Compare commits
33 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
| 3f5cb4570b | |||
| 428d2741d1 | |||
| 2f4c47f0d2 | |||
| 2be1ce6908 | |||
| c0375508f0 | |||
| 3e86ba034b | |||
| 05e74cbe2e | |||
| 8fbdbf9f64 | |||
| bfbc0f108e | |||
| bab7528f0b | |||
| 6047705e7d | |||
| ab19b561c4 | |||
| 7ef3613e91 | |||
| 940eebe29f | |||
| 8ecaffe165 | |||
| e5cb31ffb1 | |||
| 7c2635fc13 | |||
| eb3d396c68 | |||
| 13ba5670f0 | |||
| 961b811b7a | |||
| cd491e1517 | |||
| b8a03def79 | |||
| 2b6798083d | |||
| 3c7b5dc690 | |||
| 2f4afddf73 | |||
| 212a46894e | |||
| 653ef109be | |||
| a0b17132ad | |||
| 486ec11ce6 | |||
| a24d28d4e0 | |||
| 8cc45a53e9 | |||
| edf7a86f07 | |||
| 8b8a8ff943 |
@@ -1 +0,0 @@
|
|||||||
{"sessionId":"4b0f0a7f-f187-40a3-a38b-cb9a7e877011","pid":3110692,"acquiredAt":1775914414249}
|
|
||||||
+104
@@ -1,5 +1,109 @@
|
|||||||
# Changelog
|
# Changelog
|
||||||
|
|
||||||
|
## 2026-04-16 - 3.80.0 - feat(stepper,updater)
|
||||||
|
add progress-aware stepper flows and updater countdown states
|
||||||
|
|
||||||
|
- extend dees-stepper with embedded progressbar rendering, progress state helpers, and automatic progression for async validation steps
|
||||||
|
- rework dees-updater to run as a non-cancelable two-step flow with live progress updates, optional external links, and configurable close or reload completion actions
|
||||||
|
- refresh stepper and updater demos plus documentation to showcase auto-advancing progress steps and ready-state countdown behavior
|
||||||
|
|
||||||
|
## 2026-04-16 - 3.79.0 - feat(dees-progressbar)
|
||||||
|
add status panels, terminal output, and legacy progress input support
|
||||||
|
|
||||||
|
- Extend dees-progressbar with label, statusText, terminalLines, statusRows, indeterminate, and showPercentage properties.
|
||||||
|
- Support legacy value input and normalized progress values while clamping and formatting percentages consistently.
|
||||||
|
- Add fixed-height status and terminal-style output with spinner animation and auto-scroll behavior for live activity updates.
|
||||||
|
- Refresh the progressbar demo and readme examples to showcase determinate, indeterminate, terminal, and compatibility usage patterns.
|
||||||
|
|
||||||
|
## 2026-04-14 - 3.78.3 - fix(dees-table)
|
||||||
|
stabilize live updates by reusing row DOM and avoiding redundant layout recalculations
|
||||||
|
|
||||||
|
- reuse keyed table rows across live-sorted updates so existing row elements persist while cells reorder
|
||||||
|
- limit flash animation restarts to changed cells by tracking per-cell flash tokens
|
||||||
|
- avoid repeated column width measurements unless table layout inputs actually change
|
||||||
|
- replace async header and footer action rendering with direct mapped output to prevent comment node growth during updates
|
||||||
|
- add Chromium live update tests covering width measurement stability, comment growth, and row DOM reuse
|
||||||
|
|
||||||
|
## 2026-04-12 - 3.78.2 - fix(deps)
|
||||||
|
bump @design.estate/dees-wcctools to ^3.9.0
|
||||||
|
|
||||||
|
- Updates the @design.estate/dees-wcctools dependency from ^3.8.4 to ^3.9.0 in package.json.
|
||||||
|
|
||||||
|
## 2026-04-12 - 3.78.1 - fix(dees-simple-login)
|
||||||
|
use dees-tile for the login credentials container
|
||||||
|
|
||||||
|
- replace the custom login card wrapper with a dees-tile component
|
||||||
|
- update styles to target dees-tile and its content part while preserving form layout
|
||||||
|
- add a credentials heading to the login tile
|
||||||
|
|
||||||
|
## 2026-04-12 - 3.78.0 - feat(dees-settings)
|
||||||
|
add dees-settings layout component for displaying read-only settings with footer actions
|
||||||
|
|
||||||
|
- introduces a new dees-settings element with heading, description, settings field grid, and footer action support
|
||||||
|
- exports dees-settings from the 00group-layout module index
|
||||||
|
- adds demo examples covering populated, empty, and multi-action states
|
||||||
|
|
||||||
|
## 2026-04-12 - 3.77.0 - feat(dees-table)
|
||||||
|
add configurable cell flash comparison and border highlight mode
|
||||||
|
|
||||||
|
- adds column-level flashCompare support so update highlighting can detect meaningful changes for custom cell values
|
||||||
|
- adds flashBorder styling for cells with badges, icons, or custom rendered content where text-color flashing is not visible
|
||||||
|
- avoids false-positive flash animations for non-primitive cell values unless a custom comparator is provided
|
||||||
|
|
||||||
|
## 2026-04-12 - 3.76.1 - fix(demo-inputs)
|
||||||
|
wrap input component demos in dees-form containers for consistent form integration
|
||||||
|
|
||||||
|
- Adds dees-form wrappers across multiple input demo pages including checkbox, dropdown, file upload, iban, list, multitoggle, phone, quantity selector, radio group, tags, text, toggle, and typelist demos
|
||||||
|
- Keeps horizontal and grid example layouts intact while nesting them inside form containers
|
||||||
|
- Cleans up file upload and text demo markup to better match expected dees-form structure
|
||||||
|
|
||||||
|
## 2026-04-12 - 3.76.0 - feat(input)
|
||||||
|
separate label info tooltips from description text across input components
|
||||||
|
|
||||||
|
- adds a dedicated infoText property for dees-label tooltips while keeping description available for helper text rendered below inputs
|
||||||
|
- introduces a shared renderDescription() helper in the input base component and updates multiple input components to use the unified description styling
|
||||||
|
- updates demos and consuming components to migrate tooltip content from description to infoText where appropriate
|
||||||
|
|
||||||
|
## 2026-04-12 - 3.75.0 - feat(dees-tile)
|
||||||
|
add configurable overscroll handling to tile content and use it in modals
|
||||||
|
|
||||||
|
- introduces a reflected overscroll property on dees-tile with contain, auto, and none options
|
||||||
|
- moves tile content scrolling and scrollbar styling into dees-tile instead of modal-specific styling
|
||||||
|
- updates dees-modal to enable contained overscroll through the new dees-tile API
|
||||||
|
|
||||||
|
## 2026-04-12 - 3.74.2 - fix(modal,tile,input-text)
|
||||||
|
move scroll handling from tile content to modal and update input text demo to use changeSubject subscriptions
|
||||||
|
|
||||||
|
- bump @design.estate/dees-wcctools from ^3.8.2 to ^3.8.4
|
||||||
|
- set dees-tile content overflow to hidden and apply scroll styling through dees-modal part selectors
|
||||||
|
- simplify the interactive dees-input-text demo by subscribing directly to changeSubject for live value updates
|
||||||
|
|
||||||
|
## 2026-04-12 - 3.74.1 - fix(dees-input-text)
|
||||||
|
adjust password toggle and validation icon alignment in text input
|
||||||
|
|
||||||
|
- positions the password toggle and validation icon with fixed top offsets for improved vertical alignment
|
||||||
|
- updates the validation icon styling to use a larger themed icon without the circular background
|
||||||
|
|
||||||
|
## 2026-04-12 - 3.74.0 - feat(input-text)
|
||||||
|
add validated success state and text editing context menu to text inputs
|
||||||
|
|
||||||
|
- show a delayed checkmark confirmation for successful validation and hide inline validation text afterward
|
||||||
|
- move IBAN validation handling into the shared text input validation function
|
||||||
|
- improve the email validation demo to use a stricter regex-based check
|
||||||
|
- add cut, copy, paste, and select-all context menu actions for text inputs
|
||||||
|
|
||||||
|
## 2026-04-12 - 3.73.2 - fix(input,label)
|
||||||
|
correct validation state attribute handling in text inputs and refine label description icon styling
|
||||||
|
|
||||||
|
- Change dees-input-text validationState to reflect as a string attribute and align validation selectors with the emitted host attribute
|
||||||
|
- Wrap the dees-label description icon in a dedicated container to improve sizing, hover feedback, and alignment
|
||||||
|
|
||||||
|
## 2026-04-12 - 3.73.1 - fix(dees-label)
|
||||||
|
align label content and icon consistently using inline flex layout
|
||||||
|
|
||||||
|
- change the label container from inline-block to inline-flex with centered alignment
|
||||||
|
- remove icon-specific vertical transform in favor of layout-based alignment
|
||||||
|
|
||||||
## 2026-04-12 - 3.73.0 - feat(dees-label)
|
## 2026-04-12 - 3.73.0 - feat(dees-label)
|
||||||
expand dees-label demo coverage and update supporting dependencies
|
expand dees-label demo coverage and update supporting dependencies
|
||||||
|
|
||||||
|
|||||||
+2
-2
@@ -1,6 +1,6 @@
|
|||||||
{
|
{
|
||||||
"name": "@design.estate/dees-catalog",
|
"name": "@design.estate/dees-catalog",
|
||||||
"version": "3.73.0",
|
"version": "3.80.0",
|
||||||
"private": false,
|
"private": false,
|
||||||
"description": "A comprehensive library that provides dynamic web components for building sophisticated and modern web applications using JavaScript and TypeScript.",
|
"description": "A comprehensive library that provides dynamic web components for building sophisticated and modern web applications using JavaScript and TypeScript.",
|
||||||
"main": "dist_ts_web/index.js",
|
"main": "dist_ts_web/index.js",
|
||||||
@@ -18,7 +18,7 @@
|
|||||||
"dependencies": {
|
"dependencies": {
|
||||||
"@design.estate/dees-domtools": "^2.5.4",
|
"@design.estate/dees-domtools": "^2.5.4",
|
||||||
"@design.estate/dees-element": "^2.2.4",
|
"@design.estate/dees-element": "^2.2.4",
|
||||||
"@design.estate/dees-wcctools": "^3.8.2",
|
"@design.estate/dees-wcctools": "^3.9.0",
|
||||||
"@fortawesome/fontawesome-svg-core": "^7.2.0",
|
"@fortawesome/fontawesome-svg-core": "^7.2.0",
|
||||||
"@fortawesome/free-brands-svg-icons": "^7.2.0",
|
"@fortawesome/free-brands-svg-icons": "^7.2.0",
|
||||||
"@fortawesome/free-regular-svg-icons": "^7.2.0",
|
"@fortawesome/free-regular-svg-icons": "^7.2.0",
|
||||||
|
|||||||
Generated
+27
-6
@@ -15,8 +15,8 @@ importers:
|
|||||||
specifier: ^2.2.4
|
specifier: ^2.2.4
|
||||||
version: 2.2.4
|
version: 2.2.4
|
||||||
'@design.estate/dees-wcctools':
|
'@design.estate/dees-wcctools':
|
||||||
specifier: ^3.8.2
|
specifier: ^3.9.0
|
||||||
version: 3.8.2
|
version: 3.9.0
|
||||||
'@fortawesome/fontawesome-svg-core':
|
'@fortawesome/fontawesome-svg-core':
|
||||||
specifier: ^7.2.0
|
specifier: ^7.2.0
|
||||||
version: 7.2.0
|
version: 7.2.0
|
||||||
@@ -323,8 +323,8 @@ packages:
|
|||||||
'@design.estate/dees-element@2.2.4':
|
'@design.estate/dees-element@2.2.4':
|
||||||
resolution: {integrity: sha512-O9cA6flBMMd+pBwMQrZXwAWel9yVxgokolb+Em6gvkXxPJ0P/B5UDn4Vc2d4ts3ta55PTBm+l2dPeDVGx/bl7Q==}
|
resolution: {integrity: sha512-O9cA6flBMMd+pBwMQrZXwAWel9yVxgokolb+Em6gvkXxPJ0P/B5UDn4Vc2d4ts3ta55PTBm+l2dPeDVGx/bl7Q==}
|
||||||
|
|
||||||
'@design.estate/dees-wcctools@3.8.2':
|
'@design.estate/dees-wcctools@3.9.0':
|
||||||
resolution: {integrity: sha512-A55XHeWExxxojdERAmedrZeyTGeK01ax5ct46VbjMeH65HbgBiTF4EOHfS6rjdTp+9VD3vXd0efhzyOxOS6uFw==}
|
resolution: {integrity: sha512-0vZBaGBEGIbl8hx+8BezIIea3U5T7iSHHF9VqlJZGf+nOFIW4zBAxcCljH8YzZ1Yayp6BEjxp/pQXjHN2YB3Jg==}
|
||||||
|
|
||||||
'@emnapi/core@1.8.1':
|
'@emnapi/core@1.8.1':
|
||||||
resolution: {integrity: sha512-AvT9QFpxK0Zd8J0jopedNm+w/2fIzvtPKPjqyw9jwvBaReTTqPBk9Hixaz7KbjimP+QNz605/XnjFcDAL2pqBg==}
|
resolution: {integrity: sha512-AvT9QFpxK0Zd8J0jopedNm+w/2fIzvtPKPjqyw9jwvBaReTTqPBk9Hixaz7KbjimP+QNz605/XnjFcDAL2pqBg==}
|
||||||
@@ -2070,6 +2070,12 @@ packages:
|
|||||||
'@types/debug@4.1.12':
|
'@types/debug@4.1.12':
|
||||||
resolution: {integrity: sha512-vIChWdVG3LG1SMxEvI/AK+FWJthlrqlTu7fbrlywTkkaONwk/UAGaULXRlf8vkzFBLVm0zkMdCquhL5aOjhXPQ==}
|
resolution: {integrity: sha512-vIChWdVG3LG1SMxEvI/AK+FWJthlrqlTu7fbrlywTkkaONwk/UAGaULXRlf8vkzFBLVm0zkMdCquhL5aOjhXPQ==}
|
||||||
|
|
||||||
|
'@types/dom-mediacapture-transform@0.1.11':
|
||||||
|
resolution: {integrity: sha512-Y2p+nGf1bF2XMttBnsVPHUWzRRZzqUoJAKmiP10b5umnO6DDrWI0BrGDJy1pOHoOULVmGSfFNkQrAlC5dcj6nQ==}
|
||||||
|
|
||||||
|
'@types/dom-webcodecs@0.1.13':
|
||||||
|
resolution: {integrity: sha512-O5hkiFIcjjszPIYyUSyvScyvrBoV3NOEEZx/pMlsu44TKzWNkLVBBxnxJz42in5n3QIolYOcBYFCPZZ0h8SkwQ==}
|
||||||
|
|
||||||
'@types/fs-extra@11.0.4':
|
'@types/fs-extra@11.0.4':
|
||||||
resolution: {integrity: sha512-yTbItCNreRooED33qjunPthRcSjERP1r4MqCZc7wv0u2sUkzTFp45tgUfS5+r7FrZPdmCCNflLhVSP/o+SemsQ==}
|
resolution: {integrity: sha512-yTbItCNreRooED33qjunPthRcSjERP1r4MqCZc7wv0u2sUkzTFp45tgUfS5+r7FrZPdmCCNflLhVSP/o+SemsQ==}
|
||||||
|
|
||||||
@@ -3136,6 +3142,9 @@ packages:
|
|||||||
mdurl@2.0.0:
|
mdurl@2.0.0:
|
||||||
resolution: {integrity: sha512-Lf+9+2r+Tdp5wXDXC4PcIBjTDtq4UKjCPMQhKIuzpJNW0b96kVqSwW0bT7FhRSfmAiFYgP+SCRvdrDozfh0U5w==}
|
resolution: {integrity: sha512-Lf+9+2r+Tdp5wXDXC4PcIBjTDtq4UKjCPMQhKIuzpJNW0b96kVqSwW0bT7FhRSfmAiFYgP+SCRvdrDozfh0U5w==}
|
||||||
|
|
||||||
|
mediabunny@1.40.1:
|
||||||
|
resolution: {integrity: sha512-HU/stGzAkdWaJIly6ypbUVgAUvT9kt39DIg0IaErR7/1fwtTmgUYs4i8uEPYcgcjPjbB9gtBmUXOLnXi6J2LDw==}
|
||||||
|
|
||||||
memory-pager@1.5.0:
|
memory-pager@1.5.0:
|
||||||
resolution: {integrity: sha512-ZS4Bp4r/Zoeq6+NLJpP+0Zzm0pR8whtGPf1XExKLJBAczGMnSi3It14OiNCStjQjM6NU1okjQGSxgEZN8eBYKg==}
|
resolution: {integrity: sha512-ZS4Bp4r/Zoeq6+NLJpP+0Zzm0pR8whtGPf1XExKLJBAczGMnSi3It14OiNCStjQjM6NU1okjQGSxgEZN8eBYKg==}
|
||||||
|
|
||||||
@@ -4711,7 +4720,7 @@ snapshots:
|
|||||||
dependencies:
|
dependencies:
|
||||||
'@design.estate/dees-domtools': 2.5.4
|
'@design.estate/dees-domtools': 2.5.4
|
||||||
'@design.estate/dees-element': 2.2.4
|
'@design.estate/dees-element': 2.2.4
|
||||||
'@design.estate/dees-wcctools': 3.8.2
|
'@design.estate/dees-wcctools': 3.9.0
|
||||||
'@fortawesome/fontawesome-svg-core': 7.2.0
|
'@fortawesome/fontawesome-svg-core': 7.2.0
|
||||||
'@fortawesome/free-brands-svg-icons': 7.2.0
|
'@fortawesome/free-brands-svg-icons': 7.2.0
|
||||||
'@fortawesome/free-regular-svg-icons': 7.2.0
|
'@fortawesome/free-regular-svg-icons': 7.2.0
|
||||||
@@ -4787,12 +4796,13 @@ snapshots:
|
|||||||
- supports-color
|
- supports-color
|
||||||
- vue
|
- vue
|
||||||
|
|
||||||
'@design.estate/dees-wcctools@3.8.2':
|
'@design.estate/dees-wcctools@3.9.0':
|
||||||
dependencies:
|
dependencies:
|
||||||
'@design.estate/dees-domtools': 2.5.4
|
'@design.estate/dees-domtools': 2.5.4
|
||||||
'@design.estate/dees-element': 2.2.4
|
'@design.estate/dees-element': 2.2.4
|
||||||
'@push.rocks/smartdelay': 3.0.5
|
'@push.rocks/smartdelay': 3.0.5
|
||||||
lit: 3.3.2
|
lit: 3.3.2
|
||||||
|
mediabunny: 1.40.1
|
||||||
transitivePeerDependencies:
|
transitivePeerDependencies:
|
||||||
- '@nuxt/kit'
|
- '@nuxt/kit'
|
||||||
- react
|
- react
|
||||||
@@ -7245,6 +7255,12 @@ snapshots:
|
|||||||
dependencies:
|
dependencies:
|
||||||
'@types/ms': 2.1.0
|
'@types/ms': 2.1.0
|
||||||
|
|
||||||
|
'@types/dom-mediacapture-transform@0.1.11':
|
||||||
|
dependencies:
|
||||||
|
'@types/dom-webcodecs': 0.1.13
|
||||||
|
|
||||||
|
'@types/dom-webcodecs@0.1.13': {}
|
||||||
|
|
||||||
'@types/fs-extra@11.0.4':
|
'@types/fs-extra@11.0.4':
|
||||||
dependencies:
|
dependencies:
|
||||||
'@types/jsonfile': 6.1.4
|
'@types/jsonfile': 6.1.4
|
||||||
@@ -8468,6 +8484,11 @@ snapshots:
|
|||||||
|
|
||||||
mdurl@2.0.0: {}
|
mdurl@2.0.0: {}
|
||||||
|
|
||||||
|
mediabunny@1.40.1:
|
||||||
|
dependencies:
|
||||||
|
'@types/dom-mediacapture-transform': 0.1.11
|
||||||
|
'@types/dom-webcodecs': 0.1.13
|
||||||
|
|
||||||
memory-pager@1.5.0: {}
|
memory-pager@1.5.0: {}
|
||||||
|
|
||||||
micromark-core-commonmark@2.0.3:
|
micromark-core-commonmark@2.0.3:
|
||||||
|
|||||||
@@ -59,8 +59,8 @@ For developers working on this library, please refer to the [UI Components Playb
|
|||||||
| **Forms** | [`DeesForm`](#deesform), [`DeesInputText`](#deesinputtext), [`DeesInputCheckbox`](#deesinputcheckbox), [`DeesInputDropdown`](#deesinputdropdown), [`DeesInputRadiogroup`](#deesinputradiogroup), [`DeesInputFileupload`](#deesinputfileupload), [`DeesInputIban`](#deesinputiban), [`DeesInputPhone`](#deesinputphone), [`DeesInputQuantitySelector`](#deesinputquantityselector), [`DeesInputMultitoggle`](#deesinputmultitoggle), [`DeesInputToggle`](#deesinputtoggle), [`DeesInputTags`](#deesinputtags), [`DeesInputTypelist`](#deesinputtypelist), [`DeesInputList`](#deesinputlist), [`DeesInputProfilepicture`](#deesinputprofilepicture), [`DeesInputRichtext`](#deesinputrichtext), [`DeesInputWysiwyg`](#deesinputwysiwyg), [`DeesInputDatepicker`](#deesinputdatepicker), [`DeesInputSearchselect`](#deesinputsearchselect), [`DeesInputCode`](#deesinputcode), [`DeesFormSubmit`](#deesformsubmit) |
|
| **Forms** | [`DeesForm`](#deesform), [`DeesInputText`](#deesinputtext), [`DeesInputCheckbox`](#deesinputcheckbox), [`DeesInputDropdown`](#deesinputdropdown), [`DeesInputRadiogroup`](#deesinputradiogroup), [`DeesInputFileupload`](#deesinputfileupload), [`DeesInputIban`](#deesinputiban), [`DeesInputPhone`](#deesinputphone), [`DeesInputQuantitySelector`](#deesinputquantityselector), [`DeesInputMultitoggle`](#deesinputmultitoggle), [`DeesInputToggle`](#deesinputtoggle), [`DeesInputTags`](#deesinputtags), [`DeesInputTypelist`](#deesinputtypelist), [`DeesInputList`](#deesinputlist), [`DeesInputProfilepicture`](#deesinputprofilepicture), [`DeesInputRichtext`](#deesinputrichtext), [`DeesInputWysiwyg`](#deesinputwysiwyg), [`DeesInputDatepicker`](#deesinputdatepicker), [`DeesInputSearchselect`](#deesinputsearchselect), [`DeesInputCode`](#deesinputcode), [`DeesFormSubmit`](#deesformsubmit) |
|
||||||
| **App Shell (Layout)** | [`DeesAppui`](#deesappui-️), [`DeesAppuiMainmenu`](#deesappuimainmenu), [`DeesAppuiSecondarymenu`](#deesappuisecondarymenu), [`DeesAppuiMaincontent`](#deesappuimaincontent), [`DeesAppuiAppbar`](#deesappuiappbar), [`DeesAppuiActivitylog`](#deesappuiactivitylog), [`DeesAppuiBottombar`](#deesappuibottombar), [`DeesAppuiProfiledropdown`](#deesappuiprofiledropdown), [`DeesAppuiTabs`](#deesappuitabs), [`DeesMobileNavigation`](#deesmobilenavigation), [`DeesDashboardGrid`](#deesdashboardgrid) |
|
| **App Shell (Layout)** | [`DeesAppui`](#deesappui-️), [`DeesAppuiMainmenu`](#deesappuimainmenu), [`DeesAppuiSecondarymenu`](#deesappuisecondarymenu), [`DeesAppuiMaincontent`](#deesappuimaincontent), [`DeesAppuiAppbar`](#deesappuiappbar), [`DeesAppuiActivitylog`](#deesappuiactivitylog), [`DeesAppuiBottombar`](#deesappuibottombar), [`DeesAppuiProfiledropdown`](#deesappuiprofiledropdown), [`DeesAppuiTabs`](#deesappuitabs), [`DeesMobileNavigation`](#deesmobilenavigation), [`DeesDashboardGrid`](#deesdashboardgrid) |
|
||||||
| **Data Display** | [`DeesTable`](#deestable), [`DeesDataviewCodebox`](#deesdataviewcodebox), [`DeesDataviewStatusobject`](#deesdataviewstatusobject), [`DeesPdf`](#deespdf), [`DeesStatsGrid`](#deesstatsgrid), [`DeesPagination`](#deespagination), [`DeesStorageBrowser`](#deesstorgebrowser) |
|
| **Data Display** | [`DeesTable`](#deestable), [`DeesDataviewCodebox`](#deesdataviewcodebox), [`DeesDataviewStatusobject`](#deesdataviewstatusobject), [`DeesPdf`](#deespdf), [`DeesStatsGrid`](#deesstatsgrid), [`DeesPagination`](#deespagination), [`DeesStorageBrowser`](#deesstorgebrowser) |
|
||||||
| **Media & Tiles** | [`DeesTilePdf`](#deestilepdf), [`DeesTileImage`](#deestileimage), [`DeesTileAudio`](#deestileaudio), [`DeesTileVideo`](#deestilevideo), [`DeesTileNote`](#deestilenote), [`DeesTileFolder`](#deestilefolder), [`DeesPreview`](#deespreview), [`DeesPdfViewer`](#deespdfviewer), [`DeesPdfPreview`](#deespdfpreview), [`DeesImageViewer`](#deesimageviewer), [`DeesAudioViewer`](#deesaudioviewer), [`DeesVideoViewer`](#deesvideoviewer) |
|
| **Media & Thumbnails** | [`DeesThumbnailPdf`](#deesthumbnailpdf), [`DeesThumbnailImage`](#deesthumbnailimage), [`DeesThumbnailAudio`](#deesthumbnailaudio), [`DeesThumbnailVideo`](#deesthumbnalvideo), [`DeesThumbnailNote`](#deesthumbnailnote), [`DeesThumbnailFolder`](#deesthumbnailfolder), [`DeesPreview`](#deespreview), [`DeesPdfViewer`](#deespdfviewer), [`DeesImageViewer`](#deesimageviewer), [`DeesAudioViewer`](#deesaudioviewer), [`DeesVideoViewer`](#deesvideoviewer) |
|
||||||
| **Visualization** | [`DeesChartArea`](#deeschartarea), [`DeesChartLog`](#deeschartlog) |
|
| **Visualization** | [`DeesChartArea`](#deeschartarea), [`DeesChartBar`](#deeschartbar), [`DeesChartDonut`](#deeschartdonut), [`DeesChartGauge`](#deeschartgauge), [`DeesChartRadar`](#deeschartradar), [`DeesChartLog`](#deeschartlog) |
|
||||||
| **Dialogs & Overlays** | [`DeesModal`](#deesmodal), [`DeesContextmenu`](#deescontextmenu), [`DeesSpeechbubble`](#deesspeechbubble), [`DeesWindowlayer`](#deeswindowlayer) |
|
| **Dialogs & Overlays** | [`DeesModal`](#deesmodal), [`DeesContextmenu`](#deescontextmenu), [`DeesSpeechbubble`](#deesspeechbubble), [`DeesWindowlayer`](#deeswindowlayer) |
|
||||||
| **Navigation** | [`DeesStepper`](#deesstepper), [`DeesProgressbar`](#deesprogressbar) |
|
| **Navigation** | [`DeesStepper`](#deesstepper), [`DeesProgressbar`](#deesprogressbar) |
|
||||||
| **Workspace / IDE** | [`DeesWorkspace`](#deesworkspace), [`DeesWorkspaceMonaco`](#deesworkspacemonaco), [`DeesWorkspaceDiffEditor`](#deesworkspacediffeditor), [`DeesWorkspaceFiletree`](#deesworkspacefiletree), [`DeesWorkspaceTerminal`](#deesworkspaceterminal), [`DeesWorkspaceTerminalPreview`](#deesworkspaceterminalpreview), [`DeesWorkspaceMarkdown`](#deesworkspacemarkdown), [`DeesWorkspaceMarkdownoutlet`](#deesworkspacemarkdownoutlet), [`DeesWorkspaceBottombar`](#deesworkspacebottombar) |
|
| **Workspace / IDE** | [`DeesWorkspace`](#deesworkspace), [`DeesWorkspaceMonaco`](#deesworkspacemonaco), [`DeesWorkspaceDiffEditor`](#deesworkspacediffeditor), [`DeesWorkspaceFiletree`](#deesworkspacefiletree), [`DeesWorkspaceTerminal`](#deesworkspaceterminal), [`DeesWorkspaceTerminalPreview`](#deesworkspaceterminalpreview), [`DeesWorkspaceMarkdown`](#deesworkspacemarkdown), [`DeesWorkspaceMarkdownoutlet`](#deesworkspacemarkdownoutlet), [`DeesWorkspaceBottombar`](#deesworkspacebottombar) |
|
||||||
@@ -143,14 +143,13 @@ Display icons from FontAwesome and Lucide icon libraries with library prefixes.
|
|||||||
```
|
```
|
||||||
|
|
||||||
#### `DeesLabel`
|
#### `DeesLabel`
|
||||||
Text label component with optional icon and status indicators.
|
Text label component with optional required indicator and info tooltip. Used internally by all input components.
|
||||||
|
|
||||||
```typescript
|
```typescript
|
||||||
<dees-label
|
<dees-label
|
||||||
text="Status" // Label text
|
.label=${'Email Address'} // Label text
|
||||||
icon="info-circle" // Optional: icon name
|
.required=${true} // Optional: shows red asterisk
|
||||||
type="info" // Options: default, info, success, warning, error
|
.infoText=${'We will never share your email'} // Optional: shows hover info icon with tooltip
|
||||||
size="medium" // Options: small, medium, large
|
|
||||||
></dees-label>
|
></dees-label>
|
||||||
```
|
```
|
||||||
|
|
||||||
@@ -321,7 +320,7 @@ Container component for form elements with built-in validation and data handling
|
|||||||
```
|
```
|
||||||
|
|
||||||
#### `DeesInputText`
|
#### `DeesInputText`
|
||||||
Text input field with validation and formatting options.
|
Text input field with validation, info tooltips, description text, and context menu (Cut/Copy/Paste/Select All).
|
||||||
|
|
||||||
```typescript
|
```typescript
|
||||||
<dees-input-text
|
<dees-input-text
|
||||||
@@ -330,10 +329,20 @@ Text input field with validation and formatting options.
|
|||||||
value="initial@value.com" // Initial value
|
value="initial@value.com" // Initial value
|
||||||
required // Makes the field required
|
required // Makes the field required
|
||||||
disabled // Disables the input
|
disabled // Disables the input
|
||||||
placeholder="Enter your email"
|
.infoText=${'Hover icon tooltip text'} // Shows ⓘ icon on label with hover tooltip
|
||||||
|
.description=${'Permanent help text below the input'} // Small text below the input
|
||||||
|
.validationFunction=${(value) => { // Auto-validates on every keystroke
|
||||||
|
const emailRegex = /^[^\s@]+@[^\s@]+\.[^\s@]+$/;
|
||||||
|
if (emailRegex.test(value)) {
|
||||||
|
return { valid: true, message: 'Email is valid' };
|
||||||
|
}
|
||||||
|
return { valid: false, message: 'Please enter a valid email' };
|
||||||
|
}}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
```
|
```
|
||||||
|
|
||||||
|
> 💡 **All input components** share these common properties from `DeesInputBase`: `key`, `label`, `required`, `disabled`, `infoText`, `description`, `layoutMode`, `labelPosition`.
|
||||||
|
|
||||||
#### `DeesInputCheckbox`
|
#### `DeesInputCheckbox`
|
||||||
Checkbox input component for boolean values.
|
Checkbox input component for boolean values.
|
||||||
|
|
||||||
@@ -1499,31 +1508,56 @@ const layer = await DeesWindowLayer.createAndShow({
|
|||||||
### Navigation Components
|
### Navigation Components
|
||||||
|
|
||||||
#### `DeesStepper`
|
#### `DeesStepper`
|
||||||
Multi-step navigation component for guided user flows.
|
Multi-step navigation component for guided user flows, including optional auto-advancing progress steps that can render `dees-progressbar` status output between form steps.
|
||||||
|
|
||||||
```typescript
|
```typescript
|
||||||
<dees-stepper
|
<dees-stepper
|
||||||
.steps=${[
|
.steps=${[
|
||||||
{ key: 'personal', label: 'Personal Info', content: html`<div>Form 1</div>` },
|
{
|
||||||
{ key: 'address', label: 'Address', content: html`<div>Form 2</div>` },
|
title: 'Account Setup',
|
||||||
{ key: 'confirm', label: 'Confirmation', content: html`<div>Review</div>` }
|
content: html`<dees-form>...</dees-form>`,
|
||||||
|
menuOptions: [{ name: 'Continue', action: async (stepper) => stepper?.goNext() }]
|
||||||
|
},
|
||||||
|
{
|
||||||
|
title: 'Provision Workspace',
|
||||||
|
content: html`<p>Preparing your environment...</p>`,
|
||||||
|
progressStep: {
|
||||||
|
label: 'Workspace setup',
|
||||||
|
indeterminate: true,
|
||||||
|
statusRows: 4,
|
||||||
|
terminalLines: ['Allocating workspace']
|
||||||
|
},
|
||||||
|
validationFunc: async (stepper, _element, signal) => {
|
||||||
|
stepper.updateProgressStep({ percentage: 35, statusText: 'Installing dependencies...' });
|
||||||
|
stepper.appendProgressStepLine('Installing dependencies');
|
||||||
|
if (signal?.aborted) return;
|
||||||
|
stepper.updateProgressStep({ percentage: 100, indeterminate: false, statusText: 'Workspace ready.' });
|
||||||
|
}
|
||||||
|
}
|
||||||
]}
|
]}
|
||||||
currentStep="personal"
|
|
||||||
@step-change=${handleStepChange}
|
|
||||||
@complete=${handleComplete}
|
|
||||||
></dees-stepper>
|
></dees-stepper>
|
||||||
```
|
```
|
||||||
|
|
||||||
#### `DeesProgressbar`
|
#### `DeesProgressbar`
|
||||||
Progress indicator component for tracking completion status.
|
Progress indicator component for tracking completion status, with optional fixed-height status text or terminal-style recent activity output.
|
||||||
|
|
||||||
```typescript
|
```typescript
|
||||||
<dees-progressbar
|
<dees-progressbar
|
||||||
value={75}
|
.percentage=${75}
|
||||||
label="Uploading"
|
label="Uploading"
|
||||||
showPercentage
|
statusText="Uploading thumbnails to edge cache..."
|
||||||
type="determinate" // Options: determinate, indeterminate
|
.statusRows=${2}
|
||||||
status="normal" // Options: normal, success, warning, error
|
></dees-progressbar>
|
||||||
|
|
||||||
|
<dees-progressbar
|
||||||
|
label="Installing dependencies"
|
||||||
|
.indeterminate=${true}
|
||||||
|
.statusRows=${4}
|
||||||
|
.terminalLines=${[
|
||||||
|
'Resolving workspace packages',
|
||||||
|
'Downloading tarballs',
|
||||||
|
'Linking local binaries'
|
||||||
|
]}
|
||||||
></dees-progressbar>
|
></dees-progressbar>
|
||||||
```
|
```
|
||||||
|
|
||||||
@@ -1561,6 +1595,33 @@ Theme provider component that wraps children and provides CSS custom properties
|
|||||||
- Works with dark/light mode
|
- Works with dark/light mode
|
||||||
- Overrides cascade to all child components
|
- Overrides cascade to all child components
|
||||||
|
|
||||||
|
#### `DeesUpdater`
|
||||||
|
Updater controller that opens a non-cancelable `dees-stepper` flow with a progress step and a ready step.
|
||||||
|
|
||||||
|
```typescript
|
||||||
|
const updater = await DeesUpdater.createAndShow({
|
||||||
|
currentVersion: '3.79.0',
|
||||||
|
updatedVersion: '3.80.0',
|
||||||
|
moreInfoUrl: 'https://code.foss.global/design.estate/dees-catalog',
|
||||||
|
changelogUrl: 'https://code.foss.global/design.estate/dees-catalog/-/blob/main/changelog.md',
|
||||||
|
successAction: 'reload',
|
||||||
|
successDelayMs: 10000,
|
||||||
|
});
|
||||||
|
|
||||||
|
updater.updateProgress({
|
||||||
|
percentage: 35,
|
||||||
|
statusText: 'Downloading signed bundle...',
|
||||||
|
terminalLines: ['Checking release manifest', 'Downloading signed bundle']
|
||||||
|
});
|
||||||
|
|
||||||
|
updater.appendProgressLine('Verifying checksum');
|
||||||
|
updater.updateProgress({ percentage: 72, statusText: 'Verifying checksum...' });
|
||||||
|
|
||||||
|
await updater.markUpdateReady();
|
||||||
|
```
|
||||||
|
|
||||||
|
After `markUpdateReady()`, the updater switches to a second countdown step with a determinate progress bar and runs the configured success action when the timer reaches zero.
|
||||||
|
|
||||||
---
|
---
|
||||||
|
|
||||||
### Workspace / IDE Components 💻
|
### Workspace / IDE Components 💻
|
||||||
@@ -1780,7 +1841,7 @@ interface ITileFolderItem {
|
|||||||
|
|
||||||
## License and Legal Information
|
## License and Legal Information
|
||||||
|
|
||||||
This repository contains open-source code licensed under the MIT License. A copy of the license can be found in the [LICENSE](./license) file.
|
This repository contains open-source code licensed under the MIT License. A copy of the license can be found in the [LICENSE](./LICENSE) file.
|
||||||
|
|
||||||
**Please note:** The MIT License does not grant permission to use the trade names, trademarks, service marks, or product names of the project, except as required for reasonable and customary use in describing the origin of the work and reproducing the content of the NOTICE file.
|
**Please note:** The MIT License does not grant permission to use the trade names, trademarks, service marks, or product names of the project, except as required for reasonable and customary use in describing the origin of the work and reproducing the content of the NOTICE file.
|
||||||
|
|
||||||
@@ -1798,5 +1859,3 @@ Registered at District Court Bremen HRB 35230 HB, Germany
|
|||||||
For any legal inquiries or further information, please contact us via email at hello@task.vc.
|
For any legal inquiries or further information, please contact us via email at hello@task.vc.
