Compare commits
8 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
| 3f5cb4570b | |||
| 428d2741d1 | |||
| 2f4c47f0d2 | |||
| 2be1ce6908 | |||
| c0375508f0 | |||
| 3e86ba034b | |||
| 05e74cbe2e | |||
| 8fbdbf9f64 |
@@ -1,5 +1,34 @@
|
||||
# Changelog
|
||||
|
||||
## 2026-04-16 - 3.80.0 - feat(stepper,updater)
|
||||
add progress-aware stepper flows and updater countdown states
|
||||
|
||||
- extend dees-stepper with embedded progressbar rendering, progress state helpers, and automatic progression for async validation steps
|
||||
- rework dees-updater to run as a non-cancelable two-step flow with live progress updates, optional external links, and configurable close or reload completion actions
|
||||
- refresh stepper and updater demos plus documentation to showcase auto-advancing progress steps and ready-state countdown behavior
|
||||
|
||||
## 2026-04-16 - 3.79.0 - feat(dees-progressbar)
|
||||
add status panels, terminal output, and legacy progress input support
|
||||
|
||||
- Extend dees-progressbar with label, statusText, terminalLines, statusRows, indeterminate, and showPercentage properties.
|
||||
- Support legacy value input and normalized progress values while clamping and formatting percentages consistently.
|
||||
- Add fixed-height status and terminal-style output with spinner animation and auto-scroll behavior for live activity updates.
|
||||
- Refresh the progressbar demo and readme examples to showcase determinate, indeterminate, terminal, and compatibility usage patterns.
|
||||
|
||||
## 2026-04-14 - 3.78.3 - fix(dees-table)
|
||||
stabilize live updates by reusing row DOM and avoiding redundant layout recalculations
|
||||
|
||||
- reuse keyed table rows across live-sorted updates so existing row elements persist while cells reorder
|
||||
- limit flash animation restarts to changed cells by tracking per-cell flash tokens
|
||||
- avoid repeated column width measurements unless table layout inputs actually change
|
||||
- replace async header and footer action rendering with direct mapped output to prevent comment node growth during updates
|
||||
- add Chromium live update tests covering width measurement stability, comment growth, and row DOM reuse
|
||||
|
||||
## 2026-04-12 - 3.78.2 - fix(deps)
|
||||
bump @design.estate/dees-wcctools to ^3.9.0
|
||||
|
||||
- Updates the @design.estate/dees-wcctools dependency from ^3.8.4 to ^3.9.0 in package.json.
|
||||
|
||||
## 2026-04-12 - 3.78.1 - fix(dees-simple-login)
|
||||
use dees-tile for the login credentials container
|
||||
|
||||
|
||||
+2
-2
@@ -1,6 +1,6 @@
|
||||
{
|
||||
"name": "@design.estate/dees-catalog",
|
||||
"version": "3.78.1",
|
||||
"version": "3.80.0",
|
||||
"private": false,
|
||||
"description": "A comprehensive library that provides dynamic web components for building sophisticated and modern web applications using JavaScript and TypeScript.",
|
||||
"main": "dist_ts_web/index.js",
|
||||
@@ -18,7 +18,7 @@
|
||||
"dependencies": {
|
||||
"@design.estate/dees-domtools": "^2.5.4",
|
||||
"@design.estate/dees-element": "^2.2.4",
|
||||
"@design.estate/dees-wcctools": "^3.8.4",
|
||||
"@design.estate/dees-wcctools": "^3.9.0",
|
||||
"@fortawesome/fontawesome-svg-core": "^7.2.0",
|
||||
"@fortawesome/free-brands-svg-icons": "^7.2.0",
|
||||
"@fortawesome/free-regular-svg-icons": "^7.2.0",
|
||||
|
||||
Generated
+27
-6
@@ -15,8 +15,8 @@ importers:
|
||||
specifier: ^2.2.4
|
||||
version: 2.2.4
|
||||
'@design.estate/dees-wcctools':
|
||||
specifier: ^3.8.4
|
||||
version: 3.8.4
|
||||
specifier: ^3.9.0
|
||||
version: 3.9.0
|
||||
'@fortawesome/fontawesome-svg-core':
|
||||
specifier: ^7.2.0
|
||||
version: 7.2.0
|
||||
@@ -323,8 +323,8 @@ packages:
|
||||
'@design.estate/dees-element@2.2.4':
|
||||
resolution: {integrity: sha512-O9cA6flBMMd+pBwMQrZXwAWel9yVxgokolb+Em6gvkXxPJ0P/B5UDn4Vc2d4ts3ta55PTBm+l2dPeDVGx/bl7Q==}
|
||||
|
||||
'@design.estate/dees-wcctools@3.8.4':
|
||||
resolution: {integrity: sha512-KpFK/azK+a/Xpq33pXKcho+tdFKVHhKZM5ArvHqo9QMwTczgp5DZZgowTDUuqAofjZwnuVfCPHK/Pw9e64N46A==}
|
||||
'@design.estate/dees-wcctools@3.9.0':
|
||||
resolution: {integrity: sha512-0vZBaGBEGIbl8hx+8BezIIea3U5T7iSHHF9VqlJZGf+nOFIW4zBAxcCljH8YzZ1Yayp6BEjxp/pQXjHN2YB3Jg==}
|
||||
|
||||
'@emnapi/core@1.8.1':
|
||||
resolution: {integrity: sha512-AvT9QFpxK0Zd8J0jopedNm+w/2fIzvtPKPjqyw9jwvBaReTTqPBk9Hixaz7KbjimP+QNz605/XnjFcDAL2pqBg==}
|
||||
@@ -2070,6 +2070,12 @@ packages:
|
||||
'@types/debug@4.1.12':
|
||||
resolution: {integrity: sha512-vIChWdVG3LG1SMxEvI/AK+FWJthlrqlTu7fbrlywTkkaONwk/UAGaULXRlf8vkzFBLVm0zkMdCquhL5aOjhXPQ==}
|
||||
|
||||
'@types/dom-mediacapture-transform@0.1.11':
|
||||
resolution: {integrity: sha512-Y2p+nGf1bF2XMttBnsVPHUWzRRZzqUoJAKmiP10b5umnO6DDrWI0BrGDJy1pOHoOULVmGSfFNkQrAlC5dcj6nQ==}
|
||||
|
||||
'@types/dom-webcodecs@0.1.13':
|
||||
resolution: {integrity: sha512-O5hkiFIcjjszPIYyUSyvScyvrBoV3NOEEZx/pMlsu44TKzWNkLVBBxnxJz42in5n3QIolYOcBYFCPZZ0h8SkwQ==}
|
||||
|
||||
'@types/fs-extra@11.0.4':
|
||||
resolution: {integrity: sha512-yTbItCNreRooED33qjunPthRcSjERP1r4MqCZc7wv0u2sUkzTFp45tgUfS5+r7FrZPdmCCNflLhVSP/o+SemsQ==}
|
||||
|
||||
@@ -3136,6 +3142,9 @@ packages:
|
||||
mdurl@2.0.0:
|
||||
resolution: {integrity: sha512-Lf+9+2r+Tdp5wXDXC4PcIBjTDtq4UKjCPMQhKIuzpJNW0b96kVqSwW0bT7FhRSfmAiFYgP+SCRvdrDozfh0U5w==}
|
||||
|
||||
mediabunny@1.40.1:
|
||||
resolution: {integrity: sha512-HU/stGzAkdWaJIly6ypbUVgAUvT9kt39DIg0IaErR7/1fwtTmgUYs4i8uEPYcgcjPjbB9gtBmUXOLnXi6J2LDw==}
|
||||
|
||||
memory-pager@1.5.0:
|
||||
resolution: {integrity: sha512-ZS4Bp4r/Zoeq6+NLJpP+0Zzm0pR8whtGPf1XExKLJBAczGMnSi3It14OiNCStjQjM6NU1okjQGSxgEZN8eBYKg==}
|
||||
|
||||
@@ -4711,7 +4720,7 @@ snapshots:
|
||||
dependencies:
|
||||
'@design.estate/dees-domtools': 2.5.4
|
||||
'@design.estate/dees-element': 2.2.4
|
||||
'@design.estate/dees-wcctools': 3.8.4
|
||||
'@design.estate/dees-wcctools': 3.9.0
|
||||
'@fortawesome/fontawesome-svg-core': 7.2.0
|
||||
'@fortawesome/free-brands-svg-icons': 7.2.0
|
||||
'@fortawesome/free-regular-svg-icons': 7.2.0
|
||||
@@ -4787,12 +4796,13 @@ snapshots:
|
||||
- supports-color
|
||||
- vue
|
||||
|
||||
'@design.estate/dees-wcctools@3.8.4':
|
||||
'@design.estate/dees-wcctools@3.9.0':
|
||||
dependencies:
|
||||
'@design.estate/dees-domtools': 2.5.4
|
||||
'@design.estate/dees-element': 2.2.4
|
||||
'@push.rocks/smartdelay': 3.0.5
|
||||
lit: 3.3.2
|
||||
mediabunny: 1.40.1
|
||||
transitivePeerDependencies:
|
||||
- '@nuxt/kit'
|
||||
- react
|
||||
@@ -7245,6 +7255,12 @@ snapshots:
|
||||
dependencies:
|
||||
'@types/ms': 2.1.0
|
||||
|
||||
'@types/dom-mediacapture-transform@0.1.11':
|
||||
dependencies:
|
||||
'@types/dom-webcodecs': 0.1.13
|
||||
|
||||
'@types/dom-webcodecs@0.1.13': {}
|
||||
|
||||
'@types/fs-extra@11.0.4':
|
||||
dependencies:
|
||||
'@types/jsonfile': 6.1.4
|
||||
@@ -8468,6 +8484,11 @@ snapshots:
|
||||
|
||||
mdurl@2.0.0: {}
|
||||
|
||||
mediabunny@1.40.1:
|
||||
dependencies:
|
||||
'@types/dom-mediacapture-transform': 0.1.11
|
||||
'@types/dom-webcodecs': 0.1.13
|
||||
|
||||
memory-pager@1.5.0: {}
|
||||
|
||||
micromark-core-commonmark@2.0.3:
|
||||
|
||||
@@ -1508,31 +1508,56 @@ const layer = await DeesWindowLayer.createAndShow({
|
||||
### Navigation Components
|
||||
|
||||
#### `DeesStepper`
|
||||
Multi-step navigation component for guided user flows.
|
||||
Multi-step navigation component for guided user flows, including optional auto-advancing progress steps that can render `dees-progressbar` status output between form steps.
|
||||
|
||||
```typescript
|
||||
<dees-stepper
|
||||
.steps=${[
|
||||
{ key: 'personal', label: 'Personal Info', content: html`<div>Form 1</div>` },
|
||||
{ key: 'address', label: 'Address', content: html`<div>Form 2</div>` },
|
||||
{ key: 'confirm', label: 'Confirmation', content: html`<div>Review</div>` }
|
||||
{
|
||||
title: 'Account Setup',
|
||||
content: html`<dees-form>...</dees-form>`,
|
||||
menuOptions: [{ name: 'Continue', action: async (stepper) => stepper?.goNext() }]
|
||||
},
|
||||
{
|
||||
title: 'Provision Workspace',
|
||||
content: html`<p>Preparing your environment...</p>`,
|
||||
progressStep: {
|
||||
label: 'Workspace setup',
|
||||
indeterminate: true,
|
||||
statusRows: 4,
|
||||
terminalLines: ['Allocating workspace']
|
||||
},
|
||||
validationFunc: async (stepper, _element, signal) => {
|
||||
stepper.updateProgressStep({ percentage: 35, statusText: 'Installing dependencies...' });
|
||||
stepper.appendProgressStepLine('Installing dependencies');
|
||||
if (signal?.aborted) return;
|
||||
stepper.updateProgressStep({ percentage: 100, indeterminate: false, statusText: 'Workspace ready.' });
|
||||
}
|
||||
}
|
||||
]}
|
||||
currentStep="personal"
|
||||
@step-change=${handleStepChange}
|
||||
@complete=${handleComplete}
|
||||
></dees-stepper>
|
||||
```
|
||||
|
||||
#### `DeesProgressbar`
|
||||
Progress indicator component for tracking completion status.
|
||||
Progress indicator component for tracking completion status, with optional fixed-height status text or terminal-style recent activity output.
|
||||
|
||||
```typescript
|
||||
<dees-progressbar
|
||||
value={75}
|
||||
.percentage=${75}
|
||||
label="Uploading"
|
||||
showPercentage
|
||||
type="determinate" // Options: determinate, indeterminate
|
||||
status="normal" // Options: normal, success, warning, error
|
||||
statusText="Uploading thumbnails to edge cache..."
