
||||
memGauge.value = 88;
|
||||
slaGauge.value = 96.5;
|
||||
});
|
||||
}
|
||||
});
|
||||
}}>
|
||||
<style>
|
||||
${css`
|
||||
.demoBox {
|
||||
position: relative;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95%)', 'hsl(0 0% 9%)')};
|
||||
height: 100%;
|
||||
width: 100%;
|
||||
padding: 40px;
|
||||
box-sizing: border-box;
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 24px;
|
||||
}
|
||||
.gaugeRow {
|
||||
display: grid;
|
||||
grid-template-columns: 1fr 1fr 1fr;
|
||||
gap: 24px;
|
||||
}
|
||||
.controls {
|
||||
display: flex;
|
||||
gap: 12px;
|
||||
margin-bottom: 8px;
|
||||
}
|
||||
.info {
|
||||
color: ${cssManager.bdTheme('hsl(215.4 16.3% 56.9%)', 'hsl(215 20.2% 55.1%)')};
|
||||
font-size: 12px;
|
||||
font-family: -apple-system, BlinkMacSystemFont, 'Segoe UI', 'Geist Sans', sans-serif;
|
||||
text-align: center;
|
||||
margin-top: 8px;
|
||||
}
|
||||
`}
|
||||
</style>
|
||||
<div class="demoBox">
|
||||
<div class="controls">
|
||||
<dees-button-group label="Actions:">
|
||||
<dees-button>Animate</dees-button>
|
||||
<dees-button>Stop</dees-button>
|
||||
<dees-button>Spike</dees-button>
|
||||
</dees-button-group>
|
||||
</div>
|
||||
|
||||
<div class="gaugeRow">
|
||||
<dees-chart-gauge
|
||||
id="cpu-gauge"
|
||||
.label=${'CPU Usage'}
|
||||
.value=${42}
|
||||
.unit=${'%'}
|
||||
.thresholds=${defaultThresholds}
|
||||
></dees-chart-gauge>
|
||||
|
||||
<dees-chart-gauge
|
||||
id="mem-gauge"
|
||||
.label=${'Memory Usage'}
|
||||
.value=${67}
|
||||
.unit=${'%'}
|
||||
.thresholds=${defaultThresholds}
|
||||
></dees-chart-gauge>
|
||||
|
||||
<dees-chart-gauge
|
||||
id="sla-gauge"
|
||||
.label=${'SLA Uptime'}
|
||||
.value=${99.8}
|
||||
.min=${95}
|
||||
.max=${100}
|
||||
.unit=${'%'}
|
||||
.showTicks=${true}
|
||||
></dees-chart-gauge>
|
||||
</div>
|
||||
|
||||
<div class="info">
|
||||
Gauge chart with animated value transitions and threshold coloring •
|
||||
Click 'Animate' for live updates, 'Spike' to simulate high load
|
||||
</div>
|
||||
</div>
|
||||
</dees-demowrapper>
|
||||
`;
|
||||
};
|
||||
@@ -0,0 +1 @@
|
||||
export * from './component.js';
|
||||
@@ -0,0 +1,11 @@
|
||||
import { css } from '@design.estate/dees-element';
|
||||
import { echartsBaseStyles } from '../dees-chart-echarts-styles.js';
|
||||
|
||||
export const gaugeStyles = [
|
||||
...echartsBaseStyles,
|
||||
css`
|
||||
:host {
|
||||
height: 320px;
|
||||
}
|
||||
`,
|
||||
];
|
||||
@@ -0,0 +1,13 @@
|
||||
import { html, type TemplateResult } from '@design.estate/dees-element';
|
||||
import type { DeesChartGauge } from './component.js';
|
||||
|
||||
export const renderChartGauge = (component: DeesChartGauge): TemplateResult => {
|
||||
return html`
|
||||
<dees-tile>
|
||||
<div slot="header" class="chartHeader">
|
||||
<span class="chartLabel">${component.label}</span>
|
||||
</div>
|
||||
<div class="chartContainer"></div>
|
||||
</dees-tile>
|
||||
`;
|
||||
};
|
||||
@@ -106,7 +106,7 @@ export class DeesChartLog extends DeesElement {
|
||||
display: block;
|
||||
height: 400px;
|
||||
font-family: -apple-system, BlinkMacSystemFont, 'Segoe UI', sans-serif;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 3.9%)', 'hsl(0 0% 98%)')};
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
dees-tile {
|
||||
@@ -124,7 +124,7 @@ export class DeesChartLog extends DeesElement {
|
||||
.title {
|
||||
font-weight: 500;
|
||||
font-size: 14px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 9%)', 'hsl(0 0% 95%)')};
|
||||
color: var(--dees-color-text-primary);
|
||||
white-space: nowrap;
|
||||
}
|
||||
|
||||
@@ -141,10 +141,10 @@ export class DeesChartLog extends DeesElement {
|
||||
flex: 1;
|
||||
padding: 4px 8px;
|
||||
font-size: 12px;
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border: 1px solid var(--dees-color-border-default);
|
||||
border-radius: 4px;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 9%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 9%)', 'hsl(0 0% 95%)')};
|
||||
background: var(--dees-color-bg-primary);
|
||||
color: var(--dees-color-text-primary);
|
||||
outline: none;
|
||||
}
|
||||
|
||||
@@ -153,7 +153,7 @@ export class DeesChartLog extends DeesElement {
|
||||
}
|
||||
|
||||
.search-box input::placeholder {
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 63.9%)', 'hsl(0 0% 45.1%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
}
|
||||
|
||||
.search-nav {
|
||||
@@ -164,35 +164,35 @@ export class DeesChartLog extends DeesElement {
|
||||
.search-nav button {
|
||||
padding: 4px 6px;
|
||||
font-size: 11px;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 14.9%)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
background: var(--dees-color-bg-primary);
|
||||
border: 1px solid var(--dees-color-border-default);
|
||||
border-radius: 3px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
cursor: pointer;
|
||||
line-height: 1;
|
||||
}
|
||||
|
||||
.search-nav button:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95.1%)', 'hsl(0 0% 20%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 93.9%)')};
|
||||
background: var(--dees-color-hover);
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
.filter-toggle {
|
||||
padding: 4px 8px;
|
||||
font-size: 11px;
|
||||
font-weight: 500;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 14.9%)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
background: var(--dees-color-bg-primary);
|
||||
border: 1px solid var(--dees-color-border-default);
|
||||
border-radius: 4px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
cursor: pointer;
|
||||
transition: all 0.15s;
|
||||
white-space: nowrap;
|
||||
}
|
||||
|
||||
.filter-toggle:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95.1%)', 'hsl(0 0% 20%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 93.9%)')};
|
||||
background: var(--dees-color-hover);
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
.filter-toggle.active {
|
||||
@@ -208,11 +208,11 @@ export class DeesChartLog extends DeesElement {
|
||||
}
|
||||
|
||||
.control-button {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 14.9%)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
background: var(--dees-color-bg-primary);
|
||||
border: 1px solid var(--dees-color-border-default);
|
||||
border-radius: 4px;
|
||||
padding: 4px 10px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
cursor: pointer;
|
||||
font-size: 12px;
|
||||
font-weight: 500;
|
||||
@@ -220,9 +220,9 @@ export class DeesChartLog extends DeesElement {
|
||||
}
|
||||
|
||||
.control-button:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95.1%)', 'hsl(0 0% 20%)')};
|
||||
border-color: ${cssManager.bdTheme('hsl(0 0% 79.8%)', 'hsl(0 0% 25%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 93.9%)')};
|
||||
background: var(--dees-color-hover);
|
||||
border-color: var(--dees-color-border-strong);
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
.control-button.active {
|
||||
@@ -247,7 +247,7 @@ export class DeesChartLog extends DeesElement {
|
||||
align-items: center;
|
||||
justify-content: center;
|
||||
height: 100%;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
font-style: italic;
|
||||
font-size: 13px;
|
||||
}
|
||||
@@ -299,7 +299,7 @@ export class DeesChartLog extends DeesElement {
|
||||
|
||||
.metric.rate {
|
||||
margin-left: auto;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
}
|
||||
|
||||
.metric.rate::before {
|
||||
|
||||
@@ -0,0 +1,132 @@
|
||||
import {
|
||||
customElement,
|
||||
property,
|
||||
type TemplateResult,
|
||||
} from '@design.estate/dees-element';
|
||||
|
||||
import { DeesChartEchartsBase } from '../dees-chart-echarts-base.js';
|
||||
import { demoFunc } from './demo.js';
|
||||
import { radarStyles } from './styles.js';
|
||||
import { renderChartRadar } from './template.js';
|
||||
import { getEchartsSeriesColors, getThemeColors, hexToRgba } from '../dees-chart-echarts-theme.js';
|
||||
|
||||
export interface IRadarIndicator {
|
||||
name: string;
|
||||
max: number;
|
||||
}
|
||||
|
||||
export interface IRadarSeriesItem {
|
||||
name: string;
|
||||
values: number[];
|
||||
color?: string;
|
||||
}
|
||||
|
||||
declare global {
|
||||
interface HTMLElementTagNameMap {
|
||||
'dees-chart-radar': DeesChartRadar;
|
||||
}
|
||||
}
|
||||
|
||||
@customElement('dees-chart-radar')
|
||||
export class DeesChartRadar extends DeesChartEchartsBase {
|
||||
public static demo = demoFunc;
|
||||
public static demoGroups = ['Chart'];
|
||||
|
||||
@property({ type: Array })
|
||||
accessor indicators: IRadarIndicator[] = [];
|
||||
|
||||
@property({ type: Array })
|
||||
accessor series: IRadarSeriesItem[] = [];
|
||||
|
||||
@property({ type: Boolean })
|
||||
accessor showLegend: boolean = true;
|
||||
|
||||
@property({ type: Boolean })
|
||||
accessor fillArea: boolean = true;
|
||||
|
||||
public static styles = radarStyles;
|
||||
|
||||
public render(): TemplateResult {
|
||||
return renderChartRadar(this);
|
||||
}
|
||||
|
||||
public async updated(changedProperties: Map<string, any>) {
|
||||
super.updated(changedProperties);
|
||||
if (
|
||||
this.chartInstance &&
|
||||
(changedProperties.has('indicators') ||
|
||||
changedProperties.has('series') ||
|
||||
changedProperties.has('showLegend') ||
|
||||
changedProperties.has('fillArea'))
|
||||
) {
|
||||
this.updateChart();
|
||||
}
|
||||
}
|
||||
|
||||
protected buildOption(): Record<string, any> {
|
||||
const colors = getThemeColors(this.goBright);
|
||||
const seriesColors = getEchartsSeriesColors(this.goBright);
|
||||
|
||||
const fillAlpha = this.goBright ? 0.1 : 0.15;
|
||||
|
||||
const seriesData = this.series.map((s, index) => {
|
||||
const color = s.color || seriesColors[index % seriesColors.length];
|
||||
return {
|
||||
name: s.name,
|
||||
value: s.values,
|
||||
itemStyle: { color, borderColor: color, borderWidth: 1 },
|
||||
lineStyle: { color, width: 1.5 },
|
||||
areaStyle: this.fillArea ? { color: hexToRgba(color, fillAlpha) } : undefined,
|
||||
symbol: 'circle',
|
||||
symbolSize: 5,
|
||||
};
|
||||
});
|
||||
|
||||
return {
|
||||
tooltip: {
|
||||
trigger: 'item',
|
||||
},
|
||||
legend: this.showLegend && this.series.length > 1
|
||||
? { bottom: 8, itemWidth: 10, itemHeight: 10 }
|
||||
: { show: false },
|
||||
radar: {
|
||||
indicator: this.indicators.map((ind) => ({
|
||||
name: ind.name,
|
||||
max: ind.max,
|
||||
})),
|
||||
shape: 'polygon',
|
||||
splitNumber: 4,
|
||||
axisName: {
|
||||
color: colors.textSecondary,
|
||||
fontSize: 11,
|
||||
},
|
||||
splitArea: {
|
||||
areaStyle: {
|
||||
color: [colors.bgTertiary, colors.bgSecondary],
|
||||
},
|
||||
},
|
||||
splitLine: {
|
||||
lineStyle: {
|
||||
color: colors.borderDefault,
|
||||
},
|
||||
},
|
||||
axisLine: {
|
||||
lineStyle: {
|
||||
color: colors.borderDefault,
|
||||
},
|
||||
},
|
||||
},
|
||||
series: [
|
||||
{
|
||||
type: 'radar',
|
||||
data: seriesData,
|
||||
emphasis: {
|
||||
lineStyle: {
|
||||
width: 3,
|
||||
},
|
||||
},
|
||||
},
|
||||
],
|
||||
};
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,119 @@
|
||||
import { html, css, cssManager } from '@design.estate/dees-element';
|
||||
import type { DeesChartRadar } from './component.js';
|
||||
import '@design.estate/dees-wcctools/demotools';
|
||||
import './component.js';
|
||||
|
||||
export const demoFunc = () => {
|
||||
const indicators = [
|
||||
{ name: 'Latency', max: 100 },
|
||||
{ name: 'Throughput', max: 100 },
|
||||
{ name: 'Availability', max: 100 },
|
||||
{ name: 'Error Rate', max: 100 },
|
||||
{ name: 'Saturation', max: 100 },
|
||||
{ name: 'Security', max: 100 },
|
||||
];
|
||||
|
||||
const series = [
|
||||
{ name: 'Service A', values: [85, 90, 99, 12, 45, 78] },
|
||||
{ name: 'Service B', values: [70, 65, 95, 28, 60, 90] },
|
||||
];
|
||||
|
||||
const singleIndicators = [
|
||||
{ name: 'Speed', max: 10 },
|
||||
{ name: 'Reliability', max: 10 },
|
||||
{ name: 'Comfort', max: 10 },
|
||||
{ name: 'Safety', max: 10 },
|
||||
{ name: 'Cost', max: 10 },
|
||||
];
|
||||
|
||||
const singleSeries = [
|
||||
{ name: 'Rating', values: [8.5, 9.2, 7.0, 9.5, 6.0] },
|
||||
];
|
||||
|
||||
return html`
|
||||
<dees-demowrapper .runAfterRender=${async (elementArg: HTMLElement) => {
|
||||
const compChart = elementArg.querySelector('#comparison-chart') as DeesChartRadar;
|
||||
const singleChart = elementArg.querySelector('#single-chart') as DeesChartRadar;
|
||||
|
||||
const buttons = elementArg.querySelectorAll('dees-button');
|
||||
buttons.forEach((button: any) => {
|
||||
const text = button.text?.trim();
|
||||
if (text === 'Randomize') {
|
||||
button.addEventListener('click', () => {
|
||||
compChart.series = series.map((s) => ({
|
||||
...s,
|
||||
values: s.values.map(() => Math.round(20 + Math.random() * 80)),
|
||||
}));
|
||||
singleChart.series = singleSeries.map((s) => ({
|
||||
...s,
|
||||
values: s.values.map(() => Math.round((2 + Math.random() * 8) * 10) / 10),
|
||||
}));
|
||||
});
|
||||
}
|
||||
});
|
||||
}}>
|
||||
<style>
|
||||
${css`
|
||||
.demoBox {
|
||||
position: relative;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95%)', 'hsl(0 0% 9%)')};
|
||||
height: 100%;
|
||||
width: 100%;
|
||||
padding: 40px;
|
||||
box-sizing: border-box;
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 24px;
|
||||
}
|
||||
.chartRow {
|
||||
display: grid;
|
||||
grid-template-columns: 1fr 1fr;
|
||||
gap: 24px;
|
||||
}
|
||||
.controls {
|
||||
display: flex;
|
||||
gap: 12px;
|
||||
margin-bottom: 8px;
|
||||
}
|
||||
.info {
|
||||
color: ${cssManager.bdTheme('hsl(215.4 16.3% 56.9%)', 'hsl(215 20.2% 55.1%)')};
|
||||
font-size: 12px;
|
||||
font-family: -apple-system, BlinkMacSystemFont, 'Segoe UI', 'Geist Sans', sans-serif;
|
||||
text-align: center;
|
||||
margin-top: 8px;
|
||||
}
|
||||
`}
|
||||
</style>
|
||||
<div class="demoBox">
|
||||
<div class="controls">
|
||||
<dees-button-group label="Actions:">
|
||||
<dees-button>Randomize</dees-button>
|
||||
</dees-button-group>
|
||||
</div>
|
||||
|
||||
<div class="chartRow">
|
||||
<dees-chart-radar
|
||||
id="comparison-chart"
|
||||
.label=${'Service Health Comparison'}
|
||||
.indicators=${indicators}
|
||||
.series=${series}
|
||||
></dees-chart-radar>
|
||||
|
||||
<dees-chart-radar
|
||||
id="single-chart"
|
||||
.label=${'Product Rating'}
|
||||
.indicators=${singleIndicators}
|
||||
.series=${singleSeries}
|
||||
.fillArea=${true}
|
||||
></dees-chart-radar>
|
||||
</div>
|
||||
|
||||
<div class="info">
|
||||
Radar chart for multi-dimensional comparison •
|
||||
Supports multiple overlay series and configurable fill •
|
||||
Click 'Randomize' to update data
|
||||
</div>
|
||||
</div>
|
||||
</dees-demowrapper>
|
||||
`;
|
||||
};
|
||||
@@ -0,0 +1 @@
|
||||
export * from './component.js';
|
||||
@@ -0,0 +1,7 @@
|
||||
import { css } from '@design.estate/dees-element';
|
||||
import { echartsBaseStyles } from '../dees-chart-echarts-styles.js';
|
||||
|
||||
export const radarStyles = [
|
||||
...echartsBaseStyles,
|
||||
css``,
|
||||
];
|
||||
@@ -0,0 +1,13 @@
|
||||
import { html, type TemplateResult } from '@design.estate/dees-element';
|
||||
import type { DeesChartRadar } from './component.js';
|
||||
|
||||
export const renderChartRadar = (component: DeesChartRadar): TemplateResult => {
|
||||
return html`
|
||||
<dees-tile>
|
||||
<div slot="header" class="chartHeader">
|
||||
<span class="chartLabel">${component.label}</span>
|
||||
</div>
|
||||
<div class="chartContainer"></div>
|
||||
</dees-tile>
|
||||
`;
|
||||
};
|
||||
@@ -1,3 +1,7 @@
|
||||
// Chart Components
|
||||
export * from './dees-chart-area/index.js';
|
||||
export * from './dees-chart-bar/index.js';
|
||||
export * from './dees-chart-donut/index.js';
|
||||
export * from './dees-chart-gauge/index.js';
|
||||
export * from './dees-chart-log/index.js';
|
||||
export * from './dees-chart-radar/index.js';
|
||||
|
||||
@@ -2,6 +2,7 @@ import { demoFunc } from './dees-dataview-codebox.demo.js';
|
||||
import {
|
||||
DeesElement,
|
||||
html,
|
||||
css,
|
||||
customElement,
|
||||
type TemplateResult,
|
||||
property,
|
||||
@@ -9,6 +10,7 @@ import {
|
||||
cssManager,
|
||||
} from '@design.estate/dees-element';
|
||||
import { cssGeistFontFamily, cssMonoFontFamily } from '../../00fonts.js';
|
||||
import { themeDefaultStyles } from '../../00theme.js';
|
||||
|
||||
import type { HLJSApi } from 'highlight.js';
|
||||
|
||||
@@ -39,6 +41,11 @@ export class DeesDataviewCodebox extends DeesElement {
|
||||
})
|
||||
accessor codeToDisplay: string = '';
|
||||
|
||||
public static styles = [
|
||||
themeDefaultStyles,
|
||||
cssManager.defaultStyles,
|
||||
];
|
||||
|
||||
constructor() {
|
||||
super();
|
||||
}
|
||||
@@ -56,11 +63,11 @@ export class DeesDataviewCodebox extends DeesElement {
|
||||
box-sizing: border-box;
|
||||
}
|
||||
dees-tile {
|
||||
color: ${cssManager.bdTheme('#09090b', '#fafafa')};
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
.appbar {
|
||||
color: ${cssManager.bdTheme('#71717a', '#a1a1aa')};
|
||||
color: var(--dees-color-text-muted);
|
||||
height: 32px;
|
||||
display: flex;
|
||||
font-size: 13px;
|
||||
@@ -78,7 +85,7 @@ export class DeesDataviewCodebox extends DeesElement {
|
||||
}
|
||||
|
||||
.bottomBar {
|
||||
color: ${cssManager.bdTheme('#71717a', '#a1a1aa')};
|
||||
color: var(--dees-color-text-muted);
|
||||
height: 28px;
|
||||
font-size: 11px;
|
||||
line-height: 28px;
|
||||
@@ -118,10 +125,10 @@ export class DeesDataviewCodebox extends DeesElement {
|
||||
}
|
||||
|
||||
.lineNumbers {
|
||||
color: ${cssManager.bdTheme('#71717a', '#52525b')};
|
||||
color: var(--dees-color-text-muted);
|
||||
padding: 24px 16px 0px 0px;
|
||||
text-align: right;
|
||||
border-right: 1px solid ${cssManager.bdTheme('#e5e7eb', '#27272a')};
|
||||
border-right: 1px solid var(--dees-color-border-default);
|
||||
}
|
||||
|
||||
.lineCounter:last-child {
|
||||
|
||||
+11
-11
@@ -42,7 +42,7 @@ export class DeesDataviewStatusobject extends DeesElement {
|
||||
}
|
||||
|
||||
dees-tile {
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 9%)', 'hsl(0 0% 98%)')};
|
||||
color: var(--dees-color-text-primary);
|
||||
cursor: default;
|
||||
}
|
||||
|
||||
@@ -61,7 +61,7 @@ export class DeesDataviewStatusobject extends DeesElement {
|
||||
font-size: 14px;
|
||||
font-weight: 500;
|
||||
letter-spacing: -0.01em;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 20%)', 'hsl(0 0% 63.9%)')};
|
||||
color: var(--dees-color-text-secondary);
|
||||
flex: 1;
|
||||
}
|
||||
|
||||
@@ -78,21 +78,21 @@ export class DeesDataviewStatusobject extends DeesElement {
|
||||
.copyMain {
|
||||
font-size: 11px;
|
||||
font-weight: 500;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 14.9%)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
background: var(--dees-color-bg-primary);
|
||||
border: 1px solid var(--dees-color-border-default);
|
||||
text-align: center;
|
||||
padding: 4px 10px;
|
||||
border-radius: 4px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
user-select: none;
|
||||
cursor: pointer;
|
||||
transition: all 0.15s ease;
|
||||
}
|
||||
|
||||
.copyMain:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95.1%)', 'hsl(0 0% 14.9%)')};
|
||||
border-color: ${cssManager.bdTheme('hsl(0 0% 79.8%)', 'hsl(0 0% 20.9%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 93.9%)')};
|
||||
background: var(--dees-color-hover);
|
||||
border-color: var(--dees-color-border-strong);
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
.copyMain:active {
|
||||
@@ -121,7 +121,7 @@ export class DeesDataviewStatusobject extends DeesElement {
|
||||
gap: 10px;
|
||||
height: 36px;
|
||||
padding: 0 16px;
|
||||
border-bottom: 1px solid ${cssManager.bdTheme('hsl(0 0% 95%)', 'hsl(0 0% 10%)')};
|
||||
border-bottom: 1px solid var(--dees-color-border-subtle);
|
||||
transition: background-color 0.15s ease;
|
||||
cursor: context-menu;
|
||||
}
|
||||
@@ -149,7 +149,7 @@ export class DeesDataviewStatusobject extends DeesElement {
|
||||
.detail .detailsText .label {
|
||||
font-size: 12px;
|
||||
font-weight: 500;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
letter-spacing: -0.01em;
|
||||
white-space: nowrap;
|
||||
flex-shrink: 0;
|
||||
@@ -167,7 +167,7 @@ export class DeesDataviewStatusobject extends DeesElement {
|
||||
}
|
||||
|
||||
.bottomBar {
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
height: 28px;
|
||||
font-size: 11px;
|
||||
line-height: 28px;
|
||||
|
||||
@@ -160,7 +160,7 @@ export class DeesStatsGrid extends DeesElement {
|
||||
.grid-title {
|
||||
font-size: 16px;
|
||||
font-weight: 500;
|
||||
color: ${cssManager.bdTheme('#09090b', '#fafafa')};
|
||||
color: var(--dees-color-text-primary);
|
||||
letter-spacing: -0.01em;
|
||||
}
|
||||
|
||||
@@ -186,7 +186,7 @@ export class DeesStatsGrid extends DeesElement {
|
||||
}
|
||||
|
||||
.stats-tile:hover::part(outer) {
|
||||
border-color: ${cssManager.bdTheme('#d0d0d0', '#2a2a2a')};
|
||||
border-color: var(--dees-color-border-strong);
|
||||
}
|
||||
|
||||
.stats-tile.clickable {
|
||||
@@ -281,7 +281,7 @@ export class DeesStatsGrid extends DeesElement {
|
||||
|
||||
.gauge-background {
|
||||
fill: none;
|
||||
stroke: ${cssManager.bdTheme('#e8e8e8', '#1a1a1a')};
|
||||
stroke: var(--dees-color-border-default);
|
||||
stroke-width: 6;
|
||||
}
|
||||
|
||||
@@ -329,7 +329,7 @@ export class DeesStatsGrid extends DeesElement {
|
||||
.percentage-bar {
|
||||
width: 100%;
|
||||
height: 6px;
|
||||
background: ${cssManager.bdTheme('#e8e8e8', '#1a1a1a')};
|
||||
background: var(--dees-color-border-default);
|
||||
border-radius: 3px;
|
||||
overflow: hidden;
|
||||
margin-top: auto;
|
||||
@@ -337,7 +337,7 @@ export class DeesStatsGrid extends DeesElement {
|
||||
|
||||
.percentage-fill {
|
||||
height: 100%;
|
||||
background: ${cssManager.bdTheme('#333333', '#e0e0e0')};
|
||||
background: var(--dees-color-text-muted);
|
||||
transition: width 0.6s cubic-bezier(0.4, 0, 0.2, 1);
|
||||
border-radius: 3px;
|
||||
}
|
||||
@@ -386,14 +386,14 @@ export class DeesStatsGrid extends DeesElement {
|
||||
.multi-percentage-bar {
|
||||
width: 100%;
|
||||
height: 4px;
|
||||
background: ${cssManager.bdTheme('#e8e8e8', '#1a1a1a')};
|
||||
background: var(--dees-color-border-default);
|
||||
border-radius: 2px;
|
||||
overflow: hidden;
|
||||
}
|
||||
|
||||
.multi-percentage-fill {
|
||||
height: 100%;
|
||||
background: ${cssManager.bdTheme('#333333', '#e0e0e0')};
|
||||
background: var(--dees-color-text-muted);
|
||||
transition: width 0.6s cubic-bezier(0.4, 0, 0.2, 1);
|
||||
border-radius: 2px;
|
||||
}
|
||||
@@ -464,7 +464,7 @@ export class DeesStatsGrid extends DeesElement {
|
||||
.cpu-core-bar-wrapper {
|
||||
flex: 1;
|
||||
width: 100%;
|
||||
background: ${cssManager.bdTheme('#e8e8e8', '#1a1a1a')};
|
||||
background: var(--dees-color-border-default);
|
||||
border-radius: 2px;
|
||||
position: relative;
|
||||
overflow: hidden;
|
||||
@@ -477,21 +477,21 @@ export class DeesStatsGrid extends DeesElement {
|
||||
left: 0;
|
||||
right: 0;
|
||||
width: 100%;
|
||||
background: ${cssManager.bdTheme('#666666', '#888888')};
|
||||
background: var(--dees-color-text-muted);
|
||||
transition: height 0.3s cubic-bezier(0.4, 0, 0.2, 1), background-color 0.3s ease;
|
||||
border-radius: 2px 2px 0 0;
|
||||
}
|
||||
|
||||
.cpu-core-bar-fill.low {
|
||||
background: ${cssManager.bdTheme('hsl(142.1 76.2% 36.3%)', 'hsl(142.1 70.6% 45.3%)')};
|
||||
background: var(--dees-color-accent-success);
|
||||
}
|
||||
|
||||
.cpu-core-bar-fill.medium {
|
||||
background: ${cssManager.bdTheme('hsl(45.4 93.4% 47.5%)', 'hsl(45.4 93.4% 47.5%)')};
|
||||
background: var(--dees-color-accent-warning);
|
||||
}
|
||||
|
||||
.cpu-core-bar-fill.high {
|
||||
background: ${cssManager.bdTheme('hsl(0 84.2% 60.2%)', 'hsl(0 84.2% 60.2%)')};
|
||||
background: var(--dees-color-accent-error);
|
||||
}
|
||||
|
||||
.cpu-core-label {
|
||||
@@ -531,24 +531,24 @@ export class DeesStatsGrid extends DeesElement {
|
||||
.partition-bar {
|
||||
width: 100%;
|
||||
height: 6px;
|
||||
background: ${cssManager.bdTheme('#e8e8e8', '#1a1a1a')};
|
||||
background: var(--dees-color-border-default);
|
||||
border-radius: 3px;
|
||||
overflow: hidden;
|
||||
}
|
||||
|
||||
.partition-bar-fill {
|
||||
height: 100%;
|
||||
background: ${cssManager.bdTheme('#333333', '#e0e0e0')};
|
||||
background: var(--dees-color-text-muted);
|
||||
transition: width 0.6s cubic-bezier(0.4, 0, 0.2, 1);
|
||||
border-radius: 3px;
|
||||
}
|
||||
|
||||
.partition-bar-fill.warning {
|
||||
background: ${cssManager.bdTheme('hsl(45.4 93.4% 47.5%)', 'hsl(45.4 93.4% 47.5%)')};
|
||||
background: var(--dees-color-accent-warning);
|
||||
}
|
||||
|
||||
.partition-bar-fill.critical {
|
||||
background: ${cssManager.bdTheme('hsl(0 84.2% 60.2%)', 'hsl(0 84.2% 60.2%)')};
|
||||
background: var(--dees-color-accent-error);
|
||||
}
|
||||
|
||||
.partition-stats {
|
||||
@@ -695,7 +695,7 @@ export class DeesStatsGrid extends DeesElement {
|
||||
.disk-health-bar {
|
||||
width: 100%;
|
||||
height: 4px;
|
||||
background: ${cssManager.bdTheme('#e8e8e8', '#1a1a1a')};
|
||||
background: var(--dees-color-border-default);
|
||||
border-radius: 2px;
|
||||
overflow: hidden;
|
||||
}
|
||||
@@ -771,7 +771,7 @@ export class DeesStatsGrid extends DeesElement {
|
||||
|
||||
.trend-line {
|
||||
fill: none;
|
||||
stroke: ${cssManager.bdTheme('#999999', '#666666')};
|
||||
stroke: var(--dees-color-text-muted);
|
||||
stroke-width: 1.5;
|
||||
stroke-linejoin: round;
|
||||
stroke-linecap: round;
|
||||
|
||||
@@ -1,4 +1,4 @@
|
||||
import type { Column, TDisplayFunction } from './types.js';
|
||||
import type { Column, ISortDescriptor, TDisplayFunction } from './types.js';
|
||||
|
||||
export function computeColumnsFromDisplayFunction<T>(
|
||||
displayFunction: TDisplayFunction<T>,
|
||||
@@ -36,11 +36,31 @@ export function getCellValue<T>(row: T, col: Column<T>, displayFunction?: TDispl
|
||||
return col.value ? col.value(row) : (row as any)[col.key as any];
|
||||
}
|
||||
|
||||
/**
|
||||
* Compares two cell values in ascending order. Returns -1, 0, or 1.
|
||||
* Null/undefined values sort before defined values. Numbers compare numerically;
|
||||
* everything else compares as case-insensitive strings.
|
||||
*/
|
||||
export function compareCellValues(va: any, vb: any): number {
|
||||
if (va == null && vb == null) return 0;
|
||||
if (va == null) return -1;
|
||||
if (vb == null) return 1;
|
||||
if (typeof va === 'number' && typeof vb === 'number') {
|
||||
if (va < vb) return -1;
|
||||
if (va > vb) return 1;
|
||||
return 0;
|
||||
}
|
||||
const sa = String(va).toLowerCase();
|
||||
const sb = String(vb).toLowerCase();
|
||||
if (sa < sb) return -1;
|
||||
if (sa > sb) return 1;
|
||||
return 0;
|
||||
}
|
||||
|
||||
export function getViewData<T>(
|
||||
data: T[],
|
||||
effectiveColumns: Column<T>[],
|
||||
sortKey?: string,
|
||||
sortDir?: 'asc' | 'desc' | null,
|
||||
sortBy: ISortDescriptor[],
|
||||
filterText?: string,
|
||||
columnFilters?: Record<string, string>,
|
||||
filterMode: 'table' | 'data' = 'table',
|
||||
@@ -94,21 +114,17 @@ export function getViewData<T>(
|
||||
return true;
|
||||
});
|
||||
}
|
||||
if (!sortKey || !sortDir) return arr;
|
||||
const col = effectiveColumns.find((c) => String(c.key) === sortKey);
|
||||
if (!col) return arr;
|
||||
const dir = sortDir === 'asc' ? 1 : -1;
|
||||
if (!sortBy || sortBy.length === 0) return arr;
|
||||
// Pre-resolve descriptors -> columns once for performance.
|
||||
const resolved = sortBy
|
||||
.map((desc) => ({ desc, col: effectiveColumns.find((c) => String(c.key) === desc.key) }))
|
||||
.filter((entry): entry is { desc: ISortDescriptor; col: Column<T> } => !!entry.col);
|
||||
if (resolved.length === 0) return arr;
|
||||
arr.sort((a, b) => {
|
||||
const va = getCellValue(a, col);
|
||||
const vb = getCellValue(b, col);
|
||||
if (va == null && vb == null) return 0;
|
||||
if (va == null) return -1 * dir;
|
||||
if (vb == null) return 1 * dir;
|
||||
if (typeof va === 'number' && typeof vb === 'number') return (va - vb) * dir;
|
||||
const sa = String(va).toLowerCase();
|
||||
const sb = String(vb).toLowerCase();
|
||||
if (sa < sb) return -1 * dir;
|
||||
if (sa > sb) return 1 * dir;
|
||||
for (const { desc, col } of resolved) {
|
||||
const cmp = compareCellValues(getCellValue(a, col), getCellValue(b, col));
|
||||
if (cmp !== 0) return desc.dir === 'asc' ? cmp : -cmp;
|
||||
}
|
||||
return 0;
|
||||
});
|
||||
return arr;
|
||||
|
||||
@@ -1,6 +1,7 @@
|
||||
import { type ITableAction } from './dees-table.js';
|
||||
import * as plugins from '../../00plugins.js';
|
||||
import { html, css, cssManager } from '@design.estate/dees-element';
|
||||
import '@design.estate/dees-wcctools/demotools';
|
||||
|
||||
interface ITableDemoData {
|
||||
date: string;
|
||||
@@ -55,36 +56,66 @@ export const demoFunc = () => html`
|
||||
<div class="demo-container">
|
||||
<div class="demo-section">
|
||||
<h2 class="demo-title">Basic Table with Actions</h2>
|
||||
<p class="demo-description">A standard table with row actions, editable fields, and context menu support. Double-click on descriptions to edit. Grid lines are enabled by default.</p>
|
||||
<p class="demo-description">A standard table with row actions, editable cells, and context menu support. Double-click any cell to edit. Tab moves to the next editable cell, Enter to the row below, Esc cancels.</p>
|
||||
<dees-table
|
||||
heading1="Current Account Statement"
|
||||
heading2="Bunq - Payment Account 2 - April 2021"
|
||||
.editableFields="${['description']}"
|
||||
.columns=${[
|
||||
{ key: 'date', header: 'Date', sortable: true, editable: true, editor: 'date' },
|
||||
{ key: 'amount', header: 'Amount', editable: true, editor: 'text' },
|
||||
{
|
||||
key: 'category',
|
||||
header: 'Category',
|
||||
editable: true,
|
||||
editor: 'dropdown',
|
||||
editorOptions: {
|
||||
options: [
|
||||
{ option: 'Office Supplies', key: 'office' },
|
||||
{ option: 'Hardware', key: 'hardware' },
|
||||
{ option: 'Software', key: 'software' },
|
||||
{ option: 'Travel', key: 'travel' },
|
||||
],
|
||||
},
|
||||
},
|
||||
{ key: 'description', header: 'Description', editable: true },
|
||||
{ key: 'reconciled', header: 'OK', editable: true, editor: 'checkbox' },
|
||||
]}
|
||||
@cellEdit=${(e: CustomEvent) => console.log('cellEdit', e.detail)}
|
||||
.data=${[
|
||||
{
|
||||
date: '2021-04-01',
|
||||
amount: '2464.65 €',
|
||||
description: 'Printing Paper (Office Supplies) - STAPLES BREMEN',
|
||||
category: 'office',
|
||||
description: 'Printing Paper - STAPLES BREMEN',
|
||||
reconciled: true,
|
||||
},
|
||||
{
|
||||
date: '2021-04-02',
|
||||
amount: '165.65 €',
|
||||
description: 'Logitech Mouse (Hardware) - logi.com OnlineShop',
|
||||
category: 'hardware',
|
||||
description: 'Logitech Mouse - logi.com OnlineShop',
|
||||
reconciled: false,
|
||||
},
|
||||
{
|
||||
date: '2021-04-03',
|
||||
amount: '2999,00 €',
|
||||
description: 'Macbook Pro 16inch (Hardware) - Apple.de OnlineShop',
|
||||
category: 'hardware',
|
||||
description: 'Macbook Pro 16inch - Apple.de OnlineShop',
|
||||
reconciled: false,
|
||||
},
|
||||
{
|
||||
date: '2021-04-01',
|
||||
amount: '2464.65 €',
|
||||
category: 'office',
|
||||
description: 'Office-Supplies - STAPLES BREMEN',
|
||||
reconciled: true,
|
||||
},
|
||||
{
|
||||
date: '2021-04-01',
|
||||
amount: '2464.65 €',
|
||||
category: 'office',
|
||||
description: 'Office-Supplies - STAPLES BREMEN',
|
||||
reconciled: true,
|
||||
},
|
||||
]}
|
||||
dataName="transactions"
|
||||
@@ -510,13 +541,13 @@ export const demoFunc = () => html`
|
||||
<h2 class="demo-title">Column Filters + Sticky Header (New)</h2>
|
||||
<p class="demo-description">Per-column quick filters and sticky header with internal scroll. Try filtering the Name column. Uses --table-max-height var.</p>
|
||||
<style>
|
||||
dees-table[sticky-header] { --table-max-height: 220px; }
|
||||
dees-table[fixed-height] { --table-max-height: 220px; }
|
||||
</style>
|
||||
<dees-table
|
||||
heading1="Employees"
|
||||
heading2="Quick filter per column + sticky header"
|
||||
.showColumnFilters=${true}
|
||||
.stickyHeader=${true}
|
||||
.fixedHeight=${true}
|
||||
.columns=${[
|
||||
{ key: 'name', header: 'Name', sortable: true },
|
||||
{ key: 'email', header: 'Email', sortable: true },
|
||||
@@ -580,6 +611,44 @@ export const demoFunc = () => html`
|
||||
></dees-table>
|
||||
</div>
|
||||
|
||||
<div class="demo-section">
|
||||
<h2 class="demo-title">Multi-Column Sort</h2>
|
||||
<p class="demo-description">
|
||||
Click any column header for a single-column sort. Hold Shift while clicking to add the
|
||||
column to a multi-sort cascade (or cycle its direction). Right-click any sortable header
|
||||
to open a menu where you can pin a column to a specific priority slot, remove it, or
|
||||
clear the cascade.
|
||||
</p>
|
||||
<dees-table
|
||||
heading1="People Directory"
|
||||
heading2="Pre-seeded with department ▲ 1, name ▲ 2"
|
||||
.sortBy=${[
|
||||
{ key: 'department', dir: 'asc' },
|
||||
{ key: 'name', dir: 'asc' },
|
||||
]}
|
||||
.columns=${[
|
||||
{ key: 'department', header: 'Department', sortable: true },
|
||||
{ key: 'name', header: 'Name', sortable: true },
|
||||
{ key: 'role', header: 'Role', sortable: true },
|
||||
{ key: 'createdAt', header: 'Created', sortable: true },
|
||||
{ key: 'location', header: 'Location', sortable: true },
|
||||
{ key: 'status', header: 'Status', sortable: true },
|
||||
]}
|
||||
.data=${[
|
||||
{ department: 'R&D', name: 'Alice Johnson', role: 'Engineer', createdAt: '2023-01-12', location: 'Berlin', status: 'Active' },
|
||||
{ department: 'R&D', name: 'Diana Martinez', role: 'Engineer', createdAt: '2020-06-30', location: 'Madrid', status: 'Active' },
|
||||
{ department: 'R&D', name: 'Mark Lee', role: 'Engineer', createdAt: '2024-03-04', location: 'Berlin', status: 'Active' },
|
||||
{ department: 'Design', name: 'Bob Smith', role: 'Designer', createdAt: '2022-11-05', location: 'Paris', status: 'Active' },
|
||||
{ department: 'Design', name: 'Sara Kim', role: 'Designer', createdAt: '2021-08-19', location: 'Paris', status: 'On Leave' },
|
||||
{ department: 'Ops', name: 'Charlie Davis', role: 'Manager', createdAt: '2021-04-21', location: 'London', status: 'On Leave' },
|
||||
{ department: 'Ops', name: 'Helena Voss', role: 'SRE', createdAt: '2023-07-22', location: 'London', status: 'Active' },
|
||||
{ department: 'QA', name: 'Fiona Clark', role: 'QA', createdAt: '2022-03-14', location: 'Vienna', status: 'Active' },
|
||||
{ department: 'QA', name: 'Tomás Rivera', role: 'QA', createdAt: '2024-01-09', location: 'Madrid', status: 'Active' },
|
||||
{ department: 'CS', name: 'Ethan Brown', role: 'Support', createdAt: '2019-09-18', location: 'Rome', status: 'Inactive' },
|
||||
]}
|
||||
></dees-table>
|
||||
</div>
|
||||
|
||||
<div class="demo-section">
|
||||
<h2 class="demo-title">Wide Properties + Many Actions</h2>
|
||||
<p class="demo-description">A table with many columns and rich actions to stress test layout and sticky Actions.</p>
|
||||
@@ -631,8 +700,9 @@ export const demoFunc = () => html`
|
||||
</style>
|
||||
<dees-table
|
||||
id="scrollSmallHeight"
|
||||
.stickyHeader=${true}
|
||||
heading1="People Directory (Scrollable)"
|
||||
.fixedHeight=${true}
|
||||
.virtualized=${true}
|
||||
heading1="People Directory (Scrollable, Virtualized)"
|
||||
heading2="Forced scrolling with many items"
|
||||
.columns=${[
|
||||
{ key: 'id', header: 'ID', sortable: true },
|
||||
@@ -673,6 +743,71 @@ export const demoFunc = () => html`
|
||||
] as ITableAction[]}
|
||||
></dees-table>
|
||||
</div>
|
||||
|
||||
<dees-demowrapper .runAfterRender=${async (elementArg: HTMLElement) => {
|
||||
const tableEl = elementArg.querySelector('#demoLiveFlash') as any;
|
||||
if (!tableEl) return;
|
||||
// Guard against double-start if runAfterRender fires more than once
|
||||
// (e.g. across hot-reload cycles).
|
||||
if (tableEl.__liveFlashTimerId) {
|
||||
window.clearInterval(tableEl.__liveFlashTimerId);
|
||||
}
|
||||
const tick = () => {
|
||||
if (!Array.isArray(tableEl.data) || tableEl.data.length === 0) return;
|
||||
const next = tableEl.data.map((r: any) => ({ ...r }));
|
||||
const count = 1 + Math.floor(Math.random() * 3);
|
||||
for (let i = 0; i < count; i++) {
|
||||
const idx = Math.floor(Math.random() * next.length);
|
||||
const delta = +((Math.random() * 2 - 1) * 3).toFixed(2);
|
||||
const newPrice = Math.max(1, +(next[idx].price + delta).toFixed(2));
|
||||
next[idx] = {
|
||||
...next[idx],
|
||||
price: newPrice,
|
||||
change: delta,
|
||||
updatedAt: new Date().toLocaleTimeString(),
|
||||
};
|
||||
}
|
||||
tableEl.data = next;
|
||||
};
|
||||
tableEl.__liveFlashTimerId = window.setInterval(tick, 1500);
|
||||
}}>
|
||||
<div class="demo-section">
|
||||
<h2 class="demo-title">Live Updates with Flash Highlighting</h2>
|
||||
<p class="demo-description">
|
||||
Opt-in cell-flash via <code>highlight-updates="flash"</code>. The ticker below mutates
|
||||
random rows every 1.5s and reassigns <code>.data</code>. Updated cells briefly flash
|
||||
amber and fade out. Requires <code>rowKey</code> (here <code>"symbol"</code>). Honors
|
||||
<code>prefers-reduced-motion</code>. Row selection persists across updates — click a
|
||||
row, then watch it stay selected as the data churns.
|
||||
</p>
|
||||
<dees-table
|
||||
id="demoLiveFlash"
|
||||
.rowKey=${'symbol'}
|
||||
highlight-updates="flash"
|
||||
.selectionMode=${'multi'}
|
||||
heading1="Live Market Feed"
|
||||
heading2="Flashing cells indicate updated values"
|
||||
.columns=${[
|
||||
{ key: 'symbol', header: 'Symbol', sortable: true },
|
||||
{ key: 'price', header: 'Price', sortable: true },
|
||||
{ key: 'change', header: 'Δ', sortable: true },
|
||||
{ key: 'updatedAt', header: 'Updated' },
|
||||
]}
|
||||
.data=${[
|
||||
{ symbol: 'AAPL', price: 182.52, change: 0, updatedAt: '—' },
|
||||
{ symbol: 'MSFT', price: 414.18, change: 0, updatedAt: '—' },
|
||||
{ symbol: 'GOOG', price: 168.74, change: 0, updatedAt: '—' },
|
||||
{ symbol: 'AMZN', price: 186.13, change: 0, updatedAt: '—' },
|
||||
{ symbol: 'TSLA', price: 248.50, change: 0, updatedAt: '—' },
|
||||
{ symbol: 'NVDA', price: 877.35, change: 0, updatedAt: '—' },
|
||||
{ symbol: 'META', price: 492.96, change: 0, updatedAt: '—' },
|
||||
{ symbol: 'NFLX', price: 605.88, change: 0, updatedAt: '—' },
|
||||
{ symbol: 'AMD', price: 165.24, change: 0, updatedAt: '—' },
|
||||
{ symbol: 'INTC', price: 42.15, change: 0, updatedAt: '—' },
|
||||
]}
|
||||
></dees-table>
|
||||
</div>
|
||||
</dees-demowrapper>
|
||||
</div>
|
||||
</div>
|
||||
`;
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -13,7 +13,7 @@ export const tableStyles: CSSResult[] = [
|
||||
}
|
||||
|
||||
dees-tile {
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 3.9%)', 'hsl(0 0% 98%)')};
|
||||
color: var(--dees-color-text-primary);
|
||||
font-family: ${cssGeistFontFamily};
|
||||
font-weight: 400;
|
||||
font-size: 14px;
|
||||
@@ -41,7 +41,7 @@ export const tableStyles: CSSResult[] = [
|
||||
.heading1 {
|
||||
font-size: 14px;
|
||||
font-weight: 500;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 20%)', 'hsl(0 0% 63.9%)')};
|
||||
color: var(--dees-color-text-secondary);
|
||||
letter-spacing: -0.01em;
|
||||
}
|
||||
|
||||
@@ -69,18 +69,18 @@ export const tableStyles: CSSResult[] = [
|
||||
padding: 4px 10px;
|
||||
font-size: 12px;
|
||||
font-weight: 500;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
background: transparent;
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border: 1px solid var(--dees-color-border-default);
|
||||
border-radius: 4px;
|
||||
cursor: pointer;
|
||||
transition: all 0.15s ease;
|
||||
}
|
||||
|
||||
.headerAction:hover {
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 9%)', 'hsl(0 0% 95%)')};
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95.1%)', 'hsl(0 0% 14.9%)')};
|
||||
border-color: ${cssManager.bdTheme('hsl(0 0% 79.8%)', 'hsl(0 0% 20.9%)')};
|
||||
color: var(--dees-color-text-primary);
|
||||
background: var(--dees-color-hover);
|
||||
border-color: var(--dees-color-border-strong);
|
||||
}
|
||||
|
||||
.headerAction dees-icon {
|
||||
@@ -93,8 +93,8 @@ export const tableStyles: CSSResult[] = [
|
||||
grid-gap: 16px;
|
||||
grid-template-columns: 1fr max-content;
|
||||
padding: 16px 24px;
|
||||
background: ${cssManager.bdTheme('hsl(210 40% 98%)', 'hsl(0 0% 3.9%)')};
|
||||
border-bottom: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
background: var(--dees-color-bg-secondary);
|
||||
border-bottom: 1px solid var(--dees-color-border-default);
|
||||
transition: all 0.2s ease;
|
||||
}
|
||||
|
||||
@@ -114,29 +114,48 @@ export const tableStyles: CSSResult[] = [
|
||||
border-bottom-width: 0px;
|
||||
}
|
||||
|
||||
/* Default mode (Mode B, page sticky): horizontal scroll lives on
|
||||
.tableScroll (so wide tables don't get clipped by an ancestor
|
||||
overflow:hidden such as dees-tile). Vertical sticky is handled by
|
||||
a JS-managed floating header (.floatingHeader, position:fixed),
|
||||
which is unaffected by ancestor overflow. */
|
||||
.tableScroll {
|
||||
/* enable horizontal scroll only when content exceeds width */
|
||||
position: relative;
|
||||
overflow-x: auto;
|
||||
/* prevent vertical scroll inside the table container */
|
||||
overflow-y: hidden;
|
||||
/* avoid reserving extra space for classic scrollbars where possible */
|
||||
scrollbar-gutter: stable both-edges;
|
||||
overflow-y: visible;
|
||||
scrollbar-gutter: stable;
|
||||
}
|
||||
/* Hide horizontal scrollbar entirely when not using sticky header */
|
||||
:host(:not([sticky-header])) .tableScroll {
|
||||
-ms-overflow-style: none; /* IE/Edge */
|
||||
scrollbar-width: none; /* Firefox (hides both axes) */
|
||||
}
|
||||
:host(:not([sticky-header])) .tableScroll::-webkit-scrollbar {
|
||||
display: none; /* Chrome/Safari */
|
||||
}
|
||||
/* In sticky-header mode, hide only the horizontal scrollbar in WebKit/Blink */
|
||||
:host([sticky-header]) .tableScroll::-webkit-scrollbar:horizontal {
|
||||
height: 0px;
|
||||
}
|
||||
:host([sticky-header]) .tableScroll {
|
||||
/* Mode A, internal scroll: opt-in via fixed-height attribute.