|
||||||
|
|
||||||
By using this repository, you acknowledge that you have read this section, agree to comply with its terms, and understand that the licensing of the code does not imply endorsement by Task Venture Capital GmbH of any derivative works.
|
By using this repository, you acknowledge that you have read this section, agree to comply with its terms, and understand that the licensing of the code does not imply endorsement by Task Venture Capital GmbH of any derivative works.
|
||||||
|
|
||||||
By using this repository, you acknowledge that you have read this section, agree to comply with its terms, and understand that the licensing of the code does not imply endorsement by Task Venture Capital GmbH of any derivative works.
|
|
||||||
|
|||||||
@@ -0,0 +1,167 @@
|
|||||||
|
import { expect, tap } from '@git.zone/tstest/tapbundle';
|
||||||
|
import * as deesCatalog from '../ts_web/index.js';
|
||||||
|
import type {
|
||||||
|
Column,
|
||||||
|
ISortDescriptor,
|
||||||
|
} from '../ts_web/elements/00group-dataview/dees-table/index.js';
|
||||||
|
|
||||||
|
interface ITestRow {
|
||||||
|
id: string;
|
||||||
|
score: number;
|
||||||
|
label: string;
|
||||||
|
}
|
||||||
|
|
||||||
|
const testColumns: Column<ITestRow>[] = [
|
||||||
|
{ key: 'id', header: 'ID' },
|
||||||
|
{ key: 'score', header: 'Score' },
|
||||||
|
{ key: 'label', header: 'Label' },
|
||||||
|
];
|
||||||
|
|
||||||
|
const scoreSort: ISortDescriptor[] = [{ key: 'score', dir: 'desc' }];
|
||||||
|
|
||||||
|
const waitForNextFrame = async () => {
|
||||||
|
await new Promise<void>((resolve) => {
|
||||||
|
requestAnimationFrame(() => resolve());
|
||||||
|
});
|
||||||
|
};
|
||||||
|
|
||||||
|
const waitForMacrotask = async () => {
|
||||||
|
await new Promise<void>((resolve) => {
|
||||||
|
window.setTimeout(() => resolve(), 0);
|
||||||
|
});
|
||||||
|
};
|
||||||
|
|
||||||
|
const settleTable = async (table: deesCatalog.DeesTable<ITestRow>) => {
|
||||||
|
await table.updateComplete;
|
||||||
|
await waitForNextFrame();
|
||||||
|
await waitForMacrotask();
|
||||||
|
await table.updateComplete;
|
||||||
|
};
|
||||||
|
|
||||||
|
const createRows = (iteration: number): ITestRow[] => {
|
||||||
|
const cycle = iteration % 3;
|
||||||
|
|
||||||
|
if (cycle === 0) {
|
||||||
|
return [
|
||||||
|
{ id: 'alpha', score: 60, label: `Alpha ${iteration}` },
|
||||||
|
{ id: 'beta', score: 20, label: `Beta ${iteration}` },
|
||||||
|
{ id: 'gamma', score: 40, label: `Gamma ${iteration}` },
|
||||||
|
];
|
||||||
|
}
|
||||||
|
|
||||||
|
if (cycle === 1) {
|
||||||
|
return [
|
||||||
|
{ id: 'alpha', score: 30, label: `Alpha ${iteration}` },
|
||||||
|
{ id: 'beta', score: 70, label: `Beta ${iteration}` },
|
||||||
|
{ id: 'gamma', score: 50, label: `Gamma ${iteration}` },
|
||||||
|
];
|
||||||
|
}
|
||||||
|
|
||||||
|
return [
|
||||||
|
{ id: 'alpha', score: 55, label: `Alpha ${iteration}` },
|
||||||
|
{ id: 'beta', score: 35, label: `Beta ${iteration}` },
|
||||||
|
{ id: 'gamma', score: 75, label: `Gamma ${iteration}` },
|
||||||
|
];
|
||||||
|
};
|
||||||
|
|
||||||
|
const createTable = (
|
||||||
|
rows: ITestRow[],
|
||||||
|
highlightUpdates: 'none' | 'flash'
|
||||||
|
): deesCatalog.DeesTable<ITestRow> => {
|
||||||
|
const table = new deesCatalog.DeesTable<ITestRow>();
|
||||||
|
table.searchable = false;
|
||||||
|
table.columns = testColumns;
|
||||||
|
table.rowKey = 'id';
|
||||||
|
table.sortBy = scoreSort;
|
||||||
|
table.highlightUpdates = highlightUpdates;
|
||||||
|
table.data = rows;
|
||||||
|
document.body.appendChild(table);
|
||||||
|
return table;
|
||||||
|
};
|
||||||
|
|
||||||
|
const countComments = (root: Node): number => {
|
||||||
|
const walker = document.createTreeWalker(root, NodeFilter.SHOW_COMMENT);
|
||||||
|
let count = 0;
|
||||||
|
while (walker.nextNode()) count++;
|
||||||
|
return count;
|
||||||
|
};
|
||||||
|
|
||||||
|
const getBodyRows = (table: deesCatalog.DeesTable<ITestRow>): HTMLTableRowElement[] =>
|
||||||
|
Array.from(
|
||||||
|
table.shadowRoot?.querySelectorAll('tbody tr[data-row-idx]') ?? []
|
||||||
|
) as HTMLTableRowElement[];
|
||||||
|
|
||||||
|
const getRenderedRowIds = (table: deesCatalog.DeesTable<ITestRow>): string[] =>
|
||||||
|
getBodyRows(table).map((row) => row.cells[0]?.textContent?.trim() ?? '');
|
||||||
|
|
||||||
|
const getRenderedRowMap = (
|
||||||
|
table: deesCatalog.DeesTable<ITestRow>
|
||||||
|
): Map<string, HTMLTableRowElement> => {
|
||||||
|
const rowMap = new Map<string, HTMLTableRowElement>();
|
||||||
|
for (const row of getBodyRows(table)) {
|
||||||
|
const rowId = row.cells[0]?.textContent?.trim() ?? '';
|
||||||
|
if (rowId) rowMap.set(rowId, row);
|
||||||
|
}
|
||||||
|
return rowMap;
|
||||||
|
};
|
||||||
|
|
||||||
|
tap.test('dees-table avoids repeated width measurement and comment growth on live updates', async () => {
|
||||||
|
const table = new deesCatalog.DeesTable<ITestRow>();
|
||||||
|
let widthMeasureCalls = 0;
|
||||||
|
const originalDetermineColumnWidths = table.determineColumnWidths.bind(table);
|
||||||
|
table.determineColumnWidths = (async () => {
|
||||||
|
widthMeasureCalls++;
|
||||||
|
await originalDetermineColumnWidths();
|
||||||
|
}) as typeof table.determineColumnWidths;
|
||||||
|
|
||||||
|
table.searchable = false;
|
||||||
|
table.columns = testColumns;
|
||||||
|
table.rowKey = 'id';
|
||||||
|
table.sortBy = scoreSort;
|
||||||
|
table.highlightUpdates = 'none';
|
||||||
|
table.data = createRows(0);
|
||||||
|
document.body.appendChild(table);
|
||||||
|
|
||||||
|
try {
|
||||||
|
await settleTable(table);
|
||||||
|
|
||||||
|
const initialWidthMeasureCalls = widthMeasureCalls;
|
||||||
|
const initialCommentCount = countComments(table.shadowRoot!);
|
||||||
|
|
||||||
|
expect(initialWidthMeasureCalls).toBeGreaterThan(0);
|
||||||
|
|
||||||
|
for (let iteration = 1; iteration <= 10; iteration++) {
|
||||||
|
table.data = createRows(iteration);
|
||||||
|
await settleTable(table);
|
||||||
|
}
|
||||||
|
|
||||||
|
expect(widthMeasureCalls).toEqual(initialWidthMeasureCalls);
|
||||||
|
expect(countComments(table.shadowRoot!)).toEqual(initialCommentCount);
|
||||||
|
} finally {
|
||||||
|
table.remove();
|
||||||
|
}
|
||||||
|
});
|
||||||
|
|
||||||
|
tap.test('dees-table reuses row DOM while flashing live-sorted updates', async () => {
|
||||||
|
const table = createTable(createRows(0), 'flash');
|
||||||
|
|
||||||
|
try {
|
||||||
|
await settleTable(table);
|
||||||
|
|
||||||
|
const initialRowMap = getRenderedRowMap(table);
|
||||||
|
|
||||||
|
table.data = createRows(1);
|
||||||
|
await settleTable(table);
|
||||||
|
|
||||||
|
const updatedRowMap = getRenderedRowMap(table);
|
||||||
|
|
||||||
|
expect(getRenderedRowIds(table)).toEqual(['beta', 'gamma', 'alpha']);
|
||||||
|
expect(updatedRowMap.get('alpha')).toEqual(initialRowMap.get('alpha'));
|
||||||
|
expect(updatedRowMap.get('beta')).toEqual(initialRowMap.get('beta'));
|
||||||
|
expect(updatedRowMap.get('gamma')).toEqual(initialRowMap.get('gamma'));
|
||||||
|
} finally {
|
||||||
|
table.remove();
|
||||||
|
}
|
||||||
|
});
|
||||||
|
|
||||||
|
export default tap.start();
|
||||||
@@ -3,6 +3,6 @@
|
|||||||
*/
|
*/
|
||||||
export const commitinfo = {
|
export const commitinfo = {
|
||||||
name: '@design.estate/dees-catalog',
|
name: '@design.estate/dees-catalog',
|
||||||
version: '3.73.0',
|
version: '3.80.0',
|
||||||
description: 'A comprehensive library that provides dynamic web components for building sophisticated and modern web applications using JavaScript and TypeScript.'
|
description: 'A comprehensive library that provides dynamic web components for building sophisticated and modern web applications using JavaScript and TypeScript.'
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -293,9 +293,9 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
private accessor __floatingActive: boolean = false;
|
private accessor __floatingActive: boolean = false;
|
||||||
|
|
||||||
// ─── Flash-on-update state (only populated when highlightUpdates === 'flash') ──
|
// ─── Flash-on-update state (only populated when highlightUpdates === 'flash') ──
|
||||||
/** rowId → set of colKey strings currently flashing. */
|
/** rowId → (colKey → flash token) for cells currently flashing. */
|
||||||
@state()
|
@state()
|
||||||
private accessor __flashingCells: Map<string, Set<string>> = new Map();
|
private accessor __flashingCells: Map<string, Map<string, number>> = new Map();
|
||||||
|
|
||||||
/** rowId → (colKey → last-seen resolved cell value). Populated per diff pass. */
|
/** rowId → (colKey → last-seen resolved cell value). Populated per diff pass. */
|
||||||
private __prevSnapshot?: Map<string, Map<string, unknown>>;
|
private __prevSnapshot?: Map<string, Map<string, unknown>>;
|
||||||
@@ -303,7 +303,7 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
/** Single shared timer that clears __flashingCells after highlightDuration ms. */
|
/** Single shared timer that clears __flashingCells after highlightDuration ms. */
|
||||||
private __flashClearTimer?: ReturnType<typeof setTimeout>;
|
private __flashClearTimer?: ReturnType<typeof setTimeout>;
|
||||||
|
|
||||||
/** Monotonic counter bumped each flash batch so directives.keyed recreates the cell node and restarts the animation. */
|
/** Monotonic counter bumped per flash batch so only changed cells restart their animation. */
|
||||||
private __flashTick: number = 0;
|
private __flashTick: number = 0;
|
||||||
|
|
||||||
/** One-shot console.warn gate for missing rowKey in flash mode. */
|
/** One-shot console.warn gate for missing rowKey in flash mode. */
|
||||||
@@ -317,7 +317,7 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
columns: any;
|
columns: any;
|
||||||
augment: boolean;
|
augment: boolean;
|
||||||
displayFunction: any;
|
displayFunction: any;
|
||||||
data: any;
|
displayShapeKey: string;
|
||||||
out: Column<T>[];
|
out: Column<T>[];
|
||||||
};
|
};
|
||||||
private __memoViewData?: {
|
private __memoViewData?: {
|
||||||
@@ -329,8 +329,13 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
effectiveColumns: Column<T>[];
|
effectiveColumns: Column<T>[];
|
||||||
out: T[];
|
out: T[];
|
||||||
};
|
};
|
||||||
/** Tracks the (data, columns) pair that `determineColumnWidths()` last sized for. */
|
/** Tracks the layout inputs that `determineColumnWidths()` last sized for. */
|
||||||
private __columnsSizedFor?: { data: any; columns: any };
|
private __columnsSizedFor?: {
|
||||||
|
effectiveColumns: Column<T>[];
|
||||||
|
showSelectionCheckbox: boolean;
|
||||||
|
inRowActionCount: number;
|
||||||
|
table: HTMLTableElement;
|
||||||
|
};
|
||||||
|
|
||||||
// ─── Virtualization state ────────────────────────────────────────────
|
// ─── Virtualization state ────────────────────────────────────────────
|
||||||
/** Estimated row height (px). Measured once from the first rendered row. */
|
/** Estimated row height (px). Measured once from the first rendered row. */
|
||||||
@@ -409,15 +414,7 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
const view: T[] = (this as any)._lastViewData ?? [];
|
const view: T[] = (this as any)._lastViewData ?? [];
|
||||||
const item = view.find((r) => this.getRowId(r) === this.__focusedCell!.rowId);
|
const item = view.find((r) => this.getRowId(r) === this.__focusedCell!.rowId);
|
||||||
if (!item) return;
|
if (!item) return;
|
||||||
const allCols: Column<T>[] =
|
const allCols = this.__getEffectiveColumns();
|
||||||
Array.isArray(this.columns) && this.columns.length > 0
|
|
||||||
? computeEffectiveColumnsFn(
|
|
||||||
this.columns,
|
|
||||||
this.augmentFromDisplayFunction,
|
|
||||||
this.displayFunction,
|
|
||||||
this.data
|
|
||||||
)
|
|
||||||
: computeColumnsFromDisplayFunctionFn(this.displayFunction, this.data);
|
|
||||||
const col = allCols.find((c) => String(c.key) === this.__focusedCell!.colKey);
|
const col = allCols.find((c) => String(c.key) === this.__focusedCell!.colKey);
|
||||||
if (!col || !this.__isColumnEditable(col)) return;
|
if (!col || !this.__isColumnEditable(col)) return;
|
||||||
eventArg.preventDefault();
|
eventArg.preventDefault();
|
||||||
@@ -469,15 +466,24 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
* that affect it. Avoids re-running `computeEffectiveColumnsFn` /
|
* that affect it. Avoids re-running `computeEffectiveColumnsFn` /
|
||||||
* `computeColumnsFromDisplayFunctionFn` on every Lit update.
|
* `computeColumnsFromDisplayFunctionFn` on every Lit update.
|
||||||
*/
|
*/
|
||||||
|
private __getDisplayFunctionShapeKey(): string {
|
||||||
|
if (!this.data || this.data.length === 0) return '';
|
||||||
|
const firstTransformedItem = this.displayFunction(this.data[0]) ?? {};
|
||||||
|
return Object.keys(firstTransformedItem).join('\u0000');
|
||||||
|
}
|
||||||
|
|
||||||
private __getEffectiveColumns(): Column<T>[] {
|
private __getEffectiveColumns(): Column<T>[] {
|
||||||
const usingColumns = Array.isArray(this.columns) && this.columns.length > 0;
|
const usingColumns = Array.isArray(this.columns) && this.columns.length > 0;
|
||||||
|
const displayShapeKey = !usingColumns || this.augmentFromDisplayFunction
|
||||||
|
? this.__getDisplayFunctionShapeKey()
|
||||||
|
: '';
|
||||||
const cache = this.__memoEffectiveCols;
|
const cache = this.__memoEffectiveCols;
|
||||||
if (
|
if (
|
||||||
cache &&
|
cache &&
|
||||||
cache.columns === this.columns &&
|
cache.columns === this.columns &&
|
||||||
cache.augment === this.augmentFromDisplayFunction &&
|
cache.augment === this.augmentFromDisplayFunction &&
|
||||||
cache.displayFunction === this.displayFunction &&
|
cache.displayFunction === this.displayFunction &&
|
||||||
cache.data === this.data
|
cache.displayShapeKey === displayShapeKey
|
||||||
) {
|
) {
|
||||||
return cache.out;
|
return cache.out;
|
||||||
}
|
}
|
||||||
@@ -493,7 +499,7 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
columns: this.columns,
|
columns: this.columns,
|
||||||
augment: this.augmentFromDisplayFunction,
|
augment: this.augmentFromDisplayFunction,
|
||||||
displayFunction: this.displayFunction,
|
displayFunction: this.displayFunction,
|
||||||
data: this.data,
|
displayShapeKey,
|
||||||
out,
|
out,
|
||||||
};
|
};
|
||||||
return out;
|
return out;
|
||||||
@@ -543,6 +549,9 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
public render(): TemplateResult {
|
public render(): TemplateResult {
|
||||||
const effectiveColumns = this.__getEffectiveColumns();
|
const effectiveColumns = this.__getEffectiveColumns();
|
||||||
const viewData = this.__getViewData(effectiveColumns);
|
const viewData = this.__getViewData(effectiveColumns);
|
||||||
|
const headerActions = this.getActionsForType('header');
|
||||||
|
const footerActions = this.getActionsForType('footer');
|
||||||
|
const inRowActions = this.getActionsForType('inRow');
|
||||||
(this as any)._lastViewData = viewData;
|
(this as any)._lastViewData = viewData;
|
||||||
|
|
||||||
// Virtualization slice — only the rows in `__virtualRange` actually
|
// Virtualization slice — only the rows in `__virtualRange` actually
|
||||||
@@ -572,29 +581,22 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
<div class="heading heading2">${this.heading2}</div>
|
<div class="heading heading2">${this.heading2}</div>
|
||||||
</div>
|
</div>
|
||||||
<div class="headerActions">
|
<div class="headerActions">
|
||||||
${directives.resolveExec(async () => {
|
${headerActions.map(
|
||||||
const resultArray: TemplateResult[] = [];
|
(action) => html`<div
|
||||||
for (const action of this.dataActions) {
|
class="headerAction"
|
||||||
if (!action.type?.includes('header')) continue;
|
@click=${() => {
|
||||||
resultArray.push(
|
action.actionFunc({
|
||||||
html`<div
|
item: this.selectedDataRow,
|
||||||
class="headerAction"
|
table: this,
|
||||||
@click=${() => {
|
});
|
||||||
action.actionFunc({
|
}}
|
||||||
item: this.selectedDataRow,
|
>
|
||||||
table: this,
|
${action.iconName
|
||||||
});
|
? html`<dees-icon .iconSize=${14} .icon=${action.iconName}></dees-icon>
|
||||||
}}
|
${action.name}`
|
||||||
>
|
: action.name}
|
||||||
${action.iconName
|
</div>`
|
||||||
? html`<dees-icon .iconSize=${14} .icon=${action.iconName}></dees-icon>
|
)}
|
||||||
${action.name}`
|
|
||||||
: action.name}
|
|
||||||
</div>`
|
|
||||||
);
|
|
||||||
}
|
|
||||||
return resultArray;
|
|
||||||
})}
|
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
<div class="headingSeparation"></div>
|
<div class="headingSeparation"></div>
|
||||||
@@ -610,26 +612,26 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
<div class="searchGrid hidden">
|
<div class="searchGrid hidden">
|
||||||
<dees-input-text
|
<dees-input-text
|
||||||
.label=${'lucene syntax search'}
|
.label=${'lucene syntax search'}
|
||||||
.description=${`
|
.infoText=${`
|
||||||
You can use the lucene syntax to search for data, e.g.:
|
You can use the lucene syntax to search for data, e.g.:
|
||||||
|
|
||||||
\`\`\`
|
\`\`\`
|
||||||
name: "john" AND age: 18
|
name: "john" AND age: 18
|
||||||
\`\`\`
|
\`\`\`
|
||||||
|
|
||||||
`}
|
`}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
<dees-input-multitoggle
|
<dees-input-multitoggle
|
||||||
.label=${'search mode'}
|
.label=${'search mode'}
|
||||||
.options=${['table', 'data', 'server']}
|
.options=${['table', 'data', 'server']}
|
||||||
.selectedOption=${'table'}
|
.selectedOption=${'table'}
|
||||||
.description=${`
|
.infoText=${`
|
||||||
There are three basic modes:
|
There are three basic modes:
|
||||||
|
|
||||||
* table: only searches data already in the table
|
* table: only searches data already in the table
|
||||||
* data: searches original data, ignoring table transforms
|
* data: searches original data, ignoring table transforms
|
||||||
* server: searches data on the server
|
* server: searches data on the server
|
||||||
|
|
||||||
`}
|
`}
|
||||||
></dees-input-multitoggle>
|
></dees-input-multitoggle>
|
||||||
</div>
|
</div>
|
||||||
@@ -658,11 +660,11 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
: html``}
|
: html``}
|
||||||
${directives.repeat(
|
${directives.repeat(
|
||||||
renderRows,
|
renderRows,
|
||||||
(itemArg, sliceIdx) => `${this.getRowId(itemArg)}::${renderStart + sliceIdx}`,
|
(itemArg) => this.getRowId(itemArg),
|
||||||
(itemArg, sliceIdx) => {
|
(itemArg, sliceIdx) => {
|
||||||
const rowIndex = renderStart + sliceIdx;
|
const rowIndex = renderStart + sliceIdx;
|
||||||
const rowId = this.getRowId(itemArg);
|
const rowId = this.getRowId(itemArg);
|
||||||
const flashSet = this.__flashingCells.get(rowId);
|
const flashTokens = this.__flashingCells.get(rowId);
|
||||||
return html`
|
return html`
|
||||||
<tr
|
<tr
|
||||||
data-row-idx=${rowIndex}
|
data-row-idx=${rowIndex}
|
||||||
@@ -694,7 +696,9 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
const isEditing =
|
const isEditing =
|
||||||
this.__editingCell?.rowId === rowId &&
|
this.__editingCell?.rowId === rowId &&
|
||||||
this.__editingCell?.colKey === editKey;
|
this.__editingCell?.colKey === editKey;
|
||||||
const isFlashing = !!flashSet?.has(editKey);
|
const flashToken = flashTokens?.get(editKey);
|
||||||
|
const isFlashing = flashToken !== undefined;
|
||||||
|
const useFlashBorder = isFlashing && !!col.flashBorder;
|
||||||
const cellClasses = [
|
const cellClasses = [
|
||||||
isEditable ? 'editable' : '',
|
isEditable ? 'editable' : '',
|
||||||
isFocused && !isEditing ? 'focused' : '',
|
isFocused && !isEditing ? 'focused' : '',
|
||||||
@@ -702,8 +706,13 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
]
|
]
|
||||||
.filter(Boolean)
|
.filter(Boolean)
|
||||||
.join(' ');
|
.join(' ');
|
||||||
|
const flashClass = isFlashing
|
||||||
|
? useFlashBorder
|
||||||
|
? 'innerCellContainer flashing-border'
|
||||||
|
: 'innerCellContainer flashing'
|
||||||
|
: 'innerCellContainer';
|
||||||
const innerHtml = html`<div
|
const innerHtml = html`<div
|
||||||
class=${isFlashing ? 'innerCellContainer flashing' : 'innerCellContainer'}
|
class=${flashClass}
|
||||||
>
|
>
|
||||||
${isEditing ? this.renderCellEditor(itemArg, col) : content}
|
${isEditing ? this.renderCellEditor(itemArg, col) : content}
|
||||||
</div>`;
|
</div>`;
|
||||||
@@ -714,7 +723,7 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
>
|
>
|
||||||
${isFlashing
|
${isFlashing
|
||||||
? directives.keyed(
|
? directives.keyed(
|
||||||
`${rowId}:${editKey}:${this.__flashTick}`,
|
`${rowId}:${editKey}:${flashToken}`,
|
||||||
innerHtml
|
innerHtml
|
||||||
)
|
)
|
||||||
: innerHtml}
|
: innerHtml}
|
||||||
@@ -722,11 +731,11 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
`;
|
`;
|
||||||
})}
|
})}
|
||||||
${(() => {
|
${(() => {
|
||||||
if (this.dataActions && this.dataActions.length > 0) {
|
if (inRowActions.length > 0) {
|
||||||
return html`
|
return html`
|
||||||
<td class="actionsCol">
|
<td class="actionsCol">
|
||||||
<div class="actionsContainer">
|
<div class="actionsContainer">
|
||||||
${this.getActionsForType('inRow').map(
|
${inRowActions.map(
|
||||||
(actionArg) => html`
|
(actionArg) => html`
|
||||||
<div
|
<div
|
||||||
class="action"
|
class="action"
|
||||||
@@ -774,29 +783,22 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
selected
|
selected
|
||||||
</div>
|
</div>
|
||||||
<div class="footerActions">
|
<div class="footerActions">
|
||||||
${directives.resolveExec(async () => {
|
${footerActions.map(
|
||||||
const resultArray: TemplateResult[] = [];
|
(action) => html`<div
|
||||||
for (const action of this.dataActions) {
|
class="footerAction"
|
||||||
if (!action.type?.includes('footer')) continue;
|
@click=${() => {
|
||||||
resultArray.push(
|
action.actionFunc({
|
||||||
html`<div
|
item: this.selectedDataRow,
|
||||||
class="footerAction"
|
table: this,
|
||||||
@click=${() => {
|
});
|
||||||
action.actionFunc({
|
}}
|
||||||
item: this.selectedDataRow,
|
>
|
||||||
table: this,
|
${action.iconName
|
||||||
});
|
? html`<dees-icon .iconSize=${14} .icon=${action.iconName}></dees-icon>
|
||||||
}}
|
${action.name}`
|
||||||
>
|
: action.name}
|
||||||
${action.iconName
|
</div>`
|
||||||
? html`<dees-icon .iconSize=${14} .icon=${action.iconName}></dees-icon>
|
)}
|
||||||
${action.name}`
|
|
||||||
: action.name}
|
|
||||||
</div>`
|
|
||||||
);
|
|
||||||
}
|
|
||||||
return resultArray;
|
|
||||||
})}
|
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
</dees-tile>
|
</dees-tile>
|
||||||
@@ -1154,7 +1156,7 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
/**
|
/**
|
||||||
* Measures the height of the first rendered body row and stores it for
|
* Measures the height of the first rendered body row and stores it for
|
||||||
* subsequent virtualization math. Idempotent — only measures once per
|
* subsequent virtualization math. Idempotent — only measures once per
|
||||||
* `data`/`columns` pair (cleared in `updated()` when those change).
|
* rendered table layout (cleared in `updated()` when that layout changes).
|
||||||
*/
|
*/
|
||||||
private __measureRowHeight() {
|
private __measureRowHeight() {
|
||||||
if (!this.virtualized || this.__rowHeightMeasured) return;
|
if (!this.virtualized || this.__rowHeightMeasured) return;
|
||||||
@@ -1362,6 +1364,7 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
|
|
||||||
const effectiveColumns = this.__getEffectiveColumns();
|
const effectiveColumns = this.__getEffectiveColumns();
|
||||||
const visibleCols = effectiveColumns.filter((c) => !c.hidden);
|
const visibleCols = effectiveColumns.filter((c) => !c.hidden);
|
||||||
|
const colByKey = new Map<string, Column<T>>(visibleCols.map((c) => [String(c.key), c]));
|
||||||
const nextSnapshot = new Map<string, Map<string, unknown>>();
|
const nextSnapshot = new Map<string, Map<string, unknown>>();
|
||||||
const newlyFlashing = new Map<string, Set<string>>();
|
const newlyFlashing = new Map<string, Set<string>>();
|
||||||
|
|
||||||
@@ -1376,7 +1379,26 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
const prevCells = this.__prevSnapshot?.get(rowId);
|
const prevCells = this.__prevSnapshot?.get(rowId);
|
||||||
if (!prevCells) continue; // new row — not an "update"
|
if (!prevCells) continue; // new row — not an "update"
|
||||||
for (const [colKey, nextVal] of cellMap) {
|
for (const [colKey, nextVal] of cellMap) {
|
||||||
if (prevCells.get(colKey) !== nextVal) {
|
const prevVal = prevCells.get(colKey);
|
||||||
|
|
||||||
|
// Look up the column definition for flash options.
|
||||||
|
const colDef = colByKey.get(colKey);
|
||||||
|
|
||||||
|
// Determine whether the cell changed.
|
||||||
|
let changed: boolean;
|
||||||
|
if (colDef?.flashCompare) {
|
||||||
|
// Explicit custom comparator — caller decides.
|
||||||
|
changed = colDef.flashCompare(prevVal, nextVal);
|
||||||
|
} else if (nextVal !== null && nextVal !== undefined && typeof nextVal === 'object') {
|
||||||
|
// Non-primitive (TemplateResult, object, array, etc.) — skip by
|
||||||
|
// default. Custom renderings don't benefit from the text-color
|
||||||
|
// flash and reference inequality causes false positives.
|
||||||
|
changed = false;
|
||||||
|
} else {
|
||||||
|
changed = prevVal !== nextVal;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (changed) {
|
||||||
// Don't flash the cell the user is actively editing.
|
// Don't flash the cell the user is actively editing.
|
||||||
if (
|
if (
|
||||||
this.__editingCell &&
|
this.__editingCell &&
|
||||||
@@ -1400,20 +1422,16 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
if (newlyFlashing.size === 0) return;
|
if (newlyFlashing.size === 0) return;
|
||||||
|
|
||||||
// Merge with any in-flight flashes from a rapid second update so a cell
|
// Merge with any in-flight flashes from a rapid second update so a cell
|
||||||
// that changes twice before its animation ends gets a single clean
|
// that changes twice before its animation ends gets a clean restart,
|
||||||
// restart (via __flashTick / directives.keyed) instead of stacking.
|
// while unrelated cells keep their existing DOM subtree.
|
||||||
|
const flashToken = ++this.__flashTick;
|
||||||
|
const nextFlashingCells = new Map(this.__flashingCells);
|
||||||
for (const [rowId, cols] of newlyFlashing) {
|
for (const [rowId, cols] of newlyFlashing) {
|
||||||
const existing = this.__flashingCells.get(rowId);
|
const existing = new Map(nextFlashingCells.get(rowId) ?? []);
|
||||||
if (existing) {
|
for (const colKey of cols) existing.set(colKey, flashToken);
|
||||||
for (const c of cols) existing.add(c);
|
nextFlashingCells.set(rowId, existing);
|
||||||
} else {
|
|
||||||
this.__flashingCells.set(rowId, cols);
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
this.__flashTick++;
|
this.__flashingCells = nextFlashingCells;
|
||||||
// Reactivity nudge: we've mutated the Map in place, so give Lit a fresh
|
|
||||||
// reference so the @state change fires for render.
|
|
||||||
this.__flashingCells = new Map(this.__flashingCells);
|
|
||||||
if (this.__flashClearTimer) clearTimeout(this.__flashClearTimer);
|
if (this.__flashClearTimer) clearTimeout(this.__flashClearTimer);
|
||||||
this.__flashClearTimer = setTimeout(() => {
|
this.__flashClearTimer = setTimeout(() => {
|
||||||
this.__flashingCells = new Map();
|
this.__flashingCells = new Map();
|
||||||
@@ -1423,6 +1441,9 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
|
|
||||||
public async updated(changedProperties: Map<string | number | symbol, unknown>): Promise<void> {
|
public async updated(changedProperties: Map<string | number | symbol, unknown>): Promise<void> {
|
||||||
super.updated(changedProperties);
|
super.updated(changedProperties);
|
||||||
|
const effectiveColumns = this.__getEffectiveColumns();
|
||||||
|
const currentTable = this.shadowRoot?.querySelector('table') ?? null;
|
||||||
|
const inRowActionCount = this.getActionsForType('inRow').length;
|
||||||
|
|
||||||
// Feed highlightDuration into the CSS variable so JS and CSS stay in
|
// Feed highlightDuration into the CSS variable so JS and CSS stay in
|
||||||
// sync via a single source of truth.
|
// sync via a single source of truth.
|
||||||
@@ -1430,15 +1451,23 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
this.style.setProperty('--dees-table-flash-duration', `${this.highlightDuration}ms`);
|
this.style.setProperty('--dees-table-flash-duration', `${this.highlightDuration}ms`);
|
||||||
}
|
}
|
||||||
|
|
||||||
// Only re-measure column widths when the data or schema actually changed
|
// Only re-measure column widths when layout-affecting inputs changed or
|
||||||
// (or on first paint). `determineColumnWidths` is the single biggest
|
// when a new <table> element was rendered after previously having none.
|
||||||
// first-paint cost — it forces multiple layout flushes per row.
|
const columnLayoutChanged =
|
||||||
const dataOrColsChanged =
|
!!currentTable && (
|
||||||
!this.__columnsSizedFor ||
|
!this.__columnsSizedFor ||
|
||||||
this.__columnsSizedFor.data !== this.data ||
|
this.__columnsSizedFor.effectiveColumns !== effectiveColumns ||
|
||||||
this.__columnsSizedFor.columns !== this.columns;
|
this.__columnsSizedFor.showSelectionCheckbox !== this.showSelectionCheckbox ||
|
||||||
if (dataOrColsChanged) {
|
this.__columnsSizedFor.inRowActionCount !== inRowActionCount ||
|
||||||
this.__columnsSizedFor = { data: this.data, columns: this.columns };
|
this.__columnsSizedFor.table !== currentTable
|
||||||
|
);
|
||||||
|
if (currentTable && columnLayoutChanged) {
|
||||||
|
this.__columnsSizedFor = {
|
||||||
|
effectiveColumns,
|
||||||
|
showSelectionCheckbox: this.showSelectionCheckbox,
|
||||||
|
inRowActionCount,
|
||||||
|
table: currentTable,
|
||||||
|
};
|
||||||
this.determineColumnWidths();
|
this.determineColumnWidths();
|
||||||
// Force re-measure of row height; structure may have changed.
|
// Force re-measure of row height; structure may have changed.
|
||||||
this.__rowHeightMeasured = false;
|
this.__rowHeightMeasured = false;
|
||||||
@@ -1476,7 +1505,7 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
if (
|
if (
|
||||||
!this.fixedHeight &&
|
!this.fixedHeight &&
|
||||||
this.data.length > 0 &&
|
this.data.length > 0 &&
|
||||||
(this.__floatingActive || dataOrColsChanged)
|
(this.__floatingActive || columnLayoutChanged)
|
||||||
) {
|
) {
|
||||||
this.__syncFloatingHeader();
|
this.__syncFloatingHeader();
|
||||||
}
|
}
|
||||||
@@ -1778,10 +1807,7 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
* Used by the modal helper to render human-friendly labels.
|
* Used by the modal helper to render human-friendly labels.
|
||||||
*/
|
*/
|
||||||
private _lookupColumnByKey(key: string): Column<T> | undefined {
|
private _lookupColumnByKey(key: string): Column<T> | undefined {
|
||||||
const usingColumns = Array.isArray(this.columns) && this.columns.length > 0;
|
const effective = this.__getEffectiveColumns();
|
||||||
const effective = usingColumns
|
|
||||||
? computeEffectiveColumnsFn(this.columns, this.augmentFromDisplayFunction, this.displayFunction, this.data)
|
|
||||||
: computeColumnsFromDisplayFunctionFn(this.displayFunction, this.data);
|
|
||||||
return effective.find((c) => String(c.key) === key);
|
return effective.find((c) => String(c.key) === key);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -2517,9 +2543,7 @@ export class DeesTable<T> extends DeesElement {
|
|||||||
const view: T[] = (this as any)._lastViewData ?? [];
|
const view: T[] = (this as any)._lastViewData ?? [];
|
||||||
if (view.length === 0) return;
|
if (view.length === 0) return;
|
||||||
// Recompute editable columns from the latest effective set.
|
// Recompute editable columns from the latest effective set.
|
||||||
const allCols: Column<T>[] = Array.isArray(this.columns) && this.columns.length > 0
|
const allCols = this.__getEffectiveColumns();
|
||||||
? computeEffectiveColumnsFn(this.columns, this.augmentFromDisplayFunction, this.displayFunction, this.data)
|
|
||||||
: computeColumnsFromDisplayFunctionFn(this.displayFunction, this.data);
|
|
||||||
const editableCols = this.__editableColumns(allCols);
|
const editableCols = this.__editableColumns(allCols);
|
||||||
if (editableCols.length === 0) return;
|
if (editableCols.length === 0) return;
|
||||||
|
|
||||||
|
|||||||
@@ -404,11 +404,44 @@ export const tableStyles: CSSResult[] = [
|
|||||||
100% { color: var(--dees-color-text-primary); }
|
100% { color: var(--dees-color-text-primary); }
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/* Border/background flash variant for cells with styled content
|
||||||
|
(badges, icons, custom components) where a text-color animation
|
||||||
|
would be invisible. Activated via flashBorder on Column. */
|
||||||
|
.innerCellContainer.flashing-border {
|
||||||
|
animation: dees-table-cell-flash-border
|
||||||
|
var(--dees-table-flash-duration, 900ms)
|
||||||
|
var(--dees-table-flash-easing);
|
||||||
|
border-radius: 3px;
|
||||||
|
}
|
||||||
|
|
||||||
|
@keyframes dees-table-cell-flash-border {
|
||||||
|
0%,
|
||||||
|
35% {
|
||||||
|
box-shadow: inset 0 0 0 1.5px var(--dees-table-flash-color);
|
||||||
|
background: ${cssManager.bdTheme(
|
||||||
|
'hsl(45 93% 62% / 0.10)',
|
||||||
|
'hsl(45 93% 62% / 0.08)'
|
||||||
|
)};
|
||||||
|
}
|
||||||
|
100% {
|
||||||
|
box-shadow: inset 0 0 0 1.5px transparent;
|
||||||
|
background: transparent;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
@media (prefers-reduced-motion: reduce) {
|
@media (prefers-reduced-motion: reduce) {
|
||||||
.innerCellContainer.flashing {
|
.innerCellContainer.flashing {
|
||||||
animation: none;
|
animation: none;
|
||||||
color: var(--dees-table-flash-color);
|
color: var(--dees-table-flash-color);
|
||||||
}
|
}
|
||||||
|
.innerCellContainer.flashing-border {
|
||||||
|
animation: none;
|
||||||
|
box-shadow: inset 0 0 0 1.5px var(--dees-table-flash-color);
|
||||||
|
background: ${cssManager.bdTheme(
|
||||||
|
'hsl(45 93% 62% / 0.10)',
|
||||||
|
'hsl(45 93% 62% / 0.08)'
|
||||||
|
)};
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/* Dev-time warning banner shown when highlight-updates="flash" but
|
/* Dev-time warning banner shown when highlight-updates="flash" but
|
||||||
|
|||||||
@@ -65,6 +65,25 @@ export interface Column<T = any> {
|
|||||||
parse?: (editorValue: any, row: T) => any;
|
parse?: (editorValue: any, row: T) => any;
|
||||||
/** Validate the parsed value before commit. Return string for error, true/void for ok. */
|
/** Validate the parsed value before commit. Return string for error, true/void for ok. */
|
||||||
validate?: (value: any, row: T) => true | string | void;
|
validate?: (value: any, row: T) => true | string | void;
|
||||||
|
|
||||||
|
// ─── Flash highlight options ───
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Custom comparison for flash-on-update diffing.