|
||||
.statusRows=${2}
|
||||
></dees-progressbar>
|
||||
|
||||
<dees-progressbar
|
||||
label="Installing dependencies"
|
||||
.indeterminate=${true}
|
||||
.statusRows=${4}
|
||||
.terminalLines=${[
|
||||
'Resolving workspace packages',
|
||||
'Downloading tarballs',
|
||||
'Linking local binaries'
|
||||
]}
|
||||
></dees-progressbar>
|
||||
```
|
||||
|
||||
@@ -1570,6 +1595,33 @@ Theme provider component that wraps children and provides CSS custom properties
|
||||
- Works with dark/light mode
|
||||
- Overrides cascade to all child components
|
||||
|
||||
#### `DeesUpdater`
|
||||
Updater controller that opens a non-cancelable `dees-stepper` flow with a progress step and a ready step.
|
||||
|
||||
```typescript
|
||||
const updater = await DeesUpdater.createAndShow({
|
||||
currentVersion: '3.79.0',
|
||||
updatedVersion: '3.80.0',
|
||||
moreInfoUrl: 'https://code.foss.global/design.estate/dees-catalog',
|
||||
changelogUrl: 'https://code.foss.global/design.estate/dees-catalog/-/blob/main/changelog.md',
|
||||
successAction: 'reload',
|
||||
successDelayMs: 10000,
|
||||
});
|
||||
|
||||
updater.updateProgress({
|
||||
percentage: 35,
|
||||
statusText: 'Downloading signed bundle...',
|
||||
terminalLines: ['Checking release manifest', 'Downloading signed bundle']
|
||||
});
|
||||
|
||||
updater.appendProgressLine('Verifying checksum');
|
||||
updater.updateProgress({ percentage: 72, statusText: 'Verifying checksum...' });
|
||||
|
||||
await updater.markUpdateReady();
|
||||
```
|
||||
|
||||
After `markUpdateReady()`, the updater switches to a second countdown step with a determinate progress bar and runs the configured success action when the timer reaches zero.
|
||||
|
||||
---
|
||||
|
||||
### Workspace / IDE Components 💻
|
||||
|
||||
@@ -0,0 +1,167 @@
|
||||
import { expect, tap } from '@git.zone/tstest/tapbundle';
|
||||
import * as deesCatalog from '../ts_web/index.js';
|
||||
import type {
|
||||
Column,
|
||||
ISortDescriptor,
|
||||
} from '../ts_web/elements/00group-dataview/dees-table/index.js';
|
||||
|
||||
interface ITestRow {
|
||||
id: string;
|
||||
score: number;
|
||||
label: string;
|
||||
}
|
||||
|
||||
const testColumns: Column<ITestRow>[] = [
|
||||
{ key: 'id', header: 'ID' },
|
||||
{ key: 'score', header: 'Score' },
|
||||
{ key: 'label', header: 'Label' },
|
||||
];
|
||||
|
||||
const scoreSort: ISortDescriptor[] = [{ key: 'score', dir: 'desc' }];
|
||||
|
||||
const waitForNextFrame = async () => {
|
||||
await new Promise<void>((resolve) => {
|
||||
requestAnimationFrame(() => resolve());
|
||||
});
|
||||
};
|
||||
|
||||
const waitForMacrotask = async () => {
|
||||
await new Promise<void>((resolve) => {
|
||||
window.setTimeout(() => resolve(), 0);
|
||||
});
|
||||
};
|
||||
|
||||
const settleTable = async (table: deesCatalog.DeesTable<ITestRow>) => {
|
||||
await table.updateComplete;
|
||||
await waitForNextFrame();
|
||||
await waitForMacrotask();
|
||||
await table.updateComplete;
|
||||
};
|
||||
|
||||
const createRows = (iteration: number): ITestRow[] => {
|
||||
const cycle = iteration % 3;
|
||||
|
||||
if (cycle === 0) {
|
||||
return [
|
||||
{ id: 'alpha', score: 60, label: `Alpha ${iteration}` },
|
||||
{ id: 'beta', score: 20, label: `Beta ${iteration}` },
|
||||
{ id: 'gamma', score: 40, label: `Gamma ${iteration}` },
|
||||
];
|
||||
}
|
||||
|
||||
if (cycle === 1) {
|
||||
return [
|
||||
{ id: 'alpha', score: 30, label: `Alpha ${iteration}` },
|
||||
{ id: 'beta', score: 70, label: `Beta ${iteration}` },
|
||||
{ id: 'gamma', score: 50, label: `Gamma ${iteration}` },
|
||||
];
|
||||
}
|
||||
|
||||
return [
|
||||
{ id: 'alpha', score: 55, label: `Alpha ${iteration}` },
|
||||
{ id: 'beta', score: 35, label: `Beta ${iteration}` },
|
||||
{ id: 'gamma', score: 75, label: `Gamma ${iteration}` },
|
||||
];
|
||||
};
|
||||
|
||||
const createTable = (
|
||||
rows: ITestRow[],
|
||||
highlightUpdates: 'none' | 'flash'
|
||||
): deesCatalog.DeesTable<ITestRow> => {
|
||||
const table = new deesCatalog.DeesTable<ITestRow>();
|
||||
table.searchable = false;
|
||||
table.columns = testColumns;
|
||||
table.rowKey = 'id';
|
||||
table.sortBy = scoreSort;
|
||||
table.highlightUpdates = highlightUpdates;
|
||||
table.data = rows;
|
||||
document.body.appendChild(table);
|
||||
return table;
|
||||
};
|
||||
|
||||
const countComments = (root: Node): number => {
|
||||
const walker = document.createTreeWalker(root, NodeFilter.SHOW_COMMENT);
|
||||
let count = 0;
|
||||
while (walker.nextNode()) count++;
|
||||
return count;
|
||||
};
|
||||
|
||||
const getBodyRows = (table: deesCatalog.DeesTable<ITestRow>): HTMLTableRowElement[] =>
|
||||
Array.from(
|
||||
table.shadowRoot?.querySelectorAll('tbody tr[data-row-idx]') ?? []
|
||||
) as HTMLTableRowElement[];
|
||||
|
||||
const getRenderedRowIds = (table: deesCatalog.DeesTable<ITestRow>): string[] =>
|
||||
getBodyRows(table).map((row) => row.cells[0]?.textContent?.trim() ?? '');
|
||||
|
||||
const getRenderedRowMap = (
|
||||
table: deesCatalog.DeesTable<ITestRow>
|
||||
): Map<string, HTMLTableRowElement> => {
|
||||
const rowMap = new Map<string, HTMLTableRowElement>();
|
||||
for (const row of getBodyRows(table)) {
|
||||
const rowId = row.cells[0]?.textContent?.trim() ?? '';
|
||||
if (rowId) rowMap.set(rowId, row);
|
||||
}
|
||||
return rowMap;
|
||||
};
|
||||
|
||||
tap.test('dees-table avoids repeated width measurement and comment growth on live updates', async () => {
|
||||
const table = new deesCatalog.DeesTable<ITestRow>();
|
||||
let widthMeasureCalls = 0;
|
||||
const originalDetermineColumnWidths = table.determineColumnWidths.bind(table);
|
||||
table.determineColumnWidths = (async () => {
|
||||
widthMeasureCalls++;
|
||||
await originalDetermineColumnWidths();
|
||||
}) as typeof table.determineColumnWidths;
|
||||
|
||||
table.searchable = false;
|
||||
table.columns = testColumns;
|
||||
table.rowKey = 'id';
|
||||
table.sortBy = scoreSort;
|
||||
table.highlightUpdates = 'none';
|
||||
table.data = createRows(0);
|
||||
document.body.appendChild(table);
|
||||
|
||||
try {
|
||||
await settleTable(table);
|
||||
|
||||
const initialWidthMeasureCalls = widthMeasureCalls;
|
||||
const initialCommentCount = countComments(table.shadowRoot!);
|
||||
|
||||
expect(initialWidthMeasureCalls).toBeGreaterThan(0);
|
||||
|
||||
for (let iteration = 1; iteration <= 10; iteration++) {
|
||||
table.data = createRows(iteration);
|
||||
await settleTable(table);
|
||||
}
|
||||
|
||||
expect(widthMeasureCalls).toEqual(initialWidthMeasureCalls);
|
||||
expect(countComments(table.shadowRoot!)).toEqual(initialCommentCount);
|
||||
} finally {
|
||||
table.remove();
|
||||
}
|
||||
});
|
||||
|
||||
tap.test('dees-table reuses row DOM while flashing live-sorted updates', async () => {
|
||||
const table = createTable(createRows(0), 'flash');
|
||||
|
||||
try {
|
||||
await settleTable(table);
|
||||
|
||||
const initialRowMap = getRenderedRowMap(table);
|
||||
|
||||
table.data = createRows(1);
|
||||
await settleTable(table);
|
||||
|
||||
const updatedRowMap = getRenderedRowMap(table);
|
||||
|
||||
expect(getRenderedRowIds(table)).toEqual(['beta', 'gamma', 'alpha']);
|
||||
expect(updatedRowMap.get('alpha')).toEqual(initialRowMap.get('alpha'));
|
||||
expect(updatedRowMap.get('beta')).toEqual(initialRowMap.get('beta'));
|
||||
expect(updatedRowMap.get('gamma')).toEqual(initialRowMap.get('gamma'));
|
||||
} finally {
|
||||
table.remove();
|
||||
}
|
||||
});
|
||||
|
||||
export default tap.start();
|
||||
@@ -3,6 +3,6 @@
|
||||
*/
|
||||
export const commitinfo = {
|
||||
name: '@design.estate/dees-catalog',
|
||||
version: '3.78.1',
|
||||
version: '3.80.0',
|
||||
description: 'A comprehensive library that provides dynamic web components for building sophisticated and modern web applications using JavaScript and TypeScript.'
|
||||
}
|
||||
|
||||
@@ -293,9 +293,9 @@ export class DeesTable<T> extends DeesElement {
|
||||
private accessor __floatingActive: boolean = false;
|
||||
|
||||
// ─── Flash-on-update state (only populated when highlightUpdates === 'flash') ──
|
||||
/** rowId → set of colKey strings currently flashing. */
|
||||
/** rowId → (colKey → flash token) for cells currently flashing. */
|
||||
@state()
|
||||
private accessor __flashingCells: Map<string, Set<string>> = new Map();
|
||||
private accessor __flashingCells: Map<string, Map<string, number>> = new Map();
|
||||
|
||||
/** rowId → (colKey → last-seen resolved cell value). Populated per diff pass. */
|
||||
private __prevSnapshot?: Map<string, Map<string, unknown>>;
|
||||
@@ -303,7 +303,7 @@ export class DeesTable<T> extends DeesElement {
|
||||
/** Single shared timer that clears __flashingCells after highlightDuration ms. */
|
||||
private __flashClearTimer?: ReturnType<typeof setTimeout>;
|
||||
|
||||
/** Monotonic counter bumped each flash batch so directives.keyed recreates the cell node and restarts the animation. */
|
||||
/** Monotonic counter bumped per flash batch so only changed cells restart their animation. */
|
||||
private __flashTick: number = 0;
|
||||
|
||||
/** One-shot console.warn gate for missing rowKey in flash mode. */
|
||||
@@ -317,7 +317,7 @@ export class DeesTable<T> extends DeesElement {
|
||||
columns: any;
|
||||
augment: boolean;
|
||||
displayFunction: any;
|
||||
data: any;
|
||||
displayShapeKey: string;
|
||||
out: Column<T>[];
|
||||
};
|
||||
private __memoViewData?: {
|
||||
@@ -329,8 +329,13 @@ export class DeesTable<T> extends DeesElement {
|
||||
effectiveColumns: Column<T>[];
|
||||
out: T[];
|
||||
};
|
||||
/** Tracks the (data, columns) pair that `determineColumnWidths()` last sized for. */
|
||||
private __columnsSizedFor?: { data: any; columns: any };
|
||||
/** Tracks the layout inputs that `determineColumnWidths()` last sized for. */
|
||||
private __columnsSizedFor?: {
|
||||
effectiveColumns: Column<T>[];
|
||||
showSelectionCheckbox: boolean;
|
||||
inRowActionCount: number;
|
||||
table: HTMLTableElement;
|
||||
};
|
||||
|
||||
// ─── Virtualization state ────────────────────────────────────────────
|
||||
/** Estimated row height (px). Measured once from the first rendered row. */
|
||||
@@ -409,15 +414,7 @@ export class DeesTable<T> extends DeesElement {
|
||||
const view: T[] = (this as any)._lastViewData ?? [];
|
||||
const item = view.find((r) => this.getRowId(r) === this.__focusedCell!.rowId);
|
||||
if (!item) return;
|
||||
const allCols: Column<T>[] =
|
||||
Array.isArray(this.columns) && this.columns.length > 0
|
||||
? computeEffectiveColumnsFn(
|
||||
this.columns,
|
||||
this.augmentFromDisplayFunction,
|
||||
this.displayFunction,
|
||||
this.data
|
||||
)
|
||||
: computeColumnsFromDisplayFunctionFn(this.displayFunction, this.data);
|
||||
const allCols = this.__getEffectiveColumns();
|
||||
const col = allCols.find((c) => String(c.key) === this.__focusedCell!.colKey);
|
||||
if (!col || !this.__isColumnEditable(col)) return;
|
||||
eventArg.preventDefault();
|
||||
@@ -469,15 +466,24 @@ export class DeesTable<T> extends DeesElement {
|
||||
* that affect it. Avoids re-running `computeEffectiveColumnsFn` /
|
||||
* `computeColumnsFromDisplayFunctionFn` on every Lit update.