|
||||
The table scrolls inside its own box and the header sticks via plain CSS sticky. */
|
||||
:host([fixed-height]) .tableScroll {
|
||||
max-height: var(--table-max-height, 360px);
|
||||
overflow: auto;
|
||||
scrollbar-gutter: stable both-edges;
|
||||
}
|
||||
:host([fixed-height]) .tableScroll::-webkit-scrollbar:horizontal {
|
||||
height: 0px;
|
||||
}
|
||||
|
||||
/* Floating header overlay (Mode B). Position is managed by JS so it
|
||||
escapes any ancestor overflow:hidden (position:fixed is not clipped
|
||||
by overflow ancestors). */
|
||||
.floatingHeader {
|
||||
position: fixed;
|
||||
top: 0;
|
||||
left: 0;
|
||||
z-index: 100;
|
||||
visibility: hidden;
|
||||
overflow: hidden;
|
||||
pointer-events: none;
|
||||
}
|
||||
.floatingHeader.active {
|
||||
visibility: visible;
|
||||
}
|
||||
.floatingHeader table {
|
||||
margin: 0;
|
||||
}
|
||||
.floatingHeader th {
|
||||
pointer-events: auto;
|
||||
}
|
||||
|
||||
table {
|
||||
@@ -157,22 +176,32 @@ export const tableStyles: CSSResult[] = [
|
||||
|
||||
thead {
|
||||
background: ${cssManager.bdTheme('hsl(210 40% 96.1%)', 'hsl(0 0% 9%)')};
|
||||
border-bottom: 1px solid ${cssManager.bdTheme('hsl(0 0% 79.8%)', 'hsl(0 0% 20.9%)')};
|
||||
border-bottom: 1px solid var(--dees-color-border-strong);
|
||||
}
|
||||
:host([sticky-header]) thead th {
|
||||
/* th needs its own background so sticky cells paint over scrolled rows
|
||||
(browsers don't paint the <thead> box behind a sticky <th>). */
|
||||
th {
|
||||
background: ${cssManager.bdTheme('hsl(210 40% 96.1%)', 'hsl(0 0% 9%)')};
|
||||
}
|
||||
/* Mode A — internal scroll sticky */
|
||||
:host([fixed-height]) thead th {
|
||||
position: sticky;
|
||||
top: 0;
|
||||
z-index: 2;
|
||||
}
|
||||
:host([fixed-height]) thead tr.filtersRow th {
|
||||
top: 36px; /* matches th { height: 36px } below */
|
||||
}
|
||||
|
||||
tbody tr {
|
||||
transition: background-color 0.15s ease;
|
||||
position: relative;
|
||||
user-select: none;
|
||||
}
|
||||
|
||||
/* Default horizontal lines (bottom border only) */
|
||||
tbody tr {
|
||||
border-bottom: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border-bottom: 1px solid var(--dees-color-border-default);
|
||||
}
|
||||
|
||||
tbody tr:last-child {
|
||||
@@ -181,8 +210,8 @@ export const tableStyles: CSSResult[] = [
|
||||
|
||||
/* Full horizontal lines when enabled */
|
||||
:host([show-horizontal-lines]) tbody tr {
|
||||
border-top: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border-bottom: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border-top: 1px solid var(--dees-color-border-default);
|
||||
border-bottom: 1px solid var(--dees-color-border-default);
|
||||
}
|
||||
|
||||
:host([show-horizontal-lines]) tbody tr:first-child {
|
||||
@@ -190,7 +219,7 @@ export const tableStyles: CSSResult[] = [
|
||||
}
|
||||
|
||||
:host([show-horizontal-lines]) tbody tr:last-child {
|
||||
border-bottom: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border-bottom: 1px solid var(--dees-color-border-default);
|
||||
}
|
||||
|
||||
tbody tr:hover {
|
||||
@@ -222,13 +251,13 @@ export const tableStyles: CSSResult[] = [
|
||||
|
||||
/* Grid mode - shows both vertical and horizontal lines */
|
||||
:host([show-grid]) th {
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border: 1px solid var(--dees-color-border-default);
|
||||
border-left: none;
|
||||
border-top: none;
|
||||
}
|
||||
|
||||
:host([show-grid]) td {
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border: 1px solid var(--dees-color-border-default);
|
||||
border-left: none;
|
||||
border-top: none;
|
||||
}
|
||||
@@ -251,12 +280,12 @@ export const tableStyles: CSSResult[] = [
|
||||
tbody td.actionsCol {
|
||||
position: sticky;
|
||||
right: 0;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 3.9%)')};
|
||||
background: var(--dees-color-bg-primary);
|
||||
}
|
||||
thead th.actionsCol { z-index: 3; }
|
||||
tbody td.actionsCol {
|
||||
z-index: 1;
|
||||
box-shadow: -1px 0 0 0 ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
box-shadow: -1px 0 0 0 var(--dees-color-border-default);
|
||||
}
|
||||
|
||||
tbody tr.selected {
|
||||
@@ -277,19 +306,45 @@ export const tableStyles: CSSResult[] = [
|
||||
letter-spacing: -0.01em;
|
||||
}
|
||||
|
||||
th[role='columnheader']:hover {
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
th .sortArrow {
|
||||
display: inline-block;
|
||||
margin-left: 6px;
|
||||
font-size: 10px;
|
||||
line-height: 1;
|
||||
opacity: 0.7;
|
||||
vertical-align: middle;
|
||||
}
|
||||
|
||||
th .sortBadge {
|
||||
display: inline-block;
|
||||
margin-left: 3px;
|
||||
padding: 1px 5px;
|
||||
font-size: 10px;
|
||||
font-weight: 600;
|
||||
line-height: 1;
|
||||
color: ${cssManager.bdTheme('hsl(222.2 47.4% 30%)', 'hsl(217.2 91.2% 75%)')};
|
||||
background: ${cssManager.bdTheme('hsl(222.2 47.4% 51.2% / 0.12)', 'hsl(217.2 91.2% 59.8% / 0.18)')};
|
||||
border-radius: 999px;
|
||||
vertical-align: middle;
|
||||
}
|
||||
|
||||
:host([show-vertical-lines]) th {
|
||||
border-right: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border-right: 1px solid var(--dees-color-border-default);
|
||||
}
|
||||
|
||||
td {
|
||||
padding: 8px 16px;
|
||||
vertical-align: middle;
|
||||
font-size: 13px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 3.9%)', 'hsl(0 0% 98%)')};
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
:host([show-vertical-lines]) td {
|
||||
border-right: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border-right: 1px solid var(--dees-color-border-default);
|
||||
}
|
||||
|
||||
th:first-child,
|
||||
@@ -317,32 +372,136 @@ export const tableStyles: CSSResult[] = [
|
||||
min-height: 24px;
|
||||
line-height: 24px;
|
||||
}
|
||||
td input {
|
||||
position: absolute;
|
||||
top: 4px;
|
||||
bottom: 4px;
|
||||
left: 20px;
|
||||
right: 20px;
|
||||
width: calc(100% - 40px);
|
||||
height: calc(100% - 8px);
|
||||
padding: 0 12px;
|
||||
outline: none;
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border-radius: 6px;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 9%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 3.9%)', 'hsl(0 0% 98%)')};
|
||||
font-family: inherit;
|
||||
font-size: inherit;
|
||||
font-weight: inherit;
|
||||
transition: all 0.15s ease;
|
||||
box-shadow: 0 1px 2px 0 rgb(0 0 0 / 0.05);
|
||||
|
||||
/* ---- Cell flash highlighting (opt-in via highlight-updates="flash") ----
|
||||
Bloomberg/TradingView-style: the text itself briefly takes an accent
|
||||
color then fades back to the default. No background tint, no layout
|
||||
shift, no weight change. Readable, modern, subtle.
|
||||
Consumers can override per instance:
|
||||
dees-table#myTable { --dees-table-flash-color: hsl(142 76% 40%); }
|
||||
*/
|
||||
:host {
|
||||
--dees-table-flash-color: ${cssManager.bdTheme(
|
||||
'hsl(32 95% 44%)',
|
||||
'hsl(45 93% 62%)'
|
||||
)};
|
||||
--dees-table-flash-easing: cubic-bezier(0.22, 0.61, 0.36, 1);
|
||||
}
|
||||
|
||||
td input:focus {
|
||||
border-color: ${cssManager.bdTheme('hsl(222.2 47.4% 51.2%)', 'hsl(217.2 91.2% 59.8%)')};
|
||||
outline: 2px solid transparent;
|
||||
outline-offset: 2px;
|
||||
box-shadow: 0 0 0 2px ${cssManager.bdTheme('hsl(222.2 47.4% 51.2% / 0.2)', 'hsl(217.2 91.2% 59.8% / 0.2)')};
|
||||
.innerCellContainer.flashing {
|
||||
animation: dees-table-cell-flash
|
||||
var(--dees-table-flash-duration, 900ms)
|
||||
var(--dees-table-flash-easing);
|
||||
}
|
||||
|
||||
/* Hold the accent color briefly, then fade back to the theme's default
|
||||
text color. Inherits to child text and to SVG icons that use
|
||||
currentColor. Cells with explicit color overrides in renderers are
|
||||
intentionally unaffected. */
|
||||
@keyframes dees-table-cell-flash {
|
||||
0%,
|
||||
35% { color: var(--dees-table-flash-color); }
|
||||
100% { color: var(--dees-color-text-primary); }
|
||||
}
|
||||
|
||||
/* Border/background flash variant for cells with styled content
|
||||
(badges, icons, custom components) where a text-color animation
|
||||
would be invisible. Activated via flashBorder on Column. */
|
||||
.innerCellContainer.flashing-border {
|
||||
animation: dees-table-cell-flash-border
|
||||
var(--dees-table-flash-duration, 900ms)
|
||||
var(--dees-table-flash-easing);
|
||||
border-radius: 3px;
|
||||
}
|
||||
|
||||
@keyframes dees-table-cell-flash-border {
|
||||
0%,
|
||||
35% {
|
||||
box-shadow: inset 0 0 0 1.5px var(--dees-table-flash-color);
|
||||
background: ${cssManager.bdTheme(
|
||||
'hsl(45 93% 62% / 0.10)',
|
||||
'hsl(45 93% 62% / 0.08)'
|
||||
)};
|
||||
}
|
||||
100% {
|
||||
box-shadow: inset 0 0 0 1.5px transparent;
|
||||
background: transparent;
|
||||
}
|
||||
}
|
||||
|
||||
@media (prefers-reduced-motion: reduce) {
|
||||
.innerCellContainer.flashing {
|
||||
animation: none;
|
||||
color: var(--dees-table-flash-color);
|
||||
}
|
||||
.innerCellContainer.flashing-border {
|
||||
animation: none;
|
||||
box-shadow: inset 0 0 0 1.5px var(--dees-table-flash-color);
|
||||
background: ${cssManager.bdTheme(
|
||||
'hsl(45 93% 62% / 0.10)',
|
||||
'hsl(45 93% 62% / 0.08)'
|
||||
)};
|
||||
}
|
||||
}
|
||||
|
||||
/* Dev-time warning banner shown when highlight-updates="flash" but
|
||||
rowKey is missing. Consumers should never ship this to production. */
|
||||
.flashConfigWarning {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
gap: 8px;
|
||||
margin: 8px 16px 0;
|
||||
padding: 8px 12px;
|
||||
border-left: 3px solid ${cssManager.bdTheme('hsl(38 92% 50%)', 'hsl(48 96% 63%)')};
|
||||
background: ${cssManager.bdTheme('hsl(48 96% 89% / 0.6)', 'hsl(48 96% 30% / 0.15)')};
|
||||
color: ${cssManager.bdTheme('hsl(32 81% 29%)', 'hsl(48 96% 80%)')};
|
||||
font-size: 12px;
|
||||
line-height: 1.4;
|
||||
border-radius: 4px;
|
||||
}
|
||||
.flashConfigWarning dees-icon {
|
||||
width: 14px;
|
||||
height: 14px;
|
||||
flex: 0 0 auto;
|
||||
}
|
||||
.flashConfigWarning code {
|
||||
padding: 1px 4px;
|
||||
border-radius: 3px;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100% / 0.6)', 'hsl(0 0% 0% / 0.3)')};
|
||||
font-family: ${cssGeistFontFamily};
|
||||
font-size: 11px;
|
||||
}
|
||||
|
||||
/* Editable cell affordances */
|
||||
td.editable {
|
||||
cursor: text;
|
||||
}
|
||||
td.focused {
|
||||
outline: 2px solid ${cssManager.bdTheme(
|
||||
'hsl(222.2 47.4% 51.2% / 0.6)',
|
||||
'hsl(217.2 91.2% 59.8% / 0.6)'
|
||||
)};
|
||||
outline-offset: -2px;
|
||||
}
|
||||
td.editingCell {
|
||||
padding: 0;
|
||||
outline: 2px solid ${cssManager.bdTheme(
|
||||
'hsl(222.2 47.4% 51.2% / 0.6)',
|
||||
'hsl(217.2 91.2% 59.8% / 0.6)'
|
||||
)};
|
||||
outline-offset: -2px;
|
||||
}
|
||||
td.editingCell .innerCellContainer {
|
||||
padding: 0;
|
||||
line-height: normal;
|
||||
}
|
||||
td.editingCell dees-input-text,
|
||||
td.editingCell dees-input-checkbox,
|
||||
td.editingCell dees-input-dropdown,
|
||||
td.editingCell dees-input-datepicker,
|
||||
td.editingCell dees-input-tags {
|
||||
display: block;
|
||||
width: 100%;
|
||||
}
|
||||
|
||||
/* filter row */
|
||||
@@ -355,9 +514,9 @@ export const tableStyles: CSSResult[] = [
|
||||
padding: 6px 8px;
|
||||
font-size: 13px;
|
||||
border-radius: 6px;
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border: 1px solid var(--dees-color-border-default);
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 9%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 3.9%)', 'hsl(0 0% 98%)')};
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
.actionsContainer {
|
||||
display: flex;
|
||||
@@ -398,7 +557,7 @@ export const tableStyles: CSSResult[] = [
|
||||
height: 32px;
|
||||
padding: 0 16px;
|
||||
font-size: 11px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45%)', 'hsl(0 0% 55%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
width: 100%;
|
||||
box-sizing: border-box;
|
||||
}
|
||||
|
||||
@@ -15,15 +15,84 @@ export interface ITableAction<T = any> {
|
||||
actionFunc: (actionDataArg: ITableActionDataArg<T>) => Promise<any>;
|
||||
}
|
||||
|
||||
/**
|
||||
* Available cell editor types. Each maps to a dees-input-* component.
|
||||
* Use `editor` on `Column<T>` to opt a column into in-cell editing.
|
||||
*/
|
||||
export type TCellEditorType =
|
||||
| 'text'
|
||||
| 'number'
|
||||
| 'checkbox'
|
||||
| 'dropdown'
|
||||
| 'date'
|
||||
| 'tags';
|
||||
|
||||
/** Detail payload for the `cellEdit` CustomEvent dispatched on commit. */
|
||||
export interface ICellEditDetail<T = any> {
|
||||
row: T;
|
||||
key: string;
|
||||
oldValue: any;
|
||||
newValue: any;
|
||||
}
|
||||
|
||||
/** Detail payload for the `cellEditError` CustomEvent dispatched on validation failure. */
|
||||
export interface ICellEditErrorDetail<T = any> {
|
||||
row: T;
|
||||
key: string;
|
||||
value: any;
|
||||
message: string;
|
||||
}
|
||||
|
||||
export interface Column<T = any> {
|
||||
key: keyof T | string;
|
||||
header?: string | TemplateResult;
|
||||
value?: (row: T) => any;
|
||||
renderer?: (value: any, row: T, ctx: { rowIndex: number; colIndex: number; column: Column<T> }) => TemplateResult | string;
|
||||
/** Whether this column can be sorted by clicking its header. Defaults to `true`; set to `false` to disable. */
|
||||
sortable?: boolean;
|
||||
/** whether this column participates in per-column quick filtering (default: true) */
|
||||
filterable?: boolean;
|
||||
hidden?: boolean;
|
||||
/** Marks the column as editable. Shorthand for `editor: 'text'` if no editor is specified. */
|
||||
editable?: boolean;
|
||||
/** Editor type — picks the dees-input-* component used for in-cell editing. */
|
||||
editor?: TCellEditorType;
|
||||
/** Editor-specific options forwarded to the editor (e.g. `{ options: [...] }` for dropdowns). */
|
||||
editorOptions?: Record<string, any>;
|
||||
/** Convert raw row value -> editor value. Defaults to identity. */
|
||||
format?: (raw: any, row: T) => any;
|
||||
/** Convert editor value -> raw row value. Defaults to identity. */
|
||||
parse?: (editorValue: any, row: T) => any;
|
||||
/** Validate the parsed value before commit. Return string for error, true/void for ok. */
|
||||
validate?: (value: any, row: T) => true | string | void;
|
||||
|
||||
// ─── Flash highlight options ───
|
||||
|
||||
/**
|
||||
* Custom comparison for flash-on-update diffing.
|
||||
* Return `true` if the cell should flash (i.e. the values differ).
|
||||
* When absent, non-primitive cell values are skipped entirely
|
||||
* (only strings, numbers, booleans, null, and undefined are diffed).
|
||||
*/
|
||||
flashCompare?: (prevVal: any, nextVal: any) => boolean;
|
||||
|
||||
/**
|
||||
* When `true`, flash this cell with a border/background pulse instead of
|
||||
* the default text-color animation. Useful for cells containing styled
|
||||
* badges, icons, or custom web-component renderings where a text-color
|
||||
* change would be invisible.
|
||||
* @default false
|
||||
*/
|
||||
flashBorder?: boolean;
|
||||
}
|
||||
|
||||
/**
|
||||
* One entry in a multi-column sort cascade. Order in the array reflects priority:
|
||||
* index 0 is the primary sort key, index 1 the secondary tiebreaker, and so on.
|
||||
*/
|
||||
export interface ISortDescriptor {
|
||||
key: string;
|
||||
dir: 'asc' | 'desc';
|
||||
}
|
||||
|
||||
export type TDisplayFunction<T = any> = (itemArg: T) => Record<string, any>;
|
||||
|
||||
@@ -1,11 +1,245 @@
|
||||
import { html } from '@design.estate/dees-element';
|
||||
|
||||
import { DeesProgressbar } from '../dees-progressbar/dees-progressbar.js';
|
||||
import { html, css, cssManager } from '@design.estate/dees-element';
|
||||
import '@design.estate/dees-wcctools/demotools';
|
||||
import type { DeesProgressbar } from './dees-progressbar.js';
|
||||
|
||||
export const demoFunc = () => {
|
||||
const terminalSnapshots = [
|
||||
['Resolving workspace packages'],
|
||||
['Resolving workspace packages', 'Downloading ui-assets.tar.gz'],
|
||||
['Resolving workspace packages', 'Downloading ui-assets.tar.gz', 'Verifying checksum'],
|
||||
['Resolving workspace packages', 'Downloading ui-assets.tar.gz', 'Verifying checksum', 'Extracting release bundle'],
|
||||
['Resolving workspace packages', 'Downloading ui-assets.tar.gz', 'Verifying checksum', 'Extracting release bundle', 'Restarting application'],
|
||||
];
|
||||
|
||||
const getUploadStatus = (percentage: number): string => {
|
||||
if (percentage >= 100) {
|
||||
return 'Upload complete. Finalizing package manifest...';
|
||||
}
|
||||
|
||||
if (percentage >= 82) {
|
||||
return 'Verifying checksums before handoff...';
|
||||
}
|
||||
|
||||
if (percentage >= 55) {
|
||||
return 'Uploading thumbnails to edge cache...';
|
||||
}
|
||||
|
||||
if (percentage >= 25) {
|
||||
return 'Streaming source files to the remote worker...';
|
||||
}
|
||||
|
||||
return 'Preparing archive and dependency graph...';
|
||||
};
|
||||
|
||||
return html`
|
||||
<dees-demowrapper .runAfterRender=${async (elementArg: HTMLElement) => {
|
||||
const liveProgressbar = elementArg.querySelector('#live-progress') as DeesProgressbar | null;
|
||||
const terminalProgressbar = elementArg.querySelector('#terminal-progress') as DeesProgressbar | null;
|
||||
const demoElement = elementArg as HTMLElement & {
|
||||
__progressbarDemoIntervalId?: number;
|
||||
};
|
||||
|
||||
if (!liveProgressbar || !terminalProgressbar) {
|
||||
return;
|
||||
}
|
||||
|
||||
if (demoElement.__progressbarDemoIntervalId) {
|
||||
window.clearInterval(demoElement.__progressbarDemoIntervalId);
|
||||
}
|
||||
|
||||
let livePercentage = 12;
|
||||
let terminalSnapshotIndex = 0;
|
||||
|
||||
const updateDemo = () => {
|
||||
liveProgressbar.percentage = livePercentage;
|
||||
liveProgressbar.statusText = getUploadStatus(livePercentage);
|
||||
|
||||
terminalProgressbar.terminalLines = [...terminalSnapshots[terminalSnapshotIndex]];
|
||||
terminalProgressbar.percentage = Math.min(100, (terminalSnapshotIndex + 1) * 20);
|
||||
terminalProgressbar.indeterminate = terminalSnapshotIndex < terminalSnapshots.length - 1;
|
||||
|
||||
livePercentage = livePercentage >= 100 ? 12 : Math.min(100, livePercentage + 11);
|
||||
terminalSnapshotIndex = terminalSnapshotIndex >= terminalSnapshots.length - 1 ? 0 : terminalSnapshotIndex + 1;
|
||||
};
|
||||
|
||||
updateDemo();
|
||||
demoElement.__progressbarDemoIntervalId = window.setInterval(updateDemo, 1400);
|
||||
}}>
|
||||
<style>
|
||||
${css`
|
||||
.demoBox {
|
||||
position: relative;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95%)', 'hsl(0 0% 9%)')};
|
||||
width: 100%;
|
||||
height: 100%;
|
||||
box-sizing: border-box;
|
||||
padding: 40px;
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 24px;
|
||||
}
|
||||
|
||||
.demoIntro {
|
||||
max-width: 720px;
|
||||
color: ${cssManager.bdTheme('hsl(215 20% 30%)', 'hsl(215 18% 76%)')};
|
||||
font-size: 14px;
|
||||
line-height: 1.6;
|
||||
}
|
||||
|
||||
.showcaseGrid {
|
||||
display: grid;
|
||||
grid-template-columns: repeat(auto-fit, minmax(280px, 1fr));
|
||||
gap: 18px;
|
||||
}
|
||||
|
||||
.showcaseCard {
|
||||
background: ${cssManager.bdTheme('rgba(255,255,255,0.78)', 'rgba(255,255,255,0.04)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(210 22% 86%)', 'hsl(210 10% 18%)')};
|
||||
border-radius: 16px;
|
||||
padding: 20px;
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 16px;
|
||||
backdrop-filter: blur(8px);
|
||||
}
|
||||
|
||||
.showcaseCard.wide {
|
||||
grid-column: span 2;
|
||||
}
|
||||
|
||||
.showcaseCard h3 {
|
||||
margin: 0;
|
||||
font-size: 15px;
|
||||
font-weight: 600;
|
||||
}
|
||||
|
||||
.showcaseCard p {
|
||||
margin: 0;
|
||||
color: ${cssManager.bdTheme('hsl(215 14% 40%)', 'hsl(215 10% 66%)')};
|
||||
font-size: 13px;
|
||||
line-height: 1.55;
|
||||
}
|
||||
|
||||
.progressStack {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 14px;
|
||||
}
|
||||
|
||||
.codeLabel {
|
||||
font-family: 'SF Mono', 'Monaco', 'Inconsolata', 'Fira Code', monospace;
|
||||
font-size: 11px;
|
||||
color: ${cssManager.bdTheme('hsl(215 14% 44%)', 'hsl(215 10% 70%)')};
|
||||
letter-spacing: 0.03em;
|
||||
text-transform: uppercase;
|
||||
}
|
||||
|
||||
@media (max-width: 900px) {
|
||||
.demoBox {
|
||||
padding: 24px;
|
||||
}
|
||||
|
||||
.showcaseCard.wide {
|
||||
grid-column: span 1;
|
||||
}
|
||||
}
|
||||
`}
|
||||
</style>
|
||||
<div class="demoBox">
|
||||
<div class="demoIntro">
|
||||
<code>dees-progressbar</code> can now pair a classic progress bar with a fixed-height status area. Use simple status text for clear user-facing updates or switch to terminal-like lines when you want recent steps to stay visible without causing layout jumps.
|
||||
</div>
|
||||
<div class="showcaseGrid">
|
||||
<section class="showcaseCard">
|
||||
<div class="codeLabel">Determinate</div>
|
||||
<h3>Percentage plus current task</h3>
|
||||
<p>Use a label, a percentage, and one short status line when the work is measurable.</p>
|
||||
<div class="progressStack">
|
||||
<dees-progressbar
|
||||
.percentage=${50}
|
||||
label="Media upload"
|
||||
.percentage=${68}
|
||||
statusText="Uploading thumbnails to edge cache..."
|
||||
.statusRows=${2}
|
||||
></dees-progressbar>
|
||||
<dees-progressbar
|
||||
label="Asset sync"
|
||||
.percentage=${100}
|
||||
statusText="All files are synced and available."
|
||||
.statusRows=${2}
|
||||
></dees-progressbar>
|
||||
</div>
|
||||
</section>
|
||||
|
||||
<section class="showcaseCard">
|
||||
<div class="codeLabel">Indeterminate</div>
|
||||
<h3>Spinner-style text indicator</h3>
|
||||
<p>When there is no trustworthy percentage yet, keep the bar moving and let the text explain what is happening.</p>
|
||||
<div class="progressStack">
|
||||
<dees-progressbar
|
||||
label="Dependency install"
|
||||
.indeterminate=${true}
|
||||
statusText="Downloading package metadata..."
|
||||
.statusRows=${2}
|
||||
></dees-progressbar>
|
||||
<dees-progressbar
|
||||
label="Queued job"
|
||||
.percentage=${32}
|
||||
.showPercentage=${false}
|
||||
statusText="Waiting for a worker slot to become available..."
|
||||
.statusRows=${2}
|
||||
></dees-progressbar>
|
||||
</div>
|
||||
</section>
|
||||
|
||||
<section class="showcaseCard wide">
|
||||
<div class="codeLabel">Terminal Lines</div>
|
||||
<h3>Fixed-height terminal-style status output</h3>
|
||||
<p>The panel stays the same height while the latest step stays visible. This is useful for update flows, downloads, and staged background work.</p>
|
||||
<dees-progressbar
|
||||
id="terminal-progress"
|
||||
label="Release bundle"
|
||||
.percentage=${20}
|
||||
.indeterminate=${true}
|
||||
.statusRows=${4}
|
||||
.terminalLines=${terminalSnapshots[0]}
|
||||
></dees-progressbar>
|
||||
</section>
|
||||
|
||||
<section class="showcaseCard">
|
||||
<div class="codeLabel">Live Demo</div>
|
||||
<h3>Updating percentage and text together</h3>
|
||||
<p>A single component can express both how far the job is and which phase is currently active.</p>
|
||||
<dees-progressbar
|
||||
id="live-progress"
|
||||
label="Customer export"
|
||||
.percentage=${12}
|
||||
statusText="Preparing archive and dependency graph..."
|
||||
.statusRows=${2}
|
||||
></dees-progressbar>
|
||||
</section>
|
||||
|
||||
<section class="showcaseCard">
|
||||
<div class="codeLabel">Compatibility</div>
|
||||
<h3>Legacy <code>value</code> and <code>progress</code> inputs</h3>
|
||||
<p>Existing usages can keep passing percentages directly or normalized progress values from 0 to 1.</p>
|
||||
<div class="progressStack">
|
||||
<dees-progressbar
|
||||
label="From value"
|
||||
.value=${75}
|
||||
statusText="Migrating existing readme-style usage..."
|
||||
.statusRows=${2}
|
||||
></dees-progressbar>
|
||||
<dees-progressbar
|
||||
label="From progress"
|
||||
.progress=${0.42}
|
||||
.showPercentage=${false}
|
||||
statusText="Rendering normalized progress input..."
|
||||
.statusRows=${2}
|
||||
></dees-progressbar>
|
||||
</div>
|
||||
</section>
|
||||
</div>
|
||||
</div>
|
||||
</dees-demowrapper>
|
||||
`;
|
||||
}
|
||||
};
|
||||
|
||||
@@ -1,4 +1,3 @@
|
||||
import * as plugins from '../../00plugins.js';
|
||||
import * as colors from '../../00colors.js';
|
||||
import { demoFunc } from './dees-progressbar.demo.js';
|
||||
import {
|
||||
@@ -6,94 +5,342 @@ import {
|
||||
html,
|
||||
DeesElement,
|
||||
property,
|
||||
type TemplateResult,
|
||||
cssManager,
|
||||
css,
|
||||
type CSSResult,
|
||||
unsafeCSS,
|
||||
unsafeHTML,
|
||||
state,
|
||||
} from '@design.estate/dees-element';
|
||||
|
||||
import * as domtools from '@design.estate/dees-domtools';
|
||||
import { themeDefaultStyles } from '../../00theme.js';
|
||||
|
||||
declare global {
|
||||
interface HTMLElementTagNameMap {
|
||||
'dees-progressbar': DeesProgressbar;
|
||||
}
|
||||
}
|
||||
|
||||
@customElement('dees-progressbar')
|
||||
export class DeesProgressbar extends DeesElement {
|
||||
// STATIC
|
||||
public static demo = demoFunc;
|
||||
public static demoGroups = ['Feedback'];
|
||||
|
||||
// INSTANCE
|
||||
@property({
|
||||
type: Number,
|
||||
})
|
||||
accessor percentage = 0;
|
||||
|
||||
// `value` and `progress` keep existing readme/internal usages working.
|
||||
@property({
|
||||
type: Number,
|
||||
})
|
||||
accessor value: number | null = null;
|
||||
|
||||
@property({
|
||||
type: Number,
|
||||
})
|
||||
accessor progress: number | null = null;
|
||||
|
||||
@property({
|
||||
type: String,
|
||||
})
|
||||
accessor label = '';
|
||||
|
||||
@property({
|
||||
type: String,
|
||||
})
|
||||
accessor statusText = '';
|
||||
|
||||
@property({
|
||||
type: Array,
|
||||
})
|
||||
accessor terminalLines: string[] = [];
|
||||
|
||||
@property({
|
||||
type: Number,
|
||||
})
|
||||
accessor statusRows = 3;
|
||||
|
||||
@property({
|
||||
type: Boolean,
|
||||
})
|
||||
accessor indeterminate = false;
|
||||
|
||||
@property({
|
||||
type: Boolean,
|
||||
})
|
||||
accessor showPercentage = true;
|
||||
|
||||
@state()
|
||||
accessor activeSpinnerFrame = 0;
|
||||
|
||||
private spinnerIntervalId: number | null = null;
|
||||
private readonly spinnerFrames = ['|', '/', '-', '\\'];
|
||||
|
||||
public static styles = [
|
||||
themeDefaultStyles,
|
||||
cssManager.defaultStyles,
|
||||
css`
|
||||
/* TODO: Migrate hardcoded values to --dees-* CSS variables */
|
||||
:host {
|
||||
display: block;
|
||||
color: ${cssManager.bdTheme(colors.bright.text, colors.dark.text)};
|
||||
}
|
||||
|
||||
.progressBarContainer {
|
||||
padding: 8px;
|
||||
min-width: 200px;
|
||||
padding: 8px;
|
||||
box-sizing: border-box;
|
||||
}
|
||||
|
||||
.progressHeader {
|
||||
display: flex;
|
||||
justify-content: space-between;
|
||||
align-items: baseline;
|
||||
gap: 12px;
|
||||
margin-bottom: 8px;
|
||||
}
|
||||
|
||||
.progressLabel {
|
||||
font-size: 14px;
|
||||
font-weight: 500;
|
||||
line-height: 1.3;
|
||||
}
|
||||
|
||||
.progressValue {
|
||||
font-size: 12px;
|
||||
line-height: 1.3;
|
||||
color: ${cssManager.bdTheme('hsl(215 15% 40%)', 'hsl(215 15% 70%)')};
|
||||
font-family: 'SF Mono', 'Monaco', 'Inconsolata', 'Fira Code', monospace;
|
||||
}
|
||||
|
||||
.progressBar {
|
||||
background: ${cssManager.bdTheme('#eeeeeb', '#444')};
|
||||
height: 8px;
|
||||
position: relative;
|
||||
overflow: hidden;
|
||||
width: 100%;
|
||||
border-radius: 4px;
|
||||
border-top: 0.5px solid ${cssManager.bdTheme('none', '#555')};
|
||||
height: 8px;
|
||||
border-radius: 999px;
|
||||
background: ${cssManager.bdTheme('#eeeeeb', '#444')};
|
||||
border-top: 0.5px solid ${cssManager.bdTheme('transparent', '#555')};
|
||||
}
|
||||
|
||||
.progressBarFill {
|
||||
height: 100%;
|
||||
border-radius: inherit;
|
||||
background: ${cssManager.bdTheme(colors.dark.blueActive, colors.bright.blueActive)};
|
||||
height: 8px;
|
||||
margin-top: -0.5px;
|
||||
transition: 0.2s width;
|
||||
border-radius: 4px;
|
||||
width: 0px;
|
||||
border-top: 0.5 solid ${cssManager.bdTheme('none', '#398fff')};
|
||||
transition: width 0.2s ease;
|
||||
}
|
||||
|
||||
.progressText {
|
||||
padding: 8px;
|
||||
.progressBarFill.indeterminate {
|
||||
width: 34%;
|
||||
transition: none;
|
||||
animation: indeterminateSlide 1.2s ease-in-out infinite;
|
||||
}
|
||||
|
||||
.statusPanel {
|
||||
margin-top: 10px;
|
||||
height: calc(var(--status-rows, 3) * 1.35em + 16px);
|
||||
min-height: calc(var(--status-rows, 3) * 1.35em + 16px);
|
||||
padding: 8px 10px;
|
||||
box-sizing: border-box;
|
||||
border-radius: 8px;
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(210 20% 86%)', 'hsl(210 10% 26%)')};
|
||||
background: ${cssManager.bdTheme('hsl(210 33% 98%)', 'hsl(220 20% 10%)')};
|
||||
font-family: 'SF Mono', 'Monaco', 'Inconsolata', 'Fira Code', monospace;
|
||||
font-size: 12px;
|
||||
line-height: 1.35;
|
||||
overflow: hidden;
|
||||
}
|
||||
|
||||
.statusTextRow,
|
||||
.terminalLine {
|
||||
display: flex;
|
||||
align-items: flex-start;
|
||||
gap: 8px;
|
||||
min-height: 1.35em;
|
||||
}
|
||||
|
||||
.terminalScroller {
|
||||
height: 100%;
|
||||
overflow: auto;
|
||||
}
|
||||
|
||||
.terminalScroller::-webkit-scrollbar {
|
||||
width: 6px;
|
||||
}
|
||||
|
||||
.terminalScroller::-webkit-scrollbar-thumb {
|
||||
background: ${cssManager.bdTheme('hsl(215 18% 78%)', 'hsl(215 10% 34%)')};
|
||||
border-radius: 999px;
|
||||
}
|
||||
|
||||
.terminalScroller::-webkit-scrollbar-track {
|
||||
background: transparent;
|
||||
}
|
||||
|
||||
.linePrefix {
|
||||
width: 1ch;
|
||||
flex: 0 0 1ch;
|
||||
color: ${cssManager.bdTheme(colors.dark.blueActive, colors.bright.blueActive)};
|
||||
text-align: center;
|
||||
}
|
||||
`
|
||||
|
||||
.lineText {
|
||||
flex: 1;
|
||||
min-width: 0;
|
||||
color: ${cssManager.bdTheme('hsl(220 15% 25%)', 'hsl(210 15% 86%)')};
|
||||
white-space: pre-wrap;
|
||||
word-break: break-word;
|
||||
}
|
||||
|
||||
.terminalLine:not(.current) .lineText {
|
||||
color: ${cssManager.bdTheme('hsl(215 12% 42%)', 'hsl(215 12% 63%)')};
|
||||
}
|
||||
|
||||
@keyframes indeterminateSlide {
|
||||
0% {
|
||||
transform: translateX(-120%);
|
||||
}
|
||||
|
||||
100% {
|
||||
transform: translateX(320%);
|
||||
}
|
||||
}
|
||||
`,
|
||||
];
|
||||
|
||||
public async connectedCallback(): Promise<void> {
|
||||
await super.connectedCallback();
|
||||
this.syncSpinnerState();
|
||||
}
|
||||
|
||||
public async disconnectedCallback(): Promise<void> {
|
||||
this.stopSpinner();
|
||||
await super.disconnectedCallback();
|
||||
}
|
||||
|
||||
public updated(changedProperties: Map<string | number | symbol, unknown>): void {
|
||||
super.updated(changedProperties);
|
||||
this.syncSpinnerState();
|
||||
|
||||
if (changedProperties.has('terminalLines') && this.terminalLines.length > 0) {
|
||||
this.scrollTerminalToBottom();
|
||||
}
|
||||
}
|
||||
|
||||
public render() {
|
||||
const effectivePercentage = this.getEffectivePercentage();
|
||||
const showHeader = Boolean(this.label) || (this.showPercentage && !this.indeterminate);
|
||||
const hasTerminalLines = this.terminalLines.length > 0;
|
||||
const hasStatusContent = hasTerminalLines || this.statusText.trim().length > 0;
|
||||
const renderedRows = this.getRenderedStatusRows();
|
||||
const spinnerFrame = this.spinnerFrames[this.activeSpinnerFrame] ?? this.spinnerFrames[0];
|
||||
|
||||
return html`
|
||||
<div class="progressBarContainer">
|
||||
${showHeader ? html`
|
||||
<div class="progressHeader">
|
||||
<div class="progressLabel">${this.label}</div>
|
||||
${this.showPercentage && !this.indeterminate ? html`
|
||||
<div class="progressValue">${this.formatPercentage(effectivePercentage)}%</div>
|
||||
` : ''}
|
||||
</div>
|
||||
` : ''}
|
||||
<div class="progressBar">
|
||||
<div class="progressBarFill"></div>
|
||||
<div class="progressText">
|
||||
${this.percentage}%
|
||||
<div>
|
||||
<div
|
||||
class="progressBarFill ${this.indeterminate ? 'indeterminate' : ''}"
|
||||
style="${this.indeterminate ? '' : `width: ${effectivePercentage}%;`}"
|
||||
></div>
|
||||
</div>
|
||||
${hasStatusContent ? html`
|
||||
<div
|
||||
class="statusPanel"
|
||||
style="--status-rows: ${renderedRows};"
|
||||
aria-live="polite"
|
||||
aria-atomic="true"
|
||||
>
|
||||
${hasTerminalLines ? html`
|
||||
<div class="terminalScroller">
|
||||
${this.terminalLines.map((line, index) => {
|
||||
const isCurrentLine = index === this.terminalLines.length - 1;
|
||||
const prefix = this.indeterminate && isCurrentLine ? spinnerFrame : '>';
|
||||
return html`
|
||||
<div class="terminalLine ${isCurrentLine ? 'current' : ''}">
|
||||
<span class="linePrefix">${prefix}</span>
|
||||
<span class="lineText">${line}</span>
|
||||
</div>
|
||||
`
|
||||
`;
|
||||
})}
|
||||
</div>
|
||||
` : html`
|
||||
<div class="statusTextRow">
|
||||
<span class="linePrefix">${this.indeterminate ? spinnerFrame : '>'}</span>
|
||||
<span class="lineText">${this.statusText}</span>
|
||||
</div>
|
||||
`}
|
||||
</div>
|
||||
` : ''}
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
|
||||
firstUpdated (_changedProperties: Map<string | number | symbol, unknown>): void {
|
||||
super.firstUpdated(_changedProperties);
|
||||
this.updateComplete.then(() => {
|
||||
this.updatePercentage();
|
||||
private getEffectivePercentage(): number {
|
||||
if (typeof this.value === 'number' && Number.isFinite(this.value)) {
|
||||
return this.clampPercentage(this.value);
|
||||
}
|
||||
|
||||
if (typeof this.progress === 'number' && Number.isFinite(this.progress)) {
|
||||
const normalizedProgress = this.progress >= 0 && this.progress <= 1
|
||||
? this.progress * 100
|
||||
: this.progress;
|
||||
return this.clampPercentage(normalizedProgress);
|
||||
}
|
||||
|
||||
return this.clampPercentage(this.percentage);
|
||||
}
|
||||
|
||||
private getRenderedStatusRows(): number {
|
||||
const rows = Number.isFinite(this.statusRows) ? Math.floor(this.statusRows) : 3;
|
||||
return Math.max(1, rows);
|
||||
}
|
||||
|
||||
private clampPercentage(input: number): number {
|
||||
return Math.max(0, Math.min(100, input));
|
||||
}
|
||||
|
||||
private formatPercentage(input: number): string {
|
||||
return Number.isInteger(input) ? `${input}` : input.toFixed(1).replace(/\.0$/, '');
|
||||
}
|
||||
|
||||
private syncSpinnerState(): void {
|
||||
const shouldAnimate = this.indeterminate && (this.statusText.trim().length > 0 || this.terminalLines.length > 0);
|
||||
|
||||
if (shouldAnimate && this.spinnerIntervalId === null) {
|
||||
this.spinnerIntervalId = window.setInterval(() => {
|
||||
this.activeSpinnerFrame = (this.activeSpinnerFrame + 1) % this.spinnerFrames.length;
|
||||
}, 120);
|
||||
return;
|
||||
}
|
||||
|
||||
if (!shouldAnimate) {
|
||||
this.stopSpinner();
|
||||
}
|
||||
}
|
||||
|
||||
private stopSpinner(): void {
|
||||
if (this.spinnerIntervalId !== null) {
|
||||
window.clearInterval(this.spinnerIntervalId);
|
||||
this.spinnerIntervalId = null;
|
||||
}
|
||||
|
||||
this.activeSpinnerFrame = 0;
|
||||
}
|
||||
|
||||
private scrollTerminalToBottom(): void {
|
||||
const terminalScroller = this.shadowRoot?.querySelector('.terminalScroller') as HTMLElement | null;
|
||||
|
||||
if (!terminalScroller) {
|
||||
return;
|
||||
}
|
||||
|
||||
window.requestAnimationFrame(() => {
|
||||
terminalScroller.scrollTop = terminalScroller.scrollHeight;
|
||||
});
|
||||
}
|
||||
|
||||
public async updatePercentage() {
|
||||
const progressBarFill = this.shadowRoot!.querySelector('.progressBarFill') as HTMLElement;
|
||||
progressBarFill.style.width = `${this.percentage}%`;
|
||||
}
|
||||
|
||||
updated(){
|
||||
this.updatePercentage();
|
||||
}
|
||||
}
|
||||
@@ -75,12 +75,23 @@ export class DeesFormSubmit extends DeesElement {
|
||||
.text=${this.text}
|
||||
?disabled=${this.disabled}
|
||||
@clicked=${this.submit}
|
||||
>
|
||||
<slot></slot>
|
||||
</dees-button>
|
||||
></dees-button>
|
||||
`;
|
||||
}
|
||||
|
||||
public async firstUpdated() {
|
||||
// Capture light DOM text content as the button label. dees-button wipes
|
||||
// its own light DOM during extractLightDom(), so we cannot simply forward
|
||||
// a <slot> into it — we have to hoist the text onto the .text property
|
||||
// ourselves before handing it to dees-button.
|
||||
if (!this.text) {
|
||||
const slotText = this.textContent?.trim();
|
||||
if (slotText) {
|
||||
this.text = slotText;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
public async submit() {
|
||||
if (this.disabled) {
|
||||
return;
|
||||
|
||||
@@ -92,7 +92,7 @@ export const demoFunc = () => html`
|
||||
.required=${true}
|
||||
key="firstName"
|
||||
label="First Name"
|
||||
.description=${'Your given name'}
|
||||
.infoText=${'Your given name'}
|
||||
></dees-input-text>
|
||||
|
||||
<dees-input-text
|
||||
@@ -105,7 +105,7 @@ export const demoFunc = () => html`
|
||||
.required=${true}
|
||||
key="email"
|
||||
label="Email Address"
|
||||
.description=${'We will use this to contact you'}
|
||||
.infoText=${'We will use this to contact you'}
|
||||
></dees-input-text>
|
||||
|
||||
<dees-input-dropdown
|
||||
@@ -126,7 +126,7 @@ export const demoFunc = () => html`
|
||||
key="password"
|
||||
label="Password"
|
||||
isPasswordBool
|
||||
.description=${'Minimum 8 characters'}
|
||||
.infoText=${'Minimum 8 characters'}
|
||||
></dees-input-text>
|
||||
|
||||
<dees-input-checkbox
|
||||
@@ -300,7 +300,7 @@ export const demoFunc = () => html`
|
||||
<dees-input-fileupload
|
||||
key="documents"
|
||||
.label=${'Upload Documents'}
|
||||
.description=${'PDF, DOC, or DOCX files up to 10MB'}
|
||||
.infoText=${'PDF, DOC, or DOCX files up to 10MB'}
|
||||
></dees-input-fileupload>
|
||||
|
||||
<dees-form-submit>Submit Application</dees-form-submit>
|
||||
|
||||
@@ -1,6 +1,7 @@
|
||||
import {
|
||||
DeesElement,
|
||||
property,
|
||||
html,
|
||||
css,
|
||||
type CSSResult,
|
||||
cssManager,
|
||||
@@ -42,6 +43,9 @@ export abstract class DeesInputBase<T = any> extends DeesElement {
|
||||
@property({ type: Boolean })
|
||||
accessor disabled: boolean = false;
|
||||
|
||||
@property({ type: String })
|
||||
accessor infoText!: string;
|
||||
|
||||
@property({ type: String })
|
||||
accessor description!: string;
|
||||
|
||||
@@ -90,6 +94,14 @@ export abstract class DeesInputBase<T = any> extends DeesElement {
|
||||
:host([label-position="none"]) dees-label {
|
||||
display: none;
|
||||
}
|
||||
|
||||
/* Description text below input */
|
||||
.descriptionText {
|
||||
margin-top: 4px;
|
||||
font-size: 12px;
|
||||
line-height: 1.4;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
||||
}
|
||||
`,
|
||||
];
|
||||
}
|
||||
@@ -155,6 +167,14 @@ export abstract class DeesInputBase<T = any> extends DeesElement {
|
||||
this.disabled = false;
|
||||
}
|
||||
|
||||
/**
|
||||
* Renders the description text below the input.
|
||||
* Call ${this.renderDescription()} at the end of your render template.