|
||||||
|
* Return `true` if the cell should flash (i.e. the values differ).
|
||||||
|
* When absent, non-primitive cell values are skipped entirely
|
||||||
|
* (only strings, numbers, booleans, null, and undefined are diffed).
|
||||||
|
*/
|
||||||
|
flashCompare?: (prevVal: any, nextVal: any) => boolean;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* When `true`, flash this cell with a border/background pulse instead of
|
||||||
|
* the default text-color animation. Useful for cells containing styled
|
||||||
|
* badges, icons, or custom web-component renderings where a text-color
|
||||||
|
* change would be invisible.
|
||||||
|
* @default false
|
||||||
|
*/
|
||||||
|
flashBorder?: boolean;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -1,11 +1,245 @@
|
|||||||
import { html } from '@design.estate/dees-element';
|
import { html, css, cssManager } from '@design.estate/dees-element';
|
||||||
|
import '@design.estate/dees-wcctools/demotools';
|
||||||
import { DeesProgressbar } from '../dees-progressbar/dees-progressbar.js';
|
import type { DeesProgressbar } from './dees-progressbar.js';
|
||||||
|
|
||||||
export const demoFunc = () => {
|
export const demoFunc = () => {
|
||||||
|
const terminalSnapshots = [
|
||||||
|
['Resolving workspace packages'],
|
||||||
|
['Resolving workspace packages', 'Downloading ui-assets.tar.gz'],
|
||||||
|
['Resolving workspace packages', 'Downloading ui-assets.tar.gz', 'Verifying checksum'],
|
||||||
|
['Resolving workspace packages', 'Downloading ui-assets.tar.gz', 'Verifying checksum', 'Extracting release bundle'],
|
||||||
|
['Resolving workspace packages', 'Downloading ui-assets.tar.gz', 'Verifying checksum', 'Extracting release bundle', 'Restarting application'],
|
||||||
|
];
|
||||||
|
|
||||||
|
const getUploadStatus = (percentage: number): string => {
|
||||||
|
if (percentage >= 100) {
|
||||||
|
return 'Upload complete. Finalizing package manifest...';
|
||||||
|
}
|
||||||
|
|
||||||
|
if (percentage >= 82) {
|
||||||
|
return 'Verifying checksums before handoff...';
|
||||||
|
}
|
||||||
|
|
||||||
|
if (percentage >= 55) {
|
||||||
|
return 'Uploading thumbnails to edge cache...';
|
||||||
|
}
|
||||||
|
|
||||||
|
if (percentage >= 25) {
|
||||||
|
return 'Streaming source files to the remote worker...';
|
||||||
|
}
|
||||||
|
|
||||||
|
return 'Preparing archive and dependency graph...';
|
||||||
|
};
|
||||||
|
|
||||||
return html`
|
return html`
|
||||||
<dees-progressbar
|
<dees-demowrapper .runAfterRender=${async (elementArg: HTMLElement) => {
|
||||||
.percentage=${50}
|
const liveProgressbar = elementArg.querySelector('#live-progress') as DeesProgressbar | null;
|
||||||
></dees-progressbar>
|
const terminalProgressbar = elementArg.querySelector('#terminal-progress') as DeesProgressbar | null;
|
||||||
|
const demoElement = elementArg as HTMLElement & {
|
||||||
|
__progressbarDemoIntervalId?: number;
|
||||||
|
};
|
||||||
|
|
||||||
|
if (!liveProgressbar || !terminalProgressbar) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (demoElement.__progressbarDemoIntervalId) {
|
||||||
|
window.clearInterval(demoElement.__progressbarDemoIntervalId);
|
||||||
|
}
|
||||||
|
|
||||||
|
let livePercentage = 12;
|
||||||
|
let terminalSnapshotIndex = 0;
|
||||||
|
|
||||||
|
const updateDemo = () => {
|
||||||
|
liveProgressbar.percentage = livePercentage;
|
||||||
|
liveProgressbar.statusText = getUploadStatus(livePercentage);
|
||||||
|
|
||||||
|
terminalProgressbar.terminalLines = [...terminalSnapshots[terminalSnapshotIndex]];
|
||||||
|
terminalProgressbar.percentage = Math.min(100, (terminalSnapshotIndex + 1) * 20);
|
||||||
|
terminalProgressbar.indeterminate = terminalSnapshotIndex < terminalSnapshots.length - 1;
|
||||||
|
|
||||||
|
livePercentage = livePercentage >= 100 ? 12 : Math.min(100, livePercentage + 11);
|
||||||
|
terminalSnapshotIndex = terminalSnapshotIndex >= terminalSnapshots.length - 1 ? 0 : terminalSnapshotIndex + 1;
|
||||||
|
};
|
||||||
|
|
||||||
|
updateDemo();
|
||||||
|
demoElement.__progressbarDemoIntervalId = window.setInterval(updateDemo, 1400);
|
||||||
|
}}>
|
||||||
|
<style>
|
||||||
|
${css`
|
||||||
|
.demoBox {
|
||||||
|
position: relative;
|
||||||
|
background: ${cssManager.bdTheme('hsl(0 0% 95%)', 'hsl(0 0% 9%)')};
|
||||||
|
width: 100%;
|
||||||
|
height: 100%;
|
||||||
|
box-sizing: border-box;
|
||||||
|
padding: 40px;
|
||||||
|
display: flex;
|
||||||
|
flex-direction: column;
|
||||||
|
gap: 24px;
|
||||||
|
}
|
||||||
|
|
||||||
|
.demoIntro {
|
||||||
|
max-width: 720px;
|
||||||
|
color: ${cssManager.bdTheme('hsl(215 20% 30%)', 'hsl(215 18% 76%)')};
|
||||||
|
font-size: 14px;
|
||||||
|
line-height: 1.6;
|
||||||
|
}
|
||||||
|
|
||||||
|
.showcaseGrid {
|
||||||
|
display: grid;
|
||||||
|
grid-template-columns: repeat(auto-fit, minmax(280px, 1fr));
|
||||||
|
gap: 18px;
|
||||||
|
}
|
||||||
|
|
||||||
|
.showcaseCard {
|
||||||
|
background: ${cssManager.bdTheme('rgba(255,255,255,0.78)', 'rgba(255,255,255,0.04)')};
|
||||||
|
border: 1px solid ${cssManager.bdTheme('hsl(210 22% 86%)', 'hsl(210 10% 18%)')};
|
||||||
|
border-radius: 16px;
|
||||||
|
padding: 20px;
|
||||||
|
display: flex;
|
||||||
|
flex-direction: column;
|
||||||
|
gap: 16px;
|
||||||
|
backdrop-filter: blur(8px);
|
||||||
|
}
|
||||||
|
|
||||||
|
.showcaseCard.wide {
|
||||||
|
grid-column: span 2;
|
||||||
|
}
|
||||||
|
|
||||||
|
.showcaseCard h3 {
|
||||||
|
margin: 0;
|
||||||
|
font-size: 15px;
|
||||||
|
font-weight: 600;
|
||||||
|
}
|
||||||
|
|
||||||
|
.showcaseCard p {
|
||||||
|
margin: 0;
|
||||||
|
color: ${cssManager.bdTheme('hsl(215 14% 40%)', 'hsl(215 10% 66%)')};
|
||||||
|
font-size: 13px;
|
||||||
|
line-height: 1.55;
|
||||||
|
}
|
||||||
|
|
||||||
|
.progressStack {
|
||||||
|
display: flex;
|
||||||
|
flex-direction: column;
|
||||||
|
gap: 14px;
|
||||||
|
}
|
||||||
|
|
||||||
|
.codeLabel {
|
||||||
|
font-family: 'SF Mono', 'Monaco', 'Inconsolata', 'Fira Code', monospace;
|
||||||
|
font-size: 11px;
|
||||||
|
color: ${cssManager.bdTheme('hsl(215 14% 44%)', 'hsl(215 10% 70%)')};
|
||||||
|
letter-spacing: 0.03em;
|
||||||
|
text-transform: uppercase;
|
||||||
|
}
|
||||||
|
|
||||||
|
@media (max-width: 900px) {
|
||||||
|
.demoBox {
|
||||||
|
padding: 24px;
|
||||||
|
}
|
||||||
|
|
||||||
|
.showcaseCard.wide {
|
||||||
|
grid-column: span 1;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
`}
|
||||||
|
</style>
|
||||||
|
<div class="demoBox">
|
||||||
|
<div class="demoIntro">
|
||||||
|
<code>dees-progressbar</code> can now pair a classic progress bar with a fixed-height status area. Use simple status text for clear user-facing updates or switch to terminal-like lines when you want recent steps to stay visible without causing layout jumps.
|
||||||
|
</div>
|
||||||
|
<div class="showcaseGrid">
|
||||||
|
<section class="showcaseCard">
|
||||||
|
<div class="codeLabel">Determinate</div>
|
||||||
|
<h3>Percentage plus current task</h3>
|
||||||
|
<p>Use a label, a percentage, and one short status line when the work is measurable.</p>
|
||||||
|
<div class="progressStack">
|
||||||
|
<dees-progressbar
|
||||||
|
label="Media upload"
|
||||||
|
.percentage=${68}
|
||||||
|
statusText="Uploading thumbnails to edge cache..."
|
||||||
|
.statusRows=${2}
|
||||||
|
></dees-progressbar>
|
||||||
|
<dees-progressbar
|
||||||
|
label="Asset sync"
|
||||||
|
.percentage=${100}
|
||||||
|
statusText="All files are synced and available."
|
||||||
|
.statusRows=${2}
|
||||||
|
></dees-progressbar>
|
||||||
|
</div>
|
||||||
|
</section>
|
||||||
|
|
||||||
|
<section class="showcaseCard">
|
||||||
|
<div class="codeLabel">Indeterminate</div>
|
||||||
|
<h3>Spinner-style text indicator</h3>
|
||||||
|
<p>When there is no trustworthy percentage yet, keep the bar moving and let the text explain what is happening.</p>
|
||||||
|
<div class="progressStack">
|
||||||
|
<dees-progressbar
|
||||||
|
label="Dependency install"
|
||||||
|
.indeterminate=${true}
|
||||||
|
statusText="Downloading package metadata..."
|
||||||
|
.statusRows=${2}
|
||||||
|
></dees-progressbar>
|
||||||
|
<dees-progressbar
|
||||||
|
label="Queued job"
|
||||||
|
.percentage=${32}
|
||||||
|
.showPercentage=${false}
|
||||||
|
statusText="Waiting for a worker slot to become available..."
|
||||||
|
.statusRows=${2}
|
||||||
|
></dees-progressbar>
|
||||||
|
</div>
|
||||||
|
</section>
|
||||||
|
|
||||||
|
<section class="showcaseCard wide">
|
||||||
|
<div class="codeLabel">Terminal Lines</div>
|
||||||
|
<h3>Fixed-height terminal-style status output</h3>
|
||||||
|
<p>The panel stays the same height while the latest step stays visible. This is useful for update flows, downloads, and staged background work.</p>
|
||||||
|
<dees-progressbar
|
||||||
|
id="terminal-progress"
|
||||||
|
label="Release bundle"
|
||||||
|
.percentage=${20}
|
||||||
|
.indeterminate=${true}
|
||||||
|
.statusRows=${4}
|
||||||
|
.terminalLines=${terminalSnapshots[0]}
|
||||||
|
></dees-progressbar>
|
||||||
|
</section>
|
||||||
|
|
||||||
|
<section class="showcaseCard">
|
||||||
|
<div class="codeLabel">Live Demo</div>
|
||||||
|
<h3>Updating percentage and text together</h3>
|
||||||
|
<p>A single component can express both how far the job is and which phase is currently active.</p>
|
||||||
|
<dees-progressbar
|
||||||
|
id="live-progress"
|
||||||
|
label="Customer export"
|
||||||
|
.percentage=${12}
|
||||||
|
statusText="Preparing archive and dependency graph..."
|
||||||
|
.statusRows=${2}
|
||||||
|
></dees-progressbar>
|
||||||
|
</section>
|
||||||
|
|
||||||
|
<section class="showcaseCard">
|
||||||
|
<div class="codeLabel">Compatibility</div>
|
||||||
|
<h3>Legacy <code>value</code> and <code>progress</code> inputs</h3>
|
||||||
|
<p>Existing usages can keep passing percentages directly or normalized progress values from 0 to 1.</p>
|
||||||
|
<div class="progressStack">
|
||||||
|
<dees-progressbar
|
||||||
|
label="From value"
|
||||||
|
.value=${75}
|
||||||
|
statusText="Migrating existing readme-style usage..."
|
||||||
|
.statusRows=${2}
|
||||||
|
></dees-progressbar>
|
||||||
|
<dees-progressbar
|
||||||
|
label="From progress"
|
||||||
|
.progress=${0.42}
|
||||||
|
.showPercentage=${false}
|
||||||
|
statusText="Rendering normalized progress input..."
|
||||||
|
.statusRows=${2}
|
||||||
|
></dees-progressbar>
|
||||||
|
</div>
|
||||||
|
</section>
|
||||||
|
</div>
|
||||||
|
</div>
|
||||||
|
</dees-demowrapper>
|
||||||
`;
|
`;
|
||||||
}
|
};
|
||||||
|
|||||||
@@ -1,4 +1,3 @@
|
|||||||
import * as plugins from '../../00plugins.js';
|
|
||||||
import * as colors from '../../00colors.js';
|
import * as colors from '../../00colors.js';
|
||||||
import { demoFunc } from './dees-progressbar.demo.js';
|
import { demoFunc } from './dees-progressbar.demo.js';
|
||||||
import {
|
import {
|
||||||
@@ -6,94 +5,342 @@ import {
|
|||||||
html,
|
html,
|
||||||
DeesElement,
|
DeesElement,
|
||||||
property,
|
property,
|
||||||
type TemplateResult,
|
|
||||||
cssManager,
|
cssManager,
|
||||||
css,
|
css,
|
||||||
type CSSResult,
|
|
||||||
unsafeCSS,
|
|
||||||
unsafeHTML,
|
|
||||||
state,
|
state,
|
||||||
} from '@design.estate/dees-element';
|
} from '@design.estate/dees-element';
|
||||||
|
|
||||||
import * as domtools from '@design.estate/dees-domtools';
|
|
||||||
import { themeDefaultStyles } from '../../00theme.js';
|
import { themeDefaultStyles } from '../../00theme.js';
|
||||||
|
|
||||||
|
declare global {
|
||||||
|
interface HTMLElementTagNameMap {
|
||||||
|
'dees-progressbar': DeesProgressbar;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
@customElement('dees-progressbar')
|
@customElement('dees-progressbar')
|
||||||
export class DeesProgressbar extends DeesElement {
|
export class DeesProgressbar extends DeesElement {
|
||||||
// STATIC
|
|
||||||
public static demo = demoFunc;
|
public static demo = demoFunc;
|
||||||
public static demoGroups = ['Feedback'];
|
public static demoGroups = ['Feedback'];
|
||||||
|
|
||||||
// INSTANCE
|
|
||||||
@property({
|
@property({
|
||||||
type: Number,
|
type: Number,
|
||||||
})
|
})
|
||||||
accessor percentage = 0;
|
accessor percentage = 0;
|
||||||
|
|
||||||
|
// `value` and `progress` keep existing readme/internal usages working.
|
||||||
|
@property({
|
||||||
|
type: Number,
|
||||||
|
})
|
||||||
|
accessor value: number | null = null;
|
||||||
|
|
||||||
|
@property({
|
||||||
|
type: Number,
|
||||||
|
})
|
||||||
|
accessor progress: number | null = null;
|
||||||
|
|
||||||
|
@property({
|
||||||
|
type: String,
|
||||||
|
})
|
||||||
|
accessor label = '';
|
||||||
|
|
||||||
|
@property({
|
||||||
|
type: String,
|
||||||
|
})
|
||||||
|
accessor statusText = '';
|
||||||
|
|
||||||
|
@property({
|
||||||
|
type: Array,
|
||||||
|
})
|
||||||
|
accessor terminalLines: string[] = [];
|
||||||
|
|
||||||
|
@property({
|
||||||
|
type: Number,
|
||||||
|
})
|
||||||
|
accessor statusRows = 3;
|
||||||
|
|
||||||
|
@property({
|
||||||
|
type: Boolean,
|
||||||
|
})
|
||||||
|
accessor indeterminate = false;
|
||||||
|
|
||||||
|
@property({
|
||||||
|
type: Boolean,
|
||||||
|
})
|
||||||
|
accessor showPercentage = true;
|
||||||
|
|
||||||
|
@state()
|
||||||
|
accessor activeSpinnerFrame = 0;
|
||||||
|
|
||||||
|
private spinnerIntervalId: number | null = null;
|
||||||
|
private readonly spinnerFrames = ['|', '/', '-', '\\'];
|
||||||
|
|
||||||
public static styles = [
|
public static styles = [
|
||||||
themeDefaultStyles,
|
themeDefaultStyles,
|
||||||
cssManager.defaultStyles,
|
cssManager.defaultStyles,
|
||||||
css`
|
css`
|
||||||
/* TODO: Migrate hardcoded values to --dees-* CSS variables */
|
|
||||||
:host {
|
:host {
|
||||||
|
display: block;
|
||||||
color: ${cssManager.bdTheme(colors.bright.text, colors.dark.text)};
|
color: ${cssManager.bdTheme(colors.bright.text, colors.dark.text)};
|
||||||
}
|
}
|
||||||
|
|
||||||
.progressBarContainer {
|
.progressBarContainer {
|
||||||
padding: 8px;
|
|
||||||
min-width: 200px;
|
min-width: 200px;
|
||||||
|
padding: 8px;
|
||||||
|
box-sizing: border-box;
|
||||||
|
}
|
||||||
|
|
||||||
|
.progressHeader {
|
||||||
|
display: flex;
|
||||||
|
justify-content: space-between;
|
||||||
|
align-items: baseline;
|
||||||
|
gap: 12px;
|
||||||
|
margin-bottom: 8px;
|
||||||
|
}
|
||||||
|
|
||||||
|
.progressLabel {
|
||||||
|
font-size: 14px;
|
||||||
|
font-weight: 500;
|
||||||
|
line-height: 1.3;
|
||||||
|
}
|
||||||
|
|
||||||
|
.progressValue {
|
||||||
|
font-size: 12px;
|
||||||
|
line-height: 1.3;
|
||||||
|
color: ${cssManager.bdTheme('hsl(215 15% 40%)', 'hsl(215 15% 70%)')};
|
||||||
|
font-family: 'SF Mono', 'Monaco', 'Inconsolata', 'Fira Code', monospace;
|
||||||
}
|
}
|
||||||
|
|
||||||
.progressBar {
|
.progressBar {
|
||||||
background: ${cssManager.bdTheme('#eeeeeb', '#444')};
|
position: relative;
|
||||||
height: 8px;
|
overflow: hidden;
|
||||||
width: 100%;
|
width: 100%;
|
||||||
border-radius: 4px;
|
height: 8px;
|
||||||
border-top: 0.5px solid ${cssManager.bdTheme('none', '#555')};
|
border-radius: 999px;
|
||||||
|
background: ${cssManager.bdTheme('#eeeeeb', '#444')};
|
||||||
|
border-top: 0.5px solid ${cssManager.bdTheme('transparent', '#555')};
|
||||||
}
|
}
|
||||||
|
|
||||||
.progressBarFill {
|
.progressBarFill {
|
||||||
|
height: 100%;
|
||||||
|
border-radius: inherit;
|
||||||
background: ${cssManager.bdTheme(colors.dark.blueActive, colors.bright.blueActive)};
|
background: ${cssManager.bdTheme(colors.dark.blueActive, colors.bright.blueActive)};
|
||||||
height: 8px;
|
transition: width 0.2s ease;
|
||||||
margin-top: -0.5px;
|
|
||||||
transition: 0.2s width;
|
|
||||||
border-radius: 4px;
|
|
||||||
width: 0px;
|
|
||||||
border-top: 0.5 solid ${cssManager.bdTheme('none', '#398fff')};
|
|
||||||
}
|
}
|
||||||
|
|
||||||
.progressText {
|
.progressBarFill.indeterminate {
|
||||||
padding: 8px;
|
width: 34%;
|
||||||
|
transition: none;
|
||||||
|
animation: indeterminateSlide 1.2s ease-in-out infinite;
|
||||||
|
}
|
||||||
|
|
||||||
|
.statusPanel {
|
||||||
|
margin-top: 10px;
|
||||||
|
height: calc(var(--status-rows, 3) * 1.35em + 16px);
|
||||||
|
min-height: calc(var(--status-rows, 3) * 1.35em + 16px);
|
||||||
|
padding: 8px 10px;
|
||||||
|
box-sizing: border-box;
|
||||||
|
border-radius: 8px;
|
||||||
|
border: 1px solid ${cssManager.bdTheme('hsl(210 20% 86%)', 'hsl(210 10% 26%)')};
|
||||||
|
background: ${cssManager.bdTheme('hsl(210 33% 98%)', 'hsl(220 20% 10%)')};
|
||||||
|
font-family: 'SF Mono', 'Monaco', 'Inconsolata', 'Fira Code', monospace;
|
||||||
|
font-size: 12px;
|
||||||
|
line-height: 1.35;
|
||||||
|
overflow: hidden;
|
||||||
|
}
|
||||||
|
|
||||||
|
.statusTextRow,
|
||||||
|
.terminalLine {
|
||||||
|
display: flex;
|
||||||
|
align-items: flex-start;
|
||||||
|
gap: 8px;
|
||||||
|
min-height: 1.35em;
|
||||||
|
}
|
||||||
|
|
||||||
|
.terminalScroller {
|
||||||
|
height: 100%;
|
||||||
|
overflow: auto;
|
||||||
|
}
|
||||||
|
|
||||||
|
.terminalScroller::-webkit-scrollbar {
|
||||||
|
width: 6px;
|
||||||
|
}
|
||||||
|
|
||||||
|
.terminalScroller::-webkit-scrollbar-thumb {
|
||||||
|
background: ${cssManager.bdTheme('hsl(215 18% 78%)', 'hsl(215 10% 34%)')};
|
||||||
|
border-radius: 999px;
|
||||||
|
}
|
||||||
|
|
||||||
|
.terminalScroller::-webkit-scrollbar-track {
|
||||||
|
background: transparent;
|
||||||
|
}
|
||||||
|
|
||||||
|
.linePrefix {
|
||||||
|
width: 1ch;
|
||||||
|
flex: 0 0 1ch;
|
||||||
|
color: ${cssManager.bdTheme(colors.dark.blueActive, colors.bright.blueActive)};
|
||||||
text-align: center;
|
text-align: center;
|
||||||
}
|
}
|
||||||
`
|
|
||||||
|
.lineText {
|
||||||
|
flex: 1;
|
||||||
|
min-width: 0;
|
||||||
|
color: ${cssManager.bdTheme('hsl(220 15% 25%)', 'hsl(210 15% 86%)')};
|
||||||
|
white-space: pre-wrap;
|
||||||
|
word-break: break-word;
|
||||||
|
}
|
||||||
|
|
||||||
|
.terminalLine:not(.current) .lineText {
|
||||||
|
color: ${cssManager.bdTheme('hsl(215 12% 42%)', 'hsl(215 12% 63%)')};
|
||||||
|
}
|
||||||
|
|
||||||
|
@keyframes indeterminateSlide {
|
||||||
|
0% {
|
||||||
|
transform: translateX(-120%);
|
||||||
|
}
|
||||||
|
|
||||||
|
100% {
|
||||||
|
transform: translateX(320%);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
`,
|
||||||
];
|
];
|
||||||
|
|
||||||
|
public async connectedCallback(): Promise<void> {
|
||||||
|
await super.connectedCallback();
|
||||||
|
this.syncSpinnerState();
|
||||||
|
}
|
||||||
|
|
||||||
|
public async disconnectedCallback(): Promise<void> {
|
||||||
|
this.stopSpinner();
|
||||||
|
await super.disconnectedCallback();
|
||||||
|
}
|
||||||
|
|
||||||
|
public updated(changedProperties: Map<string | number | symbol, unknown>): void {
|
||||||
|
super.updated(changedProperties);
|
||||||
|
this.syncSpinnerState();
|
||||||
|
|
||||||
|
if (changedProperties.has('terminalLines') && this.terminalLines.length > 0) {
|
||||||
|
this.scrollTerminalToBottom();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
public render() {
|
public render() {
|
||||||
|
const effectivePercentage = this.getEffectivePercentage();
|
||||||
|
const showHeader = Boolean(this.label) || (this.showPercentage && !this.indeterminate);
|
||||||
|
const hasTerminalLines = this.terminalLines.length > 0;
|
||||||
|
const hasStatusContent = hasTerminalLines || this.statusText.trim().length > 0;
|
||||||
|
const renderedRows = this.getRenderedStatusRows();
|
||||||
|
const spinnerFrame = this.spinnerFrames[this.activeSpinnerFrame] ?? this.spinnerFrames[0];
|
||||||
|
|
||||||
return html`
|
return html`
|
||||||
<div class="progressBarContainer">
|
<div class="progressBarContainer">
|
||||||
|
${showHeader ? html`
|
||||||
|
<div class="progressHeader">
|
||||||
|
<div class="progressLabel">${this.label}</div>
|
||||||
|
${this.showPercentage && !this.indeterminate ? html`
|
||||||
|
<div class="progressValue">${this.formatPercentage(effectivePercentage)}%</div>
|
||||||
|
` : ''}
|
||||||
|
</div>
|
||||||
|
` : ''}
|
||||||
<div class="progressBar">
|
<div class="progressBar">
|
||||||
<div class="progressBarFill"></div>
|
<div
|
||||||
<div class="progressText">
|
class="progressBarFill ${this.indeterminate ? 'indeterminate' : ''}"
|
||||||
${this.percentage}%
|
style="${this.indeterminate ? '' : `width: ${effectivePercentage}%;`}"
|
||||||
<div>
|
></div>
|
||||||
</div>
|
</div>
|
||||||
|
${hasStatusContent ? html`
|
||||||
|
<div
|
||||||
|
class="statusPanel"
|
||||||
|
style="--status-rows: ${renderedRows};"
|
||||||
|
aria-live="polite"
|
||||||
|
aria-atomic="true"
|
||||||
|
>
|
||||||
|
${hasTerminalLines ? html`
|
||||||
|
<div class="terminalScroller">
|
||||||
|
${this.terminalLines.map((line, index) => {
|
||||||
|
const isCurrentLine = index === this.terminalLines.length - 1;
|
||||||
|
const prefix = this.indeterminate && isCurrentLine ? spinnerFrame : '>';
|
||||||
|
return html`
|
||||||
|
<div class="terminalLine ${isCurrentLine ? 'current' : ''}">
|
||||||
|
<span class="linePrefix">${prefix}</span>
|
||||||
|
<span class="lineText">${line}</span>
|
||||||
|
</div>
|
||||||
|
`;
|
||||||
|
})}
|
||||||
|
</div>
|
||||||
|
` : html`
|
||||||
|
<div class="statusTextRow">
|
||||||
|
<span class="linePrefix">${this.indeterminate ? spinnerFrame : '>'}</span>
|
||||||
|
<span class="lineText">${this.statusText}</span>
|
||||||
|
</div>
|
||||||
|
`}
|
||||||
|
</div>
|
||||||
|
` : ''}
|
||||||
</div>
|
</div>
|
||||||
`
|
`;
|
||||||
}
|
}
|
||||||
|
|
||||||
firstUpdated (_changedProperties: Map<string | number | symbol, unknown>): void {
|
private getEffectivePercentage(): number {
|
||||||
super.firstUpdated(_changedProperties);
|
if (typeof this.value === 'number' && Number.isFinite(this.value)) {
|
||||||
this.updateComplete.then(() => {
|
return this.clampPercentage(this.value);
|
||||||
this.updatePercentage();
|
}
|
||||||
|
|
||||||
|
if (typeof this.progress === 'number' && Number.isFinite(this.progress)) {
|
||||||
|
const normalizedProgress = this.progress >= 0 && this.progress <= 1
|
||||||
|
? this.progress * 100
|
||||||
|
: this.progress;
|
||||||
|
return this.clampPercentage(normalizedProgress);
|
||||||
|
}
|
||||||
|
|
||||||
|
return this.clampPercentage(this.percentage);
|
||||||
|
}
|
||||||
|
|
||||||
|
private getRenderedStatusRows(): number {
|
||||||
|
const rows = Number.isFinite(this.statusRows) ? Math.floor(this.statusRows) : 3;
|
||||||
|
return Math.max(1, rows);
|
||||||
|
}
|
||||||
|
|
||||||
|
private clampPercentage(input: number): number {
|
||||||
|
return Math.max(0, Math.min(100, input));
|
||||||
|
}
|
||||||
|
|
||||||
|
private formatPercentage(input: number): string {
|
||||||
|
return Number.isInteger(input) ? `${input}` : input.toFixed(1).replace(/\.0$/, '');
|
||||||
|
}
|
||||||
|
|
||||||
|
private syncSpinnerState(): void {
|
||||||
|
const shouldAnimate = this.indeterminate && (this.statusText.trim().length > 0 || this.terminalLines.length > 0);
|
||||||
|
|
||||||
|
if (shouldAnimate && this.spinnerIntervalId === null) {
|
||||||
|
this.spinnerIntervalId = window.setInterval(() => {
|
||||||
|
this.activeSpinnerFrame = (this.activeSpinnerFrame + 1) % this.spinnerFrames.length;
|
||||||
|
}, 120);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!shouldAnimate) {
|
||||||
|
this.stopSpinner();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
private stopSpinner(): void {
|
||||||
|
if (this.spinnerIntervalId !== null) {
|
||||||
|
window.clearInterval(this.spinnerIntervalId);
|
||||||
|
this.spinnerIntervalId = null;
|
||||||
|
}
|
||||||
|
|
||||||
|
this.activeSpinnerFrame = 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
private scrollTerminalToBottom(): void {
|
||||||
|
const terminalScroller = this.shadowRoot?.querySelector('.terminalScroller') as HTMLElement | null;
|
||||||
|
|
||||||
|
if (!terminalScroller) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
window.requestAnimationFrame(() => {
|
||||||
|
terminalScroller.scrollTop = terminalScroller.scrollHeight;
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
}
|
||||||
public async updatePercentage() {
|
|
||||||
const progressBarFill = this.shadowRoot!.querySelector('.progressBarFill') as HTMLElement;
|
|
||||||
progressBarFill.style.width = `${this.percentage}%`;
|
|
||||||
}
|
|
||||||
|
|
||||||
updated(){
|
|
||||||
this.updatePercentage();
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|||||||
@@ -92,7 +92,7 @@ export const demoFunc = () => html`
|
|||||||
.required=${true}
|
.required=${true}
|
||||||
key="firstName"
|
key="firstName"
|
||||||
label="First Name"
|
label="First Name"
|
||||||
.description=${'Your given name'}
|
.infoText=${'Your given name'}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
|
|
||||||
<dees-input-text
|
<dees-input-text
|
||||||
@@ -105,7 +105,7 @@ export const demoFunc = () => html`
|
|||||||
.required=${true}
|
.required=${true}
|
||||||
key="email"
|
key="email"
|
||||||
label="Email Address"
|
label="Email Address"
|
||||||
.description=${'We will use this to contact you'}
|
.infoText=${'We will use this to contact you'}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
|
|
||||||
<dees-input-dropdown
|
<dees-input-dropdown
|
||||||
@@ -126,7 +126,7 @@ export const demoFunc = () => html`
|
|||||||
key="password"
|
key="password"
|
||||||
label="Password"
|
label="Password"
|
||||||
isPasswordBool
|
isPasswordBool
|
||||||
.description=${'Minimum 8 characters'}
|
.infoText=${'Minimum 8 characters'}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
|
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
@@ -300,7 +300,7 @@ export const demoFunc = () => html`
|
|||||||
<dees-input-fileupload
|
<dees-input-fileupload
|
||||||
key="documents"
|
key="documents"
|
||||||
.label=${'Upload Documents'}
|
.label=${'Upload Documents'}
|
||||||
.description=${'PDF, DOC, or DOCX files up to 10MB'}
|
.infoText=${'PDF, DOC, or DOCX files up to 10MB'}
|
||||||
></dees-input-fileupload>
|
></dees-input-fileupload>
|
||||||
|
|
||||||
<dees-form-submit>Submit Application</dees-form-submit>
|
<dees-form-submit>Submit Application</dees-form-submit>
|
||||||
|
|||||||
@@ -1,6 +1,7 @@
|
|||||||
import {
|
import {
|
||||||
DeesElement,
|
DeesElement,
|
||||||
property,
|
property,
|
||||||
|
html,
|
||||||
css,
|
css,
|
||||||
type CSSResult,
|
type CSSResult,
|
||||||
cssManager,
|
cssManager,
|
||||||
@@ -42,6 +43,9 @@ export abstract class DeesInputBase<T = any> extends DeesElement {
|
|||||||
@property({ type: Boolean })
|
@property({ type: Boolean })
|
||||||
accessor disabled: boolean = false;
|
accessor disabled: boolean = false;
|
||||||
|
|
||||||
|
@property({ type: String })
|
||||||
|
accessor infoText!: string;
|
||||||
|
|
||||||
@property({ type: String })
|
@property({ type: String })
|
||||||
accessor description!: string;
|
accessor description!: string;
|
||||||
|
|
||||||
@@ -90,6 +94,14 @@ export abstract class DeesInputBase<T = any> extends DeesElement {
|
|||||||
:host([label-position="none"]) dees-label {
|
:host([label-position="none"]) dees-label {
|
||||||
display: none;
|
display: none;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/* Description text below input */
|
||||||
|
.descriptionText {
|
||||||
|
margin-top: 4px;
|
||||||
|
font-size: 12px;
|
||||||
|
line-height: 1.4;
|
||||||
|
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
||||||
|
}
|
||||||
`,
|
`,
|
||||||
];
|
];
|
||||||
}
|
}
|
||||||
@@ -155,6 +167,14 @@ export abstract class DeesInputBase<T = any> extends DeesElement {
|
|||||||
this.disabled = false;
|
this.disabled = false;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Renders the description text below the input.
|
||||||
|
* Call ${this.renderDescription()} at the end of your render template.