|
||||
*/
|
||||
private __getDisplayFunctionShapeKey(): string {
|
||||
if (!this.data || this.data.length === 0) return '';
|
||||
const firstTransformedItem = this.displayFunction(this.data[0]) ?? {};
|
||||
return Object.keys(firstTransformedItem).join('\u0000');
|
||||
}
|
||||
|
||||
private __getEffectiveColumns(): Column<T>[] {
|
||||
const usingColumns = Array.isArray(this.columns) && this.columns.length > 0;
|
||||
const displayShapeKey = !usingColumns || this.augmentFromDisplayFunction
|
||||
? this.__getDisplayFunctionShapeKey()
|
||||
: '';
|
||||
const cache = this.__memoEffectiveCols;
|
||||
if (
|
||||
cache &&
|
||||
cache.columns === this.columns &&
|
||||
cache.augment === this.augmentFromDisplayFunction &&
|
||||
cache.displayFunction === this.displayFunction &&
|
||||
cache.data === this.data
|
||||
cache.displayShapeKey === displayShapeKey
|
||||
) {
|
||||
return cache.out;
|
||||
}
|
||||
@@ -493,7 +499,7 @@ export class DeesTable<T> extends DeesElement {
|
||||
columns: this.columns,
|
||||
augment: this.augmentFromDisplayFunction,
|
||||
displayFunction: this.displayFunction,
|
||||
data: this.data,
|
||||
displayShapeKey,
|
||||
out,
|
||||
};
|
||||
return out;
|
||||
@@ -543,6 +549,9 @@ export class DeesTable<T> extends DeesElement {
|
||||
public render(): TemplateResult {
|
||||
const effectiveColumns = this.__getEffectiveColumns();
|
||||
const viewData = this.__getViewData(effectiveColumns);
|
||||
const headerActions = this.getActionsForType('header');
|
||||
const footerActions = this.getActionsForType('footer');
|
||||
const inRowActions = this.getActionsForType('inRow');
|
||||
(this as any)._lastViewData = viewData;
|
||||
|
||||
// Virtualization slice — only the rows in `__virtualRange` actually
|
||||
@@ -572,29 +581,22 @@ export class DeesTable<T> extends DeesElement {
|
||||
<div class="heading heading2">${this.heading2}</div>
|
||||
</div>
|
||||
<div class="headerActions">
|
||||
${directives.resolveExec(async () => {
|
||||
const resultArray: TemplateResult[] = [];
|
||||
for (const action of this.dataActions) {
|
||||
if (!action.type?.includes('header')) continue;
|
||||
resultArray.push(
|
||||
html`<div
|
||||
class="headerAction"
|
||||
@click=${() => {
|
||||
action.actionFunc({
|
||||
item: this.selectedDataRow,
|
||||
table: this,
|
||||
});
|
||||
}}
|
||||
>
|
||||
${action.iconName
|
||||
? html`<dees-icon .iconSize=${14} .icon=${action.iconName}></dees-icon>
|
||||
${action.name}`
|
||||
: action.name}
|
||||
</div>`
|
||||
);
|
||||
}
|
||||
return resultArray;
|
||||
})}
|
||||
${headerActions.map(
|
||||
(action) => html`<div
|
||||
class="headerAction"
|
||||
@click=${() => {
|
||||
action.actionFunc({
|
||||
item: this.selectedDataRow,
|
||||
table: this,
|
||||
});
|
||||
}}
|
||||
>
|
||||
${action.iconName
|
||||
? html`<dees-icon .iconSize=${14} .icon=${action.iconName}></dees-icon>
|
||||
${action.name}`
|
||||
: action.name}
|
||||
</div>`
|
||||
)}
|
||||
</div>
|
||||
</div>
|
||||
<div class="headingSeparation"></div>
|
||||
@@ -658,11 +660,11 @@ export class DeesTable<T> extends DeesElement {
|
||||
: html``}
|
||||
${directives.repeat(
|
||||
renderRows,
|
||||
(itemArg, sliceIdx) => `${this.getRowId(itemArg)}::${renderStart + sliceIdx}`,
|
||||
(itemArg) => this.getRowId(itemArg),
|
||||
(itemArg, sliceIdx) => {
|
||||
const rowIndex = renderStart + sliceIdx;
|
||||
const rowId = this.getRowId(itemArg);
|
||||
const flashSet = this.__flashingCells.get(rowId);
|
||||
const flashTokens = this.__flashingCells.get(rowId);
|
||||
return html`
|
||||
<tr
|
||||
data-row-idx=${rowIndex}
|
||||
@@ -694,7 +696,8 @@ export class DeesTable<T> extends DeesElement {
|
||||
const isEditing =
|
||||
this.__editingCell?.rowId === rowId &&
|
||||
this.__editingCell?.colKey === editKey;
|
||||
const isFlashing = !!flashSet?.has(editKey);
|
||||
const flashToken = flashTokens?.get(editKey);
|
||||
const isFlashing = flashToken !== undefined;
|
||||
const useFlashBorder = isFlashing && !!col.flashBorder;
|
||||
const cellClasses = [
|
||||
isEditable ? 'editable' : '',
|
||||
@@ -720,7 +723,7 @@ export class DeesTable<T> extends DeesElement {
|
||||
>
|
||||
${isFlashing
|
||||
? directives.keyed(
|
||||
`${rowId}:${editKey}:${this.__flashTick}`,
|
||||
`${rowId}:${editKey}:${flashToken}`,
|
||||
innerHtml
|
||||
)
|
||||
: innerHtml}
|
||||
@@ -728,11 +731,11 @@ export class DeesTable<T> extends DeesElement {
|
||||
`;
|
||||
})}
|
||||
${(() => {
|
||||
if (this.dataActions && this.dataActions.length > 0) {
|
||||
if (inRowActions.length > 0) {
|
||||
return html`
|
||||
<td class="actionsCol">
|
||||
<div class="actionsContainer">
|
||||
${this.getActionsForType('inRow').map(
|
||||
${inRowActions.map(
|
||||
(actionArg) => html`
|
||||
<div
|
||||
class="action"
|
||||
@@ -780,29 +783,22 @@ export class DeesTable<T> extends DeesElement {
|
||||
selected
|
||||
</div>
|
||||
<div class="footerActions">
|
||||
${directives.resolveExec(async () => {
|
||||
const resultArray: TemplateResult[] = [];
|
||||
for (const action of this.dataActions) {
|
||||
if (!action.type?.includes('footer')) continue;
|
||||
resultArray.push(
|
||||
html`<div
|
||||
class="footerAction"
|
||||
@click=${() => {
|
||||
action.actionFunc({
|
||||
item: this.selectedDataRow,
|
||||
table: this,
|
||||
});
|
||||
}}
|
||||
>
|
||||
${action.iconName
|
||||
? html`<dees-icon .iconSize=${14} .icon=${action.iconName}></dees-icon>
|
||||
${action.name}`
|
||||
: action.name}
|
||||
</div>`
|
||||
);
|
||||
}
|
||||
return resultArray;
|
||||
})}
|
||||
${footerActions.map(
|
||||
(action) => html`<div
|
||||
class="footerAction"
|
||||
@click=${() => {
|
||||
action.actionFunc({
|
||||
item: this.selectedDataRow,
|
||||
table: this,
|
||||
});
|
||||
}}
|
||||
>
|
||||
${action.iconName
|
||||
? html`<dees-icon .iconSize=${14} .icon=${action.iconName}></dees-icon>
|
||||
${action.name}`
|
||||
: action.name}
|
||||
</div>`
|
||||
)}
|
||||
</div>
|
||||
</div>
|
||||
</dees-tile>
|
||||
@@ -1160,7 +1156,7 @@ export class DeesTable<T> extends DeesElement {
|
||||
/**
|
||||
* Measures the height of the first rendered body row and stores it for
|
||||
* subsequent virtualization math. Idempotent — only measures once per
|
||||
* `data`/`columns` pair (cleared in `updated()` when those change).
|
||||
* rendered table layout (cleared in `updated()` when that layout changes).
|
||||
*/
|
||||
private __measureRowHeight() {
|
||||
if (!this.virtualized || this.__rowHeightMeasured) return;
|
||||
@@ -1426,20 +1422,16 @@ export class DeesTable<T> extends DeesElement {
|
||||
if (newlyFlashing.size === 0) return;
|
||||
|
||||
// Merge with any in-flight flashes from a rapid second update so a cell
|
||||
// that changes twice before its animation ends gets a single clean
|
||||
// restart (via __flashTick / directives.keyed) instead of stacking.
|
||||
// that changes twice before its animation ends gets a clean restart,
|
||||
// while unrelated cells keep their existing DOM subtree.
|
||||
const flashToken = ++this.__flashTick;
|
||||
const nextFlashingCells = new Map(this.__flashingCells);
|
||||
for (const [rowId, cols] of newlyFlashing) {
|
||||
const existing = this.__flashingCells.get(rowId);
|
||||
if (existing) {
|
||||
for (const c of cols) existing.add(c);
|
||||
} else {
|
||||
this.__flashingCells.set(rowId, cols);
|
||||
}
|
||||
const existing = new Map(nextFlashingCells.get(rowId) ?? []);
|
||||
for (const colKey of cols) existing.set(colKey, flashToken);
|
||||
nextFlashingCells.set(rowId, existing);
|
||||
}
|
||||
this.__flashTick++;
|
||||
// Reactivity nudge: we've mutated the Map in place, so give Lit a fresh
|
||||
// reference so the @state change fires for render.
|
||||
this.__flashingCells = new Map(this.__flashingCells);
|
||||
this.__flashingCells = nextFlashingCells;
|
||||
if (this.__flashClearTimer) clearTimeout(this.__flashClearTimer);
|
||||
this.__flashClearTimer = setTimeout(() => {
|
||||
this.__flashingCells = new Map();
|
||||
@@ -1449,6 +1441,9 @@ export class DeesTable<T> extends DeesElement {
|
||||
|
||||
public async updated(changedProperties: Map<string | number | symbol, unknown>): Promise<void> {
|
||||
super.updated(changedProperties);
|
||||
const effectiveColumns = this.__getEffectiveColumns();
|
||||
const currentTable = this.shadowRoot?.querySelector('table') ?? null;
|
||||
const inRowActionCount = this.getActionsForType('inRow').length;
|
||||
|
||||
// Feed highlightDuration into the CSS variable so JS and CSS stay in
|
||||
// sync via a single source of truth.
|
||||
@@ -1456,15 +1451,23 @@ export class DeesTable<T> extends DeesElement {
|
||||
this.style.setProperty('--dees-table-flash-duration', `${this.highlightDuration}ms`);
|
||||
}
|
||||
|
||||
// Only re-measure column widths when the data or schema actually changed
|
||||
// (or on first paint). `determineColumnWidths` is the single biggest
|
||||
// first-paint cost — it forces multiple layout flushes per row.
|
||||
const dataOrColsChanged =
|
||||
!this.__columnsSizedFor ||
|
||||
this.__columnsSizedFor.data !== this.data ||
|
||||
this.__columnsSizedFor.columns !== this.columns;
|
||||
if (dataOrColsChanged) {
|
||||
this.__columnsSizedFor = { data: this.data, columns: this.columns };
|
||||
// Only re-measure column widths when layout-affecting inputs changed or
|
||||
// when a new <table> element was rendered after previously having none.
|
||||
const columnLayoutChanged =
|
||||
!!currentTable && (
|
||||
!this.__columnsSizedFor ||
|
||||
this.__columnsSizedFor.effectiveColumns !== effectiveColumns ||
|
||||
this.__columnsSizedFor.showSelectionCheckbox !== this.showSelectionCheckbox ||
|
||||
this.__columnsSizedFor.inRowActionCount !== inRowActionCount ||
|
||||
this.__columnsSizedFor.table !== currentTable
|
||||
);
|
||||
if (currentTable && columnLayoutChanged) {
|
||||
this.__columnsSizedFor = {
|
||||
effectiveColumns,
|
||||
showSelectionCheckbox: this.showSelectionCheckbox,
|
||||
inRowActionCount,
|
||||
table: currentTable,
|
||||
};
|
||||
this.determineColumnWidths();
|
||||
// Force re-measure of row height; structure may have changed.
|
||||
this.__rowHeightMeasured = false;
|
||||
@@ -1502,7 +1505,7 @@ export class DeesTable<T> extends DeesElement {
|
||||
if (
|
||||
!this.fixedHeight &&
|
||||
this.data.length > 0 &&
|
||||
(this.__floatingActive || dataOrColsChanged)
|
||||
(this.__floatingActive || columnLayoutChanged)
|
||||
) {
|
||||
this.__syncFloatingHeader();
|
||||
}
|
||||
@@ -1804,10 +1807,7 @@ export class DeesTable<T> extends DeesElement {
|
||||
* Used by the modal helper to render human-friendly labels.