|
||||
*/
|
||||
public renderDescription() {
|
||||
return this.description ? html`<div class="descriptionText">${this.description}</div>` : '';
|
||||
}
|
||||
|
||||
/**
|
||||
* Abstract method that child classes must implement to get their value
|
||||
*/
|
||||
|
||||
@@ -111,7 +111,7 @@ export const demoFunc = () => html`
|
||||
|
||||
<div class="demo-container">
|
||||
<dees-panel .title=${'Basic Checkboxes'} .subtitle=${'Simple checkbox examples with various labels'}>
|
||||
<div class="checkbox-group">
|
||||
<dees-form>
|
||||
<dees-input-checkbox
|
||||
.label=${'I agree to the Terms and Conditions'}
|
||||
.value=${true}
|
||||
@@ -130,11 +130,11 @@ export const demoFunc = () => html`
|
||||
.description=${'Receive email updates about your account'}
|
||||
.key=${'notifications'}
|
||||
></dees-input-checkbox>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Checkbox States'} .subtitle=${'Different checkbox states and configurations'}>
|
||||
<div class="checkbox-group">
|
||||
<dees-form>
|
||||
<dees-input-checkbox
|
||||
.label=${'Default state'}
|
||||
.value=${false}
|
||||
@@ -162,10 +162,11 @@ export const demoFunc = () => html`
|
||||
.required=${true}
|
||||
.key=${'required'}
|
||||
></dees-input-checkbox>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Horizontal Layout'} .subtitle=${'Checkboxes arranged horizontally for compact forms'}>
|
||||
<dees-form>
|
||||
<div class="horizontal-checkboxes">
|
||||
<dees-input-checkbox
|
||||
.label=${'Option A'}
|
||||
@@ -195,6 +196,7 @@ export const demoFunc = () => html`
|
||||
.key=${'optionD'}
|
||||
></dees-input-checkbox>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Feature Selection Example'} .subtitle=${'Common use case for feature toggles with batch operations'}>
|
||||
@@ -204,7 +206,7 @@ export const demoFunc = () => html`
|
||||
</div>
|
||||
|
||||
<div class="feature-list">
|
||||
<div class="checkbox-group">
|
||||
<dees-form>
|
||||
<dees-input-checkbox
|
||||
.label=${'Dark Mode Support'}
|
||||
.value=${true}
|
||||
@@ -234,7 +236,7 @@ export const demoFunc = () => html`
|
||||
.value=${false}
|
||||
.key=${'feature5'}
|
||||
></dees-input-checkbox>
|
||||
</div>
|
||||
</dees-form>
|
||||
</div>
|
||||
</dees-panel>
|
||||
|
||||
@@ -242,7 +244,7 @@ export const demoFunc = () => html`
|
||||
<div class="form-section">
|
||||
<h4 class="section-title">Privacy Preferences</h4>
|
||||
|
||||
<div class="checkbox-group">
|
||||
<dees-form>
|
||||
<dees-input-checkbox
|
||||
.label=${'Share analytics data'}
|
||||
.value=${true}
|
||||
@@ -266,12 +268,12 @@ export const demoFunc = () => html`
|
||||
.value=${false}
|
||||
.description=${'Allow approved partners to access your data'}
|
||||
></dees-input-checkbox>
|
||||
</div>
|
||||
</dees-form>
|
||||
</div>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Interactive Example'} .subtitle=${'Click checkboxes to see value changes'}>
|
||||
<div class="checkbox-group">
|
||||
<dees-form>
|
||||
<dees-input-checkbox
|
||||
.label=${'Feature toggle'}
|
||||
.value=${false}
|
||||
@@ -295,7 +297,7 @@ export const demoFunc = () => html`
|
||||
}
|
||||
}}
|
||||
></dees-input-checkbox>
|
||||
</div>
|
||||
</dees-form>
|
||||
|
||||
<div class="interactive-section">
|
||||
<div id="checkbox-output" class="output-text">Feature is disabled</div>
|
||||
|
||||
@@ -147,12 +147,6 @@ export class DeesInputCheckbox extends DeesInputBase<DeesInputCheckbox> {
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 90%)')};
|
||||
}
|
||||
|
||||
/* Description */
|
||||
.description-text {
|
||||
font-size: 12px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
||||
line-height: 1.5;
|
||||
}
|
||||
`,
|
||||
];
|
||||
|
||||
@@ -185,7 +179,7 @@ export class DeesInputCheckbox extends DeesInputBase<DeesInputCheckbox> {
|
||||
</div>
|
||||
<div class="label-container">
|
||||
${this.label ? html`<div class="checkbox-label">${this.label}</div>` : ''}
|
||||
${this.description ? html`<div class="description-text">${this.description}</div>` : ''}
|
||||
${this.renderDescription()}
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
|
||||
@@ -79,6 +79,12 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
@state()
|
||||
accessor copySuccess: boolean = false;
|
||||
|
||||
@state()
|
||||
accessor lineCount: number = 0;
|
||||
|
||||
@state()
|
||||
accessor cursorPosition: { line: number; column: number } = { line: 1, column: 1 };
|
||||
|
||||
private editorElement: DeesWorkspaceMonaco | null = null;
|
||||
|
||||
public static styles = [
|
||||
@@ -142,16 +148,16 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
padding: 4px 10px;
|
||||
font-size: 12px;
|
||||
font-weight: 500;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 12%)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 20%)')};
|
||||
background: var(--dees-color-bg-primary);
|
||||
border: 1px solid var(--dees-color-border-default);
|
||||
border-radius: 4px;
|
||||
cursor: pointer;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 20%)', 'hsl(0 0% 90%)')};
|
||||
color: var(--dees-color-text-secondary);
|
||||
transition: all 0.15s ease;
|
||||
}
|
||||
|
||||
.language-button:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95%)', 'hsl(0 0% 15%)')};
|
||||
background: var(--dees-color-hover);
|
||||
}
|
||||
|
||||
.language-dropdown {
|
||||
@@ -159,8 +165,8 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
top: 100%;
|
||||
left: 0;
|
||||
margin-top: 4px;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 9%)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 20%)')};
|
||||
background: var(--dees-color-bg-primary);
|
||||
border: 1px solid var(--dees-color-border-default);
|
||||
border-radius: 6px;
|
||||
box-shadow: 0 4px 12px rgba(0, 0, 0, 0.15);
|
||||
z-index: 100;
|
||||
@@ -173,16 +179,16 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
padding: 8px 12px;
|
||||
font-size: 12px;
|
||||
cursor: pointer;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 20%)', 'hsl(0 0% 90%)')};
|
||||
color: var(--dees-color-text-secondary);
|
||||
transition: background 0.15s ease;
|
||||
}
|
||||
|
||||
.language-option:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95%)', 'hsl(0 0% 15%)')};
|
||||
background: var(--dees-color-hover);
|
||||
}
|
||||
|
||||
.language-option.selected {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 90%)', 'hsl(0 0% 20%)')};
|
||||
background: var(--dees-color-active);
|
||||
}
|
||||
|
||||
.toolbar-button {
|
||||
@@ -195,18 +201,18 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
border: none;
|
||||
border-radius: 4px;
|
||||
cursor: pointer;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45%)', 'hsl(0 0% 60%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
transition: all 0.15s ease;
|
||||
}
|
||||
|
||||
.toolbar-button:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 90%)', 'hsl(0 0% 15%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 20%)', 'hsl(0 0% 90%)')};
|
||||
background: var(--dees-color-hover);
|
||||
color: var(--dees-color-text-secondary);
|
||||
}
|
||||
|
||||
.toolbar-button.active {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 85%)', 'hsl(0 0% 20%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 20%)', 'hsl(0 0% 90%)')};
|
||||
background: var(--dees-color-active);
|
||||
color: var(--dees-color-text-secondary);
|
||||
}
|
||||
|
||||
.toolbar-button.success {
|
||||
@@ -223,13 +229,44 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
height: 100%;
|
||||
}
|
||||
|
||||
/* Match Monaco background to tile */
|
||||
dees-workspace-monaco::part(container) {
|
||||
background: var(--dees-color-bg-primary);
|
||||
}
|
||||
|
||||
.toolbar-divider {
|
||||
width: 1px;
|
||||
height: 20px;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 85%)', 'hsl(0 0% 20%)')};
|
||||
background: var(--dees-color-border-default);
|
||||
margin: 0 4px;
|
||||
}
|
||||
|
||||
/* Footer */
|
||||
.editor-footer {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: space-between;
|
||||
padding: 0 12px;
|
||||
height: 28px;
|
||||
font-size: 11px;
|
||||
color: var(--dees-color-text-muted);
|
||||
width: 100%;
|
||||
box-sizing: border-box;
|
||||
}
|
||||
|
||||
.footer-left,
|
||||
.footer-right {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
gap: 12px;
|
||||
}
|
||||
|
||||
.footer-separator {
|
||||
width: 1px;
|
||||
height: 12px;
|
||||
background: var(--dees-color-border-default);
|
||||
}
|
||||
|
||||
:host([disabled]) .code-container {
|
||||
opacity: 0.5;
|
||||
pointer-events: none;
|
||||
@@ -247,7 +284,7 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
}
|
||||
</style>
|
||||
<div class="input-wrapper">
|
||||
<dees-label .label=${this.label} .description=${this.description} .required=${this.required}></dees-label>
|
||||
<dees-label .label=${this.label} .infoText=${this.infoText} .required=${this.required}></dees-label>
|
||||
<dees-tile>
|
||||
<div slot="header" class="toolbar">
|
||||
<div class="toolbar-left">
|
||||
@@ -314,7 +351,18 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
@content-change=${this.handleContentChange}
|
||||
></dees-workspace-monaco>
|
||||
</div>
|
||||
<div slot="footer" class="editor-footer">
|
||||
<div class="footer-left">
|
||||
<span>Ln ${this.cursorPosition.line}, Col ${this.cursorPosition.column}</span>
|
||||
<div class="footer-separator"></div>
|
||||
<span>${this.lineCount} line${this.lineCount !== 1 ? 's' : ''}</span>
|
||||
</div>
|
||||
<div class="footer-right">
|
||||
<span>${(LANGUAGES.find(l => l.key === this.language) || LANGUAGES[0]).label}</span>
|
||||
</div>
|
||||
</div>
|
||||
</dees-tile>
|
||||
${this.renderDescription()}
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
@@ -329,6 +377,49 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
this.changeSubject.next(this as any);
|
||||
}
|
||||
});
|
||||
|
||||
// Track cursor position and line count
|
||||
const editor = await this.editorElement.editorDeferred.promise;
|
||||
|
||||
// Set initial line count
|
||||
const model = editor.getModel();
|
||||
if (model) {
|
||||
this.lineCount = model.getLineCount();
|
||||
model.onDidChangeContent(() => {
|
||||
this.lineCount = model.getLineCount();
|
||||
});
|
||||
}
|
||||
|
||||
// Track cursor position
|
||||
editor.onDidChangeCursorPosition((e) => {
|
||||
this.cursorPosition = { line: e.position.lineNumber, column: e.position.column };
|
||||
});
|
||||
|
||||
// Override Monaco editor background to match tile
|
||||
const domtoolsInstance = await this.editorElement.domtoolsPromise;
|
||||
const updateEditorBg = (isBright: boolean) => {
|
||||
const bg = isBright ? '#ffffff' : '#0a0a0a';
|
||||
editor.updateOptions({});
|
||||
// Override via Monaco's theme API
|
||||
(window as any).monaco?.editor?.defineTheme?.('dees-light', {
|
||||
base: 'vs',
|
||||
inherit: true,
|
||||
rules: [],
|
||||
colors: { 'editor.background': bg },
|
||||
});
|
||||
(window as any).monaco?.editor?.defineTheme?.('dees-dark', {
|
||||
base: 'vs-dark',
|
||||
inherit: true,
|
||||
rules: [],
|
||||
colors: { 'editor.background': bg },
|
||||
});
|
||||
editor.updateOptions({ theme: isBright ? 'dees-light' : 'dees-dark' });
|
||||
};
|
||||
|
||||
updateEditorBg(domtoolsInstance.themeManager.goBrightBoolean);
|
||||
domtoolsInstance.themeManager.themeObservable.subscribe((goBright: boolean) => {
|
||||
updateEditorBg(goBright);
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
@@ -418,23 +509,15 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
const toolbar = modal.shadowRoot?.querySelector('.modal-toolbar');
|
||||
if (!toolbar) return;
|
||||
|
||||
// Update language button text
|
||||
const langBtn = toolbar.querySelector('.language-button span');
|
||||
if (langBtn) langBtn.textContent = getLanguageLabel();
|
||||
|
||||
// Update word wrap button
|
||||
const wrapBtn = toolbar.querySelector('.wrap-btn') as HTMLElement;
|
||||
if (wrapBtn) {
|
||||
wrapBtn.classList.toggle('active', modalWordWrap === 'on');
|
||||
}
|
||||
if (wrapBtn) wrapBtn.classList.toggle('active', modalWordWrap === 'on');
|
||||
|
||||
// Update line numbers button
|
||||
const linesBtn = toolbar.querySelector('.lines-btn') as HTMLElement;
|
||||
if (linesBtn) {
|
||||
linesBtn.classList.toggle('active', modalShowLineNumbers);
|
||||
}
|
||||
if (linesBtn) linesBtn.classList.toggle('active', modalShowLineNumbers);
|
||||
|
||||
// Update copy button
|
||||
const copyBtn = toolbar.querySelector('.copy-btn') as HTMLElement;
|
||||
const copyIcon = copyBtn?.querySelector('dees-icon') as any;
|
||||
if (copyBtn && copyIcon) {
|
||||
@@ -442,13 +525,28 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
copyIcon.icon = modalCopySuccess ? 'lucide:Check' : 'lucide:Copy';
|
||||
}
|
||||
|
||||
// Update dropdown visibility
|
||||
const dropdown = toolbar.querySelector('.language-dropdown') as HTMLElement;
|
||||
if (dropdown) {
|
||||
dropdown.style.display = modalLanguageDropdownOpen ? 'block' : 'none';
|
||||
}
|
||||
if (dropdown) dropdown.style.display = modalLanguageDropdownOpen ? 'block' : 'none';
|
||||
};
|
||||
|
||||
// Helper to update footer UI
|
||||
const updateFooterUI = (modal: DeesModal) => {
|
||||
const footer = modal.shadowRoot?.querySelector('.modal-footer');
|
||||
if (!footer) return;
|
||||
|
||||
const cursorEl = footer.querySelector('.footer-cursor');
|
||||
const linesEl = footer.querySelector('.footer-lines');
|
||||
const langEl = footer.querySelector('.footer-lang');
|
||||
|
||||
if (cursorEl) cursorEl.textContent = `Ln ${modalCursorLine}, Col ${modalCursorCol}`;
|
||||
if (linesEl) linesEl.textContent = `${modalLineCount} line${modalLineCount !== 1 ? 's' : ''}`;
|
||||
if (langEl) langEl.textContent = getLanguageLabel();
|
||||
};
|
||||
|
||||
let modalCursorLine = 1;
|
||||
let modalCursorCol = 1;
|
||||
let modalLineCount = currentValue.split('\n').length;
|
||||
|
||||
const modal = await DeesModal.createAndShow({
|
||||
heading: this.label || 'Code Editor',
|
||||
width: 'fullscreen',
|
||||
@@ -459,9 +557,7 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: space-between;
|
||||
padding: 8px 12px;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 97%)', 'hsl(0 0% 7%)')};
|
||||
border-bottom: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
padding: 4px 12px;
|
||||
gap: 8px;
|
||||
}
|
||||
.modal-toolbar .toolbar-left {
|
||||
@@ -554,9 +650,30 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
}
|
||||
.modal-editor-wrapper {
|
||||
position: relative;
|
||||
height: calc(100vh - 175px);
|
||||
height: calc(100vh - 200px);
|
||||
width: 100%;
|
||||
}
|
||||
.modal-footer {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: space-between;
|
||||
padding: 0 12px;
|
||||
height: 28px;
|
||||
font-size: 11px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45%)', 'hsl(0 0% 55%)')};
|
||||
border-top: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
}
|
||||
.modal-footer .footer-left,
|
||||
.modal-footer .footer-right {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
gap: 12px;
|
||||
}
|
||||
.modal-footer .footer-separator {
|
||||
width: 1px;
|
||||
height: 12px;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 85%)', 'hsl(0 0% 20%)')};
|
||||
}
|
||||
</style>
|
||||
<div class="modal-toolbar">
|
||||
<div class="toolbar-left">
|
||||
@@ -597,6 +714,16 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
.wordWrap=${modalWordWrap}
|
||||
></dees-workspace-monaco>
|
||||
</div>
|
||||
<div class="modal-footer">
|
||||
<div class="footer-left">
|
||||
<span class="footer-cursor">Ln ${modalCursorLine}, Col ${modalCursorCol}</span>
|
||||
<div class="footer-separator"></div>
|
||||
<span class="footer-lines">${modalLineCount} line${modalLineCount !== 1 ? 's' : ''}</span>
|
||||
</div>
|
||||
<div class="footer-right">
|
||||
<span class="footer-lang">${getLanguageLabel()}</span>
|
||||
</div>
|
||||
</div>
|
||||
`,
|
||||
menuOptions: [
|
||||
{
|
||||
@@ -608,7 +735,6 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
{
|
||||
name: 'Save & Close',
|
||||
action: async (modalRef) => {
|
||||
// Get the editor content from the modal
|
||||
modalEditorElement = modalRef!.shadowRoot?.querySelector('dees-workspace-monaco') as DeesWorkspaceMonaco;
|
||||
if (modalEditorElement) {
|
||||
const editor = await modalEditorElement.editorDeferred.promise;
|
||||
@@ -625,17 +751,61 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
await new Promise(resolve => setTimeout(resolve, 100));
|
||||
modalEditorElement = modal.shadowRoot?.querySelector('dees-workspace-monaco') as DeesWorkspaceMonaco;
|
||||
|
||||
// Apply custom Monaco theme for matching background
|
||||
if (modalEditorElement) {
|
||||
const editor = await modalEditorElement.editorDeferred.promise;
|
||||
const domtoolsInstance = await modalEditorElement.domtoolsPromise;
|
||||
|
||||
const applyModalTheme = (isBright: boolean) => {
|
||||
const bg = isBright ? '#ffffff' : '#0a0a0a';
|
||||
(window as any).monaco?.editor?.defineTheme?.('dees-light', {
|
||||
base: 'vs',
|
||||
inherit: true,
|
||||
rules: [],
|
||||
colors: { 'editor.background': bg },
|
||||
});
|
||||
(window as any).monaco?.editor?.defineTheme?.('dees-dark', {
|
||||
base: 'vs-dark',
|
||||
inherit: true,
|
||||
rules: [],
|
||||
colors: { 'editor.background': bg },
|
||||
});
|
||||
editor.updateOptions({ theme: isBright ? 'dees-light' : 'dees-dark' });
|
||||
};
|
||||
|
||||
applyModalTheme(domtoolsInstance.themeManager.goBrightBoolean);
|
||||
domtoolsInstance.themeManager.themeObservable.subscribe((goBright: boolean) => {
|
||||
applyModalTheme(goBright);
|
||||
});
|
||||
|
||||
// Track cursor position
|
||||
editor.onDidChangeCursorPosition((e) => {
|
||||
modalCursorLine = e.position.lineNumber;
|
||||
modalCursorCol = e.position.column;
|
||||
updateFooterUI(modal);
|
||||
});
|
||||
|
||||
// Track line count
|
||||
const model = editor.getModel();
|
||||
if (model) {
|
||||
modalLineCount = model.getLineCount();
|
||||
updateFooterUI(modal);
|
||||
model.onDidChangeContent(() => {
|
||||
modalLineCount = model.getLineCount();
|
||||
updateFooterUI(modal);
|
||||
});
|
||||
}
|
||||
}
|
||||
|
||||
// Wire up toolbar event handlers
|
||||
const toolbar = modal.shadowRoot?.querySelector('.modal-toolbar');
|
||||
if (toolbar) {
|
||||
// Language button click
|
||||
const langBtn = toolbar.querySelector('.language-button');
|
||||
langBtn?.addEventListener('click', () => {
|
||||
modalLanguageDropdownOpen = !modalLanguageDropdownOpen;
|
||||
updateToolbarUI(modal);
|
||||
});
|
||||
|
||||
// Language option clicks
|
||||
const langOptions = toolbar.querySelectorAll('.language-option');
|
||||
langOptions.forEach((option) => {
|
||||
option.addEventListener('click', async () => {
|
||||
@@ -644,23 +814,21 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
modalLanguage = newLang;
|
||||
modalLanguageDropdownOpen = false;
|
||||
|
||||
// Update editor language
|
||||
const editor = await modalEditorElement.editorDeferred.promise;
|
||||
const model = editor.getModel();
|
||||
if (model) {
|
||||
(window as any).monaco.editor.setModelLanguage(model, newLang);
|
||||
const editorModel = editor.getModel();
|
||||
if (editorModel) {
|
||||
(window as any).monaco.editor.setModelLanguage(editorModel, newLang);
|
||||
}
|
||||
|
||||
// Update selected state
|
||||
langOptions.forEach(opt => opt.classList.remove('selected'));
|
||||
option.classList.add('selected');
|
||||
|
||||
updateToolbarUI(modal);
|
||||
updateFooterUI(modal);
|
||||
}
|
||||
});
|
||||
});
|
||||
|
||||
// Word wrap button
|
||||
const wrapBtn = toolbar.querySelector('.wrap-btn');
|
||||
wrapBtn?.addEventListener('click', async () => {
|
||||
modalWordWrap = modalWordWrap === 'on' ? 'off' : 'on';
|
||||
@@ -671,7 +839,6 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
updateToolbarUI(modal);
|
||||
});
|
||||
|
||||
// Line numbers button
|
||||
const linesBtn = toolbar.querySelector('.lines-btn');
|
||||
linesBtn?.addEventListener('click', async () => {
|
||||
modalShowLineNumbers = !modalShowLineNumbers;
|
||||
@@ -682,7 +849,6 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
updateToolbarUI(modal);
|
||||
});
|
||||
|
||||
// Copy button
|
||||
const copyBtn = toolbar.querySelector('.copy-btn');
|
||||
copyBtn?.addEventListener('click', async () => {
|
||||
if (modalEditorElement) {
|
||||
@@ -702,7 +868,6 @@ export class DeesInputCode extends DeesInputBase<string> {
|
||||
}
|
||||
});
|
||||
|
||||
// Close dropdown when clicking outside
|
||||
document.addEventListener('click', (e) => {
|
||||
if (modalLanguageDropdownOpen && !langBtn?.contains(e.target as Node)) {
|
||||
modalLanguageDropdownOpen = false;
|
||||
|
||||
@@ -8,7 +8,7 @@ import { DeesInputBase } from '../dees-input-base/dees-input-base.js';
|
||||
import { demoFunc } from './demo.js';
|
||||
import { datepickerStyles } from './styles.js';
|
||||
import { renderDatepicker } from './template.js';
|
||||
import type { IDateEvent } from './types.js';
|
||||
import { DeesInputDatepickerPopup } from './datepicker-popup.js';
|
||||
import '../../00group-utility/dees-icon/dees-icon.js';
|
||||
import '../../00group-layout/dees-label/dees-label.js';
|
||||
|
||||
@@ -49,7 +49,7 @@ export class DeesInputDatepicker extends DeesInputBase<DeesInputDatepicker> {
|
||||
accessor disabledDates: string[] = [];
|
||||
|
||||
@property({ type: Number })
|
||||
accessor weekStartsOn: 0 | 1 = 1; // Default to Monday
|
||||
accessor weekStartsOn: 0 | 1 = 1;
|
||||
|
||||
@property({ type: String })
|
||||
accessor placeholder: string = 'YYYY-MM-DD';
|
||||
@@ -61,14 +61,11 @@ export class DeesInputDatepicker extends DeesInputBase<DeesInputDatepicker> {
|
||||
accessor timezone: string = Intl.DateTimeFormat().resolvedOptions().timeZone;
|
||||
|
||||
@property({ type: Array })
|
||||
accessor events: IDateEvent[] = [];
|
||||
accessor events: import('./types.js').IDateEvent[] = [];
|
||||
|
||||
@state()
|
||||
accessor isOpened: boolean = false;
|
||||
|
||||
@state()
|
||||
accessor opensToTop: boolean = false;
|
||||
|
||||
@state()
|
||||
accessor selectedDate: Date | null = null;
|
||||
|
||||
@@ -81,57 +78,19 @@ export class DeesInputDatepicker extends DeesInputBase<DeesInputDatepicker> {
|
||||
@state()
|
||||
accessor selectedMinute: number = 0;
|
||||
|
||||
private popupInstance: DeesInputDatepickerPopup | null = null;
|
||||
|
||||
public static styles = datepickerStyles;
|
||||
|
||||
|
||||
|
||||
public getTimezones(): { value: string; label: string }[] {
|
||||
// Common timezones with their display names
|
||||
return [
|
||||
{ value: 'UTC', label: 'UTC (Coordinated Universal Time)' },
|
||||
{ value: 'America/New_York', label: 'Eastern Time (US & Canada)' },
|
||||
{ value: 'America/Chicago', label: 'Central Time (US & Canada)' },
|
||||
{ value: 'America/Denver', label: 'Mountain Time (US & Canada)' },
|
||||
{ value: 'America/Los_Angeles', label: 'Pacific Time (US & Canada)' },
|
||||
{ value: 'America/Phoenix', label: 'Arizona' },
|
||||
{ value: 'America/Anchorage', label: 'Alaska' },
|
||||
{ value: 'Pacific/Honolulu', label: 'Hawaii' },
|
||||
{ value: 'Europe/London', label: 'London' },
|
||||
{ value: 'Europe/Paris', label: 'Paris' },
|
||||
{ value: 'Europe/Berlin', label: 'Berlin' },
|
||||
{ value: 'Europe/Moscow', label: 'Moscow' },
|
||||
{ value: 'Asia/Dubai', label: 'Dubai' },
|
||||
{ value: 'Asia/Kolkata', label: 'India Standard Time' },
|
||||
{ value: 'Asia/Shanghai', label: 'China Standard Time' },
|
||||
{ value: 'Asia/Tokyo', label: 'Tokyo' },
|
||||
{ value: 'Australia/Sydney', label: 'Sydney' },
|
||||
{ value: 'Pacific/Auckland', label: 'Auckland' },
|
||||
];
|
||||
}
|
||||
|
||||
public render(): TemplateResult {
|
||||
return renderDatepicker(this);
|
||||
}
|
||||
|
||||
|
||||
|
||||
async connectedCallback() {
|
||||
super.connectedCallback();
|
||||
this.handleClickOutside = this.handleClickOutside.bind(this);
|
||||
}
|
||||
|
||||
async disconnectedCallback() {
|
||||
await super.disconnectedCallback();
|
||||
document.removeEventListener('click', this.handleClickOutside);
|
||||
}
|
||||
|
||||
async firstUpdated() {
|
||||
// Initialize with empty value if not set
|
||||
if (!this.value) {
|
||||
this.value = '';
|
||||
}
|
||||
|
||||
// Initialize view date and selected time
|
||||
if (this.value) {
|
||||
try {
|
||||
const date = new Date(this.value);
|
||||
@@ -160,19 +119,15 @@ export class DeesInputDatepicker extends DeesInputBase<DeesInputDatepicker> {
|
||||
if (isNaN(date.getTime())) return '';
|
||||
|
||||
let formatted = this.dateFormat;
|
||||
|
||||
// Basic date formatting
|
||||
const day = date.getDate().toString().padStart(2, '0');
|
||||
const month = (date.getMonth() + 1).toString().padStart(2, '0');
|
||||
const year = date.getFullYear().toString();
|
||||
|
||||
// Replace in correct order to avoid conflicts
|
||||
formatted = formatted.replace('YYYY', year);
|
||||
formatted = formatted.replace('YY', year.slice(-2));
|
||||
formatted = formatted.replace('MM', month);
|
||||
formatted = formatted.replace('DD', day);
|
||||
|
||||
// Time formatting if enabled
|
||||
if (this.enableTime) {
|
||||
const hours24 = date.getHours();
|
||||
const hours12 = hours24 === 0 ? 12 : hours24 > 12 ? hours24 - 12 : hours24;
|
||||
@@ -186,17 +141,11 @@ export class DeesInputDatepicker extends DeesInputBase<DeesInputDatepicker> {
|
||||
}
|
||||
}
|
||||
|
||||
// Timezone formatting if enabled
|
||||
if (this.enableTimezone) {
|
||||
const formatter = new Intl.DateTimeFormat('en-US', {
|
||||
timeZoneName: 'short',
|
||||
timeZone: this.timezone
|
||||
});
|
||||
const formatter = new Intl.DateTimeFormat('en-US', { timeZoneName: 'short', timeZone: this.timezone });
|
||||
const parts = formatter.formatToParts(date);
|
||||
const tzPart = parts.find(part => part.type === 'timeZoneName');
|
||||
if (tzPart) {
|
||||
formatted += ` ${tzPart.value}`;
|
||||
}
|
||||
if (tzPart) formatted += ` ${tzPart.value}`;
|
||||
}
|
||||
|
||||
return formatted;
|
||||
@@ -205,274 +154,101 @@ export class DeesInputDatepicker extends DeesInputBase<DeesInputDatepicker> {
|
||||
}
|
||||
}
|
||||
|
||||
private handleClickOutside = (event: MouseEvent) => {
|
||||
const path = event.composedPath();
|
||||
if (!path.includes(this)) {
|
||||
this.isOpened = false;
|
||||
document.removeEventListener('click', this.handleClickOutside);
|
||||
}
|
||||
};
|
||||
|
||||
public async toggleCalendar(): Promise<void> {
|
||||
if (this.disabled) return;
|
||||
|
||||
this.isOpened = !this.isOpened;
|
||||
|
||||
if (this.isOpened) {
|
||||
// Check available space and set position
|
||||
this.closePopup();
|
||||
return;
|
||||
}
|
||||
|
||||
this.isOpened = true;
|
||||
|
||||
const inputContainer = this.shadowRoot!.querySelector('.input-container') as HTMLElement;
|
||||
const rect = inputContainer.getBoundingClientRect();
|
||||
const spaceBelow = window.innerHeight - rect.bottom;
|
||||
const spaceAbove = rect.top;
|
||||
const opensToTop = spaceBelow < 400 && spaceAbove > spaceBelow;
|
||||
|
||||
// Determine if we should open upwards (approximate height of 400px)
|
||||
this.opensToTop = spaceBelow < 400 && spaceAbove > spaceBelow;
|
||||
|
||||
// Add click outside listener
|
||||
setTimeout(() => {
|
||||
document.addEventListener('click', this.handleClickOutside);
|
||||
}, 0);
|
||||
} else {
|
||||
document.removeEventListener('click', this.handleClickOutside);
|
||||
}
|
||||
if (!this.popupInstance) {
|
||||
this.popupInstance = new DeesInputDatepickerPopup();
|
||||
}
|
||||
|
||||
public getDaysInMonth(): Date[] {
|
||||
const year = this.viewDate.getFullYear();
|
||||
const month = this.viewDate.getMonth();
|
||||
const firstDay = new Date(year, month, 1);
|
||||
const lastDay = new Date(year, month + 1, 0);
|
||||
const days: Date[] = [];
|
||||
// Configure popup
|
||||
this.popupInstance.triggerRect = rect;
|
||||
this.popupInstance.ownerComponent = this;
|
||||
this.popupInstance.opensToTop = opensToTop;
|
||||
this.popupInstance.enableTime = this.enableTime;
|
||||
this.popupInstance.timeFormat = this.timeFormat;
|
||||
this.popupInstance.minuteIncrement = this.minuteIncrement;
|
||||
this.popupInstance.weekStartsOn = this.weekStartsOn;
|
||||
this.popupInstance.minDate = this.minDate;
|
||||
this.popupInstance.maxDate = this.maxDate;
|
||||
this.popupInstance.disabledDates = this.disabledDates;
|
||||
this.popupInstance.enableTimezone = this.enableTimezone;
|
||||
this.popupInstance.timezone = this.timezone;
|
||||
this.popupInstance.events = this.events;
|
||||
this.popupInstance.selectedDate = this.selectedDate;
|
||||
this.popupInstance.viewDate = new Date(this.viewDate);
|
||||
this.popupInstance.selectedHour = this.selectedHour;
|
||||
this.popupInstance.selectedMinute = this.selectedMinute;
|
||||
|
||||
// Adjust for week start
|
||||
const startOffset = this.weekStartsOn === 1
|
||||
? (firstDay.getDay() === 0 ? 6 : firstDay.getDay() - 1)
|
||||
: firstDay.getDay();
|
||||
// Listen for popup events
|
||||
this.popupInstance.addEventListener('date-selected', this.handleDateSelected);
|
||||
this.popupInstance.addEventListener('date-cleared', this.handleDateCleared);
|
||||
this.popupInstance.addEventListener('close-request', this.handleCloseRequest);
|
||||
this.popupInstance.addEventListener('reposition-request', this.handleRepositionRequest);
|
||||
|
||||
// Add days from previous month
|
||||
for (let i = startOffset; i > 0; i--) {
|
||||
days.push(new Date(year, month, 1 - i));
|
||||
await this.popupInstance.show();
|
||||
}
|
||||
|
||||
// Add days of current month
|
||||
for (let i = 1; i <= lastDay.getDate(); i++) {
|
||||
days.push(new Date(year, month, i));
|
||||
}
|
||||
|
||||
// Add days from next month to complete the grid (6 rows)
|
||||
const remainingDays = 42 - days.length;
|
||||
for (let i = 1; i <= remainingDays; i++) {
|
||||
days.push(new Date(year, month + 1, i));
|
||||
}
|
||||
|
||||
return days;
|
||||
}
|
||||
|
||||
public isToday(date: Date): boolean {
|
||||
const today = new Date();
|
||||
return date.getDate() === today.getDate() &&
|
||||
date.getMonth() === today.getMonth() &&
|
||||
date.getFullYear() === today.getFullYear();
|
||||
}
|
||||
|
||||
public isSelected(date: Date): boolean {
|
||||
if (!this.selectedDate) return false;
|
||||
return date.getDate() === this.selectedDate.getDate() &&
|
||||
date.getMonth() === this.selectedDate.getMonth() &&
|
||||
date.getFullYear() === this.selectedDate.getFullYear();
|
||||
}
|
||||
|
||||
public isDisabled(date: Date): boolean {
|
||||
// Check min date
|
||||
if (this.minDate) {
|
||||
const min = new Date(this.minDate);
|
||||
if (date < min) return true;
|
||||
}
|
||||
|
||||
// Check max date
|
||||
if (this.maxDate) {
|
||||
const max = new Date(this.maxDate);
|
||||
if (date > max) return true;
|
||||
}
|
||||
|
||||
// Check disabled dates
|
||||
if (this.disabledDates && this.disabledDates.length > 0) {
|
||||
return this.disabledDates.some(disabledStr => {
|
||||
try {
|
||||
const disabled = new Date(disabledStr);
|
||||
return date.getDate() === disabled.getDate() &&
|
||||
date.getMonth() === disabled.getMonth() &&
|
||||
date.getFullYear() === disabled.getFullYear();
|
||||
} catch {
|
||||
return false;
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
return false;
|
||||
}
|
||||
|
||||
public getEventsForDate(date: Date): IDateEvent[] {
|
||||
if (!this.events || this.events.length === 0) return [];
|
||||
|
||||
const dateStr = `${date.getFullYear()}-${(date.getMonth() + 1).toString().padStart(2, '0')}-${date.getDate().toString().padStart(2, '0')}`;
|
||||
return this.events.filter(event => event.date === dateStr);
|
||||
}
|
||||
|
||||
public selectDate(date: Date): void {
|
||||
this.selectedDate = new Date(
|
||||
date.getFullYear(),
|
||||
date.getMonth(),
|
||||
date.getDate(),
|
||||
this.selectedHour,
|
||||
this.selectedMinute
|
||||
);
|
||||
|
||||
this.value = this.formatValueWithTimezone(this.selectedDate);
|
||||
this.changeSubject.next(this);
|
||||
|
||||
if (!this.enableTime) {
|
||||
private closePopup(): void {
|
||||
this.isOpened = false;
|
||||
if (this.popupInstance) {
|
||||
this.popupInstance.removeEventListener('date-selected', this.handleDateSelected);
|
||||
this.popupInstance.removeEventListener('date-cleared', this.handleDateCleared);
|
||||
this.popupInstance.removeEventListener('close-request', this.handleCloseRequest);
|
||||
this.popupInstance.removeEventListener('reposition-request', this.handleRepositionRequest);
|
||||
this.popupInstance.hide();
|
||||
}
|
||||
}
|
||||
|
||||
public selectToday(): void {
|
||||
const today = new Date();
|
||||
this.selectedDate = today;
|
||||
this.viewDate = new Date(today);
|
||||
this.selectedHour = today.getHours();
|
||||
this.selectedMinute = today.getMinutes();
|
||||
|
||||
this.value = this.formatValueWithTimezone(this.selectedDate);
|
||||
private handleDateSelected = (event: Event): void => {
|
||||
const date = (event as CustomEvent).detail as Date;
|
||||
this.selectedDate = date;
|
||||
this.selectedHour = date.getHours();
|
||||
this.selectedMinute = date.getMinutes();
|
||||
this.viewDate = new Date(date);
|
||||
this.value = this.formatValueWithTimezone(date);
|
||||
this.changeSubject.next(this);
|
||||
};
|
||||
|
||||
if (!this.enableTime) {
|
||||
this.isOpened = false;
|
||||
}
|
||||
}
|
||||
|
||||
public clear(): void {
|
||||
private handleDateCleared = (): void => {
|
||||
this.value = '';
|
||||
this.selectedDate = null;
|
||||
this.changeSubject.next(this);
|
||||
this.isOpened = false;
|
||||
};
|
||||
|
||||
private handleCloseRequest = (): void => {
|
||||
this.closePopup();
|
||||
};
|
||||
|
||||
private handleRepositionRequest = (): void => {
|
||||
if (!this.popupInstance || !this.isOpened) return;
|
||||
const inputContainer = this.shadowRoot!.querySelector('.input-container') as HTMLElement;
|
||||
if (!inputContainer) return;
|
||||
|
||||
const rect = inputContainer.getBoundingClientRect();
|
||||
if (rect.bottom < 0 || rect.top > window.innerHeight) {
|
||||
this.closePopup();
|
||||
return;
|
||||
}
|
||||
|
||||
public previousMonth(): void {
|
||||
this.viewDate = new Date(this.viewDate.getFullYear(), this.viewDate.getMonth() - 1, 1);
|
||||
}
|
||||
|
||||
public nextMonth(): void {
|
||||
this.viewDate = new Date(this.viewDate.getFullYear(), this.viewDate.getMonth() + 1, 1);
|
||||
}
|
||||
|
||||
public handleHourInput(e: InputEvent): void {
|
||||
const input = e.target as HTMLInputElement;
|
||||
let value = parseInt(input.value) || 0;
|
||||
|
||||
if (this.timeFormat === '12h') {
|
||||
value = Math.max(1, Math.min(12, value));
|
||||
// Convert to 24h format
|
||||
if (this.selectedHour >= 12 && value !== 12) {
|
||||
this.selectedHour = value + 12;
|
||||
} else if (this.selectedHour < 12 && value === 12) {
|
||||
this.selectedHour = 0;
|
||||
} else {
|
||||
this.selectedHour = value;
|
||||
}
|
||||
} else {
|
||||
this.selectedHour = Math.max(0, Math.min(23, value));
|
||||
}
|
||||
|
||||
this.updateSelectedDateTime();
|
||||
}
|
||||
|
||||
public handleMinuteInput(e: InputEvent): void {
|
||||
const input = e.target as HTMLInputElement;
|
||||
let value = parseInt(input.value) || 0;
|
||||
value = Math.max(0, Math.min(59, value));
|
||||
|
||||
if (this.minuteIncrement && this.minuteIncrement > 1) {
|
||||
value = Math.round(value / this.minuteIncrement) * this.minuteIncrement;
|
||||
}
|
||||
|
||||
this.selectedMinute = value;
|
||||
this.updateSelectedDateTime();
|
||||
}
|
||||
|
||||
public setAMPM(period: 'am' | 'pm'): void {
|
||||
if (period === 'am' && this.selectedHour >= 12) {
|
||||
this.selectedHour -= 12;
|
||||
} else if (period === 'pm' && this.selectedHour < 12) {
|
||||
this.selectedHour += 12;
|
||||
}
|
||||
this.updateSelectedDateTime();
|
||||
}
|
||||
|
||||
private updateSelectedDateTime(): void {
|
||||
if (this.selectedDate) {
|
||||
this.selectedDate = new Date(
|
||||
this.selectedDate.getFullYear(),
|
||||
this.selectedDate.getMonth(),
|
||||
this.selectedDate.getDate(),
|
||||
this.selectedHour,
|
||||
this.selectedMinute
|
||||
);
|
||||
this.value = this.formatValueWithTimezone(this.selectedDate);
|
||||
this.changeSubject.next(this);
|
||||
}
|
||||
}
|
||||
|
||||
public handleTimezoneChange(e: Event): void {
|
||||
const select = e.target as HTMLSelectElement;
|
||||
this.timezone = select.value;
|
||||
this.updateSelectedDateTime();
|
||||
}
|
||||
|
||||
private formatValueWithTimezone(date: Date): string {
|
||||
if (!this.enableTimezone) {
|
||||
return date.toISOString();
|
||||
}
|
||||
|
||||
// Format the date with timezone offset
|
||||
const formatter = new Intl.DateTimeFormat('en-US', {
|
||||
year: 'numeric',
|
||||
month: '2-digit',
|
||||
day: '2-digit',
|
||||
hour: '2-digit',
|
||||
minute: '2-digit',
|
||||
second: '2-digit',
|
||||
hour12: false,
|
||||
timeZone: this.timezone,
|
||||
timeZoneName: 'short'
|
||||
});
|
||||
|
||||
const parts = formatter.formatToParts(date);
|
||||
const dateParts: any = {};
|
||||
parts.forEach(part => {
|
||||
dateParts[part.type] = part.value;
|
||||
});
|
||||
|
||||
// Create ISO-like format with timezone
|
||||
const isoString = `${dateParts.year}-${dateParts.month}-${dateParts.day}T${dateParts.hour}:${dateParts.minute}:${dateParts.second}`;
|
||||
|
||||
// Get timezone offset
|
||||
const tzOffset = this.getTimezoneOffset(date, this.timezone);
|
||||
return `${isoString}${tzOffset}`;
|
||||
}
|
||||
|
||||
private getTimezoneOffset(date: Date, timezone: string): string {
|
||||
// Create a date in the target timezone
|
||||
const tzDate = new Date(date.toLocaleString('en-US', { timeZone: timezone }));
|
||||
const utcDate = new Date(date.toLocaleString('en-US', { timeZone: 'UTC' }));
|
||||
|
||||
const offsetMinutes = (tzDate.getTime() - utcDate.getTime()) / (1000 * 60);
|
||||
const hours = Math.floor(Math.abs(offsetMinutes) / 60);
|
||||
const minutes = Math.abs(offsetMinutes) % 60;
|
||||
const sign = offsetMinutes >= 0 ? '+' : '-';
|
||||
|
||||
return `${sign}${hours.toString().padStart(2, '0')}:${minutes.toString().padStart(2, '0')}`;
|
||||
}
|
||||
const spaceBelow = window.innerHeight - rect.bottom;
|
||||
const spaceAbove = rect.top;
|
||||
this.popupInstance.opensToTop = spaceBelow < 400 && spaceAbove > spaceBelow;
|
||||
this.popupInstance.triggerRect = rect;
|
||||
};
|
||||
|
||||
public handleKeydown(e: KeyboardEvent): void {
|
||||
if (e.key === 'Enter' || e.key === ' ') {
|
||||
@@ -480,7 +256,7 @@ export class DeesInputDatepicker extends DeesInputBase<DeesInputDatepicker> {
|
||||
this.toggleCalendar();
|
||||
} else if (e.key === 'Escape' && this.isOpened) {
|
||||
e.preventDefault();
|
||||
this.isOpened = false;
|
||||
this.closePopup();
|
||||
}
|
||||
}
|
||||
|
||||
@@ -496,7 +272,6 @@ export class DeesInputDatepicker extends DeesInputBase<DeesInputDatepicker> {
|
||||
const inputValue = input.value.trim();
|
||||
|
||||
if (!inputValue) {
|
||||
// Clear the value if input is empty
|
||||
this.value = '';
|
||||
this.selectedDate = null;
|
||||
return;
|
||||
@@ -504,7 +279,6 @@ export class DeesInputDatepicker extends DeesInputBase<DeesInputDatepicker> {
|
||||
|
||||
const parsedDate = this.parseManualDate(inputValue);
|
||||
if (parsedDate && !isNaN(parsedDate.getTime())) {
|
||||
// Update internal state without triggering re-render of input
|
||||
this.value = parsedDate.toISOString();
|
||||
this.selectedDate = parsedDate;
|
||||
this.viewDate = new Date(parsedDate);
|
||||
@@ -533,10 +307,8 @@ export class DeesInputDatepicker extends DeesInputBase<DeesInputDatepicker> {
|
||||
this.selectedHour = parsedDate.getHours();
|
||||
this.selectedMinute = parsedDate.getMinutes();
|
||||
this.changeSubject.next(this);
|
||||
// Update the input with formatted date
|
||||
input.value = this.formatDate(this.value);
|
||||
} else {
|
||||
// Revert to previous valid value on blur if parsing failed
|
||||
input.value = this.formatDate(this.value);
|
||||
}
|
||||
}
|
||||
@@ -544,22 +316,17 @@ export class DeesInputDatepicker extends DeesInputBase<DeesInputDatepicker> {
|
||||
private parseManualDate(input: string): Date | null {
|
||||
if (!input) return null;
|
||||
|
||||
// Split date and time parts if present
|
||||
const parts = input.split(' ');
|
||||
let datePart = parts[0];
|
||||
let timePart = parts[1] || '';
|
||||
|
||||
let parsedDate: Date | null = null;
|
||||
|
||||
// Try different date formats
|
||||
// Format 1: YYYY-MM-DD (ISO-like)
|
||||
const isoMatch = datePart.match(/^(\d{4})-(\d{1,2})-(\d{1,2})$/);
|
||||
if (isoMatch) {
|
||||
const [_, year, month, day] = isoMatch;
|
||||
parsedDate = new Date(parseInt(year), parseInt(month) - 1, parseInt(day));
|
||||
}
|
||||
|
||||
// Format 2: DD.MM.YYYY (European)
|
||||
if (!parsedDate) {
|
||||
const euMatch = datePart.match(/^(\d{1,2})\.(\d{1,2})\.(\d{4})$/);
|
||||
if (euMatch) {
|
||||
@@ -568,7 +335,6 @@ export class DeesInputDatepicker extends DeesInputBase<DeesInputDatepicker> {
|
||||
}
|
||||
}
|
||||
|
||||
// Format 3: MM/DD/YYYY (US)
|
||||
if (!parsedDate) {
|
||||
const usMatch = datePart.match(/^(\d{1,2})\/(\d{1,2})\/(\d{4})$/);
|
||||
if (usMatch) {
|
||||
@@ -577,12 +343,8 @@ export class DeesInputDatepicker extends DeesInputBase<DeesInputDatepicker> {
|
||||
}
|
||||
}
|
||||
|
||||
// If no date was parsed, return null
|
||||
if (!parsedDate || isNaN(parsedDate.getTime())) {
|
||||
return null;
|
||||
}
|
||||
if (!parsedDate || isNaN(parsedDate.getTime())) return null;
|
||||
|
||||
// Parse time if present (HH:MM format)
|
||||
if (timePart) {
|
||||
const timeMatch = timePart.match(/^(\d{1,2}):(\d{2})$/);
|
||||
if (timeMatch) {
|
||||
@@ -591,7 +353,6 @@ export class DeesInputDatepicker extends DeesInputBase<DeesInputDatepicker> {
|
||||
parsedDate.setMinutes(parseInt(minutes));
|
||||
}
|
||||
} else if (!this.enableTime) {
|
||||
// If time is not enabled and not provided, use current time
|
||||
const now = new Date();
|
||||
parsedDate.setHours(now.getHours());
|
||||
parsedDate.setMinutes(now.getMinutes());
|
||||
@@ -602,6 +363,34 @@ export class DeesInputDatepicker extends DeesInputBase<DeesInputDatepicker> {
|
||||
return parsedDate;
|
||||
}
|
||||
|
||||
private formatValueWithTimezone(date: Date): string {
|
||||
if (!this.enableTimezone) return date.toISOString();
|
||||
|
||||
const formatter = new Intl.DateTimeFormat('en-US', {
|
||||
year: 'numeric', month: '2-digit', day: '2-digit',
|
||||
hour: '2-digit', minute: '2-digit', second: '2-digit',
|
||||
hour12: false, timeZone: this.timezone, timeZoneName: 'short',
|
||||
});
|
||||
|
||||
const parts = formatter.formatToParts(date);
|
||||
const dateParts: any = {};
|
||||
parts.forEach(part => { dateParts[part.type] = part.value; });
|
||||
|
||||
const isoString = `${dateParts.year}-${dateParts.month}-${dateParts.day}T${dateParts.hour}:${dateParts.minute}:${dateParts.second}`;
|
||||
const tzOffset = this.getTimezoneOffset(date, this.timezone);
|
||||
return `${isoString}${tzOffset}`;
|
||||
}
|
||||
|
||||
private getTimezoneOffset(date: Date, timezone: string): string {
|
||||
const tzDate = new Date(date.toLocaleString('en-US', { timeZone: timezone }));
|
||||
const utcDate = new Date(date.toLocaleString('en-US', { timeZone: 'UTC' }));
|
||||
const offsetMinutes = (tzDate.getTime() - utcDate.getTime()) / (1000 * 60);
|
||||
const hours = Math.floor(Math.abs(offsetMinutes) / 60);
|
||||
const minutes = Math.abs(offsetMinutes) % 60;
|
||||
const sign = offsetMinutes >= 0 ? '+' : '-';
|
||||
return `${sign}${hours.toString().padStart(2, '0')}:${minutes.toString().padStart(2, '0')}`;
|
||||
}
|
||||
|
||||
public getValue(): string {
|
||||
return this.value;
|
||||
}
|
||||
@@ -622,4 +411,16 @@ export class DeesInputDatepicker extends DeesInputBase<DeesInputDatepicker> {
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
async disconnectedCallback() {
|
||||
await super.disconnectedCallback();
|
||||
if (this.popupInstance) {
|
||||
this.popupInstance.removeEventListener('date-selected', this.handleDateSelected);
|
||||
this.popupInstance.removeEventListener('date-cleared', this.handleDateCleared);
|
||||
this.popupInstance.removeEventListener('close-request', this.handleCloseRequest);
|
||||
this.popupInstance.removeEventListener('reposition-request', this.handleRepositionRequest);
|
||||
this.popupInstance.hide();
|
||||
this.popupInstance = null;
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1,758 @@
|
||||
import {
|
||||
customElement,
|
||||
type TemplateResult,
|
||||
property,
|
||||
state,
|
||||
html,
|
||||
css,
|
||||
cssManager,
|
||||
DeesElement,
|
||||
} from '@design.estate/dees-element';
|
||||
import * as domtools from '@design.estate/dees-domtools';
|
||||
import { zIndexRegistry } from '../../00zindex.js';
|
||||
import { themeDefaultStyles } from '../../00theme.js';
|
||||
import { DeesWindowLayer } from '../../00group-overlay/dees-windowlayer/dees-windowlayer.js';
|
||||
import '../../00group-utility/dees-icon/dees-icon.js';
|
||||
import type { IDateEvent } from './types.js';
|
||||
|
||||
declare global {
|
||||
interface HTMLElementTagNameMap {
|
||||
'dees-input-datepicker-popup': DeesInputDatepickerPopup;
|
||||
}
|
||||
}
|
||||
|
||||
@customElement('dees-input-datepicker-popup')
|
||||
export class DeesInputDatepickerPopup extends DeesElement {
|
||||
// Properties set by the parent
|
||||
@property({ attribute: false })
|
||||
accessor triggerRect: DOMRect | null = null;
|
||||
|
||||
@property({ attribute: false })
|
||||
accessor ownerComponent: HTMLElement | null = null;
|
||||
|
||||
@property({ type: Boolean })
|
||||
accessor enableTime: boolean = false;
|
||||
|
||||
@property({ type: String })
|
||||
accessor timeFormat: '24h' | '12h' = '24h';
|
||||
|
||||
@property({ type: Number })
|
||||
accessor minuteIncrement: number = 1;
|
||||
|
||||
@property({ type: Number })
|
||||
accessor weekStartsOn: 0 | 1 = 1;
|
||||
|
||||
@property({ type: String })
|
||||
accessor minDate: string = '';
|
||||
|
||||
@property({ type: String })
|
||||
accessor maxDate: string = '';
|
||||
|
||||
@property({ type: Array })
|
||||
accessor disabledDates: string[] = [];
|
||||
|
||||
@property({ type: Boolean })
|
||||
accessor enableTimezone: boolean = false;
|
||||
|
||||
@property({ type: String })
|
||||
accessor timezone: string = Intl.DateTimeFormat().resolvedOptions().timeZone;
|
||||
|
||||
@property({ type: Array })
|
||||
accessor events: IDateEvent[] = [];
|
||||
|
||||
@property({ type: Boolean })
|
||||
accessor opensToTop: boolean = false;
|
||||
|
||||
// Internal state
|
||||
@state()
|
||||
accessor selectedDate: Date | null = null;
|
||||
|
||||
@state()
|
||||
accessor viewDate: Date = new Date();
|
||||
|
||||
@state()
|
||||
accessor selectedHour: number = 0;
|
||||
|
||||
@state()
|
||||
accessor selectedMinute: number = 0;
|
||||
|
||||
@state()
|
||||
accessor menuZIndex: number = 1000;
|
||||
|
||||
@state()
|
||||
accessor visible: boolean = false;
|
||||
|
||||
private windowLayer: DeesWindowLayer | null = null;
|
||||
private isDestroying: boolean = false;
|
||||
|
||||
public static styles = [
|
||||
themeDefaultStyles,