|
||||||
|
*/
|
||||||
|
public renderDescription() {
|
||||||
|
return this.description ? html`<div class="descriptionText">${this.description}</div>` : '';
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Abstract method that child classes must implement to get their value
|
* Abstract method that child classes must implement to get their value
|
||||||
*/
|
*/
|
||||||
|
|||||||
@@ -111,90 +111,92 @@ export const demoFunc = () => html`
|
|||||||
|
|
||||||
<div class="demo-container">
|
<div class="demo-container">
|
||||||
<dees-panel .title=${'Basic Checkboxes'} .subtitle=${'Simple checkbox examples with various labels'}>
|
<dees-panel .title=${'Basic Checkboxes'} .subtitle=${'Simple checkbox examples with various labels'}>
|
||||||
<div class="checkbox-group">
|
<dees-form>
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'I agree to the Terms and Conditions'}
|
.label=${'I agree to the Terms and Conditions'}
|
||||||
.value=${true}
|
.value=${true}
|
||||||
.key=${'terms'}
|
.key=${'terms'}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
|
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'Subscribe to newsletter'}
|
.label=${'Subscribe to newsletter'}
|
||||||
.value=${false}
|
.value=${false}
|
||||||
.key=${'newsletter'}
|
.key=${'newsletter'}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
|
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'Enable notifications'}
|
.label=${'Enable notifications'}
|
||||||
.value=${false}
|
.value=${false}
|
||||||
.description=${'Receive email updates about your account'}
|
.description=${'Receive email updates about your account'}
|
||||||
.key=${'notifications'}
|
.key=${'notifications'}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Checkbox States'} .subtitle=${'Different checkbox states and configurations'}>
|
<dees-panel .title=${'Checkbox States'} .subtitle=${'Different checkbox states and configurations'}>
|
||||||
<div class="checkbox-group">
|
<dees-form>
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'Default state'}
|
.label=${'Default state'}
|
||||||
.value=${false}
|
.value=${false}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
|
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'Checked state'}
|
.label=${'Checked state'}
|
||||||
.value=${true}
|
.value=${true}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
|
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'Disabled unchecked'}
|
.label=${'Disabled unchecked'}
|
||||||
.value=${false}
|
.value=${false}
|
||||||
.disabled=${true}
|
.disabled=${true}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
|
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'Disabled checked'}
|
.label=${'Disabled checked'}
|
||||||
.value=${true}
|
.value=${true}
|
||||||
.disabled=${true}
|
.disabled=${true}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
|
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'Required checkbox'}
|
.label=${'Required checkbox'}
|
||||||
.required=${true}
|
.required=${true}
|
||||||
.key=${'required'}
|
.key=${'required'}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Horizontal Layout'} .subtitle=${'Checkboxes arranged horizontally for compact forms'}>
|
<dees-panel .title=${'Horizontal Layout'} .subtitle=${'Checkboxes arranged horizontally for compact forms'}>
|
||||||
<div class="horizontal-checkboxes">
|
<dees-form>
|
||||||
<dees-input-checkbox
|
<div class="horizontal-checkboxes">
|
||||||
.label=${'Option A'}
|
<dees-input-checkbox
|
||||||
.value=${false}
|
.label=${'Option A'}
|
||||||
.layoutMode=${'horizontal'}
|
.value=${false}
|
||||||
.key=${'optionA'}
|
.layoutMode=${'horizontal'}
|
||||||
></dees-input-checkbox>
|
.key=${'optionA'}
|
||||||
|
></dees-input-checkbox>
|
||||||
<dees-input-checkbox
|
|
||||||
.label=${'Option B'}
|
<dees-input-checkbox
|
||||||
.value=${true}
|
.label=${'Option B'}
|
||||||
.layoutMode=${'horizontal'}
|
.value=${true}
|
||||||
.key=${'optionB'}
|
.layoutMode=${'horizontal'}
|
||||||
></dees-input-checkbox>
|
.key=${'optionB'}
|
||||||
|
></dees-input-checkbox>
|
||||||
<dees-input-checkbox
|
|
||||||
.label=${'Option C'}
|
<dees-input-checkbox
|
||||||
.value=${false}
|
.label=${'Option C'}
|
||||||
.layoutMode=${'horizontal'}
|
.value=${false}
|
||||||
.key=${'optionC'}
|
.layoutMode=${'horizontal'}
|
||||||
></dees-input-checkbox>
|
.key=${'optionC'}
|
||||||
|
></dees-input-checkbox>
|
||||||
<dees-input-checkbox
|
|
||||||
.label=${'Option D'}
|
<dees-input-checkbox
|
||||||
.value=${true}
|
.label=${'Option D'}
|
||||||
.layoutMode=${'horizontal'}
|
.value=${true}
|
||||||
.key=${'optionD'}
|
.layoutMode=${'horizontal'}
|
||||||
></dees-input-checkbox>
|
.key=${'optionD'}
|
||||||
</div>
|
></dees-input-checkbox>
|
||||||
|
</div>
|
||||||
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Feature Selection Example'} .subtitle=${'Common use case for feature toggles with batch operations'}>
|
<dees-panel .title=${'Feature Selection Example'} .subtitle=${'Common use case for feature toggles with batch operations'}>
|
||||||
@@ -204,76 +206,76 @@ export const demoFunc = () => html`
|
|||||||
</div>
|
</div>
|
||||||
|
|
||||||
<div class="feature-list">
|
<div class="feature-list">
|
||||||
<div class="checkbox-group">
|
<dees-form>
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'Dark Mode Support'}
|
.label=${'Dark Mode Support'}
|
||||||
.value=${true}
|
.value=${true}
|
||||||
.key=${'feature1'}
|
.key=${'feature1'}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
|
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'Email Notifications'}
|
.label=${'Email Notifications'}
|
||||||
.value=${true}
|
.value=${true}
|
||||||
.key=${'feature2'}
|
.key=${'feature2'}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
|
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'Two-Factor Authentication'}
|
.label=${'Two-Factor Authentication'}
|
||||||
.value=${false}
|
.value=${false}
|
||||||
.key=${'feature3'}
|
.key=${'feature3'}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
|
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'API Access'}
|
.label=${'API Access'}
|
||||||
.value=${true}
|
.value=${true}
|
||||||
.key=${'feature4'}
|
.key=${'feature4'}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
|
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'Advanced Analytics'}
|
.label=${'Advanced Analytics'}
|
||||||
.value=${false}
|
.value=${false}
|
||||||
.key=${'feature5'}
|
.key=${'feature5'}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
</div>
|
</dees-form>
|
||||||
</div>
|
</div>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Privacy Settings Example'} .subtitle=${'Checkboxes in a typical form context'}>
|
<dees-panel .title=${'Privacy Settings Example'} .subtitle=${'Checkboxes in a typical form context'}>
|
||||||
<div class="form-section">
|
<div class="form-section">
|
||||||
<h4 class="section-title">Privacy Preferences</h4>
|
<h4 class="section-title">Privacy Preferences</h4>
|
||||||
|
|
||||||
<div class="checkbox-group">
|
<dees-form>
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'Share analytics data'}
|
.label=${'Share analytics data'}
|
||||||
.value=${true}
|
.value=${true}
|
||||||
.description=${'Help us improve by sharing anonymous usage data'}
|
.description=${'Help us improve by sharing anonymous usage data'}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
|
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'Personalized recommendations'}
|
.label=${'Personalized recommendations'}
|
||||||
.value=${true}
|
.value=${true}
|
||||||
.description=${'Get suggestions based on your activity'}
|
.description=${'Get suggestions based on your activity'}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
|
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'Marketing communications'}
|
.label=${'Marketing communications'}
|
||||||
.value=${false}
|
.value=${false}
|
||||||
.description=${'Receive promotional emails and special offers'}
|
.description=${'Receive promotional emails and special offers'}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
|
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'Third-party integrations'}
|
.label=${'Third-party integrations'}
|
||||||
.value=${false}
|
.value=${false}
|
||||||
.description=${'Allow approved partners to access your data'}
|
.description=${'Allow approved partners to access your data'}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
</div>
|
</dees-form>
|
||||||
</div>
|
</div>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Interactive Example'} .subtitle=${'Click checkboxes to see value changes'}>
|
<dees-panel .title=${'Interactive Example'} .subtitle=${'Click checkboxes to see value changes'}>
|
||||||
<div class="checkbox-group">
|
<dees-form>
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'Feature toggle'}
|
.label=${'Feature toggle'}
|
||||||
.value=${false}
|
.value=${false}
|
||||||
@changeSubject=${(event: CustomEvent) => {
|
@changeSubject=${(event: CustomEvent) => {
|
||||||
const output = document.querySelector('#checkbox-output');
|
const output = document.querySelector('#checkbox-output');
|
||||||
@@ -283,9 +285,9 @@ export const demoFunc = () => html`
|
|||||||
}
|
}
|
||||||
}}
|
}}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
|
|
||||||
<dees-input-checkbox
|
<dees-input-checkbox
|
||||||
.label=${'Debug mode'}
|
.label=${'Debug mode'}
|
||||||
.value=${false}
|
.value=${false}
|
||||||
@changeSubject=${(event: CustomEvent) => {
|
@changeSubject=${(event: CustomEvent) => {
|
||||||
const output = document.querySelector('#debug-output');
|
const output = document.querySelector('#debug-output');
|
||||||
@@ -295,8 +297,8 @@ export const demoFunc = () => html`
|
|||||||
}
|
}
|
||||||
}}
|
}}
|
||||||
></dees-input-checkbox>
|
></dees-input-checkbox>
|
||||||
</div>
|
</dees-form>
|
||||||
|
|
||||||
<div class="interactive-section">
|
<div class="interactive-section">
|
||||||
<div id="checkbox-output" class="output-text">Feature is disabled</div>
|
<div id="checkbox-output" class="output-text">Feature is disabled</div>
|
||||||
<div id="debug-output" class="output-text" style="margin-top: 8px;">Debug mode: OFF</div>
|
<div id="debug-output" class="output-text" style="margin-top: 8px;">Debug mode: OFF</div>
|
||||||
|
|||||||
@@ -147,12 +147,6 @@ export class DeesInputCheckbox extends DeesInputBase<DeesInputCheckbox> {
|
|||||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 90%)')};
|
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 90%)')};
|
||||||
}
|
}
|
||||||
|
|
||||||
/* Description */
|
|
||||||
.description-text {
|
|
||||||
font-size: 12px;
|
|
||||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
|
||||||
line-height: 1.5;
|
|
||||||
}
|
|
||||||
`,
|
`,
|
||||||
];
|
];
|
||||||
|
|
||||||
@@ -185,7 +179,7 @@ export class DeesInputCheckbox extends DeesInputBase<DeesInputCheckbox> {
|
|||||||
</div>
|
</div>
|
||||||
<div class="label-container">
|
<div class="label-container">
|
||||||
${this.label ? html`<div class="checkbox-label">${this.label}</div>` : ''}
|
${this.label ? html`<div class="checkbox-label">${this.label}</div>` : ''}
|
||||||
${this.description ? html`<div class="description-text">${this.description}</div>` : ''}
|
${this.renderDescription()}
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
|||||||
@@ -284,7 +284,7 @@ export class DeesInputCode extends DeesInputBase<string> {
|
|||||||
}
|
}
|
||||||
</style>
|
</style>
|
||||||
<div class="input-wrapper">
|
<div class="input-wrapper">
|
||||||
<dees-label .label=${this.label} .description=${this.description} .required=${this.required}></dees-label>
|
<dees-label .label=${this.label} .infoText=${this.infoText} .required=${this.required}></dees-label>
|
||||||
<dees-tile>
|
<dees-tile>
|
||||||
<div slot="header" class="toolbar">
|
<div slot="header" class="toolbar">
|
||||||
<div class="toolbar-left">
|
<div class="toolbar-left">
|
||||||
@@ -362,6 +362,7 @@ export class DeesInputCode extends DeesInputBase<string> {
|
|||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
</dees-tile>
|
</dees-tile>
|
||||||
|
${this.renderDescription()}
|
||||||
</div>
|
</div>
|
||||||
`;
|
`;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -4,7 +4,7 @@ import type { DeesInputDatepicker } from './component.js';
|
|||||||
export const renderDatepicker = (component: DeesInputDatepicker): TemplateResult => {
|
export const renderDatepicker = (component: DeesInputDatepicker): TemplateResult => {
|
||||||
return html`
|
return html`
|
||||||
<div class="input-wrapper">
|
<div class="input-wrapper">
|
||||||
<dees-label .label=${component.label} .description=${component.description} .required=${component.required}></dees-label>
|
<dees-label .label=${component.label} .infoText=${component.infoText} .required=${component.required}></dees-label>
|
||||||
<div class="input-container">
|
<div class="input-container">
|
||||||
<input
|
<input
|
||||||
type="text"
|
type="text"
|
||||||
@@ -27,6 +27,7 @@ export const renderDatepicker = (component: DeesInputDatepicker): TemplateResult
|
|||||||
<dees-icon class="calendar-icon" icon="lucide:calendar" iconSize="16"></dees-icon>
|
<dees-icon class="calendar-icon" icon="lucide:calendar" iconSize="16"></dees-icon>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
${component.renderDescription()}
|
||||||
</div>
|
</div>
|
||||||
`;
|
`;
|
||||||
|
|
||||||
|
|||||||
@@ -31,12 +31,6 @@ export const demoFunc = () => html`
|
|||||||
flex-wrap: wrap;
|
flex-wrap: wrap;
|
||||||
}
|
}
|
||||||
|
|
||||||
.input-group {
|
|
||||||
display: flex;
|
|
||||||
flex-direction: column;
|
|
||||||
gap: 16px;
|
|
||||||
}
|
|
||||||
|
|
||||||
.spacer {
|
.spacer {
|
||||||
height: 200px;
|
height: 200px;
|
||||||
display: flex;
|
display: flex;
|
||||||
@@ -69,9 +63,10 @@ export const demoFunc = () => html`
|
|||||||
}
|
}
|
||||||
}}>
|
}}>
|
||||||
<dees-panel .title=${'1. Basic Dropdowns'} .subtitle=${'Standard dropdown with search functionality and various options'}>
|
<dees-panel .title=${'1. Basic Dropdowns'} .subtitle=${'Standard dropdown with search functionality and various options'}>
|
||||||
<div class="input-group">
|
<dees-form>
|
||||||
<dees-input-dropdown
|
<dees-input-dropdown
|
||||||
.label=${'Select Country'}
|
.label=${'Select Country'}
|
||||||
|
.description=${'Choose the country where your business is registered'}
|
||||||
.options=${[
|
.options=${[
|
||||||
{ option: 'United States', key: 'us' },
|
{ option: 'United States', key: 'us' },
|
||||||
{ option: 'Canada', key: 'ca' },
|
{ option: 'Canada', key: 'ca' },
|
||||||
@@ -94,7 +89,7 @@ export const demoFunc = () => html`
|
|||||||
{ option: 'Guest', key: 'guest' }
|
{ option: 'Guest', key: 'guest' }
|
||||||
]}
|
]}
|
||||||
></dees-input-dropdown>
|
></dees-input-dropdown>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
</dees-demowrapper>
|
</dees-demowrapper>
|
||||||
|
|
||||||
@@ -135,40 +130,42 @@ export const demoFunc = () => html`
|
|||||||
});
|
});
|
||||||
}}>
|
}}>
|
||||||
<dees-panel .title=${'3. Horizontal Layout'} .subtitle=${'Multiple dropdowns in a horizontal layout for compact forms'}>
|
<dees-panel .title=${'3. Horizontal Layout'} .subtitle=${'Multiple dropdowns in a horizontal layout for compact forms'}>
|
||||||
<div class="horizontal-group">
|
<dees-form>
|
||||||
<dees-input-dropdown
|
<div class="horizontal-group">
|
||||||
.label=${'Department'}
|
<dees-input-dropdown
|
||||||
.layoutMode=${'horizontal'}
|
.label=${'Department'}
|
||||||
.options=${[
|
.layoutMode=${'horizontal'}
|
||||||
{ option: 'Engineering', key: 'eng' },
|
.options=${[
|
||||||
{ option: 'Design', key: 'design' },
|
{ option: 'Engineering', key: 'eng' },
|
||||||
{ option: 'Marketing', key: 'marketing' },
|
{ option: 'Design', key: 'design' },
|
||||||
{ option: 'Sales', key: 'sales' }
|
{ option: 'Marketing', key: 'marketing' },
|
||||||
]}
|
{ option: 'Sales', key: 'sales' }
|
||||||
></dees-input-dropdown>
|
]}
|
||||||
|
></dees-input-dropdown>
|
||||||
<dees-input-dropdown
|
|
||||||
.label=${'Team Size'}
|
<dees-input-dropdown
|
||||||
.layoutMode=${'horizontal'}
|
.label=${'Team Size'}
|
||||||
.enableSearch=${false}
|
.layoutMode=${'horizontal'}
|
||||||
.options=${[
|
.enableSearch=${false}
|
||||||
{ option: '1-5', key: 'small' },
|
.options=${[
|
||||||
{ option: '6-20', key: 'medium' },
|
{ option: '1-5', key: 'small' },
|
||||||
{ option: '21-50', key: 'large' },
|
{ option: '6-20', key: 'medium' },
|
||||||
{ option: '50+', key: 'xlarge' }
|
{ option: '21-50', key: 'large' },
|
||||||
]}
|
{ option: '50+', key: 'xlarge' }
|
||||||
></dees-input-dropdown>
|
]}
|
||||||
|
></dees-input-dropdown>
|
||||||
<dees-input-dropdown
|
|
||||||
.label=${'Location'}
|
<dees-input-dropdown
|
||||||
.layoutMode=${'horizontal'}
|
.label=${'Location'}
|
||||||
.options=${[
|
.layoutMode=${'horizontal'}
|
||||||
{ option: 'Remote', key: 'remote' },
|
.options=${[
|
||||||
{ option: 'On-site', key: 'onsite' },
|
{ option: 'Remote', key: 'remote' },
|
||||||
{ option: 'Hybrid', key: 'hybrid' }
|
{ option: 'On-site', key: 'onsite' },
|
||||||
]}
|
{ option: 'Hybrid', key: 'hybrid' }
|
||||||
></dees-input-dropdown>
|
]}
|
||||||
</div>
|
></dees-input-dropdown>
|
||||||
|
</div>
|
||||||
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
</dees-demowrapper>
|
</dees-demowrapper>
|
||||||
|
|
||||||
@@ -184,7 +181,7 @@ export const demoFunc = () => html`
|
|||||||
}
|
}
|
||||||
}}>
|
}}>
|
||||||
<dees-panel .title=${'4. States'} .subtitle=${'Different states and configurations'}>
|
<dees-panel .title=${'4. States'} .subtitle=${'Different states and configurations'}>
|
||||||
<div class="input-group">
|
<dees-form>
|
||||||
<dees-input-dropdown
|
<dees-input-dropdown
|
||||||
.label=${'Required Field'}
|
.label=${'Required Field'}
|
||||||
.required=${true}
|
.required=${true}
|
||||||
@@ -203,7 +200,7 @@ export const demoFunc = () => html`
|
|||||||
]}
|
]}
|
||||||
.selectedOption=${{ option: 'Cannot Select', key: 'disabled' }}
|
.selectedOption=${{ option: 'Cannot Select', key: 'disabled' }}
|
||||||
></dees-input-dropdown>
|
></dees-input-dropdown>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
</dees-demowrapper>
|
</dees-demowrapper>
|
||||||
|
|
||||||
|
|||||||
@@ -168,7 +168,7 @@ export class DeesInputDropdown extends DeesInputBase<DeesInputDropdown> {
|
|||||||
public render(): TemplateResult {
|
public render(): TemplateResult {
|
||||||
return html`
|
return html`
|
||||||
<div class="input-wrapper">
|
<div class="input-wrapper">
|
||||||
<dees-label .label=${this.label} .description=${this.description} .required=${this.required}></dees-label>
|
<dees-label .label=${this.label} .infoText=${this.infoText} .required=${this.required}></dees-label>
|
||||||
<div class="maincontainer">
|
<div class="maincontainer">
|
||||||
<div
|
<div
|
||||||
class="selectedBox ${this.isOpened ? 'open' : ''} ${this.disabled ? 'disabled' : ''}"
|
class="selectedBox ${this.isOpened ? 'open' : ''} ${this.disabled ? 'disabled' : ''}"
|
||||||
@@ -179,6 +179,7 @@ export class DeesInputDropdown extends DeesInputBase<DeesInputDropdown> {
|
|||||||
${this.selectedOption?.option || 'Select an option'}
|
${this.selectedOption?.option || 'Select an option'}
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
${this.renderDescription()}
|
||||||
</div>
|
</div>
|
||||||
`;
|
`;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -73,7 +73,7 @@ export class DeesInputFileupload extends DeesInputBase<DeesInputFileupload> {
|
|||||||
<div class="input-wrapper">
|
<div class="input-wrapper">
|
||||||
<dees-label
|
<dees-label
|
||||||
.label=${this.label}
|
.label=${this.label}
|
||||||
.description=${this.description}
|
.infoText=${this.infoText}
|
||||||
.required=${this.required}
|
.required=${this.required}
|
||||||
></dees-label>
|
></dees-label>
|
||||||
<dees-tile
|
<dees-tile
|
||||||
@@ -114,6 +114,7 @@ export class DeesInputFileupload extends DeesInputBase<DeesInputFileupload> {
|
|||||||
${this.validationMessage
|
${this.validationMessage
|
||||||
? html`<div class="validation-message" aria-live="polite">${this.validationMessage}</div>`
|
? html`<div class="validation-message" aria-live="polite">${this.validationMessage}</div>`
|
||||||
: html``}
|
: html``}
|
||||||
|
${this.renderDescription()}
|
||||||
</div>
|
</div>
|
||||||
`;
|
`;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -55,40 +55,43 @@ export const demoFunc = () => html`
|
|||||||
.title=${'Modern file uploader'}
|
.title=${'Modern file uploader'}
|
||||||
.subtitle=${'Shadcn-inspired layout with drag & drop, previews and validation'}
|
.subtitle=${'Shadcn-inspired layout with drag & drop, previews and validation'}
|
||||||
>
|
>
|
||||||
<div class="demo-grid demo-grid--two">
|
<dees-form>
|
||||||
<div class="demo-stack">
|
<div class="demo-grid demo-grid--two">
|
||||||
<dees-input-fileupload
|
<div class="demo-stack">
|
||||||
.label=${'Attachments'}
|
<dees-input-fileupload
|
||||||
.description=${'Upload supporting documents for your request'}
|
.label=${'Attachments'}
|
||||||
.accept=${'image/*,.pdf,.zip'}
|
.infoText=${'Upload supporting documents for your request'}
|
||||||
.maxSize=${10 * 1024 * 1024}
|
.description=${'Accepted formats: images, PDF, and ZIP archives up to 10MB'}
|
||||||
></dees-input-fileupload>
|
.accept=${'image/*,.pdf,.zip'}
|
||||||
|
.maxSize=${10 * 1024 * 1024}
|
||||||
|
></dees-input-fileupload>
|
||||||
|
|
||||||
<dees-input-fileupload
|
<dees-input-fileupload
|
||||||
.label=${'Brand assets'}
|
.label=${'Brand assets'}
|
||||||
.description=${'Upload high-resolution imagery (JPG/PNG)'}
|
.infoText=${'Upload high-resolution imagery (JPG/PNG)'}
|
||||||
.accept=${'image/jpeg,image/png'}
|
.accept=${'image/jpeg,image/png'}
|
||||||
.multiple=${false}
|
.multiple=${false}
|
||||||
.maxSize=${5 * 1024 * 1024}
|
.maxSize=${5 * 1024 * 1024}
|
||||||
.buttonText=${'Select cover image'}
|
.buttonText=${'Select cover image'}
|
||||||
></dees-input-fileupload>
|
></dees-input-fileupload>
|
||||||
|
</div>
|
||||||
|
|
||||||
|
<div class="demo-stack">
|
||||||
|
<dees-input-fileupload
|
||||||
|
.label=${'Audio uploads'}
|
||||||
|
.infoText=${'Share podcast drafts (MP3/WAV, max 25MB each)'}
|
||||||
|
.accept=${'audio/*'}
|
||||||
|
.maxSize=${25 * 1024 * 1024}
|
||||||
|
></dees-input-fileupload>
|
||||||
|
|
||||||
|
<dees-input-fileupload
|
||||||
|
.label=${'Disabled example'}
|
||||||
|
.infoText=${'Uploader is disabled while moderation is pending'}
|
||||||
|
.disabled=${true}
|
||||||
|
></dees-input-fileupload>
|
||||||
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
</dees-form>
|
||||||
<div class="demo-stack">
|
|
||||||
<dees-input-fileupload
|
|
||||||
.label=${'Audio uploads'}
|
|
||||||
.description=${'Share podcast drafts (MP3/WAV, max 25MB each)'}
|
|
||||||
.accept=${'audio/*'}
|
|
||||||
.maxSize=${25 * 1024 * 1024}
|
|
||||||
></dees-input-fileupload>
|
|
||||||
|
|
||||||
<dees-input-fileupload
|
|
||||||
.label=${'Disabled example'}
|
|
||||||
.description=${'Uploader is disabled while moderation is pending'}
|
|
||||||
.disabled=${true}
|
|
||||||
></dees-input-fileupload>
|
|
||||||
</div>
|
|
||||||
</div>
|
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel
|
<dees-panel
|
||||||
@@ -97,10 +100,9 @@ export const demoFunc = () => html`
|
|||||||
>
|
>
|
||||||
<div class="demo-grid">
|
<div class="demo-grid">
|
||||||
<dees-form>
|
<dees-form>
|
||||||
<div class="demo-stack">
|
|
||||||
<dees-input-text
|
<dees-input-text
|
||||||
.label=${'Project name'}
|
.label=${'Project name'}
|
||||||
.description=${'How should we refer to this project internally?'}
|
.infoText=${'How should we refer to this project internally?'}
|
||||||
.required=${true}
|
.required=${true}
|
||||||
.key=${'projectName'}
|
.key=${'projectName'}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
@@ -114,7 +116,7 @@ export const demoFunc = () => html`
|
|||||||
|
|
||||||
<dees-input-fileupload
|
<dees-input-fileupload
|
||||||
.label=${'Statement of work'}
|
.label=${'Statement of work'}
|
||||||
.description=${'Upload a signed statement of work (PDF, max 15MB)'}
|
.infoText=${'Upload a signed statement of work (PDF, max 15MB)'}
|
||||||
.required=${true}
|
.required=${true}
|
||||||
.accept=${'application/pdf'}
|
.accept=${'application/pdf'}
|
||||||
.maxSize=${15 * 1024 * 1024}
|
.maxSize=${15 * 1024 * 1024}
|
||||||
@@ -124,7 +126,7 @@ export const demoFunc = () => html`
|
|||||||
|
|
||||||
<dees-input-fileupload
|
<dees-input-fileupload
|
||||||
.label=${'Creative references'}
|
.label=${'Creative references'}
|
||||||
.description=${'Optional. Upload up to five visual references'}
|
.infoText=${'Optional. Upload up to five visual references'}
|
||||||
.accept=${'image/*'}
|
.accept=${'image/*'}
|
||||||
.maxFiles=${5}
|
.maxFiles=${5}
|
||||||
.maxSize=${8 * 1024 * 1024}
|
.maxSize=${8 * 1024 * 1024}
|
||||||
@@ -133,13 +135,12 @@ export const demoFunc = () => html`
|
|||||||
|
|
||||||
<dees-input-text
|
<dees-input-text
|
||||||
.label=${'Notes'}
|
.label=${'Notes'}
|
||||||
.description=${'Add optional context for reviewers'}
|
.infoText=${'Add optional context for reviewers'}
|
||||||
.inputType=${'textarea'}
|
.inputType=${'textarea'}
|
||||||
.key=${'notes'}
|
.key=${'notes'}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
|
|
||||||
<dees-form-submit .text=${'Submit briefing'}></dees-form-submit>
|
<dees-form-submit .text=${'Submit briefing'}></dees-form-submit>
|
||||||
</div>
|
|
||||||
</dees-form>
|
</dees-form>
|
||||||
|
|
||||||
<div class="demo-note">
|
<div class="demo-note">
|
||||||
|
|||||||
@@ -13,12 +13,6 @@ export const demoFunc = () => html`
|
|||||||
margin: 0 auto;
|
margin: 0 auto;
|
||||||
}
|
}
|
||||||
|
|
||||||
.input-group {
|
|
||||||
display: flex;
|
|
||||||
flex-direction: column;
|
|
||||||
gap: 16px;
|
|
||||||
}
|
|
||||||
|
|
||||||
.payment-group {
|
.payment-group {
|
||||||
display: flex;
|
display: flex;
|
||||||
align-items: center;
|
align-items: center;
|
||||||
@@ -30,58 +24,61 @@ export const demoFunc = () => html`
|
|||||||
|
|
||||||
<div class="demo-container">
|
<div class="demo-container">
|
||||||
<dees-panel .title=${'Basic IBAN Input'} .subtitle=${'International Bank Account Number with automatic formatting'}>
|
<dees-panel .title=${'Basic IBAN Input'} .subtitle=${'International Bank Account Number with automatic formatting'}>
|
||||||
<div class="input-group">
|
<dees-form>
|
||||||
<dees-input-iban
|
<dees-input-iban
|
||||||
.label=${'Bank Account IBAN'}
|
.label=${'Bank Account IBAN'}
|
||||||
.description=${'Enter your International Bank Account Number'}
|
.infoText=${'Enter your International Bank Account Number'}
|
||||||
|
.description=${'Your IBAN can be found on your bank statement'}
|
||||||
></dees-input-iban>
|
></dees-input-iban>
|
||||||
|
|
||||||
<dees-input-iban
|
<dees-input-iban
|
||||||
.label=${'Verified IBAN'}
|
.label=${'Verified IBAN'}
|
||||||
.description=${'This IBAN has been verified'}
|
.infoText=${'This IBAN has been verified'}
|
||||||
.value=${'DE89370400440532013000'}
|
.value=${'DE89370400440532013000'}
|
||||||
></dees-input-iban>
|
></dees-input-iban>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Payment Information'} .subtitle=${'IBAN input with horizontal layout for payment forms'}>
|
<dees-panel .title=${'Payment Information'} .subtitle=${'IBAN input with horizontal layout for payment forms'}>
|
||||||
<div class="payment-group">
|
<dees-form>
|
||||||
<dees-input-text
|
<div class="payment-group">
|
||||||
.label=${'Account Holder'}
|
<dees-input-text
|
||||||
.layoutMode=${'horizontal'}
|
.label=${'Account Holder'}
|
||||||
.value=${'John Doe'}
|
.layoutMode=${'horizontal'}
|
||||||
></dees-input-text>
|
.value=${'John Doe'}
|
||||||
|
></dees-input-text>
|
||||||
<dees-input-iban
|
|
||||||
.label=${'IBAN'}
|
<dees-input-iban
|
||||||
.layoutMode=${'horizontal'}
|
.label=${'IBAN'}
|
||||||
.value=${'GB82WEST12345698765432'}
|
.layoutMode=${'horizontal'}
|
||||||
></dees-input-iban>
|
.value=${'GB82WEST12345698765432'}
|
||||||
</div>
|
></dees-input-iban>
|
||||||
|
</div>
|
||||||
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Validation & States'} .subtitle=${'Required fields and disabled states'}>
|
<dees-panel .title=${'Validation & States'} .subtitle=${'Required fields and disabled states'}>
|
||||||
<div class="input-group">
|
<dees-form>
|
||||||
<dees-input-iban
|
<dees-input-iban
|
||||||
.label=${'Payment Account'}
|
.label=${'Payment Account'}
|
||||||
.description=${'Required for processing payments'}
|
.infoText=${'Required for processing payments'}
|
||||||
.required=${true}
|
.required=${true}
|
||||||
></dees-input-iban>
|
></dees-input-iban>
|
||||||
|
|
||||||
<dees-input-iban
|
<dees-input-iban
|
||||||
.label=${'Locked IBAN'}
|
.label=${'Locked IBAN'}
|
||||||
.description=${'This IBAN cannot be changed'}
|
.infoText=${'This IBAN cannot be changed'}
|
||||||
.value=${'FR1420041010050500013M02606'}
|
.value=${'FR1420041010050500013M02606'}
|
||||||
.disabled=${true}
|
.disabled=${true}
|
||||||
></dees-input-iban>
|
></dees-input-iban>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Bank Transfer Form'} .subtitle=${'Complete form example with IBAN validation'}>
|
<dees-panel .title=${'Bank Transfer Form'} .subtitle=${'Complete form example with IBAN validation'}>
|
||||||
<dees-form>
|
<dees-form>
|
||||||
<dees-input-text .label=${'Recipient Name'} .required=${true}></dees-input-text>
|
<dees-input-text .label=${'Recipient Name'} .required=${true}></dees-input-text>
|
||||||
<dees-input-iban .label=${'Recipient IBAN'} .required=${true}></dees-input-iban>
|
<dees-input-iban .label=${'Recipient IBAN'} .required=${true}></dees-input-iban>
|
||||||
<dees-input-text .label=${'Transfer Reference'} .description=${'Optional reference for the transfer'}></dees-input-text>
|
<dees-input-text .label=${'Transfer Reference'} .infoText=${'Optional reference for the transfer'}></dees-input-text>
|
||||||
<dees-input-text .label=${'Amount'} .inputType=${'number'} .required=${true}></dees-input-text>
|
<dees-input-text .label=${'Amount'} .inputType=${'number'} .required=${true}></dees-input-text>
|
||||||
</dees-form>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|||||||
@@ -44,16 +44,27 @@ export class DeesInputIban extends DeesInputBase<DeesInputIban> {
|
|||||||
public render(): TemplateResult {
|
public render(): TemplateResult {
|
||||||
return html`
|
return html`
|
||||||
<div class="input-wrapper">
|
<div class="input-wrapper">
|
||||||
<dees-label .label=${this.label || 'IBAN'} .description=${this.description}></dees-label>
|
<dees-label .label=${this.label || 'IBAN'} .infoText=${this.infoText}></dees-label>
|
||||||
<dees-input-text
|
<dees-input-text
|
||||||
.value=${this.value}
|
.value=${this.value}
|
||||||
.disabled=${this.disabled}
|
.disabled=${this.disabled}
|
||||||
.required=${this.required}
|
.required=${this.required}
|
||||||
.placeholder=${'DE89 3704 0044 0532 0130 00'}
|
.placeholder=${'DE89 3704 0044 0532 0130 00'}
|
||||||
|
.validationFunction=${(value: string) => {
|
||||||
|
const normalized = value.replace(/ /g, '');
|
||||||
|
if (normalized.length === 0) {
|
||||||
|
return { valid: true, message: '' };
|
||||||
|
}
|
||||||
|
const isValid = ibantools.isValidIBAN(normalized);