|
||||
*/
|
||||
private _lookupColumnByKey(key: string): Column<T> | undefined {
|
||||
const usingColumns = Array.isArray(this.columns) && this.columns.length > 0;
|
||||
const effective = usingColumns
|
||||
? computeEffectiveColumnsFn(this.columns, this.augmentFromDisplayFunction, this.displayFunction, this.data)
|
||||
: computeColumnsFromDisplayFunctionFn(this.displayFunction, this.data);
|
||||
const effective = this.__getEffectiveColumns();
|
||||
return effective.find((c) => String(c.key) === key);
|
||||
}
|
||||
|
||||
@@ -2543,9 +2543,7 @@ export class DeesTable<T> extends DeesElement {
|
||||
const view: T[] = (this as any)._lastViewData ?? [];
|
||||
if (view.length === 0) return;
|
||||
// Recompute editable columns from the latest effective set.
|
||||
const allCols: Column<T>[] = Array.isArray(this.columns) && this.columns.length > 0
|
||||
? computeEffectiveColumnsFn(this.columns, this.augmentFromDisplayFunction, this.displayFunction, this.data)
|
||||
: computeColumnsFromDisplayFunctionFn(this.displayFunction, this.data);
|
||||
const allCols = this.__getEffectiveColumns();
|
||||
const editableCols = this.__editableColumns(allCols);
|
||||
if (editableCols.length === 0) return;
|
||||
|
||||
|
||||
@@ -1,11 +1,245 @@
|
||||
import { html } from '@design.estate/dees-element';
|
||||
|
||||
import { DeesProgressbar } from '../dees-progressbar/dees-progressbar.js';
|
||||
import { html, css, cssManager } from '@design.estate/dees-element';
|
||||
import '@design.estate/dees-wcctools/demotools';
|
||||
import type { DeesProgressbar } from './dees-progressbar.js';
|
||||
|
||||
export const demoFunc = () => {
|
||||
const terminalSnapshots = [
|
||||
['Resolving workspace packages'],
|
||||
['Resolving workspace packages', 'Downloading ui-assets.tar.gz'],
|
||||
['Resolving workspace packages', 'Downloading ui-assets.tar.gz', 'Verifying checksum'],
|
||||
['Resolving workspace packages', 'Downloading ui-assets.tar.gz', 'Verifying checksum', 'Extracting release bundle'],
|
||||
['Resolving workspace packages', 'Downloading ui-assets.tar.gz', 'Verifying checksum', 'Extracting release bundle', 'Restarting application'],
|
||||
];
|
||||
|
||||
const getUploadStatus = (percentage: number): string => {
|
||||
if (percentage >= 100) {
|
||||
return 'Upload complete. Finalizing package manifest...';
|
||||
}
|
||||
|
||||
if (percentage >= 82) {
|
||||
return 'Verifying checksums before handoff...';
|
||||
}
|
||||
|
||||
if (percentage >= 55) {
|
||||
return 'Uploading thumbnails to edge cache...';
|
||||
}
|
||||
|
||||
if (percentage >= 25) {
|
||||
return 'Streaming source files to the remote worker...';
|
||||
}
|
||||
|
||||
return 'Preparing archive and dependency graph...';
|
||||
};
|
||||
|
||||
return html`
|
||||
<dees-progressbar
|
||||
.percentage=${50}
|
||||
></dees-progressbar>
|
||||
<dees-demowrapper .runAfterRender=${async (elementArg: HTMLElement) => {
|
||||
const liveProgressbar = elementArg.querySelector('#live-progress') as DeesProgressbar | null;
|
||||
const terminalProgressbar = elementArg.querySelector('#terminal-progress') as DeesProgressbar | null;
|
||||
const demoElement = elementArg as HTMLElement & {
|
||||
__progressbarDemoIntervalId?: number;
|
||||
};
|
||||
|
||||
if (!liveProgressbar || !terminalProgressbar) {
|
||||
return;
|
||||
}
|
||||
|
||||
if (demoElement.__progressbarDemoIntervalId) {
|
||||
window.clearInterval(demoElement.__progressbarDemoIntervalId);
|
||||
}
|
||||
|
||||
let livePercentage = 12;
|
||||
let terminalSnapshotIndex = 0;
|
||||
|
||||
const updateDemo = () => {
|
||||
liveProgressbar.percentage = livePercentage;
|
||||
liveProgressbar.statusText = getUploadStatus(livePercentage);
|
||||
|
||||
terminalProgressbar.terminalLines = [...terminalSnapshots[terminalSnapshotIndex]];
|
||||
terminalProgressbar.percentage = Math.min(100, (terminalSnapshotIndex + 1) * 20);
|
||||
terminalProgressbar.indeterminate = terminalSnapshotIndex < terminalSnapshots.length - 1;
|
||||
|
||||
livePercentage = livePercentage >= 100 ? 12 : Math.min(100, livePercentage + 11);
|
||||
terminalSnapshotIndex = terminalSnapshotIndex >= terminalSnapshots.length - 1 ? 0 : terminalSnapshotIndex + 1;
|
||||
};
|
||||
|
||||
updateDemo();
|
||||
demoElement.__progressbarDemoIntervalId = window.setInterval(updateDemo, 1400);
|
||||
}}>
|
||||
<style>
|
||||
${css`
|
||||
.demoBox {
|
||||
position: relative;
|
||||
background: ${cssManager.bdTheme('hsl(0 0% 95%)', 'hsl(0 0% 9%)')};
|
||||
width: 100%;
|
||||
height: 100%;
|
||||
box-sizing: border-box;
|
||||
padding: 40px;
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 24px;
|
||||
}
|
||||
|
||||
.demoIntro {
|
||||
max-width: 720px;
|
||||
color: ${cssManager.bdTheme('hsl(215 20% 30%)', 'hsl(215 18% 76%)')};
|
||||
font-size: 14px;
|
||||
line-height: 1.6;
|
||||
}
|
||||
|
||||
.showcaseGrid {
|
||||
display: grid;
|
||||
grid-template-columns: repeat(auto-fit, minmax(280px, 1fr));
|
||||
gap: 18px;
|
||||
}
|
||||
|
||||
.showcaseCard {
|
||||
background: ${cssManager.bdTheme('rgba(255,255,255,0.78)', 'rgba(255,255,255,0.04)')};
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(210 22% 86%)', 'hsl(210 10% 18%)')};
|
||||
border-radius: 16px;
|
||||
padding: 20px;
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 16px;
|
||||
backdrop-filter: blur(8px);
|
||||
}
|
||||
|
||||
.showcaseCard.wide {
|
||||
grid-column: span 2;
|
||||
}
|
||||
|
||||
.showcaseCard h3 {
|
||||
margin: 0;
|
||||
font-size: 15px;
|
||||
font-weight: 600;
|
||||
}
|
||||
|
||||
.showcaseCard p {
|
||||
margin: 0;
|
||||
color: ${cssManager.bdTheme('hsl(215 14% 40%)', 'hsl(215 10% 66%)')};
|
||||
font-size: 13px;
|
||||
line-height: 1.55;
|
||||
}
|
||||
|
||||
.progressStack {
|
||||
display: flex;
|
||||
flex-direction: column;
|
||||
gap: 14px;
|
||||
}
|
||||
|
||||
.codeLabel {
|
||||
font-family: 'SF Mono', 'Monaco', 'Inconsolata', 'Fira Code', monospace;
|
||||
font-size: 11px;
|
||||
color: ${cssManager.bdTheme('hsl(215 14% 44%)', 'hsl(215 10% 70%)')};
|
||||
letter-spacing: 0.03em;
|
||||
text-transform: uppercase;
|
||||
}
|
||||
|
||||
@media (max-width: 900px) {
|
||||
.demoBox {
|
||||
padding: 24px;
|
||||
}
|
||||
|
||||
.showcaseCard.wide {
|
||||
grid-column: span 1;
|
||||
}
|
||||
}
|
||||
`}
|
||||
</style>
|
||||
<div class="demoBox">
|
||||
<div class="demoIntro">
|
||||
<code>dees-progressbar</code> can now pair a classic progress bar with a fixed-height status area. Use simple status text for clear user-facing updates or switch to terminal-like lines when you want recent steps to stay visible without causing layout jumps.
|
||||
</div>
|
||||
<div class="showcaseGrid">
|
||||
<section class="showcaseCard">
|
||||
<div class="codeLabel">Determinate</div>
|
||||
<h3>Percentage plus current task</h3>
|
||||
<p>Use a label, a percentage, and one short status line when the work is measurable.</p>
|
||||
<div class="progressStack">
|
||||
<dees-progressbar
|
||||
label="Media upload"
|
||||
.percentage=${68}
|
||||
statusText="Uploading thumbnails to edge cache..."
|
||||
.statusRows=${2}
|
||||
></dees-progressbar>
|
||||
<dees-progressbar
|
||||
label="Asset sync"
|
||||
.percentage=${100}
|
||||
statusText="All files are synced and available."
|
||||
.statusRows=${2}
|
||||
></dees-progressbar>
|
||||
</div>
|
||||
</section>
|
||||
|
||||
<section class="showcaseCard">
|
||||
<div class="codeLabel">Indeterminate</div>
|
||||
<h3>Spinner-style text indicator</h3>
|
||||
<p>When there is no trustworthy percentage yet, keep the bar moving and let the text explain what is happening.</p>
|
||||
<div class="progressStack">
|
||||
<dees-progressbar
|
||||
label="Dependency install"
|
||||
.indeterminate=${true}
|
||||
statusText="Downloading package metadata..."
|
||||
.statusRows=${2}
|
||||
></dees-progressbar>
|
||||
<dees-progressbar
|
||||
label="Queued job"
|
||||
.percentage=${32}
|
||||
.showPercentage=${false}
|
||||
statusText="Waiting for a worker slot to become available..."
|
||||
.statusRows=${2}
|
||||
></dees-progressbar>
|
||||
</div>
|
||||
</section>
|
||||
|
||||
<section class="showcaseCard wide">
|
||||
<div class="codeLabel">Terminal Lines</div>
|
||||
<h3>Fixed-height terminal-style status output</h3>
|
||||
<p>The panel stays the same height while the latest step stays visible. This is useful for update flows, downloads, and staged background work.</p>
|
||||
<dees-progressbar
|
||||
id="terminal-progress"
|
||||
label="Release bundle"
|
||||
.percentage=${20}
|
||||
.indeterminate=${true}
|
||||
.statusRows=${4}
|
||||
.terminalLines=${terminalSnapshots[0]}
|
||||
></dees-progressbar>
|
||||
</section>
|
||||
|
||||
<section class="showcaseCard">
|
||||
<div class="codeLabel">Live Demo</div>
|
||||
<h3>Updating percentage and text together</h3>
|
||||
<p>A single component can express both how far the job is and which phase is currently active.</p>
|
||||
<dees-progressbar
|
||||
id="live-progress"
|
||||
label="Customer export"
|
||||
.percentage=${12}
|
||||
statusText="Preparing archive and dependency graph..."
|
||||
.statusRows=${2}
|
||||
></dees-progressbar>
|
||||
</section>
|
||||
|
||||
<section class="showcaseCard">
|
||||
<div class="codeLabel">Compatibility</div>
|
||||
<h3>Legacy <code>value</code> and <code>progress</code> inputs</h3>
|
||||
<p>Existing usages can keep passing percentages directly or normalized progress values from 0 to 1.</p>
|
||||
<div class="progressStack">
|
||||
<dees-progressbar
|
||||
label="From value"
|
||||
.value=${75}
|
||||
statusText="Migrating existing readme-style usage..."
|
||||
.statusRows=${2}
|
||||
></dees-progressbar>
|
||||
<dees-progressbar
|
||||
label="From progress"
|
||||
.progress=${0.42}
|
||||
.showPercentage=${false}
|
||||
statusText="Rendering normalized progress input..."