|
||||
cssManager.defaultStyles,
|
||||
css`
|
||||
:host {
|
||||
position: fixed;
|
||||
top: 0;
|
||||
left: 0;
|
||||
width: 0;
|
||||
height: 0;
|
||||
pointer-events: none;
|
||||
}
|
||||
|
||||
* {
|
||||
box-sizing: border-box;
|
||||
}
|
||||
|
||||
.calendar-popup {
|
||||
position: fixed;
|
||||
pointer-events: auto;
|
||||
will-change: transform, opacity;
|
||||
transition: all 0.15s ease;
|
||||
opacity: 0;
|
||||
transform: translateY(-4px);
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(224 71.4% 4.1%)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
box-shadow: ${cssManager.bdTheme(
|
||||
'0 10px 15px -3px hsl(0 0% 0% / 0.1), 0 4px 6px -4px hsl(0 0% 0% / 0.1)',
|
||||
'0 10px 15px -3px hsl(0 0% 0% / 0.2), 0 4px 6px -4px hsl(0 0% 0% / 0.2)'
|
||||
)};
|
||||
border-radius: 6px;
|
||||
padding: 12px;
|
||||
user-select: none;
|
||||
min-width: 280px;
|
||||
}
|
||||
|
||||
.calendar-popup.top {
|
||||
transform: translateY(4px);
|
||||
}
|
||||
|
||||
.calendar-popup.show {
|
||||
transform: translateY(0);
|
||||
opacity: 1;
|
||||
}
|
||||
|
||||
/* Calendar Header */
|
||||
.calendar-header {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: space-between;
|
||||
margin-bottom: 16px;
|
||||
gap: 8px;
|
||||
}
|
||||
|
||||
.month-year-display {
|
||||
font-weight: 500;
|
||||
font-size: 14px;
|
||||
color: ${cssManager.bdTheme('hsl(224 71.4% 4.1%)', 'hsl(210 20% 98%)')};
|
||||
flex: 1;
|
||||
text-align: center;
|
||||
}
|
||||
|
||||
.nav-button {
|
||||
width: 28px;
|
||||
height: 28px;
|
||||
border: none;
|
||||
background: transparent;
|
||||
cursor: pointer;
|
||||
border-radius: 6px;
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: center;
|
||||
color: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
transition: all 0.2s ease;
|
||||
}
|
||||
|
||||
.nav-button:hover {
|
||||
background: ${cssManager.bdTheme('hsl(210 20% 98%)', 'hsl(215 27.9% 16.9%)')};
|
||||
color: ${cssManager.bdTheme('hsl(224 71.4% 4.1%)', 'hsl(210 20% 98%)')};
|
||||
}
|
||||
|
||||
/* Weekday headers */
|
||||
.weekdays {
|
||||
display: grid;
|
||||
grid-template-columns: repeat(7, 1fr);
|
||||
margin-bottom: 4px;
|
||||
}
|
||||
|
||||
.weekday {
|
||||
text-align: center;
|
||||
font-size: 12px;
|
||||
font-weight: 400;
|
||||
color: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
padding: 0 0 8px 0;
|
||||
}
|
||||
|
||||
/* Days grid */
|
||||
.days-grid {
|
||||
display: grid;
|
||||
grid-template-columns: repeat(7, 1fr);
|
||||
gap: 2px;
|
||||
}
|
||||
|
||||
.day {
|
||||
aspect-ratio: 1;
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: center;
|
||||
cursor: pointer;
|
||||
border-radius: 6px;
|
||||
font-size: 14px;
|
||||
transition: all 0.2s ease;
|
||||
color: ${cssManager.bdTheme('hsl(224 71.4% 4.1%)', 'hsl(210 20% 98%)')};
|
||||
border: none;
|
||||
width: 36px;
|
||||
height: 36px;
|
||||
background: transparent;
|
||||
position: relative;
|
||||
}
|
||||
|
||||
.day:hover:not(.disabled) {
|
||||
background: ${cssManager.bdTheme('hsl(210 20% 98%)', 'hsl(215 27.9% 16.9%)')};
|
||||
}
|
||||
|
||||
.day.other-month {
|
||||
color: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
opacity: 0.5;
|
||||
}
|
||||
|
||||
.day.today {
|
||||
background: ${cssManager.bdTheme('hsl(210 20% 98%)', 'hsl(215 27.9% 16.9%)')};
|
||||
font-weight: 500;
|
||||
}
|
||||
|
||||
.day.selected {
|
||||
background: ${cssManager.bdTheme('hsl(222.2 47.4% 11.2%)', 'hsl(210 20% 98%)')};
|
||||
color: ${cssManager.bdTheme('hsl(210 20% 98%)', 'hsl(222.2 47.4% 11.2%)')};
|
||||
font-weight: 500;
|
||||
}
|
||||
|
||||
.day.disabled {
|
||||
color: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
cursor: not-allowed;
|
||||
opacity: 0.3;
|
||||
}
|
||||
|
||||
/* Event indicators */
|
||||
.event-indicator {
|
||||
position: absolute;
|
||||
bottom: 4px;
|
||||
left: 50%;
|
||||
transform: translateX(-50%);
|
||||
display: flex;
|
||||
gap: 2px;
|
||||
}
|
||||
|
||||
.event-dot {
|
||||
width: 4px;
|
||||
height: 4px;
|
||||
border-radius: 50%;
|
||||
background: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
}
|
||||
|
||||
.event-dot.info { background: ${cssManager.bdTheme('hsl(211 70% 52%)', 'hsl(211 70% 62%)')}; }
|
||||
.event-dot.warning { background: ${cssManager.bdTheme('hsl(45 90% 45%)', 'hsl(45 90% 55%)')}; }
|
||||
.event-dot.success { background: ${cssManager.bdTheme('hsl(142 69% 45%)', 'hsl(142 69% 55%)')}; }
|
||||
.event-dot.error { background: ${cssManager.bdTheme('hsl(0 72% 51%)', 'hsl(0 72% 61%)')}; }
|
||||
|
||||
.event-count {
|
||||
position: absolute;
|
||||
top: 2px;
|
||||
right: 2px;
|
||||
min-width: 16px;
|
||||
height: 16px;
|
||||
padding: 0 4px;
|
||||
background: ${cssManager.bdTheme('hsl(0 72% 51%)', 'hsl(0 72% 61%)')};
|
||||
color: white;
|
||||
border-radius: 8px;
|
||||
font-size: 10px;
|
||||
font-weight: 600;
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: center;
|
||||
}
|
||||
|
||||
.event-tooltip {
|
||||
position: absolute;
|
||||
bottom: calc(100% + 8px);
|
||||
left: 50%;
|
||||
transform: translateX(-50%);
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 20%)', 'hsl(0 0% 90%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 0%)')};
|
||||
padding: 8px 12px;
|
||||
border-radius: 6px;
|
||||
font-size: 12px;
|
||||
white-space: nowrap;
|
||||
pointer-events: none;
|
||||
opacity: 0;
|
||||
transition: opacity 0.2s ease;
|
||||
z-index: 10;
|
||||
}
|
||||
|
||||
.day.has-event:hover .event-tooltip { opacity: 1; }
|
||||
|
||||
/* Time selector */
|
||||
.time-selector {
|
||||
margin-top: 12px;
|
||||
padding-top: 12px;
|
||||
border-top: 1px solid ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
}
|
||||
|
||||
.time-selector-title {
|
||||
font-size: 12px;
|
||||
font-weight: 500;
|
||||
margin-bottom: 8px;
|
||||
color: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
}
|
||||
|
||||
.time-inputs {
|
||||
display: flex;
|
||||
gap: 8px;
|
||||
align-items: center;
|
||||
}
|
||||
|
||||
.time-input {
|
||||
width: 65px;
|
||||
height: 36px;
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
border-radius: 6px;
|
||||
padding: 0 12px;
|
||||
font-size: 14px;
|
||||
text-align: center;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(224 71.4% 4.1%)')};
|
||||
color: ${cssManager.bdTheme('hsl(224 71.4% 4.1%)', 'hsl(210 20% 98%)')};
|
||||
transition: all 0.2s ease;
|
||||
}
|
||||
|
||||
.time-input:focus {
|
||||
outline: none;
|
||||
border-color: ${cssManager.bdTheme('hsl(222.2 47.4% 11.2%)', 'hsl(210 20% 98%)')};
|
||||
box-shadow: 0 0 0 2px ${cssManager.bdTheme('hsl(222.2 47.4% 11.2% / 0.1)', 'hsl(210 20% 98% / 0.1)')};
|
||||
}
|
||||
|
||||
.time-separator {
|
||||
font-size: 14px;
|
||||
font-weight: 500;
|
||||
color: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
}
|
||||
|
||||
.am-pm-selector { display: flex; gap: 4px; margin-left: 8px; }
|
||||
|
||||
.am-pm-button {
|
||||
padding: 6px 12px;
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(224 71.4% 4.1%)')};
|
||||
border-radius: 6px;
|
||||
font-size: 12px;
|
||||
font-weight: 500;
|
||||
cursor: pointer;
|
||||
transition: all 0.2s ease;
|
||||
color: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
}
|
||||
|
||||
.am-pm-button.selected {
|
||||
background: ${cssManager.bdTheme('hsl(222.2 47.4% 11.2%)', 'hsl(210 20% 98%)')};
|
||||
color: ${cssManager.bdTheme('hsl(210 20% 98%)', 'hsl(222.2 47.4% 11.2%)')};
|
||||
border-color: ${cssManager.bdTheme('hsl(222.2 47.4% 11.2%)', 'hsl(210 20% 98%)')};
|
||||
}
|
||||
|
||||
.am-pm-button:hover:not(.selected) {
|
||||
background: ${cssManager.bdTheme('hsl(210 20% 98%)', 'hsl(215 27.9% 16.9%)')};
|
||||
}
|
||||
|
||||
/* Timezone selector */
|
||||
.timezone-selector {
|
||||
margin-top: 12px;
|
||||
padding-top: 12px;
|
||||
border-top: 1px solid ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
}
|
||||
|
||||
.timezone-selector-title {
|
||||
font-size: 12px;
|
||||
font-weight: 500;
|
||||
margin-bottom: 8px;
|
||||
color: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
}
|
||||
|
||||
.timezone-select {
|
||||
width: 100%;
|
||||
height: 36px;
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
border-radius: 6px;
|
||||
padding: 0 12px;
|
||||
font-size: 14px;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(224 71.4% 4.1%)')};
|
||||
color: ${cssManager.bdTheme('hsl(224 71.4% 4.1%)', 'hsl(210 20% 98%)')};
|
||||
cursor: pointer;
|
||||
}
|
||||
|
||||
/* Action buttons */
|
||||
.calendar-actions {
|
||||
display: flex;
|
||||
gap: 8px;
|
||||
margin-top: 12px;
|
||||
padding-top: 12px;
|
||||
border-top: 1px solid ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
}
|
||||
|
||||
.action-button {
|
||||
flex: 1;
|
||||
height: 36px;
|
||||
border: none;
|
||||
border-radius: 6px;
|
||||
font-size: 14px;
|
||||
font-weight: 500;
|
||||
cursor: pointer;
|
||||
transition: all 0.2s ease;
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: center;
|
||||
}
|
||||
|
||||
.today-button {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(224 71.4% 4.1%)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
color: ${cssManager.bdTheme('hsl(224 71.4% 4.1%)', 'hsl(210 20% 98%)')};
|
||||
}
|
||||
|
||||
.today-button:hover {
|
||||
background: ${cssManager.bdTheme('hsl(210 20% 98%)', 'hsl(215 27.9% 16.9%)')};
|
||||
}
|
||||
|
||||
.clear-action-button {
|
||||
background: transparent;
|
||||
border: 1px solid transparent;
|
||||
color: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
}
|
||||
|
||||
.clear-action-button:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 72.2% 50.6% / 0.1)', 'hsl(0 62.8% 30.6% / 0.1)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 72.2% 50.6%)', 'hsl(0 62.8% 30.6%)')};
|
||||
}
|
||||
`,
|
||||
];
|
||||
|
||||
private static readonly MONTH_NAMES = [
|
||||
'January', 'February', 'March', 'April', 'May', 'June',
|
||||
'July', 'August', 'September', 'October', 'November', 'December',
|
||||
];
|
||||
|
||||
private static readonly TIMEZONES = [
|
||||
{ value: 'UTC', label: 'UTC (Coordinated Universal Time)' },
|
||||
{ value: 'America/New_York', label: 'Eastern Time (US & Canada)' },
|
||||
{ value: 'America/Chicago', label: 'Central Time (US & Canada)' },
|
||||
{ value: 'America/Denver', label: 'Mountain Time (US & Canada)' },
|
||||
{ value: 'America/Los_Angeles', label: 'Pacific Time (US & Canada)' },
|
||||
{ value: 'Europe/London', label: 'London' },
|
||||
{ value: 'Europe/Paris', label: 'Paris' },
|
||||
{ value: 'Europe/Berlin', label: 'Berlin' },
|
||||
{ value: 'Europe/Moscow', label: 'Moscow' },
|
||||
{ value: 'Asia/Dubai', label: 'Dubai' },
|
||||
{ value: 'Asia/Kolkata', label: 'India Standard Time' },
|
||||
{ value: 'Asia/Shanghai', label: 'China Standard Time' },
|
||||
{ value: 'Asia/Tokyo', label: 'Tokyo' },
|
||||
{ value: 'Australia/Sydney', label: 'Sydney' },
|
||||
{ value: 'Pacific/Auckland', label: 'Auckland' },
|
||||
];
|
||||
|
||||
public render(): TemplateResult {
|
||||
if (!this.triggerRect) return html``;
|
||||
|
||||
const posStyle = this.computePositionStyle();
|
||||
const weekDays = this.weekStartsOn === 1
|
||||
? ['Mo', 'Tu', 'We', 'Th', 'Fr', 'Sa', 'Su']
|
||||
: ['Su', 'Mo', 'Tu', 'We', 'Th', 'Fr', 'Sa'];
|
||||
const days = this.getDaysInMonth();
|
||||
const isAM = this.selectedHour < 12;
|
||||
|
||||
return html`
|
||||
<div
|
||||
class="calendar-popup ${this.visible ? 'show' : ''} ${this.opensToTop ? 'top' : 'bottom'}"
|
||||
style="${posStyle}; z-index: ${this.menuZIndex};"
|
||||
>
|
||||
<div class="calendar-header">
|
||||
<button class="nav-button" @click=${this.previousMonth}>
|
||||
<dees-icon icon="lucide:chevronLeft" iconSize="16"></dees-icon>
|
||||
</button>
|
||||
<div class="month-year-display">
|
||||
${DeesInputDatepickerPopup.MONTH_NAMES[this.viewDate.getMonth()]} ${this.viewDate.getFullYear()}
|
||||
</div>
|
||||
<button class="nav-button" @click=${this.nextMonth}>
|
||||
<dees-icon icon="lucide:chevronRight" iconSize="16"></dees-icon>
|
||||
</button>
|
||||
</div>
|
||||
|
||||
<div class="weekdays">
|
||||
${weekDays.map(day => html`<div class="weekday">${day}</div>`)}
|
||||
</div>
|
||||
|
||||
<div class="days-grid">
|
||||
${days.map(day => {
|
||||
const isToday = this.isToday(day);
|
||||
const isSelected = this.isSelected(day);
|
||||
const isOtherMonth = day.getMonth() !== this.viewDate.getMonth();
|
||||
const isDayDisabled = this.isDayDisabled(day);
|
||||
const dayEvents = this.getEventsForDate(day);
|
||||
const hasEvents = dayEvents.length > 0;
|
||||
const totalEventCount = dayEvents.reduce((sum, event) => sum + (event.count || 1), 0);
|
||||
|
||||
return html`
|
||||
<div
|
||||
class="day ${isOtherMonth ? 'other-month' : ''} ${isToday ? 'today' : ''} ${isSelected ? 'selected' : ''} ${isDayDisabled ? 'disabled' : ''} ${hasEvents ? 'has-event' : ''}"
|
||||
@click=${() => !isDayDisabled && this.handleSelectDate(day)}
|
||||
>
|
||||
${day.getDate()}
|
||||
${hasEvents ? html`
|
||||
${totalEventCount > 3 ? html`
|
||||
<div class="event-count">${totalEventCount}</div>
|
||||
` : html`
|
||||
<div class="event-indicator">
|
||||
${dayEvents.slice(0, 3).map(event => html`
|
||||
<div class="event-dot ${event.type || 'info'}"></div>
|
||||
`)}
|
||||
</div>
|
||||
`}
|
||||
${dayEvents[0].title ? html`
|
||||
<div class="event-tooltip">
|
||||
${dayEvents[0].title}
|
||||
${totalEventCount > 1 ? html` (+${totalEventCount - 1} more)` : ''}
|
||||
</div>
|
||||
` : ''}
|
||||
` : ''}
|
||||
</div>
|
||||
`;
|
||||
})}
|
||||
</div>
|
||||
|
||||
${this.enableTime ? html`
|
||||
<div class="time-selector">
|
||||
<div class="time-selector-title">Time</div>
|
||||
<div class="time-inputs">
|
||||
<input type="number" class="time-input"
|
||||
.value=${this.timeFormat === '12h'
|
||||
? (this.selectedHour === 0 ? 12 : this.selectedHour > 12 ? this.selectedHour - 12 : this.selectedHour).toString().padStart(2, '0')
|
||||
: this.selectedHour.toString().padStart(2, '0')}
|
||||
@input=${this.handleHourInput}
|
||||
min="${this.timeFormat === '12h' ? 1 : 0}"
|
||||
max="${this.timeFormat === '12h' ? 12 : 23}"
|
||||
/>
|
||||
<span class="time-separator">:</span>
|
||||
<input type="number" class="time-input"
|
||||
.value=${this.selectedMinute.toString().padStart(2, '0')}
|
||||
@input=${this.handleMinuteInput}
|
||||
min="0" max="59" step="${this.minuteIncrement || 1}"
|
||||
/>
|
||||
${this.timeFormat === '12h' ? html`
|
||||
<div class="am-pm-selector">
|
||||
<button class="am-pm-button ${isAM ? 'selected' : ''}" @click=${() => this.setAMPM('am')}>AM</button>
|
||||
<button class="am-pm-button ${!isAM ? 'selected' : ''}" @click=${() => this.setAMPM('pm')}>PM</button>
|
||||
</div>
|
||||
` : ''}
|
||||
</div>
|
||||
</div>
|
||||
` : ''}
|
||||
|
||||
${this.enableTimezone ? html`
|
||||
<div class="timezone-selector">
|
||||
<div class="timezone-selector-title">Timezone</div>
|
||||
<select class="timezone-select" .value=${this.timezone} @change=${this.handleTimezoneChange}>
|
||||
${DeesInputDatepickerPopup.TIMEZONES.map(tz => html`
|
||||
<option value="${tz.value}" ?selected=${tz.value === this.timezone}>${tz.label}</option>
|
||||
`)}
|
||||
</select>
|
||||
</div>
|
||||
` : ''}
|
||||
|
||||
<div class="calendar-actions">
|
||||
<button class="action-button today-button" @click=${this.handleSelectToday}>Today</button>
|
||||
<button class="action-button clear-action-button" @click=${this.handleClear}>Clear</button>
|
||||
</div>
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
|
||||
private computePositionStyle(): string {
|
||||
const rect = this.triggerRect!;
|
||||
const left = rect.left;
|
||||
|
||||
if (this.opensToTop) {
|
||||
const bottom = window.innerHeight - rect.top + 4;
|
||||
return `left: ${left}px; bottom: ${bottom}px; top: auto`;
|
||||
} else {
|
||||
const top = rect.bottom + 4;
|
||||
return `left: ${left}px; top: ${top}px`;
|
||||
}
|
||||
}
|
||||
|
||||
// Calendar logic
|
||||
private getDaysInMonth(): Date[] {
|
||||
const year = this.viewDate.getFullYear();
|
||||
const month = this.viewDate.getMonth();
|
||||
const firstDay = new Date(year, month, 1);
|
||||
const lastDay = new Date(year, month + 1, 0);
|
||||
const days: Date[] = [];
|
||||
|
||||
const startOffset = this.weekStartsOn === 1
|
||||
? (firstDay.getDay() === 0 ? 6 : firstDay.getDay() - 1)
|
||||
: firstDay.getDay();
|
||||
|
||||
for (let i = startOffset; i > 0; i--) days.push(new Date(year, month, 1 - i));
|
||||
for (let i = 1; i <= lastDay.getDate(); i++) days.push(new Date(year, month, i));
|
||||
const remaining = 42 - days.length;
|
||||
for (let i = 1; i <= remaining; i++) days.push(new Date(year, month + 1, i));
|
||||
|
||||
return days;
|
||||
}
|
||||
|
||||
private isToday(date: Date): boolean {
|
||||
const today = new Date();
|
||||
return date.getDate() === today.getDate() && date.getMonth() === today.getMonth() && date.getFullYear() === today.getFullYear();
|
||||
}
|
||||
|
||||
private isSelected(date: Date): boolean {
|
||||
if (!this.selectedDate) return false;
|
||||
return date.getDate() === this.selectedDate.getDate() && date.getMonth() === this.selectedDate.getMonth() && date.getFullYear() === this.selectedDate.getFullYear();
|
||||
}
|
||||
|
||||
private isDayDisabled(date: Date): boolean {
|
||||
if (this.minDate) { const min = new Date(this.minDate); if (date < min) return true; }
|
||||
if (this.maxDate) { const max = new Date(this.maxDate); if (date > max) return true; }
|
||||
if (this.disabledDates?.length) {
|
||||
return this.disabledDates.some(ds => {
|
||||
try { const d = new Date(ds); return date.getDate() === d.getDate() && date.getMonth() === d.getMonth() && date.getFullYear() === d.getFullYear(); }
|
||||
catch { return false; }
|
||||
});
|
||||
}
|
||||
return false;
|
||||
}
|
||||
|
||||
private getEventsForDate(date: Date): IDateEvent[] {
|
||||
if (!this.events?.length) return [];
|
||||
const dateStr = `${date.getFullYear()}-${(date.getMonth() + 1).toString().padStart(2, '0')}-${date.getDate().toString().padStart(2, '0')}`;
|
||||
return this.events.filter(e => e.date === dateStr);
|
||||
}
|
||||
|
||||
private previousMonth(): void {
|
||||
this.viewDate = new Date(this.viewDate.getFullYear(), this.viewDate.getMonth() - 1, 1);
|
||||
}
|
||||
|
||||
private nextMonth(): void {
|
||||
this.viewDate = new Date(this.viewDate.getFullYear(), this.viewDate.getMonth() + 1, 1);
|
||||
}
|
||||
|
||||
// Event dispatching
|
||||
private handleSelectDate(day: Date): void {
|
||||
this.selectedDate = new Date(day.getFullYear(), day.getMonth(), day.getDate(), this.selectedHour, this.selectedMinute);
|
||||
this.dispatchEvent(new CustomEvent('date-selected', { detail: this.selectedDate }));
|
||||
if (!this.enableTime) {
|
||||
this.dispatchEvent(new CustomEvent('close-request'));
|
||||
}
|
||||
}
|
||||
|
||||
private handleSelectToday(): void {
|
||||
const today = new Date();
|
||||
this.selectedDate = today;
|
||||
this.viewDate = new Date(today);
|
||||
this.selectedHour = today.getHours();
|
||||
this.selectedMinute = today.getMinutes();
|
||||
this.dispatchEvent(new CustomEvent('date-selected', { detail: this.selectedDate }));
|
||||
if (!this.enableTime) {
|
||||
this.dispatchEvent(new CustomEvent('close-request'));
|
||||
}
|
||||
}
|
||||
|
||||
private handleClear(): void {
|
||||
this.dispatchEvent(new CustomEvent('date-cleared'));
|
||||
this.dispatchEvent(new CustomEvent('close-request'));
|
||||
}
|
||||
|
||||
private handleHourInput = (e: InputEvent): void => {
|
||||
const input = e.target as HTMLInputElement;
|
||||
let value = parseInt(input.value) || 0;
|
||||
if (this.timeFormat === '12h') {
|
||||
value = Math.max(1, Math.min(12, value));
|
||||
if (this.selectedHour >= 12 && value !== 12) this.selectedHour = value + 12;
|
||||
else if (this.selectedHour < 12 && value === 12) this.selectedHour = 0;
|
||||
else this.selectedHour = value;
|
||||
} else {
|
||||
this.selectedHour = Math.max(0, Math.min(23, value));
|
||||
}
|
||||
this.emitTimeUpdate();
|
||||
};
|
||||
|
||||
private handleMinuteInput = (e: InputEvent): void => {
|
||||
const input = e.target as HTMLInputElement;
|
||||
let value = parseInt(input.value) || 0;
|
||||
value = Math.max(0, Math.min(59, value));
|
||||
if (this.minuteIncrement > 1) value = Math.round(value / this.minuteIncrement) * this.minuteIncrement;
|
||||
this.selectedMinute = value;
|
||||
this.emitTimeUpdate();
|
||||
};
|
||||
|
||||
private setAMPM(period: 'am' | 'pm'): void {
|
||||
if (period === 'am' && this.selectedHour >= 12) this.selectedHour -= 12;
|
||||
else if (period === 'pm' && this.selectedHour < 12) this.selectedHour += 12;
|
||||
this.emitTimeUpdate();
|
||||
}
|
||||
|
||||
private handleTimezoneChange = (e: Event): void => {
|
||||
this.timezone = (e.target as HTMLSelectElement).value;
|
||||
this.emitTimeUpdate();
|
||||
};
|
||||
|
||||
private emitTimeUpdate(): void {
|
||||
if (this.selectedDate) {
|
||||
this.selectedDate = new Date(this.selectedDate.getFullYear(), this.selectedDate.getMonth(), this.selectedDate.getDate(), this.selectedHour, this.selectedMinute);
|
||||
this.dispatchEvent(new CustomEvent('date-selected', { detail: this.selectedDate }));
|
||||
}
|
||||
}
|
||||
|
||||
// Show/hide lifecycle
|
||||
public async show(): Promise<void> {
|
||||
this.windowLayer = await DeesWindowLayer.createAndShow();
|
||||
this.windowLayer.addEventListener('click', () => {
|
||||
this.dispatchEvent(new CustomEvent('close-request'));
|
||||
});
|
||||
|
||||
this.menuZIndex = zIndexRegistry.getNextZIndex();
|
||||
zIndexRegistry.register(this, this.menuZIndex);
|
||||
this.style.zIndex = this.menuZIndex.toString();
|
||||
|
||||
document.body.appendChild(this);
|
||||
|
||||
await domtools.plugins.smartdelay.delayFor(0);
|
||||
this.visible = true;
|
||||
|
||||
window.addEventListener('scroll', this.handleScrollOrResize, { capture: true, passive: true });
|
||||
window.addEventListener('resize', this.handleScrollOrResize, { passive: true });
|
||||
}
|
||||
|
||||
public async hide(): Promise<void> {
|
||||
if (this.isDestroying) return;
|
||||
this.isDestroying = true;
|
||||
|
||||
window.removeEventListener('scroll', this.handleScrollOrResize, { capture: true } as EventListenerOptions);
|
||||
window.removeEventListener('resize', this.handleScrollOrResize);
|
||||
zIndexRegistry.unregister(this);
|
||||
|
||||
if (this.windowLayer) {
|
||||
this.windowLayer.destroy();
|
||||
this.windowLayer = null;
|
||||
}
|
||||
|
||||
this.visible = false;
|
||||
await domtools.plugins.smartdelay.delayFor(150);
|
||||
|
||||
if (this.parentElement) this.parentElement.removeChild(this);
|
||||
this.isDestroying = false;
|
||||
}
|
||||
|
||||
private handleScrollOrResize = (): void => {
|
||||
this.dispatchEvent(new CustomEvent('reposition-request'));
|
||||
};
|
||||
|
||||
async disconnectedCallback() {
|
||||
await super.disconnectedCallback();
|
||||
window.removeEventListener('scroll', this.handleScrollOrResize, { capture: true } as EventListenerOptions);
|
||||
window.removeEventListener('resize', this.handleScrollOrResize);
|
||||
zIndexRegistry.unregister(this);
|
||||
}
|
||||
}
|
||||
@@ -1 +1,2 @@
|
||||
export * from './component.js';
|
||||
export * from './datepicker-popup.js';
|
||||
|
||||
@@ -56,7 +56,6 @@ export const datepickerStyles = [
|
||||
opacity: 0.5;
|
||||
}
|
||||
|
||||
/* Icon container using flexbox for better positioning */
|
||||
.icon-container {
|
||||
position: absolute;
|
||||
right: 0;
|
||||
@@ -101,414 +100,5 @@ export const datepickerStyles = [
|
||||
background: ${cssManager.bdTheme('hsl(210 20% 98%)', 'hsl(215 27.9% 16.9%)')};
|
||||
color: ${cssManager.bdTheme('hsl(224 71.4% 4.1%)', 'hsl(210 20% 98%)')};
|
||||
}
|
||||
|
||||
.clear-button:disabled {
|
||||
display: none;
|
||||
}
|
||||
|
||||
/* Calendar Popup Styles */
|
||||
.calendar-popup {
|
||||
will-change: transform, opacity;
|
||||
pointer-events: none;
|
||||
transition: all 0.2s ease;
|
||||
opacity: 0;
|
||||
transform: translateY(-4px);
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(224 71.4% 4.1%)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
box-shadow: ${cssManager.bdTheme(
|
||||
'0 10px 15px -3px hsl(0 0% 0% / 0.1), 0 4px 6px -4px hsl(0 0% 0% / 0.1)',
|
||||
'0 10px 15px -3px hsl(0 0% 0% / 0.2), 0 4px 6px -4px hsl(0 0% 0% / 0.2)'
|
||||
)};
|
||||
border-radius: 6px;
|
||||
padding: 12px;
|
||||
position: absolute;
|
||||
user-select: none;
|
||||
margin-top: 4px;
|
||||
z-index: 50;
|
||||
left: 0;
|
||||
min-width: 280px;
|
||||
}
|
||||
|
||||
.calendar-popup.top {
|
||||
bottom: calc(100% + 4px);
|
||||
top: auto;
|
||||
margin-top: 0;
|
||||
margin-bottom: 4px;
|
||||
transform: translateY(4px);
|
||||
}
|
||||
|
||||
.calendar-popup.bottom {
|
||||
top: 100%;
|
||||
}
|
||||
|
||||
.calendar-popup.show {
|
||||
pointer-events: all;
|
||||
transform: translateY(0);
|
||||
opacity: 1;
|
||||
}
|
||||
|
||||
/* Calendar Header */
|
||||
.calendar-header {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: space-between;
|
||||
margin-bottom: 16px;
|
||||
gap: 8px;
|
||||
}
|
||||
|
||||
.month-year-display {
|
||||
font-weight: 500;
|
||||
font-size: 14px;
|
||||
color: ${cssManager.bdTheme('hsl(224 71.4% 4.1%)', 'hsl(210 20% 98%)')};
|
||||
flex: 1;
|
||||
text-align: center;
|
||||
}
|
||||
|
||||
.nav-button {
|
||||
width: 28px;
|
||||
height: 28px;
|
||||
border: none;
|
||||
background: transparent;
|
||||
cursor: pointer;
|
||||
border-radius: 6px;
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: center;
|
||||
color: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
transition: all 0.2s ease;
|
||||
}
|
||||
|
||||
.nav-button:hover {
|
||||
background: ${cssManager.bdTheme('hsl(210 20% 98%)', 'hsl(215 27.9% 16.9%)')};
|
||||
color: ${cssManager.bdTheme('hsl(224 71.4% 4.1%)', 'hsl(210 20% 98%)')};
|
||||
}
|
||||
|
||||
.nav-button:active {
|
||||
background: ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
}
|
||||
|
||||
/* Weekday headers */
|
||||
.weekdays {
|
||||
display: grid;
|
||||
grid-template-columns: repeat(7, 1fr);
|
||||
gap: 0;
|
||||
margin-bottom: 4px;
|
||||
}
|
||||
|
||||
.weekday {
|
||||
text-align: center;
|
||||
font-size: 12px;
|
||||
font-weight: 400;
|
||||
color: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
padding: 0 0 8px 0;
|
||||
}
|
||||
|
||||
/* Days grid */
|
||||
.days-grid {
|
||||
display: grid;
|
||||
grid-template-columns: repeat(7, 1fr);
|
||||
gap: 2px;
|
||||
}
|
||||
|
||||
.day {
|
||||
aspect-ratio: 1;
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: center;
|
||||
cursor: pointer;
|
||||
border-radius: 6px;
|
||||
font-size: 14px;
|
||||
transition: all 0.2s ease;
|
||||
color: ${cssManager.bdTheme('hsl(224 71.4% 4.1%)', 'hsl(210 20% 98%)')};
|
||||
border: none;
|
||||
width: 36px;
|
||||
height: 36px;
|
||||
background: transparent;
|
||||
}
|
||||
|
||||
.day:hover:not(.disabled) {
|
||||
background: ${cssManager.bdTheme('hsl(210 20% 98%)', 'hsl(215 27.9% 16.9%)')};
|
||||
}
|
||||
|
||||
.day.other-month {
|
||||
color: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
opacity: 0.5;
|
||||
}
|
||||
|
||||
.day.today {
|
||||
background: ${cssManager.bdTheme('hsl(210 20% 98%)', 'hsl(215 27.9% 16.9%)')};
|
||||
font-weight: 500;
|
||||
}
|
||||
|
||||
.day.selected {
|
||||
background: ${cssManager.bdTheme('hsl(222.2 47.4% 11.2%)', 'hsl(210 20% 98%)')};
|
||||
color: ${cssManager.bdTheme('hsl(210 20% 98%)', 'hsl(222.2 47.4% 11.2%)')};
|
||||
font-weight: 500;
|
||||
}
|
||||
|
||||
.day.disabled {
|
||||
color: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
cursor: not-allowed;
|
||||
opacity: 0.3;
|
||||
}
|
||||
|
||||
/* Event indicators */
|
||||
.day.has-event {
|
||||
position: relative;
|
||||
}
|
||||
|
||||
.event-indicator {
|
||||
position: absolute;
|
||||
bottom: 4px;
|
||||
left: 50%;
|
||||
transform: translateX(-50%);
|
||||
display: flex;
|
||||
gap: 2px;
|
||||
justify-content: center;
|
||||
}
|
||||
|
||||
.event-dot {
|
||||
width: 4px;
|
||||
height: 4px;
|
||||
border-radius: 50%;
|
||||
background: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
}
|
||||
|
||||
.event-dot.info {
|
||||
background: ${cssManager.bdTheme('hsl(211 70% 52%)', 'hsl(211 70% 62%)')};
|
||||
}
|
||||
|
||||
.event-dot.warning {
|
||||
background: ${cssManager.bdTheme('hsl(45 90% 45%)', 'hsl(45 90% 55%)')};
|
||||
}
|
||||
|
||||
.event-dot.success {
|
||||
background: ${cssManager.bdTheme('hsl(142 69% 45%)', 'hsl(142 69% 55%)')};
|
||||
}
|
||||
|
||||
.event-dot.error {
|
||||
background: ${cssManager.bdTheme('hsl(0 72% 51%)', 'hsl(0 72% 61%)')};
|
||||
}
|
||||
|
||||
.event-count {
|
||||
position: absolute;
|
||||
top: 2px;
|
||||
right: 2px;
|
||||
min-width: 16px;
|
||||
height: 16px;
|
||||
padding: 0 4px;
|
||||
background: ${cssManager.bdTheme('hsl(0 72% 51%)', 'hsl(0 72% 61%)')};
|
||||
color: white;
|
||||
border-radius: 8px;
|
||||
font-size: 10px;
|
||||
font-weight: 600;
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: center;
|
||||
line-height: 1;
|
||||
}
|
||||
|
||||
/* Tooltip for event details */
|
||||
.event-tooltip {
|
||||
position: absolute;
|
||||
bottom: calc(100% + 8px);
|
||||
left: 50%;
|
||||
transform: translateX(-50%);
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 20%)', 'hsl(0 0% 90%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 0%)')};
|
||||
padding: 8px 12px;
|
||||
border-radius: 6px;
|
||||
font-size: 12px;
|
||||
white-space: nowrap;
|
||||
pointer-events: none;
|
||||
opacity: 0;
|
||||
transition: opacity 0.2s ease;
|
||||
z-index: 10;
|
||||
box-shadow: 0 2px 8px rgba(0, 0, 0, 0.2);
|
||||
}
|
||||
|
||||
.event-tooltip::after {
|
||||
content: '';
|
||||
position: absolute;
|
||||
top: 100%;
|
||||
left: 50%;
|
||||
transform: translateX(-50%);
|
||||
border: 4px solid transparent;
|
||||
border-top-color: ${cssManager.bdTheme('hsl(0 0% 20%)', 'hsl(0 0% 90%)')};
|
||||
}
|
||||
|
||||
.day.has-event:hover .event-tooltip {
|
||||
opacity: 1;
|
||||
}
|
||||
|
||||
/* Time selector */
|
||||
.time-selector {
|
||||
margin-top: 12px;
|
||||
padding-top: 12px;
|
||||
border-top: 1px solid ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
}
|
||||
|
||||
.time-selector-title {
|
||||
font-size: 12px;
|
||||
font-weight: 500;
|
||||
margin-bottom: 8px;
|
||||
color: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
}
|
||||
|
||||
.time-inputs {
|
||||
display: flex;
|
||||
gap: 8px;
|
||||
align-items: center;
|
||||
}
|
||||
|
||||
.time-input {
|
||||
width: 65px;
|
||||
height: 36px;
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
border-radius: 6px;
|
||||
padding: 0 12px;
|
||||
font-size: 14px;
|
||||
text-align: center;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(224 71.4% 4.1%)')};
|
||||
color: ${cssManager.bdTheme('hsl(224 71.4% 4.1%)', 'hsl(210 20% 98%)')};
|
||||
transition: all 0.2s ease;
|
||||
}
|
||||
|
||||
.time-input:hover {
|
||||
border-color: ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
background: ${cssManager.bdTheme('hsl(210 20% 98%)', 'hsl(215 27.9% 16.9%)')};
|
||||
}
|
||||
|
||||
.time-input:focus {
|
||||
outline: none;
|
||||
border-color: ${cssManager.bdTheme('hsl(222.2 47.4% 11.2%)', 'hsl(210 20% 98%)')};
|
||||
box-shadow: 0 0 0 2px ${cssManager.bdTheme('hsl(222.2 47.4% 11.2% / 0.1)', 'hsl(210 20% 98% / 0.1)')};
|
||||
}
|
||||
|
||||
.time-separator {
|
||||
font-size: 14px;
|
||||
font-weight: 500;
|
||||
color: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
}
|
||||
|
||||
.am-pm-selector {
|
||||
display: flex;
|
||||
gap: 4px;
|
||||
margin-left: 8px;
|
||||
}
|
||||
|
||||
.am-pm-button {
|
||||
padding: 6px 12px;
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(224 71.4% 4.1%)')};
|
||||
border-radius: 6px;
|
||||
font-size: 12px;
|
||||
font-weight: 500;
|
||||
cursor: pointer;
|
||||
transition: all 0.2s ease;
|
||||
color: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
}
|
||||
|
||||
.am-pm-button.selected {
|
||||
background: ${cssManager.bdTheme('hsl(222.2 47.4% 11.2%)', 'hsl(210 20% 98%)')};
|
||||
color: ${cssManager.bdTheme('hsl(210 20% 98%)', 'hsl(222.2 47.4% 11.2%)')};
|
||||
border-color: ${cssManager.bdTheme('hsl(222.2 47.4% 11.2%)', 'hsl(210 20% 98%)')};
|
||||
}
|
||||
|
||||
.am-pm-button:hover:not(.selected) {
|
||||
background: ${cssManager.bdTheme('hsl(210 20% 98%)', 'hsl(215 27.9% 16.9%)')};
|
||||
border-color: ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
}
|
||||
|
||||
/* Action buttons */
|
||||
.calendar-actions {
|
||||
display: flex;
|
||||
gap: 8px;
|
||||
margin-top: 12px;
|
||||
padding-top: 12px;
|
||||
border-top: 1px solid ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
}
|
||||
|
||||
.action-button {
|
||||
flex: 1;
|
||||
height: 36px;
|
||||
border: none;
|
||||
border-radius: 6px;
|
||||
font-size: 14px;
|
||||
font-weight: 500;
|
||||
cursor: pointer;
|
||||
transition: all 0.2s ease;
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: center;
|
||||
}
|
||||
|
||||
.today-button {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(224 71.4% 4.1%)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
color: ${cssManager.bdTheme('hsl(224 71.4% 4.1%)', 'hsl(210 20% 98%)')};
|
||||
}
|
||||
|
||||
.today-button:hover {
|
||||
background: ${cssManager.bdTheme('hsl(210 20% 98%)', 'hsl(215 27.9% 16.9%)')};
|
||||
border-color: ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
}
|
||||
|
||||
.today-button:active {
|
||||
background: ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
}
|
||||
|
||||
.clear-button {
|
||||
background: transparent;
|
||||
border: 1px solid transparent;
|
||||
color: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
}
|
||||
|
||||
.clear-button:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 72.2% 50.6% / 0.1)', 'hsl(0 62.8% 30.6% / 0.1)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 72.2% 50.6%)', 'hsl(0 62.8% 30.6%)')};
|
||||
}
|
||||
|
||||
.clear-button:active {
|
||||
background: ${cssManager.bdTheme('hsl(0 72.2% 50.6% / 0.2)', 'hsl(0 62.8% 30.6% / 0.2)')};
|
||||
}
|
||||
|
||||
/* Timezone selector */
|
||||
.timezone-selector {
|
||||
margin-top: 12px;
|
||||
padding-top: 12px;
|
||||
border-top: 1px solid ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
}
|
||||
|
||||
.timezone-selector-title {
|
||||
font-size: 12px;
|
||||
font-weight: 500;
|
||||
margin-bottom: 8px;
|
||||
color: ${cssManager.bdTheme('hsl(220 8.9% 46.1%)', 'hsl(215 20.2% 65.1%)')};
|
||||
}
|
||||
|
||||
.timezone-select {
|
||||
width: 100%;
|
||||
height: 36px;
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
border-radius: 6px;
|
||||
padding: 0 12px;
|
||||
font-size: 14px;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(224 71.4% 4.1%)')};
|
||||
color: ${cssManager.bdTheme('hsl(224 71.4% 4.1%)', 'hsl(210 20% 98%)')};
|
||||
cursor: pointer;
|
||||
transition: all 0.2s ease;
|
||||
}
|
||||
|
||||
.timezone-select:hover {
|
||||
border-color: ${cssManager.bdTheme('hsl(214.3 31.8% 91.4%)', 'hsl(217.2 32.6% 17.5%)')};
|
||||
background: ${cssManager.bdTheme('hsl(210 20% 98%)', 'hsl(215 27.9% 16.9%)')};
|
||||
}
|
||||
|
||||
.timezone-select:focus {
|
||||
outline: none;
|
||||
border-color: ${cssManager.bdTheme('hsl(222.2 47.4% 11.2%)', 'hsl(210 20% 98%)')};
|
||||
box-shadow: 0 0 0 2px ${cssManager.bdTheme('hsl(222.2 47.4% 11.2% / 0.1)', 'hsl(210 20% 98% / 0.1)')};
|
||||
}
|
||||
`,
|
||||
];
|
||||
@@ -2,22 +2,9 @@ import { html, type TemplateResult } from '@design.estate/dees-element';
|
||||
import type { DeesInputDatepicker } from './component.js';
|
||||
|
||||
export const renderDatepicker = (component: DeesInputDatepicker): TemplateResult => {
|
||||
const monthNames = [
|
||||
'January', 'February', 'March', 'April', 'May', 'June',
|
||||
'July', 'August', 'September', 'October', 'November', 'December'
|
||||
];
|
||||
|
||||
const weekDays = component.weekStartsOn === 1
|
||||
? ['Mo', 'Tu', 'We', 'Th', 'Fr', 'Sa', 'Su']
|
||||
: ['Su', 'Mo', 'Tu', 'We', 'Th', 'Fr', 'Sa'];
|
||||
|
||||
const days = component.getDaysInMonth();
|
||||
const isAM = component.selectedHour < 12;
|
||||
const timezones = component.getTimezones();
|
||||
|
||||
return html`
|
||||
<div class="input-wrapper">
|
||||
<dees-label .label=${component.label} .description=${component.description} .required=${component.required}></dees-label>
|
||||
<dees-label .label=${component.label} .infoText=${component.infoText} .required=${component.required}></dees-label>
|
||||
<div class="input-container">
|
||||
<input
|
||||
type="text"
|
||||
@@ -39,140 +26,8 @@ export const renderDatepicker = (component: DeesInputDatepicker): TemplateResult
|
||||
` : ''}
|
||||
<dees-icon class="calendar-icon" icon="lucide:calendar" iconSize="16"></dees-icon>
|
||||
</div>
|
||||
|
||||
<!-- Calendar Popup -->
|
||||
<div class="calendar-popup ${component.isOpened ? 'show' : ''} ${component.opensToTop ? 'top' : 'bottom'}">
|
||||
<!-- Month/Year Navigation -->
|
||||
<div class="calendar-header">
|
||||
<button class="nav-button" @click=${component.previousMonth}>
|
||||
<dees-icon icon="lucide:chevronLeft" iconSize="16"></dees-icon>
|
||||
</button>
|
||||
<div class="month-year-display">
|
||||
${monthNames[component.viewDate.getMonth()]} ${component.viewDate.getFullYear()}
|
||||
</div>
|
||||
<button class="nav-button" @click=${component.nextMonth}>
|
||||
<dees-icon icon="lucide:chevronRight" iconSize="16"></dees-icon>
|
||||
</button>
|
||||
</div>
|
||||
|
||||
<!-- Weekday Headers -->
|
||||
<div class="weekdays">
|
||||
${weekDays.map(day => html`<div class="weekday">${day}</div>`)}
|
||||
</div>
|
||||
|
||||
<!-- Days Grid -->
|
||||
<div class="days-grid">
|
||||
${days.map(day => {
|
||||
const isToday = component.isToday(day);
|
||||
const isSelected = component.isSelected(day);
|
||||
const isOtherMonth = day.getMonth() !== component.viewDate.getMonth();
|
||||
const isDisabled = component.isDisabled(day);
|
||||
const dayEvents = component.getEventsForDate(day);
|
||||
const hasEvents = dayEvents.length > 0;
|
||||
const totalEventCount = dayEvents.reduce((sum, event) => sum + (event.count || 1), 0);
|
||||
|
||||
return html`
|
||||
<div
|
||||
class="day ${isOtherMonth ? 'other-month' : ''} ${isToday ? 'today' : ''} ${isSelected ? 'selected' : ''} ${isDisabled ? 'disabled' : ''} ${hasEvents ? 'has-event' : ''}"
|
||||
@click=${() => !isDisabled && component.selectDate(day)}
|
||||
>
|
||||
${day.getDate()}
|
||||
${hasEvents ? html`
|
||||
${totalEventCount > 3 ? html`
|
||||
<div class="event-count">${totalEventCount}</div>
|
||||
` : html`
|
||||
<div class="event-indicator">
|
||||
${dayEvents.slice(0, 3).map(event => html`
|
||||
<div class="event-dot ${event.type || 'info'}"></div>
|
||||
`)}
|
||||
</div>
|
||||
`}
|
||||
${dayEvents[0].title ? html`
|
||||
<div class="event-tooltip">
|
||||
${dayEvents[0].title}
|
||||
${totalEventCount > 1 ? html` (+${totalEventCount - 1} more)` : ''}
|
||||
</div>
|
||||
` : ''}
|
||||
` : ''}
|
||||
</div>
|
||||
`;
|
||||
})}
|
||||
</div>
|
||||
|
||||
<!-- Time Selector -->
|
||||
${component.enableTime ? html`
|
||||
<div class="time-selector">
|
||||
<div class="time-selector-title">Time</div>
|
||||
<div class="time-inputs">
|
||||
<input
|
||||
type="number"
|
||||
class="time-input"
|
||||
.value=${component.timeFormat === '12h'
|
||||
? (component.selectedHour === 0 ? 12 : component.selectedHour > 12 ? component.selectedHour - 12 : component.selectedHour).toString().padStart(2, '0')
|
||||
: component.selectedHour.toString().padStart(2, '0')}
|
||||
@input=${(e: InputEvent) => component.handleHourInput(e)}
|
||||
min="${component.timeFormat === '12h' ? 1 : 0}"
|
||||
max="${component.timeFormat === '12h' ? 12 : 23}"
|
||||
/>
|
||||
<span class="time-separator">:</span>
|
||||
<input
|
||||
type="number"
|
||||
class="time-input"
|
||||
.value=${component.selectedMinute.toString().padStart(2, '0')}
|
||||
@input=${(e: InputEvent) => component.handleMinuteInput(e)}
|
||||
min="0"
|
||||
max="59"
|
||||
step="${component.minuteIncrement || 1}"
|
||||
/>
|
||||
${component.timeFormat === '12h' ? html`
|
||||
<div class="am-pm-selector">
|
||||
<button
|
||||
class="am-pm-button ${isAM ? 'selected' : ''}"
|
||||
@click=${() => component.setAMPM('am')}
|
||||
>
|
||||
AM
|
||||
</button>
|
||||
<button
|
||||
class="am-pm-button ${!isAM ? 'selected' : ''}"
|
||||
@click=${() => component.setAMPM('pm')}
|
||||
>
|
||||
PM
|
||||
</button>
|
||||
</div>
|
||||
` : ''}
|
||||
</div>
|
||||
</div>
|
||||
` : ''}
|
||||
|
||||
<!-- Timezone Selector -->
|
||||
${component.enableTimezone ? html`
|
||||
<div class="timezone-selector">
|
||||
<div class="timezone-selector-title">Timezone</div>
|
||||
<select
|
||||
class="timezone-select"
|
||||
.value=${component.timezone}
|
||||
@change=${(e: Event) => component.handleTimezoneChange(e)}
|
||||
>
|
||||
${timezones.map(tz => html`
|
||||
<option value="${tz.value}" ?selected=${tz.value === component.timezone}>
|
||||
${tz.label}
|
||||
</option>
|
||||
`)}
|
||||
</select>
|
||||
</div>
|
||||
` : ''}
|
||||
|
||||
<!-- Action Buttons -->
|
||||
<div class="calendar-actions">
|
||||
<button class="action-button today-button" @click=${component.selectToday}>
|
||||
Today
|
||||
</button>
|
||||
<button class="action-button clear-button" @click=${component.clear}>
|
||||
Clear
|
||||
</button>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
${component.renderDescription()}
|
||||
</div>
|
||||
`;
|
||||
|
||||
|
||||
@@ -0,0 +1,374 @@
|
||||
import {
|
||||
customElement,
|
||||
type TemplateResult,
|
||||
property,
|
||||
state,
|
||||
html,
|
||||
css,
|
||||
cssManager,
|
||||
DeesElement,
|
||||
} from '@design.estate/dees-element';
|
||||
import * as domtools from '@design.estate/dees-domtools';
|
||||
import { zIndexRegistry } from '../../00zindex.js';
|
||||
import { cssGeistFontFamily } from '../../00fonts.js';
|
||||
import { themeDefaultStyles } from '../../00theme.js';
|
||||
import { DeesWindowLayer } from '../../00group-overlay/dees-windowlayer/dees-windowlayer.js';
|
||||
|
||||
declare global {
|
||||
interface HTMLElementTagNameMap {
|
||||
'dees-input-dropdown-popup': DeesInputDropdownPopup;
|
||||
}
|
||||
}
|
||||
|
||||
@customElement('dees-input-dropdown-popup')
|
||||
export class DeesInputDropdownPopup extends DeesElement {
|
||||
@property({ type: Array })
|
||||
accessor options: { option: string; key: string; payload?: any }[] = [];
|
||||
|
||||
@property({ type: Boolean })
|
||||
accessor enableSearch: boolean = true;
|
||||
|
||||
@property({ type: Boolean })
|
||||
accessor opensToTop: boolean = false;
|
||||
|
||||
@property({ attribute: false })
|
||||
accessor triggerRect: DOMRect | null = null;
|
||||
|
||||
@property({ attribute: false })
|
||||
accessor ownerComponent: HTMLElement | null = null;
|
||||
|
||||
@state()
|
||||
accessor filteredOptions: { option: string; key: string; payload?: any }[] = [];
|
||||
|
||||
@state()
|
||||
accessor highlightedIndex: number = 0;
|
||||
|
||||
@state()
|
||||
accessor searchValue: string = '';
|
||||
|
||||
@state()
|
||||
accessor menuZIndex: number = 1000;
|
||||
|
||||
@state()
|
||||
accessor visible: boolean = false;
|
||||
|
||||
private windowLayer: DeesWindowLayer | null = null;
|
||||
private isDestroying: boolean = false;
|
||||
|
||||
public static styles = [
|
||||
themeDefaultStyles,
|
||||
cssManager.defaultStyles,
|
||||
css`
|
||||
:host {
|
||||
position: fixed;
|
||||
top: 0;
|
||||
left: 0;
|
||||
width: 0;
|
||||
height: 0;
|
||||
pointer-events: none;
|
||||
font-family: ${cssGeistFontFamily};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 90%)')};
|
||||
}
|
||||
|
||||
* {
|
||||
box-sizing: border-box;
|
||||
}
|
||||
|
||||
.selectionBox {
|
||||
position: fixed;
|
||||
pointer-events: auto;
|
||||
will-change: transform, opacity;
|
||||
transition: all 0.15s ease;
|
||||
opacity: 0;
|
||||
transform: translateY(-8px) scale(0.98);
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 3.9%)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
box-shadow: 0 4px 6px -1px hsl(0 0% 0% / 0.1), 0 2px 4px -2px hsl(0 0% 0% / 0.1);
|
||||
min-height: 40px;
|
||||
max-height: 300px;
|
||||
overflow: hidden;
|
||||
border-radius: 6px;
|
||||
user-select: none;
|
||||
}
|
||||
|
||||
.selectionBox.top {
|
||||
transform: translateY(8px) scale(0.98);
|
||||
}
|
||||
|
||||
.selectionBox.show {
|
||||
pointer-events: auto;
|
||||
transform: translateY(0) scale(1);
|
||||
opacity: 1;
|
||||
}
|
||||
|
||||
.options-container {
|
||||
max-height: 250px;
|
||||
overflow-y: auto;
|
||||
padding: 4px;
|
||||
}
|
||||
|
||||
.option {
|
||||
transition: all 0.15s ease;
|
||||
line-height: 32px;
|
||||
padding: 0 8px;
|
||||
border-radius: 4px;
|
||||
margin: 2px 0;
|
||||
cursor: pointer;
|
||||
font-size: 14px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 90%)')};
|
||||
}
|
||||
|
||||
.option.highlighted {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95.1%)', 'hsl(0 0% 14.9%)')};
|
||||
}
|
||||
|
||||
.option:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95.1%)', 'hsl(0 0% 14.9%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 9%)', 'hsl(0 0% 95%)')};
|
||||
}
|
||||
|
||||
.no-options {
|
||||
padding: 8px;
|
||||
text-align: center;
|
||||
font-size: 14px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
||||
font-style: italic;
|
||||
}
|
||||
|
||||
.search {
|
||||
padding: 4px;
|
||||
border-bottom: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
margin-bottom: 4px;
|
||||
}
|
||||
|
||||
.search input {
|
||||
display: block;
|
||||
width: 100%;
|
||||
height: 32px;
|
||||
padding: 0 8px;
|
||||
background: transparent;
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border-radius: 4px;
|
||||
color: inherit;
|
||||
font-size: 14px;
|
||||
font-family: inherit;
|
||||
outline: none;
|
||||
transition: border-color 0.15s ease;
|
||||
}
|
||||
|
||||
.search input::placeholder {
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 63.9%)', 'hsl(0 0% 45.1%)')};
|
||||
}
|
||||
|
||||
.search input:focus {
|
||||
border-color: ${cssManager.bdTheme('hsl(222.2 47.4% 51.2%)', 'hsl(217.2 91.2% 59.8%)')};
|
||||
}
|
||||
|
||||
.options-container::-webkit-scrollbar {
|
||||
width: 8px;
|
||||
}
|
||||
|
||||
.options-container::-webkit-scrollbar-track {
|
||||
background: transparent;
|
||||
}
|
||||
|
||||
.options-container::-webkit-scrollbar-thumb {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border-radius: 4px;
|
||||
}
|
||||
|
||||
.options-container::-webkit-scrollbar-thumb:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 79.8%)', 'hsl(0 0% 20.9%)')};
|
||||
}
|
||||
`,
|
||||
];
|
||||
|
||||
public render(): TemplateResult {
|
||||
if (!this.triggerRect) return html``;
|
||||
|
||||
const posStyle = this.computePositionStyle();
|
||||
|
||||
return html`
|
||||
<div
|
||||
class="selectionBox ${this.visible ? 'show' : ''} ${this.opensToTop ? 'top' : 'bottom'}"
|
||||
style="${posStyle}; z-index: ${this.menuZIndex};"
|
||||
>
|
||||
${this.enableSearch
|
||||
? html`
|
||||
<div class="search">
|
||||
<input
|
||||
type="text"
|
||||
placeholder="Search options..."