|
||||||
|
return isValid
|
||||||
|
? { valid: true, message: 'IBAN is valid' }
|
||||||
|
: { valid: false, message: 'Please enter a valid IBAN' };
|
||||||
|
}}
|
||||||
@input=${(eventArg: InputEvent) => {
|
@input=${(eventArg: InputEvent) => {
|
||||||
this.validateIban(eventArg);
|
this.validateIban(eventArg);
|
||||||
}}
|
}}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
|
${this.renderDescription()}
|
||||||
</div>
|
</div>
|
||||||
`;
|
`;
|
||||||
}
|
}
|
||||||
@@ -81,10 +92,6 @@ export class DeesInputIban extends DeesInputBase<DeesInputIban> {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
this.enteredIbanIsValid = ibantools.isValidIBAN(this.enteredString.replace(/ /g, ''));
|
this.enteredIbanIsValid = ibantools.isValidIBAN(this.enteredString.replace(/ /g, ''));
|
||||||
const deesInputText = this.shadowRoot!.querySelector('dees-input-text') as any;
|
|
||||||
if (deesInputText) {
|
|
||||||
deesInputText.validationText = `IBAN is valid: ${this.enteredIbanIsValid}`;
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
public getValue(): string {
|
public getValue(): string {
|
||||||
|
|||||||
@@ -109,25 +109,27 @@ export const demoFunc = () => html`
|
|||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'3. Validation & Constraints'} .subtitle=${'Lists with minimum/maximum items and duplicate prevention'}>
|
<dees-panel .title=${'3. Validation & Constraints'} .subtitle=${'Lists with minimum/maximum items and duplicate prevention'}>
|
||||||
<div class="grid-layout">
|
<dees-form>
|
||||||
<dees-input-list
|
<div class="grid-layout">
|
||||||
.label=${'Team Members (Min 2, Max 5)'}
|
<dees-input-list
|
||||||
.placeholder=${'Add team member...'}
|
.label=${'Team Members (Min 2, Max 5)'}
|
||||||
.minItems=${2}
|
.placeholder=${'Add team member...'}
|
||||||
.maxItems=${5}
|
.minItems=${2}
|
||||||
.value=${['Alice', 'Bob']}
|
.maxItems=${5}
|
||||||
.required=${true}
|
.value=${['Alice', 'Bob']}
|
||||||
.description=${'Add 2-5 team members'}
|
.required=${true}
|
||||||
></dees-input-list>
|
.description=${'Add 2-5 team members'}
|
||||||
|
></dees-input-list>
|
||||||
<dees-input-list
|
|
||||||
.label=${'Unique Tags (No Duplicates)'}
|
<dees-input-list
|
||||||
.placeholder=${'Add unique tag...'}
|
.label=${'Unique Tags (No Duplicates)'}
|
||||||
.allowDuplicates=${false}
|
.placeholder=${'Add unique tag...'}
|
||||||
.value=${['frontend', 'backend', 'database']}
|
.allowDuplicates=${false}
|
||||||
.description=${'Duplicate items are not allowed'}
|
.value=${['frontend', 'backend', 'database']}
|
||||||
></dees-input-list>
|
.description=${'Duplicate items are not allowed'}
|
||||||
</div>
|
></dees-input-list>
|
||||||
|
</div>
|
||||||
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'4. Delete Confirmation'} .subtitle=${'Require confirmation before deleting items'}>
|
<dees-panel .title=${'4. Delete Confirmation'} .subtitle=${'Require confirmation before deleting items'}>
|
||||||
|
|||||||
@@ -373,13 +373,6 @@ export class DeesInputList extends DeesInputBase<DeesInputList> {
|
|||||||
line-height: 1.4;
|
line-height: 1.4;
|
||||||
}
|
}
|
||||||
|
|
||||||
.description {
|
|
||||||
color: ${cssManager.bdTheme('hsl(215.4 16.3% 56.9%)', 'hsl(215 20.2% 55.1%)')};
|
|
||||||
font-size: 12px;
|
|
||||||
margin-top: 4px;
|
|
||||||
line-height: 1.4;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Scrollbar styling */
|
/* Scrollbar styling */
|
||||||
.list-items::-webkit-scrollbar {
|
.list-items::-webkit-scrollbar {
|
||||||
width: 8px;
|
width: 8px;
|
||||||
@@ -546,9 +539,7 @@ export class DeesInputList extends DeesInputBase<DeesInputList> {
|
|||||||
<div class="validation-message">${this.validationText}</div>
|
<div class="validation-message">${this.validationText}</div>
|
||||||
` : ''}
|
` : ''}
|
||||||
|
|
||||||
${this.description ? html`
|
${this.renderDescription()}
|
||||||
<div class="description">${this.description}</div>
|
|
||||||
` : ''}
|
|
||||||
</div>
|
</div>
|
||||||
`;
|
`;
|
||||||
}
|
}
|
||||||
|
|||||||
+68
-65
@@ -52,80 +52,83 @@ export const demoFunc = () => html`
|
|||||||
<div class="section">
|
<div class="section">
|
||||||
<div class="section-title">Multi-Option Toggle</div>
|
<div class="section-title">Multi-Option Toggle</div>
|
||||||
<div class="section-description">Select from multiple options with a smooth sliding indicator animation.</div>
|
<div class="section-description">Select from multiple options with a smooth sliding indicator animation.</div>
|
||||||
|
|
||||||
<dees-input-multitoggle
|
<dees-form>
|
||||||
.label=${'Display Mode'}
|
<dees-input-multitoggle
|
||||||
.description=${'Choose how content is displayed'}
|
.label=${'Display Mode'}
|
||||||
.options=${['List View', 'Grid View', 'Compact']}
|
.infoText=${'Choose how content is displayed'}
|
||||||
.selectedOption=${'Grid View'}
|
.description=${'This setting affects how items appear on your dashboard'}
|
||||||
></dees-input-multitoggle>
|
.options=${['List View', 'Grid View', 'Compact']}
|
||||||
|
.selectedOption=${'Grid View'}
|
||||||
<br><br>
|
></dees-input-multitoggle>
|
||||||
|
|
||||||
<dees-input-multitoggle
|
<dees-input-multitoggle
|
||||||
.label=${'T-Shirt Size'}
|
.label=${'T-Shirt Size'}
|
||||||
.description=${'Select your preferred size'}
|
.infoText=${'Select your preferred size'}
|
||||||
.options=${['XS', 'S', 'M', 'L', 'XL', 'XXL']}
|
.options=${['XS', 'S', 'M', 'L', 'XL', 'XXL']}
|
||||||
.selectedOption=${'M'}
|
.selectedOption=${'M'}
|
||||||
></dees-input-multitoggle>
|
></dees-input-multitoggle>
|
||||||
|
</dees-form>
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
<div class="section">
|
<div class="section">
|
||||||
<div class="section-title">Boolean Toggle</div>
|
<div class="section-title">Boolean Toggle</div>
|
||||||
<div class="section-description">Simple on/off switches with customizable labels for clearer context.</div>
|
<div class="section-description">Simple on/off switches with customizable labels for clearer context.</div>
|
||||||
|
|
||||||
<dees-input-multitoggle
|
<dees-form>
|
||||||
.label=${'Notifications'}
|
<dees-input-multitoggle
|
||||||
.description=${'Enable or disable push notifications'}
|
.label=${'Notifications'}
|
||||||
.type=${'boolean'}
|
.infoText=${'Enable or disable push notifications'}
|
||||||
.selectedOption=${'true'}
|
.type=${'boolean'}
|
||||||
></dees-input-multitoggle>
|
.selectedOption=${'true'}
|
||||||
|
></dees-input-multitoggle>
|
||||||
<br><br>
|
|
||||||
|
<dees-input-multitoggle
|
||||||
<dees-input-multitoggle
|
.label=${'Theme Mode'}
|
||||||
.label=${'Theme Mode'}
|
.infoText=${'Switch between light and dark theme'}
|
||||||
.description=${'Switch between light and dark theme'}
|
.type=${'boolean'}
|
||||||
.type=${'boolean'}
|
.booleanTrueName=${'Dark'}
|
||||||
.booleanTrueName=${'Dark'}
|
.booleanFalseName=${'Light'}
|
||||||
.booleanFalseName=${'Light'}
|
.selectedOption=${'Dark'}
|
||||||
.selectedOption=${'Dark'}
|
></dees-input-multitoggle>
|
||||||
></dees-input-multitoggle>
|
</dees-form>
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
<div class="section">
|
<div class="section">
|
||||||
<div class="section-title">Settings Grid</div>
|
<div class="section-title">Settings Grid</div>
|
||||||
<div class="section-description">Configuration options arranged in a responsive grid layout.</div>
|
<div class="section-description">Configuration options arranged in a responsive grid layout.</div>
|
||||||
|
|
||||||
<div class="settings-grid">
|
<dees-form>
|
||||||
<dees-input-multitoggle
|
<div class="settings-grid">
|
||||||
.label=${'Auto-Save'}
|
<dees-input-multitoggle
|
||||||
.type=${'boolean'}
|
.label=${'Auto-Save'}
|
||||||
.booleanTrueName=${'Enabled'}
|
.type=${'boolean'}
|
||||||
.booleanFalseName=${'Disabled'}
|
.booleanTrueName=${'Enabled'}
|
||||||
.selectedOption=${'Enabled'}
|
.booleanFalseName=${'Disabled'}
|
||||||
></dees-input-multitoggle>
|
.selectedOption=${'Enabled'}
|
||||||
|
></dees-input-multitoggle>
|
||||||
<dees-input-multitoggle
|
|
||||||
.label=${'Language'}
|
<dees-input-multitoggle
|
||||||
.options=${['English', 'German', 'French', 'Spanish']}
|
.label=${'Language'}
|
||||||
.selectedOption=${'English'}
|
.options=${['English', 'German', 'French', 'Spanish']}
|
||||||
></dees-input-multitoggle>
|
.selectedOption=${'English'}
|
||||||
|
></dees-input-multitoggle>
|
||||||
<dees-input-multitoggle
|
|
||||||
.label=${'Quality'}
|
<dees-input-multitoggle
|
||||||
.options=${['Low', 'Medium', 'High', 'Ultra']}
|
.label=${'Quality'}
|
||||||
.selectedOption=${'High'}
|
.options=${['Low', 'Medium', 'High', 'Ultra']}
|
||||||
></dees-input-multitoggle>
|
.selectedOption=${'High'}
|
||||||
|
></dees-input-multitoggle>
|
||||||
<dees-input-multitoggle
|
|
||||||
.label=${'Privacy'}
|
<dees-input-multitoggle
|
||||||
.type=${'boolean'}
|
.label=${'Privacy'}
|
||||||
.booleanTrueName=${'Private'}
|
.type=${'boolean'}
|
||||||
.booleanFalseName=${'Public'}
|
.booleanTrueName=${'Private'}
|
||||||
.selectedOption=${'Private'}
|
.booleanFalseName=${'Public'}
|
||||||
></dees-input-multitoggle>
|
.selectedOption=${'Private'}
|
||||||
</div>
|
></dees-input-multitoggle>
|
||||||
|
</div>
|
||||||
|
</dees-form>
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
<div class="section">
|
<div class="section">
|
||||||
@@ -134,7 +137,7 @@ export const demoFunc = () => html`
|
|||||||
|
|
||||||
<dees-input-multitoggle
|
<dees-input-multitoggle
|
||||||
.label=${'Account Type'}
|
.label=${'Account Type'}
|
||||||
.description=${'This setting is locked'}
|
.infoText=${'This setting is locked'}
|
||||||
.options=${['Free', 'Pro', 'Enterprise']}
|
.options=${['Free', 'Pro', 'Enterprise']}
|
||||||
.selectedOption=${'Enterprise'}
|
.selectedOption=${'Enterprise'}
|
||||||
.disabled=${true}
|
.disabled=${true}
|
||||||
|
|||||||
@@ -146,7 +146,7 @@ export class DeesInputMultitoggle extends DeesInputBase<DeesInputMultitoggle> {
|
|||||||
public render(): TemplateResult {
|
public render(): TemplateResult {
|
||||||
return html`
|
return html`
|
||||||
<div class="input-wrapper">
|
<div class="input-wrapper">
|
||||||
<dees-label .label=${this.label} .description=${this.description}></dees-label>
|
<dees-label .label=${this.label} .infoText=${this.infoText}></dees-label>
|
||||||
<div class="mainbox">
|
<div class="mainbox">
|
||||||
<div class="selections">
|
<div class="selections">
|
||||||
<div class="indicator"></div>
|
<div class="indicator"></div>
|
||||||
@@ -158,6 +158,7 @@ export class DeesInputMultitoggle extends DeesInputBase<DeesInputMultitoggle> {
|
|||||||
)}
|
)}
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
${this.renderDescription()}
|
||||||
</div>
|
</div>
|
||||||
`;
|
`;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -13,12 +13,6 @@ export const demoFunc = () => html`
|
|||||||
margin: 0 auto;
|
margin: 0 auto;
|
||||||
}
|
}
|
||||||
|
|
||||||
.input-group {
|
|
||||||
display: flex;
|
|
||||||
flex-direction: column;
|
|
||||||
gap: 16px;
|
|
||||||
}
|
|
||||||
|
|
||||||
.horizontal-group {
|
.horizontal-group {
|
||||||
display: flex;
|
display: flex;
|
||||||
align-items: center;
|
align-items: center;
|
||||||
@@ -30,43 +24,46 @@ export const demoFunc = () => html`
|
|||||||
|
|
||||||
<div class="demo-container">
|
<div class="demo-container">
|
||||||
<dees-panel .title=${'Basic Phone Input'} .subtitle=${'Automatic formatting for phone numbers'}>
|
<dees-panel .title=${'Basic Phone Input'} .subtitle=${'Automatic formatting for phone numbers'}>
|
||||||
<div class="input-group">
|
<dees-form>
|
||||||
<dees-input-phone
|
<dees-input-phone
|
||||||
.label=${'Phone Number'}
|
.label=${'Phone Number'}
|
||||||
.description=${'Enter your phone number with country code'}
|
.infoText=${'Enter your phone number with country code'}
|
||||||
|
.description=${'Include country code for international numbers'}
|
||||||
.value=${'5551234567'}
|
.value=${'5551234567'}
|
||||||
></dees-input-phone>
|
></dees-input-phone>
|
||||||
|
|
||||||
<dees-input-phone
|
<dees-input-phone
|
||||||
.label=${'Contact Phone'}
|
.label=${'Contact Phone'}
|
||||||
.description=${'Required for account verification'}
|
.infoText=${'Required for account verification'}
|
||||||
.required=${true}
|
.required=${true}
|
||||||
.placeholder=${'+1 (555) 000-0000'}
|
.placeholder=${'+1 (555) 000-0000'}
|
||||||
></dees-input-phone>
|
></dees-input-phone>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Horizontal Layout'} .subtitle=${'Phone inputs arranged horizontally'}>
|
<dees-panel .title=${'Horizontal Layout'} .subtitle=${'Phone inputs arranged horizontally'}>
|
||||||
<div class="horizontal-group">
|
<dees-form>
|
||||||
<dees-input-phone
|
<div class="horizontal-group">
|
||||||
.label=${'Mobile'}
|
<dees-input-phone
|
||||||
.layoutMode=${'horizontal'}
|
.label=${'Mobile'}
|
||||||
.value=${'4155551234'}
|
.layoutMode=${'horizontal'}
|
||||||
></dees-input-phone>
|
.value=${'4155551234'}
|
||||||
|
></dees-input-phone>
|
||||||
<dees-input-phone
|
|
||||||
.label=${'Office'}
|
<dees-input-phone
|
||||||
.layoutMode=${'horizontal'}
|
.label=${'Office'}
|
||||||
.placeholder=${'+1 (800) 555-0000'}
|
.layoutMode=${'horizontal'}
|
||||||
></dees-input-phone>
|
.placeholder=${'+1 (800) 555-0000'}
|
||||||
</div>
|
></dees-input-phone>
|
||||||
|
</div>
|
||||||
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'International Numbers'} .subtitle=${'Supports formatting for numbers with country codes'}>
|
<dees-panel .title=${'International Numbers'} .subtitle=${'Supports formatting for numbers with country codes'}>
|
||||||
<div class="input-group">
|
<dees-form>
|
||||||
<dees-input-phone
|
<dees-input-phone
|
||||||
.label=${'International Contact'}
|
.label=${'International Contact'}
|
||||||
.description=${'Automatically formats international numbers'}
|
.infoText=${'Automatically formats international numbers'}
|
||||||
.value=${'441234567890'}
|
.value=${'441234567890'}
|
||||||
></dees-input-phone>
|
></dees-input-phone>
|
||||||
|
|
||||||
@@ -75,7 +72,7 @@ export const demoFunc = () => html`
|
|||||||
.value=${'911'}
|
.value=${'911'}
|
||||||
.disabled=${true}
|
.disabled=${true}
|
||||||
></dees-input-phone>
|
></dees-input-phone>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Form Integration'} .subtitle=${'Phone input as part of a contact form'}>
|
<dees-panel .title=${'Form Integration'} .subtitle=${'Phone input as part of a contact form'}>
|
||||||
|
|||||||
@@ -47,7 +47,7 @@ export class DeesInputPhone extends DeesInputBase<DeesInputPhone> {
|
|||||||
public render(): TemplateResult {
|
public render(): TemplateResult {
|
||||||
return html`
|
return html`
|
||||||
<div class="input-wrapper">
|
<div class="input-wrapper">
|
||||||
<dees-label .label=${this.label} .description=${this.description}></dees-label>
|
<dees-label .label=${this.label} .infoText=${this.infoText}></dees-label>
|
||||||
<dees-input-text
|
<dees-input-text
|
||||||
.value=${this.formattedPhone}
|
.value=${this.formattedPhone}
|
||||||
.disabled=${this.disabled}
|
.disabled=${this.disabled}
|
||||||
@@ -55,6 +55,7 @@ export class DeesInputPhone extends DeesInputBase<DeesInputPhone> {
|
|||||||
.placeholder=${this.placeholder}
|
.placeholder=${this.placeholder}
|
||||||
@input=${(event: InputEvent) => this.handlePhoneInput(event)}
|
@input=${(event: InputEvent) => this.handlePhoneInput(event)}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
|
${this.renderDescription()}
|
||||||
</div>
|
</div>
|
||||||
`;
|
`;
|
||||||
}
|
}
|
||||||
|
|||||||
+10
-15
@@ -14,12 +14,6 @@ export const demoFunc = () => html`
|
|||||||
margin: 0 auto;
|
margin: 0 auto;
|
||||||
}
|
}
|
||||||
|
|
||||||
.input-group {
|
|
||||||
display: flex;
|
|
||||||
flex-direction: column;
|
|
||||||
gap: 16px;
|
|
||||||
}
|
|
||||||
|
|
||||||
.shopping-grid {
|
.shopping-grid {
|
||||||
display: grid;
|
display: grid;
|
||||||
grid-template-columns: repeat(auto-fill, minmax(280px, 1fr));
|
grid-template-columns: repeat(auto-fill, minmax(280px, 1fr));
|
||||||
@@ -66,19 +60,20 @@ export const demoFunc = () => html`
|
|||||||
|
|
||||||
<div class="demo-container">
|
<div class="demo-container">
|
||||||
<dees-panel .title=${'Basic Quantity Selector'} .subtitle=${'Simple quantity input with increment/decrement buttons'}>
|
<dees-panel .title=${'Basic Quantity Selector'} .subtitle=${'Simple quantity input with increment/decrement buttons'}>
|
||||||
<div class="input-group">
|
<dees-form>
|
||||||
<dees-input-quantityselector
|
<dees-input-quantityselector
|
||||||
.label=${'Quantity'}
|
.label=${'Quantity'}
|
||||||
.description=${'Select the desired quantity'}
|
.infoText=${'Select the desired quantity'}
|
||||||
|
.description=${'Minimum order quantity is 1 item'}
|
||||||
.value=${1}
|
.value=${1}
|
||||||
></dees-input-quantityselector>
|
></dees-input-quantityselector>
|
||||||
|
|
||||||
<dees-input-quantityselector
|
<dees-input-quantityselector
|
||||||
.label=${'Items in Cart'}
|
.label=${'Items in Cart'}
|
||||||
.description=${'Adjust the quantity of items'}
|
.infoText=${'Adjust the quantity of items'}
|
||||||
.value=${3}
|
.value=${3}
|
||||||
></dees-input-quantityselector>
|
></dees-input-quantityselector>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Shopping Cart'} .subtitle=${'Modern e-commerce product cards with interactive quantity selectors'} .runAfterRender=${async (elementArg: HTMLElement) => {
|
<dees-panel .title=${'Shopping Cart'} .subtitle=${'Modern e-commerce product cards with interactive quantity selectors'} .runAfterRender=${async (elementArg: HTMLElement) => {
|
||||||
@@ -177,21 +172,21 @@ export const demoFunc = () => html`
|
|||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Required & Disabled States'} .subtitle=${'Different states for validation and restrictions'}>
|
<dees-panel .title=${'Required & Disabled States'} .subtitle=${'Different states for validation and restrictions'}>
|
||||||
<div class="input-group">
|
<dees-form>
|
||||||
<dees-input-quantityselector
|
<dees-input-quantityselector
|
||||||
.label=${'Number of Licenses'}
|
.label=${'Number of Licenses'}
|
||||||
.description=${'Select how many licenses you need'}
|
.infoText=${'Select how many licenses you need'}
|
||||||
.required=${true}
|
.required=${true}
|
||||||
.value=${1}
|
.value=${1}
|
||||||
></dees-input-quantityselector>
|
></dees-input-quantityselector>
|
||||||
|
|
||||||
<dees-input-quantityselector
|
<dees-input-quantityselector
|
||||||
.label=${'Fixed Quantity'}
|
.label=${'Fixed Quantity'}
|
||||||
.description=${'This quantity cannot be changed'}
|
.infoText=${'This quantity cannot be changed'}
|
||||||
.disabled=${true}
|
.disabled=${true}
|
||||||
.value=${5}
|
.value=${5}
|
||||||
></dees-input-quantityselector>
|
></dees-input-quantityselector>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Order Form'} .subtitle=${'Complete order form with quantity selection'}>
|
<dees-panel .title=${'Order Form'} .subtitle=${'Complete order form with quantity selection'}>
|
||||||
@@ -204,7 +199,7 @@ export const demoFunc = () => html`
|
|||||||
></dees-input-dropdown>
|
></dees-input-dropdown>
|
||||||
<dees-input-quantityselector
|
<dees-input-quantityselector
|
||||||
.label=${'Quantity'}
|
.label=${'Quantity'}
|
||||||
.description=${'Number of licenses'}
|
.infoText=${'Number of licenses'}
|
||||||
.value=${1}
|
.value=${1}
|
||||||
></dees-input-quantityselector>
|
></dees-input-quantityselector>
|
||||||
<dees-input-text
|
<dees-input-text
|
||||||
|
|||||||
+2
-1
@@ -129,7 +129,7 @@ export class DeesInputQuantitySelector extends DeesInputBase<DeesInputQuantitySe
|
|||||||
public render(): TemplateResult {
|
public render(): TemplateResult {
|
||||||
return html`
|
return html`
|
||||||
<div class="input-wrapper">
|
<div class="input-wrapper">
|
||||||
${this.label ? html`<dees-label .label=${this.label} .description=${this.description} .required=${this.required}></dees-label>` : ''}
|
${this.label ? html`<dees-label .label=${this.label} .infoText=${this.infoText} .required=${this.required}></dees-label>` : ''}
|
||||||
<div
|
<div
|
||||||
class="quantity-container ${this.disabled ? 'disabled' : ''}"
|
class="quantity-container ${this.disabled ? 'disabled' : ''}"
|
||||||
data-min="${this.value <= 0}"
|
data-min="${this.value <= 0}"
|
||||||
@@ -162,6 +162,7 @@ export class DeesInputQuantitySelector extends DeesInputBase<DeesInputQuantitySe
|
|||||||
aria-label="Increase quantity"
|
aria-label="Increase quantity"
|
||||||
>+</div>
|
>+</div>
|
||||||
</div>
|
</div>
|
||||||
|
${this.renderDescription()}
|
||||||
</div>
|
</div>
|
||||||
`;
|
`;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -23,12 +23,6 @@ export const demoFunc = () => html`
|
|||||||
margin-bottom: 0;
|
margin-bottom: 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
.input-group {
|
|
||||||
display: flex;
|
|
||||||
flex-direction: column;
|
|
||||||
gap: 16px;
|
|
||||||
}
|
|
||||||
|
|
||||||
.demo-grid {
|
.demo-grid {
|
||||||
display: grid;
|
display: grid;
|
||||||
grid-template-columns: repeat(auto-fit, minmax(300px, 1fr));
|
grid-template-columns: repeat(auto-fit, minmax(300px, 1fr));
|
||||||
@@ -48,25 +42,27 @@ export const demoFunc = () => html`
|
|||||||
|
|
||||||
<div class="demo-container">
|
<div class="demo-container">
|
||||||
<dees-panel .title=${'1. Basic Radio Groups'} .subtitle=${'Simple string options for common use cases'}>
|
<dees-panel .title=${'1. Basic Radio Groups'} .subtitle=${'Simple string options for common use cases'}>
|
||||||
<div class="demo-grid">
|
<dees-form>
|
||||||
<dees-input-radiogroup
|
<div class="demo-grid">
|
||||||
.label=${'Subscription Plan'}
|
<dees-input-radiogroup
|
||||||
.options=${['Basic - $9/month', 'Pro - $29/month', 'Enterprise - $99/month']}
|
.label=${'Subscription Plan'}
|
||||||
.selectedOption=${'Pro - $29/month'}
|
.options=${['Basic - $9/month', 'Pro - $29/month', 'Enterprise - $99/month']}
|
||||||
.description=${'Choose your subscription tier'}
|
.selectedOption=${'Pro - $29/month'}
|
||||||
></dees-input-radiogroup>
|
.description=${'Choose your subscription tier'}
|
||||||
|
></dees-input-radiogroup>
|
||||||
<dees-input-radiogroup
|
|
||||||
.label=${'Priority Level'}
|
<dees-input-radiogroup
|
||||||
.options=${['High', 'Medium', 'Low']}
|
.label=${'Priority Level'}
|
||||||
.selectedOption=${'Medium'}
|
.options=${['High', 'Medium', 'Low']}
|
||||||
.required=${true}
|
.selectedOption=${'Medium'}
|
||||||
></dees-input-radiogroup>
|
.required=${true}
|
||||||
</div>
|
></dees-input-radiogroup>
|
||||||
|
</div>
|
||||||
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'2. Horizontal Layout'} .subtitle=${'Radio groups with horizontal arrangement'}>
|
<dees-panel .title=${'2. Horizontal Layout'} .subtitle=${'Radio groups with horizontal arrangement'}>
|
||||||
<div class="input-group">
|
<dees-form>
|
||||||
<dees-input-radiogroup
|
<dees-input-radiogroup
|
||||||
.label=${'Do you agree with the terms?'}
|
.label=${'Do you agree with the terms?'}
|
||||||
.options=${['Yes', 'No', 'Maybe']}
|
.options=${['Yes', 'No', 'Maybe']}
|
||||||
@@ -81,7 +77,7 @@ export const demoFunc = () => html`
|
|||||||
.selectedOption=${'Intermediate'}
|
.selectedOption=${'Intermediate'}
|
||||||
.description=${'Select your experience level with web development'}
|
.description=${'Select your experience level with web development'}
|
||||||
></dees-input-radiogroup>
|
></dees-input-radiogroup>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'3. Advanced Options'} .subtitle=${'Using object format with keys and payloads'}>
|
<dees-panel .title=${'3. Advanced Options'} .subtitle=${'Using object format with keys and payloads'}>
|
||||||
@@ -106,41 +102,45 @@ export const demoFunc = () => html`
|
|||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'4. Survey Example'} .subtitle=${'Multiple radio groups for surveys and forms'}>
|
<dees-panel .title=${'4. Survey Example'} .subtitle=${'Multiple radio groups for surveys and forms'}>
|
||||||
<div class="demo-grid">
|
<dees-form>
|
||||||
<dees-input-radiogroup
|
<div class="demo-grid">
|
||||||
.label=${'How satisfied are you?'}
|
<dees-input-radiogroup
|
||||||
.options=${['Very Satisfied', 'Satisfied', 'Neutral', 'Dissatisfied', 'Very Dissatisfied']}
|
.label=${'How satisfied are you?'}
|
||||||
.selectedOption=${'Satisfied'}
|
.options=${['Very Satisfied', 'Satisfied', 'Neutral', 'Dissatisfied', 'Very Dissatisfied']}
|
||||||
></dees-input-radiogroup>
|
.selectedOption=${'Satisfied'}
|
||||||
|
></dees-input-radiogroup>
|
||||||
<dees-input-radiogroup
|
|
||||||
.label=${'Would you recommend us?'}
|
<dees-input-radiogroup
|
||||||
.options=${['Definitely', 'Probably', 'Not Sure', 'Probably Not', 'Definitely Not']}
|
.label=${'Would you recommend us?'}
|
||||||
.selectedOption=${'Probably'}
|
.options=${['Definitely', 'Probably', 'Not Sure', 'Probably Not', 'Definitely Not']}
|
||||||
></dees-input-radiogroup>
|
.selectedOption=${'Probably'}
|
||||||
</div>
|
></dees-input-radiogroup>
|
||||||
|
</div>
|
||||||
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'5. States & Validation'} .subtitle=${'Different states and validation examples'}>
|
<dees-panel .title=${'5. States & Validation'} .subtitle=${'Different states and validation examples'}>
|
||||||
<div class="demo-grid">
|
<dees-form>
|
||||||
<dees-input-radiogroup
|
<div class="demo-grid">
|
||||||
.label=${'Required Selection'}
|
<dees-input-radiogroup
|
||||||
.options=${['Option A', 'Option B', 'Option C']}
|
.label=${'Required Selection'}
|
||||||
.required=${true}
|
.options=${['Option A', 'Option B', 'Option C']}
|
||||||
.description=${'This field is required'}
|
.required=${true}
|
||||||
></dees-input-radiogroup>
|
.description=${'This field is required'}
|
||||||
|
></dees-input-radiogroup>
|
||||||
<dees-input-radiogroup
|
|
||||||
.label=${'Disabled State'}
|
<dees-input-radiogroup
|
||||||
.options=${['Disabled Option 1', 'Disabled Option 2', 'Disabled Option 3']}
|
.label=${'Disabled State'}
|
||||||
.selectedOption=${'Disabled Option 2'}
|
.options=${['Disabled Option 1', 'Disabled Option 2', 'Disabled Option 3']}
|
||||||
.disabled=${true}
|
.selectedOption=${'Disabled Option 2'}
|
||||||
></dees-input-radiogroup>
|
.disabled=${true}
|
||||||
</div>
|
></dees-input-radiogroup>
|
||||||
|
</div>
|
||||||
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'6. Settings Example'} .subtitle=${'Common patterns in application settings'}>
|
<dees-panel .title=${'6. Settings Example'} .subtitle=${'Common patterns in application settings'}>
|
||||||
<div class="input-group">
|
<dees-form>
|
||||||
<dees-input-radiogroup
|
<dees-input-radiogroup
|
||||||
.label=${'Theme Preference'}
|
.label=${'Theme Preference'}
|
||||||
.options=${[
|
.options=${[
|
||||||
@@ -165,7 +165,7 @@ export const demoFunc = () => html`
|
|||||||
.selectedOption=${'English'}
|
.selectedOption=${'English'}
|
||||||
.direction=${'horizontal'}
|
.direction=${'horizontal'}
|
||||||
></dees-input-radiogroup>
|
></dees-input-radiogroup>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'7. Form Integration'} .subtitle=${'Works seamlessly with dees-form'}>
|
<dees-panel .title=${'7. Form Integration'} .subtitle=${'Works seamlessly with dees-form'}>
|
||||||
|
|||||||
@@ -189,14 +189,6 @@ export class DeesInputRadiogroup extends DeesInputBase<string | object> {
|
|||||||
line-height: 20px;
|
line-height: 20px;
|
||||||
}
|
}
|
||||||
|
|
||||||
.description-text {
|
|
||||||
font-size: 13px;
|
|
||||||
color: ${cssManager.bdTheme('hsl(215.4 16.3% 56.9%)', 'hsl(215 20.2% 55.1%)')};
|
|
||||||
margin-top: 10px;
|
|
||||||
line-height: 1.5;
|
|
||||||
letter-spacing: -0.003em;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Validation styles */
|
/* Validation styles */
|
||||||
:host([validationState="invalid"]) .radio-circle {
|
:host([validationState="invalid"]) .radio-circle {
|
||||||
border-color: ${cssManager.bdTheme('hsl(0 72.2% 50.6%)', 'hsl(0 62.8% 30.6%)')};
|
border-color: ${cssManager.bdTheme('hsl(0 72.2% 50.6%)', 'hsl(0 62.8% 30.6%)')};
|
||||||
@@ -256,7 +248,7 @@ export class DeesInputRadiogroup extends DeesInputBase<string | object> {
|
|||||||
`;
|
`;
|
||||||
})}
|
})}
|
||||||
</div>
|
</div>
|
||||||
${this.description ? html`<div class="description-text">${this.description}</div>` : ''}
|
${this.renderDescription()}
|
||||||
</div>
|
</div>
|
||||||
`;
|
`;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -278,13 +278,6 @@ export const richtextStyles = [
|
|||||||
border-color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 93.9%)')};
|
border-color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 93.9%)')};
|
||||||
}
|
}
|
||||||
|
|
||||||
.description {
|
|
||||||
margin-top: 8px;
|
|
||||||
font-size: 12px;
|
|
||||||
color: ${cssManager.bdTheme('hsl(215.4 16.3% 46.9%)', 'hsl(215 20.2% 65.1%)')};
|
|
||||||
line-height: 1.4;
|
|
||||||
}
|
|
||||||
|
|
||||||
:host([disabled]) dees-tile {
|
:host([disabled]) dees-tile {
|
||||||
opacity: 0.6;
|
opacity: 0.6;
|
||||||
cursor: not-allowed;
|
cursor: not-allowed;
|
||||||
|
|||||||
@@ -26,7 +26,7 @@ export const renderRichtext = (component: DeesInputRichtext): TemplateResult =>
|
|||||||
`
|
`
|
||||||
: ''}
|
: ''}
|
||||||
</dees-tile>
|
</dees-tile>
|
||||||
${component.description ? html`<div class="description">${component.description}</div>` : ''}
|
${component.renderDescription()}
|
||||||
</div>
|
</div>
|
||||||
`;
|
`;
|
||||||
|
|
||||||
|
|||||||
@@ -115,24 +115,26 @@ export const demoFunc = () => html`
|
|||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'3. Limited Tags'} .subtitle=${'Restrict the number of tags users can add'}>
|
<dees-panel .title=${'3. Limited Tags'} .subtitle=${'Restrict the number of tags users can add'}>
|
||||||
<div class="grid-layout">
|
<dees-form>
|
||||||
<dees-input-tags
|
<div class="grid-layout">
|
||||||
.label=${'Top 3 Skills'}
|
<dees-input-tags
|
||||||
.placeholder=${'Add up to 3 skills...'}
|
.label=${'Top 3 Skills'}
|
||||||
.maxTags=${3}
|
.placeholder=${'Add up to 3 skills...'}
|
||||||
.value=${['Design', 'Development']}
|
.maxTags=${3}
|
||||||
.description=${'Maximum 3 tags allowed'}
|
.value=${['Design', 'Development']}
|
||||||
></dees-input-tags>
|
.description=${'Maximum 3 tags allowed'}
|
||||||
|
></dees-input-tags>
|
||||||
<dees-input-tags
|
|
||||||
.label=${'Categories (Max 5)'}
|
<dees-input-tags
|
||||||
.placeholder=${'Select categories...'}
|
.label=${'Categories (Max 5)'}
|
||||||
.maxTags=${5}
|
.placeholder=${'Select categories...'}
|
||||||
.suggestions=${['Blog', 'Tutorial', 'News', 'Review', 'Guide', 'Case Study', 'Interview']}
|
.maxTags=${5}
|
||||||
.value=${['Tutorial', 'Guide']}
|
.suggestions=${['Blog', 'Tutorial', 'News', 'Review', 'Guide', 'Case Study', 'Interview']}
|
||||||
.description=${'Choose up to 5 categories'}
|
.value=${['Tutorial', 'Guide']}
|
||||||
></dees-input-tags>
|
.description=${'Choose up to 5 categories'}
|
||||||
</div>
|
></dees-input-tags>
|
||||||
|
</div>
|
||||||
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'4. Required & Validation'} .subtitle=${'Tags input with validation requirements'}>
|
<dees-panel .title=${'4. Required & Validation'} .subtitle=${'Tags input with validation requirements'}>
|
||||||
|
|||||||