|
||||
.statusRows=${2}
|
||||
></dees-progressbar>
|
||||
</div>
|
||||
</section>
|
||||
</div>
|
||||
</div>
|
||||
</dees-demowrapper>
|
||||
`;
|
||||
}
|
||||
};
|
||||
|
||||
@@ -1,4 +1,3 @@
|
||||
import * as plugins from '../../00plugins.js';
|
||||
import * as colors from '../../00colors.js';
|
||||
import { demoFunc } from './dees-progressbar.demo.js';
|
||||
import {
|
||||
@@ -6,94 +5,342 @@ import {
|
||||
html,
|
||||
DeesElement,
|
||||
property,
|
||||
type TemplateResult,
|
||||
cssManager,
|
||||
css,
|
||||
type CSSResult,
|
||||
unsafeCSS,
|
||||
unsafeHTML,
|
||||
state,
|
||||
} from '@design.estate/dees-element';
|
||||
|
||||
import * as domtools from '@design.estate/dees-domtools';
|
||||
import { themeDefaultStyles } from '../../00theme.js';
|
||||
|
||||
declare global {
|
||||
interface HTMLElementTagNameMap {
|
||||
'dees-progressbar': DeesProgressbar;
|
||||
}
|
||||
}
|
||||
|
||||
@customElement('dees-progressbar')
|
||||
export class DeesProgressbar extends DeesElement {
|
||||
// STATIC
|
||||
public static demo = demoFunc;
|
||||
public static demoGroups = ['Feedback'];
|
||||
|
||||
// INSTANCE
|
||||
@property({
|
||||
type: Number,
|
||||
})
|
||||
accessor percentage = 0;
|
||||
|
||||
// `value` and `progress` keep existing readme/internal usages working.
|
||||
@property({
|
||||
type: Number,
|
||||
})
|
||||
accessor value: number | null = null;
|
||||
|
||||
@property({
|
||||
type: Number,
|
||||
})
|
||||
accessor progress: number | null = null;
|
||||
|
||||
@property({
|
||||
type: String,
|
||||
})
|
||||
accessor label = '';
|
||||
|
||||
@property({
|
||||
type: String,
|
||||
})
|
||||
accessor statusText = '';
|
||||
|
||||
@property({
|
||||
type: Array,
|
||||
})
|
||||
accessor terminalLines: string[] = [];
|
||||
|
||||
@property({
|
||||
type: Number,
|
||||
})
|
||||
accessor statusRows = 3;
|
||||
|
||||
@property({
|
||||
type: Boolean,
|
||||
})
|
||||
accessor indeterminate = false;
|
||||
|
||||
@property({
|
||||
type: Boolean,
|
||||
})
|
||||
accessor showPercentage = true;
|
||||
|
||||
@state()
|
||||
accessor activeSpinnerFrame = 0;
|
||||
|
||||
private spinnerIntervalId: number | null = null;
|
||||
private readonly spinnerFrames = ['|', '/', '-', '\\'];
|
||||
|
||||
public static styles = [
|
||||
themeDefaultStyles,
|
||||
cssManager.defaultStyles,
|
||||
css`
|
||||
/* TODO: Migrate hardcoded values to --dees-* CSS variables */
|
||||
:host {
|
||||
display: block;
|
||||
color: ${cssManager.bdTheme(colors.bright.text, colors.dark.text)};
|
||||
}
|
||||
|
||||
.progressBarContainer {
|
||||
padding: 8px;
|
||||
min-width: 200px;
|
||||
padding: 8px;
|
||||
box-sizing: border-box;
|
||||
}
|
||||
|
||||
.progressHeader {
|
||||
display: flex;
|
||||
justify-content: space-between;
|
||||
align-items: baseline;
|
||||
gap: 12px;
|
||||
margin-bottom: 8px;
|
||||
}
|
||||
|
||||
.progressLabel {
|
||||
font-size: 14px;
|
||||
font-weight: 500;
|
||||
line-height: 1.3;
|
||||
}
|
||||
|
||||
.progressValue {
|
||||
font-size: 12px;
|
||||
line-height: 1.3;
|
||||
color: ${cssManager.bdTheme('hsl(215 15% 40%)', 'hsl(215 15% 70%)')};
|
||||
font-family: 'SF Mono', 'Monaco', 'Inconsolata', 'Fira Code', monospace;
|
||||
}
|
||||
|
||||
.progressBar {
|
||||
background: ${cssManager.bdTheme('#eeeeeb', '#444')};
|
||||
height: 8px;
|
||||
position: relative;
|
||||
overflow: hidden;
|
||||
width: 100%;
|
||||
border-radius: 4px;
|
||||
border-top: 0.5px solid ${cssManager.bdTheme('none', '#555')};
|
||||
height: 8px;
|
||||
border-radius: 999px;
|
||||
background: ${cssManager.bdTheme('#eeeeeb', '#444')};
|
||||
border-top: 0.5px solid ${cssManager.bdTheme('transparent', '#555')};
|
||||
}
|
||||
|
||||
.progressBarFill {
|
||||
height: 100%;
|
||||
border-radius: inherit;
|
||||
background: ${cssManager.bdTheme(colors.dark.blueActive, colors.bright.blueActive)};
|
||||
height: 8px;
|
||||
margin-top: -0.5px;
|
||||
transition: 0.2s width;
|
||||
border-radius: 4px;
|
||||
width: 0px;
|
||||
border-top: 0.5 solid ${cssManager.bdTheme('none', '#398fff')};
|
||||
transition: width 0.2s ease;
|
||||
}
|
||||
|
||||
.progressText {
|
||||
padding: 8px;
|
||||
.progressBarFill.indeterminate {
|
||||
width: 34%;
|
||||
transition: none;
|
||||
animation: indeterminateSlide 1.2s ease-in-out infinite;
|
||||
}
|
||||
|
||||
.statusPanel {
|
||||
margin-top: 10px;
|
||||
height: calc(var(--status-rows, 3) * 1.35em + 16px);
|
||||
min-height: calc(var(--status-rows, 3) * 1.35em + 16px);
|
||||
padding: 8px 10px;
|
||||
box-sizing: border-box;
|
||||
border-radius: 8px;
|
||||
border: 1px solid ${cssManager.bdTheme('hsl(210 20% 86%)', 'hsl(210 10% 26%)')};
|
||||
background: ${cssManager.bdTheme('hsl(210 33% 98%)', 'hsl(220 20% 10%)')};
|
||||
font-family: 'SF Mono', 'Monaco', 'Inconsolata', 'Fira Code', monospace;
|
||||
font-size: 12px;
|
||||
line-height: 1.35;
|
||||
overflow: hidden;
|
||||
}
|
||||
|
||||
.statusTextRow,
|
||||
.terminalLine {
|
||||
display: flex;
|
||||
align-items: flex-start;
|
||||
gap: 8px;
|
||||
min-height: 1.35em;
|
||||
}
|
||||
|
||||
.terminalScroller {
|
||||
height: 100%;
|
||||
overflow: auto;
|
||||
}
|
||||
|
||||
.terminalScroller::-webkit-scrollbar {
|
||||
width: 6px;
|
||||
}
|
||||
|
||||
.terminalScroller::-webkit-scrollbar-thumb {
|
||||
background: ${cssManager.bdTheme('hsl(215 18% 78%)', 'hsl(215 10% 34%)')};
|
||||
border-radius: 999px;
|
||||
}
|
||||
|
||||
.terminalScroller::-webkit-scrollbar-track {
|
||||
background: transparent;
|
||||
}
|
||||
|
||||
.linePrefix {
|
||||
width: 1ch;
|
||||
flex: 0 0 1ch;
|
||||
color: ${cssManager.bdTheme(colors.dark.blueActive, colors.bright.blueActive)};
|
||||
text-align: center;
|
||||
}
|
||||
`
|
||||
|
||||
.lineText {
|
||||
flex: 1;
|
||||
min-width: 0;
|
||||
color: ${cssManager.bdTheme('hsl(220 15% 25%)', 'hsl(210 15% 86%)')};
|
||||
white-space: pre-wrap;
|
||||
word-break: break-word;
|
||||
}
|
||||
|
||||
.terminalLine:not(.current) .lineText {
|
||||
color: ${cssManager.bdTheme('hsl(215 12% 42%)', 'hsl(215 12% 63%)')};
|
||||
}
|
||||
|
||||
@keyframes indeterminateSlide {
|
||||
0% {
|
||||
transform: translateX(-120%);
|
||||
}
|
||||
|
||||
100% {
|
||||
transform: translateX(320%);
|
||||
}
|
||||
}
|
||||
`,
|
||||
];
|
||||
|
||||
public async connectedCallback(): Promise<void> {
|
||||
await super.connectedCallback();
|
||||
this.syncSpinnerState();
|
||||
}
|
||||
|
||||
public async disconnectedCallback(): Promise<void> {
|
||||
this.stopSpinner();
|
||||
await super.disconnectedCallback();
|
||||
}
|
||||
|
||||
public updated(changedProperties: Map<string | number | symbol, unknown>): void {
|
||||
super.updated(changedProperties);
|
||||
this.syncSpinnerState();
|
||||
|
||||
if (changedProperties.has('terminalLines') && this.terminalLines.length > 0) {
|
||||
this.scrollTerminalToBottom();
|
||||
}
|
||||
}
|
||||
|
||||
public render() {
|
||||
const effectivePercentage = this.getEffectivePercentage();
|
||||
const showHeader = Boolean(this.label) || (this.showPercentage && !this.indeterminate);
|
||||
const hasTerminalLines = this.terminalLines.length > 0;
|
||||
const hasStatusContent = hasTerminalLines || this.statusText.trim().length > 0;
|
||||
const renderedRows = this.getRenderedStatusRows();
|
||||
const spinnerFrame = this.spinnerFrames[this.activeSpinnerFrame] ?? this.spinnerFrames[0];
|
||||
|
||||
return html`
|
||||
<div class="progressBarContainer">
|
||||
${showHeader ? html`
|
||||
<div class="progressHeader">
|
||||
<div class="progressLabel">${this.label}</div>
|
||||
${this.showPercentage && !this.indeterminate ? html`
|
||||
<div class="progressValue">${this.formatPercentage(effectivePercentage)}%</div>
|
||||
` : ''}
|
||||
</div>
|
||||
` : ''}
|
||||
<div class="progressBar">
|
||||
<div class="progressBarFill"></div>
|
||||
<div class="progressText">
|
||||
${this.percentage}%
|
||||
<div>
|
||||
<div
|
||||
class="progressBarFill ${this.indeterminate ? 'indeterminate' : ''}"
|
||||
style="${this.indeterminate ? '' : `width: ${effectivePercentage}%;`}"
|
||||
></div>
|
||||
</div>
|
||||
${hasStatusContent ? html`
|
||||
<div
|
||||
class="statusPanel"
|
||||
style="--status-rows: ${renderedRows};"
|
||||
aria-live="polite"
|
||||
aria-atomic="true"
|
||||
>
|
||||
${hasTerminalLines ? html`
|
||||
<div class="terminalScroller">
|
||||
${this.terminalLines.map((line, index) => {
|
||||
const isCurrentLine = index === this.terminalLines.length - 1;
|
||||
const prefix = this.indeterminate && isCurrentLine ? spinnerFrame : '>';
|
||||
return html`
|
||||
<div class="terminalLine ${isCurrentLine ? 'current' : ''}">
|
||||
<span class="linePrefix">${prefix}</span>
|
||||
<span class="lineText">${line}</span>
|
||||
</div>
|
||||
`;
|
||||
})}
|
||||
</div>
|
||||
` : html`
|
||||
<div class="statusTextRow">
|
||||
<span class="linePrefix">${this.indeterminate ? spinnerFrame : '>'}</span>
|
||||
<span class="lineText">${this.statusText}</span>
|