|
||||
.value="${this.searchValue}"
|
||||
@input="${this.handleSearch}"
|
||||
@click="${(e: Event) => e.stopPropagation()}"
|
||||
@keydown="${this.handleSearchKeydown}"
|
||||
/>
|
||||
</div>
|
||||
`
|
||||
: null}
|
||||
<div class="options-container">
|
||||
${this.filteredOptions.length === 0
|
||||
? html`<div class="no-options">No options found</div>`
|
||||
: this.filteredOptions.map((option, index) => {
|
||||
const isHighlighted = this.highlightedIndex === index;
|
||||
return html`
|
||||
<div
|
||||
class="option ${isHighlighted ? 'highlighted' : ''}"
|
||||
@click="${() => this.selectOption(option)}"
|
||||
@mouseenter="${() => (this.highlightedIndex = index)}"
|
||||
>
|
||||
${option.option}
|
||||
</div>
|
||||
`;
|
||||
})}
|
||||
</div>
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
|
||||
private computePositionStyle(): string {
|
||||
const rect = this.triggerRect!;
|
||||
const left = rect.left;
|
||||
const width = rect.width;
|
||||
|
||||
if (this.opensToTop) {
|
||||
const bottom = window.innerHeight - rect.top + 4;
|
||||
return `left: ${left}px; width: ${width}px; bottom: ${bottom}px; top: auto`;
|
||||
} else {
|
||||
const top = rect.bottom + 4;
|
||||
return `left: ${left}px; width: ${width}px; top: ${top}px`;
|
||||
}
|
||||
}
|
||||
|
||||
public async show(): Promise<void> {
|
||||
this.filteredOptions = this.options;
|
||||
this.highlightedIndex = 0;
|
||||
this.searchValue = '';
|
||||
|
||||
// Create window layer (transparent, no blur)
|
||||
this.windowLayer = await DeesWindowLayer.createAndShow();
|
||||
this.windowLayer.addEventListener('click', () => {
|
||||
this.dispatchEvent(new CustomEvent('close-request'));
|
||||
});
|
||||
|
||||
// Set z-index above the window layer
|
||||
this.menuZIndex = zIndexRegistry.getNextZIndex();
|
||||
zIndexRegistry.register(this, this.menuZIndex);
|
||||
this.style.zIndex = this.menuZIndex.toString();
|
||||
|
||||
document.body.appendChild(this);
|
||||
|
||||
// Animate in on next frame
|
||||
await domtools.plugins.smartdelay.delayFor(0);
|
||||
this.visible = true;
|
||||
|
||||
// Add scroll/resize listeners for repositioning
|
||||
window.addEventListener('scroll', this.handleScrollOrResize, { capture: true, passive: true });
|
||||
window.addEventListener('resize', this.handleScrollOrResize, { passive: true });
|
||||
}
|
||||
|
||||
public async hide(): Promise<void> {
|
||||
// Guard against double-destruction
|
||||
if (this.isDestroying) {
|
||||
return;
|
||||
}
|
||||
this.isDestroying = true;
|
||||
|
||||
// Remove scroll/resize listeners
|
||||
window.removeEventListener('scroll', this.handleScrollOrResize, { capture: true } as EventListenerOptions);
|
||||
window.removeEventListener('resize', this.handleScrollOrResize);
|
||||
|
||||
zIndexRegistry.unregister(this);
|
||||
|
||||
this.searchValue = '';
|
||||
this.filteredOptions = this.options;
|
||||
this.highlightedIndex = 0;
|
||||
|
||||
// Don't await - let window layer cleanup happen in background for instant visual feedback
|
||||
if (this.windowLayer) {
|
||||
this.windowLayer.destroy();
|
||||
this.windowLayer = null;
|
||||
}
|
||||
|
||||
// Animate out via CSS transition
|
||||
this.visible = false;
|
||||
await domtools.plugins.smartdelay.delayFor(150);
|
||||
|
||||
if (this.parentElement) {
|
||||
this.parentElement.removeChild(this);
|
||||
}
|
||||
|
||||
this.isDestroying = false;
|
||||
}
|
||||
|
||||
public async focusSearchInput(): Promise<void> {
|
||||
await this.updateComplete;
|
||||
const input = this.shadowRoot!.querySelector('.search input') as HTMLInputElement;
|
||||
if (input) input.focus();
|
||||
}
|
||||
|
||||
public updateOptions(options: { option: string; key: string; payload?: any }[]): void {
|
||||
this.options = options;
|
||||
// Re-filter with current search value
|
||||
if (this.searchValue) {
|
||||
const searchLower = this.searchValue.toLowerCase();
|
||||
this.filteredOptions = this.options.filter((opt) =>
|
||||
opt.option.toLowerCase().includes(searchLower)
|
||||
);
|
||||
} else {
|
||||
this.filteredOptions = this.options;
|
||||
}
|
||||
this.highlightedIndex = 0;
|
||||
}
|
||||
|
||||
private selectOption(option: { option: string; key: string; payload?: any }): void {
|
||||
this.dispatchEvent(
|
||||
new CustomEvent('option-selected', {
|
||||
detail: option,
|
||||
})
|
||||
);
|
||||
}
|
||||
|
||||
private handleSearch = (event: Event): void => {
|
||||
const searchTerm = (event.target as HTMLInputElement).value;
|
||||
this.searchValue = searchTerm;
|
||||
const searchLower = searchTerm.toLowerCase();
|
||||
this.filteredOptions = this.options.filter((option) =>
|
||||
option.option.toLowerCase().includes(searchLower)
|
||||
);
|
||||
this.highlightedIndex = 0;
|
||||
};
|
||||
|
||||
private handleSearchKeydown = (event: KeyboardEvent): void => {
|
||||
const key = event.key;
|
||||
const maxIndex = this.filteredOptions.length - 1;
|
||||
|
||||
if (key === 'ArrowDown') {
|
||||
event.preventDefault();
|
||||
this.highlightedIndex = this.highlightedIndex + 1 > maxIndex ? 0 : this.highlightedIndex + 1;
|
||||
} else if (key === 'ArrowUp') {
|
||||
event.preventDefault();
|
||||
this.highlightedIndex = this.highlightedIndex - 1 < 0 ? maxIndex : this.highlightedIndex - 1;
|
||||
} else if (key === 'Enter') {
|
||||
event.preventDefault();
|
||||
if (this.filteredOptions[this.highlightedIndex]) {
|
||||
this.selectOption(this.filteredOptions[this.highlightedIndex]);
|
||||
}
|
||||
} else if (key === 'Escape') {
|
||||
event.preventDefault();
|
||||
this.dispatchEvent(new CustomEvent('close-request'));
|
||||
}
|
||||
};
|
||||
|
||||
private handleScrollOrResize = (): void => {
|
||||
this.dispatchEvent(new CustomEvent('reposition-request'));
|
||||
};
|
||||
|
||||
async disconnectedCallback() {
|
||||
await super.disconnectedCallback();
|
||||
window.removeEventListener('scroll', this.handleScrollOrResize, { capture: true } as EventListenerOptions);
|
||||
window.removeEventListener('resize', this.handleScrollOrResize);
|
||||
zIndexRegistry.unregister(this);
|
||||
}
|
||||
}
|
||||
@@ -31,12 +31,6 @@ export const demoFunc = () => html`
|
||||
flex-wrap: wrap;
|
||||
}
|
||||
|
||||
.input-group {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 16px;
|
||||
}
|
||||
|
||||
.spacer {
|
||||
height: 200px;
|
||||
display: flex;
|
||||
@@ -69,9 +63,10 @@ export const demoFunc = () => html`
|
||||
}
|
||||
}}>
|
||||
<dees-panel .title=${'1. Basic Dropdowns'} .subtitle=${'Standard dropdown with search functionality and various options'}>
|
||||
<div class="input-group">
|
||||
<dees-form>
|
||||
<dees-input-dropdown
|
||||
.label=${'Select Country'}
|
||||
.description=${'Choose the country where your business is registered'}
|
||||
.options=${[
|
||||
{ option: 'United States', key: 'us' },
|
||||
{ option: 'Canada', key: 'ca' },
|
||||
@@ -94,7 +89,7 @@ export const demoFunc = () => html`
|
||||
{ option: 'Guest', key: 'guest' }
|
||||
]}
|
||||
></dees-input-dropdown>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
</dees-demowrapper>
|
||||
|
||||
@@ -135,6 +130,7 @@ export const demoFunc = () => html`
|
||||
});
|
||||
}}>
|
||||
<dees-panel .title=${'3. Horizontal Layout'} .subtitle=${'Multiple dropdowns in a horizontal layout for compact forms'}>
|
||||
<dees-form>
|
||||
<div class="horizontal-group">
|
||||
<dees-input-dropdown
|
||||
.label=${'Department'}
|
||||
@@ -169,6 +165,7 @@ export const demoFunc = () => html`
|
||||
]}
|
||||
></dees-input-dropdown>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
</dees-demowrapper>
|
||||
|
||||
@@ -184,7 +181,7 @@ export const demoFunc = () => html`
|
||||
}
|
||||
}}>
|
||||
<dees-panel .title=${'4. States'} .subtitle=${'Different states and configurations'}>
|
||||
<div class="input-group">
|
||||
<dees-form>
|
||||
<dees-input-dropdown
|
||||
.label=${'Required Field'}
|
||||
.required=${true}
|
||||
@@ -203,7 +200,7 @@ export const demoFunc = () => html`
|
||||
]}
|
||||
.selectedOption=${{ option: 'Cannot Select', key: 'disabled' }}
|
||||
></dees-input-dropdown>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
</dees-demowrapper>
|
||||
|
||||
|
||||
@@ -7,11 +7,11 @@ import {
|
||||
css,
|
||||
cssManager,
|
||||
} from '@design.estate/dees-element';
|
||||
import * as domtools from '@design.estate/dees-domtools';
|
||||
import { demoFunc } from './dees-input-dropdown.demo.js';
|
||||
import { DeesInputBase } from '../dees-input-base/dees-input-base.js';
|
||||
import { cssGeistFontFamily } from '../../00fonts.js';
|
||||
import { themeDefaultStyles } from '../../00theme.js';
|
||||
import { DeesInputDropdownPopup } from './dees-input-dropdown-popup.js';
|
||||
|
||||
declare global {
|
||||
interface HTMLElementTagNameMap {
|
||||
@@ -46,27 +46,22 @@ export class DeesInputDropdown extends DeesInputBase<DeesInputDropdown> {
|
||||
})
|
||||
accessor enableSearch: boolean = true;
|
||||
|
||||
@state()
|
||||
accessor opensToTop: boolean = false;
|
||||
|
||||
@state()
|
||||
accessor filteredOptions: { option: string; key: string; payload?: any }[] = [];
|
||||
|
||||
@state()
|
||||
accessor highlightedIndex: number = 0;
|
||||
@property({
|
||||
type: Boolean,
|
||||
reflect: true,
|
||||
})
|
||||
accessor vintegrated: boolean = false;
|
||||
|
||||
@state()
|
||||
accessor isOpened = false;
|
||||
|
||||
@state()
|
||||
accessor searchValue: string = '';
|
||||
private popupInstance: DeesInputDropdownPopup | null = null;
|
||||
|
||||
public static styles = [
|
||||
themeDefaultStyles,
|
||||
...DeesInputBase.baseStyles,
|
||||
cssManager.defaultStyles,
|
||||
css`
|
||||
/* TODO: Migrate hardcoded values to --dees-* CSS variables */
|
||||
* {
|
||||
box-sizing: border-box;
|
||||
}
|
||||
@@ -138,135 +133,34 @@ export class DeesInputDropdown extends DeesInputBase<DeesInputDropdown> {
|
||||
transform: translateY(-50%) rotate(180deg);
|
||||
}
|
||||
|
||||
.selectionBox {
|
||||
will-change: transform, opacity;
|
||||
pointer-events: none;
|
||||
transition: all 0.15s ease;
|
||||
opacity: 0;
|
||||
transform: translateY(-8px) scale(0.98);
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 3.9%)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
box-shadow: 0 4px 6px -1px hsl(0 0% 0% / 0.1), 0 2px 4px -2px hsl(0 0% 0% / 0.1);
|
||||
min-height: 40px;
|
||||
max-height: 300px;
|
||||
overflow: hidden;
|
||||
border-radius: 6px;
|
||||
position: absolute;
|
||||
user-select: none;
|
||||
margin-top: 4px;
|
||||
z-index: 50;
|
||||
left: 0;
|
||||
right: 0;
|
||||
/* Visually integrated mode: shed chrome to blend into a host component
|
||||
(e.g. a dees-table cell in edit mode). */
|
||||
:host([vintegrated]) dees-label {
|
||||
display: none;
|
||||
}
|
||||
|
||||
.selectionBox.top {
|
||||
bottom: calc(100% + 4px);
|
||||
top: auto;
|
||||
margin-top: 0;
|
||||
margin-bottom: 4px;
|
||||
transform: translateY(8px) scale(0.98);
|
||||
:host([vintegrated]) .maincontainer {
|
||||
height: 40px;
|
||||
}
|
||||
|
||||
.selectionBox.bottom {
|
||||
top: 100%;
|
||||
}
|
||||
|
||||
.selectionBox.show {
|
||||
pointer-events: all;
|
||||
transform: translateY(0) scale(1);
|
||||
opacity: 1;
|
||||
}
|
||||
|
||||
/* Options container */
|
||||
.options-container {
|
||||
max-height: 250px;
|
||||
overflow-y: auto;
|
||||
padding: 4px;
|
||||
}
|
||||
|
||||
/* Options */
|
||||
.option {
|
||||
transition: all 0.15s ease;
|
||||
line-height: 32px;
|
||||
padding: 0 8px;
|
||||
border-radius: 4px;
|
||||
margin: 2px 0;
|
||||
cursor: pointer;
|
||||
font-size: 14px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 90%)')};
|
||||
}
|
||||
|
||||
.option.highlighted {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95.1%)', 'hsl(0 0% 14.9%)')};
|
||||
}
|
||||
|
||||
.option:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95.1%)', 'hsl(0 0% 14.9%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 9%)', 'hsl(0 0% 95%)')};
|
||||
}
|
||||
|
||||
/* No options message */
|
||||
.no-options {
|
||||
padding: 8px;
|
||||
text-align: center;
|
||||
font-size: 14px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
||||
font-style: italic;
|
||||
}
|
||||
|
||||
/* Search */
|
||||
.search {
|
||||
padding: 4px;
|
||||
border-bottom: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
margin-bottom: 4px;
|
||||
}
|
||||
|
||||
.search.bottom {
|
||||
border-bottom: none;
|
||||
border-top: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
margin-bottom: 0;
|
||||
margin-top: 4px;
|
||||
}
|
||||
|
||||
.search input {
|
||||
display: block;
|
||||
width: 100%;
|
||||
height: 32px;
|
||||
padding: 0 8px;
|
||||
:host([vintegrated]) .selectedBox {
|
||||
height: 40px;
|
||||
line-height: 40px;
|
||||
padding: 0 32px 0 16px;
|
||||
font-size: 13px;
|
||||
border: none;
|
||||
border-radius: 0;
|
||||
background: transparent;
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border-radius: 4px;
|
||||
color: inherit;
|
||||
font-size: 14px;
|
||||
font-family: inherit;
|
||||
outline: none;
|
||||
transition: border-color 0.15s ease;
|
||||
box-shadow: none;
|
||||
transition: none;
|
||||
}
|
||||
|
||||
.search input::placeholder {
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 63.9%)', 'hsl(0 0% 45.1%)')};
|
||||
}
|
||||
|
||||
.search input:focus {
|
||||
border-color: ${cssManager.bdTheme('hsl(222.2 47.4% 51.2%)', 'hsl(217.2 91.2% 59.8%)')};
|
||||
}
|
||||
|
||||
/* Scrollbar styling */
|
||||
.options-container::-webkit-scrollbar {
|
||||
width: 8px;
|
||||
}
|
||||
|
||||
.options-container::-webkit-scrollbar-track {
|
||||
:host([vintegrated]) .selectedBox:hover:not(.disabled),
|
||||
:host([vintegrated]) .selectedBox:focus-visible {
|
||||
border: none;
|
||||
box-shadow: none;
|
||||
background: transparent;
|
||||
}
|
||||
|
||||
.options-container::-webkit-scrollbar-thumb {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border-radius: 4px;
|
||||
}
|
||||
|
||||
.options-container::-webkit-scrollbar-thumb:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 79.8%)', 'hsl(0 0% 20.9%)')};
|
||||
:host([vintegrated]) .selectedBox::after {
|
||||
right: 12px;
|
||||
opacity: 0.6;
|
||||
}
|
||||
`,
|
||||
];
|
||||
@@ -274,7 +168,7 @@ export class DeesInputDropdown extends DeesInputBase<DeesInputDropdown> {
|
||||
public render(): TemplateResult {
|
||||
return html`
|
||||
<div class="input-wrapper">
|
||||
<dees-label .label=${this.label} .description=${this.description} .required=${this.required}></dees-label>
|
||||
<dees-label .label=${this.label} .infoText=${this.infoText} .required=${this.required}></dees-label>
|
||||
<div class="maincontainer">
|
||||
<div
|
||||
class="selectedBox ${this.isOpened ? 'open' : ''} ${this.disabled ? 'disabled' : ''}"
|
||||
@@ -284,68 +178,27 @@ export class DeesInputDropdown extends DeesInputBase<DeesInputDropdown> {
|
||||
>
|
||||
${this.selectedOption?.option || 'Select an option'}
|
||||
</div>
|
||||
<div class="selectionBox ${this.isOpened ? 'show' : ''} ${this.opensToTop ? 'top' : 'bottom'}">
|
||||
${this.enableSearch
|
||||
? html`
|
||||
<div class="search">
|
||||
<input
|
||||
type="text"
|
||||
placeholder="Search options..."
|
||||
.value="${this.searchValue}"
|
||||
@input="${this.handleSearch}"
|
||||
@click="${(e: Event) => e.stopPropagation()}"
|
||||
@keydown="${this.handleSearchKeydown}"
|
||||
/>
|
||||
</div>
|
||||
`
|
||||
: null}
|
||||
<div class="options-container">
|
||||
${this.filteredOptions.length === 0
|
||||
? html`<div class="no-options">No options found</div>`
|
||||
: this.filteredOptions.map((option, index) => {
|
||||
const isHighlighted = this.highlightedIndex === index;
|
||||
return html`
|
||||
<div
|
||||
class="option ${isHighlighted ? 'highlighted' : ''}"
|
||||
@click="${() => this.updateSelection(option)}"
|
||||
@mouseenter="${() => this.highlightedIndex = index}"
|
||||
>
|
||||
${option.option}
|
||||
${this.renderDescription()}
|
||||
</div>
|
||||
`;
|
||||
})
|
||||
}
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
|
||||
async connectedCallback() {
|
||||
super.connectedCallback();
|
||||
this.handleClickOutside = this.handleClickOutside.bind(this);
|
||||
}
|
||||
|
||||
firstUpdated() {
|
||||
this.selectedOption = this.selectedOption || null;
|
||||
this.filteredOptions = this.options;
|
||||
}
|
||||
|
||||
updated(changedProperties: Map<string, any>) {
|
||||
super.updated(changedProperties);
|
||||
|
||||
if (changedProperties.has('options')) {
|
||||
this.filteredOptions = this.options;
|
||||
if (changedProperties.has('options') && this.popupInstance && this.isOpened) {
|
||||
this.popupInstance.updateOptions(this.options);
|
||||
}
|
||||
}
|
||||
|
||||
public async updateSelection(selectedOption: { option: string; key: string; payload?: any }) {
|
||||
this.selectedOption = selectedOption;
|
||||
this.isOpened = false;
|
||||
this.searchValue = '';
|
||||
this.filteredOptions = this.options;
|
||||
this.highlightedIndex = 0;
|
||||
this.closePopup();
|
||||
|
||||
this.dispatchEvent(
|
||||
new CustomEvent('selectedOption', {
|
||||
@@ -357,85 +210,88 @@ export class DeesInputDropdown extends DeesInputBase<DeesInputDropdown> {
|
||||
this.changeSubject.next(this);
|
||||
}
|
||||
|
||||
private handleClickOutside = (event: MouseEvent) => {
|
||||
const path = event.composedPath();
|
||||
if (!path.includes(this)) {
|
||||
this.isOpened = false;
|
||||
this.searchValue = '';
|
||||
this.filteredOptions = this.options;
|
||||
document.removeEventListener('click', this.handleClickOutside);
|
||||
}
|
||||
};
|
||||
|
||||
public async toggleSelectionBox() {
|
||||
this.isOpened = !this.isOpened;
|
||||
|
||||
if (this.isOpened) {
|
||||
// Check available space and set position
|
||||
this.closePopup();
|
||||
return;
|
||||
}
|
||||
|
||||
this.isOpened = true;
|
||||
|
||||
// Get trigger position
|
||||
const selectedBox = this.shadowRoot!.querySelector('.selectedBox') as HTMLElement;
|
||||
const rect = selectedBox.getBoundingClientRect();
|
||||
const spaceBelow = window.innerHeight - rect.bottom;
|
||||
const spaceAbove = rect.top;
|
||||
const opensToTop = spaceBelow < 300 && spaceAbove > spaceBelow;
|
||||
|
||||
// Determine if we should open upwards
|
||||
this.opensToTop = spaceBelow < 300 && spaceAbove > spaceBelow;
|
||||
|
||||
// Focus search input if present
|
||||
await this.updateComplete;
|
||||
const searchInput = this.shadowRoot!.querySelector('.search input') as HTMLInputElement;
|
||||
if (searchInput) {
|
||||
searchInput.focus();
|
||||
// Create popup if needed
|
||||
if (!this.popupInstance) {
|
||||
this.popupInstance = new DeesInputDropdownPopup();
|
||||
}
|
||||
|
||||
// Add click outside listener
|
||||
setTimeout(() => {
|
||||
document.addEventListener('click', this.handleClickOutside);
|
||||
}, 0);
|
||||
} else {
|
||||
// Cleanup
|
||||
this.searchValue = '';
|
||||
this.filteredOptions = this.options;
|
||||
document.removeEventListener('click', this.handleClickOutside);
|
||||
// Configure popup
|
||||
this.popupInstance.options = this.options;
|
||||
this.popupInstance.enableSearch = this.enableSearch;
|
||||
this.popupInstance.opensToTop = opensToTop;
|
||||
this.popupInstance.triggerRect = rect;
|
||||
this.popupInstance.ownerComponent = this;
|
||||
|
||||
// Listen for popup events
|
||||
this.popupInstance.addEventListener('option-selected', this.handleOptionSelected);
|
||||
this.popupInstance.addEventListener('close-request', this.handleCloseRequest);
|
||||
this.popupInstance.addEventListener('reposition-request', this.handleRepositionRequest);
|
||||
|
||||
// Show popup (creates window layer, appends to document.body)
|
||||
await this.popupInstance.show();
|
||||
|
||||
// Focus search input
|
||||
if (this.enableSearch) {
|
||||
await this.popupInstance.focusSearchInput();
|
||||
}
|
||||
}
|
||||
|
||||
private handleSearch(event: Event): void {
|
||||
const searchTerm = (event.target as HTMLInputElement).value;
|
||||
this.searchValue = searchTerm;
|
||||
const searchLower = searchTerm.toLowerCase();
|
||||
this.filteredOptions = this.options.filter((option) =>
|
||||
option.option.toLowerCase().includes(searchLower)
|
||||
);
|
||||
this.highlightedIndex = 0;
|
||||
}
|
||||
|
||||
private handleKeyDown(event: KeyboardEvent): void {
|
||||
const key = event.key;
|
||||
const maxIndex = this.filteredOptions.length - 1;
|
||||
|
||||
if (key === 'ArrowDown') {
|
||||
event.preventDefault();
|
||||
this.highlightedIndex = this.highlightedIndex + 1 > maxIndex ? 0 : this.highlightedIndex + 1;
|
||||
} else if (key === 'ArrowUp') {
|
||||
event.preventDefault();
|
||||
this.highlightedIndex = this.highlightedIndex - 1 < 0 ? maxIndex : this.highlightedIndex - 1;
|
||||
} else if (key === 'Enter') {
|
||||
event.preventDefault();
|
||||
if (this.filteredOptions[this.highlightedIndex]) {
|
||||
this.updateSelection(this.filteredOptions[this.highlightedIndex]);
|
||||
}
|
||||
} else if (key === 'Escape') {
|
||||
event.preventDefault();
|
||||
private closePopup(): void {
|
||||
this.isOpened = false;
|
||||
|
||||
if (this.popupInstance) {
|
||||
this.popupInstance.removeEventListener('option-selected', this.handleOptionSelected);
|
||||
this.popupInstance.removeEventListener('close-request', this.handleCloseRequest);
|
||||
this.popupInstance.removeEventListener('reposition-request', this.handleRepositionRequest);
|
||||
this.popupInstance.hide();
|
||||
}
|
||||
}
|
||||
|
||||
private handleSearchKeydown(event: KeyboardEvent): void {
|
||||
if (event.key === 'ArrowDown' || event.key === 'ArrowUp' || event.key === 'Enter') {
|
||||
this.handleKeyDown(event);
|
||||
}
|
||||
private handleOptionSelected = (event: Event): void => {
|
||||
const detail = (event as CustomEvent).detail;
|
||||
this.updateSelection(detail);
|
||||
};
|
||||
|
||||
private handleCloseRequest = (): void => {
|
||||
this.closePopup();
|
||||
};
|
||||
|
||||
private handleRepositionRequest = (): void => {
|
||||
if (!this.popupInstance || !this.isOpened) return;
|
||||
|
||||
const selectedBox = this.shadowRoot!.querySelector('.selectedBox') as HTMLElement;
|
||||
if (!selectedBox) return;
|
||||
|
||||
const rect = selectedBox.getBoundingClientRect();
|
||||
|
||||
// Close if trigger scrolled off-screen
|
||||
if (rect.bottom < 0 || rect.top > window.innerHeight) {
|
||||
this.closePopup();
|
||||
return;
|
||||
}
|
||||
|
||||
// Update position
|
||||
const spaceBelow = window.innerHeight - rect.bottom;
|
||||
const spaceAbove = rect.top;
|
||||
this.popupInstance.opensToTop = spaceBelow < 300 && spaceAbove > spaceBelow;
|
||||
this.popupInstance.triggerRect = rect;
|
||||
};
|
||||
|
||||
private handleSelectedBoxKeydown(event: KeyboardEvent) {
|
||||
if (this.disabled) return;
|
||||
|
||||
@@ -450,7 +306,7 @@ export class DeesInputDropdown extends DeesInputBase<DeesInputDropdown> {
|
||||
} else if (event.key === 'Escape') {
|
||||
event.preventDefault();
|
||||
if (this.isOpened) {
|
||||
this.isOpened = false;
|
||||
this.closePopup();
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -465,6 +321,12 @@ export class DeesInputDropdown extends DeesInputBase<DeesInputDropdown> {
|
||||
|
||||
async disconnectedCallback() {
|
||||
await super.disconnectedCallback();
|
||||
document.removeEventListener('click', this.handleClickOutside);
|
||||
if (this.popupInstance) {
|
||||
this.popupInstance.removeEventListener('option-selected', this.handleOptionSelected);
|
||||
this.popupInstance.removeEventListener('close-request', this.handleCloseRequest);
|
||||
this.popupInstance.removeEventListener('reposition-request', this.handleRepositionRequest);
|
||||
this.popupInstance.hide();
|
||||
this.popupInstance = null;
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1 +1,2 @@
|
||||
export * from './dees-input-dropdown.js';
|
||||
export * from './dees-input-dropdown-popup.js';
|
||||
|
||||
@@ -3,6 +3,7 @@ import { demoFunc } from './demo.js';
|
||||
import { fileuploadStyles } from './styles.js';
|
||||
import '../../00group-utility/dees-icon/dees-icon.js';
|
||||
import '../../00group-layout/dees-label/dees-label.js';
|
||||
import '../../00group-layout/dees-tile/dees-tile.js';
|
||||
|
||||
import {
|
||||
customElement,
|
||||
@@ -72,17 +73,16 @@ export class DeesInputFileupload extends DeesInputBase<DeesInputFileupload> {
|
||||
<div class="input-wrapper">
|
||||
<dees-label
|
||||
.label=${this.label}
|
||||
.description=${this.description}
|
||||
.infoText=${this.infoText}
|
||||
.required=${this.required}
|
||||
></dees-label>
|
||||
<div
|
||||
class="dropzone ${this.state === 'dragOver' ? 'dropzone--active' : ''} ${this.disabled ? 'dropzone--disabled' : ''} ${this.value.length > 0 ? 'dropzone--has-files' : ''}"
|
||||
role="button"
|
||||
<dees-tile
|
||||
class="${this.state === 'dragOver' ? 'dragover' : ''}"
|
||||
@click=${this.handleDropzoneClick}
|
||||
@keydown=${this.handleDropzoneKeydown}
|
||||
tabindex=${this.disabled ? -1 : 0}
|
||||
aria-disabled=${this.disabled}
|
||||
aria-label=${`Select files${acceptedSummary ? ` (${acceptedSummary})` : ''}`}
|
||||
@click=${this.handleDropzoneClick}
|
||||
@keydown=${this.handleDropzoneKeydown}
|
||||
>
|
||||
<input
|
||||
class="file-input"
|
||||
@@ -94,56 +94,49 @@ export class DeesInputFileupload extends DeesInputBase<DeesInputFileupload> {
|
||||
@change=${this.handleFileInputChange}
|
||||
tabindex="-1"
|
||||
/>
|
||||
<div class="dropzone__body">
|
||||
<div class="dropzone__icon">
|
||||
<div slot="header" class="dropzone-header">
|
||||
${this.isLoading
|
||||
? html`<span class="dropzone__loader" aria-hidden="true"></span>`
|
||||
: html`<dees-icon icon="lucide:FolderOpen"></dees-icon>`}
|
||||
</div>
|
||||
<div class="dropzone__content">
|
||||
<span class="dropzone__headline">${this.buttonText || 'Select files'}</span>
|
||||
<span class="dropzone__subline">
|
||||
Drag and drop files here or
|
||||
? html`<span class="dropzone-loader" aria-hidden="true"></span>`
|
||||
: html`<dees-icon icon="lucide:Upload"></dees-icon>`}
|
||||
<span class="dropzone-title">Drop files here or</span>
|
||||
<button
|
||||
type="button"
|
||||
class="dropzone__browse"
|
||||
@click=${this.handleBrowseClick}
|
||||
class="dropzone-browse"
|
||||
@click=${(e: MouseEvent) => { e.stopPropagation(); this.openFileSelector(); }}
|
||||
?disabled=${this.disabled}
|
||||
>
|
||||
browse
|
||||
</button>
|
||||
</span>
|
||||
</div>
|
||||
</div>
|
||||
<div class="dropzone__meta">
|
||||
${metaEntries.map((entry) => html`<span>${entry}</span>`)}
|
||||
>browse</button>
|
||||
</div>
|
||||
${this.renderFileList()}
|
||||
<div slot="footer" class="dropzone-footer">
|
||||
${metaEntries.map((entry) => html`<span class="meta-chip">${entry}</span>`)}
|
||||
</div>
|
||||
</dees-tile>
|
||||
${this.validationMessage
|
||||
? html`<div class="validation-message" aria-live="polite">${this.validationMessage}</div>`
|
||||
: html``}
|
||||
${this.renderDescription()}
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
|
||||
private renderFileList(): TemplateResult {
|
||||
if (this.value.length === 0) {
|
||||
return html``;
|
||||
return html`
|
||||
<div class="file-list-empty">
|
||||
<dees-icon icon="lucide:FileStack"></dees-icon>
|
||||
<span>No files selected</span>
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
|
||||
return html`
|
||||
<div class="file-list">
|
||||
<div class="file-list__header">
|
||||
<div class="file-list-header">
|
||||
<span>${this.value.length} file${this.value.length === 1 ? '' : 's'} selected</span>
|
||||
${this.value.length > 0
|
||||
? html`<button type="button" class="file-list__clear" @click=${this.handleClearAll}>Clear ${this.value.length > 1 ? 'all' : ''}</button>`
|
||||
: html``}
|
||||
<button type="button" class="file-list-clear" @click=${this.handleClearAll}>Clear ${this.value.length > 1 ? 'all' : ''}</button>
|
||||
</div>
|
||||
<div class="file-list__items">
|
||||
${this.value.map((file) => this.renderFileRow(file))}
|
||||
</div>
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
|
||||
@@ -193,21 +186,14 @@ export class DeesInputFileupload extends DeesInputBase<DeesInputFileupload> {
|
||||
if (this.disabled) {
|
||||
return;
|
||||
}
|
||||
// Don't open file selector if clicking on the browse button or file list
|
||||
if ((event.target as HTMLElement).closest('.dropzone__browse, .file-list')) {
|
||||
// Don't open file selector when clicking file list items or actions
|
||||
const target = event.target as HTMLElement;
|
||||
if (target.closest('.file-list, .dropzone-header, .dropzone-footer')) {
|
||||
return;
|
||||
}
|
||||
this.openFileSelector();
|
||||
};
|
||||
|
||||
private handleBrowseClick = (event: MouseEvent) => {
|
||||
if (this.disabled) {
|
||||
return;
|
||||
}
|
||||
event.stopPropagation(); // Stop propagation to prevent double trigger
|
||||
this.openFileSelector();
|
||||
};
|
||||
|
||||
private handleDropzoneKeydown = (event: KeyboardEvent) => {
|
||||
if (this.disabled) {
|
||||
return;
|
||||
@@ -280,7 +266,7 @@ export class DeesInputFileupload extends DeesInputBase<DeesInputFileupload> {
|
||||
}
|
||||
|
||||
private rebindInteractiveElements(): void {
|
||||
const newDropArea = this.shadowRoot?.querySelector('.dropzone') as HTMLElement | null;
|
||||
const newDropArea = this.shadowRoot?.querySelector('dees-tile') as HTMLElement | null;
|
||||
|
||||
if (newDropArea !== this.dropArea) {
|
||||
this.detachDropListeners();
|
||||
|
||||
@@ -55,18 +55,20 @@ export const demoFunc = () => html`
|
||||
.title=${'Modern file uploader'}
|
||||
.subtitle=${'Shadcn-inspired layout with drag & drop, previews and validation'}
|
||||
>
|
||||
<dees-form>
|
||||
<div class="demo-grid demo-grid--two">
|
||||
<div class="demo-stack">
|
||||
<dees-input-fileupload
|
||||
.label=${'Attachments'}
|
||||
.description=${'Upload supporting documents for your request'}
|
||||
.infoText=${'Upload supporting documents for your request'}
|
||||
.description=${'Accepted formats: images, PDF, and ZIP archives up to 10MB'}
|
||||
.accept=${'image/*,.pdf,.zip'}
|
||||
.maxSize=${10 * 1024 * 1024}
|
||||
></dees-input-fileupload>
|
||||
|
||||
<dees-input-fileupload
|
||||
.label=${'Brand assets'}
|
||||
.description=${'Upload high-resolution imagery (JPG/PNG)'}
|
||||
.infoText=${'Upload high-resolution imagery (JPG/PNG)'}
|
||||
.accept=${'image/jpeg,image/png'}
|
||||
.multiple=${false}
|
||||
.maxSize=${5 * 1024 * 1024}
|
||||
@@ -77,18 +79,19 @@ export const demoFunc = () => html`
|
||||
<div class="demo-stack">
|
||||
<dees-input-fileupload
|
||||
.label=${'Audio uploads'}
|
||||
.description=${'Share podcast drafts (MP3/WAV, max 25MB each)'}
|
||||
.infoText=${'Share podcast drafts (MP3/WAV, max 25MB each)'}
|
||||
.accept=${'audio/*'}
|
||||
.maxSize=${25 * 1024 * 1024}
|
||||
></dees-input-fileupload>
|
||||
|
||||
<dees-input-fileupload
|
||||
.label=${'Disabled example'}
|
||||
.description=${'Uploader is disabled while moderation is pending'}
|
||||
.infoText=${'Uploader is disabled while moderation is pending'}
|
||||
.disabled=${true}
|
||||
></dees-input-fileupload>
|
||||
</div>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel
|
||||
@@ -97,10 +100,9 @@ export const demoFunc = () => html`
|
||||
>
|
||||
<div class="demo-grid">
|
||||
<dees-form>
|
||||
<div class="demo-stack">
|
||||
<dees-input-text
|
||||
.label=${'Project name'}
|
||||
.description=${'How should we refer to this project internally?'}
|
||||
.infoText=${'How should we refer to this project internally?'}
|
||||
.required=${true}
|
||||
.key=${'projectName'}
|
||||
></dees-input-text>
|
||||
@@ -114,7 +116,7 @@ export const demoFunc = () => html`
|
||||
|
||||
<dees-input-fileupload
|
||||
.label=${'Statement of work'}
|
||||
.description=${'Upload a signed statement of work (PDF, max 15MB)'}
|
||||
.infoText=${'Upload a signed statement of work (PDF, max 15MB)'}
|
||||
.required=${true}
|
||||
.accept=${'application/pdf'}
|
||||
.maxSize=${15 * 1024 * 1024}
|
||||
@@ -124,7 +126,7 @@ export const demoFunc = () => html`
|
||||
|
||||
<dees-input-fileupload
|
||||
.label=${'Creative references'}
|
||||
.description=${'Optional. Upload up to five visual references'}
|
||||
.infoText=${'Optional. Upload up to five visual references'}
|
||||
.accept=${'image/*'}
|
||||
.maxFiles=${5}
|
||||
.maxSize=${8 * 1024 * 1024}
|
||||
@@ -133,13 +135,12 @@ export const demoFunc = () => html`
|
||||
|
||||
<dees-input-text
|
||||
.label=${'Notes'}
|
||||
.description=${'Add optional context for reviewers'}
|
||||
.infoText=${'Add optional context for reviewers'}
|
||||
.inputType=${'textarea'}
|
||||
.key=${'notes'}
|
||||
></dees-input-text>
|
||||
|
||||
<dees-form-submit .text=${'Submit briefing'}></dees-form-submit>
|
||||
</div>
|
||||
</dees-form>
|
||||
|
||||
<div class="demo-note">
|
||||
|
||||
@@ -1,201 +1,158 @@
|
||||
import { css, cssManager } from '@design.estate/dees-element';
|
||||
import { DeesInputBase } from '../dees-input-base/dees-input-base.js';
|
||||
import { themeDefaultStyles } from '../../00theme.js';
|
||||
|
||||
export const fileuploadStyles = [
|
||||
cssManager.defaultStyles,
|
||||
themeDefaultStyles,
|
||||
...DeesInputBase.baseStyles,
|
||||
cssManager.defaultStyles,
|
||||
css`
|
||||
:host {
|
||||
position: relative;
|
||||
display: block;
|
||||
}
|
||||
|
||||
|
||||
.input-wrapper {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 12px;
|
||||
}
|
||||
|
||||
.dropzone {
|
||||
position: relative;
|
||||
padding: 20px;
|
||||
border-radius: 12px;
|
||||
border: 1.5px dashed ${cssManager.bdTheme('hsl(215 16% 80%)', 'hsl(217 20% 25%)')};
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(215 20% 12%)')};
|
||||
transition: border-color 0.2s ease, box-shadow 0.2s ease, background 0.2s ease;
|
||||
cursor: pointer;
|
||||
outline: none;
|
||||
/* ── Tile integration ── */
|
||||
dees-tile {
|
||||
cursor: default;
|
||||
}
|
||||
|
||||
.dropzone:focus-visible {
|
||||
box-shadow: 0 0 0 2px ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(215 20% 12%)')},
|
||||
0 0 0 4px ${cssManager.bdTheme('hsl(217 91% 60% / 0.5)', 'hsl(213 93% 68% / 0.4)')};
|
||||
border-color: ${cssManager.bdTheme('hsl(217 91% 60%)', 'hsl(213 93% 68%)')};
|
||||
dees-tile:hover::part(outer) {
|
||||
border-color: var(--dees-color-border-strong);
|
||||
}
|
||||
|
||||
.dropzone--active {
|
||||
border-color: ${cssManager.bdTheme('hsl(217 91% 60%)', 'hsl(213 93% 68%)')};
|
||||
box-shadow: 0 12px 32px ${cssManager.bdTheme('rgba(15, 23, 42, 0.12)', 'rgba(0, 0, 0, 0.35)')};
|
||||
background: ${cssManager.bdTheme('hsl(217 91% 60% / 0.06)', 'hsl(213 93% 68% / 0.12)')};
|
||||
dees-tile.dragover::part(outer) {
|
||||
border-color: var(--dees-color-accent-primary);
|
||||
box-shadow: 0 0 0 2px ${cssManager.bdTheme('hsl(217 91% 60% / 0.15)', 'hsl(213 93% 68% / 0.15)')};
|
||||
}
|
||||
|
||||
.dropzone--has-files {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 99%)', 'hsl(215 20% 11%)')};
|
||||
}
|
||||
|
||||
.dropzone--disabled {
|
||||
:host([disabled]) dees-tile {
|
||||
opacity: 0.6;
|
||||
pointer-events: none;
|
||||
cursor: not-allowed;
|
||||
pointer-events: none;
|
||||
}
|
||||
|
||||
.dropzone__body {
|
||||
/* ── Header slot: sleek toolbar ── */
|
||||
.dropzone-header {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
gap: 16px;
|
||||
gap: 8px;
|
||||
height: 32px;
|
||||
padding: 0 12px;
|
||||
}
|
||||
|
||||
.dropzone__icon {
|
||||
width: 48px;
|
||||
height: 48px;
|
||||
border-radius: 16px;
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: center;
|
||||
color: ${cssManager.bdTheme('hsl(217 91% 60%)', 'hsl(213 93% 68%)')};
|
||||
background: ${cssManager.bdTheme('hsl(217 91% 60% / 0.12)', 'hsl(213 93% 68% / 0.12)')};
|
||||
position: relative;
|
||||
flex-shrink: 0;
|
||||
.dropzone-header dees-icon {
|
||||
width: 14px;
|
||||
height: 14px;
|
||||
color: var(--dees-color-text-muted);
|
||||
}
|
||||
|
||||
.dropzone__icon dees-icon {
|
||||
font-size: 22px;
|
||||
}
|
||||
|
||||
.dropzone__loader {
|
||||
width: 20px;
|
||||
height: 20px;
|
||||
border-radius: 999px;
|
||||
.dropzone-loader {
|
||||
width: 14px;
|
||||
height: 14px;
|
||||
border-radius: var(--dees-radius-full);
|
||||
border: 2px solid ${cssManager.bdTheme('rgba(15, 23, 42, 0.15)', 'rgba(255, 255, 255, 0.15)')};
|
||||
border-top-color: ${cssManager.bdTheme('hsl(217 91% 60%)', 'hsl(213 93% 68%)')};
|
||||
border-top-color: var(--dees-color-accent-primary);
|
||||
animation: loader-spin 0.6s linear infinite;
|
||||
}
|
||||
|
||||
.dropzone__content {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 4px;
|
||||
min-width: 0;
|
||||
}
|
||||
|
||||
.dropzone__headline {
|
||||
font-size: 15px;
|
||||
font-weight: 600;
|
||||
color: ${cssManager.bdTheme('hsl(222 47% 11%)', 'hsl(210 20% 96%)')};
|
||||
}
|
||||
|
||||
.dropzone__subline {
|
||||
.dropzone-title {
|
||||
font-size: 13px;
|
||||
color: ${cssManager.bdTheme('hsl(215 16% 46%)', 'hsl(215 16% 70%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
}
|
||||
|
||||
.dropzone__browse {
|
||||
.dropzone-browse {
|
||||
appearance: none;
|
||||
border: none;
|
||||
background: none;
|
||||
padding: 0;
|
||||
margin-left: 4px;
|
||||
color: ${cssManager.bdTheme('hsl(217 91% 60%)', 'hsl(213 93% 68%)')};
|
||||
font-size: 13px;
|
||||
font-family: inherit;
|
||||
font-weight: 600;
|
||||
color: var(--dees-color-accent-primary);
|
||||
cursor: pointer;
|
||||
text-decoration: none;
|
||||
}
|
||||
|
||||
.dropzone__browse:hover {
|
||||
.dropzone-browse:hover {
|
||||
text-decoration: underline;
|
||||
}
|
||||
|
||||
.dropzone__browse:disabled {
|
||||
.dropzone-browse:disabled {
|
||||
cursor: not-allowed;
|
||||
opacity: 0.6;
|
||||
opacity: 0.5;
|
||||
}
|
||||
|
||||
.dropzone__meta {
|
||||
margin-top: 14px;
|
||||
/* ── Content slot: file list in rounded inset ── */
|
||||
.file-list-empty {
|
||||
display: flex;
|
||||
flex-wrap: wrap;
|
||||
flex-direction: column;
|
||||
align-items: center;
|
||||
justify-content: center;
|
||||
gap: 8px;
|
||||
font-size: 12px;
|
||||
color: ${cssManager.bdTheme('hsl(215 16% 50%)', 'hsl(215 16% 72%)')};
|
||||
padding: 24px 16px;
|
||||
color: var(--dees-color-text-muted);
|
||||
font-size: 13px;
|
||||
}
|
||||
|
||||
.dropzone__meta span {
|
||||
padding: 4px 10px;
|
||||
border-radius: 999px;
|
||||
background: ${cssManager.bdTheme('hsl(217 91% 95%)', 'hsl(213 93% 18%)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(217 91% 90%)', 'hsl(213 93% 24%)')};
|
||||
.file-list-empty dees-icon {
|
||||
font-size: 24px;
|
||||
opacity: 0.4;
|
||||
}
|
||||
|
||||
.file-list {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 12px;
|
||||
margin-top: 20px;
|
||||
padding-top: 20px;
|
||||
border-top: 1px solid ${cssManager.bdTheme('hsl(217 91% 90%)', 'hsl(213 93% 24%)')};
|
||||
}
|
||||
|
||||
.file-list__header {
|
||||
.file-list-header {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: space-between;
|
||||
font-size: 13px;
|
||||
padding: 8px 12px;
|
||||
font-size: 12px;
|
||||
font-weight: 500;
|
||||
color: ${cssManager.bdTheme('hsl(215 16% 45%)', 'hsl(215 16% 68%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
}
|
||||
|
||||
.file-list__clear {
|
||||
.file-list-clear {
|
||||
appearance: none;
|
||||
border: none;
|
||||
background: none;
|
||||
color: ${cssManager.bdTheme('hsl(217 91% 60%)', 'hsl(213 93% 68%)')};
|
||||
color: var(--dees-color-accent-primary);
|
||||
cursor: pointer;
|
||||
font-weight: 500;
|
||||
font-size: 13px;
|
||||
font-size: 12px;
|
||||
padding: 0;
|
||||
font-family: inherit;
|
||||
}
|
||||
|
||||
.file-list__clear:hover {
|
||||
.file-list-clear:hover {
|
||||
text-decoration: underline;
|
||||
}
|
||||
|
||||
.file-list__items {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 12px;
|
||||
}
|
||||
|
||||
.file-row {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
gap: 12px;
|
||||
padding: 10px 12px;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100% / 0.5)', 'hsl(215 20% 16% / 0.5)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(213 27% 92%)', 'hsl(217 25% 26%)')};
|
||||
border-radius: 8px;
|
||||
transition: background 0.15s ease;
|
||||
padding: 6px 12px;
|
||||
transition: background var(--dees-transition-fast) ease;
|
||||
}
|
||||
|
||||
.file-row:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100% / 0.8)', 'hsl(215 20% 16% / 0.8)')};
|
||||
background: var(--dees-color-row-hover);
|
||||
}
|
||||
|
||||
.file-thumb {
|
||||
width: 36px;
|
||||
height: 36px;
|
||||
border-radius: 8px;
|
||||
background: ${cssManager.bdTheme('hsl(214 31% 92%)', 'hsl(217 32% 18%)')};
|
||||
width: 32px;
|
||||
height: 32px;
|
||||
border-radius: var(--dees-radius-sm);
|
||||
background: var(--dees-color-bg-tertiary);
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: center;
|
||||
@@ -204,16 +161,15 @@ export const fileuploadStyles = [
|
||||
}
|
||||
|
||||
.file-thumb dees-icon {
|
||||
font-size: 18px;
|
||||
color: ${cssManager.bdTheme('hsl(215 16% 45%)', 'hsl(215 16% 70%)')};
|
||||
font-size: 16px;
|
||||
color: var(--dees-color-text-muted);
|
||||
display: block;
|
||||
width: 18px;
|
||||
height: 18px;
|
||||
width: 16px;
|
||||
height: 16px;
|
||||
line-height: 1;
|
||||
flex-shrink: 0;
|
||||
}
|
||||
|
||||
|
||||
.thumb-image {
|
||||
width: 100%;
|
||||
height: 100%;
|
||||
@@ -223,14 +179,14 @@ export const fileuploadStyles = [
|
||||
.file-meta {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 4px;
|
||||
gap: 2px;
|
||||
min-width: 0;
|
||||
}
|
||||
|
||||
.file-name {
|
||||
font-weight: 600;
|
||||
font-size: 14px;
|
||||
color: ${cssManager.bdTheme('hsl(222 47% 11%)', 'hsl(210 20% 96%)')};
|
||||
font-weight: 500;
|
||||
font-size: 13px;
|
||||
color: var(--dees-color-text-primary);
|
||||
white-space: nowrap;
|
||||
overflow: hidden;
|
||||
text-overflow: ellipsis;
|
||||
@@ -241,8 +197,8 @@ export const fileuploadStyles = [
|
||||
align-items: center;
|
||||
gap: 8px;
|
||||
flex-wrap: wrap;
|
||||
font-size: 12px;
|
||||
color: ${cssManager.bdTheme('hsl(215 16% 46%)', 'hsl(215 16% 70%)')};
|
||||
font-size: 11px;
|
||||
color: var(--dees-color-text-muted);
|
||||
}
|
||||
|
||||
.file-size {
|
||||
@@ -250,39 +206,40 @@ export const fileuploadStyles = [
|
||||
}
|
||||
|
||||
.file-type {
|
||||
padding: 2px 8px;
|
||||
border-radius: 999px;
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(214 31% 86%)', 'hsl(217 32% 28%)')};
|
||||
color: ${cssManager.bdTheme('hsl(215 16% 46%)', 'hsl(215 16% 70%)')};
|
||||
padding: 1px 6px;
|
||||
border-radius: var(--dees-radius-full);
|
||||
border: 1px solid var(--dees-color-border-default);
|
||||
color: var(--dees-color-text-muted);
|
||||
text-transform: uppercase;
|
||||
letter-spacing: 0.08em;
|
||||
line-height: 1;
|
||||
font-size: 10px;
|
||||
}
|
||||
|
||||
.file-actions {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
gap: 8px;
|
||||
margin-left: auto;
|
||||
}
|
||||
|
||||
.remove-button {
|
||||
width: 28px;
|
||||
height: 28px;
|
||||
border-radius: 6px;
|
||||
width: 24px;
|
||||
height: 24px;
|
||||
border-radius: var(--dees-radius-xs);
|
||||
background: transparent;
|
||||
border: none;
|
||||
cursor: pointer;
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: center;
|
||||
transition: background 0.15s ease, transform 0.15s ease, color 0.15s ease;
|
||||
color: ${cssManager.bdTheme('hsl(215 16% 52%)', 'hsl(215 16% 68%)')};
|
||||
transition: background var(--dees-transition-fast) ease,
|
||||
color var(--dees-transition-fast) ease;
|
||||
color: var(--dees-color-text-muted);
|
||||
}
|
||||
|
||||
.remove-button:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 72% 50% / 0.08)', 'hsl(0 62% 32% / 0.15)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 72% 46%)', 'hsl(0 70% 70%)')};
|
||||
color: var(--dees-color-accent-error);
|
||||
}
|
||||
|
||||
.remove-button:active {
|
||||
@@ -298,9 +255,28 @@ export const fileuploadStyles = [
|
||||
flex-shrink: 0;
|
||||
}
|
||||
|
||||
/* ── Footer slot: meta chips ── */
|
||||
.dropzone-footer {
|
||||
display: flex;
|
||||
flex-wrap: wrap;
|
||||
gap: 6px;
|
||||
padding: 6px 12px;
|
||||
align-items: center;
|
||||
}
|
||||
|
||||
.meta-chip {
|
||||
font-size: 11px;
|
||||
padding: 2px 8px;
|
||||
border-radius: var(--dees-radius-full);
|
||||
color: var(--dees-color-text-muted);
|
||||
background: var(--dees-color-bg-tertiary);
|
||||
border: 1px solid var(--dees-color-border-subtle);
|
||||
}
|
||||
|
||||
/* ── Validation ── */
|
||||
.validation-message {
|
||||
font-size: 13px;
|
||||
color: ${cssManager.bdTheme('hsl(0 72% 40%)', 'hsl(0 70% 68%)')};
|
||||
color: var(--dees-color-accent-error);
|
||||
line-height: 1.5;
|
||||
}
|
||||
|
||||
|
||||
@@ -13,12 +13,6 @@ export const demoFunc = () => html`
|
||||
margin: 0 auto;
|
||||
}
|
||||
|
||||
.input-group {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 16px;
|
||||
}
|
||||
|
||||
.payment-group {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
@@ -30,21 +24,23 @@ export const demoFunc = () => html`
|
||||
|
||||
<div class="demo-container">
|
||||
<dees-panel .title=${'Basic IBAN Input'} .subtitle=${'International Bank Account Number with automatic formatting'}>
|
||||
<div class="input-group">
|
||||
<dees-form>
|
||||
<dees-input-iban
|
||||
.label=${'Bank Account IBAN'}
|
||||
.description=${'Enter your International Bank Account Number'}
|
||||
.infoText=${'Enter your International Bank Account Number'}
|
||||
.description=${'Your IBAN can be found on your bank statement'}
|
||||
></dees-input-iban>
|
||||
|
||||
<dees-input-iban
|
||||
.label=${'Verified IBAN'}
|
||||
.description=${'This IBAN has been verified'}
|
||||
.infoText=${'This IBAN has been verified'}
|
||||
.value=${'DE89370400440532013000'}
|
||||
></dees-input-iban>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Payment Information'} .subtitle=${'IBAN input with horizontal layout for payment forms'}>
|
||||
<dees-form>
|
||||
<div class="payment-group">
|
||||
<dees-input-text
|
||||
.label=${'Account Holder'}
|
||||
@@ -58,30 +54,31 @@ export const demoFunc = () => html`
|
||||
.value=${'GB82WEST12345698765432'}
|
||||
></dees-input-iban>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Validation & States'} .subtitle=${'Required fields and disabled states'}>
|
||||
<div class="input-group">
|
||||
<dees-form>
|
||||
<dees-input-iban
|
||||
.label=${'Payment Account'}
|
||||
.description=${'Required for processing payments'}
|
||||
.infoText=${'Required for processing payments'}
|
||||
.required=${true}
|
||||
></dees-input-iban>
|
||||
|
||||
<dees-input-iban
|
||||
.label=${'Locked IBAN'}
|
||||
.description=${'This IBAN cannot be changed'}
|
||||
.infoText=${'This IBAN cannot be changed'}
|
||||
.value=${'FR1420041010050500013M02606'}
|
||||
.disabled=${true}
|
||||
></dees-input-iban>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Bank Transfer Form'} .subtitle=${'Complete form example with IBAN validation'}>
|
||||
<dees-form>
|
||||
<dees-input-text .label=${'Recipient Name'} .required=${true}></dees-input-text>
|
||||
<dees-input-iban .label=${'Recipient IBAN'} .required=${true}></dees-input-iban>
|
||||
<dees-input-text .label=${'Transfer Reference'} .description=${'Optional reference for the transfer'}></dees-input-text>
|
||||
<dees-input-text .label=${'Transfer Reference'} .infoText=${'Optional reference for the transfer'}></dees-input-text>
|
||||
<dees-input-text .label=${'Amount'} .inputType=${'number'} .required=${true}></dees-input-text>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
@@ -44,16 +44,27 @@ export class DeesInputIban extends DeesInputBase<DeesInputIban> {
|
||||
public render(): TemplateResult {
|
||||
return html`
|
||||
<div class="input-wrapper">
|
||||
<dees-label .label=${this.label || 'IBAN'} .description=${this.description}></dees-label>
|
||||
<dees-label .label=${this.label || 'IBAN'} .infoText=${this.infoText}></dees-label>
|
||||
<dees-input-text
|
||||
.value=${this.value}
|
||||
.disabled=${this.disabled}
|
||||
.required=${this.required}
|
||||
.placeholder=${'DE89 3704 0044 0532 0130 00'}
|
||||
.validationFunction=${(value: string) => {
|
||||
const normalized = value.replace(/ /g, '');
|
||||
if (normalized.length === 0) {
|
||||
return { valid: true, message: '' };
|
||||
}
|
||||
const isValid = ibantools.isValidIBAN(normalized);
|
||||
return isValid
|
||||
? { valid: true, message: 'IBAN is valid' }
|
||||
: { valid: false, message: 'Please enter a valid IBAN' };
|
||||
}}
|
||||
@input=${(eventArg: InputEvent) => {
|
||||
this.validateIban(eventArg);
|
||||
}}
|
||||
></dees-input-text>
|
||||
${this.renderDescription()}
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
@@ -81,10 +92,6 @@ export class DeesInputIban extends DeesInputBase<DeesInputIban> {
|
||||
}
|
||||
}
|
||||
this.enteredIbanIsValid = ibantools.isValidIBAN(this.enteredString.replace(/ /g, ''));
|
||||
const deesInputText = this.shadowRoot!.querySelector('dees-input-text') as any;
|
||||
if (deesInputText) {
|
||||
deesInputText.validationText = `IBAN is valid: ${this.enteredIbanIsValid}`;
|
||||
}
|
||||
}
|
||||
|
||||
public getValue(): string {
|
||||
|
||||
@@ -109,6 +109,7 @@ export const demoFunc = () => html`
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'3. Validation & Constraints'} .subtitle=${'Lists with minimum/maximum items and duplicate prevention'}>
|
||||
<dees-form>
|
||||
<div class="grid-layout">
|
||||
<dees-input-list
|
||||
.label=${'Team Members (Min 2, Max 5)'}
|
||||
@@ -128,6 +129,7 @@ export const demoFunc = () => html`
|
||||
.description=${'Duplicate items are not allowed'}
|
||||
></dees-input-list>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'4. Delete Confirmation'} .subtitle=${'Require confirmation before deleting items'}>
|
||||
@@ -262,7 +264,85 @@ export const demoFunc = () => html`
|
||||
></dees-input-list>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'9. Empty State'} .subtitle=${'How the component looks with no items'}>
|
||||
<dees-panel .title=${'9. Candidates with Tab Completion'} .subtitle=${'Terminal-style autocomplete — Tab accepts, Shift+Tab cycles'}>
|
||||
<div class="grid-layout">
|
||||
<dees-input-list
|
||||
id="candidate-list"
|
||||
.label=${'Assign Team Members'}
|
||||
.placeholder=${'Type a name... (Tab to complete)'}
|
||||
.candidates=${[
|
||||
{ viewKey: 'Alice Smith', payload: { id: 1, role: 'Engineer', department: 'Frontend' } },
|
||||
{ viewKey: 'Bob Johnson', payload: { id: 2, role: 'Designer', department: 'UX' } },
|
||||
{ viewKey: 'Carol Williams', payload: { id: 3, role: 'Product Manager', department: 'Product' } },
|
||||
{ viewKey: 'David Brown', payload: { id: 4, role: 'Engineer', department: 'Backend' } },
|
||||
{ viewKey: 'Eve Davis', payload: { id: 5, role: 'QA Engineer', department: 'Quality' } },
|
||||
{ viewKey: 'Frank Miller', payload: { id: 6, role: 'DevOps', department: 'Infrastructure' } },
|
||||
{ viewKey: 'Grace Wilson', payload: { id: 7, role: 'Designer', department: 'UX' } },
|
||||
{ viewKey: 'Henry Moore', payload: { id: 8, role: 'Engineer', department: 'Frontend' } },
|
||||
]}
|
||||
.value=${['Alice Smith', 'Carol Williams']}
|
||||
.maxItems=${5}
|
||||
.description=${'Type to see ghost completion. Tab to accept, Shift+Tab to cycle, Enter to add.'}
|
||||
@change=${(e: CustomEvent) => {
|
||||
const preview = document.querySelector('#candidate-json');
|
||||
if (preview) {
|
||||
const list = (e.target as any);
|
||||
const candidates = list.getAddedCandidates();
|
||||
preview.textContent = JSON.stringify(candidates, null, 2);
|
||||
}
|
||||
}}
|
||||
></dees-input-list>
|
||||
|
||||
<div>
|
||||
<div style="font-size: 13px; font-weight: 500; margin-bottom: 8px; color: inherit;">Selected Candidates (with payloads)</div>
|
||||
<div class="output-preview" id="candidate-json">[]</div>
|
||||
<div class="feature-note">
|
||||
Try typing "D" — ghost text shows "avid Brown". Press Shift+Tab to cycle to other D-matches. Tab accepts, Enter adds.