@@ -210,14 +210,6 @@ export class DeesInputTags extends DeesInputBase<DeesInputTags> {
|
|||||||
line-height: 1.5;
|
line-height: 1.5;
|
||||||
}
|
}
|
||||||
|
|
||||||
/* Description styles */
|
|
||||||
.description {
|
|
||||||
color: ${cssManager.bdTheme('hsl(215.4 16.3% 56.9%)', 'hsl(215 20.2% 55.1%)')};
|
|
||||||
font-size: 13px;
|
|
||||||
margin-top: 6px;
|
|
||||||
line-height: 1.5;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* Scrollbar styling */
|
/* Scrollbar styling */
|
||||||
.suggestions-dropdown::-webkit-scrollbar {
|
.suggestions-dropdown::-webkit-scrollbar {
|
||||||
width: 8px;
|
width: 8px;
|
||||||
@@ -302,9 +294,7 @@ export class DeesInputTags extends DeesInputBase<DeesInputTags> {
|
|||||||
<div class="validation-message">${this.validationText}</div>
|
<div class="validation-message">${this.validationText}</div>
|
||||||
` : ''}
|
` : ''}
|
||||||
|
|
||||||
${this.description ? html`
|
${this.renderDescription()}
|
||||||
<div class="description">${this.description}</div>
|
|
||||||
` : ''}
|
|
||||||
</div>
|
</div>
|
||||||
`;
|
`;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -30,12 +30,6 @@ export const demoFunc = () => html`
|
|||||||
flex-wrap: wrap;
|
flex-wrap: wrap;
|
||||||
}
|
}
|
||||||
|
|
||||||
.input-group {
|
|
||||||
display: flex;
|
|
||||||
flex-direction: column;
|
|
||||||
gap: 16px;
|
|
||||||
}
|
|
||||||
|
|
||||||
.grid-layout {
|
.grid-layout {
|
||||||
display: grid;
|
display: grid;
|
||||||
grid-template-columns: 1fr 1fr;
|
grid-template-columns: 1fr 1fr;
|
||||||
@@ -89,17 +83,18 @@ export const demoFunc = () => html`
|
|||||||
}
|
}
|
||||||
}}>
|
}}>
|
||||||
<dees-panel .title=${'Basic Text Inputs'} .subtitle=${'Standard text inputs with labels and descriptions'}>
|
<dees-panel .title=${'Basic Text Inputs'} .subtitle=${'Standard text inputs with labels and descriptions'}>
|
||||||
<div class="input-group">
|
<dees-form>
|
||||||
<dees-input-text
|
<dees-input-text
|
||||||
.label=${'Username'}
|
.label=${'Username'}
|
||||||
.value=${'johndoe'}
|
.value=${'johndoe'}
|
||||||
.key=${'username'}
|
.key=${'username'}
|
||||||
|
.description=${'Your username will be visible to other users'}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
|
|
||||||
<dees-input-text
|
<dees-input-text
|
||||||
.label=${'Email Address'}
|
.label=${'Email Address'}
|
||||||
.value=${'john@example.com'}
|
.value=${'john@example.com'}
|
||||||
.description=${'We will never share your email with anyone'}
|
.infoText=${'We will never share your email with anyone'}
|
||||||
.key=${'email'}
|
.key=${'email'}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
|
|
||||||
@@ -109,7 +104,7 @@ export const demoFunc = () => html`
|
|||||||
.value=${'secret123'}
|
.value=${'secret123'}
|
||||||
.key=${'password'}
|
.key=${'password'}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
</dees-demowrapper>
|
</dees-demowrapper>
|
||||||
|
|
||||||
@@ -139,28 +134,30 @@ export const demoFunc = () => html`
|
|||||||
}
|
}
|
||||||
}}>
|
}}>
|
||||||
<dees-panel .title=${'Horizontal Layout'} .subtitle=${'Multiple inputs arranged horizontally for compact forms'}>
|
<dees-panel .title=${'Horizontal Layout'} .subtitle=${'Multiple inputs arranged horizontally for compact forms'}>
|
||||||
<div class="horizontal-group">
|
<dees-form>
|
||||||
<dees-input-text
|
<div class="horizontal-group">
|
||||||
.label=${'First Name'}
|
<dees-input-text
|
||||||
.value=${'John'}
|
.label=${'First Name'}
|
||||||
.layoutMode=${'horizontal'}
|
.value=${'John'}
|
||||||
.key=${'firstName'}
|
.layoutMode=${'horizontal'}
|
||||||
></dees-input-text>
|
.key=${'firstName'}
|
||||||
|
></dees-input-text>
|
||||||
<dees-input-text
|
|
||||||
.label=${'Last Name'}
|
<dees-input-text
|
||||||
.value=${'Doe'}
|
.label=${'Last Name'}
|
||||||
.layoutMode=${'horizontal'}
|
.value=${'Doe'}
|
||||||
.key=${'lastName'}
|
.layoutMode=${'horizontal'}
|
||||||
></dees-input-text>
|
.key=${'lastName'}
|
||||||
|
></dees-input-text>
|
||||||
<dees-input-text
|
|
||||||
.label=${'Age'}
|
<dees-input-text
|
||||||
.value=${'28'}
|
.label=${'Age'}
|
||||||
.layoutMode=${'horizontal'}
|
.value=${'28'}
|
||||||
.key=${'age'}
|
.layoutMode=${'horizontal'}
|
||||||
></dees-input-text>
|
.key=${'age'}
|
||||||
</div>
|
></dees-input-text>
|
||||||
|
</div>
|
||||||
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
</dees-demowrapper>
|
</dees-demowrapper>
|
||||||
|
|
||||||
@@ -180,7 +177,7 @@ export const demoFunc = () => html`
|
|||||||
}
|
}
|
||||||
}}>
|
}}>
|
||||||
<dees-panel .title=${'Label Positions'} .subtitle=${'Different label positioning options for various layouts'}>
|
<dees-panel .title=${'Label Positions'} .subtitle=${'Different label positioning options for various layouts'}>
|
||||||
<div class="input-group">
|
<dees-form>
|
||||||
<dees-input-text
|
<dees-input-text
|
||||||
.label=${'Label on Top (Default)'}
|
.label=${'Label on Top (Default)'}
|
||||||
.value=${'Standard layout'}
|
.value=${'Standard layout'}
|
||||||
@@ -194,57 +191,25 @@ export const demoFunc = () => html`
|
|||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
|
|
||||||
<div class="grid-layout">
|
<div class="grid-layout">
|
||||||
<dees-input-text
|
<dees-input-text
|
||||||
.label=${'City'}
|
.label=${'City'}
|
||||||
.value=${'New York'}
|
.value=${'New York'}
|
||||||
.labelPosition=${'left'}
|
.labelPosition=${'left'}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
|
|
||||||
<dees-input-text
|
<dees-input-text
|
||||||
.label=${'ZIP Code'}
|
.label=${'ZIP Code'}
|
||||||
.value=${'10001'}
|
.value=${'10001'}
|
||||||
.labelPosition=${'left'}
|
.labelPosition=${'left'}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
</dees-demowrapper>
|
</dees-demowrapper>
|
||||||
|
|
||||||
<dees-demowrapper .runAfterRender=${async (elementArg: HTMLElement) => {
|
<dees-demowrapper>
|
||||||
// Demonstrate validation states
|
|
||||||
const requiredInput = elementArg.querySelector('dees-input-text[required]') as DeesInputText;
|
|
||||||
const disabledInput = elementArg.querySelector('dees-input-text[disabled]') as DeesInputText;
|
|
||||||
const errorInput = elementArg.querySelector('dees-input-text[validationState="invalid"]') as DeesInputText;
|
|
||||||
|
|
||||||
if (requiredInput) {
|
|
||||||
// Show validation on blur for empty required field
|
|
||||||
requiredInput.addEventListener('blur', () => {
|
|
||||||
if (!requiredInput.getValue()) {
|
|
||||||
console.log('Required field is empty!');
|
|
||||||
}
|
|
||||||
});
|
|
||||||
}
|
|
||||||
|
|
||||||
if (disabledInput) {
|
|
||||||
console.log('Disabled input cannot be edited');
|
|
||||||
}
|
|
||||||
|
|
||||||
if (errorInput) {
|
|
||||||
console.log('Error input shows validation message:', errorInput.validationText);
|
|
||||||
|
|
||||||
// Simulate fixing the error
|
|
||||||
errorInput.addEventListener('changeSubject', () => {
|
|
||||||
const value = errorInput.getValue();
|
|
||||||
if (value.includes('@') && value.includes('.')) {
|
|
||||||
errorInput.validationState = 'valid';
|
|
||||||
errorInput.validationText = '';
|
|
||||||
console.log('Email validation passed!');
|
|
||||||
}
|
|
||||||
});
|
|
||||||
}
|
|
||||||
}}>
|
|
||||||
<dees-panel .title=${'Validation & States'} .subtitle=${'Different validation states and input configurations'}>
|
<dees-panel .title=${'Validation & States'} .subtitle=${'Different validation states and input configurations'}>
|
||||||
<div class="input-group">
|
<dees-form>
|
||||||
<dees-input-text
|
<dees-input-text
|
||||||
.label=${'Required Field'}
|
.label=${'Required Field'}
|
||||||
.required=${true}
|
.required=${true}
|
||||||
@@ -258,12 +223,17 @@ export const demoFunc = () => html`
|
|||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
|
|
||||||
<dees-input-text
|
<dees-input-text
|
||||||
.label=${'Field with Error'}
|
.label=${'Email with Validation'}
|
||||||
.value=${'invalid@'}
|
.value=${'invalid@'}
|
||||||
.validationText=${'Please enter a valid email address'}
|
.validationFunction=${(value: string) => {
|
||||||
.validationState=${'invalid'}
|
const emailRegex = /^[^\s@]+@[^\s@]+\.[^\s@]+$/;
|
||||||
|
if (emailRegex.test(value)) {
|
||||||
|
return { valid: true, message: 'Email address is valid' };
|
||||||
|
}
|
||||||
|
return { valid: false, message: 'Please enter a valid email address' };
|
||||||
|
}}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
</dees-demowrapper>
|
</dees-demowrapper>
|
||||||
|
|
||||||
@@ -292,59 +262,40 @@ export const demoFunc = () => html`
|
|||||||
});
|
});
|
||||||
}}>
|
}}>
|
||||||
<dees-panel .title=${'Advanced Features'} .subtitle=${'Password visibility toggle and other advanced features'}>
|
<dees-panel .title=${'Advanced Features'} .subtitle=${'Password visibility toggle and other advanced features'}>
|
||||||
<div class="input-group">
|
<dees-form>
|
||||||
<dees-input-text
|
<dees-input-text
|
||||||
.label=${'Password with Toggle'}
|
.label=${'Password with Toggle'}
|
||||||
.isPasswordBool=${true}
|
.isPasswordBool=${true}
|
||||||
.value=${'mySecurePassword123'}
|
.value=${'mySecurePassword123'}
|
||||||
.description=${'Click the eye icon to show/hide password'}
|
.infoText=${'Click the eye icon to show/hide password'}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
|
|
||||||
<dees-input-text
|
<dees-input-text
|
||||||
.label=${'API Key'}
|
.label=${'API Key'}
|
||||||
.isPasswordBool=${true}
|
.isPasswordBool=${true}
|
||||||
.value=${'sk-1234567890abcdef'}
|
.value=${'sk-1234567890abcdef'}
|
||||||
.description=${'Keep this key secure and never share it'}
|
.infoText=${'Keep this key secure and never share it'}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
</dees-demowrapper>
|
</dees-demowrapper>
|
||||||
|
|
||||||
<dees-demowrapper .runAfterRender=${async (elementArg: HTMLElement) => {
|
<dees-demowrapper .runAfterRender=${async (elementArg: HTMLElement) => {
|
||||||
// Set up interactive example
|
const dynamicInput = elementArg.querySelector('dees-input-text') as DeesInputText;
|
||||||
const dynamicInput = elementArg.querySelector('dees-input-text');
|
|
||||||
const output = elementArg.querySelector('#text-input-output');
|
const output = elementArg.querySelector('#text-input-output');
|
||||||
|
|
||||||
if (dynamicInput && output) {
|
if (dynamicInput && output) {
|
||||||
// Update output on every change
|
dynamicInput.changeSubject.subscribe(() => {
|
||||||
dynamicInput.addEventListener('changeSubject', ((event: CustomEvent) => {
|
output.textContent = `Current value: "${dynamicInput.getValue()}"`;
|
||||||
const value = (event.detail as DeesInputText).getValue();
|
|
||||||
output.textContent = `Current value: "${value}"`;
|
|
||||||
}) as EventListener);
|
|
||||||
|
|
||||||
// Also track focus/blur events
|
|
||||||
dynamicInput.addEventListener('focus', () => {
|
|
||||||
console.log('Input focused');
|
|
||||||
});
|
|
||||||
|
|
||||||
dynamicInput.addEventListener('blur', () => {
|
|
||||||
console.log('Input blurred');
|
|
||||||
});
|
|
||||||
|
|
||||||
// Track keypress events
|
|
||||||
let keypressCount = 0;
|
|
||||||
dynamicInput.addEventListener('keydown', () => {
|
|
||||||
keypressCount++;
|
|
||||||
console.log(`Keypress count: ${keypressCount}`);
|
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
}}>
|
}}>
|
||||||
<dees-panel .title=${'Interactive Example'} .subtitle=${'Try typing in the inputs to see real-time value changes'}>
|
<dees-panel .title=${'Interactive Example'} .subtitle=${'Try typing in the input to see real-time value changes'}>
|
||||||
<dees-input-text
|
<dees-input-text
|
||||||
.label=${'Dynamic Input'}
|
.label=${'Dynamic Input'}
|
||||||
.placeholder=${'Type something here...'}
|
.placeholder=${'Type something here...'}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
|
|
||||||
<div class="interactive-section">
|
<div class="interactive-section">
|
||||||
<div id="text-input-output" class="output-text">Current value: ""</div>
|
<div id="text-input-output" class="output-text">Current value: ""</div>
|
||||||
</div>
|
</div>
|
||||||
|
|||||||
@@ -7,11 +7,13 @@ import {
|
|||||||
customElement,
|
customElement,
|
||||||
type TemplateResult,
|
type TemplateResult,
|
||||||
property,
|
property,
|
||||||
|
state,
|
||||||
html,
|
html,
|
||||||
cssManager,
|
cssManager,
|
||||||
css,
|
css,
|
||||||
} from '@design.estate/dees-element';
|
} from '@design.estate/dees-element';
|
||||||
import { themeDefaultStyles } from '../../00theme.js';
|
import { themeDefaultStyles } from '../../00theme.js';
|
||||||
|
import '../../00group-overlay/dees-contextmenu/dees-contextmenu.js';
|
||||||
|
|
||||||
declare global {
|
declare global {
|
||||||
interface HTMLElementTagNameMap {
|
interface HTMLElementTagNameMap {
|
||||||
@@ -44,7 +46,7 @@ export class DeesInputText extends DeesInputBase {
|
|||||||
accessor showPasswordBool = false;
|
accessor showPasswordBool = false;
|
||||||
|
|
||||||
@property({
|
@property({
|
||||||
type: Boolean,
|
type: String,
|
||||||
reflect: true,
|
reflect: true,
|
||||||
})
|
})
|
||||||
accessor validationState!: 'valid' | 'warn' | 'invalid';
|
accessor validationState!: 'valid' | 'warn' | 'invalid';
|
||||||
@@ -54,8 +56,8 @@ export class DeesInputText extends DeesInputBase {
|
|||||||
})
|
})
|
||||||
accessor validationText: string = '';
|
accessor validationText: string = '';
|
||||||
|
|
||||||
@property({})
|
@property({ attribute: false })
|
||||||
accessor validationFunction!: (value: string) => boolean;
|
accessor validationFunction!: (value: string) => { valid: boolean; message?: string };
|
||||||
|
|
||||||
@property({
|
@property({
|
||||||
type: Boolean,
|
type: Boolean,
|
||||||
@@ -63,6 +65,11 @@ export class DeesInputText extends DeesInputBase {
|
|||||||
})
|
})
|
||||||
accessor vintegrated: boolean = false;
|
accessor vintegrated: boolean = false;
|
||||||
|
|
||||||
|
@property({ attribute: false })
|
||||||
|
accessor validConfirmed: boolean = false;
|
||||||
|
|
||||||
|
private validTimeout: ReturnType<typeof setTimeout> | undefined;
|
||||||
|
|
||||||
public static styles = [
|
public static styles = [
|
||||||
themeDefaultStyles,
|
themeDefaultStyles,
|
||||||
...DeesInputBase.baseStyles,
|
...DeesInputBase.baseStyles,
|
||||||
@@ -127,7 +134,7 @@ export class DeesInputText extends DeesInputBase {
|
|||||||
.showPassword {
|
.showPassword {
|
||||||
position: absolute;
|
position: absolute;
|
||||||
right: 1px;
|
right: 1px;
|
||||||
top: 50%;
|
top: 20px;
|
||||||
transform: translateY(-50%);
|
transform: translateY(-50%);
|
||||||
display: flex;
|
display: flex;
|
||||||
align-items: center;
|
align-items: center;
|
||||||
@@ -145,6 +152,29 @@ export class DeesInputText extends DeesInputBase {
|
|||||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 93.9%)')};
|
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 93.9%)')};
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/* Valid checkmark icon */
|
||||||
|
.validIcon {
|
||||||
|
position: absolute;
|
||||||
|
right: 10px;
|
||||||
|
top: 20px;
|
||||||
|
transform: translateY(-50%);
|
||||||
|
display: flex;
|
||||||
|
align-items: center;
|
||||||
|
justify-content: center;
|
||||||
|
opacity: 0;
|
||||||
|
transition: opacity 0.2s ease;
|
||||||
|
pointer-events: none;
|
||||||
|
color: ${cssManager.bdTheme('hsl(142.1 76.2% 36.3%)', 'hsl(142.1 70.6% 45.3%)')};
|
||||||
|
}
|
||||||
|
|
||||||
|
.validIcon.show {
|
||||||
|
opacity: 1;
|
||||||
|
}
|
||||||
|
|
||||||
|
.validIcon dees-icon {
|
||||||
|
font-size: 18px;
|
||||||
|
}
|
||||||
|
|
||||||
/* Validation styles */
|
/* Validation styles */
|
||||||
.validationContainer {
|
.validationContainer {
|
||||||
margin-top: 4px;
|
margin-top: 4px;
|
||||||
@@ -156,7 +186,7 @@ export class DeesInputText extends DeesInputBase {
|
|||||||
overflow: hidden;
|
overflow: hidden;
|
||||||
}
|
}
|
||||||
|
|
||||||
.validationContainer.error {
|
.validationContainer.invalid {
|
||||||
background: ${cssManager.bdTheme('hsl(0 84.2% 60.2% / 0.1)', 'hsl(0 72.2% 50.6% / 0.1)')};
|
background: ${cssManager.bdTheme('hsl(0 84.2% 60.2% / 0.1)', 'hsl(0 72.2% 50.6% / 0.1)')};
|
||||||
color: ${cssManager.bdTheme('hsl(0 84.2% 60.2%)', 'hsl(0 72.2% 50.6%)')};
|
color: ${cssManager.bdTheme('hsl(0 84.2% 60.2%)', 'hsl(0 72.2% 50.6%)')};
|
||||||
}
|
}
|
||||||
@@ -172,31 +202,31 @@ export class DeesInputText extends DeesInputBase {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/* Error state for input */
|
/* Error state for input */
|
||||||
:host([validation-state="invalid"]) input {
|
:host([validationstate="invalid"]) input {
|
||||||
border-color: ${cssManager.bdTheme('hsl(0 84.2% 60.2%)', 'hsl(0 72.2% 50.6%)')};
|
border-color: ${cssManager.bdTheme('hsl(0 84.2% 60.2%)', 'hsl(0 72.2% 50.6%)')};
|
||||||
}
|
}
|
||||||
|
|
||||||
:host([validation-state="invalid"]) input:focus {
|
:host([validationstate="invalid"]) input:focus {
|
||||||
border-color: ${cssManager.bdTheme('hsl(0 84.2% 60.2%)', 'hsl(0 72.2% 50.6%)')};
|
border-color: ${cssManager.bdTheme('hsl(0 84.2% 60.2%)', 'hsl(0 72.2% 50.6%)')};
|
||||||
box-shadow: 0 0 0 2px ${cssManager.bdTheme('hsl(0 84.2% 60.2% / 0.05)', 'hsl(0 72.2% 50.6% / 0.05)')};
|
box-shadow: 0 0 0 2px ${cssManager.bdTheme('hsl(0 84.2% 60.2% / 0.05)', 'hsl(0 72.2% 50.6% / 0.05)')};
|
||||||
}
|
}
|
||||||
|
|
||||||
/* Warning state for input */
|
/* Warning state for input */
|
||||||
:host([validation-state="warn"]) input {
|
:host([validationstate="warn"]) input {
|
||||||
border-color: ${cssManager.bdTheme('hsl(25 95% 53%)', 'hsl(25 95% 63%)')};
|
border-color: ${cssManager.bdTheme('hsl(25 95% 53%)', 'hsl(25 95% 63%)')};
|
||||||
}
|
}
|
||||||
|
|
||||||
:host([validation-state="warn"]) input:focus {
|
:host([validationstate="warn"]) input:focus {
|
||||||
border-color: ${cssManager.bdTheme('hsl(25 95% 53%)', 'hsl(25 95% 63%)')};
|
border-color: ${cssManager.bdTheme('hsl(25 95% 53%)', 'hsl(25 95% 63%)')};
|
||||||
box-shadow: 0 0 0 2px ${cssManager.bdTheme('hsl(25 95% 53% / 0.05)', 'hsl(25 95% 63% / 0.05)')};
|
box-shadow: 0 0 0 2px ${cssManager.bdTheme('hsl(25 95% 53% / 0.05)', 'hsl(25 95% 63% / 0.05)')};
|
||||||
}
|
}
|
||||||
|
|
||||||
/* Valid state for input */
|
/* Valid state for input */
|
||||||
:host([validation-state="valid"]) input {
|
:host([validationstate="valid"]) input {
|
||||||
border-color: ${cssManager.bdTheme('hsl(142.1 76.2% 36.3%)', 'hsl(142.1 70.6% 45.3%)')};
|
border-color: ${cssManager.bdTheme('hsl(142.1 76.2% 36.3%)', 'hsl(142.1 70.6% 45.3%)')};
|
||||||
}
|
}
|
||||||
|
|
||||||
:host([validation-state="valid"]) input:focus {
|
:host([validationstate="valid"]) input:focus {
|
||||||
border-color: ${cssManager.bdTheme('hsl(142.1 76.2% 36.3%)', 'hsl(142.1 70.6% 45.3%)')};
|
border-color: ${cssManager.bdTheme('hsl(142.1 76.2% 36.3%)', 'hsl(142.1 70.6% 45.3%)')};
|
||||||
box-shadow: 0 0 0 2px ${cssManager.bdTheme('hsl(142.1 76.2% 36.3% / 0.05)', 'hsl(142.1 70.6% 45.3% / 0.05)')};
|
box-shadow: 0 0 0 2px ${cssManager.bdTheme('hsl(142.1 76.2% 36.3% / 0.05)', 'hsl(142.1 70.6% 45.3% / 0.05)')};
|
||||||
}
|
}
|
||||||
@@ -239,9 +269,9 @@ export class DeesInputText extends DeesInputBase {
|
|||||||
input {
|
input {
|
||||||
font-family: ${this.isPasswordBool ? cssMonoFontFamily : 'inherit'};
|
font-family: ${this.isPasswordBool ? cssMonoFontFamily : 'inherit'};
|
||||||
letter-spacing: ${this.isPasswordBool ? '0.5px' : 'normal'};
|
letter-spacing: ${this.isPasswordBool ? '0.5px' : 'normal'};
|
||||||
padding-right: ${this.isPasswordBool ? '48px' : '12px'};
|
padding-right: ${this.isPasswordBool ? '48px' : this.validConfirmed ? '40px' : '12px'};
|
||||||
}
|
}
|
||||||
${this.validationText
|
${this.validationText && !this.validConfirmed
|
||||||
? css`
|
? css`
|
||||||
.validationContainer {
|
.validationContainer {
|
||||||
height: auto;
|
height: auto;
|
||||||
@@ -259,7 +289,7 @@ export class DeesInputText extends DeesInputBase {
|
|||||||
`}
|
`}
|
||||||
</style>
|
</style>
|
||||||
<div class="input-wrapper">
|
<div class="input-wrapper">
|
||||||
<dees-label .label=${this.label} .description=${this.description} .required=${this.required}></dees-label>
|
<dees-label .label=${this.label} .infoText=${this.infoText} .required=${this.required}></dees-label>
|
||||||
<div class="maincontainer">
|
<div class="maincontainer">
|
||||||
<input
|
<input
|
||||||
type="${this.isPasswordBool && !this.showPasswordBool ? 'password' : 'text'}"
|
type="${this.isPasswordBool && !this.showPasswordBool ? 'password' : 'text'}"
|
||||||
@@ -275,28 +305,114 @@ export class DeesInputText extends DeesInputBase {
|
|||||||
</div>
|
</div>
|
||||||
`
|
`
|
||||||
: html``}
|
: html``}
|
||||||
|
<div class="validIcon ${this.validConfirmed ? 'show' : ''}">
|
||||||
|
<dees-icon .icon=${'lucide:Check'}></dees-icon>
|
||||||
|
</div>
|
||||||
${this.validationText
|
${this.validationText
|
||||||
? html`
|
? html`
|
||||||
<div class="validationContainer ${this.validationState || 'error'}">
|
<div class="validationContainer ${this.validationState || 'invalid'}">
|
||||||
${this.validationText}
|
${this.validationText}
|
||||||
</div>
|
</div>
|
||||||
`
|
`
|
||||||
: html`<div class="validationContainer"></div>`}
|
: html`<div class="validationContainer"></div>`}
|
||||||
|
${this.renderDescription()}
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
`;
|
`;
|
||||||
}
|
}
|
||||||
|
|
||||||
firstUpdated() {
|
firstUpdated() {
|
||||||
// Input event handling is already done in updateValue method
|
if (this.validationFunction && this.value) {
|
||||||
|
const result = this.validationFunction(this.value);
|
||||||
|
this.validationState = result.valid ? 'valid' : 'invalid';
|
||||||
|
this.validationText = result.message || '';
|
||||||
|
if (result.valid) {
|
||||||
|
this.validConfirmed = false;
|
||||||
|
this.validTimeout = setTimeout(() => {
|
||||||
|
this.validConfirmed = true;
|
||||||
|
this.validationState = undefined as any;
|
||||||
|
}, 500);
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
public async updateValue(eventArg: Event) {
|
public async updateValue(eventArg: Event) {
|
||||||
const target: any = eventArg.target;
|
const target: any = eventArg.target;
|
||||||
this.value = target.value;
|
this.value = target.value;
|
||||||
|
if (this.validationFunction) {
|
||||||
|
const result = this.validationFunction(this.value);
|
||||||
|
this.validationState = result.valid ? 'valid' : 'invalid';
|
||||||
|
this.validationText = result.message || '';
|
||||||
|
if (result.valid) {
|
||||||
|
this.validConfirmed = false;
|
||||||
|
clearTimeout(this.validTimeout);
|
||||||
|
this.validTimeout = setTimeout(() => {
|
||||||
|
this.validConfirmed = true;
|
||||||
|
this.validationState = undefined as any;
|
||||||
|
}, 500);
|
||||||
|
} else {
|
||||||
|
clearTimeout(this.validTimeout);
|
||||||
|
this.validConfirmed = false;
|
||||||
|
}
|
||||||
|
}
|
||||||
this.changeSubject.next(this);
|
this.changeSubject.next(this);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
public getContextMenuItems() {
|
||||||
|
const input = this.shadowRoot!.querySelector('input')!;
|
||||||
|
const hasSelection = input.selectionStart !== input.selectionEnd;
|
||||||
|
return [
|
||||||
|
{
|
||||||
|
name: 'Cut',
|
||||||
|
iconName: 'lucide:Scissors',
|
||||||
|
shortcut: 'Cmd+X',
|
||||||
|
disabled: !hasSelection,
|
||||||
|
action: async () => {
|
||||||
|
const selected = this.value.substring(input.selectionStart!, input.selectionEnd!);
|
||||||
|
await navigator.clipboard.writeText(selected);
|
||||||
|
const start = input.selectionStart!;
|
||||||
|
this.value = this.value.substring(0, start) + this.value.substring(input.selectionEnd!);
|
||||||
|
input.value = this.value;
|
||||||
|
input.setSelectionRange(start, start);
|
||||||
|
this.changeSubject.next(this);
|
||||||
|
},
|
||||||
|
},
|
||||||
|
{
|
||||||
|
name: 'Copy',
|
||||||
|
iconName: 'lucide:Copy',
|
||||||
|
shortcut: 'Cmd+C',
|
||||||
|
disabled: !hasSelection,
|
||||||
|
action: async () => {
|
||||||
|
const selected = this.value.substring(input.selectionStart!, input.selectionEnd!);
|
||||||
|
await navigator.clipboard.writeText(selected);
|
||||||
|
},
|
||||||
|
},
|
||||||
|
{
|
||||||
|
name: 'Paste',
|
||||||
|
iconName: 'lucide:ClipboardPaste',
|
||||||
|
shortcut: 'Cmd+V',
|
||||||
|
action: async () => {
|
||||||
|
const text = await navigator.clipboard.readText();
|
||||||
|
const start = input.selectionStart!;
|
||||||
|
const end = input.selectionEnd!;
|
||||||
|
this.value = this.value.substring(0, start) + text + this.value.substring(end);
|
||||||
|
input.value = this.value;
|
||||||
|
input.setSelectionRange(start + text.length, start + text.length);
|
||||||
|
this.changeSubject.next(this);
|
||||||
|
},
|
||||||
|
},
|
||||||
|
{ divider: true },
|
||||||
|
{
|
||||||
|
name: 'Select All',
|
||||||
|
iconName: 'lucide:TextCursorInput',
|
||||||
|
shortcut: 'Cmd+A',
|
||||||
|
action: async () => {
|
||||||
|
input.select();
|
||||||
|
},
|
||||||
|
},
|
||||||
|
];
|
||||||
|
}
|
||||||
|
|
||||||
public getValue(): string {
|
public getValue(): string {
|
||||||
return this.value;
|
return this.value;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -116,7 +116,7 @@ export const demoFunc = () => html`
|
|||||||
|
|
||||||
<div class="demo-container">
|
<div class="demo-container">
|
||||||
<dees-panel .title=${'Basic Toggle'} .subtitle=${'Simple on/off toggle switch with drag support'}>
|
<dees-panel .title=${'Basic Toggle'} .subtitle=${'Simple on/off toggle switch with drag support'}>
|
||||||
<div class="toggle-group">
|
<dees-form>
|
||||||
<dees-input-toggle
|
<dees-input-toggle
|
||||||
.label=${'Enable feature'}
|
.label=${'Enable feature'}
|
||||||
.value=${false}
|
.value=${false}
|
||||||
@@ -135,12 +135,12 @@ export const demoFunc = () => html`
|
|||||||
.description=${'This toggle has additional helper text explaining its purpose'}
|
.description=${'This toggle has additional helper text explaining its purpose'}
|
||||||
.key=${'withDesc'}
|
.key=${'withDesc'}
|
||||||
></dees-input-toggle>
|
></dees-input-toggle>
|
||||||
</div>
|
</dees-form>
|
||||||
<p class="drag-hint">Tip: You can drag the toggle knob to switch states</p>
|
<p class="drag-hint">Tip: You can drag the toggle knob to switch states</p>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Toggle States'} .subtitle=${'Different toggle states and configurations'}>
|
<dees-panel .title=${'Toggle States'} .subtitle=${'Different toggle states and configurations'}>
|
||||||
<div class="toggle-group">
|
<dees-form>
|
||||||
<dees-input-toggle
|
<dees-input-toggle
|
||||||
.label=${'Default (off)'}
|
.label=${'Default (off)'}
|
||||||
.value=${false}
|
.value=${false}
|
||||||
@@ -169,42 +169,44 @@ export const demoFunc = () => html`
|
|||||||
.required=${true}
|
.required=${true}
|
||||||
.description=${'This toggle cannot be turned off'}
|
.description=${'This toggle cannot be turned off'}
|
||||||
></dees-input-toggle>
|
></dees-input-toggle>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Horizontal Layout'} .subtitle=${'Toggles arranged horizontally for compact interfaces'}>
|
<dees-panel .title=${'Horizontal Layout'} .subtitle=${'Toggles arranged horizontally for compact interfaces'}>
|
||||||
<div class="horizontal-toggles">
|
<dees-form>
|
||||||
<dees-input-toggle
|
<div class="horizontal-toggles">
|
||||||
.label=${'WiFi'}
|
<dees-input-toggle
|
||||||
.value=${true}
|
.label=${'WiFi'}
|
||||||
.layoutMode=${'horizontal'}
|
.value=${true}
|
||||||
></dees-input-toggle>
|
.layoutMode=${'horizontal'}
|
||||||
|
></dees-input-toggle>
|
||||||
|
|
||||||
<dees-input-toggle
|
<dees-input-toggle
|
||||||
.label=${'Bluetooth'}
|
.label=${'Bluetooth'}
|
||||||
.value=${false}
|
.value=${false}
|
||||||
.layoutMode=${'horizontal'}
|
.layoutMode=${'horizontal'}
|
||||||
></dees-input-toggle>
|
></dees-input-toggle>
|
||||||
|
|
||||||
<dees-input-toggle
|
<dees-input-toggle
|
||||||
.label=${'GPS'}
|
.label=${'GPS'}
|
||||||
.value=${true}
|
.value=${true}
|
||||||
.layoutMode=${'horizontal'}
|
.layoutMode=${'horizontal'}
|
||||||
></dees-input-toggle>
|
></dees-input-toggle>
|
||||||
|
|
||||||
<dees-input-toggle
|
<dees-input-toggle
|
||||||
.label=${'NFC'}
|
.label=${'NFC'}
|
||||||
.value=${false}
|
.value=${false}
|
||||||
.layoutMode=${'horizontal'}
|
.layoutMode=${'horizontal'}
|
||||||
></dees-input-toggle>
|
></dees-input-toggle>
|
||||||
</div>
|
</div>
|
||||||
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Settings Example'} .subtitle=${'Toggles in a typical settings context'}>
|
<dees-panel .title=${'Settings Example'} .subtitle=${'Toggles in a typical settings context'}>
|
||||||
<div class="settings-section">
|
<div class="settings-section">
|
||||||
<h4 class="section-title">Notification Settings</h4>
|
<h4 class="section-title">Notification Settings</h4>
|
||||||
|
|
||||||
<div class="toggle-group">
|
<dees-form>
|
||||||
<dees-input-toggle
|
<dees-input-toggle
|
||||||
.label=${'Push notifications'}
|
.label=${'Push notifications'}
|
||||||
.value=${true}
|
.value=${true}
|
||||||
@@ -232,7 +234,7 @@ export const demoFunc = () => html`
|
|||||||
.description=${'Vibrate for notifications'}
|
.description=${'Vibrate for notifications'}
|
||||||
.key=${'vibration'}
|
.key=${'vibration'}
|
||||||
></dees-input-toggle>
|
></dees-input-toggle>
|
||||||
</div>
|
</dees-form>
|
||||||
</div>
|
</div>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
@@ -243,7 +245,7 @@ export const demoFunc = () => html`
|
|||||||
</div>
|
</div>
|
||||||
|
|
||||||
<div class="feature-toggles">
|
<div class="feature-toggles">
|
||||||
<div class="toggle-group">
|
<dees-form>
|
||||||
<dees-input-toggle
|
<dees-input-toggle
|
||||||
.label=${'Dark Mode'}
|
.label=${'Dark Mode'}
|
||||||
.value=${true}
|
.value=${true}
|
||||||
@@ -273,12 +275,12 @@ export const demoFunc = () => html`
|
|||||||
.value=${false}
|
.value=${false}
|
||||||
.key=${'beta'}
|
.key=${'beta'}
|
||||||
></dees-input-toggle>
|
></dees-input-toggle>
|
||||||
</div>
|
</dees-form>
|
||||||
</div>
|
</div>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Interactive Example'} .subtitle=${'Toggle to see value changes in real-time'}>
|
<dees-panel .title=${'Interactive Example'} .subtitle=${'Toggle to see value changes in real-time'}>
|
||||||
<div class="toggle-group">
|
<dees-form>
|
||||||
<dees-input-toggle
|
<dees-input-toggle
|
||||||
.label=${'Airplane mode'}
|
.label=${'Airplane mode'}
|
||||||
.value=${false}
|
.value=${false}
|
||||||
@@ -300,7 +302,7 @@ export const demoFunc = () => html`
|
|||||||
}
|
}
|
||||||
}}
|
}}
|
||||||
></dees-input-toggle>
|
></dees-input-toggle>
|
||||||
</div>
|
</dees-form>
|
||||||
|
|
||||||
<div class="interactive-section">
|
<div class="interactive-section">
|
||||||
<div id="airplane-output" class="output-text">Airplane mode: OFF</div>
|
<div id="airplane-output" class="output-text">Airplane mode: OFF</div>
|
||||||
|
|||||||
@@ -170,12 +170,6 @@ export class DeesInputToggle extends DeesInputBase<DeesInputToggle> {
|
|||||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 90%)')};
|
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 90%)')};
|
||||||
}
|
}
|
||||||
|
|
||||||
/* Description */
|
|
||||||
.description-text {
|
|
||||||
font-size: 12px;
|
|
||||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