||||
</div>
|
||||
`}
|
||||
</div>
|
||||
` : ''}
|
||||
</div>
|
||||
`
|
||||
`;
|
||||
}
|
||||
|
||||
firstUpdated (_changedProperties: Map<string | number | symbol, unknown>): void {
|
||||
super.firstUpdated(_changedProperties);
|
||||
this.updateComplete.then(() => {
|
||||
this.updatePercentage();
|
||||
private getEffectivePercentage(): number {
|
||||
if (typeof this.value === 'number' && Number.isFinite(this.value)) {
|
||||
return this.clampPercentage(this.value);
|
||||
}
|
||||
|
||||
if (typeof this.progress === 'number' && Number.isFinite(this.progress)) {
|
||||
const normalizedProgress = this.progress >= 0 && this.progress <= 1
|
||||
? this.progress * 100
|
||||
: this.progress;
|
||||
return this.clampPercentage(normalizedProgress);
|
||||
}
|
||||
|
||||
return this.clampPercentage(this.percentage);
|
||||
}
|
||||
|
||||
private getRenderedStatusRows(): number {
|
||||
const rows = Number.isFinite(this.statusRows) ? Math.floor(this.statusRows) : 3;
|
||||
return Math.max(1, rows);
|
||||
}
|
||||
|
||||
private clampPercentage(input: number): number {
|
||||
return Math.max(0, Math.min(100, input));
|
||||
}
|
||||
|
||||
private formatPercentage(input: number): string {
|
||||
return Number.isInteger(input) ? `${input}` : input.toFixed(1).replace(/\.0$/, '');
|
||||
}
|
||||
|
||||
private syncSpinnerState(): void {
|
||||
const shouldAnimate = this.indeterminate && (this.statusText.trim().length > 0 || this.terminalLines.length > 0);
|
||||
|
||||
if (shouldAnimate && this.spinnerIntervalId === null) {
|
||||
this.spinnerIntervalId = window.setInterval(() => {
|
||||
this.activeSpinnerFrame = (this.activeSpinnerFrame + 1) % this.spinnerFrames.length;
|
||||
}, 120);
|
||||
return;
|
||||
}
|
||||
|
||||
if (!shouldAnimate) {
|
||||
this.stopSpinner();
|
||||
}
|
||||
}
|
||||
|
||||
private stopSpinner(): void {
|
||||
if (this.spinnerIntervalId !== null) {
|
||||
window.clearInterval(this.spinnerIntervalId);
|
||||
this.spinnerIntervalId = null;
|
||||
}
|
||||
|
||||
this.activeSpinnerFrame = 0;
|
||||
}
|
||||
|
||||
private scrollTerminalToBottom(): void {
|
||||
const terminalScroller = this.shadowRoot?.querySelector('.terminalScroller') as HTMLElement | null;
|
||||
|
||||
if (!terminalScroller) {
|
||||
return;
|
||||
}
|
||||
|
||||
window.requestAnimationFrame(() => {
|
||||
terminalScroller.scrollTop = terminalScroller.scrollHeight;
|
||||
});
|
||||
}
|
||||
|
||||
public async updatePercentage() {
|
||||
const progressBarFill = this.shadowRoot!.querySelector('.progressBarFill') as HTMLElement;
|
||||
progressBarFill.style.width = `${this.percentage}%`;
|
||||
}
|
||||
|
||||
updated(){
|
||||
this.updatePercentage();
|
||||
}
|
||||
}
|
||||
@@ -1,7 +1,45 @@
|
||||
import { html } from '@design.estate/dees-element';
|
||||
import { DeesStepper, type IStep } from './dees-stepper.js';
|
||||
|
||||
const demoSteps: IStep[] = [
|
||||
const waitForProgressTick = async (timeoutArg: number, signal?: AbortSignal): Promise<boolean> => {
|
||||
return new Promise((resolve) => {
|
||||
let completed = false;
|
||||
|
||||
const finish = (result: boolean) => {
|
||||
if (completed) {
|
||||
return;
|
||||
}
|
||||
|
||||
completed = true;
|
||||
if (signal) {
|
||||
signal.removeEventListener('abort', handleAbort);
|
||||
}
|
||||
resolve(result);
|
||||
};
|
||||
|
||||
const handleAbort = () => {
|
||||
window.clearTimeout(timeoutId);
|
||||
finish(false);
|
||||
};
|
||||
|
||||
const timeoutId = window.setTimeout(() => {
|
||||
finish(true);
|
||||
}, timeoutArg);
|
||||
|
||||
if (signal) {
|
||||
signal.addEventListener('abort', handleAbort, { once: true });
|
||||
}
|
||||
});
|
||||
};
|
||||
|
||||
const createContinueMenuOptions = (labelArg = 'Continue') => [
|
||||
{
|
||||
name: labelArg,
|
||||
action: async (stepper?: DeesStepper) => stepper?.goNext(),
|
||||
},
|
||||
];
|
||||
|
||||
const createDemoSteps = (): IStep[] => [
|
||||
{
|
||||
title: 'Account Setup',
|
||||
content: html`
|
||||
@@ -10,9 +48,7 @@ const demoSteps: IStep[] = [
|
||||
<dees-input-text key="password" label="Create Password" type="password" required></dees-input-text>
|
||||
</dees-form>
|
||||
`,
|
||||
menuOptions: [
|
||||
{ name: 'Continue', action: async (stepper) => stepper!.goNext() },
|
||||
],
|
||||
menuOptions: createContinueMenuOptions(),
|
||||
},
|
||||
{
|
||||
title: 'Profile Details',
|
||||
@@ -22,9 +58,7 @@ const demoSteps: IStep[] = [
|
||||
<dees-input-text key="lastName" label="Last Name" required></dees-input-text>
|
||||
</dees-form>
|
||||
`,
|
||||
menuOptions: [
|
||||
{ name: 'Continue', action: async (stepper) => stepper!.goNext() },
|
||||
],
|
||||
menuOptions: createContinueMenuOptions(),
|
||||
},
|
||||
{
|
||||
title: 'Contact Information',
|
||||
@@ -34,9 +68,74 @@ const demoSteps: IStep[] = [
|
||||
<dees-input-text key="company" label="Company"></dees-input-text>
|
||||
</dees-form>
|
||||
`,
|
||||
menuOptions: [
|
||||
{ name: 'Continue', action: async (stepper) => stepper!.goNext() },
|
||||
],
|
||||
menuOptions: createContinueMenuOptions(),
|
||||
},
|
||||
{
|
||||
title: 'Provision Workspace',
|
||||
content: html`
|
||||
<dees-panel>
|
||||
<p>
|
||||
We are creating your starter workspace, applying your onboarding choices,
|
||||
and preparing a live preview. This step moves forward automatically when
|
||||
the environment is ready.
|
||||
</p>
|
||||
</dees-panel>
|
||||
`,
|
||||
progressStep: {
|
||||
label: 'Workspace setup',
|
||||
percentage: 8,
|
||||
indeterminate: true,
|
||||
statusRows: 4,
|
||||
statusText: 'Allocating a clean workspace...',
|
||||
terminalLines: ['Allocating a clean workspace'],
|
||||
},
|
||||
validationFunc: async (stepper, _htmlElement, signal) => {
|
||||
const progressFrames = [
|
||||
{ line: 'Allocating a clean workspace', percentage: 8, delay: 500 },
|
||||
{ line: 'Syncing account preferences', percentage: 24, delay: 650 },
|
||||
{ line: 'Installing selected integrations', percentage: 47, delay: 700 },
|
||||
{ line: 'Generating starter project files', percentage: 71, delay: 650 },
|
||||
{ line: 'Booting the live preview environment', percentage: 92, delay: 700 },
|
||||
];
|
||||
|
||||
stepper.resetProgressStep();
|
||||
|
||||
for (const [index, progressFrame] of progressFrames.entries()) {
|
||||
if (signal?.aborted) {
|
||||
return;
|
||||
}
|
||||
|
||||
if (index === 0) {
|
||||
stepper.updateProgressStep({
|
||||
percentage: progressFrame.percentage,
|
||||
indeterminate: true,
|
||||
statusText: `${progressFrame.line}...`,
|
||||
terminalLines: [progressFrame.line],
|
||||
});
|
||||
} else {
|
||||
stepper.appendProgressStepLine(progressFrame.line);
|
||||
stepper.updateProgressStep({
|
||||
percentage: progressFrame.percentage,
|
||||
indeterminate: true,
|
||||
statusText: `${progressFrame.line}...`,
|
||||
});
|
||||
}
|
||||
|
||||
const completed = await waitForProgressTick(progressFrame.delay, signal);
|
||||
if (!completed) {
|
||||
return;
|
||||
}
|
||||
}
|
||||
|
||||
stepper.appendProgressStepLine('Workspace ready');
|
||||
stepper.updateProgressStep({
|
||||
percentage: 100,
|
||||
indeterminate: false,
|
||||
statusText: 'Workspace ready.',
|
||||
});
|
||||
|
||||
await waitForProgressTick(350, signal);
|
||||
},
|
||||
},
|
||||
{
|
||||
title: 'Team Size',
|
||||
@@ -55,9 +154,7 @@ const demoSteps: IStep[] = [
|
||||
></dees-input-dropdown>
|
||||
</dees-form>
|
||||
`,
|
||||
menuOptions: [
|
||||
{ name: 'Continue', action: async (stepper) => stepper!.goNext() },
|
||||
],
|
||||
menuOptions: createContinueMenuOptions(),
|
||||
},
|
||||
{
|
||||
title: 'Goals',
|
||||
@@ -75,52 +172,31 @@ const demoSteps: IStep[] = [
|
||||
></dees-input-multitoggle>
|
||||
</dees-form>
|
||||
`,
|
||||
menuOptions: [
|
||||
{ name: 'Continue', action: async (stepper) => stepper!.goNext() },
|
||||
],
|
||||
},
|
||||
{
|
||||
title: 'Brand Preferences',
|
||||
content: html`
|
||||
<dees-form>
|
||||
<dees-input-text key="brandColor" label="Primary brand color"></dees-input-text>
|
||||
<dees-input-text key="tone" label="Preferred tone (e.g. friendly, formal)"></dees-input-text>
|
||||
</dees-form>
|
||||
`,
|
||||
menuOptions: [
|
||||
{ name: 'Continue', action: async (stepper) => stepper!.goNext() },
|
||||
],
|
||||
},
|
||||
{
|
||||
title: 'Integrations',
|
||||
content: html`
|
||||
<dees-form>
|
||||
<dees-input-list
|
||||
key="integrations"
|
||||
label="Integrations in use"
|
||||
placeholder="Add integration"
|
||||
></dees-input-list>
|
||||
</dees-form>
|
||||
`,
|
||||
menuOptions: [
|
||||
{ name: 'Continue', action: async (stepper) => stepper!.goNext() },
|
||||
],
|
||||
menuOptions: createContinueMenuOptions(),
|
||||
},
|
||||
{
|
||||
title: 'Review & Launch',
|
||||
content: html`
|
||||
<dees-panel>
|
||||
<p>Almost there! Review your selections and launch whenever you're ready.</p>
|
||||
<p>
|
||||
Your workspace is ready. Review the collected details and launch when
|
||||
you are ready to start.