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'10. Technology Stack'} .subtitle=${'Larger candidate pool with Shift+Tab cycling'}>
|
||||
<dees-input-list
|
||||
.label=${'Select Technologies'}
|
||||
.placeholder=${'Type to autocomplete...'}
|
||||
.candidates=${[
|
||||
{ viewKey: 'TypeScript', payload: { category: 'language' } },
|
||||
{ viewKey: 'React', payload: { category: 'framework' } },
|
||||
{ viewKey: 'Vue.js', payload: { category: 'framework' } },
|
||||
{ viewKey: 'Angular', payload: { category: 'framework' } },
|
||||
{ viewKey: 'Node.js', payload: { category: 'runtime' } },
|
||||
{ viewKey: 'Deno', payload: { category: 'runtime' } },
|
||||
{ viewKey: 'Docker', payload: { category: 'devops' } },
|
||||
{ viewKey: 'PostgreSQL', payload: { category: 'database' } },
|
||||
{ viewKey: 'MongoDB', payload: { category: 'database' } },
|
||||
{ viewKey: 'Redis', payload: { category: 'database' } },
|
||||
{ viewKey: 'Kubernetes', payload: { category: 'devops' } },
|
||||
]}
|
||||
.description=${'Try "D" — cycles through Deno/Docker. "R" — cycles through React/Redis.'}
|
||||
></dees-input-list>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'11. Freeform + Candidates'} .subtitle=${'Allow adding items not in the candidate list (shown with a question mark)'}>
|
||||
<dees-input-list
|
||||
.label=${'Tags'}
|
||||
.placeholder=${'Type a tag... (freeform allowed)'}
|
||||
.allowFreeform=${true}
|
||||
.candidates=${[
|
||||
{ viewKey: 'bug', payload: { color: 'red' } },
|
||||
{ viewKey: 'feature', payload: { color: 'blue' } },
|
||||
{ viewKey: 'docs', payload: { color: 'green' } },
|
||||
{ viewKey: 'refactor', payload: { color: 'purple' } },
|
||||
{ viewKey: 'performance', payload: { color: 'orange' } },
|
||||
{ viewKey: 'security', payload: { color: 'red' } },
|
||||
]}
|
||||
.value=${['bug', 'my-custom-tag', 'feature']}
|
||||
.description=${'Known tags get a checkmark, custom tags get a question mark. Tab to complete, Enter to add freeform.'}
|
||||
></dees-input-list>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'12. Empty State'} .subtitle=${'How the component looks with no items'}>
|
||||
<dees-input-list
|
||||
.label=${'Your Ideas'}
|
||||
.placeholder=${'Share your ideas...'}
|
||||
|
||||
@@ -9,9 +9,15 @@ import {
|
||||
} from '@design.estate/dees-element';
|
||||
import { DeesInputBase } from '../dees-input-base/dees-input-base.js';
|
||||
import '../../00group-utility/dees-icon/dees-icon.js';
|
||||
import '../../00group-layout/dees-tile/dees-tile.js';
|
||||
import { demoFunc } from './dees-input-list.demo.js';
|
||||
import { themeDefaultStyles } from '../../00theme.js';
|
||||
|
||||
export interface IListCandidate {
|
||||
viewKey: string;
|
||||
payload?: any;
|
||||
}
|
||||
|
||||
declare global {
|
||||
interface HTMLElementTagNameMap {
|
||||
'dees-input-list': DeesInputList;
|
||||
@@ -46,12 +52,27 @@ export class DeesInputList extends DeesInputBase<DeesInputList> {
|
||||
@property({ type: Boolean })
|
||||
accessor confirmDelete: boolean = false;
|
||||
|
||||
@property({ type: Array })
|
||||
accessor candidates: IListCandidate[] = [];
|
||||
|
||||
@property({ type: Boolean })
|
||||
accessor allowFreeform: boolean = false;
|
||||
|
||||
@property({ type: String })
|
||||
accessor validationText: string = '';
|
||||
|
||||
private addedCandidatesMap: Map<string, IListCandidate> = new Map();
|
||||
private matchingCandidates: IListCandidate[] = [];
|
||||
|
||||
@state()
|
||||
accessor inputValue: string = '';
|
||||
|
||||
@state()
|
||||
accessor ghostText: string = '';
|
||||
|
||||
@state()
|
||||
accessor currentCandidateIndex: number = -1;
|
||||
|
||||
@state()
|
||||
accessor editingIndex: number = -1;
|
||||
|
||||
@@ -99,26 +120,19 @@ export class DeesInputList extends DeesInputBase<DeesInputList> {
|
||||
width: 100%;
|
||||
}
|
||||
|
||||
.list-container {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 3.9%)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border-radius: 6px;
|
||||
overflow: hidden;
|
||||
transition: all 0.15s ease;
|
||||
dees-tile:hover::part(outer) {
|
||||
border-color: var(--dees-color-border-strong);
|
||||
}
|
||||
|
||||
.list-container:hover:not(.disabled) {
|
||||
border-color: ${cssManager.bdTheme('hsl(0 0% 79.8%)', 'hsl(0 0% 20.9%)')};
|
||||
}
|
||||
|
||||
.list-container:focus-within {
|
||||
dees-tile:focus-within::part(outer) {
|
||||
border-color: ${cssManager.bdTheme('hsl(222.2 47.4% 51.2%)', 'hsl(217.2 91.2% 59.8%)')};
|
||||
box-shadow: 0 0 0 3px ${cssManager.bdTheme('hsl(222.2 47.4% 51.2% / 0.1)', 'hsl(217.2 91.2% 59.8% / 0.1)')};
|
||||
}
|
||||
|
||||
.list-container.disabled {
|
||||
:host([disabled]) dees-tile {
|
||||
opacity: 0.6;
|
||||
cursor: not-allowed;
|
||||
pointer-events: none;
|
||||
}
|
||||
|
||||
.list-items {
|
||||
@@ -131,8 +145,8 @@ export class DeesInputList extends DeesInputBase<DeesInputList> {
|
||||
align-items: center;
|
||||
gap: 6px;
|
||||
padding: 6px 10px;
|
||||
border-bottom: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 3.9%)')};
|
||||
border-bottom: 1px solid var(--dees-color-border-subtle);
|
||||
background: transparent;
|
||||
transition: transform 0.2s ease, background 0.15s ease, box-shadow 0.15s ease;
|
||||
position: relative;
|
||||
overflow: hidden;
|
||||
@@ -143,7 +157,7 @@ export class DeesInputList extends DeesInputBase<DeesInputList> {
|
||||
}
|
||||
|
||||
.list-items:not(.is-dragging) .list-item:hover:not(.disabled) {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 97.5%)', 'hsl(0 0% 6.9%)')};
|
||||
background: var(--dees-color-row-hover);
|
||||
}
|
||||
|
||||
/* Dragging item - follows cursor */
|
||||
@@ -167,6 +181,28 @@ export class DeesInputList extends DeesInputBase<DeesInputList> {
|
||||
}
|
||||
|
||||
|
||||
.candidate-check {
|
||||
width: 14px;
|
||||
height: 14px;
|
||||
color: ${cssManager.bdTheme('hsl(142.1 76.2% 36.3%)', 'hsl(142.1 70.6% 45.3%)')};
|
||||
flex-shrink: 0;
|
||||
}
|
||||
|
||||
.candidate-unknown {
|
||||
width: 14px;
|
||||
height: 14px;
|
||||
color: ${cssManager.bdTheme('hsl(45 93% 47%)', 'hsl(45 93% 58%)')};
|
||||
flex-shrink: 0;
|
||||
}
|
||||
|
||||
.item-bullet {
|
||||
width: 14px;
|
||||
height: 14px;
|
||||
color: var(--dees-color-text-muted);
|
||||
flex-shrink: 0;
|
||||
opacity: 0.5;
|
||||
}
|
||||
|
||||
.drag-handle {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
@@ -269,12 +305,10 @@ export class DeesInputList extends DeesInputBase<DeesInputList> {
|
||||
display: flex;
|
||||
gap: 6px;
|
||||
padding: 6px 10px;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 97.5%)', 'hsl(0 0% 6.9%)')};
|
||||
border-top: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
}
|
||||
|
||||
.add-input {
|
||||
flex: 1;
|
||||
width: 100%;
|
||||
padding: 4px 8px;
|
||||
font-size: 13px;
|
||||
line-height: 18px;
|
||||
@@ -339,13 +373,6 @@ export class DeesInputList extends DeesInputBase<DeesInputList> {
|
||||
line-height: 1.4;
|
||||
}
|
||||
|
||||
.description {
|
||||
color: ${cssManager.bdTheme('hsl(215.4 16.3% 56.9%)', 'hsl(215 20.2% 55.1%)')};
|
||||
font-size: 12px;
|
||||
margin-top: 4px;
|
||||
line-height: 1.4;
|
||||
}
|
||||
|
||||
/* Scrollbar styling */
|
||||
.list-items::-webkit-scrollbar {
|
||||
width: 8px;
|
||||
@@ -368,6 +395,38 @@ export class DeesInputList extends DeesInputBase<DeesInputList> {
|
||||
.list-items.dropping .list-item {
|
||||
transition: none !important;
|
||||
}
|
||||
|
||||
/* ── Terminal-style inline autocomplete ── */
|
||||
.autocomplete-wrapper {
|
||||
position: relative;
|
||||
flex: 1;
|
||||
min-width: 0;
|
||||
overflow: hidden;
|
||||
}
|
||||
|
||||
.ghost-text {
|
||||
position: absolute;
|
||||
top: 0;
|
||||
left: 0;
|
||||
right: 0;
|
||||
bottom: 0;
|
||||
padding: 4px 8px;
|
||||
font-size: 13px;
|
||||
line-height: 18px;
|
||||
font-family: inherit;
|
||||
white-space: nowrap;
|
||||
pointer-events: none;
|
||||
overflow: hidden;
|
||||
}
|
||||
|
||||
.ghost-typed {
|
||||
visibility: hidden;
|
||||
}
|
||||
|
||||
.ghost-completion {
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 63.9%)', 'hsl(0 0% 45.1%)')};
|
||||
opacity: 0.5;
|
||||
}
|
||||
`,
|
||||
];
|
||||
|
||||
@@ -376,7 +435,7 @@ export class DeesInputList extends DeesInputBase<DeesInputList> {
|
||||
<div class="input-wrapper">
|
||||
${this.label ? html`<dees-label .label=${this.label} .required=${this.required}></dees-label>` : ''}
|
||||
|
||||
<div class="list-container ${this.disabled ? 'disabled' : ''}">
|
||||
<dees-tile .heading="${this.value.length} item${this.value.length !== 1 ? 's' : ''}">
|
||||
<div class="list-items">
|
||||
${this.value.length > 0 ? this.value.map((item, index) => html`
|
||||
<div
|
||||
@@ -393,6 +452,16 @@ export class DeesInputList extends DeesInputBase<DeesInputList> {
|
||||
</div>
|
||||
` : ''}
|
||||
|
||||
${this.candidates.length > 0 ? html`
|
||||
${this.candidates.some(c => c.viewKey === item) ? html`
|
||||
<dees-icon class="candidate-check" .icon=${'lucide:check'}></dees-icon>
|
||||
` : html`
|
||||
<dees-icon class="candidate-unknown" .icon=${'lucide:helpCircle'}></dees-icon>
|
||||
`}
|
||||
` : !this.sortable || this.disabled ? html`
|
||||
<dees-icon class="item-bullet" .icon=${'lucide:dot'}></dees-icon>
|
||||
` : ''}
|
||||
|
||||
<div class="item-content">
|
||||
${this.editingIndex === index ? html`
|
||||
<input
|
||||
@@ -438,7 +507,13 @@ export class DeesInputList extends DeesInputBase<DeesInputList> {
|
||||
</div>
|
||||
|
||||
${!this.disabled && (!this.maxItems || this.value.length < this.maxItems) ? html`
|
||||
<div class="add-item-container">
|
||||
<div slot="footer" class="add-item-container">
|
||||
<div class="autocomplete-wrapper">
|
||||
${this.ghostText ? html`
|
||||
<span class="ghost-text">
|
||||
<span class="ghost-typed">${this.inputValue}</span><span class="ghost-completion">${this.ghostText}</span>
|
||||
</span>
|
||||
` : ''}
|
||||
<input
|
||||
type="text"
|
||||
class="add-input"
|
||||
@@ -448,6 +523,7 @@ export class DeesInputList extends DeesInputBase<DeesInputList> {
|
||||
@keydown=${this.handleAddKeyDown}
|
||||
?disabled=${this.disabled}
|
||||
/>
|
||||
</div>
|
||||
<button
|
||||
class="add-button"
|
||||
@click=${this.addItem}
|
||||
@@ -457,26 +533,95 @@ export class DeesInputList extends DeesInputBase<DeesInputList> {
|
||||
</button>
|
||||
</div>
|
||||
` : ''}
|
||||
</div>
|
||||
</dees-tile>
|
||||
|
||||
${this.validationText ? html`
|
||||
<div class="validation-message">${this.validationText}</div>
|
||||
` : ''}
|
||||
|
||||
${this.description ? html`
|
||||
<div class="description">${this.description}</div>
|
||||
` : ''}
|
||||
${this.renderDescription()}
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
|
||||
private handleInput(e: InputEvent) {
|
||||
this.inputValue = (e.target as HTMLInputElement).value;
|
||||
this.updateGhostText();
|
||||
}
|
||||
|
||||
private updateGhostText(): void {
|
||||
if (this.candidates.length === 0 || !this.inputValue) {
|
||||
this.ghostText = '';
|
||||
this.currentCandidateIndex = -1;
|
||||
this.matchingCandidates = [];
|
||||
return;
|
||||
}
|
||||
|
||||
const search = this.inputValue.toLowerCase();
|
||||
this.matchingCandidates = this.candidates
|
||||
.filter(c => {
|
||||
if (this.value.includes(c.viewKey)) return false;
|
||||
return c.viewKey.toLowerCase().startsWith(search);
|
||||
})
|
||||
.sort((a, b) => a.viewKey.length - b.viewKey.length);
|
||||
|
||||
if (this.matchingCandidates.length > 0) {
|
||||
this.currentCandidateIndex = 0;
|
||||
this.ghostText = this.matchingCandidates[0].viewKey.slice(this.inputValue.length);
|
||||
} else {
|
||||
this.currentCandidateIndex = -1;
|
||||
this.ghostText = '';
|
||||
}
|
||||
}
|
||||
|
||||
private handleAddKeyDown(e: KeyboardEvent) {
|
||||
// Tab/Shift+Tab: autocomplete handling when candidates are active
|
||||
if (e.key === 'Tab' && this.candidates.length > 0 && this.inputValue) {
|
||||
e.preventDefault();
|
||||
if (e.shiftKey && this.matchingCandidates.length > 0) {
|
||||
// Shift+Tab: cycle to next candidate
|
||||
this.currentCandidateIndex = (this.currentCandidateIndex + 1) % this.matchingCandidates.length;
|
||||
const candidate = this.matchingCandidates[this.currentCandidateIndex];
|
||||
this.ghostText = candidate.viewKey.slice(this.inputValue.length);
|
||||
} else if (!e.shiftKey && this.ghostText && this.matchingCandidates.length > 0) {
|
||||
// Tab: accept the completion into the input
|
||||
const candidate = this.matchingCandidates[this.currentCandidateIndex];
|
||||
this.inputValue = candidate.viewKey;
|
||||
this.ghostText = '';
|
||||
const input = this.shadowRoot?.querySelector('.add-input') as HTMLInputElement;
|
||||
if (input) input.value = candidate.viewKey;
|
||||
}
|
||||
return;
|
||||
}
|
||||
|
||||
// Escape: clear ghost text
|
||||
if (e.key === 'Escape' && this.ghostText) {
|
||||
e.preventDefault();
|
||||
this.ghostText = '';
|
||||
this.currentCandidateIndex = -1;
|
||||
this.matchingCandidates = [];
|
||||
return;
|
||||
}
|
||||
|
||||
// Enter: add item
|
||||
if (e.key === 'Enter' && this.inputValue.trim()) {
|
||||
e.preventDefault();
|
||||
if (this.candidates.length > 0) {
|
||||
// Try exact candidate match first
|
||||
const match = this.candidates.find(
|
||||
c => c.viewKey.toLowerCase() === this.inputValue.trim().toLowerCase()
|
||||
);
|
||||
if (match) {
|
||||
this.selectCandidate(match);
|
||||
} else if (this.allowFreeform) {
|
||||
// Allow freeform entry (won't have a candidate checkmark)
|
||||
this.ghostText = '';
|
||||
this.currentCandidateIndex = -1;
|
||||
this.matchingCandidates = [];
|
||||
this.addItem();
|
||||
}
|
||||
return;
|
||||
}
|
||||
this.addItem();
|
||||
}
|
||||
}
|
||||
@@ -491,6 +636,52 @@ export class DeesInputList extends DeesInputBase<DeesInputList> {
|
||||
}
|
||||
}
|
||||
|
||||
private selectCandidate(candidate: IListCandidate): void {
|
||||
if (this.maxItems && this.value.length >= this.maxItems) {
|
||||
this.validationText = `Maximum ${this.maxItems} items allowed`;
|
||||
setTimeout(() => this.validationText = '', 3000);
|
||||
return;
|
||||
}
|
||||
|
||||
if (!this.allowDuplicates && this.value.includes(candidate.viewKey)) {
|
||||
this.validationText = 'This item already exists in the list';
|
||||
setTimeout(() => this.validationText = '', 3000);
|
||||
return;
|
||||
}
|
||||
|
||||
this.addedCandidatesMap.set(candidate.viewKey, candidate);
|
||||
this.value = [...this.value, candidate.viewKey];
|
||||
this.inputValue = '';
|
||||
this.ghostText = '';
|
||||
this.currentCandidateIndex = -1;
|
||||
this.matchingCandidates = [];
|
||||
this.validationText = '';
|
||||
this.emitChange();
|
||||
|
||||
// Re-focus input after Lit re-renders
|
||||
this.updateComplete.then(() => {
|
||||
const input = this.shadowRoot?.querySelector('.add-input') as HTMLInputElement;
|
||||
if (input) { input.value = ''; input.focus(); }
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the full candidate object for an item by its viewKey.
|
||||
* Returns undefined if the item was added as a plain string.
|
||||
*/
|
||||
public getCandidateForItem(viewKey: string): IListCandidate | undefined {
|
||||
return this.addedCandidatesMap.get(viewKey);
|
||||
}
|
||||
|
||||
/**
|
||||
* Get all added candidates with their payloads.
|
||||
*/
|
||||
public getAddedCandidates(): IListCandidate[] {
|
||||
return this.value
|
||||
.map(v => this.addedCandidatesMap.get(v))
|
||||
.filter((c): c is IListCandidate => c !== undefined);
|
||||
}
|
||||
|
||||
private addItem() {
|
||||
const trimmedValue = this.inputValue.trim();
|
||||
if (!trimmedValue) return;
|
||||
@@ -510,15 +701,13 @@ export class DeesInputList extends DeesInputBase<DeesInputList> {
|
||||
this.value = [...this.value, trimmedValue];
|
||||
this.inputValue = '';
|
||||
this.validationText = '';
|
||||
|
||||
// Clear the input
|
||||
const input = this.shadowRoot?.querySelector('.add-input') as HTMLInputElement;
|
||||
if (input) {
|
||||
input.value = '';
|
||||
input.focus();
|
||||
}
|
||||
|
||||
this.emitChange();
|
||||
|
||||
// Re-focus input after Lit re-renders
|
||||
this.updateComplete.then(() => {
|
||||
const input = this.shadowRoot?.querySelector('.add-input') as HTMLInputElement;
|
||||
if (input) { input.value = ''; input.focus(); }
|
||||
});
|
||||
}
|
||||
|
||||
private startEdit(index: number) {
|
||||
@@ -570,6 +759,8 @@ export class DeesInputList extends DeesInputBase<DeesInputList> {
|
||||
if (!confirmed) return;
|
||||
}
|
||||
|
||||
const removedKey = this.value[index];
|
||||
this.addedCandidatesMap.delete(removedKey);
|
||||
this.value = this.value.filter((_, i) => i !== index);
|
||||
this.emitChange();
|
||||
}
|
||||
|
||||
+12
-9
@@ -53,50 +53,52 @@ export const demoFunc = () => html`
|
||||
<div class="section-title">Multi-Option Toggle</div>
|
||||
<div class="section-description">Select from multiple options with a smooth sliding indicator animation.</div>
|
||||
|
||||
<dees-form>
|
||||
<dees-input-multitoggle
|
||||
.label=${'Display Mode'}
|
||||
.description=${'Choose how content is displayed'}
|
||||
.infoText=${'Choose how content is displayed'}
|
||||
.description=${'This setting affects how items appear on your dashboard'}
|
||||
.options=${['List View', 'Grid View', 'Compact']}
|
||||
.selectedOption=${'Grid View'}
|
||||
></dees-input-multitoggle>
|
||||
|
||||
<br><br>
|
||||
|
||||
<dees-input-multitoggle
|
||||
.label=${'T-Shirt Size'}
|
||||
.description=${'Select your preferred size'}
|
||||
.infoText=${'Select your preferred size'}
|
||||
.options=${['XS', 'S', 'M', 'L', 'XL', 'XXL']}
|
||||
.selectedOption=${'M'}
|
||||
></dees-input-multitoggle>
|
||||
</dees-form>
|
||||
</div>
|
||||
|
||||
<div class="section">
|
||||
<div class="section-title">Boolean Toggle</div>
|
||||
<div class="section-description">Simple on/off switches with customizable labels for clearer context.</div>
|
||||
|
||||
<dees-form>
|
||||
<dees-input-multitoggle
|
||||
.label=${'Notifications'}
|
||||
.description=${'Enable or disable push notifications'}
|
||||
.infoText=${'Enable or disable push notifications'}
|
||||
.type=${'boolean'}
|
||||
.selectedOption=${'true'}
|
||||
></dees-input-multitoggle>
|
||||
|
||||
<br><br>
|
||||
|
||||
<dees-input-multitoggle
|
||||
.label=${'Theme Mode'}
|
||||
.description=${'Switch between light and dark theme'}
|
||||
.infoText=${'Switch between light and dark theme'}
|
||||
.type=${'boolean'}
|
||||
.booleanTrueName=${'Dark'}
|
||||
.booleanFalseName=${'Light'}
|
||||
.selectedOption=${'Dark'}
|
||||
></dees-input-multitoggle>
|
||||
</dees-form>
|
||||
</div>
|
||||
|
||||
<div class="section">
|
||||
<div class="section-title">Settings Grid</div>
|
||||
<div class="section-description">Configuration options arranged in a responsive grid layout.</div>
|
||||
|
||||
<dees-form>
|
||||
<div class="settings-grid">
|
||||
<dees-input-multitoggle
|
||||
.label=${'Auto-Save'}
|
||||
@@ -126,6 +128,7 @@ export const demoFunc = () => html`
|
||||
.selectedOption=${'Private'}
|
||||
></dees-input-multitoggle>
|
||||
</div>
|
||||
</dees-form>
|
||||
</div>
|
||||
|
||||
<div class="section">
|
||||
@@ -134,7 +137,7 @@ export const demoFunc = () => html`
|
||||
|
||||
<dees-input-multitoggle
|
||||
.label=${'Account Type'}
|
||||
.description=${'This setting is locked'}
|
||||
.infoText=${'This setting is locked'}
|
||||
.options=${['Free', 'Pro', 'Enterprise']}
|
||||
.selectedOption=${'Enterprise'}
|
||||
.disabled=${true}
|
||||
|
||||
@@ -146,7 +146,7 @@ export class DeesInputMultitoggle extends DeesInputBase<DeesInputMultitoggle> {
|
||||
public render(): TemplateResult {
|
||||
return html`
|
||||
<div class="input-wrapper">
|
||||
<dees-label .label=${this.label} .description=${this.description}></dees-label>
|
||||
<dees-label .label=${this.label} .infoText=${this.infoText}></dees-label>
|
||||
<div class="mainbox">
|
||||
<div class="selections">
|
||||
<div class="indicator"></div>
|
||||
@@ -158,6 +158,7 @@ export class DeesInputMultitoggle extends DeesInputBase<DeesInputMultitoggle> {
|
||||
)}
|
||||
</div>
|
||||
</div>
|
||||
${this.renderDescription()}
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
|
||||
@@ -13,12 +13,6 @@ export const demoFunc = () => html`
|
||||
margin: 0 auto;
|
||||
}
|
||||
|
||||
.input-group {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 16px;
|
||||
}
|
||||
|
||||
.horizontal-group {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
@@ -30,23 +24,25 @@ export const demoFunc = () => html`
|
||||
|
||||
<div class="demo-container">
|
||||
<dees-panel .title=${'Basic Phone Input'} .subtitle=${'Automatic formatting for phone numbers'}>
|
||||
<div class="input-group">
|
||||
<dees-form>
|
||||
<dees-input-phone
|
||||
.label=${'Phone Number'}
|
||||
.description=${'Enter your phone number with country code'}
|
||||
.infoText=${'Enter your phone number with country code'}
|
||||
.description=${'Include country code for international numbers'}
|
||||
.value=${'5551234567'}
|
||||
></dees-input-phone>
|
||||
|
||||
<dees-input-phone
|
||||
.label=${'Contact Phone'}
|
||||
.description=${'Required for account verification'}
|
||||
.infoText=${'Required for account verification'}
|
||||
.required=${true}
|
||||
.placeholder=${'+1 (555) 000-0000'}
|
||||
></dees-input-phone>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Horizontal Layout'} .subtitle=${'Phone inputs arranged horizontally'}>
|
||||
<dees-form>
|
||||
<div class="horizontal-group">
|
||||
<dees-input-phone
|
||||
.label=${'Mobile'}
|
||||
@@ -60,13 +56,14 @@ export const demoFunc = () => html`
|
||||
.placeholder=${'+1 (800) 555-0000'}
|
||||
></dees-input-phone>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'International Numbers'} .subtitle=${'Supports formatting for numbers with country codes'}>
|
||||
<div class="input-group">
|
||||
<dees-form>
|
||||
<dees-input-phone
|
||||
.label=${'International Contact'}
|
||||
.description=${'Automatically formats international numbers'}
|
||||
.infoText=${'Automatically formats international numbers'}
|
||||
.value=${'441234567890'}
|
||||
></dees-input-phone>
|
||||
|
||||
@@ -75,7 +72,7 @@ export const demoFunc = () => html`
|
||||
.value=${'911'}
|
||||
.disabled=${true}
|
||||
></dees-input-phone>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Form Integration'} .subtitle=${'Phone input as part of a contact form'}>
|
||||
|
||||
@@ -47,7 +47,7 @@ export class DeesInputPhone extends DeesInputBase<DeesInputPhone> {
|
||||
public render(): TemplateResult {
|
||||
return html`
|
||||
<div class="input-wrapper">
|
||||
<dees-label .label=${this.label} .description=${this.description}></dees-label>
|
||||
<dees-label .label=${this.label} .infoText=${this.infoText}></dees-label>
|
||||
<dees-input-text
|
||||
.value=${this.formattedPhone}
|
||||
.disabled=${this.disabled}
|
||||
@@ -55,6 +55,7 @@ export class DeesInputPhone extends DeesInputBase<DeesInputPhone> {
|
||||
.placeholder=${this.placeholder}
|
||||
@input=${(event: InputEvent) => this.handlePhoneInput(event)}
|
||||
></dees-input-text>
|
||||
${this.renderDescription()}
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
|
||||
+10
-15
@@ -14,12 +14,6 @@ export const demoFunc = () => html`
|
||||
margin: 0 auto;
|
||||
}
|
||||
|
||||
.input-group {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 16px;
|
||||
}
|
||||
|
||||
.shopping-grid {
|
||||
display: grid;
|
||||
grid-template-columns: repeat(auto-fill, minmax(280px, 1fr));
|
||||
@@ -66,19 +60,20 @@ export const demoFunc = () => html`
|
||||
|
||||
<div class="demo-container">
|
||||
<dees-panel .title=${'Basic Quantity Selector'} .subtitle=${'Simple quantity input with increment/decrement buttons'}>
|
||||
<div class="input-group">
|
||||
<dees-form>
|
||||
<dees-input-quantityselector
|
||||
.label=${'Quantity'}
|
||||
.description=${'Select the desired quantity'}
|
||||
.infoText=${'Select the desired quantity'}
|
||||
.description=${'Minimum order quantity is 1 item'}
|
||||
.value=${1}
|
||||
></dees-input-quantityselector>
|
||||
|
||||
<dees-input-quantityselector
|
||||
.label=${'Items in Cart'}
|
||||
.description=${'Adjust the quantity of items'}
|
||||
.infoText=${'Adjust the quantity of items'}
|
||||
.value=${3}
|
||||
></dees-input-quantityselector>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Shopping Cart'} .subtitle=${'Modern e-commerce product cards with interactive quantity selectors'} .runAfterRender=${async (elementArg: HTMLElement) => {
|
||||
@@ -177,21 +172,21 @@ export const demoFunc = () => html`
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Required & Disabled States'} .subtitle=${'Different states for validation and restrictions'}>
|
||||
<div class="input-group">
|
||||
<dees-form>
|
||||
<dees-input-quantityselector
|
||||
.label=${'Number of Licenses'}
|
||||
.description=${'Select how many licenses you need'}
|
||||
.infoText=${'Select how many licenses you need'}
|
||||
.required=${true}
|
||||
.value=${1}
|
||||
></dees-input-quantityselector>
|
||||
|
||||
<dees-input-quantityselector
|
||||
.label=${'Fixed Quantity'}
|
||||
.description=${'This quantity cannot be changed'}
|
||||
.infoText=${'This quantity cannot be changed'}
|
||||
.disabled=${true}
|
||||
.value=${5}
|
||||
></dees-input-quantityselector>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Order Form'} .subtitle=${'Complete order form with quantity selection'}>
|
||||
@@ -204,7 +199,7 @@ export const demoFunc = () => html`
|
||||
></dees-input-dropdown>
|
||||
<dees-input-quantityselector
|
||||
.label=${'Quantity'}
|
||||
.description=${'Number of licenses'}
|
||||
.infoText=${'Number of licenses'}
|
||||
.value=${1}
|
||||
></dees-input-quantityselector>
|
||||
<dees-input-text
|
||||
|
||||
+2
-1
@@ -129,7 +129,7 @@ export class DeesInputQuantitySelector extends DeesInputBase<DeesInputQuantitySe
|
||||
public render(): TemplateResult {
|
||||
return html`
|
||||
<div class="input-wrapper">
|
||||
${this.label ? html`<dees-label .label=${this.label} .description=${this.description} .required=${this.required}></dees-label>` : ''}
|
||||
${this.label ? html`<dees-label .label=${this.label} .infoText=${this.infoText} .required=${this.required}></dees-label>` : ''}
|
||||
<div
|
||||
class="quantity-container ${this.disabled ? 'disabled' : ''}"
|
||||
data-min="${this.value <= 0}"
|
||||
@@ -162,6 +162,7 @@ export class DeesInputQuantitySelector extends DeesInputBase<DeesInputQuantitySe
|
||||
aria-label="Increase quantity"
|
||||
>+</div>
|
||||
</div>
|
||||
${this.renderDescription()}
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
|
||||
@@ -23,12 +23,6 @@ export const demoFunc = () => html`
|
||||
margin-bottom: 0;
|
||||
}
|
||||
|
||||
.input-group {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 16px;
|
||||
}
|
||||
|
||||
.demo-grid {
|
||||
display: grid;
|
||||
grid-template-columns: repeat(auto-fit, minmax(300px, 1fr));
|
||||
@@ -48,6 +42,7 @@ export const demoFunc = () => html`
|
||||
|
||||
<div class="demo-container">
|
||||
<dees-panel .title=${'1. Basic Radio Groups'} .subtitle=${'Simple string options for common use cases'}>
|
||||
<dees-form>
|
||||
<div class="demo-grid">
|
||||
<dees-input-radiogroup
|
||||
.label=${'Subscription Plan'}
|
||||
@@ -63,10 +58,11 @@ export const demoFunc = () => html`
|
||||
.required=${true}
|
||||
></dees-input-radiogroup>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'2. Horizontal Layout'} .subtitle=${'Radio groups with horizontal arrangement'}>
|
||||
<div class="input-group">
|
||||
<dees-form>
|
||||
<dees-input-radiogroup
|
||||
.label=${'Do you agree with the terms?'}
|
||||
.options=${['Yes', 'No', 'Maybe']}
|
||||
@@ -81,7 +77,7 @@ export const demoFunc = () => html`
|
||||
.selectedOption=${'Intermediate'}
|
||||
.description=${'Select your experience level with web development'}
|
||||
></dees-input-radiogroup>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'3. Advanced Options'} .subtitle=${'Using object format with keys and payloads'}>
|
||||
@@ -106,6 +102,7 @@ export const demoFunc = () => html`
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'4. Survey Example'} .subtitle=${'Multiple radio groups for surveys and forms'}>
|
||||
<dees-form>
|
||||
<div class="demo-grid">
|
||||
<dees-input-radiogroup
|
||||
.label=${'How satisfied are you?'}
|
||||
@@ -119,9 +116,11 @@ export const demoFunc = () => html`
|
||||
.selectedOption=${'Probably'}
|
||||
></dees-input-radiogroup>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'5. States & Validation'} .subtitle=${'Different states and validation examples'}>
|
||||
<dees-form>
|
||||
<div class="demo-grid">
|
||||
<dees-input-radiogroup
|
||||
.label=${'Required Selection'}
|
||||
@@ -137,10 +136,11 @@ export const demoFunc = () => html`
|
||||
.disabled=${true}
|
||||
></dees-input-radiogroup>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'6. Settings Example'} .subtitle=${'Common patterns in application settings'}>
|
||||
<div class="input-group">
|
||||
<dees-form>
|
||||
<dees-input-radiogroup
|
||||
.label=${'Theme Preference'}
|
||||
.options=${[
|
||||
@@ -165,7 +165,7 @@ export const demoFunc = () => html`
|
||||
.selectedOption=${'English'}
|
||||
.direction=${'horizontal'}
|
||||
></dees-input-radiogroup>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'7. Form Integration'} .subtitle=${'Works seamlessly with dees-form'}>
|
||||
|
||||
@@ -189,14 +189,6 @@ export class DeesInputRadiogroup extends DeesInputBase<string | object> {
|
||||
line-height: 20px;
|
||||
}
|
||||
|
||||
.description-text {
|
||||
font-size: 13px;
|
||||
color: ${cssManager.bdTheme('hsl(215.4 16.3% 56.9%)', 'hsl(215 20.2% 55.1%)')};
|
||||
margin-top: 10px;
|
||||
line-height: 1.5;
|
||||
letter-spacing: -0.003em;
|
||||
}
|
||||
|
||||
/* Validation styles */
|
||||
:host([validationState="invalid"]) .radio-circle {
|
||||
border-color: ${cssManager.bdTheme('hsl(0 72.2% 50.6%)', 'hsl(0 62.8% 30.6%)')};
|
||||
@@ -256,7 +248,7 @@ export class DeesInputRadiogroup extends DeesInputBase<string | object> {
|
||||
`;
|
||||
})}
|
||||
</div>
|
||||
${this.description ? html`<div class="description-text">${this.description}</div>` : ''}
|
||||
${this.renderDescription()}
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
|
||||
@@ -1,7 +1,9 @@
|
||||
import { css, cssManager } from '@design.estate/dees-element';
|
||||
import { DeesInputBase } from '../dees-input-base/dees-input-base.js';
|
||||
import { themeDefaultStyles } from '../../00theme.js';
|
||||
|
||||
export const richtextStyles = [
|
||||
themeDefaultStyles,
|
||||
...DeesInputBase.baseStyles,
|
||||
cssManager.defaultStyles,
|
||||
css`
|
||||
@@ -20,7 +22,7 @@ export const richtextStyles = [
|
||||
margin-bottom: 8px;
|
||||
font-size: 14px;
|
||||
font-weight: 500;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 93.9%)')};
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
dees-tile {
|
||||
@@ -28,7 +30,7 @@ export const richtextStyles = [
|
||||
}
|
||||
|
||||
dees-tile:hover::part(outer) {
|
||||
border-color: ${cssManager.bdTheme('hsl(0 0% 79.8%)', 'hsl(0 0% 20.9%)')};
|
||||
border-color: var(--dees-color-border-strong);
|
||||
}
|
||||
|
||||
dees-tile.focused::part(outer) {
|
||||
@@ -68,8 +70,8 @@ export const richtextStyles = [
|
||||
}
|
||||
|
||||
.toolbar-button:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95.1%)', 'hsl(0 0% 14.9%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 9%)', 'hsl(0 0% 95%)')};
|
||||
background: var(--dees-color-hover);
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
.toolbar-button.active {
|
||||
@@ -85,7 +87,7 @@ export const richtextStyles = [
|
||||
.toolbar-divider {
|
||||
width: 1px;
|
||||
height: 24px;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
background: var(--dees-color-border-default);
|
||||
margin: 0 4px;
|
||||
}
|
||||
|
||||
@@ -99,7 +101,7 @@ export const richtextStyles = [
|
||||
.editor-content .ProseMirror {
|
||||
outline: none;
|
||||
line-height: 1.6;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 3.9%)', 'hsl(0 0% 98%)')};
|
||||
color: var(--dees-color-text-primary);
|
||||
min-height: 100%;
|
||||
white-space: pre-wrap;
|
||||
word-wrap: break-word;
|
||||
@@ -149,7 +151,7 @@ export const richtextStyles = [
|
||||
}
|
||||
|
||||
.editor-content .ProseMirror blockquote {
|
||||
border-left: 4px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border-left: 4px solid var(--dees-color-border-default);
|
||||
margin: 1em 0;
|
||||
padding-left: 1em;
|
||||
color: ${cssManager.bdTheme('hsl(215.4 16.3% 46.9%)', 'hsl(215 20.2% 65.1%)')};
|
||||
@@ -157,12 +159,12 @@ export const richtextStyles = [
|
||||
}
|
||||
|
||||
.editor-content .ProseMirror code {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95.1%)', 'hsl(0 0% 14.9%)')};
|
||||
background: var(--dees-color-bg-tertiary);
|
||||
border-radius: 3px;
|
||||
padding: 0.2em 0.4em;
|
||||
font-family: 'Intel One Mono', 'Fira Code', 'SF Mono', Monaco, 'Cascadia Code', 'Roboto Mono', Consolas, 'Courier New', monospace;
|
||||
font-size: 0.9em;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 93.9%)')};
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
.editor-content .ProseMirror pre {
|
||||
@@ -195,7 +197,7 @@ export const richtextStyles = [
|
||||
padding: 0 12px;
|
||||
height: 28px;
|
||||
font-size: 11px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45%)', 'hsl(0 0% 55%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
display: flex;
|
||||
justify-content: space-between;
|
||||
align-items: center;
|
||||
@@ -213,8 +215,8 @@ export const richtextStyles = [
|
||||
top: 100%;
|
||||
left: 0;
|
||||
right: 0;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 9%)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
background: var(--dees-color-bg-primary);
|
||||
border: 1px solid var(--dees-color-border-default);
|
||||
border-radius: 6px;
|
||||
box-shadow: 0 4px 6px -1px rgba(0, 0, 0, 0.1);
|
||||
padding: 12px;
|
||||
@@ -228,12 +230,12 @@ export const richtextStyles = [
|
||||
.link-input input {
|
||||
width: 100%;
|
||||
padding: 8px 12px;
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border: 1px solid var(--dees-color-border-default);
|
||||
border-radius: 6px;
|
||||
outline: none;
|
||||
font-size: 14px;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 9%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 3.9%)', 'hsl(0 0% 98%)')};
|
||||
background: var(--dees-color-bg-primary);
|
||||
color: var(--dees-color-text-primary);
|
||||
transition: all 0.2s cubic-bezier(0.4, 0, 0.2, 1);
|
||||
}
|
||||
|
||||
@@ -250,19 +252,19 @@ export const richtextStyles = [
|
||||
|
||||
.link-input-buttons button {
|
||||
padding: 6px 12px;
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border: 1px solid var(--dees-color-border-default);
|
||||
border-radius: 4px;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 9%)')};
|
||||
background: var(--dees-color-bg-primary);
|
||||
cursor: pointer;
|
||||
font-size: 12px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
transition: all 0.15s ease;
|
||||
font-weight: 500;
|
||||
}
|
||||
|
||||
.link-input-buttons button:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95.1%)', 'hsl(0 0% 14.9%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 9%)', 'hsl(0 0% 95%)')};
|
||||
background: var(--dees-color-hover);
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
.link-input-buttons button.primary {
|
||||
@@ -276,13 +278,6 @@ export const richtextStyles = [
|
||||
border-color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 93.9%)')};
|
||||
}
|
||||
|
||||
.description {
|
||||
margin-top: 8px;
|
||||
font-size: 12px;
|
||||
color: ${cssManager.bdTheme('hsl(215.4 16.3% 46.9%)', 'hsl(215 20.2% 65.1%)')};
|
||||
line-height: 1.4;
|
||||
}
|
||||
|
||||
:host([disabled]) dees-tile {
|
||||
opacity: 0.6;
|
||||
cursor: not-allowed;
|
||||
|
||||
@@ -26,7 +26,7 @@ export const renderRichtext = (component: DeesInputRichtext): TemplateResult =>
|
||||
`
|
||||
: ''}
|
||||
</dees-tile>
|
||||
${component.description ? html`<div class="description">${component.description}</div>` : ''}
|
||||
${component.renderDescription()}
|
||||
</div>
|
||||
`;
|
||||
|
||||
|
||||
@@ -115,6 +115,7 @@ export const demoFunc = () => html`
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'3. Limited Tags'} .subtitle=${'Restrict the number of tags users can add'}>
|
||||
<dees-form>
|
||||
<div class="grid-layout">
|
||||
<dees-input-tags
|
||||
.label=${'Top 3 Skills'}
|
||||
@@ -133,6 +134,7 @@ export const demoFunc = () => html`
|
||||
.description=${'Choose up to 5 categories'}
|
||||
></dees-input-tags>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'4. Required & Validation'} .subtitle=${'Tags input with validation requirements'}>
|
||||
|
||||
@@ -210,14 +210,6 @@ export class DeesInputTags extends DeesInputBase<DeesInputTags> {
|
||||
line-height: 1.5;
|
||||
}
|
||||
|
||||
/* Description styles */
|
||||
.description {
|
||||
color: ${cssManager.bdTheme('hsl(215.4 16.3% 56.9%)', 'hsl(215 20.2% 55.1%)')};
|
||||
font-size: 13px;
|
||||
margin-top: 6px;
|
||||
line-height: 1.5;
|
||||
}
|
||||
|
||||
/* Scrollbar styling */
|
||||
.suggestions-dropdown::-webkit-scrollbar {
|
||||
width: 8px;
|
||||
@@ -302,9 +294,7 @@ export class DeesInputTags extends DeesInputBase<DeesInputTags> {
|
||||
<div class="validation-message">${this.validationText}</div>
|
||||
` : ''}
|
||||
|
||||
${this.description ? html`
|
||||
<div class="description">${this.description}</div>
|
||||
` : ''}
|
||||
${this.renderDescription()}
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
|
||||
@@ -30,12 +30,6 @@ export const demoFunc = () => html`
|
||||
flex-wrap: wrap;
|
||||
}
|
||||
|
||||
.input-group {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 16px;
|
||||
}
|
||||
|
||||
.grid-layout {
|
||||
display: grid;
|
||||
grid-template-columns: 1fr 1fr;
|
||||
@@ -89,17 +83,18 @@ export const demoFunc = () => html`
|
||||
}
|
||||
}}>
|
||||
<dees-panel .title=${'Basic Text Inputs'} .subtitle=${'Standard text inputs with labels and descriptions'}>
|
||||
<div class="input-group">
|
||||
<dees-form>
|
||||
<dees-input-text
|
||||
.label=${'Username'}
|
||||
.value=${'johndoe'}
|
||||
.key=${'username'}
|
||||
.description=${'Your username will be visible to other users'}
|
||||
></dees-input-text>
|
||||
|
||||
<dees-input-text
|
||||
.label=${'Email Address'}
|
||||
.value=${'john@example.com'}
|
||||
.description=${'We will never share your email with anyone'}
|
||||
.infoText=${'We will never share your email with anyone'}
|
||||
.key=${'email'}
|
||||
></dees-input-text>
|
||||
|
||||
@@ -109,7 +104,7 @@ export const demoFunc = () => html`
|
||||
.value=${'secret123'}
|
||||
.key=${'password'}
|
||||
></dees-input-text>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
</dees-demowrapper>
|
||||
|
||||
@@ -139,6 +134,7 @@ export const demoFunc = () => html`
|
||||
}
|
||||
}}>
|
||||
<dees-panel .title=${'Horizontal Layout'} .subtitle=${'Multiple inputs arranged horizontally for compact forms'}>
|
||||
<dees-form>
|
||||
<div class="horizontal-group">
|
||||
<dees-input-text
|
||||
.label=${'First Name'}
|
||||
@@ -161,6 +157,7 @@ export const demoFunc = () => html`
|
||||
.key=${'age'}
|
||||
></dees-input-text>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
</dees-demowrapper>
|
||||
|
||||
@@ -180,7 +177,7 @@ export const demoFunc = () => html`
|
||||
}
|
||||
}}>
|
||||
<dees-panel .title=${'Label Positions'} .subtitle=${'Different label positioning options for various layouts'}>
|
||||
<div class="input-group">
|
||||
<dees-form>
|
||||
<dees-input-text
|
||||
.label=${'Label on Top (Default)'}
|
||||
.value=${'Standard layout'}
|
||||
@@ -206,45 +203,13 @@ export const demoFunc = () => html`
|
||||
.labelPosition=${'left'}
|
||||
></dees-input-text>
|
||||
</div>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
</dees-demowrapper>
|
||||
|
||||
<dees-demowrapper .runAfterRender=${async (elementArg: HTMLElement) => {
|
||||
// Demonstrate validation states
|
||||
const requiredInput = elementArg.querySelector('dees-input-text[required]') as DeesInputText;
|
||||
const disabledInput = elementArg.querySelector('dees-input-text[disabled]') as DeesInputText;
|
||||
const errorInput = elementArg.querySelector('dees-input-text[validationState="invalid"]') as DeesInputText;
|
||||
|
||||
if (requiredInput) {
|
||||
// Show validation on blur for empty required field
|
||||
requiredInput.addEventListener('blur', () => {
|
||||
if (!requiredInput.getValue()) {
|
||||
console.log('Required field is empty!');
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
if (disabledInput) {
|
||||
console.log('Disabled input cannot be edited');
|
||||
}
|
||||
|
||||
if (errorInput) {
|
||||
console.log('Error input shows validation message:', errorInput.validationText);
|
||||
|
||||
// Simulate fixing the error
|
||||
errorInput.addEventListener('changeSubject', () => {
|
||||
const value = errorInput.getValue();
|
||||
if (value.includes('@') && value.includes('.')) {
|
||||
errorInput.validationState = 'valid';
|
||||
errorInput.validationText = '';
|
||||
console.log('Email validation passed!');
|
||||
}
|
||||
});
|
||||
}
|
||||
}}>
|
||||
<dees-demowrapper>
|
||||
<dees-panel .title=${'Validation & States'} .subtitle=${'Different validation states and input configurations'}>
|
||||
<div class="input-group">
|
||||
<dees-form>
|
||||
<dees-input-text
|
||||
.label=${'Required Field'}
|
||||
.required=${true}
|
||||
@@ -258,12 +223,17 @@ export const demoFunc = () => html`
|
||||
></dees-input-text>
|
||||
|
||||
<dees-input-text
|
||||
.label=${'Field with Error'}
|
||||
.label=${'Email with Validation'}
|
||||
.value=${'invalid@'}
|
||||
.validationText=${'Please enter a valid email address'}
|
||||
.validationState=${'invalid'}
|
||||
.validationFunction=${(value: string) => {
|
||||
const emailRegex = /^[^\s@]+@[^\s@]+\.[^\s@]+$/;
|
||||
if (emailRegex.test(value)) {
|
||||
return { valid: true, message: 'Email address is valid' };
|
||||
}
|
||||
return { valid: false, message: 'Please enter a valid email address' };
|
||||
}}
|
||||
></dees-input-text>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
</dees-demowrapper>
|
||||
|
||||
@@ -292,54 +262,35 @@ export const demoFunc = () => html`
|
||||
});
|
||||
}}>
|
||||
<dees-panel .title=${'Advanced Features'} .subtitle=${'Password visibility toggle and other advanced features'}>
|
||||
<div class="input-group">
|
||||
<dees-form>
|
||||
<dees-input-text
|
||||
.label=${'Password with Toggle'}
|
||||
.isPasswordBool=${true}
|
||||
.value=${'mySecurePassword123'}
|
||||
.description=${'Click the eye icon to show/hide password'}
|
||||
.infoText=${'Click the eye icon to show/hide password'}
|
||||
></dees-input-text>
|
||||
|
||||
<dees-input-text
|
||||
.label=${'API Key'}
|
||||
.isPasswordBool=${true}
|
||||
.value=${'sk-1234567890abcdef'}
|
||||
.description=${'Keep this key secure and never share it'}
|
||||
.infoText=${'Keep this key secure and never share it'}
|
||||
></dees-input-text>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
</dees-demowrapper>
|
||||
|
||||
<dees-demowrapper .runAfterRender=${async (elementArg: HTMLElement) => {
|
||||
// Set up interactive example
|
||||
const dynamicInput = elementArg.querySelector('dees-input-text');
|
||||
const dynamicInput = elementArg.querySelector('dees-input-text') as DeesInputText;
|
||||
const output = elementArg.querySelector('#text-input-output');
|
||||
|
||||
if (dynamicInput && output) {
|
||||
// Update output on every change
|
||||
dynamicInput.addEventListener('changeSubject', ((event: CustomEvent) => {
|
||||
const value = (event.detail as DeesInputText).getValue();
|
||||
output.textContent = `Current value: "${value}"`;
|
||||
}) as EventListener);
|
||||
|
||||
// Also track focus/blur events
|
||||
dynamicInput.addEventListener('focus', () => {
|
||||
console.log('Input focused');
|
||||
});
|
||||
|
||||
dynamicInput.addEventListener('blur', () => {
|
||||
console.log('Input blurred');
|
||||
});
|
||||
|
||||
// Track keypress events
|
||||
let keypressCount = 0;
|
||||
dynamicInput.addEventListener('keydown', () => {
|
||||
keypressCount++;
|
||||
console.log(`Keypress count: ${keypressCount}`);
|
||||
dynamicInput.changeSubject.subscribe(() => {
|
||||
output.textContent = `Current value: "${dynamicInput.getValue()}"`;
|
||||
});
|
||||
}
|
||||
}}>
|
||||
<dees-panel .title=${'Interactive Example'} .subtitle=${'Try typing in the inputs to see real-time value changes'}>
|
||||
<dees-panel .title=${'Interactive Example'} .subtitle=${'Try typing in the input to see real-time value changes'}>
|
||||
<dees-input-text
|
||||
.label=${'Dynamic Input'}
|
||||
.placeholder=${'Type something here...'}
|
||||
|
||||
@@ -7,11 +7,13 @@ import {
|
||||
customElement,
|
||||
type TemplateResult,
|
||||
property,
|
||||
state,
|
||||
html,
|
||||
cssManager,
|
||||
css,
|
||||
} from '@design.estate/dees-element';
|
||||
import { themeDefaultStyles } from '../../00theme.js';
|
||||
import '../../00group-overlay/dees-contextmenu/dees-contextmenu.js';
|
||||
|
||||
declare global {
|
||||
interface HTMLElementTagNameMap {
|
||||
@@ -44,7 +46,7 @@ export class DeesInputText extends DeesInputBase {
|
||||
accessor showPasswordBool = false;
|
||||
|
||||
@property({
|
||||
type: Boolean,
|
||||
type: String,
|
||||
reflect: true,
|
||||
})
|
||||
accessor validationState!: 'valid' | 'warn' | 'invalid';
|
||||
@@ -54,8 +56,19 @@ export class DeesInputText extends DeesInputBase {
|
||||
})
|
||||
accessor validationText: string = '';
|
||||
|
||||
@property({})
|
||||
accessor validationFunction!: (value: string) => boolean;
|
||||
@property({ attribute: false })
|
||||
accessor validationFunction!: (value: string) => { valid: boolean; message?: string };
|
||||
|
||||
@property({
|
||||
type: Boolean,
|
||||
reflect: true,
|
||||
})
|
||||
accessor vintegrated: boolean = false;
|
||||
|
||||
@property({ attribute: false })
|
||||
accessor validConfirmed: boolean = false;
|
||||
|
||||
private validTimeout: ReturnType<typeof setTimeout> | undefined;
|
||||
|
||||