|
||||||
line-height: 1.5;
|
|
||||||
}
|
|
||||||
`,
|
`,
|
||||||
];
|
];
|
||||||
|
|
||||||
@@ -199,7 +193,7 @@ export class DeesInputToggle extends DeesInputBase<DeesInputToggle> {
|
|||||||
</div>
|
</div>
|
||||||
<div class="label-container">
|
<div class="label-container">
|
||||||
${this.label ? html`<div class="toggle-label">${this.label}</div>` : ''}
|
${this.label ? html`<div class="toggle-label">${this.label}</div>` : ''}
|
||||||
${this.description ? html`<div class="description-text">${this.description}</div>` : ''}
|
${this.renderDescription()}
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
|||||||
@@ -13,12 +13,6 @@ export const demoFunc = () => html`
|
|||||||
margin: 0 auto;
|
margin: 0 auto;
|
||||||
}
|
}
|
||||||
|
|
||||||
.input-group {
|
|
||||||
display: flex;
|
|
||||||
flex-direction: column;
|
|
||||||
gap: 16px;
|
|
||||||
}
|
|
||||||
|
|
||||||
.horizontal-group {
|
.horizontal-group {
|
||||||
display: flex;
|
display: flex;
|
||||||
gap: 24px;
|
gap: 24px;
|
||||||
@@ -45,61 +39,62 @@ export const demoFunc = () => html`
|
|||||||
|
|
||||||
<div class="demo-container">
|
<div class="demo-container">
|
||||||
<dees-panel .title=${'Basic Type List'} .subtitle=${'Add and remove items from a list'}>
|
<dees-panel .title=${'Basic Type List'} .subtitle=${'Add and remove items from a list'}>
|
||||||
<div class="input-group">
|
<dees-form>
|
||||||
<dees-input-typelist
|
<dees-input-typelist
|
||||||
.label=${'Tags'}
|
.label=${'Tags'}
|
||||||
.description=${'Add tags by typing and pressing Enter'}
|
.infoText=${'Add tags by typing and pressing Enter'}
|
||||||
|
.description=${'Tags help categorize and filter your content'}
|
||||||
.value=${['javascript', 'typescript', 'web-components']}
|
.value=${['javascript', 'typescript', 'web-components']}
|
||||||
></dees-input-typelist>
|
></dees-input-typelist>
|
||||||
|
|
||||||
<dees-input-typelist
|
<dees-input-typelist
|
||||||
.label=${'Team Members'}
|
.label=${'Team Members'}
|
||||||
.description=${'Add email addresses of team members'}
|
.infoText=${'Add email addresses of team members'}
|
||||||
.value=${['alice@example.com', 'bob@example.com']}
|
.value=${['alice@example.com', 'bob@example.com']}
|
||||||
></dees-input-typelist>
|
></dees-input-typelist>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Skills & Keywords'} .subtitle=${'Manage lists of skills and keywords'}>
|
<dees-panel .title=${'Skills & Keywords'} .subtitle=${'Manage lists of skills and keywords'}>
|
||||||
<div class="input-group">
|
<dees-form>
|
||||||
<dees-input-typelist
|
<dees-input-typelist
|
||||||
.label=${'Your Skills'}
|
.label=${'Your Skills'}
|
||||||
.description=${'List your professional skills'}
|
.infoText=${'List your professional skills'}
|
||||||
.value=${['HTML', 'CSS', 'JavaScript', 'Node.js', 'React']}
|
.value=${['HTML', 'CSS', 'JavaScript', 'Node.js', 'React']}
|
||||||
></dees-input-typelist>
|
></dees-input-typelist>
|
||||||
|
|
||||||
<div class="horizontal-group">
|
<div class="horizontal-group">
|
||||||
<dees-input-typelist
|
<dees-input-typelist
|
||||||
.label=${'Categories'}
|
.label=${'Categories'}
|
||||||
.layoutMode=${'horizontal'}
|
.layoutMode=${'horizontal'}
|
||||||
.value=${['Technology', 'Design', 'Business']}
|
.value=${['Technology', 'Design', 'Business']}
|
||||||
></dees-input-typelist>
|
></dees-input-typelist>
|
||||||
|
|
||||||
<dees-input-typelist
|
<dees-input-typelist
|
||||||
.label=${'Keywords'}
|
.label=${'Keywords'}
|
||||||
.layoutMode=${'horizontal'}
|
.layoutMode=${'horizontal'}
|
||||||
.value=${['innovation', 'startup', 'growth']}
|
.value=${['innovation', 'startup', 'growth']}
|
||||||
></dees-input-typelist>
|
></dees-input-typelist>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Required & Disabled States'} .subtitle=${'Different input states for validation'}>
|
<dees-panel .title=${'Required & Disabled States'} .subtitle=${'Different input states for validation'}>
|
||||||
<div class="input-group">
|
<dees-form>
|
||||||
<dees-input-typelist
|
<dees-input-typelist
|
||||||
.label=${'Project Dependencies'}
|
.label=${'Project Dependencies'}
|
||||||
.description=${'List all required npm packages'}
|
.infoText=${'List all required npm packages'}
|
||||||
.required=${true}
|
.required=${true}
|
||||||
.value=${['@design.estate/dees-element', '@design.estate/dees-domtools']}
|
.value=${['@design.estate/dees-element', '@design.estate/dees-domtools']}
|
||||||
></dees-input-typelist>
|
></dees-input-typelist>
|
||||||
|
|
||||||
<dees-input-typelist
|
<dees-input-typelist
|
||||||
.label=${'System Tags'}
|
.label=${'System Tags'}
|
||||||
.description=${'These tags are managed by the system'}
|
.infoText=${'These tags are managed by the system'}
|
||||||
.disabled=${true}
|
.disabled=${true}
|
||||||
.value=${['system', 'protected', 'readonly']}
|
.value=${['system', 'protected', 'readonly']}
|
||||||
></dees-input-typelist>
|
></dees-input-typelist>
|
||||||
</div>
|
</dees-form>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
|
|
||||||
<dees-panel .title=${'Article Publishing Form'} .subtitle=${'Complete form with tag management'}>
|
<dees-panel .title=${'Article Publishing Form'} .subtitle=${'Complete form with tag management'}>
|
||||||
@@ -108,16 +103,16 @@ export const demoFunc = () => html`
|
|||||||
<dees-input-text
|
<dees-input-text
|
||||||
.label=${'Summary'}
|
.label=${'Summary'}
|
||||||
.inputType=${'textarea'}
|
.inputType=${'textarea'}
|
||||||
.description=${'Brief description of the article'}
|
.infoText=${'Brief description of the article'}
|
||||||
></dees-input-text>
|
></dees-input-text>
|
||||||
<dees-input-typelist
|
<dees-input-typelist
|
||||||
.label=${'Tags'}
|
.label=${'Tags'}
|
||||||
.description=${'Add relevant tags for better discoverability'}
|
.infoText=${'Add relevant tags for better discoverability'}
|
||||||
.value=${['tutorial', 'web-development']}
|
.value=${['tutorial', 'web-development']}
|
||||||
></dees-input-typelist>
|
></dees-input-typelist>
|
||||||
<dees-input-typelist
|
<dees-input-typelist
|
||||||
.label=${'Co-Authors'}
|
.label=${'Co-Authors'}
|
||||||
.description=${'Add email addresses of co-authors'}
|
.infoText=${'Add email addresses of co-authors'}
|
||||||
></dees-input-typelist>
|
></dees-input-typelist>
|
||||||
</dees-form>
|
</dees-form>
|
||||||
|
|
||||||
|
|||||||
@@ -153,7 +153,7 @@ export class DeesInputTypelist extends DeesInputBase<DeesInputTypelist> {
|
|||||||
public render(): TemplateResult {
|
public render(): TemplateResult {
|
||||||
return html`
|
return html`
|
||||||
<div class="input-wrapper">
|
<div class="input-wrapper">
|
||||||
<dees-label .label=${this.label} .description=${this.description}></dees-label>
|
<dees-label .label=${this.label} .infoText=${this.infoText}></dees-label>
|
||||||
<div class="mainbox">
|
<div class="mainbox">
|
||||||
<div class="tags" @click=${() => {
|
<div class="tags" @click=${() => {
|
||||||
this.shadowRoot!.querySelector('input')!.focus();
|
this.shadowRoot!.querySelector('input')!.focus();
|
||||||
@@ -188,6 +188,7 @@ export class DeesInputTypelist extends DeesInputBase<DeesInputTypelist> {
|
|||||||
.disabled=${this.disabled}
|
.disabled=${this.disabled}
|
||||||
/>
|
/>
|
||||||
</div>
|
</div>
|
||||||
|
${this.renderDescription()}
|
||||||
</div>
|
</div>
|
||||||
`;
|
`;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -292,17 +292,18 @@ export class DeesInputWysiwyg extends DeesInputBase<string> {
|
|||||||
return html`
|
return html`
|
||||||
<dees-label
|
<dees-label
|
||||||
.label="${this.label}"
|
.label="${this.label}"
|
||||||
.description="${this.description}"
|
.infoText="${this.infoText}"
|
||||||
.required="${this.required}"
|
.required="${this.required}"
|
||||||
></dees-label>
|
></dees-label>
|
||||||
<div class="wysiwyg-container">
|
<div class="wysiwyg-container">
|
||||||
<div
|
<div
|
||||||
class="editor-content ${this.draggedBlockId ? 'dragging' : ''}"
|
class="editor-content ${this.draggedBlockId ? 'dragging' : ''}"
|
||||||
id="editor-content"
|
id="editor-content"
|
||||||
>
|
>
|
||||||
<!-- Blocks will be rendered programmatically -->
|
<!-- Blocks will be rendered programmatically -->
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
${this.renderDescription()}
|
||||||
`;
|
`;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -273,7 +273,7 @@ export class DeesInputProfilePicture extends DeesInputBase<DeesInputProfilePictu
|
|||||||
render(): TemplateResult {
|
render(): TemplateResult {
|
||||||
return html`
|
return html`
|
||||||
<div class="input-wrapper">
|
<div class="input-wrapper">
|
||||||
<dees-label .label=${this.label} .description=${this.description} .required=${this.required}></dees-label>
|
<dees-label .label=${this.label} .infoText=${this.infoText} .required=${this.required}></dees-label>
|
||||||
|
|
||||||
<div
|
<div
|
||||||
class="profile-container"
|
class="profile-container"
|
||||||
@@ -329,6 +329,7 @@ export class DeesInputProfilePicture extends DeesInputBase<DeesInputProfilePictu
|
|||||||
accept="${this.acceptedFormats.join(',')}"
|
accept="${this.acceptedFormats.join(',')}"
|
||||||
@change=${this.handleFileSelect}
|
@change=${this.handleFileSelect}
|
||||||
/>
|
/>
|
||||||
|
${this.renderDescription()}
|
||||||
</div>
|
</div>
|
||||||
`;
|
`;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -85,31 +85,31 @@ export const demoFunc = () => html`
|
|||||||
</div>
|
</div>
|
||||||
|
|
||||||
<div class="demo-section">
|
<div class="demo-section">
|
||||||
<h3>Description (Info Icon)</h3>
|
<h3>Info Text (Info Icon)</h3>
|
||||||
<p>When <code>description</code> is set, an info icon appears next to the label. Hover over it to see the tooltip.</p>
|
<p>When <code>infoText</code> is set, an info icon appears next to the label. Hover over it to see the tooltip.</p>
|
||||||
<div class="label-grid">
|
<div class="label-grid">
|
||||||
<div class="label-row">
|
<div class="label-row">
|
||||||
<span class="annotation">description="..."</span>
|
<span class="annotation">infoText="..."</span>
|
||||||
<dees-label .label=${'API Key'} .description=${'Your API key can be found in the developer settings dashboard.'}></dees-label>
|
<dees-label .label=${'API Key'} .infoText=${'Your API key can be found in the developer settings dashboard.'}></dees-label>
|
||||||
</div>
|
</div>
|
||||||
<div class="label-row">
|
<div class="label-row">
|
||||||
<span class="annotation">short description</span>
|
<span class="annotation">short infoText</span>
|
||||||
<dees-label .label=${'Region'} .description=${'Select your nearest datacenter.'}></dees-label>
|
<dees-label .label=${'Region'} .infoText=${'Select your nearest datacenter.'}></dees-label>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
<div class="demo-section">
|
<div class="demo-section">
|
||||||
<h3>Required + Description</h3>
|
<h3>Required + Info Text</h3>
|
||||||
<p>Both indicators can be combined. The asterisk appears first, then the info icon.</p>
|
<p>Both indicators can be combined. The asterisk appears first, then the info icon.</p>
|
||||||
<div class="label-grid">
|
<div class="label-grid">
|
||||||
<div class="label-row">
|
<div class="label-row">
|
||||||
<span class="annotation">required + description</span>
|
<span class="annotation">required + infoText</span>
|
||||||
<dees-label .label=${'Password'} .required=${true} .description=${'Must be at least 8 characters with one uppercase letter and one number.'}></dees-label>
|
<dees-label .label=${'Password'} .required=${true} .infoText=${'Must be at least 8 characters with one uppercase letter and one number.'}></dees-label>
|
||||||
</div>
|
</div>
|
||||||
<div class="label-row">
|
<div class="label-row">
|
||||||
<span class="annotation">required + description</span>
|
<span class="annotation">required + infoText</span>
|
||||||
<dees-label .label=${'Email Address'} .required=${true} .description=${'We will send a verification link to this address.'}></dees-label>
|
<dees-label .label=${'Email Address'} .required=${true} .infoText=${'We will send a verification link to this address.'}></dees-label>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
|||||||
@@ -32,7 +32,7 @@ export class DeesLabel extends DeesElement {
|
|||||||
type: String,
|
type: String,
|
||||||
reflect: true,
|
reflect: true,
|
||||||
})
|
})
|
||||||
accessor description!: string;
|
accessor infoText!: string;
|
||||||
|
|
||||||
@property({
|
@property({
|
||||||
type: Boolean,
|
type: Boolean,
|
||||||
@@ -50,7 +50,8 @@ export class DeesLabel extends DeesElement {
|
|||||||
}
|
}
|
||||||
|
|
||||||
.label {
|
.label {
|
||||||
display: inline-block;
|
display: inline-flex;
|
||||||
|
align-items: center;
|
||||||
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 90%)')};
|
color: ${cssManager.bdTheme('hsl(0 0% 15%)', 'hsl(0 0% 90%)')};
|
||||||
font-size: 14px;
|
font-size: 14px;
|
||||||
font-weight: 500;
|
font-weight: 500;
|
||||||
@@ -66,13 +67,26 @@ export class DeesLabel extends DeesElement {
|
|||||||
margin-left: 2px;
|
margin-left: 2px;
|
||||||
}
|
}
|
||||||
|
|
||||||
dees-icon {
|
.description-icon {
|
||||||
display: inline-block;
|
display: inline-flex;
|
||||||
font-size: 12px;
|
align-items: center;
|
||||||
transform: translateY(1px);
|
justify-content: center;
|
||||||
margin-left: 4px;
|
width: 24px;
|
||||||
|
height: 24px;
|
||||||
|
margin: -6px 0 -6px 2px;
|
||||||
|
border-radius: 4px;
|
||||||
|
cursor: default;
|
||||||
|
transition: background 0.15s ease, color 0.15s ease;
|
||||||
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
color: ${cssManager.bdTheme('hsl(0 0% 45.1%)', 'hsl(0 0% 63.9%)')};
|
||||||
cursor: help;
|
}
|
||||||
|
|
||||||
|
.description-icon:hover {
|
||||||
|
background: ${cssManager.bdTheme('hsl(0 0% 0% / 0.06)', 'hsl(0 0% 100% / 0.08)')};
|
||||||
|
color: ${cssManager.bdTheme('hsl(0 0% 25%)', 'hsl(0 0% 80%)')};
|
||||||
|
}
|
||||||
|
|
||||||
|
.description-icon dees-icon {
|
||||||
|
font-size: 14px;
|
||||||
}
|
}
|
||||||
`,
|
`,
|
||||||
];
|
];
|
||||||
@@ -84,10 +98,12 @@ export class DeesLabel extends DeesElement {
|
|||||||
<div class="label">
|
<div class="label">
|
||||||
${this.label}
|
${this.label}
|
||||||
${this.required ? html`<span class="required">*</span>` : ''}
|
${this.required ? html`<span class="required">*</span>` : ''}
|
||||||
${this.description
|
${this.infoText
|
||||||
? html`
|
? html`
|
||||||
<dees-icon .icon=${'lucide:info'}></dees-icon>
|
<div class="description-icon">
|
||||||
<dees-speechbubble .text=${this.description}></dees-speechbubble>
|
<dees-icon .icon=${'lucide:info'}></dees-icon>
|
||||||
|
</div>
|
||||||
|
<dees-speechbubble .text=${this.infoText}></dees-speechbubble>
|
||||||
`
|
`
|
||||||
: html``}
|
: html``}
|
||||||
</div>
|
</div>
|
||||||
|
|||||||
@@ -0,0 +1,65 @@
|
|||||||
|
import { html, css, cssManager } from '@design.estate/dees-element';
|
||||||
|
import './dees-settings.js';
|
||||||
|
import type { ISettingsField, ISettingsAction } from './dees-settings.js';
|
||||||
|
|
||||||
|
export const demoFunc = () => {
|
||||||
|
const acmeFields: ISettingsField[] = [
|
||||||
|
{ key: 'email', label: 'Account email', value: 'admin@example.com' },
|
||||||
|
{ key: 'status', label: 'Status', value: 'enabled' },
|
||||||
|
{ key: 'mode', label: 'Mode', value: 'production' },
|
||||||
|
{ key: 'autoRenew', label: 'Auto-renew', value: 'on' },
|
||||||
|
{ key: 'threshold', label: 'Renewal threshold', value: '30 days' },
|
||||||
|
];
|
||||||
|
|
||||||
|
const acmeActions: ISettingsAction[] = [
|
||||||
|
{ name: 'Edit', action: () => console.log('Edit clicked') },
|
||||||
|
];
|
||||||
|
|
||||||
|
const emptyActions: ISettingsAction[] = [
|
||||||
|
{ name: 'Configure', action: () => console.log('Configure clicked') },
|
||||||
|
];
|
||||||
|
|
||||||
|
const multiActions: ISettingsAction[] = [
|
||||||
|
{ name: 'Reset', action: () => console.log('Reset clicked') },
|
||||||
|
{ name: 'Edit', action: () => console.log('Edit clicked') },
|
||||||
|
];
|
||||||
|
|
||||||
|
return html`
|
||||||
|
<dees-demowrapper>
|
||||||
|
<style>
|
||||||
|
${css`
|
||||||
|
.demoBox {
|
||||||
|
background: ${cssManager.bdTheme('hsl(0 0% 95%)', 'hsl(0 0% 9%)')};
|
||||||
|
padding: 40px;
|
||||||
|
display: flex;
|
||||||
|
flex-direction: column;
|
||||||
|
gap: 24px;
|
||||||
|
max-width: 600px;
|
||||||
|
}
|
||||||
|
`}
|
||||||
|
</style>
|
||||||
|
<div class="demoBox">
|
||||||
|
<dees-settings
|
||||||
|
.heading=${'ACME Settings'}
|
||||||
|
.settingsFields=${acmeFields}
|
||||||
|
.actions=${acmeActions}
|
||||||
|
></dees-settings>
|
||||||
|
|
||||||
|
<dees-settings
|
||||||
|
.heading=${'ACME Settings'}
|
||||||
|
.description=${'No ACME configuration yet. Click Configure to set up automated TLS certificate issuance.'}
|
||||||
|
.actions=${emptyActions}
|
||||||
|
></dees-settings>
|
||||||
|
|
||||||
|
<dees-settings
|
||||||
|
.heading=${'Server Config'}
|
||||||
|
.settingsFields=${[
|
||||||
|
{ key: 'host', label: 'Hostname', value: 'proxy.example.com' },
|
||||||
|
{ key: 'port', label: 'Port', value: '443' },
|
||||||
|
]}
|
||||||
|
.actions=${multiActions}
|
||||||
|
></dees-settings>
|
||||||
|
</div>
|
||||||
|
</dees-demowrapper>
|
||||||
|
`;
|
||||||
|
};
|
||||||
@@ -0,0 +1,196 @@
|
|||||||
|
import {
|
||||||
|
customElement,
|
||||||
|
DeesElement,
|
||||||
|
html,
|
||||||
|
css,
|
||||||
|
cssManager,
|
||||||
|
property,
|
||||||
|
type TemplateResult,
|
||||||
|
} from '@design.estate/dees-element';
|
||||||
|
import { demoFunc } from './dees-settings.demo.js';
|
||||||
|
import { cssGeistFontFamily } from '../../00fonts.js';
|
||||||
|
import { themeDefaultStyles } from '../../00theme.js';
|
||||||
|
import '../../00group-layout/dees-tile/dees-tile.js';
|
||||||
|
|
||||||
|
declare global {
|
||||||
|
interface HTMLElementTagNameMap {
|
||||||
|
'dees-settings': DeesSettings;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
export interface ISettingsField {
|
||||||
|
key: string;
|
||||||
|
label: string;
|
||||||
|
value: string | TemplateResult;
|
||||||
|
}
|
||||||
|
|
||||||
|
export interface ISettingsAction {
|
||||||
|
name: string;
|
||||||
|
action: () => void | Promise<void>;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* dees-settings — a read-only settings display tile with modal-style footer actions.
|
||||||
|
*
|
||||||
|
* Renders a dees-tile with a heading, a grid of label/value fields,
|
||||||
|
* and a footer action bar. When an action is clicked the component
|
||||||
|
* dispatches a `settings-action` CustomEvent with the action name.
|
||||||
|
*/
|
||||||
|
@customElement('dees-settings')
|
||||||
|
export class DeesSettings extends DeesElement {
|
||||||
|
public static demo = demoFunc;
|
||||||
|
public static demoGroups = ['Layout'];
|
||||||
|
|
||||||
|
@property({ type: String })
|
||||||
|
accessor heading: string = '';
|
||||||
|
|
||||||
|
@property({ type: String })
|
||||||
|
accessor description: string = '';
|
||||||
|
|
||||||
|
@property({ attribute: false })
|
||||||
|
accessor settingsFields: ISettingsField[] = [];
|
||||||
|
|
||||||
|
@property({ attribute: false })
|
||||||
|
accessor actions: ISettingsAction[] = [];
|
||||||
|
|
||||||
|
public static styles = [
|
||||||
|
themeDefaultStyles,
|
||||||
|
cssManager.defaultStyles,
|
||||||
|
css`
|
||||||
|
:host {
|
||||||
|
display: block;
|
||||||
|
font-family: ${cssGeistFontFamily};
|
||||||
|
}
|
||||||
|
|
||||||
|
.settingsGrid {
|
||||||
|
display: grid;
|
||||||
|
grid-template-columns: repeat(auto-fit, minmax(180px, 1fr));
|
||||||
|
gap: 12px 24px;
|
||||||
|
padding: 16px;
|
||||||
|
}
|
||||||
|
|
||||||
|
.settingsField {
|
||||||
|
display: flex;
|
||||||
|
flex-direction: column;
|
||||||
|
gap: 2px;
|
||||||
|
}
|
||||||
|
|
||||||
|
.fieldLabel {
|
||||||
|
font-size: 11px;
|
||||||
|
text-transform: uppercase;
|
||||||
|
letter-spacing: 0.03em;
|
||||||
|
color: var(--dees-color-text-muted);
|
||||||
|
}
|
||||||
|
|
||||||
|
.fieldValue {
|
||||||
|
font-size: 13px;
|
||||||
|
color: var(--dees-color-text-primary);
|
||||||
|
}
|
||||||
|
|
||||||
|
.settingsDescription {
|
||||||
|
padding: 16px;
|
||||||
|
font-size: 13px;
|
||||||
|
line-height: 1.5;
|
||||||
|
color: var(--dees-color-text-muted);
|
||||||
|
}
|
||||||
|
|
||||||
|
.bottomButtons {
|
||||||
|
display: flex;
|
||||||
|
flex-direction: row;
|
||||||
|
justify-content: flex-end;
|
||||||
|
align-items: center;
|
||||||
|
gap: 0;
|
||||||
|
height: 36px;
|
||||||
|
width: 100%;
|
||||||
|
box-sizing: border-box;
|
||||||
|
}
|
||||||
|
|
||||||
|
.bottomButtons .bottomButton {
|
||||||
|
padding: 0 16px;
|
||||||
|
height: 100%;
|
||||||
|
text-align: center;
|
||||||
|
font-size: 12px;
|
||||||
|
font-weight: 500;
|
||||||
|
cursor: pointer;
|
||||||
|
user-select: none;
|
||||||
|
transition: all 0.15s ease;
|
||||||
|
background: transparent;
|
||||||
|
border: none;
|
||||||
|
border-left: 1px solid var(--dees-color-border-subtle);
|
||||||
|
color: var(--dees-color-text-muted);
|
||||||
|
white-space: nowrap;
|
||||||
|
display: flex;
|
||||||
|
align-items: center;
|
||||||
|
}
|
||||||
|
|
||||||
|
.bottomButtons .bottomButton:first-child {
|
||||||
|
border-left: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
.bottomButtons .bottomButton:hover {
|
||||||
|
background: var(--dees-color-hover);
|
||||||
|
color: var(--dees-color-text-primary);
|
||||||
|
}
|
||||||
|
|
||||||
|
.bottomButtons .bottomButton:active {
|
||||||
|
background: ${cssManager.bdTheme('hsl(0 0% 92%)', 'hsl(0 0% 13%)')};
|
||||||
|
}
|
||||||
|
|
||||||
|
.bottomButtons .bottomButton.primary {
|
||||||
|
color: ${cssManager.bdTheme('hsl(217.2 91.2% 59.8%)', 'hsl(213.1 93.9% 67.8%)')};
|
||||||
|
font-weight: 600;
|
||||||
|
}
|
||||||
|
|
||||||
|
.bottomButtons .bottomButton.primary:hover {
|
||||||
|
background: ${cssManager.bdTheme('hsl(217.2 91.2% 59.8% / 0.08)', 'hsl(213.1 93.9% 67.8% / 0.08)')};
|
||||||
|
color: ${cssManager.bdTheme('hsl(217.2 91.2% 50%)', 'hsl(213.1 93.9% 75%)')};
|
||||||
|
}
|
||||||
|
|
||||||
|
.bottomButtons .bottomButton.primary:active {
|
||||||
|
background: ${cssManager.bdTheme('hsl(217.2 91.2% 59.8% / 0.15)', 'hsl(213.1 93.9% 67.8% / 0.15)')};
|
||||||
|
}
|
||||||
|
`,
|
||||||
|
];
|
||||||
|
|
||||||
|
public render(): TemplateResult {
|
||||||
|
const hasFields = this.settingsFields.length > 0;
|
||||||
|
const hasActions = this.actions.length > 0;
|
||||||
|
|
||||||
|
return html`
|
||||||
|
<dees-tile .heading=${this.heading}>
|
||||||
|
${hasFields
|
||||||
|
? html`
|
||||||
|
<div class="settingsGrid">
|
||||||
|
${this.settingsFields.map(
|
||||||
|
(field) => html`
|
||||||
|
<div class="settingsField">
|
||||||
|
<span class="fieldLabel">${field.label}</span>
|
||||||
|
<span class="fieldValue">${field.value}</span>
|
||||||
|
</div>
|
||||||
|
`,
|
||||||
|
)}
|
||||||
|
</div>
|
||||||
|
`
|
||||||
|
: html`
|
||||||
|
<div class="settingsDescription">${this.description}</div>
|
||||||
|
`}
|
||||||
|
${hasActions
|
||||||
|
? html`
|
||||||
|
<div slot="footer" class="bottomButtons">
|
||||||
|
${this.actions.map(
|
||||||
|
(actionArg, index) => html`
|
||||||
|
<div
|
||||||
|
class="bottomButton ${index === this.actions.length - 1 ? 'primary' : ''}"
|
||||||
|
@click=${() => actionArg.action()}
|
||||||
|
>
|
||||||
|
${actionArg.name}
|
||||||
|
</div>
|
||||||
|
`,
|
||||||
|
)}
|
||||||
|
</div>
|
||||||
|
`
|
||||||
|
: ''}
|
||||||
|
</dees-tile>
|
||||||
|
`;
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1 @@
|
|||||||
|
export * from './dees-settings.js';
|
||||||
@@ -1,7 +1,45 @@
|
|||||||
import { html } from '@design.estate/dees-element';
|
import { html } from '@design.estate/dees-element';
|
||||||
import { DeesStepper, type IStep } from './dees-stepper.js';
|
import { DeesStepper, type IStep } from './dees-stepper.js';
|
||||||
|
|
||||||
const demoSteps: IStep[] = [
|
const waitForProgressTick = async (timeoutArg: number, signal?: AbortSignal): Promise<boolean> => {
|
||||||
|
return new Promise((resolve) => {
|
||||||
|
let completed = false;
|
||||||
|
|
||||||
|
const finish = (result: boolean) => {
|
||||||
|
if (completed) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
completed = true;
|
||||||
|
if (signal) {
|
||||||
|
signal.removeEventListener('abort', handleAbort);
|
||||||
|
}
|
||||||
|
resolve(result);
|
||||||
|
};
|
||||||
|
|
||||||
|
const handleAbort = () => {
|
||||||
|
window.clearTimeout(timeoutId);
|
||||||
|
finish(false);
|
||||||
|
};
|
||||||
|
|
||||||
|
const timeoutId = window.setTimeout(() => {
|
||||||
|
finish(true);
|
||||||
|
}, timeoutArg);
|
||||||
|
|
||||||
|
if (signal) {
|
||||||
|
signal.addEventListener('abort', handleAbort, { once: true });
|
||||||
|
}
|
||||||
|
});
|
||||||
|
};
|
||||||
|
|
||||||
|
const createContinueMenuOptions = (labelArg = 'Continue') => [
|
||||||
|
{
|
||||||
|
name: labelArg,
|
||||||
|
action: async (stepper?: DeesStepper) => stepper?.goNext(),
|
||||||
|
},
|
||||||
|
];
|
||||||
|
|
||||||
|
const createDemoSteps = (): IStep[] => [
|
||||||
{
|
{
|
||||||
title: 'Account Setup',
|
title: 'Account Setup',
|
||||||
content: html`
|
content: html`
|
||||||
@@ -10,9 +48,7 @@ const demoSteps: IStep[] = [
|
|||||||
<dees-input-text key="password" label="Create Password" type="password" required></dees-input-text>
|
<dees-input-text key="password" label="Create Password" type="password" required></dees-input-text>
|
||||||
</dees-form>
|
</dees-form>
|
||||||
`,
|
`,
|
||||||
menuOptions: [
|
menuOptions: createContinueMenuOptions(),
|
||||||
{ name: 'Continue', action: async (stepper) => stepper!.goNext() },
|
|
||||||
],
|
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
title: 'Profile Details',
|
title: 'Profile Details',
|
||||||
@@ -22,9 +58,7 @@ const demoSteps: IStep[] = [
|
|||||||
<dees-input-text key="lastName" label="Last Name" required></dees-input-text>
|
<dees-input-text key="lastName" label="Last Name" required></dees-input-text>
|
||||||
</dees-form>
|
</dees-form>
|
||||||
`,
|
`,
|
||||||
menuOptions: [
|
menuOptions: createContinueMenuOptions(),
|
||||||
{ name: 'Continue', action: async (stepper) => stepper!.goNext() },
|
|
||||||
],
|
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
title: 'Contact Information',
|
title: 'Contact Information',
|
||||||
@@ -34,9 +68,74 @@ const demoSteps: IStep[] = [
|
|||||||
<dees-input-text key="company" label="Company"></dees-input-text>
|
<dees-input-text key="company" label="Company"></dees-input-text>
|
||||||
</dees-form>
|
</dees-form>
|
||||||
`,
|
`,
|
||||||
menuOptions: [
|
menuOptions: createContinueMenuOptions(),
|
||||||
{ name: 'Continue', action: async (stepper) => stepper!.goNext() },
|
},
|
||||||
],
|
{
|
||||||
|
title: 'Provision Workspace',
|
||||||
|
content: html`
|
||||||
|
<dees-panel>
|
||||||
|
<p>
|
||||||
|
We are creating your starter workspace, applying your onboarding choices,
|
||||||
|
and preparing a live preview. This step moves forward automatically when
|
||||||
|
the environment is ready.
|
||||||
|
</p>
|
||||||
|
</dees-panel>
|
||||||
|
`,
|
||||||
|
progressStep: {
|
||||||
|
label: 'Workspace setup',
|
||||||
|
percentage: 8,
|
||||||
|
indeterminate: true,
|
||||||
|
statusRows: 4,
|
||||||
|
statusText: 'Allocating a clean workspace...',
|
||||||
|
terminalLines: ['Allocating a clean workspace'],
|
||||||
|
},
|
||||||
|
validationFunc: async (stepper, _htmlElement, signal) => {
|
||||||
|
const progressFrames = [
|
||||||
|
{ line: 'Allocating a clean workspace', percentage: 8, delay: 500 },
|
||||||
|
{ line: 'Syncing account preferences', percentage: 24, delay: 650 },
|
||||||
|
{ line: 'Installing selected integrations', percentage: 47, delay: 700 },
|
||||||
|
{ line: 'Generating starter project files', percentage: 71, delay: 650 },
|
||||||
|
{ line: 'Booting the live preview environment', percentage: 92, delay: 700 },
|
||||||
|
];
|
||||||
|
|
||||||
|
stepper.resetProgressStep();
|
||||||
|
|
||||||
|
for (const [index, progressFrame] of progressFrames.entries()) {
|
||||||
|
if (signal?.aborted) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (index === 0) {
|
||||||
|
stepper.updateProgressStep({
|
||||||
|
percentage: progressFrame.percentage,
|
||||||
|
indeterminate: true,
|
||||||
|
statusText: `${progressFrame.line}...`,
|
||||||
|
terminalLines: [progressFrame.line],
|
||||||
|
});
|
||||||
|
} else {
|
||||||
|
stepper.appendProgressStepLine(progressFrame.line);
|
||||||
|
stepper.updateProgressStep({
|
||||||
|
percentage: progressFrame.percentage,
|
||||||
|
indeterminate: true,
|
||||||
|
statusText: `${progressFrame.line}...`,
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
const completed = await waitForProgressTick(progressFrame.delay, signal);
|
||||||
|
if (!completed) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
stepper.appendProgressStepLine('Workspace ready');
|
||||||
|
stepper.updateProgressStep({
|
||||||
|
percentage: 100,
|
||||||
|
indeterminate: false,
|
||||||
|
statusText: 'Workspace ready.',
|
||||||
|
});
|
||||||
|
|
||||||
|
await waitForProgressTick(350, signal);
|
||||||
|
},
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
title: 'Team Size',
|
title: 'Team Size',
|
||||||
@@ -55,9 +154,7 @@ const demoSteps: IStep[] = [
|
|||||||
></dees-input-dropdown>
|
></dees-input-dropdown>
|
||||||
</dees-form>
|
</dees-form>
|
||||||
`,
|
`,
|
||||||
menuOptions: [
|
menuOptions: createContinueMenuOptions(),
|
||||||
{ name: 'Continue', action: async (stepper) => stepper!.goNext() },
|
|
||||||
],
|
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
title: 'Goals',
|
title: 'Goals',
|
||||||
@@ -75,52 +172,31 @@ const demoSteps: IStep[] = [
|
|||||||
></dees-input-multitoggle>
|
></dees-input-multitoggle>
|
||||||
</dees-form>
|
</dees-form>
|
||||||
`,
|
`,
|
||||||
menuOptions: [
|
menuOptions: createContinueMenuOptions(),
|
||||||
{ name: 'Continue', action: async (stepper) => stepper!.goNext() },
|
|
||||||
],
|
|
||||||
},
|
|
||||||
{
|
|
||||||
title: 'Brand Preferences',
|
|
||||||
content: html`
|
|
||||||
<dees-form>
|
|
||||||
<dees-input-text key="brandColor" label="Primary brand color"></dees-input-text>
|
|
||||||
<dees-input-text key="tone" label="Preferred tone (e.g. friendly, formal)"></dees-input-text>
|
|
||||||
</dees-form>
|
|
||||||
`,
|
|
||||||
menuOptions: [
|
|
||||||
{ name: 'Continue', action: async (stepper) => stepper!.goNext() },
|
|
||||||
],
|
|
||||||
},
|
|
||||||
{
|
|
||||||
title: 'Integrations',
|
|
||||||
content: html`
|
|
||||||
<dees-form>
|
|
||||||
<dees-input-list
|
|
||||||
key="integrations"
|
|
||||||
label="Integrations in use"
|
|
||||||
placeholder="Add integration"
|
|
||||||
></dees-input-list>
|
|
||||||
</dees-form>
|
|
||||||
`,
|
|
||||||
menuOptions: [
|
|
||||||
{ name: 'Continue', action: async (stepper) => stepper!.goNext() },
|
|
||||||
],
|
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
title: 'Review & Launch',
|
title: 'Review & Launch',
|
||||||
content: html`
|
content: html`
|
||||||
<dees-panel>
|
<dees-panel>
|
||||||
<p>Almost there! Review your selections and launch whenever you're ready.</p>
|
<p>
|
||||||
|
Your workspace is ready. Review the collected details and launch when
|
||||||
|
you are ready to start.