|
||||
</p>
|
||||
</dees-panel>
|
||||
`,
|
||||
menuOptions: [
|
||||
{ name: 'Launch', action: async (stepper) => stepper!.goNext() },
|
||||
{
|
||||
name: 'Launch',
|
||||
action: async (stepper?: DeesStepper) => {
|
||||
if (stepper?.overlay) {
|
||||
await stepper.destroy();
|
||||
}
|
||||
},
|
||||
},
|
||||
],
|
||||
},
|
||||
];
|
||||
|
||||
const cloneSteps = (): IStep[] => demoSteps.map((step) => ({ ...step }));
|
||||
|
||||
export const stepperDemo = () => html`
|
||||
<div style="position: absolute; inset: 0;">
|
||||
<div
|
||||
@@ -128,10 +204,10 @@ export const stepperDemo = () => html`
|
||||
>
|
||||
<dees-button
|
||||
@click=${async () => {
|
||||
await DeesStepper.createAndShow({ steps: cloneSteps() });
|
||||
await DeesStepper.createAndShow({ steps: createDemoSteps() });
|
||||
}}
|
||||
>Open stepper as overlay</dees-button>
|
||||
</div>
|
||||
<dees-stepper .steps=${cloneSteps()}></dees-stepper>
|
||||
<dees-stepper .steps=${createDemoSteps()}></dees-stepper>
|
||||
</div>
|
||||
`;
|
||||
|
||||
@@ -5,8 +5,6 @@ import {
|
||||
customElement,
|
||||
html,
|
||||
css,
|
||||
unsafeCSS,
|
||||
type CSSResult,
|
||||
cssManager,
|
||||
property,
|
||||
type TemplateResult,
|
||||
@@ -20,16 +18,33 @@ import { zIndexRegistry } from '../../00zindex.js';
|
||||
import { DeesWindowLayer } from '../../00group-overlay/dees-windowlayer/dees-windowlayer.js';
|
||||
import { DeesModal } from '../../00group-overlay/dees-modal/dees-modal.js';
|
||||
import type { DeesForm } from '../../00group-form/dees-form/dees-form.js';
|
||||
import '../../00group-feedback/dees-progressbar/dees-progressbar.js';
|
||||
import '../dees-tile/dees-tile.js';
|
||||
|
||||
export interface IStepProgressState {
|
||||
label?: string;
|
||||
percentage?: number;
|
||||
indeterminate?: boolean;
|
||||
showPercentage?: boolean;
|
||||
statusText?: string;
|
||||
terminalLines?: string[];
|
||||
statusRows?: number;
|
||||
}
|
||||
|
||||
export interface IStepProgress extends IStepProgressState {
|
||||
autoAdvance?: boolean;
|
||||
}
|
||||
|
||||
export interface IStep {
|
||||
title: string;
|
||||
content: TemplateResult;
|
||||
progressStep?: IStepProgress;
|
||||
menuOptions?: plugins.tsclass.website.IMenuItem<DeesStepper>[];
|
||||
validationFunc?: (stepper: DeesStepper, htmlElement: HTMLElement, signal?: AbortSignal) => Promise<any>;
|
||||
onReturnToStepFunc?: (stepper: DeesStepper, htmlElement: HTMLElement) => Promise<any>;
|
||||
validationFuncCalled?: boolean;
|
||||
abortController?: AbortController;
|
||||
progressStepState?: IStepProgressState;
|
||||
}
|
||||
|
||||
declare global {
|
||||
@@ -276,6 +291,14 @@ export class DeesStepper extends DeesElement {
|
||||
padding: 32px;
|
||||
}
|
||||
|
||||
.step-body .content.withProgressStep {
|
||||
padding-top: 20px;
|
||||
}
|
||||
|
||||
.progressStep {
|
||||
padding: 0 24px;
|
||||
}
|
||||
|
||||
/* --- Footer: modal-style bottom buttons --- */
|
||||
.bottomButtons {
|
||||
display: flex;
|
||||
@@ -375,6 +398,7 @@ export class DeesStepper extends DeesElement {
|
||||
const isHidden =
|
||||
this.getIndexOfStep(stepArg) > this.getIndexOfStep(this.selectedStep);
|
||||
const isFirst = stepIndex === 0;
|
||||
const progressStepState = stepArg.progressStep ? this.getProgressStepState(stepArg) : null;
|
||||
return html`<dees-tile
|
||||
class="step ${isSelected ? 'selected' : ''} ${isHidden ? 'hiddenStep' : ''} ${isFirst ? 'entrance' : ''}"
|
||||
>
|
||||
@@ -390,7 +414,20 @@ export class DeesStepper extends DeesElement {
|
||||
</div>
|
||||
<div class="step-body">
|
||||
<div class="title">${stepArg.title}</div>
|
||||
<div class="content">${stepArg.content}</div>
|
||||
${stepArg.progressStep && progressStepState ? html`
|
||||
<div class="progressStep">
|
||||
<dees-progressbar
|
||||
.label=${progressStepState.label ?? stepArg.title}
|
||||
.percentage=${progressStepState.percentage ?? 0}
|
||||
.indeterminate=${progressStepState.indeterminate ?? false}
|
||||
.showPercentage=${progressStepState.showPercentage ?? true}
|
||||
.statusText=${progressStepState.statusText ?? ''}
|
||||
.terminalLines=${progressStepState.terminalLines ?? []}
|
||||
.statusRows=${progressStepState.statusRows ?? 3}
|
||||
></dees-progressbar>
|
||||
</div>
|
||||
` : ''}
|
||||
<div class="content ${stepArg.progressStep ? 'withProgressStep' : ''}">${stepArg.content}</div>
|
||||
</div>
|
||||
<div slot="footer" class="bottomButtons">
|
||||
${isSelected && this.activeForm !== null && !this.activeFormValid
|
||||
@@ -426,22 +463,30 @@ export class DeesStepper extends DeesElement {
|
||||
public async firstUpdated() {
|
||||
await this.domtoolsPromise;
|
||||
await this.domtools.convenience.smartdelay.delayFor(0);
|
||||
if (!this.steps.length) {
|
||||
return;
|
||||
}
|
||||
this.prepareStepForActivation(this.steps[0]);
|
||||
this.selectedStep = this.steps[0];
|
||||
this.setScrollStatus();
|
||||
await this.updateComplete;
|
||||
await this.setScrollStatus();
|
||||
// Remove entrance class after initial animation completes
|
||||
await this.domtools.convenience.smartdelay.delayFor(350);
|
||||
this.shadowRoot!.querySelector('.step.entrance')?.classList.remove('entrance');
|
||||
}
|
||||
|
||||
public async updated() {
|
||||
this.setScrollStatus();
|
||||
public async updated(changedProperties: Map<string | number | symbol, unknown>) {
|
||||
if (!changedProperties.has('selectedStep') && !changedProperties.has('steps')) {
|
||||
return;
|
||||
}
|
||||
|
||||
await this.setScrollStatus();
|
||||
}
|
||||
|
||||
public scroller!: typeof domtools.plugins.SweetScroll.prototype;
|
||||
|
||||
public async setScrollStatus() {
|
||||
const stepperContainer = this.shadowRoot!.querySelector('.stepperContainer') as HTMLElement;
|
||||
const firstStepElement = this.shadowRoot!.querySelector('.step') as HTMLElement;
|
||||
const selectedStepElement = this.shadowRoot!.querySelector('.selected') as HTMLElement;
|
||||
if (!selectedStepElement) {
|
||||
return;
|
||||
@@ -452,14 +497,11 @@ export class DeesStepper extends DeesElement {
|
||||
stepperContainer.offsetHeight / 2 - selectedStepElement.offsetHeight / 2
|
||||
}px`;
|
||||
}
|
||||
console.log('Setting scroll status');
|
||||
console.log(selectedStepElement);
|
||||
const scrollPosition =
|
||||
selectedStepElement.offsetTop -
|
||||
stepperContainer.offsetHeight / 2 +
|
||||
selectedStepElement.offsetHeight / 2;
|
||||
console.log(scrollPosition);
|
||||
const domtoolsInstance = await domtools.DomTools.setupDomTools();
|
||||
await domtools.DomTools.setupDomTools();
|
||||
if (!this.scroller) {
|
||||
this.scroller = new domtools.plugins.SweetScroll(
|
||||
{
|
||||
@@ -474,7 +516,11 @@ export class DeesStepper extends DeesElement {
|
||||
if (!this.selectedStep.validationFuncCalled && this.selectedStep.validationFunc) {
|
||||
this.selectedStep.abortController = new AbortController();
|
||||
this.selectedStep.validationFuncCalled = true;
|
||||
await this.selectedStep.validationFunc(this, selectedStepElement, this.selectedStep.abortController.signal);
|
||||
void this.runStepValidation(
|
||||
this.selectedStep,
|
||||
selectedStepElement,
|
||||
this.selectedStep.abortController.signal,
|
||||
);
|
||||
}
|
||||
this.scroller.to(scrollPosition);
|
||||
}
|
||||
@@ -492,6 +538,7 @@ export class DeesStepper extends DeesElement {
|
||||
currentStep.validationFuncCalled = false;
|
||||
const previousStep = this.steps[currentIndex - 1];
|
||||
previousStep.validationFuncCalled = false;
|
||||
this.prepareStepForActivation(previousStep);
|
||||
this.selectedStep = previousStep;
|
||||
await this.domtoolsPromise;
|
||||
await this.domtools.convenience.smartdelay.delayFor(100);
|
||||
@@ -511,9 +558,52 @@ export class DeesStepper extends DeesElement {
|
||||
currentStep.validationFuncCalled = false;
|
||||
const nextStep = this.steps[currentIndex + 1];
|
||||
nextStep.validationFuncCalled = false;
|
||||
this.prepareStepForActivation(nextStep);
|
||||
this.selectedStep = nextStep;
|
||||
}
|
||||
|
||||
public resetProgressStep(stepArg: IStep = this.selectedStep) {
|
||||
if (!stepArg?.progressStep) {
|
||||
return;
|
||||
}
|
||||
|
||||
stepArg.progressStepState = this.createInitialProgressStepState(stepArg);
|
||||
this.requestUpdate();
|
||||
}
|
||||
|
||||
public updateProgressStep(
|
||||
progressStateArg: Partial<IStepProgressState>,
|
||||
stepArg: IStep = this.selectedStep,
|
||||
) {
|
||||
if (!stepArg?.progressStep) {
|
||||
return;
|
||||
}
|
||||
|
||||
const currentProgressState = this.getProgressStepState(stepArg);
|
||||
stepArg.progressStepState = {
|
||||
...currentProgressState,
|
||||
...progressStateArg,
|
||||
terminalLines: progressStateArg.terminalLines
|
||||
? [...progressStateArg.terminalLines]
|
||||
: [...(currentProgressState.terminalLines ?? [])],
|
||||
};
|
||||
this.requestUpdate();
|
||||
}
|
||||
|
||||
public appendProgressStepLine(lineArg: string, stepArg: IStep = this.selectedStep) {
|
||||
if (!stepArg?.progressStep) {
|
||||
return;
|
||||
}
|
||||
|
||||
const currentProgressState = this.getProgressStepState(stepArg);
|
||||
this.updateProgressStep(
|
||||
{
|
||||
terminalLines: [...(currentProgressState.terminalLines ?? []), lineArg],
|
||||
},
|
||||
stepArg,
|
||||
);
|
||||
}
|
||||
|
||||
/**
|
||||
* Scans the currently selected step for a <dees-form> in its content. When
|
||||
* found, subscribes to the form's RxJS changeSubject so the primary
|
||||
@@ -582,6 +672,74 @@ export class DeesStepper extends DeesElement {
|
||||
await optionArg.action(this);
|
||||
}
|
||||
|
||||
private getProgressStepState(stepArg: IStep): IStepProgressState {
|
||||
if (!stepArg.progressStep) {
|
||||
return {};
|
||||
}
|
||||
|
||||
if (!stepArg.progressStepState) {
|
||||
stepArg.progressStepState = this.createInitialProgressStepState(stepArg);
|
||||
}
|
||||
|
||||
return stepArg.progressStepState;
|
||||
}
|
||||
|
||||
private createInitialProgressStepState(stepArg: IStep): IStepProgressState {
|
||||
return {
|
||||
label: stepArg.progressStep?.label ?? stepArg.title,
|
||||
percentage: stepArg.progressStep?.percentage ?? 0,
|
||||
indeterminate: stepArg.progressStep?.indeterminate ?? false,
|
||||
showPercentage: stepArg.progressStep?.showPercentage ?? true,
|
||||
statusText: stepArg.progressStep?.statusText ?? '',
|
||||
terminalLines: [...(stepArg.progressStep?.terminalLines ?? [])],
|
||||
statusRows: stepArg.progressStep?.statusRows ?? 3,
|
||||
};
|
||||
}
|
||||
|
||||
private prepareStepForActivation(stepArg?: IStep) {
|
||||
if (!stepArg?.progressStep) {
|
||||
return;
|
||||
}
|
||||
|
||||
stepArg.progressStepState = this.createInitialProgressStepState(stepArg);
|
||||
}
|
||||
|
||||
private async runStepValidation(
|
||||
stepArg: IStep,
|
||||
selectedStepElement: HTMLElement,
|
||||
signal: AbortSignal,
|
||||
): Promise<void> {
|
||||
try {
|
||||
await stepArg.validationFunc?.(this, selectedStepElement, signal);
|
||||
|
||||
if (signal.aborted) {
|
||||
return;
|
||||
}
|
||||
|
||||
if (stepArg.progressStep && stepArg.progressStep.autoAdvance !== false && this.selectedStep === stepArg) {
|
||||
this.goNext();
|
||||
}
|
||||
} catch (error) {
|
||||
if (signal.aborted) {
|
||||
return;
|
||||
}
|
||||
|
||||
if (stepArg.progressStep) {
|
||||
const errorText = error instanceof Error ? error.message : 'Unexpected error';
|
||||
this.appendProgressStepLine(`Error: ${errorText}`, stepArg);
|
||||
this.updateProgressStep(
|
||||
{
|
||||
indeterminate: false,
|
||||
statusText: errorText,
|
||||
},
|
||||
stepArg,
|
||||
);
|
||||
}
|
||||
|
||||
console.error(error);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Currently-open confirmation modal (if any). Prevents double-stacking when
|
||||
* the user clicks the backdrop or the Cancel button while a confirm modal
|
||||
@@ -657,6 +815,9 @@ export class DeesStepper extends DeesElement {
|
||||
public async destroy() {
|
||||
const domtools = await this.domtoolsPromise;
|
||||
const container = this.shadowRoot!.querySelector('.stepperContainer');
|
||||
if (this.selectedStep?.abortController) {
|
||||
this.selectedStep.abortController.abort();
|
||||
}
|
||||
container?.classList.add('predestroy');
|
||||
await domtools.convenience.smartdelay.delayFor(250);
|
||||
if (this.parentElement) {
|
||||
|
||||
@@ -2,9 +2,73 @@ import { html } from '@design.estate/dees-element';
|
||||
|
||||
import { DeesUpdater } from '../dees-updater/dees-updater.js';
|
||||
|
||||
export const demoFunc = async () => {
|
||||
const updater = await DeesUpdater.createAndShow();
|
||||
setTimeout(async () => {
|
||||
await updater.destroy();
|
||||
}, 10000);
|
||||
}
|
||||
const waitForDemoStep = async (timeoutArg: number): Promise<void> => {
|
||||
await new Promise<void>((resolve) => {
|
||||
window.setTimeout(() => resolve(), timeoutArg);
|
||||
});
|
||||
};
|
||||
|
||||
export const demoFunc = () => {
|
||||
let updaterRunning = false;
|
||||
|
||||
return html`
|
||||
<div style="display: grid; gap: 16px; place-items: center; padding: 32px; text-align: center;">
|
||||
<p style="margin: 0; max-width: 540px; line-height: 1.6; color: var(--dees-color-text-secondary);">
|
||||
Launches the updater as a stepper flow. The first step streams terminal-style
|
||||
progress updates and then moves automatically to the ready step.