public static styles = [
|
||||
themeDefaultStyles,
|
||||
@@ -121,7 +134,7 @@ export class DeesInputText extends DeesInputBase {
|
||||
.showPassword {
|
||||
position: absolute;
|
||||
right: 1px;
|
||||
top: 50%;
|
||||
top: 20px;
|
||||
transform: translateY(-50%);
|
||||
display: flex;
|
||||
align-items: center;
|
||||
@@ -139,6 +152,29 @@ export class DeesInputText extends DeesInputBase {
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 93.9%)')};
|
||||
}
|
||||
|
||||
/* Valid checkmark icon */
|
||||
.validIcon {
|
||||
position: absolute;
|
||||
right: 10px;
|
||||
top: 20px;
|
||||
transform: translateY(-50%);
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: center;
|
||||
opacity: 0;
|
||||
transition: opacity 0.2s ease;
|
||||
pointer-events: none;
|
||||
color: ${cssManager.bdTheme('hsl(142.1 76.2% 36.3%)', 'hsl(142.1 70.6% 45.3%)')};
|
||||
}
|
||||
|
||||
.validIcon.show {
|
||||
opacity: 1;
|
||||
}
|
||||
|
||||
.validIcon dees-icon {
|
||||
font-size: 18px;
|
||||
}
|
||||
|
||||
/* Validation styles */
|
||||
.validationContainer {
|
||||
margin-top: 4px;
|
||||
@@ -150,7 +186,7 @@ export class DeesInputText extends DeesInputBase {
|
||||
overflow: hidden;
|
||||
}
|
||||
|
||||
.validationContainer.error {
|
||||
.validationContainer.invalid {
|
||||
background: ${cssManager.bdTheme('hsl(0 84.2% 60.2% / 0.1)', 'hsl(0 72.2% 50.6% / 0.1)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 84.2% 60.2%)', 'hsl(0 72.2% 50.6%)')};
|
||||
}
|
||||
@@ -166,34 +202,64 @@ export class DeesInputText extends DeesInputBase {
|
||||
}
|
||||
|
||||
/* Error state for input */
|
||||
:host([validation-state="invalid"]) input {
|
||||
:host([validationstate="invalid"]) input {
|
||||
border-color: ${cssManager.bdTheme('hsl(0 84.2% 60.2%)', 'hsl(0 72.2% 50.6%)')};
|
||||
}
|
||||
|
||||
:host([validation-state="invalid"]) input:focus {
|
||||
:host([validationstate="invalid"]) input:focus {
|
||||
border-color: ${cssManager.bdTheme('hsl(0 84.2% 60.2%)', 'hsl(0 72.2% 50.6%)')};
|
||||
box-shadow: 0 0 0 2px ${cssManager.bdTheme('hsl(0 84.2% 60.2% / 0.05)', 'hsl(0 72.2% 50.6% / 0.05)')};
|
||||
}
|
||||
|
||||
/* Warning state for input */
|
||||
:host([validation-state="warn"]) input {
|
||||
:host([validationstate="warn"]) input {
|
||||
border-color: ${cssManager.bdTheme('hsl(25 95% 53%)', 'hsl(25 95% 63%)')};
|
||||
}
|
||||
|
||||
:host([validation-state="warn"]) input:focus {
|
||||
:host([validationstate="warn"]) input:focus {
|
||||
border-color: ${cssManager.bdTheme('hsl(25 95% 53%)', 'hsl(25 95% 63%)')};
|
||||
box-shadow: 0 0 0 2px ${cssManager.bdTheme('hsl(25 95% 53% / 0.05)', 'hsl(25 95% 63% / 0.05)')};
|
||||
}
|
||||
|
||||
/* Valid state for input */
|
||||
:host([validation-state="valid"]) input {
|
||||
:host([validationstate="valid"]) input {
|
||||
border-color: ${cssManager.bdTheme('hsl(142.1 76.2% 36.3%)', 'hsl(142.1 70.6% 45.3%)')};
|
||||
}
|
||||
|
||||
:host([validation-state="valid"]) input:focus {
|
||||
:host([validationstate="valid"]) input:focus {
|
||||
border-color: ${cssManager.bdTheme('hsl(142.1 76.2% 36.3%)', 'hsl(142.1 70.6% 45.3%)')};
|
||||
box-shadow: 0 0 0 2px ${cssManager.bdTheme('hsl(142.1 76.2% 36.3% / 0.05)', 'hsl(142.1 70.6% 45.3% / 0.05)')};
|
||||
}
|
||||
|
||||
/* Visually integrated mode: shed chrome to blend into a host component
|
||||
(e.g. a dees-table cell in edit mode). */
|
||||
:host([vintegrated]) dees-label,
|
||||
:host([vintegrated]) .validationContainer {
|
||||
display: none;
|
||||
}
|
||||
:host([vintegrated]) .maincontainer {
|
||||
height: 40px;
|
||||
}
|
||||
:host([vintegrated]) input {
|
||||
height: 40px;
|
||||
line-height: 24px;
|
||||
padding: 0 16px;
|
||||
font-size: 13px;
|
||||
border: none;
|
||||
border-radius: 0;
|
||||
background: transparent;
|
||||
box-shadow: none;
|
||||
transition: none;
|
||||
}
|
||||
:host([vintegrated]) input:hover:not(:disabled):not(:focus),
|
||||
:host([vintegrated]) input:focus {
|
||||
border: none;
|
||||
box-shadow: none;
|
||||
background: transparent;
|
||||
}
|
||||
:host([vintegrated]) .showPassword {
|
||||
display: none;
|
||||
}
|
||||
`,
|
||||
];
|
||||
|
||||
@@ -203,9 +269,9 @@ export class DeesInputText extends DeesInputBase {
|
||||
input {
|
||||
font-family: ${this.isPasswordBool ? cssMonoFontFamily : 'inherit'};
|
||||
letter-spacing: ${this.isPasswordBool ? '0.5px' : 'normal'};
|
||||
padding-right: ${this.isPasswordBool ? '48px' : '12px'};
|
||||
padding-right: ${this.isPasswordBool ? '48px' : this.validConfirmed ? '40px' : '12px'};
|
||||
}
|
||||
${this.validationText
|
||||
${this.validationText && !this.validConfirmed
|
||||
? css`
|
||||
.validationContainer {
|
||||
height: auto;
|
||||
@@ -223,7 +289,7 @@ export class DeesInputText extends DeesInputBase {
|
||||
`}
|
||||
</style>
|
||||
<div class="input-wrapper">
|
||||
<dees-label .label=${this.label} .description=${this.description} .required=${this.required}></dees-label>
|
||||
<dees-label .label=${this.label} .infoText=${this.infoText} .required=${this.required}></dees-label>
|
||||
<div class="maincontainer">
|
||||
<input
|
||||
type="${this.isPasswordBool && !this.showPasswordBool ? 'password' : 'text'}"
|
||||
@@ -239,28 +305,114 @@ export class DeesInputText extends DeesInputBase {
|
||||
</div>
|
||||
`
|
||||
: html``}
|
||||
<div class="validIcon ${this.validConfirmed ? 'show' : ''}">
|
||||
<dees-icon .icon=${'lucide:Check'}></dees-icon>
|
||||
</div>
|
||||
${this.validationText
|
||||
? html`
|
||||
<div class="validationContainer ${this.validationState || 'error'}">
|
||||
<div class="validationContainer ${this.validationState || 'invalid'}">
|
||||
${this.validationText}
|
||||
</div>
|
||||
`
|
||||
: html`<div class="validationContainer"></div>`}
|
||||
${this.renderDescription()}
|
||||
</div>
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
|
||||
firstUpdated() {
|
||||
// Input event handling is already done in updateValue method
|
||||
if (this.validationFunction && this.value) {
|
||||
const result = this.validationFunction(this.value);
|
||||
this.validationState = result.valid ? 'valid' : 'invalid';
|
||||
this.validationText = result.message || '';
|
||||
if (result.valid) {
|
||||
this.validConfirmed = false;
|
||||
this.validTimeout = setTimeout(() => {
|
||||
this.validConfirmed = true;
|
||||
this.validationState = undefined as any;
|
||||
}, 500);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
public async updateValue(eventArg: Event) {
|
||||
const target: any = eventArg.target;
|
||||
this.value = target.value;
|
||||
if (this.validationFunction) {
|
||||
const result = this.validationFunction(this.value);
|
||||
this.validationState = result.valid ? 'valid' : 'invalid';
|
||||
this.validationText = result.message || '';
|
||||
if (result.valid) {
|
||||
this.validConfirmed = false;
|
||||
clearTimeout(this.validTimeout);
|
||||
this.validTimeout = setTimeout(() => {
|
||||
this.validConfirmed = true;
|
||||
this.validationState = undefined as any;
|
||||
}, 500);
|
||||
} else {
|
||||
clearTimeout(this.validTimeout);
|
||||
this.validConfirmed = false;
|
||||
}
|
||||
}
|
||||
this.changeSubject.next(this);
|
||||
}
|
||||
|
||||
public getContextMenuItems() {
|
||||
const input = this.shadowRoot!.querySelector('input')!;
|
||||
const hasSelection = input.selectionStart !== input.selectionEnd;
|
||||
return [
|
||||
{
|
||||
name: 'Cut',
|
||||
iconName: 'lucide:Scissors',
|
||||
shortcut: 'Cmd+X',
|
||||
disabled: !hasSelection,
|
||||
action: async () => {
|
||||
const selected = this.value.substring(input.selectionStart!, input.selectionEnd!);
|
||||
await navigator.clipboard.writeText(selected);
|
||||
const start = input.selectionStart!;
|
||||
this.value = this.value.substring(0, start) + this.value.substring(input.selectionEnd!);
|
||||
input.value = this.value;
|
||||
input.setSelectionRange(start, start);
|
||||
this.changeSubject.next(this);
|
||||
},
|
||||
},
|
||||
{
|
||||
name: 'Copy',
|
||||
iconName: 'lucide:Copy',
|
||||
shortcut: 'Cmd+C',
|
||||
disabled: !hasSelection,
|
||||
action: async () => {
|
||||
const selected = this.value.substring(input.selectionStart!, input.selectionEnd!);
|
||||
await navigator.clipboard.writeText(selected);
|
||||
},
|
||||
},
|
||||
{
|
||||
name: 'Paste',
|
||||
iconName: 'lucide:ClipboardPaste',
|
||||
shortcut: 'Cmd+V',
|
||||
action: async () => {
|
||||
const text = await navigator.clipboard.readText();
|
||||
const start = input.selectionStart!;
|
||||
const end = input.selectionEnd!;
|
||||
this.value = this.value.substring(0, start) + text + this.value.substring(end);
|
||||
input.value = this.value;
|
||||
input.setSelectionRange(start + text.length, start + text.length);
|
||||
this.changeSubject.next(this);
|
||||
},
|
||||
},
|
||||
{ divider: true },
|
||||
{
|
||||
name: 'Select All',
|
||||
iconName: 'lucide:TextCursorInput',
|
||||
shortcut: 'Cmd+A',
|
||||
action: async () => {
|
||||
input.select();
|
||||
},
|
||||
},
|
||||
];
|
||||
}
|
||||
|
||||
public getValue(): string {
|
||||
return this.value;
|
||||
}
|
||||
|
||||
@@ -116,7 +116,7 @@ export const demoFunc = () => html`
|
||||
|
||||
<div class="demo-container">
|
||||
<dees-panel .title=${'Basic Toggle'} .subtitle=${'Simple on/off toggle switch with drag support'}>
|
||||
<div class="toggle-group">
|
||||
<dees-form>
|
||||
<dees-input-toggle
|
||||
.label=${'Enable feature'}
|
||||
.value=${false}
|
||||
@@ -135,12 +135,12 @@ export const demoFunc = () => html`
|
||||
.description=${'This toggle has additional helper text explaining its purpose'}
|
||||
.key=${'withDesc'}
|
||||
></dees-input-toggle>
|
||||
</div>
|
||||
</dees-form>
|
||||
<p class="drag-hint">Tip: You can drag the toggle knob to switch states</p>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Toggle States'} .subtitle=${'Different toggle states and configurations'}>
|
||||
<div class="toggle-group">
|
||||
<dees-form>
|
||||
<dees-input-toggle
|
||||
.label=${'Default (off)'}
|
||||
.value=${false}
|
||||
@@ -169,10 +169,11 @@ export const demoFunc = () => html`
|
||||
.required=${true}
|
||||
.description=${'This toggle cannot be turned off'}
|
||||
></dees-input-toggle>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Horizontal Layout'} .subtitle=${'Toggles arranged horizontally for compact interfaces'}>
|
||||
<dees-form>
|
||||
<div class="horizontal-toggles">
|
||||
<dees-input-toggle
|
||||
.label=${'WiFi'}
|
||||
@@ -198,13 +199,14 @@ export const demoFunc = () => html`
|
||||
.layoutMode=${'horizontal'}
|
||||
></dees-input-toggle>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Settings Example'} .subtitle=${'Toggles in a typical settings context'}>
|
||||
<div class="settings-section">
|
||||
<h4 class="section-title">Notification Settings</h4>
|
||||
|
||||
<div class="toggle-group">
|
||||
<dees-form>
|
||||
<dees-input-toggle
|
||||
.label=${'Push notifications'}
|
||||
.value=${true}
|
||||
@@ -232,7 +234,7 @@ export const demoFunc = () => html`
|
||||
.description=${'Vibrate for notifications'}
|
||||
.key=${'vibration'}
|
||||
></dees-input-toggle>
|
||||
</div>
|
||||
</dees-form>
|
||||
</div>
|
||||
</dees-panel>
|
||||
|
||||
@@ -243,7 +245,7 @@ export const demoFunc = () => html`
|
||||
</div>
|
||||
|
||||
<div class="feature-toggles">
|
||||
<div class="toggle-group">
|
||||
<dees-form>
|
||||
<dees-input-toggle
|
||||
.label=${'Dark Mode'}
|
||||
.value=${true}
|
||||
@@ -273,12 +275,12 @@ export const demoFunc = () => html`
|
||||
.value=${false}
|
||||
.key=${'beta'}
|
||||
></dees-input-toggle>
|
||||
</div>
|
||||
</dees-form>
|
||||
</div>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Interactive Example'} .subtitle=${'Toggle to see value changes in real-time'}>
|
||||
<div class="toggle-group">
|
||||
<dees-form>
|
||||
<dees-input-toggle
|
||||
.label=${'Airplane mode'}
|
||||
.value=${false}
|
||||
@@ -300,7 +302,7 @@ export const demoFunc = () => html`
|
||||
}
|
||||
}}
|
||||
></dees-input-toggle>
|
||||
</div>
|
||||
</dees-form>
|
||||
|
||||
<div class="interactive-section">
|
||||
<div id="airplane-output" class="output-text">Airplane mode: OFF</div>
|
||||
|
||||
@@ -170,12 +170,6 @@ export class DeesInputToggle extends DeesInputBase<DeesInputToggle> {
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 90%)')};
|
||||
}
|
||||
|
||||
/* Description */
|
||||
.description-text {
|
||||
font-size: 12px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
||||
line-height: 1.5;
|
||||
}
|
||||
`,
|
||||
];
|
||||
|
||||
@@ -199,7 +193,7 @@ export class DeesInputToggle extends DeesInputBase<DeesInputToggle> {
|
||||
</div>
|
||||
<div class="label-container">
|
||||
${this.label ? html`<div class="toggle-label">${this.label}</div>` : ''}
|
||||
${this.description ? html`<div class="description-text">${this.description}</div>` : ''}
|
||||
${this.renderDescription()}
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
|
||||
@@ -13,12 +13,6 @@ export const demoFunc = () => html`
|
||||
margin: 0 auto;
|
||||
}
|
||||
|
||||
.input-group {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 16px;
|
||||
}
|
||||
|
||||
.horizontal-group {
|
||||
display: flex;
|
||||
gap: 24px;
|
||||
@@ -45,26 +39,27 @@ export const demoFunc = () => html`
|
||||
|
||||
<div class="demo-container">
|
||||
<dees-panel .title=${'Basic Type List'} .subtitle=${'Add and remove items from a list'}>
|
||||
<div class="input-group">
|
||||
<dees-form>
|
||||
<dees-input-typelist
|
||||
.label=${'Tags'}
|
||||
.description=${'Add tags by typing and pressing Enter'}
|
||||
.infoText=${'Add tags by typing and pressing Enter'}
|
||||
.description=${'Tags help categorize and filter your content'}
|
||||
.value=${['javascript', 'typescript', 'web-components']}
|
||||
></dees-input-typelist>
|
||||
|
||||
<dees-input-typelist
|
||||
.label=${'Team Members'}
|
||||
.description=${'Add email addresses of team members'}
|
||||
.infoText=${'Add email addresses of team members'}
|
||||
.value=${['alice@example.com', 'bob@example.com']}
|
||||
></dees-input-typelist>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Skills & Keywords'} .subtitle=${'Manage lists of skills and keywords'}>
|
||||
<div class="input-group">
|
||||
<dees-form>
|
||||
<dees-input-typelist
|
||||
.label=${'Your Skills'}
|
||||
.description=${'List your professional skills'}
|
||||
.infoText=${'List your professional skills'}
|
||||
.value=${['HTML', 'CSS', 'JavaScript', 'Node.js', 'React']}
|
||||
></dees-input-typelist>
|
||||
|
||||
@@ -81,25 +76,25 @@ export const demoFunc = () => html`
|
||||
.value=${['innovation', 'startup', 'growth']}
|
||||
></dees-input-typelist>
|
||||
</div>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Required & Disabled States'} .subtitle=${'Different input states for validation'}>
|
||||
<div class="input-group">
|
||||
<dees-form>
|
||||
<dees-input-typelist
|
||||
.label=${'Project Dependencies'}
|
||||
.description=${'List all required npm packages'}
|
||||
.infoText=${'List all required npm packages'}
|
||||
.required=${true}
|
||||
.value=${['@design.estate/dees-element', '@design.estate/dees-domtools']}
|
||||
></dees-input-typelist>
|
||||
|
||||
<dees-input-typelist
|
||||
.label=${'System Tags'}
|
||||
.description=${'These tags are managed by the system'}
|
||||
.infoText=${'These tags are managed by the system'}
|
||||
.disabled=${true}
|
||||
.value=${['system', 'protected', 'readonly']}
|
||||
></dees-input-typelist>
|
||||
</div>
|
||||
</dees-form>
|
||||
</dees-panel>
|
||||
|
||||
<dees-panel .title=${'Article Publishing Form'} .subtitle=${'Complete form with tag management'}>
|
||||
@@ -108,16 +103,16 @@ export const demoFunc = () => html`
|
||||
<dees-input-text
|
||||
.label=${'Summary'}
|
||||
.inputType=${'textarea'}
|
||||
.description=${'Brief description of the article'}
|
||||
.infoText=${'Brief description of the article'}
|
||||
></dees-input-text>
|
||||
<dees-input-typelist
|
||||
.label=${'Tags'}
|
||||
.description=${'Add relevant tags for better discoverability'}
|
||||
.infoText=${'Add relevant tags for better discoverability'}
|
||||
.value=${['tutorial', 'web-development']}
|
||||
></dees-input-typelist>
|
||||
<dees-input-typelist
|
||||
.label=${'Co-Authors'}
|
||||
.description=${'Add email addresses of co-authors'}
|
||||
.infoText=${'Add email addresses of co-authors'}
|
||||
></dees-input-typelist>
|
||||
</dees-form>
|
||||
|
||||
|
||||
@@ -153,7 +153,7 @@ export class DeesInputTypelist extends DeesInputBase<DeesInputTypelist> {
|
||||
public render(): TemplateResult {
|
||||
return html`
|
||||
<div class="input-wrapper">
|
||||
<dees-label .label=${this.label} .description=${this.description}></dees-label>
|
||||
<dees-label .label=${this.label} .infoText=${this.infoText}></dees-label>
|
||||
<div class="mainbox">
|
||||
<div class="tags" @click=${() => {
|
||||
this.shadowRoot!.querySelector('input')!.focus();
|
||||
@@ -188,6 +188,7 @@ export class DeesInputTypelist extends DeesInputBase<DeesInputTypelist> {
|
||||
.disabled=${this.disabled}
|
||||
/>
|
||||
</div>
|
||||
${this.renderDescription()}
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
|
||||
@@ -292,7 +292,7 @@ export class DeesInputWysiwyg extends DeesInputBase<string> {
|
||||
return html`
|
||||
<dees-label
|
||||
.label="${this.label}"
|
||||
.description="${this.description}"
|
||||
.infoText="${this.infoText}"
|
||||
.required="${this.required}"
|
||||
></dees-label>
|
||||
<div class="wysiwyg-container">
|
||||
@@ -303,6 +303,7 @@ export class DeesInputWysiwyg extends DeesInputBase<string> {
|
||||
<!-- Blocks will be rendered programmatically -->
|
||||
</div>
|
||||
</div>
|
||||
${this.renderDescription()}
|
||||
`;
|
||||
}
|
||||
|
||||
|
||||
@@ -273,7 +273,7 @@ export class DeesInputProfilePicture extends DeesInputBase<DeesInputProfilePictu
|
||||
render(): TemplateResult {
|
||||
return html`
|
||||
<div class="input-wrapper">
|
||||
<dees-label .label=${this.label} .description=${this.description} .required=${this.required}></dees-label>
|
||||
<dees-label .label=${this.label} .infoText=${this.infoText} .required=${this.required}></dees-label>
|
||||
|
||||
<div
|
||||
class="profile-container"
|
||||
@@ -329,6 +329,7 @@ export class DeesInputProfilePicture extends DeesInputBase<DeesInputProfilePictu
|
||||
accept="${this.acceptedFormats.join(',')}"
|
||||
@change=${this.handleFileSelect}
|
||||
/>
|
||||
${this.renderDescription()}
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
|
||||
@@ -8,7 +8,9 @@ export function demoFunc() {
|
||||
<dees-heading level="4">This is a H4 heading</dees-heading>
|
||||
<dees-heading level="5">This is a H5 heading</dees-heading>
|
||||
<dees-heading level="6">This is a H6 heading</dees-heading>
|
||||
<dees-heading level="hr">This is an hr heading</dees-heading>
|
||||
<dees-heading level="hr-small">This is an hr small heading</dees-heading>
|
||||
<dees-heading level="hr">This is an hr heading (level="hr")</dees-heading>
|
||||
<dees-heading level="7">This is an hr heading (level="7")</dees-heading>
|
||||
<dees-heading level="hr-small">This is an hr-small heading (level="hr-small")</dees-heading>
|
||||
<dees-heading level="8">This is an hr-small heading (level="8")</dees-heading>
|
||||
`;
|
||||
}
|
||||
@@ -27,68 +27,104 @@ export class DeesHeading extends DeesElement {
|
||||
|
||||
// properties
|
||||
/**
|
||||
* Heading level: 1-6 for h1-h6, or 'hr' for horizontal rule style
|
||||
* Heading level:
|
||||
* '1'-'6' → <h1>..<h6>
|
||||
* '7'|'hr' → horizontal-rule style heading
|
||||
* '8'|'hr-small' → small horizontal-rule style heading
|
||||
*/
|
||||
@property({ type: String, reflect: true })
|
||||
accessor level: '1' | '2' | '3' | '4' | '5' | '6' | 'hr' | 'hr-small' = '1';
|
||||
accessor level: '1' | '2' | '3' | '4' | '5' | '6' | '7' | '8' | 'hr' | 'hr-small' = '1';
|
||||
|
||||
// STATIC STYLES
|
||||
public static styles: CSSResult[] = [
|
||||
themeDefaultStyles,
|
||||
cssManager.defaultStyles,
|
||||
css`
|
||||
/* TODO: Migrate hardcoded values to --dees-* CSS variables */
|
||||
/* Heading styles */
|
||||
h1, h2, h3, h4, h5, h6 {
|
||||
margin: 16px 0 8px;
|
||||
font-weight: 600;
|
||||
color: ${cssManager.bdTheme('#000', '#fff')};
|
||||
:host {
|
||||
display: block;
|
||||
}
|
||||
h1 { font-size: 32px; font-family: ${cssCalSansFontFamily}; letter-spacing: 0.025em;}
|
||||
h2 { font-size: 28px; }
|
||||
h3 { font-size: 24px; }
|
||||
h4 { font-size: 20px; }
|
||||
h5 { font-size: 16px; }
|
||||
h6 { font-size: 14px; }
|
||||
|
||||
/* Heading styles.
|
||||
* Color hierarchy: h1-h2 stay prominent with text-primary; h3-h6 step
|
||||
* down to text-secondary so they read as subheadings instead of
|
||||
* mini-h1s. Keeps the visual loudness out of smaller headings. */
|
||||
h1, h2, h3, h4, h5, h6 {
|
||||
font-weight: 600;
|
||||
}
|
||||
h1, h2 {
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
h3, h4, h5, h6 {
|
||||
color: var(--dees-color-text-secondary);
|
||||
}
|
||||
|
||||
/* Per-level typography + spacing.
|
||||
* Margin scales with importance: h1 gets the most breathing room,
|
||||
* h6 the least. Top margin > bottom margin so headings group with
|
||||
* the content that follows them. */
|
||||
h1 {
|
||||
/* h1 uses weight 500, not 600: the Cal Sans display font is
|
||||
* already stylized enough that bold + max contrast + 32px stacks
|
||||
* too much emphasis. 500 keeps the typographic impact without
|
||||
* shouting. */
|
||||
font-weight: 500;
|
||||
font-size: 32px;
|
||||
font-family: ${cssCalSansFontFamily};
|
||||
letter-spacing: 0.025em;
|
||||
margin: var(--dees-spacing-2xl) 0 var(--dees-spacing-lg);
|
||||
}
|
||||
h2 {
|
||||
font-size: 28px;
|
||||
margin: var(--dees-spacing-xl) 0 var(--dees-spacing-md);
|
||||
}
|
||||
h3 {
|
||||
font-size: 24px;
|
||||
margin: var(--dees-spacing-xl) 0 var(--dees-spacing-md);
|
||||
}
|
||||
h4 {
|
||||
font-size: 20px;
|
||||
margin: var(--dees-spacing-lg) 0 var(--dees-spacing-sm);
|
||||
}
|
||||
h5 {
|
||||
font-size: 16px;
|
||||
margin: var(--dees-spacing-md) 0 var(--dees-spacing-sm);
|
||||
}
|
||||
h6 {
|
||||
font-size: 14px;
|
||||
margin: var(--dees-spacing-md) 0 var(--dees-spacing-xs);
|
||||
}
|
||||
|
||||
/* Horizontal rule style heading */
|
||||
.heading-hr {
|
||||
display: flex;
|
||||
align-items: center;
|
||||
text-align: center;
|
||||
margin: 16px 0;
|
||||
color: ${cssManager.bdTheme('#000', '#fff')};
|
||||
margin: var(--dees-spacing-lg) 0;
|
||||
color: var(--dees-color-text-muted);
|
||||
}
|
||||
/* Fade lines toward and away from text for hr style */
|
||||
.heading-hr::before {
|
||||
content: '';
|
||||
flex: 1;
|
||||
height: 1px;
|
||||
/* fade in toward center */
|
||||
background: ${cssManager.bdTheme(
|
||||
'linear-gradient(to right, transparent, #ccc)',
|
||||
'linear-gradient(to right, transparent, #333)'
|
||||
)};
|
||||
margin: 0 8px;
|
||||
background: linear-gradient(to right, transparent, var(--dees-color-border-strong));
|
||||
margin: 0 var(--dees-spacing-sm);
|
||||
}
|
||||
.heading-hr::after {
|
||||
content: '';
|
||||
flex: 1;
|
||||
height: 1px;
|
||||
/* fade out away from center */
|
||||
background: ${cssManager.bdTheme(
|
||||
'linear-gradient(to right, #ccc, transparent)',
|
||||
'linear-gradient(to right, #333, transparent)'
|
||||
)};
|
||||
margin: 0 8px;
|
||||
background: linear-gradient(to right, var(--dees-color-border-strong), transparent);
|
||||
margin: 0 var(--dees-spacing-sm);
|
||||
}
|
||||
/* Small hr variant with reduced margins */
|
||||
.heading-hr.heading-hr-small {
|
||||
margin: 8px 0;
|
||||
margin: var(--dees-spacing-sm) 0;
|
||||
font-size: 12px;
|
||||
}
|
||||
.heading-hr.heading-hr-small::before,
|
||||
.heading-hr.heading-hr-small::after {
|
||||
margin: 0 8px;
|
||||
margin: 0 var(--dees-spacing-sm);
|
||||
}
|
||||
`,
|
||||
];
|
||||
@@ -109,8 +145,10 @@ export class DeesHeading extends DeesElement {
|
||||
return html`<h5><slot></slot></h5>`;
|
||||
case '6':
|
||||
return html`<h6><slot></slot></h6>`;
|
||||
case '7':
|
||||
case 'hr':
|
||||
return html`<div class="heading-hr"><slot></slot></div>`;
|
||||
case '8':
|
||||
case 'hr-small':
|
||||
return html`<div class="heading-hr heading-hr-small"><slot></slot></div>`;
|
||||
default:
|
||||
|
||||
@@ -1,7 +1,128 @@
|
||||
import { html, cssManager } from '@design.estate/dees-element';
|
||||
import { html, css, cssManager } from '@design.estate/dees-element';
|
||||
|
||||
export const demoFunc = () => {
|
||||
return html`
|
||||
<dees-label .label=${'a label'}></dees-label>
|
||||
`;
|
||||
}
|
||||
export const demoFunc = () => html`
|
||||
<style>
|
||||
${css`
|
||||
.demo-container {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 24px;
|
||||
padding: 24px;
|
||||
max-width: 800px;
|
||||
margin: 0 auto;
|
||||
}
|
||||
|
||||
.demo-section {
|
||||
background: ${cssManager.bdTheme('#f8f9fa', '#1a1a1a')};
|
||||
border-radius: 8px;
|
||||
padding: 24px;
|
||||
border: 1px solid ${cssManager.bdTheme('#e0e0e0', '#333')};
|
||||
}
|
||||
|
||||
.demo-section h3 {
|
||||
margin-top: 0;
|
||||
margin-bottom: 16px;
|
||||
color: ${cssManager.bdTheme('#333', '#fff')};
|
||||
}
|
||||
|
||||
.demo-section p {
|
||||
color: ${cssManager.bdTheme('#666', '#999')};
|
||||
margin-bottom: 16px;
|
||||
font-size: 13px;
|
||||
}
|
||||
|
||||
.label-grid {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 24px;
|
||||
}
|
||||
|
||||
.label-row {
|
||||
display: flex;
|
||||
align-items: baseline;
|
||||
gap: 16px;
|
||||
}
|
||||
|
||||
.label-row .annotation {
|
||||
font-size: 12px;
|
||||
font-family: monospace;
|
||||
color: ${cssManager.bdTheme('#888', '#666')};
|
||||
flex-shrink: 0;
|
||||
min-width: 200px;
|
||||
}
|
||||
`}
|
||||
</style>
|
||||
|
||||
<div class="demo-container">
|
||||
<div class="demo-section">
|
||||
<h3>Basic Label</h3>
|
||||
<p>A simple text label with no additional indicators.</p>
|
||||
<div class="label-grid">
|
||||
<div class="label-row">
|
||||
<span class="annotation">label="Username"</span>
|
||||
<dees-label .label=${'Username'}></dees-label>
|
||||
</div>
|
||||
<div class="label-row">
|
||||
<span class="annotation">label="Email Address"</span>
|
||||
<dees-label .label=${'Email Address'}></dees-label>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
|
||||
<div class="demo-section">
|
||||
<h3>Required Indicator</h3>
|
||||
<p>When <code>required</code> is set, a red asterisk appears after the label text.</p>
|
||||
<div class="label-grid">
|
||||
<div class="label-row">
|
||||
<span class="annotation">required=${'{true}'}</span>
|
||||
<dees-label .label=${'Full Name'} .required=${true}></dees-label>
|
||||
</div>
|
||||
<div class="label-row">
|
||||
<span class="annotation">required=${'{false}'} (default)</span>
|
||||
<dees-label .label=${'Nickname'} .required=${false}></dees-label>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
|
||||
<div class="demo-section">
|
||||
<h3>Info Text (Info Icon)</h3>
|
||||
<p>When <code>infoText</code> is set, an info icon appears next to the label. Hover over it to see the tooltip.</p>
|
||||
<div class="label-grid">
|
||||
<div class="label-row">
|
||||
<span class="annotation">infoText="..."</span>
|
||||
<dees-label .label=${'API Key'} .infoText=${'Your API key can be found in the developer settings dashboard.'}></dees-label>
|
||||
</div>
|
||||
<div class="label-row">
|
||||
<span class="annotation">short infoText</span>
|
||||
<dees-label .label=${'Region'} .infoText=${'Select your nearest datacenter.'}></dees-label>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
|
||||
<div class="demo-section">
|
||||
<h3>Required + Info Text</h3>
|
||||
<p>Both indicators can be combined. The asterisk appears first, then the info icon.</p>
|
||||
<div class="label-grid">
|
||||
<div class="label-row">
|
||||
<span class="annotation">required + infoText</span>
|
||||
<dees-label .label=${'Password'} .required=${true} .infoText=${'Must be at least 8 characters with one uppercase letter and one number.'}></dees-label>
|
||||
</div>
|
||||
<div class="label-row">
|
||||
<span class="annotation">required + infoText</span>
|
||||
<dees-label .label=${'Email Address'} .required=${true} .infoText=${'We will send a verification link to this address.'}></dees-label>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
|
||||
<div class="demo-section">
|
||||
<h3>Empty Label</h3>
|
||||
<p>When <code>label</code> is empty or not set, nothing is rendered. The element below has no label text:</p>
|
||||
<div class="label-grid">
|
||||
<div class="label-row">
|
||||
<span class="annotation">label="" (empty)</span>
|
||||
<dees-label .label=${''}></dees-label>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
`;
|
||||
|
||||
@@ -32,7 +32,7 @@ export class DeesLabel extends DeesElement {
|
||||
type: String,
|
||||
reflect: true,
|
||||
})
|
||||
accessor description!: string;
|
||||
accessor infoText!: string;
|
||||
|
||||
@property({
|
||||
type: Boolean,
|
||||
@@ -50,7 +50,8 @@ export class DeesLabel extends DeesElement {
|
||||
}
|
||||
|
||||
.label {
|
||||
display: inline-block;
|
||||
display: inline-flex;
|
||||
align-items: center;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 90%)')};
|
||||
font-size: 14px;
|
||||
font-weight: 500;
|
||||
@@ -66,13 +67,26 @@ export class DeesLabel extends DeesElement {
|
||||
margin-left: 2px;
|
||||
}
|
||||
|
||||
dees-icon {
|
||||
display: inline-block;
|
||||
font-size: 12px;
|
||||
transform: translateY(1px);
|
||||
margin-left: 4px;
|
||||
.description-icon {
|
||||
display: inline-flex;
|
||||
align-items: center;
|
||||
justify-content: center;
|
||||
width: 24px;
|
||||
height: 24px;
|
||||
margin: -6px 0 -6px 2px;
|
||||
border-radius: 4px;
|
||||
cursor: default;
|
||||
transition: background 0.15s ease, color 0.15s ease;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
||||
cursor: help;
|
||||
}
|
||||
|
||||
.description-icon:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 0% / 0.06)', 'hsl(0 0% 100% / 0.08)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 25%)', 'hsl(0 0% 80%)')};
|
||||
}
|
||||
|
||||
.description-icon dees-icon {
|
||||
font-size: 14px;
|
||||
}
|
||||
`,
|
||||
];
|
||||
@@ -84,10 +98,12 @@ export class DeesLabel extends DeesElement {
|
||||
<div class="label">
|
||||
${this.label}
|
||||
${this.required ? html`<span class="required">*</span>` : ''}
|
||||
${this.description
|
||||
${this.infoText
|
||||
? html`
|
||||
<div class="description-icon">
|
||||
<dees-icon .icon=${'lucide:info'}></dees-icon>
|
||||
<dees-speechbubble .text=${this.description}></dees-speechbubble>
|
||||
</div>
|
||||
<dees-speechbubble .text=${this.infoText}></dees-speechbubble>
|
||||
`
|
||||
: html``}
|
||||
</div>
|
||||
|
||||
@@ -0,0 +1,65 @@
|
||||
import { html, css, cssManager } from '@design.estate/dees-element';
|
||||
import './dees-settings.js';
|
||||
import type { ISettingsField, ISettingsAction } from './dees-settings.js';
|
||||
|
||||
export const demoFunc = () => {
|
||||
const acmeFields: ISettingsField[] = [
|
||||
{ key: 'email', label: 'Account email', value: 'admin@example.com' },
|
||||
{ key: 'status', label: 'Status', value: 'enabled' },
|
||||
{ key: 'mode', label: 'Mode', value: 'production' },
|
||||
{ key: 'autoRenew', label: 'Auto-renew', value: 'on' },
|
||||
{ key: 'threshold', label: 'Renewal threshold', value: '30 days' },
|
||||
];
|
||||
|
||||
const acmeActions: ISettingsAction[] = [
|
||||
{ name: 'Edit', action: () => console.log('Edit clicked') },
|
||||
];
|
||||
|
||||
const emptyActions: ISettingsAction[] = [
|
||||
{ name: 'Configure', action: () => console.log('Configure clicked') },
|
||||
];
|
||||
|
||||
const multiActions: ISettingsAction[] = [
|
||||
{ name: 'Reset', action: () => console.log('Reset clicked') },
|
||||
{ name: 'Edit', action: () => console.log('Edit clicked') },
|
||||
];
|
||||
|
||||
return html`
|
||||
<dees-demowrapper>
|
||||
<style>
|
||||
${css`
|
||||
.demoBox {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95%)', 'hsl(0 0% 9%)')};
|
||||
padding: 40px;
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 24px;
|
||||
max-width: 600px;
|
||||
}
|
||||
`}
|
||||
</style>
|
||||
<div class="demoBox">
|
||||
<dees-settings
|
||||
.heading=${'ACME Settings'}
|
||||
.settingsFields=${acmeFields}
|
||||
.actions=${acmeActions}
|
||||
></dees-settings>
|
||||
|
||||
<dees-settings
|
||||
.heading=${'ACME Settings'}
|
||||
.description=${'No ACME configuration yet. Click Configure to set up automated TLS certificate issuance.'}
|
||||
.actions=${emptyActions}
|
||||
></dees-settings>
|
||||
|
||||
<dees-settings
|
||||
.heading=${'Server Config'}
|
||||
.settingsFields=${[
|
||||
{ key: 'host', label: 'Hostname', value: 'proxy.example.com' },
|
||||
{ key: 'port', label: 'Port', value: '443' },
|
||||
]}
|
||||
.actions=${multiActions}
|
||||
></dees-settings>
|
||||
</div>
|
||||
</dees-demowrapper>
|
||||
`;
|
||||
};
|
||||
@@ -0,0 +1,196 @@
|
||||
import {
|
||||
customElement,
|
||||
DeesElement,
|
||||
html,
|
||||
css,
|
||||
cssManager,
|
||||
property,
|
||||
type TemplateResult,
|
||||
} from '@design.estate/dees-element';
|
||||
import { demoFunc } from './dees-settings.demo.js';
|
||||
import { cssGeistFontFamily } from '../../00fonts.js';
|
||||
import { themeDefaultStyles } from '../../00theme.js';
|
||||
import '../../00group-layout/dees-tile/dees-tile.js';
|
||||
|
||||
declare global {
|
||||
interface HTMLElementTagNameMap {
|
||||
'dees-settings': DeesSettings;
|
||||
}
|
||||
}
|
||||
|
||||
export interface ISettingsField {
|
||||
key: string;
|
||||
label: string;
|
||||
value: string | TemplateResult;
|
||||
}
|
||||
|
||||
export interface ISettingsAction {
|
||||
name: string;
|
||||
action: () => void | Promise<void>;
|
||||
}
|
||||
|
||||
/**
|
||||
* dees-settings — a read-only settings display tile with modal-style footer actions.
|
||||
*
|
||||
* Renders a dees-tile with a heading, a grid of label/value fields,
|
||||
* and a footer action bar. When an action is clicked the component
|
||||
* dispatches a `settings-action` CustomEvent with the action name.
|
||||
*/
|
||||
@customElement('dees-settings')
|
||||
export class DeesSettings extends DeesElement {
|
||||
public static demo = demoFunc;
|
||||
public static demoGroups = ['Layout'];
|
||||
|
||||
@property({ type: String })
|
||||
accessor heading: string = '';
|
||||
|
||||
@property({ type: String })
|
||||
accessor description: string = '';
|
||||
|
||||
@property({ attribute: false })
|
||||
accessor settingsFields: ISettingsField[] = [];
|
||||
|
||||
@property({ attribute: false })
|
||||
accessor actions: ISettingsAction[] = [];
|
||||
|
||||
public static styles = [
|
||||
themeDefaultStyles,
|
||||
cssManager.defaultStyles,
|
||||
css`
|
||||
:host {
|
||||
display: block;
|
||||
font-family: ${cssGeistFontFamily};
|
||||
}
|
||||
|
||||
.settingsGrid {
|
||||
display: grid;
|
||||
grid-template-columns: repeat(auto-fit, minmax(180px, 1fr));
|
||||
gap: 12px 24px;
|
||||
padding: 16px;
|
||||
}
|
||||
|
||||
.settingsField {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 2px;
|
||||
}
|
||||
|
||||
.fieldLabel {
|
||||
font-size: 11px;
|
||||
text-transform: uppercase;
|
||||
letter-spacing: 0.03em;
|
||||
color: var(--dees-color-text-muted);
|
||||
}
|
||||
|
||||
.fieldValue {
|
||||
font-size: 13px;
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
.settingsDescription {
|
||||
padding: 16px;
|
||||
font-size: 13px;
|
||||
line-height: 1.5;
|
||||
color: var(--dees-color-text-muted);
|
||||
}
|
||||
|
||||
.bottomButtons {
|
||||
display: flex;
|
||||
flex-direction: row;
|
||||
justify-content: flex-end;
|
||||
align-items: center;
|
||||
gap: 0;
|
||||
height: 36px;
|
||||
width: 100%;
|
||||
box-sizing: border-box;
|
||||
}
|
||||
|
||||
.bottomButtons .bottomButton {
|
||||
padding: 0 16px;
|
||||
height: 100%;
|
||||
text-align: center;
|
||||
font-size: 12px;
|
||||
font-weight: 500;
|
||||
cursor: pointer;
|
||||
user-select: none;
|
||||
transition: all 0.15s ease;
|
||||
background: transparent;
|
||||
border: none;
|
||||
border-left: 1px solid var(--dees-color-border-subtle);
|
||||
color: var(--dees-color-text-muted);
|
||||
white-space: nowrap;
|
||||
display: flex;
|
||||
align-items: center;
|
||||
}
|
||||
|
||||
.bottomButtons .bottomButton:first-child {
|
||||
border-left: none;
|
||||
}
|
||||
|
||||
.bottomButtons .bottomButton:hover {
|
||||
background: var(--dees-color-hover);
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
.bottomButtons .bottomButton:active {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 92%)', 'hsl(0 0% 13%)')};
|
||||
}
|
||||
|
||||
.bottomButtons .bottomButton.primary {
|
||||
color: ${cssManager.bdTheme('hsl(217.2 91.2% 59.8%)', 'hsl(213.1 93.9% 67.8%)')};
|
||||
font-weight: 600;
|
||||
}
|
||||
|
||||
.bottomButtons .bottomButton.primary:hover {
|
||||
background: ${cssManager.bdTheme('hsl(217.2 91.2% 59.8% / 0.08)', 'hsl(213.1 93.9% 67.8% / 0.08)')};
|
||||
color: ${cssManager.bdTheme('hsl(217.2 91.2% 50%)', 'hsl(213.1 93.9% 75%)')};
|
||||
}
|
||||
|
||||
.bottomButtons .bottomButton.primary:active {
|
||||
background: ${cssManager.bdTheme('hsl(217.2 91.2% 59.8% / 0.15)', 'hsl(213.1 93.9% 67.8% / 0.15)')};
|
||||
}
|
||||
`,
|
||||
];
|
||||
|
||||
public render(): TemplateResult {
|
||||
const hasFields = this.settingsFields.length > 0;
|
||||
const hasActions = this.actions.length > 0;
|
||||
|
||||
return html`
|
||||
<dees-tile .heading=${this.heading}>
|
||||
${hasFields
|
||||
? html`
|
||||
<div class="settingsGrid">
|
||||
${this.settingsFields.map(
|
||||
(field) => html`
|
||||
<div class="settingsField">
|
||||
<span class="fieldLabel">${field.label}</span>
|
||||
<span class="fieldValue">${field.value}</span>
|
||||
</div>
|
||||
`,
|
||||
)}
|
||||
</div>
|
||||
`
|
||||
: html`
|
||||
<div class="settingsDescription">${this.description}</div>
|
||||
`}
|
||||
${hasActions
|
||||
? html`
|
||||
<div slot="footer" class="bottomButtons">
|
||||
${this.actions.map(
|
||||
(actionArg, index) => html`
|
||||
<div
|
||||
class="bottomButton ${index === this.actions.length - 1 ? 'primary' : ''}"
|
||||
@click=${() => actionArg.action()}
|
||||
>
|
||||
${actionArg.name}
|
||||
</div>
|
||||
`,
|
||||
)}
|
||||
</div>
|
||||
`
|
||||
: ''}
|
||||
</dees-tile>
|
||||
`;
|
||||
}
|
||||
}
|
||||
@@ -0,0 +1 @@
|
||||
export * from './dees-settings.js';
|
||||
@@ -1,21 +1,54 @@
|
||||
import { html } from '@design.estate/dees-element';
|
||||
import { DeesStepper, type IStep } from './dees-stepper.js';
|
||||
|
||||
export const stepperDemo = () => html`
|
||||
<dees-stepper
|
||||
.steps=${[
|
||||
const waitForProgressTick = async (timeoutArg: number, signal?: AbortSignal): Promise<boolean> => {
|
||||
return new Promise((resolve) => {
|
||||
let completed = false;
|
||||
|
||||
const finish = (result: boolean) => {
|
||||
if (completed) {
|
||||
return;
|
||||
}
|
||||
|
||||
completed = true;
|
||||
if (signal) {
|
||||
signal.removeEventListener('abort', handleAbort);
|
||||
}
|
||||
resolve(result);
|
||||
};
|
||||
|
||||
const handleAbort = () => {
|
||||
window.clearTimeout(timeoutId);
|
||||
finish(false);
|
||||
};
|
||||
|
||||
const timeoutId = window.setTimeout(() => {
|
||||
finish(true);
|
||||
}, timeoutArg);
|
||||
|
||||
if (signal) {
|
||||
signal.addEventListener('abort', handleAbort, { once: true });
|
||||
}
|
||||
});
|
||||
};
|
||||
|
||||
const createContinueMenuOptions = (labelArg = 'Continue') => [
|
||||
{
|
||||
name: labelArg,
|
||||
action: async (stepper?: DeesStepper) => stepper?.goNext(),
|
||||
},
|
||||
];
|
||||
|
||||
const createDemoSteps = (): IStep[] => [
|
||||
{
|
||||
title: 'Account Setup',
|
||||
content: html`
|
||||
<dees-form>
|
||||
<dees-input-text key="email" label="Work Email" required></dees-input-text>
|
||||
<dees-input-text key="password" label="Create Password" type="password" required></dees-input-text>
|
||||
<dees-form-submit>Continue</dees-form-submit>
|
||||
</dees-form>
|
||||
`,
|
||||
validationFunc: async (stepperArg, elementArg) => {
|
||||
const deesForm = elementArg.querySelector('dees-form');
|
||||
deesForm.addEventListener('formData', () => stepperArg.goNext(), { once: true });
|
||||
},
|
||||
menuOptions: createContinueMenuOptions(),
|
||||
},
|
||||
{
|
||||
title: 'Profile Details',
|
||||
@@ -23,13 +56,9 @@ export const stepperDemo = () => html`
|
||||
<dees-form>
|
||||
<dees-input-text key="firstName" label="First Name" required></dees-input-text>
|
||||
<dees-input-text key="lastName" label="Last Name" required></dees-input-text>
|
||||
<dees-form-submit>Continue</dees-form-submit>
|
||||
</dees-form>
|
||||
`,
|
||||
validationFunc: async (stepperArg, elementArg) => {
|
||||
const deesForm = elementArg.querySelector('dees-form');
|
||||
deesForm.addEventListener('formData', () => stepperArg.goNext(), { once: true });
|
||||
},
|
||||
menuOptions: createContinueMenuOptions(),
|
||||
},
|
||||
{
|
||||
title: 'Contact Information',
|
||||
@@ -37,12 +66,75 @@ export const stepperDemo = () => html`
|
||||
<dees-form>
|
||||
<dees-input-phone key="phone" label="Mobile Number" required></dees-input-phone>
|
||||
<dees-input-text key="company" label="Company"></dees-input-text>
|
||||
<dees-form-submit>Continue</dees-form-submit>
|
||||
</dees-form>
|
||||
`,
|
||||
validationFunc: async (stepperArg, elementArg) => {
|
||||
const deesForm = elementArg.querySelector('dees-form');
|
||||
deesForm.addEventListener('formData', () => stepperArg.goNext(), { once: true });
|
||||
menuOptions: createContinueMenuOptions(),
|
||||
},
|
||||
{
|
||||
title: 'Provision Workspace',
|
||||
content: html`
|
||||
<dees-panel>
|
||||
<p>
|
||||
We are creating your starter workspace, applying your onboarding choices,
|
||||
and preparing a live preview. This step moves forward automatically when
|
||||
the environment is ready.
|
||||
</p>
|
||||
</dees-panel>
|
||||
`,
|
||||
progressStep: {
|
||||
label: 'Workspace setup',
|
||||
percentage: 8,
|
||||
indeterminate: true,
|
||||
statusRows: 4,
|
||||
statusText: 'Allocating a clean workspace...',
|
||||
terminalLines: ['Allocating a clean workspace'],
|
||||
},
|
||||
validationFunc: async (stepper, _htmlElement, signal) => {
|
||||
const progressFrames = [
|
||||
{ line: 'Allocating a clean workspace', percentage: 8, delay: 500 },
|
||||
{ line: 'Syncing account preferences', percentage: 24, delay: 650 },
|
||||
{ line: 'Installing selected integrations', percentage: 47, delay: 700 },
|
||||
{ line: 'Generating starter project files', percentage: 71, delay: 650 },
|
||||
{ line: 'Booting the live preview environment', percentage: 92, delay: 700 },
|
||||
];
|
||||
|
||||
stepper.resetProgressStep();
|
||||
|
||||
for (const [index, progressFrame] of progressFrames.entries()) {
|
||||
if (signal?.aborted) {
|
||||
return;
|
||||
}
|
||||
|
||||
if (index === 0) {
|
||||
stepper.updateProgressStep({
|
||||
percentage: progressFrame.percentage,
|
||||
indeterminate: true,
|
||||
statusText: `${progressFrame.line}...`,
|
||||
terminalLines: [progressFrame.line],
|
||||
});
|
||||
} else {
|
||||
stepper.appendProgressStepLine(progressFrame.line);
|
||||
stepper.updateProgressStep({
|
||||
percentage: progressFrame.percentage,
|
||||
indeterminate: true,
|
||||
statusText: `${progressFrame.line}...`,
|
||||
});
|
||||
}
|
||||
|
||||
const completed = await waitForProgressTick(progressFrame.delay, signal);
|
||||
if (!completed) {
|
||||
return;
|
||||
}
|
||||
}
|
||||
|
||||
stepper.appendProgressStepLine('Workspace ready');
|
||||
stepper.updateProgressStep({
|
||||
percentage: 100,
|
||||
indeterminate: false,
|
||||
statusText: 'Workspace ready.',
|
||||
});
|
||||
|
||||
await waitForProgressTick(350, signal);
|
||||
},
|
||||
},
|
||||
{
|
||||
@@ -60,13 +152,9 @@ export const stepperDemo = () => html`
|
||||
]}
|
||||
required
|
||||
></dees-input-dropdown>
|
||||
<dees-form-submit>Continue</dees-form-submit>
|
||||
</dees-form>
|
||||
`,
|
||||
validationFunc: async (stepperArg, elementArg) => {
|
||||
const deesForm = elementArg.querySelector('dees-form');
|
||||
deesForm.addEventListener('formData', () => stepperArg.goNext(), { once: true });
|
||||
},
|
||||
menuOptions: createContinueMenuOptions(),
|
||||
},
|
||||
{
|
||||
title: 'Goals',
|
||||
@@ -82,53 +170,44 @@ export const stepperDemo = () => html`
|
||||
]}
|
||||
required
|
||||
></dees-input-multitoggle>
|
||||
<dees-form-submit>Continue</dees-form-submit>
|
||||
</dees-form>
|
||||
`,
|
||||
validationFunc: async (stepperArg, elementArg) => {
|
||||
const deesForm = elementArg.querySelector('dees-form');
|
||||
deesForm.addEventListener('formData', () => stepperArg.goNext(), { once: true });
|
||||
},
|
||||
},
|
||||
{
|
||||
title: 'Brand Preferences',
|
||||
content: html`
|
||||
<dees-form>
|
||||
<dees-input-text key="brandColor" label="Primary brand color"></dees-input-text>
|
||||
<dees-input-text key="tone" label="Preferred tone (e.g. friendly, formal)"></dees-input-text>
|
||||
<dees-form-submit>Continue</dees-form-submit>
|
||||
</dees-form>
|
||||
`,
|
||||
validationFunc: async (stepperArg, elementArg) => {
|
||||
const deesForm = elementArg.querySelector('dees-form');
|
||||
deesForm.addEventListener('formData', () => stepperArg.goNext(), { once: true });
|
||||
},
|
||||
},
|
||||
{
|
||||
title: 'Integrations',
|
||||
content: html`
|
||||
<dees-form>
|
||||
<dees-input-list
|
||||
key="integrations"
|
||||
label="Integrations in use"
|
||||
placeholder="Add integration"
|
||||
></dees-input-list>
|
||||
<dees-form-submit>Continue</dees-form-submit>
|
||||
</dees-form>
|
||||
`,
|
||||
validationFunc: async (stepperArg, elementArg) => {
|
||||
const deesForm = elementArg.querySelector('dees-form');
|
||||
deesForm.addEventListener('formData', () => stepperArg.goNext(), { once: true });
|
||||
},
|
||||
menuOptions: createContinueMenuOptions(),
|
||||
},
|
||||
{
|
||||
title: 'Review & Launch',
|
||||
content: html`
|
||||
<dees-panel>
|
||||
<p>Almost there! Review your selections and launch whenever you're ready.</p>
|
||||
<p>
|
||||
Your workspace is ready. Review the collected details and launch when
|
||||
you are ready to start.