|
||||||
|
</p>
|
||||||
</dees-panel>
|
</dees-panel>
|
||||||
`,
|
`,
|
||||||
menuOptions: [
|
menuOptions: [
|
||||||
{ name: 'Launch', action: async (stepper) => stepper!.goNext() },
|
{
|
||||||
|
name: 'Launch',
|
||||||
|
action: async (stepper?: DeesStepper) => {
|
||||||
|
if (stepper?.overlay) {
|
||||||
|
await stepper.destroy();
|
||||||
|
}
|
||||||
|
},
|
||||||
|
},
|
||||||
],
|
],
|
||||||
},
|
},
|
||||||
];
|
];
|
||||||
|
|
||||||
const cloneSteps = (): IStep[] => demoSteps.map((step) => ({ ...step }));
|
|
||||||
|
|
||||||
export const stepperDemo = () => html`
|
export const stepperDemo = () => html`
|
||||||
<div style="position: absolute; inset: 0;">
|
<div style="position: absolute; inset: 0;">
|
||||||
<div
|
<div
|
||||||
@@ -128,10 +204,10 @@ export const stepperDemo = () => html`
|
|||||||
>
|
>
|
||||||
<dees-button
|
<dees-button
|
||||||
@click=${async () => {
|
@click=${async () => {
|
||||||
await DeesStepper.createAndShow({ steps: cloneSteps() });
|
await DeesStepper.createAndShow({ steps: createDemoSteps() });
|
||||||
}}
|
}}
|
||||||
>Open stepper as overlay</dees-button>
|
>Open stepper as overlay</dees-button>
|
||||||
</div>
|
</div>
|
||||||
<dees-stepper .steps=${cloneSteps()}></dees-stepper>
|
<dees-stepper .steps=${createDemoSteps()}></dees-stepper>
|
||||||
</div>
|
</div>
|
||||||
`;
|
`;
|
||||||
|
|||||||
@@ -5,8 +5,6 @@ import {
|
|||||||
customElement,
|
customElement,
|
||||||
html,
|
html,
|
||||||
css,
|
css,
|
||||||
unsafeCSS,
|
|
||||||
type CSSResult,
|
|
||||||
cssManager,
|
cssManager,
|
||||||
property,
|
property,
|
||||||
type TemplateResult,
|
type TemplateResult,
|
||||||
@@ -20,16 +18,33 @@ import { zIndexRegistry } from '../../00zindex.js';
|
|||||||
import { DeesWindowLayer } from '../../00group-overlay/dees-windowlayer/dees-windowlayer.js';
|
import { DeesWindowLayer } from '../../00group-overlay/dees-windowlayer/dees-windowlayer.js';
|
||||||
import { DeesModal } from '../../00group-overlay/dees-modal/dees-modal.js';
|
import { DeesModal } from '../../00group-overlay/dees-modal/dees-modal.js';
|
||||||
import type { DeesForm } from '../../00group-form/dees-form/dees-form.js';
|
import type { DeesForm } from '../../00group-form/dees-form/dees-form.js';
|
||||||
|
import '../../00group-feedback/dees-progressbar/dees-progressbar.js';
|
||||||
import '../dees-tile/dees-tile.js';
|
import '../dees-tile/dees-tile.js';
|
||||||
|
|
||||||
|
export interface IStepProgressState {
|
||||||
|
label?: string;
|
||||||
|
percentage?: number;
|
||||||
|
indeterminate?: boolean;
|
||||||
|
showPercentage?: boolean;
|
||||||
|
statusText?: string;
|
||||||
|
terminalLines?: string[];
|
||||||
|
statusRows?: number;
|
||||||
|
}
|
||||||
|
|
||||||
|
export interface IStepProgress extends IStepProgressState {
|
||||||
|
autoAdvance?: boolean;
|
||||||
|
}
|
||||||
|
|
||||||
export interface IStep {
|
export interface IStep {
|
||||||
title: string;
|
title: string;
|
||||||
content: TemplateResult;
|
content: TemplateResult;
|
||||||
|
progressStep?: IStepProgress;
|
||||||
menuOptions?: plugins.tsclass.website.IMenuItem<DeesStepper>[];
|
menuOptions?: plugins.tsclass.website.IMenuItem<DeesStepper>[];
|
||||||
validationFunc?: (stepper: DeesStepper, htmlElement: HTMLElement, signal?: AbortSignal) => Promise<any>;
|
validationFunc?: (stepper: DeesStepper, htmlElement: HTMLElement, signal?: AbortSignal) => Promise<any>;
|
||||||
onReturnToStepFunc?: (stepper: DeesStepper, htmlElement: HTMLElement) => Promise<any>;
|
onReturnToStepFunc?: (stepper: DeesStepper, htmlElement: HTMLElement) => Promise<any>;
|
||||||
validationFuncCalled?: boolean;
|
validationFuncCalled?: boolean;
|
||||||
abortController?: AbortController;
|
abortController?: AbortController;
|
||||||
|
progressStepState?: IStepProgressState;
|
||||||
}
|
}
|
||||||
|
|
||||||
declare global {
|
declare global {
|
||||||
@@ -276,6 +291,14 @@ export class DeesStepper extends DeesElement {
|
|||||||
padding: 32px;
|
padding: 32px;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
.step-body .content.withProgressStep {
|
||||||
|
padding-top: 20px;
|
||||||
|
}
|
||||||
|
|
||||||
|
.progressStep {
|
||||||
|
padding: 0 24px;
|
||||||
|
}
|
||||||
|
|
||||||
/* --- Footer: modal-style bottom buttons --- */
|
/* --- Footer: modal-style bottom buttons --- */
|
||||||
.bottomButtons {
|
.bottomButtons {
|
||||||
display: flex;
|
display: flex;
|
||||||
@@ -375,6 +398,7 @@ export class DeesStepper extends DeesElement {
|
|||||||
const isHidden =
|
const isHidden =
|
||||||
this.getIndexOfStep(stepArg) > this.getIndexOfStep(this.selectedStep);
|
this.getIndexOfStep(stepArg) > this.getIndexOfStep(this.selectedStep);
|
||||||
const isFirst = stepIndex === 0;
|
const isFirst = stepIndex === 0;
|
||||||
|
const progressStepState = stepArg.progressStep ? this.getProgressStepState(stepArg) : null;
|
||||||
return html`<dees-tile
|
return html`<dees-tile
|
||||||
class="step ${isSelected ? 'selected' : ''} ${isHidden ? 'hiddenStep' : ''} ${isFirst ? 'entrance' : ''}"
|
class="step ${isSelected ? 'selected' : ''} ${isHidden ? 'hiddenStep' : ''} ${isFirst ? 'entrance' : ''}"
|
||||||
>
|
>
|
||||||
@@ -390,7 +414,20 @@ export class DeesStepper extends DeesElement {
|
|||||||
</div>
|
</div>
|
||||||
<div class="step-body">
|
<div class="step-body">
|
||||||
<div class="title">${stepArg.title}</div>
|
<div class="title">${stepArg.title}</div>
|
||||||
<div class="content">${stepArg.content}</div>
|
${stepArg.progressStep && progressStepState ? html`
|
||||||
|
<div class="progressStep">
|
||||||
|
<dees-progressbar
|
||||||
|
.label=${progressStepState.label ?? stepArg.title}
|
||||||
|
.percentage=${progressStepState.percentage ?? 0}
|
||||||
|
.indeterminate=${progressStepState.indeterminate ?? false}
|
||||||
|
.showPercentage=${progressStepState.showPercentage ?? true}
|
||||||
|
.statusText=${progressStepState.statusText ?? ''}
|
||||||
|
.terminalLines=${progressStepState.terminalLines ?? []}
|
||||||
|
.statusRows=${progressStepState.statusRows ?? 3}
|
||||||
|
></dees-progressbar>
|
||||||
|
</div>
|
||||||
|
` : ''}
|
||||||
|
<div class="content ${stepArg.progressStep ? 'withProgressStep' : ''}">${stepArg.content}</div>
|
||||||
</div>
|
</div>
|
||||||
<div slot="footer" class="bottomButtons">
|
<div slot="footer" class="bottomButtons">
|
||||||
${isSelected && this.activeForm !== null && !this.activeFormValid
|
${isSelected && this.activeForm !== null && !this.activeFormValid
|
||||||
@@ -426,22 +463,30 @@ export class DeesStepper extends DeesElement {
|
|||||||
public async firstUpdated() {
|
public async firstUpdated() {
|
||||||
await this.domtoolsPromise;
|
await this.domtoolsPromise;
|
||||||
await this.domtools.convenience.smartdelay.delayFor(0);
|
await this.domtools.convenience.smartdelay.delayFor(0);
|
||||||
|
if (!this.steps.length) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
this.prepareStepForActivation(this.steps[0]);
|
||||||
this.selectedStep = this.steps[0];
|
this.selectedStep = this.steps[0];
|
||||||
this.setScrollStatus();
|
await this.updateComplete;
|
||||||
|
await this.setScrollStatus();
|
||||||
// Remove entrance class after initial animation completes
|
// Remove entrance class after initial animation completes
|
||||||
await this.domtools.convenience.smartdelay.delayFor(350);
|
await this.domtools.convenience.smartdelay.delayFor(350);
|
||||||
this.shadowRoot!.querySelector('.step.entrance')?.classList.remove('entrance');
|
this.shadowRoot!.querySelector('.step.entrance')?.classList.remove('entrance');
|
||||||
}
|
}
|
||||||
|
|
||||||
public async updated() {
|
public async updated(changedProperties: Map<string | number | symbol, unknown>) {
|
||||||
this.setScrollStatus();
|
if (!changedProperties.has('selectedStep') && !changedProperties.has('steps')) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
await this.setScrollStatus();
|
||||||
}
|
}
|
||||||
|
|
||||||
public scroller!: typeof domtools.plugins.SweetScroll.prototype;
|
public scroller!: typeof domtools.plugins.SweetScroll.prototype;
|
||||||
|
|
||||||
public async setScrollStatus() {
|
public async setScrollStatus() {
|
||||||
const stepperContainer = this.shadowRoot!.querySelector('.stepperContainer') as HTMLElement;
|
const stepperContainer = this.shadowRoot!.querySelector('.stepperContainer') as HTMLElement;
|
||||||
const firstStepElement = this.shadowRoot!.querySelector('.step') as HTMLElement;
|
|
||||||
const selectedStepElement = this.shadowRoot!.querySelector('.selected') as HTMLElement;
|
const selectedStepElement = this.shadowRoot!.querySelector('.selected') as HTMLElement;
|
||||||
if (!selectedStepElement) {
|
if (!selectedStepElement) {
|
||||||
return;
|
return;
|
||||||
@@ -452,14 +497,11 @@ export class DeesStepper extends DeesElement {
|
|||||||
stepperContainer.offsetHeight / 2 - selectedStepElement.offsetHeight / 2
|
stepperContainer.offsetHeight / 2 - selectedStepElement.offsetHeight / 2
|
||||||
}px`;
|
}px`;
|
||||||
}
|
}
|
||||||
console.log('Setting scroll status');
|
|
||||||
console.log(selectedStepElement);
|
|
||||||
const scrollPosition =
|
const scrollPosition =
|
||||||
selectedStepElement.offsetTop -
|
selectedStepElement.offsetTop -
|
||||||
stepperContainer.offsetHeight / 2 +
|
stepperContainer.offsetHeight / 2 +
|
||||||
selectedStepElement.offsetHeight / 2;
|
selectedStepElement.offsetHeight / 2;
|
||||||
console.log(scrollPosition);
|
await domtools.DomTools.setupDomTools();
|
||||||
const domtoolsInstance = await domtools.DomTools.setupDomTools();
|
|
||||||
if (!this.scroller) {
|
if (!this.scroller) {
|
||||||
this.scroller = new domtools.plugins.SweetScroll(
|
this.scroller = new domtools.plugins.SweetScroll(
|
||||||
{
|
{
|
||||||
@@ -474,7 +516,11 @@ export class DeesStepper extends DeesElement {
|
|||||||
if (!this.selectedStep.validationFuncCalled && this.selectedStep.validationFunc) {
|
if (!this.selectedStep.validationFuncCalled && this.selectedStep.validationFunc) {
|
||||||
this.selectedStep.abortController = new AbortController();
|
this.selectedStep.abortController = new AbortController();
|
||||||
this.selectedStep.validationFuncCalled = true;
|
this.selectedStep.validationFuncCalled = true;
|
||||||
await this.selectedStep.validationFunc(this, selectedStepElement, this.selectedStep.abortController.signal);
|
void this.runStepValidation(
|
||||||
|
this.selectedStep,
|
||||||
|
selectedStepElement,
|
||||||
|
this.selectedStep.abortController.signal,
|
||||||
|
);
|
||||||
}
|
}
|
||||||
this.scroller.to(scrollPosition);
|
this.scroller.to(scrollPosition);
|
||||||
}
|
}
|
||||||
@@ -492,6 +538,7 @@ export class DeesStepper extends DeesElement {
|
|||||||
currentStep.validationFuncCalled = false;
|
currentStep.validationFuncCalled = false;
|
||||||
const previousStep = this.steps[currentIndex - 1];
|
const previousStep = this.steps[currentIndex - 1];
|
||||||
previousStep.validationFuncCalled = false;
|
previousStep.validationFuncCalled = false;
|
||||||
|
this.prepareStepForActivation(previousStep);
|
||||||
this.selectedStep = previousStep;
|
this.selectedStep = previousStep;
|
||||||
await this.domtoolsPromise;
|
await this.domtoolsPromise;
|
||||||
await this.domtools.convenience.smartdelay.delayFor(100);
|
await this.domtools.convenience.smartdelay.delayFor(100);
|
||||||
@@ -511,9 +558,52 @@ export class DeesStepper extends DeesElement {
|
|||||||
currentStep.validationFuncCalled = false;
|
currentStep.validationFuncCalled = false;
|
||||||
const nextStep = this.steps[currentIndex + 1];
|
const nextStep = this.steps[currentIndex + 1];
|
||||||
nextStep.validationFuncCalled = false;
|
nextStep.validationFuncCalled = false;
|
||||||
|
this.prepareStepForActivation(nextStep);
|
||||||
this.selectedStep = nextStep;
|
this.selectedStep = nextStep;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
public resetProgressStep(stepArg: IStep = this.selectedStep) {
|
||||||
|
if (!stepArg?.progressStep) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
stepArg.progressStepState = this.createInitialProgressStepState(stepArg);
|
||||||
|
this.requestUpdate();
|
||||||
|
}
|
||||||
|
|
||||||
|
public updateProgressStep(
|
||||||
|
progressStateArg: Partial<IStepProgressState>,
|
||||||
|
stepArg: IStep = this.selectedStep,
|
||||||
|
) {
|
||||||
|
if (!stepArg?.progressStep) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
const currentProgressState = this.getProgressStepState(stepArg);
|
||||||
|
stepArg.progressStepState = {
|
||||||
|
...currentProgressState,
|
||||||
|
...progressStateArg,
|
||||||
|
terminalLines: progressStateArg.terminalLines
|
||||||
|
? [...progressStateArg.terminalLines]
|
||||||
|
: [...(currentProgressState.terminalLines ?? [])],
|
||||||
|
};
|
||||||
|
this.requestUpdate();
|
||||||
|
}
|
||||||
|
|
||||||
|
public appendProgressStepLine(lineArg: string, stepArg: IStep = this.selectedStep) {
|
||||||
|
if (!stepArg?.progressStep) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
const currentProgressState = this.getProgressStepState(stepArg);
|
||||||
|
this.updateProgressStep(
|
||||||
|
{
|
||||||
|
terminalLines: [...(currentProgressState.terminalLines ?? []), lineArg],
|
||||||
|
},
|
||||||
|
stepArg,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Scans the currently selected step for a <dees-form> in its content. When
|
* Scans the currently selected step for a <dees-form> in its content. When
|
||||||
* found, subscribes to the form's RxJS changeSubject so the primary
|
* found, subscribes to the form's RxJS changeSubject so the primary
|
||||||
@@ -582,6 +672,74 @@ export class DeesStepper extends DeesElement {
|
|||||||
await optionArg.action(this);
|
await optionArg.action(this);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
private getProgressStepState(stepArg: IStep): IStepProgressState {
|
||||||
|
if (!stepArg.progressStep) {
|
||||||
|
return {};
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!stepArg.progressStepState) {
|
||||||
|
stepArg.progressStepState = this.createInitialProgressStepState(stepArg);
|
||||||
|
}
|
||||||
|
|
||||||
|
return stepArg.progressStepState;
|
||||||
|
}
|
||||||
|
|
||||||
|
private createInitialProgressStepState(stepArg: IStep): IStepProgressState {
|
||||||
|
return {
|
||||||
|
label: stepArg.progressStep?.label ?? stepArg.title,
|
||||||
|
percentage: stepArg.progressStep?.percentage ?? 0,
|
||||||
|
indeterminate: stepArg.progressStep?.indeterminate ?? false,
|
||||||
|
showPercentage: stepArg.progressStep?.showPercentage ?? true,
|
||||||
|
statusText: stepArg.progressStep?.statusText ?? '',
|
||||||
|
terminalLines: [...(stepArg.progressStep?.terminalLines ?? [])],
|
||||||
|
statusRows: stepArg.progressStep?.statusRows ?? 3,
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
private prepareStepForActivation(stepArg?: IStep) {
|
||||||
|
if (!stepArg?.progressStep) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
stepArg.progressStepState = this.createInitialProgressStepState(stepArg);
|
||||||
|
}
|
||||||
|
|
||||||
|
private async runStepValidation(
|
||||||
|
stepArg: IStep,
|
||||||
|
selectedStepElement: HTMLElement,
|
||||||
|
signal: AbortSignal,
|
||||||
|
): Promise<void> {
|
||||||
|
try {
|
||||||
|
await stepArg.validationFunc?.(this, selectedStepElement, signal);
|
||||||
|
|
||||||
|
if (signal.aborted) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (stepArg.progressStep && stepArg.progressStep.autoAdvance !== false && this.selectedStep === stepArg) {
|
||||||
|
this.goNext();
|
||||||
|
}
|
||||||
|
} catch (error) {
|
||||||
|
if (signal.aborted) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (stepArg.progressStep) {
|
||||||
|
const errorText = error instanceof Error ? error.message : 'Unexpected error';
|
||||||
|
this.appendProgressStepLine(`Error: ${errorText}`, stepArg);
|
||||||
|
this.updateProgressStep(
|
||||||
|
{
|
||||||
|
indeterminate: false,
|
||||||
|
statusText: errorText,
|
||||||
|
},
|
||||||
|
stepArg,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
console.error(error);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Currently-open confirmation modal (if any). Prevents double-stacking when
|
* Currently-open confirmation modal (if any). Prevents double-stacking when
|
||||||
* the user clicks the backdrop or the Cancel button while a confirm modal
|
* the user clicks the backdrop or the Cancel button while a confirm modal
|
||||||
@@ -657,6 +815,9 @@ export class DeesStepper extends DeesElement {
|
|||||||
public async destroy() {
|
public async destroy() {
|
||||||
const domtools = await this.domtoolsPromise;
|
const domtools = await this.domtoolsPromise;
|
||||||
const container = this.shadowRoot!.querySelector('.stepperContainer');
|
const container = this.shadowRoot!.querySelector('.stepperContainer');
|
||||||
|
if (this.selectedStep?.abortController) {
|
||||||
|
this.selectedStep.abortController.abort();
|
||||||
|
}
|
||||||
container?.classList.add('predestroy');
|
container?.classList.add('predestroy');
|
||||||
await domtools.convenience.smartdelay.delayFor(250);
|
await domtools.convenience.smartdelay.delayFor(250);
|
||||||
if (this.parentElement) {
|
if (this.parentElement) {
|
||||||
|
|||||||
@@ -45,6 +45,9 @@ export class DeesTile extends DeesElement {
|
|||||||
@property({ type: String })
|
@property({ type: String })
|
||||||
accessor heading: string = '';
|
accessor heading: string = '';
|
||||||
|
|
||||||
|
@property({ type: String, reflect: true })
|
||||||
|
accessor overscroll: 'contain' | 'auto' | 'none' = 'auto';
|
||||||
|
|
||||||
@state()
|
@state()
|
||||||
accessor hasFooter: boolean = false;
|
accessor hasFooter: boolean = false;
|
||||||
|
|
||||||
@@ -102,11 +105,14 @@ export class DeesTile extends DeesElement {
|
|||||||
border-bottom: 1px solid var(--dees-color-border-subtle);
|
border-bottom: 1px solid var(--dees-color-border-subtle);
|
||||||
overflow-x: hidden;
|
overflow-x: hidden;
|
||||||
overflow-y: auto;
|
overflow-y: auto;
|
||||||
overscroll-behavior: contain;
|
|
||||||
scrollbar-width: thin;
|
scrollbar-width: thin;
|
||||||
scrollbar-color: var(--dees-color-scrollbar-thumb) transparent;
|
scrollbar-color: var(--dees-color-scrollbar-thumb) transparent;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
:host([overscroll="contain"]) .tile-content {
|
||||||
|
overscroll-behavior: contain;
|
||||||
|
}
|
||||||
|
|
||||||
.tile-content.no-footer {
|
.tile-content.no-footer {
|
||||||
border-bottom: none;
|
border-bottom: none;
|
||||||
border-bottom-left-radius: 0;
|
border-bottom-left-radius: 0;
|
||||||
|
|||||||
@@ -5,5 +5,6 @@ export * from './dees-heading/index.js';
|
|||||||
export * from './dees-label/index.js';
|
export * from './dees-label/index.js';
|
||||||
export * from './dees-pagination/index.js';
|
export * from './dees-pagination/index.js';
|
||||||
export * from './dees-panel/index.js';
|
export * from './dees-panel/index.js';
|
||||||
|
export * from './dees-settings/index.js';
|
||||||
export * from './dees-stepper/index.js';
|
export * from './dees-stepper/index.js';
|
||||||
export * from './dees-tile/index.js';
|
export * from './dees-tile/index.js';
|
||||||
|
|||||||
@@ -343,7 +343,7 @@ export class DeesModal extends DeesElement {
|
|||||||
${minWidthStyle ? `dees-tile { min-width: ${minWidthStyle}; }` : ''}
|
${minWidthStyle ? `dees-tile { min-width: ${minWidthStyle}; }` : ''}
|
||||||
</style>
|
</style>
|
||||||
<div class="modalContainer" @click=${this.handleOutsideClick} style="z-index: ${this.modalZIndex}">
|
<div class="modalContainer" @click=${this.handleOutsideClick} style="z-index: ${this.modalZIndex}">
|
||||||
<dees-tile class="${widthClass} ${mobileFullscreenClass}">
|
<dees-tile class="${widthClass} ${mobileFullscreenClass}" .overscroll=${'contain'}>
|
||||||
<div slot="header" class="heading">
|
<div slot="header" class="heading">
|
||||||
<div class="heading-text">${this.heading}</div>
|
<div class="heading-text">${this.heading}</div>
|
||||||
<div class="header-buttons">
|
<div class="header-buttons">
|
||||||
|
|||||||
@@ -10,6 +10,7 @@ import {
|
|||||||
css,
|
css,
|
||||||
} from '@design.estate/dees-element';
|
} from '@design.estate/dees-element';
|
||||||
import { themeDefaultStyles } from '../../00theme.js';
|
import { themeDefaultStyles } from '../../00theme.js';
|
||||||
|
import '../../00group-layout/dees-tile/dees-tile.js';
|
||||||
|
|
||||||
declare global {
|
declare global {
|
||||||
interface HTMLElementTagNameMap {
|
interface HTMLElementTagNameMap {
|
||||||
@@ -90,24 +91,25 @@ export class DeesSimpleLogin extends DeesElement {
|
|||||||
color: var(--dees-color-text-muted);
|
color: var(--dees-color-text-muted);
|
||||||
}
|
}
|
||||||
|
|
||||||
.login-card {
|
dees-tile {
|
||||||
background: var(--dees-color-bg-primary);
|
width: 100%;
|
||||||
border: 1px solid var(--dees-color-border-default);
|
}
|
||||||
border-radius: 8px;
|
|
||||||
|
dees-tile::part(content) {
|
||||||
padding: 24px;
|
padding: 24px;
|
||||||
}
|
}
|
||||||
|
|
||||||
.login-card dees-form {
|
dees-tile dees-form {
|
||||||
display: flex;
|
display: flex;
|
||||||
flex-direction: column;
|
flex-direction: column;
|
||||||
gap: 16px;
|
gap: 16px;
|
||||||
}
|
}
|
||||||
|
|
||||||
.login-card dees-input-text {
|
dees-tile dees-input-text {
|
||||||
width: 100%;
|
width: 100%;
|
||||||
}
|
}
|
||||||
|
|
||||||
.login-card dees-form-submit {
|
dees-tile dees-form-submit {
|
||||||
margin-top: 8px;
|
margin-top: 8px;
|
||||||
width: 100%;
|
width: 100%;
|
||||||
}
|
}
|
||||||
@@ -122,13 +124,13 @@ export class DeesSimpleLogin extends DeesElement {
|
|||||||
<div class="header">Sign in</div>
|
<div class="header">Sign in</div>
|
||||||
<div class="subheader">Enter your credentials to access ${this.name}</div>
|
<div class="subheader">Enter your credentials to access ${this.name}</div>
|
||||||
</div>
|
</div>
|
||||||
<div class="login-card">
|
<dees-tile .heading=${'Credentials'}>
|
||||||
<dees-form>
|
<dees-form>
|
||||||
<dees-input-text key="username" label="Username" required></dees-input-text>
|
<dees-input-text key="username" label="Username" required></dees-input-text>
|
||||||
<dees-input-text key="password" label="Password" isPasswordBool required></dees-input-text>
|
<dees-input-text key="password" label="Password" isPasswordBool required></dees-input-text>
|
||||||
<dees-form-submit>Sign in</dees-form-submit>
|
<dees-form-submit>Sign in</dees-form-submit>
|
||||||
</dees-form>
|
</dees-form>
|
||||||
</div>
|
</dees-tile>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
<div class="slotContainer">
|
<div class="slotContainer">
|
||||||
|
|||||||
@@ -2,9 +2,73 @@ import { html } from '@design.estate/dees-element';
|
|||||||
|
|
||||||
import { DeesUpdater } from '../dees-updater/dees-updater.js';
|
import { DeesUpdater } from '../dees-updater/dees-updater.js';
|
||||||
|
|
||||||
export const demoFunc = async () => {
|
const waitForDemoStep = async (timeoutArg: number): Promise<void> => {
|
||||||
const updater = await DeesUpdater.createAndShow();
|
await new Promise<void>((resolve) => {
|
||||||
setTimeout(async () => {
|
window.setTimeout(() => resolve(), timeoutArg);
|
||||||
await updater.destroy();
|
});
|
||||||
}, 10000);
|
};
|
||||||
}
|
|
||||||
|
export const demoFunc = () => {
|
||||||
|
let updaterRunning = false;
|
||||||
|
|
||||||
|
return html`
|
||||||
|
<div style="display: grid; gap: 16px; place-items: center; padding: 32px; text-align: center;">
|
||||||
|
<p style="margin: 0; max-width: 540px; line-height: 1.6; color: var(--dees-color-text-secondary);">
|
||||||
|
Launches the updater as a stepper flow. The first step streams terminal-style
|
||||||
|
progress updates and then moves automatically to the ready step.
|
||||||
|
</p>
|
||||||
|
<dees-button
|
||||||
|
@click=${async () => {
|
||||||
|
if (updaterRunning) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
updaterRunning = true;
|
||||||
|
|
||||||
|
try {
|
||||||
|
const updater = await DeesUpdater.createAndShow({
|
||||||
|
currentVersion: '3.79.0',
|
||||||
|
updatedVersion: '3.80.0',
|
||||||
|
moreInfoUrl: 'https://code.foss.global/design.estate/dees-catalog',
|
||||||
|
changelogUrl: 'https://code.foss.global/design.estate/dees-catalog/-/blob/main/changelog.md',
|
||||||
|
successAction: 'close',
|
||||||
|
successDelayMs: 10000,
|
||||||
|
});
|
||||||
|
|
||||||
|
const progressFrames = [
|
||||||
|
{ line: 'Checking release manifest', percentage: 12, delay: 550 },
|
||||||
|
{ line: 'Downloading signed bundle', percentage: 33, delay: 700 },
|
||||||
|
{ line: 'Verifying checksum', percentage: 51, delay: 650 },
|
||||||
|
{ line: 'Applying update files', percentage: 74, delay: 800 },
|
||||||
|
{ line: 'Cleaning up previous release', percentage: 91, delay: 600 },
|
||||||
|
];
|
||||||
|
|
||||||
|
updater.updateProgress({
|
||||||
|
statusText: 'Checking release manifest...',
|
||||||
|
terminalLines: ['Checking release manifest'],
|
||||||
|
percentage: 12,
|
||||||
|
indeterminate: true,
|
||||||
|
});
|
||||||
|
|
||||||
|
for (const [index, progressFrame] of progressFrames.entries()) {
|
||||||
|
if (index > 0) {
|
||||||
|
updater.appendProgressLine(progressFrame.line);
|
||||||
|
updater.updateProgress({
|
||||||
|
percentage: progressFrame.percentage,
|
||||||
|
statusText: `${progressFrame.line}...`,
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
await waitForDemoStep(progressFrame.delay);
|
||||||
|
}
|
||||||
|
|
||||||
|
await updater.markUpdateReady();
|
||||||
|
await waitForDemoStep(10500);
|
||||||
|
} finally {
|
||||||
|
updaterRunning = false;
|
||||||
|
}
|
||||||
|
}}
|
||||||
|
>Show updater flow</dees-button>
|
||||||
|
</div>
|
||||||
|
`;
|
||||||
|
};
|
||||||
|
|||||||
@@ -4,14 +4,27 @@ import {
|
|||||||
type TemplateResult,
|
type TemplateResult,
|
||||||
html,
|
html,
|
||||||
property,
|
property,
|
||||||
type CSSResult,
|
css,
|
||||||
domtools,
|
|
||||||
} from '@design.estate/dees-element';
|
} from '@design.estate/dees-element';
|
||||||
import { demoFunc } from './dees-updater.demo.js';
|
import { demoFunc } from './dees-updater.demo.js';
|
||||||
|
import {
|
||||||
|
DeesStepper,
|
||||||
|
type IStep,
|
||||||
|
type IStepProgressState,
|
||||||
|
} from '../../00group-layout/dees-stepper/dees-stepper.js';
|
||||||
|
|
||||||
import '../../00group-overlay/dees-windowlayer/dees-windowlayer.js';
|
export type TDeesUpdaterSuccessAction = 'close' | 'reload';
|
||||||
import { css, cssManager } from '@design.estate/dees-element';
|
|
||||||
import { themeDefaultStyles } from '../../00theme.js';
|
export interface IDeesUpdaterOptions {
|
||||||
|
currentVersion?: string;
|
||||||
|
updatedVersion?: string;
|
||||||
|
moreInfoUrl?: string;
|
||||||
|
changelogUrl?: string;
|
||||||
|
successAction?: TDeesUpdaterSuccessAction;
|
||||||
|
successDelayMs?: number;
|
||||||
|
successActionLabel?: string;
|
||||||
|
onSuccessAction?: () => Promise<void> | void;
|
||||||
|
}
|
||||||
|
|
||||||
declare global {
|
declare global {
|
||||||
interface HTMLElementTagNameMap {
|
interface HTMLElementTagNameMap {
|
||||||
@@ -24,91 +37,393 @@ export class DeesUpdater extends DeesElement {
|
|||||||
public static demo = demoFunc;
|
public static demo = demoFunc;
|
||||||
public static demoGroups = ['Utility'];
|
public static demoGroups = ['Utility'];
|
||||||
|
|
||||||
public static async createAndShow() {
|
public static async createAndShow(optionsArg: IDeesUpdaterOptions = {}) {
|
||||||
const updater = new DeesUpdater();
|
const updater = new DeesUpdater();
|
||||||
|
updater.currentVersion = optionsArg.currentVersion ?? '';
|
||||||
|
updater.updatedVersion = optionsArg.updatedVersion ?? '';
|
||||||
|
updater.moreInfoUrl = optionsArg.moreInfoUrl ?? '';
|
||||||
|
updater.changelogUrl = optionsArg.changelogUrl ?? '';
|
||||||
|
updater.successAction = optionsArg.successAction ?? 'close';
|
||||||
|
updater.successDelayMs = optionsArg.successDelayMs ?? 10000;
|
||||||
|
updater.successActionLabel = optionsArg.successActionLabel ?? '';
|
||||||
|
updater.onSuccessAction = optionsArg.onSuccessAction ?? null;
|
||||||
document.body.appendChild(updater);
|
document.body.appendChild(updater);
|
||||||
|
await updater.show();
|
||||||
return updater;
|
return updater;
|
||||||
}
|
}
|
||||||
|
|
||||||
@property({
|
@property({
|
||||||
type: String,
|
type: String,
|
||||||
})
|
})
|
||||||
accessor currentVersion!: string;
|
accessor currentVersion = '';
|
||||||
|
|
||||||
@property({
|
@property({
|
||||||
type: String,
|
type: String,
|
||||||
})
|
})
|
||||||
accessor updatedVersion!: string;
|
accessor updatedVersion = '';
|
||||||
|
|
||||||
constructor() {
|
@property({
|
||||||
super();
|
type: String,
|
||||||
domtools.elementBasic.setup();
|
})
|
||||||
}
|
accessor moreInfoUrl = '';
|
||||||
|
|
||||||
|
@property({
|
||||||
|
type: String,
|
||||||
|
})
|
||||||
|
accessor changelogUrl = '';
|
||||||
|
|
||||||
|
@property({
|
||||||
|
type: String,
|
||||||
|
})
|
||||||
|
accessor successAction: TDeesUpdaterSuccessAction = 'close';
|
||||||
|
|
||||||
|
@property({
|
||||||
|
type: Number,
|
||||||
|
})
|
||||||
|
accessor successDelayMs = 10000;
|
||||||
|
|
||||||
|
@property({
|
||||||
|
type: String,
|
||||||
|
})
|
||||||
|
accessor successActionLabel = '';
|
||||||
|
|
||||||
|
private stepper: DeesStepper | null = null;
|
||||||
|
private progressStep: IStep | null = null;
|
||||||
|
private showPromise: Promise<void> | null = null;
|
||||||
|
private onSuccessAction: (() => Promise<void> | void) | null = null;
|
||||||
|
|
||||||
public static styles = [
|
public static styles = [
|
||||||
themeDefaultStyles,
|
|
||||||
cssManager.defaultStyles,
|
|
||||||
css`
|
css`
|
||||||
/* TODO: Migrate hardcoded values to --dees-* CSS variables */
|
:host {
|
||||||
.modalContainer {
|
display: none;
|
||||||
will-change: transform;
|
|
||||||
position: relative;
|
|
||||||
background: ${cssManager.bdTheme('#eeeeeb', '#222')};
|
|
||||||
max-width: 800px;
|
|
||||||
border-radius: 8px;
|
|
||||||
border-top: 1px solid ${cssManager.bdTheme('#eeeeeb', '#333')};
|
|
||||||
}
|
|
||||||
|
|
||||||
.headingContainer {
|
|
||||||
display: flex;
|
|
||||||
justify-content: center;
|
|
||||||
align-items: center;
|
|
||||||
padding: 40px 40px;
|
|
||||||
}
|
|
||||||
|
|
||||||
h1 {
|
|
||||||
margin: none;
|
|
||||||
font-size: 20px;
|
|
||||||
color: ${cssManager.bdTheme('#333', '#fff')};
|
|
||||||
margin-left: 20px;
|
|
||||||
font-weight: normal;
|
|
||||||
}
|
|
||||||
|
|
||||||
.buttonContainer {
|
|
||||||
display: grid;
|
|
||||||
grid-template-columns: 50% 50%;
|
|
||||||
}
|
}
|
||||||
`,
|
`,
|
||||||
];
|
];
|
||||||
|
|
||||||
public render(): TemplateResult {
|
public render(): TemplateResult {
|
||||||
return html`
|
return html``;
|
||||||
<dees-windowlayer
|
}
|
||||||
@clicked="${this.windowLayerClicked}"
|
|
||||||
.options=${{
|
public async connectedCallback(): Promise<void> {
|
||||||
blur: true,
|
await super.connectedCallback();
|
||||||
}}
|
void this.show();
|
||||||
>
|
}
|
||||||
<div class="modalContainer">
|
|
||||||
<div class="headingContainer">
|
public async show(): Promise<void> {
|
||||||
<dees-spinner .size=${60}></dees-spinner>
|
if (this.stepper?.isConnected) {
|
||||||
<h1>Updating the application...</h1>
|
return;
|
||||||
</div>
|
}
|
||||||
<div class="progress">
|
|
||||||
<dees-progressbar .progress=${0.5}></dees-progressbar>
|
if (this.showPromise) {
|
||||||
</div>
|
return this.showPromise;
|
||||||
<div class="buttonContainer">
|
}
|
||||||
<dees-button>More info</dees-button>
|
|
||||||
<dees-button>Changelog</dees-button>
|
this.showPromise = this.openStepperFlow();
|
||||||
</div>
|
|
||||||
</div> </dees-windowlayer
|
try {
|
||||||
>>
|
await this.showPromise;
|
||||||
`;
|
} finally {
|
||||||
|
this.showPromise = null;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public updateProgress(progressStateArg: Partial<IStepProgressState>) {
|
||||||
|
if (!this.stepper || !this.progressStep) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
this.stepper.updateProgressStep(progressStateArg, this.progressStep);
|
||||||
|
}
|
||||||
|
|
||||||
|
public appendProgressLine(lineArg: string) {
|
||||||
|
if (!this.stepper || !this.progressStep) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
this.stepper.appendProgressStepLine(lineArg, this.progressStep);
|
||||||
|
}
|
||||||
|
|
||||||
|
public markUpdateError(messageArg: string) {
|
||||||
|
this.appendProgressLine(`Error: ${messageArg}`);
|
||||||
|
this.updateProgress({
|
||||||
|
indeterminate: false,
|
||||||
|
statusText: messageArg,
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
public async markUpdateReady() {
|
||||||
|
if (!this.stepper || !this.progressStep) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
this.stepper.updateProgressStep(
|
||||||
|
{
|
||||||
|
percentage: 100,
|
||||||
|
indeterminate: false,
|
||||||
|
statusText: 'Update ready.',
|
||||||
|
},
|
||||||
|
this.progressStep,
|
||||||
|
);
|
||||||
|
this.stepper.appendProgressStepLine('Update ready', this.progressStep);
|
||||||
|
|
||||||
|
if (this.stepper.selectedStep === this.progressStep) {
|
||||||
|
this.stepper.goNext();
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
public async destroy() {
|
public async destroy() {
|
||||||
this.parentElement!.removeChild(this);
|
const stepper = this.stepper;
|
||||||
|
this.stepper = null;
|
||||||
|
this.progressStep = null;
|
||||||
|
|
||||||
|
if (stepper?.isConnected) {
|
||||||
|
await stepper.destroy();
|
||||||
|
}
|
||||||
|
|
||||||
|
if (this.parentElement) {
|
||||||
|
this.parentElement.removeChild(this);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
private windowLayerClicked() {}
|
private async openStepperFlow() {
|
||||||
|
const { steps, progressStep } = this.createUpdaterSteps();
|
||||||
|
this.progressStep = progressStep;
|
||||||
|
this.stepper = await DeesStepper.createAndShow({
|
||||||
|
steps,
|
||||||
|
cancelable: false,
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
private createUpdaterSteps(): { steps: IStep[]; progressStep: IStep } {
|
||||||
|
const infoMenuOptions = this.getLinkMenuOptions();
|
||||||
|
const progressStep: IStep = {
|
||||||
|
title: 'Updating the application',
|
||||||
|
content: this.renderProgressContent(),
|
||||||
|
progressStep: {
|
||||||
|
label: this.getProgressLabel(),
|
||||||
|
percentage: 5,
|
||||||
|
indeterminate: true,
|
||||||
|
statusRows: 4,
|
||||||
|
statusText: 'Preparing update...',
|
||||||
|
terminalLines: ['Preparing update'],
|
||||||
|
},
|
||||||
|
menuOptions: infoMenuOptions.length > 0 ? infoMenuOptions : undefined,
|
||||||
|
};
|
||||||
|
|
||||||
|
const readyStep: IStep = {
|
||||||
|
title: this.updatedVersion ? `Version ${this.updatedVersion} ready` : 'Update ready',
|
||||||
|
content: this.renderReadyContent(),
|
||||||
|
progressStep: {
|
||||||
|
label: this.getSuccessCountdownLabel(this.getSuccessDelaySeconds()),
|
||||||
|
percentage: 0,
|
||||||
|
indeterminate: false,
|
||||||
|
showPercentage: false,
|
||||||
|
statusRows: 2,
|
||||||
|
statusText: this.getSuccessCountdownStatus(this.getSuccessDelaySeconds()),
|
||||||
|
},
|
||||||
|
validationFunc: async (stepper, _htmlElement, signal) => {
|
||||||
|
await this.runSuccessCountdown(stepper, readyStep, signal);
|
||||||
|
},
|
||||||
|
};
|
||||||
|
|
||||||
|
return {
|
||||||
|
steps: [progressStep, readyStep],
|
||||||
|
progressStep,
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
private getProgressLabel(): string {
|
||||||
|
if (this.currentVersion && this.updatedVersion) {
|
||||||
|
return `${this.currentVersion} -> ${this.updatedVersion}`;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (this.updatedVersion) {
|
||||||
|
return `Preparing ${this.updatedVersion}`;
|
||||||
|
}
|
||||||
|
|
||||||
|
return 'Application update';
|
||||||
|
}
|
||||||
|
|
||||||
|
private getSuccessDelaySeconds(): number {
|
||||||
|
return Math.max(1, Math.ceil(this.successDelayMs / 1000));
|
||||||
|
}
|
||||||
|
|
||||||
|
private getSuccessActionDisplayLabel(): string {
|
||||||
|
if (this.successActionLabel) {
|
||||||
|
return this.successActionLabel;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (this.onSuccessAction) {
|
||||||
|
return 'Continuing automatically';
|
||||||
|
}
|
||||||
|
|
||||||
|
if (this.successAction === 'reload') {
|
||||||
|
return 'Reloading application';
|
||||||
|
}
|
||||||
|
|
||||||
|
return 'Closing updater';
|
||||||
|
}
|
||||||
|
|
||||||
|
private getSuccessCountdownLabel(secondsArg: number): string {
|
||||||
|
return `${this.getSuccessActionDisplayLabel()} in ${secondsArg}s`;
|
||||||
|
}
|
||||||
|
|
||||||
|
private getSuccessCountdownStatus(secondsArg: number): string {
|
||||||
|
const secondLabel = secondsArg === 1 ? 'second' : 'seconds';
|
||||||
|
return `${this.getSuccessActionDisplayLabel()} in ${secondsArg} ${secondLabel}.`;
|
||||||
|
}
|
||||||
|
|
||||||
|
private getSuccessActionNowLabel(): string {
|
||||||
|
return `${this.getSuccessActionDisplayLabel()} now...`;
|
||||||
|
}
|
||||||
|
|
||||||
|
private getLinkMenuOptions() {
|
||||||
|
const menuOptions: Array<{ name: string; action: () => Promise<void> }> = [];
|
||||||
|
|
||||||
|
if (this.moreInfoUrl) {
|
||||||
|
menuOptions.push({
|
||||||
|
name: 'More info',
|
||||||
|
action: async () => {
|
||||||
|
this.openExternalUrl(this.moreInfoUrl);
|
||||||
|
},
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
if (this.changelogUrl) {
|
||||||
|
menuOptions.push({
|
||||||
|
name: 'Changelog',
|
||||||
|
action: async () => {
|
||||||
|
this.openExternalUrl(this.changelogUrl);
|
||||||
|
},
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
return menuOptions;
|
||||||
|
}
|
||||||
|
|
||||||
|
private renderProgressContent(): TemplateResult {
|
||||||
|
return html`
|
||||||
|
<div style="display: grid; gap: 12px; color: var(--dees-color-text-secondary); line-height: 1.6;">
|
||||||
|
<p style="margin: 0; text-align: center;">
|
||||||
|
Downloading and applying the latest application release.
|
||||||
|
${this.currentVersion && this.updatedVersion
|
||||||
|
? html`Moving from <strong>${this.currentVersion}</strong> to <strong>${this.updatedVersion}</strong>.`
|
||||||
|
: this.updatedVersion
|
||||||
|
? html`Preparing <strong>${this.updatedVersion}</strong>.`
|
||||||
|
: ''}
|
||||||
|
</p>
|
||||||
|
<p style="margin: 0; text-align: center; font-size: 13px; color: var(--dees-color-text-muted);">
|
||||||
|
The updater advances automatically once the new build is installed and verified.
|
||||||
|
</p>
|
||||||
|
</div>
|
||||||
|
`;
|
||||||
|
}
|
||||||
|
|
||||||
|
private renderReadyContent(): TemplateResult {
|
||||||
|
const successDelaySeconds = this.getSuccessDelaySeconds();
|
||||||
|
|
||||||
|
return html`
|
||||||
|
<div style="display: grid; gap: 12px; color: var(--dees-color-text-secondary); line-height: 1.6;">
|
||||||
|
<p style="margin: 0; text-align: center;">
|
||||||
|
${this.updatedVersion
|
||||||
|
? html`Version <strong>${this.updatedVersion}</strong> is ready to use.`
|
||||||
|
: 'The new version is ready to use.'}
|
||||||
|
</p>
|
||||||
|
<p style="margin: 0; text-align: center; font-size: 13px; color: var(--dees-color-text-muted);">
|
||||||
|
Configured next action: ${this.getSuccessActionDisplayLabel()}. It runs automatically in ${successDelaySeconds} seconds.
|
||||||
|
</p>
|
||||||
|
</div>
|
||||||
|
`;
|
||||||
|
}
|
||||||
|
|
||||||
|
private async runSuccessCountdown(
|
||||||
|
stepperArg: DeesStepper,
|
||||||
|
stepArg: IStep,
|
||||||
|
signal?: AbortSignal,
|
||||||
|
): Promise<void> {
|
||||||
|
const totalDuration = Math.max(1000, this.successDelayMs);
|
||||||
|
const startTime = Date.now();
|
||||||
|
|
||||||
|
while (!signal?.aborted) {
|
||||||
|
const elapsed = Math.min(totalDuration, Date.now() - startTime);
|
||||||
|
const remainingMilliseconds = Math.max(0, totalDuration - elapsed);
|
||||||
|
const remainingSeconds = Math.max(0, Math.ceil(remainingMilliseconds / 1000));
|
||||||
|
|
||||||
|
stepperArg.updateProgressStep(
|
||||||
|
{
|
||||||
|
label: remainingMilliseconds > 0
|
||||||
|
? this.getSuccessCountdownLabel(remainingSeconds)
|
||||||
|
: this.getSuccessActionNowLabel(),
|
||||||
|
percentage: (elapsed / totalDuration) * 100,
|
||||||
|
indeterminate: false,
|
||||||
|
showPercentage: false,
|
||||||
|
statusText: remainingMilliseconds > 0
|
||||||
|
? this.getSuccessCountdownStatus(remainingSeconds)
|
||||||
|
: this.getSuccessActionNowLabel(),
|
||||||
|
},
|
||||||
|
stepArg,
|
||||||
|
);
|
||||||
|
|
||||||
|
if (remainingMilliseconds <= 0) {
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
|
||||||
|
const completed = await this.waitForCountdownTick(100, signal);
|
||||||
|
if (!completed) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
await this.runConfiguredSuccessAction();
|
||||||
|
}
|
||||||
|
|
||||||
|
private async waitForCountdownTick(timeoutArg: number, signal?: AbortSignal): Promise<boolean> {
|
||||||
|
return new Promise((resolve) => {
|
||||||
|
let completed = false;
|
||||||
|
|
||||||
|
const finish = (result: boolean) => {
|
||||||
|
if (completed) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
completed = true;
|
||||||
|
if (signal) {
|
||||||
|
signal.removeEventListener('abort', handleAbort);
|
||||||
|
}
|
||||||
|
resolve(result);
|
||||||
|
};
|
||||||
|
|
||||||
|
const handleAbort = () => {
|
||||||
|
window.clearTimeout(timeoutId);
|
||||||
|
finish(false);
|
||||||
|
};
|
||||||
|
|
||||||
|
const timeoutId = window.setTimeout(() => {
|
||||||
|
finish(true);
|
||||||
|
}, timeoutArg);
|
||||||
|
|
||||||
|
if (signal) {
|
||||||
|
signal.addEventListener('abort', handleAbort, { once: true });
|
||||||
|
}
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
private async runConfiguredSuccessAction(): Promise<void> {
|
||||||
|
if (this.onSuccessAction) {
|
||||||
|
await this.onSuccessAction();
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (this.successAction === 'reload') {
|
||||||
|
await this.destroy();
|
||||||
|
window.location.reload();
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
await this.destroy();
|
||||||
|
}
|
||||||
|
|
||||||
|
private openExternalUrl(urlArg: string) {
|
||||||
|
window.open(urlArg, '_blank', 'noopener,noreferrer');
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
Reference in New Issue
Block a user