|
||||
</p>
|
||||
</dees-panel>
|
||||
`,
|
||||
menuOptions: [
|
||||
{
|
||||
name: 'Launch',
|
||||
action: async (stepper?: DeesStepper) => {
|
||||
if (stepper?.overlay) {
|
||||
await stepper.destroy();
|
||||
}
|
||||
},
|
||||
] as const}
|
||||
></dees-stepper>
|
||||
},
|
||||
],
|
||||
},
|
||||
];
|
||||
|
||||
export const stepperDemo = () => html`
|
||||
<div style="position: absolute; inset: 0;">
|
||||
<div
|
||||
style="position: absolute; top: 16px; left: 50%; transform: translateX(-50%); z-index: 10;"
|
||||
>
|
||||
<dees-button
|
||||
@click=${async () => {
|
||||
await DeesStepper.createAndShow({ steps: createDemoSteps() });
|
||||
}}
|
||||
>Open stepper as overlay</dees-button>
|
||||
</div>
|
||||
<dees-stepper .steps=${createDemoSteps()}></dees-stepper>
|
||||
</div>
|
||||
`;
|
||||
|
||||
@@ -1,13 +1,10 @@
|
||||
import * as plugins from '../../00plugins.js';
|
||||
import * as colors from '../../00colors.js';
|
||||
|
||||
import {
|
||||
DeesElement,
|
||||
customElement,
|
||||
html,
|
||||
css,
|
||||
unsafeCSS,
|
||||
type CSSResult,
|
||||
cssManager,
|
||||
property,
|
||||
type TemplateResult,
|
||||
@@ -16,14 +13,38 @@ import {
|
||||
import * as domtools from '@design.estate/dees-domtools';
|
||||
import { stepperDemo } from './dees-stepper.demo.js';
|
||||
import { themeDefaultStyles } from '../../00theme.js';
|
||||
import { cssGeistFontFamily } from '../../00fonts.js';
|
||||
import { zIndexRegistry } from '../../00zindex.js';
|
||||
import { DeesWindowLayer } from '../../00group-overlay/dees-windowlayer/dees-windowlayer.js';
|
||||
import { DeesModal } from '../../00group-overlay/dees-modal/dees-modal.js';
|
||||
import type { DeesForm } from '../../00group-form/dees-form/dees-form.js';
|
||||
import '../../00group-feedback/dees-progressbar/dees-progressbar.js';
|
||||
import '../dees-tile/dees-tile.js';
|
||||
|
||||
export interface IStepProgressState {
|
||||
label?: string;
|
||||
percentage?: number;
|
||||
indeterminate?: boolean;
|
||||
showPercentage?: boolean;
|
||||
statusText?: string;
|
||||
terminalLines?: string[];
|
||||
statusRows?: number;
|
||||
}
|
||||
|
||||
export interface IStepProgress extends IStepProgressState {
|
||||
autoAdvance?: boolean;
|
||||
}
|
||||
|
||||
export interface IStep {
|
||||
title: string;
|
||||
content: TemplateResult;
|
||||
progressStep?: IStepProgress;
|
||||
menuOptions?: plugins.tsclass.website.IMenuItem<DeesStepper>[];
|
||||
validationFunc?: (stepper: DeesStepper, htmlElement: HTMLElement, signal?: AbortSignal) => Promise<any>;
|
||||
onReturnToStepFunc?: (stepper: DeesStepper, htmlElement: HTMLElement) => Promise<any>;
|
||||
validationFuncCalled?: boolean;
|
||||
abortController?: AbortController;
|
||||
progressStepState?: IStepProgressState;
|
||||
}
|
||||
|
||||
declare global {
|
||||
@@ -34,9 +55,33 @@ declare global {
|
||||
|
||||
@customElement('dees-stepper')
|
||||
export class DeesStepper extends DeesElement {
|
||||
// STATIC
|
||||
public static demo = stepperDemo;
|
||||
public static demoGroups = ['Layout', 'Form'];
|
||||
|
||||
public static async createAndShow(optionsArg: {
|
||||
steps: IStep[];
|
||||
cancelable?: boolean;
|
||||
}): Promise<DeesStepper> {
|
||||
const body = document.body;
|
||||
const stepper = new DeesStepper();
|
||||
stepper.steps = optionsArg.steps;
|
||||
stepper.overlay = true;
|
||||
if (optionsArg.cancelable !== undefined) {
|
||||
stepper.cancelable = optionsArg.cancelable;
|
||||
}
|
||||
stepper.windowLayer = await DeesWindowLayer.createAndShow({ blur: true });
|
||||
body.append(stepper.windowLayer);
|
||||
body.append(stepper);
|
||||
|
||||
// Get z-index for stepper (should be above window layer)
|
||||
stepper.stepperZIndex = zIndexRegistry.getNextZIndex();
|
||||
zIndexRegistry.register(stepper, stepper.stepperZIndex);
|
||||
|
||||
return stepper;
|
||||
}
|
||||
|
||||
// INSTANCE
|
||||
@property({
|
||||
type: Array,
|
||||
})
|
||||
@@ -47,6 +92,37 @@ export class DeesStepper extends DeesElement {
|
||||
})
|
||||
accessor selectedStep!: IStep;
|
||||
|
||||
@property({
|
||||
type: Boolean,
|
||||
reflect: true,
|
||||
})
|
||||
accessor overlay: boolean = false;
|
||||
|
||||
/**
|
||||
* When true (default), the stepper renders a Cancel button in every step's
|
||||
* footer, and clicking the backdrop (overlay mode) triggers the same cancel
|
||||
* confirmation flow. Set to false for forced flows where the user must
|
||||
* complete the stepper — no Cancel button, no backdrop dismissal.
|
||||
*/
|
||||
@property({
|
||||
type: Boolean,
|
||||
reflect: true,
|
||||
})
|
||||
accessor cancelable: boolean = true;
|
||||
|
||||
@property({ type: Number, attribute: false })
|
||||
accessor stepperZIndex: number = 1000;
|
||||
|
||||
@property({ type: Object, attribute: false })
|
||||
accessor activeForm: DeesForm | null = null;
|
||||
|
||||
@property({ type: Boolean, attribute: false })
|
||||
accessor activeFormValid: boolean = true;
|
||||
|
||||
private activeFormSubscription?: { unsubscribe: () => void };
|
||||
|
||||
private windowLayer?: DeesWindowLayer;
|
||||
|
||||
constructor() {
|
||||
super();
|
||||
}
|
||||
@@ -60,7 +136,24 @@ export class DeesStepper extends DeesElement {
|
||||
position: absolute;
|
||||
width: 100%;
|
||||
height: 100%;
|
||||
font-family: ${cssGeistFontFamily};
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
/*
|
||||
* In overlay mode the host is "transparent" to layout — the inner
|
||||
* .stepperContainer.overlay is what pins to the viewport and carries the
|
||||
* z-index. Keeping :host unpositioned avoids nesting the stacking context
|
||||
* under an auto-z-index parent (which was trapping .stepperContainer
|
||||
* below DeesWindowLayer's sibling layers). This mirrors how dees-modal
|
||||
* keeps its own :host unpositioned and lets .modalContainer drive layout.
|
||||
*/
|
||||
:host([overlay]) {
|
||||
position: static;
|
||||
width: 0;
|
||||
height: 0;
|
||||
}
|
||||
|
||||
.stepperContainer {
|
||||
position: absolute;
|
||||
width: 100%;
|
||||
@@ -68,101 +161,125 @@ export class DeesStepper extends DeesElement {
|
||||
overflow: hidden;
|
||||
}
|
||||
|
||||
.step {
|
||||
.stepperContainer.overlay {
|
||||
position: fixed;
|
||||
top: 0;
|
||||
left: 0;
|
||||
width: 100vw;
|
||||
height: 100vh;
|
||||
}
|
||||
|
||||
/* Exit animation — reverse of the entry. Tiles slide DOWN + fade out,
|
||||
mirroring the .entrance slide-up. The transition override is needed
|
||||
because dees-tile.step has its own 0.7s transition for step selection
|
||||
which would otherwise make the exit sluggish. */
|
||||
.stepperContainer.predestroy dees-tile.step {
|
||||
transform: translateY(16px);
|
||||
filter: opacity(0);
|
||||
transition: transform 0.25s, filter 0.2s;
|
||||
}
|
||||
|
||||
dees-tile.step {
|
||||
position: relative;
|
||||
pointer-events: none;
|
||||
overflow: hidden;
|
||||
transition: transform 0.7s cubic-bezier(0.87, 0, 0.13, 1), box-shadow 0.7s cubic-bezier(0.87, 0, 0.13, 1), filter 0.7s cubic-bezier(0.87, 0, 0.13, 1), border 0.7s cubic-bezier(0.87, 0, 0.13, 1);
|
||||
max-width: 500px;
|
||||
min-height: 300px;
|
||||
border-radius: 12px;
|
||||
background: ${cssManager.bdTheme('#ffffff', '#0f0f11')};
|
||||
border: 1px solid ${cssManager.bdTheme('#e2e8f0', '#272729')};
|
||||
color: ${cssManager.bdTheme('#0f172a', '#f5f5f5')};
|
||||
margin: auto;
|
||||
margin-bottom: 20px;
|
||||
filter: opacity(0.55) saturate(0.85);
|
||||
box-shadow: 0 8px 32px rgba(0, 0, 0, 0.4);
|
||||
transition: transform 0.7s cubic-bezier(0.87, 0, 0.13, 1), filter 0.7s cubic-bezier(0.87, 0, 0.13, 1);
|
||||
user-select: none;
|
||||
}
|
||||
|
||||
.step.selected {
|
||||
dees-tile.step.selected {
|
||||
pointer-events: all;
|
||||
filter: opacity(1) saturate(1);
|
||||
user-select: auto;
|
||||
}
|
||||
|
||||
.step.hiddenStep {
|
||||
dees-tile.step.hiddenStep {
|
||||
filter: opacity(0);
|
||||
}
|
||||
|
||||
.step.entrance {
|
||||
transition: transform 0.35s ease, box-shadow 0.35s ease, filter 0.35s ease, border 0.35s ease;
|
||||
dees-tile.step.entrance {
|
||||
transition: transform 0.35s ease, filter 0.35s ease;
|
||||
}
|
||||
|
||||
.step.entrance.hiddenStep {
|
||||
dees-tile.step.entrance.hiddenStep {
|
||||
transform: translateY(16px);
|
||||
}
|
||||
|
||||
.step:last-child {
|
||||
dees-tile.step:last-child {
|
||||
margin-bottom: 100vh;
|
||||
}
|
||||
|
||||
.step .stepCounter {
|
||||
color: ${cssManager.bdTheme('#64748b', '#a1a1aa')};
|
||||
position: absolute;
|
||||
top: 12px;
|
||||
right: 12px;
|
||||
padding: 6px 14px;
|
||||
font-size: 12px;
|
||||
border-radius: 999px;
|
||||
background: ${cssManager.bdTheme('rgba(226, 232, 240, 0.5)', 'rgba(63, 63, 70, 0.45)')};
|
||||
border: 1px solid ${cssManager.bdTheme('rgba(226, 232, 240, 0.7)', 'rgba(63, 63, 70, 0.6)')};
|
||||
.stepperContainer.overlay dees-tile.step::part(outer) {
|
||||
box-shadow:
|
||||
0 0 0 1px ${cssManager.bdTheme('hsl(0 0% 0% / 0.03)', 'hsl(0 0% 100% / 0.03)')},
|
||||
0 8px 40px ${cssManager.bdTheme('hsl(0 0% 0% / 0.12)', 'hsl(0 0% 0% / 0.5)')},
|
||||
0 2px 8px ${cssManager.bdTheme('hsl(0 0% 0% / 0.06)', 'hsl(0 0% 0% / 0.25)')};
|
||||
}
|
||||
|
||||
.step .goBack {
|
||||
position: absolute;
|
||||
top: 12px;
|
||||
left: 12px;
|
||||
.step-header {
|
||||
height: 36px;
|
||||
display: flex;
|
||||
align-items: center;
|
||||
justify-content: space-between;
|
||||
padding: 0 8px 0 12px;
|
||||
gap: 12px;
|
||||
}
|
||||
|
||||
.goBack-spacer {
|
||||
width: 1px;
|
||||
}
|
||||
|
||||
.step-header .goBack {
|
||||
display: inline-flex;
|
||||
align-items: center;
|
||||
gap: 6px;
|
||||
padding: 6px 12px;
|
||||
height: 24px;
|
||||
padding: 0 8px;
|
||||
font-size: 12px;
|
||||
font-weight: 500;
|
||||
border-radius: 999px;
|
||||
border: 1px solid ${cssManager.bdTheme('rgba(226, 232, 240, 0.9)', 'rgba(63, 63, 70, 0.85)')};
|
||||
background: ${cssManager.bdTheme('rgba(255, 255, 255, 0.9)', 'rgba(39, 39, 42, 0.85)')};
|
||||
color: ${cssManager.bdTheme('#475569', '#d4d4d8')};
|
||||
line-height: 1;
|
||||
border: none;
|
||||
background: transparent;
|
||||
color: var(--dees-color-text-muted);
|
||||
border-radius: 4px;
|
||||
cursor: pointer;
|
||||
transition: border 0.2s ease, color 0.2s ease, background 0.2s ease, transform 0.2s ease;
|
||||
transition: background 0.15s ease, color 0.15s ease, transform 0.2s ease;
|
||||
}
|
||||
|
||||
.step .goBack:hover {
|
||||
color: ${cssManager.bdTheme('#0f172a', '#fafafa')};
|
||||
border-color: ${cssManager.bdTheme(colors.dark.blue, colors.dark.blue)};
|
||||
background: ${cssManager.bdTheme('rgba(226, 232, 240, 0.95)', 'rgba(63, 63, 70, 0.7)')};
|
||||
.step-header .goBack:hover {
|
||||
background: var(--dees-color-hover);
|
||||
color: var(--dees-color-text-secondary);
|
||||
transform: translateX(-2px);
|
||||
}
|
||||
|
||||
.step .goBack:active {
|
||||
color: ${cssManager.bdTheme('#0f172a', '#fafafa')};
|
||||
border-color: ${cssManager.bdTheme(colors.dark.blueActive, colors.dark.blueActive)};
|
||||
background: ${cssManager.bdTheme('rgba(226, 232, 240, 0.85)', 'rgba(63, 63, 70, 0.6)')};
|
||||
.step-header .goBack:active {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 90%)', 'hsl(0 0% 15%)')};
|
||||
}
|
||||
|
||||
.step .goBack span {
|
||||
.step-header .goBack span {
|
||||
transition: transform 0.2s ease;
|
||||
display: inline-block;
|
||||
}
|
||||
|
||||
.step .goBack:hover span {
|
||||
.step-header .goBack:hover span {
|
||||
transform: translateX(-2px);
|
||||
}
|
||||
|
||||
.step .title {
|
||||
.step-header .stepCounter {
|
||||
color: var(--dees-color-text-muted);
|
||||
font-size: 12px;
|
||||
font-weight: 500;
|
||||
letter-spacing: -0.01em;
|
||||
padding: 0 8px;
|
||||
}
|
||||
|
||||
.step-body .title {
|
||||
text-align: center;
|
||||
padding-top: 64px;
|
||||
padding-top: 32px;
|
||||
font-family: 'Geist Sans', sans-serif;
|
||||
font-size: 24px;
|
||||
font-weight: 600;
|
||||
@@ -170,35 +287,171 @@ export class DeesStepper extends DeesElement {
|
||||
color: inherit;
|
||||
}
|
||||
|
||||
.step .content {
|
||||
.step-body .content {
|
||||
padding: 32px;
|
||||
}
|
||||
|
||||
.step-body .content.withProgressStep {
|
||||
padding-top: 20px;
|
||||
}
|
||||
|
||||
.progressStep {
|
||||
padding: 0 24px;
|
||||
}
|
||||
|
||||
/* --- Footer: modal-style bottom buttons --- */
|
||||
.bottomButtons {
|
||||
display: flex;
|
||||
flex-direction: row;
|
||||
justify-content: flex-end;
|
||||
align-items: center;
|
||||
gap: 0;
|
||||
height: 36px;
|
||||
width: 100%;
|
||||
box-sizing: border-box;
|
||||
}
|
||||
|
||||
.bottomButtons .bottomButton {
|
||||
padding: 0 16px;
|
||||
height: 100%;
|
||||
text-align: center;
|
||||
font-size: 12px;
|
||||
font-weight: 500;
|
||||
cursor: pointer;
|
||||
user-select: none;
|
||||
transition: all 0.15s ease;
|
||||
background: transparent;
|
||||
border: none;
|
||||
color: var(--dees-color-text-muted);
|
||||
white-space: nowrap;
|
||||
display: flex;
|
||||
align-items: center;
|
||||
}
|
||||
|
||||
/* Border-left separator on every button EXCEPT the first one.
|
||||
Uses general sibling so the stepHint (if rendered on the left) does
|
||||
not shift which button counts as "first" and create a phantom border. */
|
||||
.bottomButtons .bottomButton ~ .bottomButton {
|
||||
border-left: 1px solid var(--dees-color-border-subtle);
|
||||
}
|
||||
|
||||
.bottomButtons .bottomButton:hover {
|
||||
background: var(--dees-color-hover);
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
.bottomButtons .bottomButton:active {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 92%)', 'hsl(0 0% 13%)')};
|
||||
}
|
||||
|
||||
.bottomButtons .bottomButton.primary {
|
||||
color: ${cssManager.bdTheme('hsl(217.2 91.2% 59.8%)', 'hsl(213.1 93.9% 67.8%)')};
|
||||
font-weight: 600;
|
||||
}
|
||||
|
||||
.bottomButtons .bottomButton.primary:hover {
|
||||
background: ${cssManager.bdTheme('hsl(217.2 91.2% 59.8% / 0.08)', 'hsl(213.1 93.9% 67.8% / 0.08)')};
|
||||
color: ${cssManager.bdTheme('hsl(217.2 91.2% 50%)', 'hsl(213.1 93.9% 75%)')};
|
||||
}
|
||||
|
||||
.bottomButtons .bottomButton.primary:active {
|
||||
background: ${cssManager.bdTheme('hsl(217.2 91.2% 59.8% / 0.12)', 'hsl(213.1 93.9% 67.8% / 0.12)')};
|
||||
}
|
||||
|
||||
.bottomButtons .bottomButton.disabled {
|
||||
pointer-events: none;
|
||||
opacity: 0.4;
|
||||
cursor: not-allowed;
|
||||
}
|
||||
|
||||
.bottomButtons .bottomButton.disabled:hover {
|
||||
background: transparent;
|
||||
color: var(--dees-color-text-muted);
|
||||
}
|
||||
|
||||
/* Hint shown on the left of the footer when the active step's form has
|
||||
unfilled required fields. Uses margin-right: auto to push right-aligned
|
||||
buttons to the right while keeping the hint flush-left. */
|
||||
.bottomButtons .stepHint {
|
||||
margin-right: auto;
|
||||
padding: 0 16px;
|
||||
font-size: 11px;
|
||||
line-height: 1;
|
||||
letter-spacing: -0.01em;
|
||||
color: var(--dees-color-text-muted);
|
||||
display: flex;
|
||||
align-items: center;
|
||||
user-select: none;
|
||||
}
|
||||
`,
|
||||
];
|
||||
|
||||
public render() {
|
||||
return html`
|
||||
<div class="stepperContainer">
|
||||
${this.steps.map(
|
||||
(stepArg) =>
|
||||
html`<div
|
||||
class="step ${stepArg === this.selectedStep
|
||||
? 'selected'
|
||||
: null} ${this.getIndexOfStep(stepArg) > this.getIndexOfStep(this.selectedStep)
|
||||
? 'hiddenStep'
|
||||
: ''} ${this.getIndexOfStep(stepArg) === 0 ? 'entrance' : ''}"
|
||||
<div
|
||||
class="stepperContainer ${this.overlay ? 'overlay' : ''}"
|
||||
style=${this.overlay ? `z-index: ${this.stepperZIndex};` : ''}
|
||||
@click=${this.handleOutsideClick}
|
||||
>
|
||||
${this.getIndexOfStep(stepArg) > 0
|
||||
? html`<div class="goBack" @click=${this.goBack}><span style="font-family: Inter"><-</span> go to previous step</div>`
|
||||
: ``}
|
||||
${this.steps.map((stepArg, stepIndex) => {
|
||||
const isSelected = stepArg === this.selectedStep;
|
||||
const isHidden =
|
||||
this.getIndexOfStep(stepArg) > this.getIndexOfStep(this.selectedStep);
|
||||
const isFirst = stepIndex === 0;
|
||||
const progressStepState = stepArg.progressStep ? this.getProgressStepState(stepArg) : null;
|
||||
return html`<dees-tile
|
||||
class="step ${isSelected ? 'selected' : ''} ${isHidden ? 'hiddenStep' : ''} ${isFirst ? 'entrance' : ''}"
|
||||
>
|
||||
<div slot="header" class="step-header">
|
||||
${!isFirst
|
||||
? html`<div class="goBack" @click=${this.goBack}>
|
||||
<span style="font-family: Inter"><-</span> go to previous step
|
||||
</div>`
|
||||
: html`<div class="goBack-spacer"></div>`}
|
||||
<div class="stepCounter">
|
||||
Step ${this.steps.findIndex((elementArg) => elementArg === stepArg) + 1} of
|
||||
${this.steps.length}
|
||||
Step ${stepIndex + 1} of ${this.steps.length}
|
||||
</div>
|
||||
</div>
|
||||
<div class="step-body">
|
||||
<div class="title">${stepArg.title}</div>
|
||||
<div class="content">${stepArg.content}</div>
|
||||
</div> `
|
||||
)}
|
||||
${stepArg.progressStep && progressStepState ? html`
|
||||
<div class="progressStep">
|
||||
<dees-progressbar
|
||||
.label=${progressStepState.label ?? stepArg.title}
|
||||
.percentage=${progressStepState.percentage ?? 0}
|
||||
.indeterminate=${progressStepState.indeterminate ?? false}
|
||||
.showPercentage=${progressStepState.showPercentage ?? true}
|
||||
.statusText=${progressStepState.statusText ?? ''}
|
||||
.terminalLines=${progressStepState.terminalLines ?? []}
|
||||
.statusRows=${progressStepState.statusRows ?? 3}
|
||||
></dees-progressbar>
|
||||
</div>
|
||||
` : ''}
|
||||
<div class="content ${stepArg.progressStep ? 'withProgressStep' : ''}">${stepArg.content}</div>
|
||||
</div>
|
||||
<div slot="footer" class="bottomButtons">
|
||||
${isSelected && this.activeForm !== null && !this.activeFormValid
|
||||
? html`<div class="stepHint">Complete form to continue</div>`
|
||||
: ''}
|
||||
${this.cancelable
|
||||
? html`<div
|
||||
class="bottomButton"
|
||||
@click=${() => this.handleCancelRequest()}
|
||||
>Cancel</div>`
|
||||
: ''}
|
||||
${stepArg.menuOptions?.map((actionArg, actionIndex) => {
|
||||
const isPrimary = actionIndex === stepArg.menuOptions!.length - 1;
|
||||
const isDisabled = isPrimary && this.activeForm !== null && !this.activeFormValid;
|
||||
return html`
|
||||
<div
|
||||
class="bottomButton ${isPrimary ? 'primary' : ''} ${isDisabled ? 'disabled' : ''}"
|
||||
@click=${() => this.handleMenuOptionClick(actionArg, isPrimary)}
|
||||
>${actionArg.name}</div>
|
||||
`;
|
||||
}) ?? ''}
|
||||
</div>
|
||||
</dees-tile>`;
|
||||
})}
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
@@ -210,39 +463,45 @@ export class DeesStepper extends DeesElement {
|
||||
public async firstUpdated() {
|
||||
await this.domtoolsPromise;
|
||||
await this.domtools.convenience.smartdelay.delayFor(0);
|
||||
if (!this.steps.length) {
|
||||
return;
|
||||
}
|
||||
this.prepareStepForActivation(this.steps[0]);
|
||||
this.selectedStep = this.steps[0];
|
||||
this.setScrollStatus();
|
||||
await this.updateComplete;
|
||||
await this.setScrollStatus();
|
||||
// Remove entrance class after initial animation completes
|
||||
await this.domtools.convenience.smartdelay.delayFor(350);
|
||||
this.shadowRoot!.querySelector('.step.entrance')?.classList.remove('entrance');
|
||||
}
|
||||
|
||||
public async updated() {
|
||||
this.setScrollStatus();
|
||||
public async updated(changedProperties: Map<string | number | symbol, unknown>) {
|
||||
if (!changedProperties.has('selectedStep') && !changedProperties.has('steps')) {
|
||||
return;
|
||||
}
|
||||
|
||||
await this.setScrollStatus();
|
||||
}
|
||||
|
||||
public scroller!: typeof domtools.plugins.SweetScroll.prototype;
|
||||
|
||||
public async setScrollStatus() {
|
||||
const stepperContainer = this.shadowRoot!.querySelector('.stepperContainer') as HTMLElement;
|
||||
const firstStepElement = this.shadowRoot!.querySelector('.step') as HTMLElement;
|
||||
const selectedStepElement = this.shadowRoot!.querySelector('.selected') as HTMLElement;
|
||||
if (!selectedStepElement) {
|
||||
return;
|
||||
}
|
||||
this.scanActiveForm(selectedStepElement);
|
||||
if (!stepperContainer.style.paddingTop) {
|
||||
stepperContainer.style.paddingTop = `${
|
||||
stepperContainer.offsetHeight / 2 - selectedStepElement.offsetHeight / 2
|
||||
}px`;
|
||||
}
|
||||
console.log('Setting scroll status');
|
||||
console.log(selectedStepElement);
|
||||
const scrollPosition =
|
||||
selectedStepElement.offsetTop -
|
||||
stepperContainer.offsetHeight / 2 +
|
||||
selectedStepElement.offsetHeight / 2;
|
||||
console.log(scrollPosition);
|
||||
const domtoolsInstance = await domtools.DomTools.setupDomTools();
|
||||
await domtools.DomTools.setupDomTools();
|
||||
if (!this.scroller) {
|
||||
this.scroller = new domtools.plugins.SweetScroll(
|
||||
{
|
||||
@@ -257,7 +516,11 @@ export class DeesStepper extends DeesElement {
|
||||
if (!this.selectedStep.validationFuncCalled && this.selectedStep.validationFunc) {
|
||||
this.selectedStep.abortController = new AbortController();
|
||||
this.selectedStep.validationFuncCalled = true;
|
||||
await this.selectedStep.validationFunc(this, selectedStepElement, this.selectedStep.abortController.signal);
|
||||
void this.runStepValidation(
|
||||
this.selectedStep,
|
||||
selectedStepElement,
|
||||
this.selectedStep.abortController.signal,
|
||||
);
|
||||
}
|
||||
this.scroller.to(scrollPosition);
|
||||
}
|
||||
@@ -275,6 +538,7 @@ export class DeesStepper extends DeesElement {
|
||||
currentStep.validationFuncCalled = false;
|
||||
const previousStep = this.steps[currentIndex - 1];
|
||||
previousStep.validationFuncCalled = false;
|
||||
this.prepareStepForActivation(previousStep);
|
||||
this.selectedStep = previousStep;
|
||||
await this.domtoolsPromise;
|
||||
await this.domtools.convenience.smartdelay.delayFor(100);
|
||||
@@ -294,6 +558,281 @@ export class DeesStepper extends DeesElement {
|
||||
currentStep.validationFuncCalled = false;
|
||||
const nextStep = this.steps[currentIndex + 1];
|
||||
nextStep.validationFuncCalled = false;
|
||||
this.prepareStepForActivation(nextStep);
|
||||
this.selectedStep = nextStep;
|
||||
}
|
||||
|
||||
public resetProgressStep(stepArg: IStep = this.selectedStep) {
|
||||
if (!stepArg?.progressStep) {
|
||||
return;
|
||||
}
|
||||
|
||||
stepArg.progressStepState = this.createInitialProgressStepState(stepArg);
|
||||
this.requestUpdate();
|
||||
}
|
||||
|
||||
public updateProgressStep(
|
||||
progressStateArg: Partial<IStepProgressState>,
|
||||
stepArg: IStep = this.selectedStep,
|
||||
) {
|
||||
if (!stepArg?.progressStep) {
|
||||
return;
|
||||
}
|
||||
|
||||
const currentProgressState = this.getProgressStepState(stepArg);
|
||||
stepArg.progressStepState = {
|
||||
...currentProgressState,
|
||||
...progressStateArg,
|
||||
terminalLines: progressStateArg.terminalLines
|
||||
? [...progressStateArg.terminalLines]
|
||||
: [...(currentProgressState.terminalLines ?? [])],
|
||||
};
|
||||
this.requestUpdate();
|
||||
}
|
||||
|
||||
public appendProgressStepLine(lineArg: string, stepArg: IStep = this.selectedStep) {
|
||||
if (!stepArg?.progressStep) {
|
||||
return;
|
||||
}
|
||||
|
||||
const currentProgressState = this.getProgressStepState(stepArg);
|
||||
this.updateProgressStep(
|
||||
{
|
||||
terminalLines: [...(currentProgressState.terminalLines ?? []), lineArg],
|
||||
},
|
||||
stepArg,
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Scans the currently selected step for a <dees-form> in its content. When
|
||||
* found, subscribes to the form's RxJS changeSubject so the primary
|
||||
* menuOption button can auto-enable/disable as required fields are filled.
|
||||
*
|
||||
* If the form reference is the same as the previous activation (e.g. on a
|
||||
* same-step re-render), we just recompute validity without re-subscribing.
|
||||
*/
|
||||
private scanActiveForm(selectedStepElement: HTMLElement) {
|
||||
const form = selectedStepElement.querySelector('dees-form') as DeesForm | null;
|
||||
if (form === this.activeForm) {
|
||||
this.recomputeFormValid();
|
||||
return;
|
||||
}
|
||||
this.activeFormSubscription?.unsubscribe();
|
||||
this.activeFormSubscription = undefined;
|
||||
this.activeForm = form;
|
||||
if (!form) {
|
||||
this.activeFormValid = true;
|
||||
return;
|
||||
}
|
||||
// Initial check before subscribing, in case the form's firstUpdated fires
|
||||
// synchronously between scan and subscribe.
|
||||
this.recomputeFormValid();
|
||||
this.activeFormSubscription = form.changeSubject.subscribe(() => {
|
||||
this.recomputeFormValid();
|
||||
});
|
||||
}
|
||||
|
||||
/**
|
||||
* Recomputes activeFormValid by checking every required field in the active
|
||||
* form for a non-empty value. Mirrors dees-form.updateRequiredStatus's logic
|
||||
* but stores the result on the stepper instead of mutating a submit button.
|
||||
*/
|
||||
private recomputeFormValid() {
|
||||
const form = this.activeForm;
|
||||
if (!form) {
|
||||
this.activeFormValid = true;
|
||||
return;
|
||||
}
|
||||
const fields = form.getFormElements();
|
||||
this.activeFormValid = fields.every(
|
||||
(field) => !field.required || (field.value !== null && field.value !== undefined && field.value !== ''),
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Click handler for menuOption buttons in the footer. For the primary (last)
|
||||
* button, if an active form is present, gates on required-field validity and
|
||||
* triggers the form's gatherAndDispatch() before running the action. The
|
||||
* action is awaited so any async work (e.g. goNext → scroll animation)
|
||||
* completes before the click handler returns.
|
||||
*/
|
||||
private async handleMenuOptionClick(
|
||||
optionArg: plugins.tsclass.website.IMenuItem<DeesStepper>,
|
||||
isPrimary: boolean,
|
||||
) {
|
||||
const form = this.activeForm;
|
||||
if (isPrimary && form) {
|
||||
if (!this.activeFormValid) return;
|
||||
await new Promise<void>((resolve) => {
|
||||
form.addEventListener('formData', () => resolve(), { once: true });
|
||||
form.gatherAndDispatch();
|
||||
});
|
||||
}
|
||||
await optionArg.action(this);
|
||||
}
|
||||
|
||||
private getProgressStepState(stepArg: IStep): IStepProgressState {
|
||||
if (!stepArg.progressStep) {
|
||||
return {};
|
||||
}
|
||||
|
||||
if (!stepArg.progressStepState) {
|
||||
stepArg.progressStepState = this.createInitialProgressStepState(stepArg);
|
||||
}
|
||||
|
||||
return stepArg.progressStepState;
|
||||
}
|
||||
|
||||
private createInitialProgressStepState(stepArg: IStep): IStepProgressState {
|
||||
return {
|
||||
label: stepArg.progressStep?.label ?? stepArg.title,
|
||||
percentage: stepArg.progressStep?.percentage ?? 0,
|
||||
indeterminate: stepArg.progressStep?.indeterminate ?? false,
|
||||
showPercentage: stepArg.progressStep?.showPercentage ?? true,
|
||||
statusText: stepArg.progressStep?.statusText ?? '',
|
||||
terminalLines: [...(stepArg.progressStep?.terminalLines ?? [])],
|
||||
statusRows: stepArg.progressStep?.statusRows ?? 3,
|
||||
};
|
||||
}
|
||||
|
||||
private prepareStepForActivation(stepArg?: IStep) {
|
||||
if (!stepArg?.progressStep) {
|
||||
return;
|
||||
}
|
||||
|
||||
stepArg.progressStepState = this.createInitialProgressStepState(stepArg);
|
||||
}
|
||||
|
||||
private async runStepValidation(
|
||||
stepArg: IStep,
|
||||
selectedStepElement: HTMLElement,
|
||||
signal: AbortSignal,
|
||||
): Promise<void> {
|
||||
try {
|
||||
await stepArg.validationFunc?.(this, selectedStepElement, signal);
|
||||
|
||||
if (signal.aborted) {
|
||||
return;
|
||||
}
|
||||
|
||||
if (stepArg.progressStep && stepArg.progressStep.autoAdvance !== false && this.selectedStep === stepArg) {
|
||||
this.goNext();
|
||||
}
|
||||
} catch (error) {
|
||||
if (signal.aborted) {
|
||||
return;
|
||||
}
|
||||
|
||||
if (stepArg.progressStep) {
|
||||
const errorText = error instanceof Error ? error.message : 'Unexpected error';
|
||||
this.appendProgressStepLine(`Error: ${errorText}`, stepArg);
|
||||
this.updateProgressStep(
|
||||
{
|
||||
indeterminate: false,
|
||||
statusText: errorText,
|
||||
},
|
||||
stepArg,
|
||||
);
|
||||
}
|
||||
|
||||
console.error(error);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Currently-open confirmation modal (if any). Prevents double-stacking when
|
||||
* the user clicks the backdrop or the Cancel button while a confirm modal
|
||||
* is already visible. The reference may become stale (point to a destroyed
|
||||
* modal) if the user dismisses the confirm modal by clicking its own
|
||||
* backdrop — so handleCancelRequest() uses isConnected to detect that.
|
||||
*/
|
||||
private cancelConfirmModal?: DeesModal;
|
||||
|
||||
/**
|
||||
* Click handler on .stepperContainer. Mirrors dees-modal.handleOutsideClick:
|
||||
* when the user clicks the empty backdrop area (target === stepperContainer,
|
||||
* not any descendant tile), trigger the cancel confirmation flow. Clicks
|
||||
* that originate inside a step tile have a different event.target and are
|
||||
* ignored here.
|
||||
*/
|
||||
private handleOutsideClick(eventArg: MouseEvent) {
|
||||
if (!this.overlay) return;
|
||||
if (!this.cancelable) return;
|
||||
eventArg.stopPropagation();
|
||||
const stepperContainer = this.shadowRoot!.querySelector('.stepperContainer');
|
||||
if (eventArg.target === stepperContainer) {
|
||||
this.handleCancelRequest();
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Shown by both the backdrop click and the Cancel button in the footer.
|
||||
* Presents a dees-modal asking the user to confirm cancellation. If they
|
||||
* confirm, the stepper and window layer are destroyed; otherwise the
|
||||
* confirm modal is dismissed and the stepper stays open.
|
||||
*
|
||||
* The isConnected check on the cached reference handles the case where the
|
||||
* user dismissed the previous confirm modal by clicking ITS OWN backdrop —
|
||||
* dees-modal.handleOutsideClick calls destroy() directly, bypassing our
|
||||
* action callbacks, so our cached reference would be stale without this
|
||||
* fallback check.
|
||||
*/
|
||||
public async handleCancelRequest() {
|
||||
if (!this.cancelable) return;
|
||||
if (this.cancelConfirmModal && this.cancelConfirmModal.isConnected) return;
|
||||
this.cancelConfirmModal = undefined;
|
||||
this.cancelConfirmModal = await DeesModal.createAndShow({
|
||||
heading: 'Cancel setup?',
|
||||
width: 'small',
|
||||
content: html`
|
||||
<p style="margin: 0;">
|
||||
Are you sure you want to cancel? Any progress on the current step will be lost.
|
||||
</p>
|
||||
`,
|
||||
menuOptions: [
|
||||
{
|
||||
name: 'Continue setup',
|
||||
action: async (modal) => {
|
||||
this.cancelConfirmModal = undefined;
|
||||
await modal!.destroy();
|
||||
},
|
||||
},
|
||||
{
|
||||
name: 'Yes, cancel',
|
||||
action: async (modal) => {
|
||||
this.cancelConfirmModal = undefined;
|
||||
modal!.destroy(); // fire-and-forget — starts the confirm modal fade
|
||||
const domtools = await this.domtoolsPromise;
|
||||
await domtools.convenience.smartdelay.delayFor(100);
|
||||
await this.destroy();
|
||||
},
|
||||
},
|
||||
],
|
||||
});
|
||||
}
|
||||
|
||||
public async destroy() {
|
||||
const domtools = await this.domtoolsPromise;
|
||||
const container = this.shadowRoot!.querySelector('.stepperContainer');
|
||||
if (this.selectedStep?.abortController) {
|
||||
this.selectedStep.abortController.abort();
|
||||
}
|
||||
container?.classList.add('predestroy');
|
||||
await domtools.convenience.smartdelay.delayFor(250);
|
||||
if (this.parentElement) {
|
||||
this.parentElement.removeChild(this);
|
||||
}
|
||||
if (this.windowLayer) {
|
||||
await this.windowLayer.destroy();
|
||||
}
|
||||
|
||||
// Tear down form subscription to avoid leaks when the overlay closes.
|
||||
this.activeFormSubscription?.unsubscribe();
|
||||
this.activeFormSubscription = undefined;
|
||||
this.activeForm = null;
|
||||
|
||||
// Unregister from z-index registry
|
||||
zIndexRegistry.unregister(this);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -45,6 +45,9 @@ export class DeesTile extends DeesElement {
|
||||
@property({ type: String })
|
||||
accessor heading: string = '';
|
||||
|
||||
@property({ type: String, reflect: true })
|
||||
accessor overscroll: 'contain' | 'auto' | 'none' = 'auto';
|
||||
|
||||
@state()
|
||||
accessor hasFooter: boolean = false;
|
||||
|
||||
@@ -56,7 +59,7 @@ export class DeesTile extends DeesElement {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
font-family: ${cssGeistFontFamily};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 3.9%)', 'hsl(0 0% 98%)')};
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
/* --- The frame --- */
|
||||
@@ -64,8 +67,8 @@ export class DeesTile extends DeesElement {
|
||||
position: relative;
|
||||
flex: 1;
|
||||
min-height: 0;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 100%)', 'hsl(0 0% 3.9%)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
background: var(--dees-color-bg-primary);
|
||||
border: 1px solid var(--dees-color-border-default);
|
||||
border-radius: 8px;
|
||||
overflow: hidden;
|
||||
display: flex;
|
||||
@@ -84,17 +87,30 @@ export class DeesTile extends DeesElement {
|
||||
font-size: 14px;
|
||||
font-weight: 500;
|
||||
letter-spacing: -0.01em;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 20%)', 'hsl(0 0% 63.9%)')};
|
||||
color: var(--dees-color-text-secondary);
|
||||
}
|
||||
|
||||
/* --- Content: the rounded inset --- */
|
||||
/* --- Content: the rounded inset ---
|
||||
Uses overflow-y: auto so that when a consumer (e.g. dees-modal) caps
|
||||
the tile with max-height, long content scrolls inside the tile
|
||||
instead of being clipped. For consumers without max-height
|
||||
(e.g. dees-stepper), the tile grows with content and the scroll
|
||||
never activates. Horizontal overflow stays clipped to preserve the
|
||||
rounded corners. */
|
||||
.tile-content {
|
||||
flex: 1;
|
||||
position: relative;
|
||||
border-radius: 8px;
|
||||
border-top: 1px solid ${cssManager.bdTheme('hsl(0 0% 93%)', 'hsl(0 0% 11%)')};
|
||||
border-bottom: 1px solid ${cssManager.bdTheme('hsl(0 0% 93%)', 'hsl(0 0% 11%)')};
|
||||
overflow: hidden;
|
||||
border-top: 1px solid var(--dees-color-border-subtle);
|
||||
border-bottom: 1px solid var(--dees-color-border-subtle);
|
||||
overflow-x: hidden;
|
||||
overflow-y: auto;
|
||||
scrollbar-width: thin;
|
||||
scrollbar-color: var(--dees-color-scrollbar-thumb) transparent;
|
||||
}
|
||||
|
||||
:host([overscroll="contain"]) .tile-content {
|
||||
overscroll-behavior: contain;
|
||||
}
|
||||
|
||||
.tile-content.no-footer {
|
||||
|
||||
@@ -5,5 +5,6 @@ export * from './dees-heading/index.js';
|
||||
export * from './dees-label/index.js';
|
||||
export * from './dees-pagination/index.js';
|
||||
export * from './dees-panel/index.js';
|
||||
export * from './dees-settings/index.js';
|
||||
export * from './dees-stepper/index.js';
|
||||
export * from './dees-tile/index.js';
|
||||
|
||||
@@ -1,6 +1,8 @@
|
||||
import { css, cssManager } from '@design.estate/dees-element';
|
||||
import { themeDefaultStyles } from '../../00theme.js';
|
||||
|
||||
export const viewerStyles = [
|
||||
themeDefaultStyles,
|
||||
cssManager.defaultStyles,
|
||||
css`
|
||||
:host {
|
||||
@@ -369,7 +371,7 @@ export const viewerStyles = [
|
||||
display: flex;
|
||||
align-items: center;
|
||||
font-size: 11px;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45%)', 'hsl(0 0% 55%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
width: 100%;
|
||||
box-sizing: border-box;
|
||||
position: relative;
|
||||
@@ -383,7 +385,7 @@ export const viewerStyles = [
|
||||
|
||||
.pdf-footer-left .pdf-footer-item + .pdf-footer-item {
|
||||
padding-left: 12px;
|
||||
border-left: 1px solid ${cssManager.bdTheme('hsl(0 0% 89.8%)', 'hsl(0 0% 14.9%)')};
|
||||
border-left: 1px solid var(--dees-color-border-default);
|
||||
}
|
||||
|
||||
.pdf-footer-center {
|
||||
|
||||
@@ -352,5 +352,80 @@ export const demoFunc = () => html`
|
||||
});
|
||||
}}>Test Responsive</dees-button>
|
||||
</div>
|
||||
|
||||
<div class="demo-section">
|
||||
<h3>Scrollable Content</h3>
|
||||
<p>When content exceeds the modal's max-height (<code>calc(100vh - 80px)</code>), the tile caps at that height and the content area scrolls inside. The heading and bottom buttons stay pinned.</p>
|
||||
<div class="button-grid">
|
||||
<dees-button @click=${() => {
|
||||
DeesModal.createAndShow({
|
||||
heading: 'Long Article',
|
||||
width: 'medium',
|
||||
content: html`
|
||||
<h4 style="margin-top: 0;">Lorem ipsum dolor sit amet</h4>
|
||||
${Array.from({ length: 40 }, (_, i) => html`
|
||||
<p>
|
||||
<strong>§ ${i + 1}.</strong>
|
||||
Lorem ipsum dolor sit amet, consectetur adipiscing elit. Sed do
|
||||
eiusmod tempor incididunt ut labore et dolore magna aliqua. Ut
|
||||
enim ad minim veniam, quis nostrud exercitation ullamco laboris
|
||||
nisi ut aliquip ex ea commodo consequat. Duis aute irure dolor
|
||||
in reprehenderit in voluptate velit esse cillum dolore eu fugiat
|
||||
nulla pariatur. Excepteur sint occaecat cupidatat non proident,
|
||||
sunt in culpa qui officia deserunt mollit anim id est laborum.
|
||||
</p>
|
||||
`)}
|
||||
`,
|
||||
menuOptions: [{
|
||||
name: 'Cancel',
|
||||
action: async (modal) => modal!.destroy()
|
||||
}, {
|
||||
name: 'Accept',
|
||||
action: async (modal) => modal!.destroy()
|
||||
}],
|
||||
});
|
||||
}}>Long Article</dees-button>
|
||||
|
||||
<dees-button @click=${() => {
|
||||
DeesModal.createAndShow({
|
||||
heading: 'Long List',
|
||||
width: 'small',
|
||||
content: html`
|
||||
<p>Selected items:</p>
|
||||
<ul style="padding-left: 20px; margin: 0;">
|
||||
${Array.from({ length: 80 }, (_, i) => html`
|
||||
<li style="padding: 4px 0;">Item ${i + 1} — option label</li>
|
||||
`)}
|
||||
</ul>
|
||||
`,
|
||||
menuOptions: [{
|
||||
name: 'Done',
|
||||
action: async (modal) => modal!.destroy()
|
||||
}],
|
||||
});
|
||||
}}>Long List</dees-button>
|
||||
|
||||
<dees-button @click=${() => {
|
||||
DeesModal.createAndShow({
|
||||
heading: 'Tall Form',
|
||||
width: 'medium',
|
||||
content: html`
|
||||
<dees-form>
|
||||
${Array.from({ length: 25 }, (_, i) => html`
|
||||
<dees-input-text .label=${`Field ${i + 1}`}></dees-input-text>
|
||||
`)}
|
||||
</dees-form>
|
||||
`,
|
||||
menuOptions: [{
|
||||
name: 'Cancel',
|
||||
action: async (modal) => modal!.destroy()
|
||||
}, {
|
||||
name: 'Submit',
|
||||
action: async (modal) => modal!.destroy()
|
||||
}],
|
||||
});
|
||||
}}>Tall Form</dees-button>
|
||||
</div>
|
||||
</div>
|
||||
</div>
|
||||
`
|
||||
@@ -129,7 +129,7 @@ export class DeesModal extends DeesElement {
|
||||
/* TODO: Migrate hardcoded values to --dees-* CSS variables */
|
||||
:host {
|
||||
font-family: ${cssGeistFontFamily};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 9%)', 'hsl(0 0% 95%)')};
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
.modalContainer {
|
||||
display: flex;
|
||||
@@ -231,7 +231,7 @@ export class DeesModal extends DeesElement {
|
||||
font-weight: 500;
|
||||
font-size: 13px;
|
||||
letter-spacing: -0.01em;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 20%)', 'hsl(0 0% 63.9%)')};
|
||||
color: var(--dees-color-text-secondary);
|
||||
white-space: nowrap;
|
||||
overflow: hidden;
|
||||
text-overflow: ellipsis;
|
||||
@@ -255,12 +255,12 @@ export class DeesModal extends DeesElement {
|
||||
cursor: pointer;
|
||||
transition: all 0.15s ease;
|
||||
background: transparent;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 55%)', 'hsl(0 0% 45%)')};
|
||||
color: var(--dees-color-text-muted);
|
||||
}
|
||||
|
||||
.heading .header-button:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 93%)', 'hsl(0 0% 12%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 20%)', 'hsl(0 0% 90%)')};
|
||||
background: var(--dees-color-hover);
|
||||
color: var(--dees-color-text-secondary);
|
||||
}
|
||||
|
||||
.heading .header-button:active {
|
||||
@@ -268,18 +268,9 @@ export class DeesModal extends DeesElement {
|
||||
}
|
||||
|
||||
.heading .header-button dees-icon {
|
||||
width: 14px;
|
||||
height: 14px;
|
||||
display: block;
|
||||
font-size: 14px;
|
||||
}
|
||||
|
||||
.content {
|
||||
overflow-y: auto;
|
||||
overflow-x: hidden;
|
||||
overscroll-behavior: contain;
|
||||
scrollbar-width: thin;
|
||||
scrollbar-color: ${cssManager.bdTheme('hsl(0 0% 85%)', 'hsl(0 0% 20%)')} transparent;
|
||||
}
|
||||
.bottomButtons {
|
||||
display: flex;
|
||||
flex-direction: row;
|
||||
@@ -302,8 +293,8 @@ export class DeesModal extends DeesElement {
|
||||
transition: all 0.15s ease;
|
||||
background: transparent;
|
||||
border: none;
|
||||
border-left: 1px solid ${cssManager.bdTheme('hsl(0 0% 93%)', 'hsl(0 0% 11%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 45%)', 'hsl(0 0% 55%)')};
|
||||
border-left: 1px solid var(--dees-color-border-subtle);
|
||||
color: var(--dees-color-text-muted);
|
||||
white-space: nowrap;
|
||||
display: flex;
|
||||
align-items: center;
|
||||
@@ -314,8 +305,8 @@ export class DeesModal extends DeesElement {
|
||||
}
|
||||
|
||||
.bottomButtons .bottomButton:hover {
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95%)', 'hsl(0 0% 10%)')};
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 90%)')};
|
||||
background: var(--dees-color-hover);
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
.bottomButtons .bottomButton:active {
|
||||
@@ -352,7 +343,7 @@ export class DeesModal extends DeesElement {
|
||||
${minWidthStyle ? `dees-tile { min-width: ${minWidthStyle}; }` : ''}
|
||||
</style>
|
||||
<div class="modalContainer" @click=${this.handleOutsideClick} style="z-index: ${this.modalZIndex}">
|
||||
<dees-tile class="${widthClass} ${mobileFullscreenClass}">
|
||||
<dees-tile class="${widthClass} ${mobileFullscreenClass}" .overscroll=${'contain'}>
|
||||
<div slot="header" class="heading">
|
||||
<div class="heading-text">${this.heading}</div>
|
||||
<div class="header-buttons">
|
||||
|
||||
+3
-3
@@ -67,7 +67,7 @@ export class DeesShoppingProductcard extends DeesElement {
|
||||
}
|
||||
|
||||
dees-tile:hover::part(outer) {
|
||||
border-color: ${cssManager.bdTheme('hsl(0 0% 79.8%)', 'hsl(0 0% 20.9%)')};
|
||||
border-color: var(--dees-color-border-strong);
|
||||
box-shadow: 0 4px 6px -1px hsl(0 0% 0% / 0.1), 0 2px 4px -2px hsl(0 0% 0% / 0.1);
|
||||
}
|
||||
|
||||
@@ -148,7 +148,7 @@ export class DeesShoppingProductcard extends DeesElement {
|
||||
.product-name {
|
||||
font-size: 14px;
|
||||
font-weight: 500;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 20%)', 'hsl(0 0% 63.9%)')};
|
||||
color: var(--dees-color-text-secondary);
|
||||
white-space: nowrap;
|
||||
overflow: hidden;
|
||||
text-overflow: ellipsis;
|
||||
@@ -204,7 +204,7 @@ export class DeesShoppingProductcard extends DeesElement {
|
||||
.price-current {
|
||||
font-size: 20px;
|
||||
font-weight: 600;
|
||||
color: ${cssManager.bdTheme('hsl(0 0% 9%)', 'hsl(0 0% 95%)')};
|
||||
color: var(--dees-color-text-primary);
|
||||
}
|
||||
|
||||
.price-original {
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user