|
||||
</p>
|
||||
<dees-button
|
||||
@click=${async () => {
|
||||
if (updaterRunning) {
|
||||
return;
|
||||
}
|
||||
|
||||
updaterRunning = true;
|
||||
|
||||
try {
|
||||
const updater = await DeesUpdater.createAndShow({
|
||||
currentVersion: '3.79.0',
|
||||
updatedVersion: '3.80.0',
|
||||
moreInfoUrl: 'https://code.foss.global/design.estate/dees-catalog',
|
||||
changelogUrl: 'https://code.foss.global/design.estate/dees-catalog/-/blob/main/changelog.md',
|
||||
successAction: 'close',
|
||||
successDelayMs: 10000,
|
||||
});
|
||||
|
||||
const progressFrames = [
|
||||
{ line: 'Checking release manifest', percentage: 12, delay: 550 },
|
||||
{ line: 'Downloading signed bundle', percentage: 33, delay: 700 },
|
||||
{ line: 'Verifying checksum', percentage: 51, delay: 650 },
|
||||
{ line: 'Applying update files', percentage: 74, delay: 800 },
|
||||
{ line: 'Cleaning up previous release', percentage: 91, delay: 600 },
|
||||
];
|
||||
|
||||
updater.updateProgress({
|
||||
statusText: 'Checking release manifest...',
|
||||
terminalLines: ['Checking release manifest'],
|
||||
percentage: 12,
|
||||
indeterminate: true,
|
||||
});
|
||||
|
||||
for (const [index, progressFrame] of progressFrames.entries()) {
|
||||
if (index > 0) {
|
||||
updater.appendProgressLine(progressFrame.line);
|
||||
updater.updateProgress({
|
||||
percentage: progressFrame.percentage,
|
||||
statusText: `${progressFrame.line}...`,
|
||||
});
|
||||
}
|
||||
|
||||
await waitForDemoStep(progressFrame.delay);
|
||||
}
|
||||
|
||||
await updater.markUpdateReady();
|
||||
await waitForDemoStep(10500);
|
||||
} finally {
|
||||
updaterRunning = false;
|
||||
}
|
||||
}}
|
||||
>Show updater flow</dees-button>
|
||||
</div>
|
||||
`;
|
||||
};
|
||||
|
||||
@@ -4,14 +4,27 @@ import {
|
||||
type TemplateResult,
|
||||
html,
|
||||
property,
|
||||
type CSSResult,
|
||||
domtools,
|
||||
css,
|
||||
} from '@design.estate/dees-element';
|
||||
import { demoFunc } from './dees-updater.demo.js';
|
||||
import {
|
||||
DeesStepper,
|
||||
type IStep,
|
||||
type IStepProgressState,
|
||||
} from '../../00group-layout/dees-stepper/dees-stepper.js';
|
||||
|
||||
import '../../00group-overlay/dees-windowlayer/dees-windowlayer.js';
|
||||
import { css, cssManager } from '@design.estate/dees-element';
|
||||
import { themeDefaultStyles } from '../../00theme.js';
|
||||
export type TDeesUpdaterSuccessAction = 'close' | 'reload';
|
||||
|
||||
export interface IDeesUpdaterOptions {
|
||||
currentVersion?: string;
|
||||
updatedVersion?: string;
|
||||
moreInfoUrl?: string;
|
||||
changelogUrl?: string;
|
||||
successAction?: TDeesUpdaterSuccessAction;
|
||||
successDelayMs?: number;
|
||||
successActionLabel?: string;
|
||||
onSuccessAction?: () => Promise<void> | void;
|
||||
}
|
||||
|
||||
declare global {
|
||||
interface HTMLElementTagNameMap {
|
||||
@@ -24,91 +37,393 @@ export class DeesUpdater extends DeesElement {
|
||||
public static demo = demoFunc;
|
||||
public static demoGroups = ['Utility'];
|
||||
|
||||
public static async createAndShow() {
|
||||
public static async createAndShow(optionsArg: IDeesUpdaterOptions = {}) {
|
||||
const updater = new DeesUpdater();
|
||||
updater.currentVersion = optionsArg.currentVersion ?? '';
|
||||
updater.updatedVersion = optionsArg.updatedVersion ?? '';
|
||||
updater.moreInfoUrl = optionsArg.moreInfoUrl ?? '';
|
||||
updater.changelogUrl = optionsArg.changelogUrl ?? '';
|
||||
updater.successAction = optionsArg.successAction ?? 'close';
|
||||
updater.successDelayMs = optionsArg.successDelayMs ?? 10000;
|
||||
updater.successActionLabel = optionsArg.successActionLabel ?? '';
|
||||
updater.onSuccessAction = optionsArg.onSuccessAction ?? null;
|
||||
document.body.appendChild(updater);
|
||||
await updater.show();
|
||||
return updater;
|
||||
}
|
||||
|
||||
@property({
|
||||
type: String,
|
||||
})
|
||||
accessor currentVersion!: string;
|
||||
accessor currentVersion = '';
|
||||
|
||||
@property({
|
||||
type: String,
|
||||
})
|
||||
accessor updatedVersion!: string;
|
||||
accessor updatedVersion = '';
|
||||
|
||||
constructor() {
|
||||
super();
|
||||
domtools.elementBasic.setup();
|
||||
}
|
||||
@property({
|
||||
type: String,
|
||||
})
|
||||
accessor moreInfoUrl = '';
|
||||
|
||||
@property({
|
||||
type: String,
|
||||
})
|
||||
accessor changelogUrl = '';
|
||||
|
||||
@property({
|
||||
type: String,
|
||||
})
|
||||
accessor successAction: TDeesUpdaterSuccessAction = 'close';
|
||||
|
||||
@property({
|
||||
type: Number,
|
||||
})
|
||||
accessor successDelayMs = 10000;
|
||||
|
||||
@property({
|
||||
type: String,
|
||||
})
|
||||
accessor successActionLabel = '';
|
||||
|
||||
private stepper: DeesStepper | null = null;
|
||||
private progressStep: IStep | null = null;
|
||||
private showPromise: Promise<void> | null = null;
|
||||
private onSuccessAction: (() => Promise<void> | void) | null = null;
|
||||
|
||||
public static styles = [
|
||||
themeDefaultStyles,
|
||||
cssManager.defaultStyles,
|
||||
css`
|
||||
/* TODO: Migrate hardcoded values to --dees-* CSS variables */
|
||||
.modalContainer {
|
||||
will-change: transform;
|
||||
position: relative;
|
||||
background: ${cssManager.bdTheme('#eeeeeb', '#222')};
|
||||
max-width: 800px;
|
||||
border-radius: 8px;
|
||||
border-top: 1px solid ${cssManager.bdTheme('#eeeeeb', '#333')};
|
||||
}
|
||||
|
||||
.headingContainer {
|
||||
display: flex;
|
||||
justify-content: center;
|
||||
align-items: center;
|
||||
padding: 40px 40px;
|
||||
}
|
||||
|
||||
h1 {
|
||||
margin: none;
|
||||
font-size: 20px;
|
||||
color: ${cssManager.bdTheme('#333', '#fff')};
|
||||
margin-left: 20px;
|
||||
font-weight: normal;
|
||||
}
|
||||
|
||||
.buttonContainer {
|
||||
display: grid;
|
||||
grid-template-columns: 50% 50%;
|
||||
:host {
|
||||
display: none;
|
||||
}
|
||||
`,
|
||||
];
|
||||
|
||||
public render(): TemplateResult {
|
||||
return html`
|
||||
<dees-windowlayer
|
||||
@clicked="${this.windowLayerClicked}"
|
||||
.options=${{
|
||||
blur: true,
|
||||
}}
|
||||
>
|
||||
<div class="modalContainer">
|
||||
<div class="headingContainer">
|
||||
<dees-spinner .size=${60}></dees-spinner>
|
||||
<h1>Updating the application...</h1>
|
||||
</div>
|
||||
<div class="progress">
|
||||
<dees-progressbar .progress=${0.5}></dees-progressbar>
|
||||
</div>
|
||||
<div class="buttonContainer">
|
||||
<dees-button>More info</dees-button>
|
||||
<dees-button>Changelog</dees-button>
|
||||
</div>
|
||||
</div> </dees-windowlayer
|
||||
>>
|
||||
`;
|
||||
return html``;
|
||||
}
|
||||
|
||||
public async connectedCallback(): Promise<void> {
|
||||
await super.connectedCallback();
|
||||
void this.show();
|
||||
}
|
||||
|
||||
public async show(): Promise<void> {
|
||||
if (this.stepper?.isConnected) {
|
||||
return;
|
||||
}
|
||||
|
||||
if (this.showPromise) {
|
||||
return this.showPromise;
|
||||
}
|
||||
|
||||
this.showPromise = this.openStepperFlow();
|
||||
|
||||
try {
|
||||
await this.showPromise;
|
||||
} finally {
|
||||
this.showPromise = null;
|
||||
}
|
||||
}
|
||||
|
||||
public updateProgress(progressStateArg: Partial<IStepProgressState>) {
|
||||
if (!this.stepper || !this.progressStep) {
|
||||
return;
|
||||
}
|
||||
|
||||
this.stepper.updateProgressStep(progressStateArg, this.progressStep);
|
||||
}
|
||||
|
||||
public appendProgressLine(lineArg: string) {
|
||||
if (!this.stepper || !this.progressStep) {
|
||||
return;
|
||||
}
|
||||
|
||||
this.stepper.appendProgressStepLine(lineArg, this.progressStep);
|
||||
}
|
||||
|
||||
public markUpdateError(messageArg: string) {
|
||||
this.appendProgressLine(`Error: ${messageArg}`);
|
||||
this.updateProgress({
|
||||
indeterminate: false,
|
||||
statusText: messageArg,
|
||||
});
|
||||
}
|
||||
|
||||
public async markUpdateReady() {
|
||||
if (!this.stepper || !this.progressStep) {
|
||||
return;
|
||||
}
|
||||
|
||||
this.stepper.updateProgressStep(
|
||||
{
|
||||
percentage: 100,
|
||||
indeterminate: false,
|
||||
statusText: 'Update ready.',
|
||||
},
|
||||
this.progressStep,
|
||||
);
|
||||
this.stepper.appendProgressStepLine('Update ready', this.progressStep);
|
||||
|
||||
if (this.stepper.selectedStep === this.progressStep) {
|
||||
this.stepper.goNext();
|
||||
}
|
||||
}
|
||||
|
||||
public async destroy() {
|
||||
this.parentElement!.removeChild(this);
|
||||
const stepper = this.stepper;
|
||||
this.stepper = null;
|
||||
this.progressStep = null;
|
||||
|
||||
if (stepper?.isConnected) {
|
||||
await stepper.destroy();
|
||||
}
|
||||
|
||||
if (this.parentElement) {
|
||||
this.parentElement.removeChild(this);
|
||||
}
|
||||
}
|
||||
|
||||
private windowLayerClicked() {}
|
||||
private async openStepperFlow() {
|
||||
const { steps, progressStep } = this.createUpdaterSteps();
|
||||
this.progressStep = progressStep;
|
||||
this.stepper = await DeesStepper.createAndShow({
|
||||
steps,
|
||||
cancelable: false,
|
||||
});
|
||||
}
|
||||
|
||||
private createUpdaterSteps(): { steps: IStep[]; progressStep: IStep } {
|
||||
const infoMenuOptions = this.getLinkMenuOptions();
|
||||
const progressStep: IStep = {
|
||||
title: 'Updating the application',
|
||||
content: this.renderProgressContent(),
|
||||
progressStep: {
|
||||
label: this.getProgressLabel(),
|
||||
percentage: 5,
|
||||
indeterminate: true,
|
||||
statusRows: 4,
|
||||
statusText: 'Preparing update...',
|
||||
terminalLines: ['Preparing update'],
|
||||
},
|
||||
menuOptions: infoMenuOptions.length > 0 ? infoMenuOptions : undefined,
|
||||
};
|
||||
|
||||
const readyStep: IStep = {
|
||||
title: this.updatedVersion ? `Version ${this.updatedVersion} ready` : 'Update ready',
|
||||
content: this.renderReadyContent(),
|
||||
progressStep: {
|
||||
label: this.getSuccessCountdownLabel(this.getSuccessDelaySeconds()),
|
||||
percentage: 0,
|
||||
indeterminate: false,
|
||||
showPercentage: false,
|
||||
statusRows: 2,
|
||||
statusText: this.getSuccessCountdownStatus(this.getSuccessDelaySeconds()),
|
||||
},
|
||||
validationFunc: async (stepper, _htmlElement, signal) => {
|
||||
await this.runSuccessCountdown(stepper, readyStep, signal);
|
||||
},
|
||||
};
|
||||
|
||||
return {
|
||||
steps: [progressStep, readyStep],
|
||||
progressStep,
|
||||
};
|
||||
}
|
||||
|
||||
private getProgressLabel(): string {
|
||||
if (this.currentVersion && this.updatedVersion) {
|
||||
return `${this.currentVersion} -> ${this.updatedVersion}`;
|
||||
}
|
||||
|
||||
if (this.updatedVersion) {
|
||||
return `Preparing ${this.updatedVersion}`;
|
||||
}
|
||||
|
||||
return 'Application update';
|
||||
}
|
||||
|
||||
private getSuccessDelaySeconds(): number {
|
||||
return Math.max(1, Math.ceil(this.successDelayMs / 1000));
|
||||
}
|
||||
|
||||
private getSuccessActionDisplayLabel(): string {
|
||||
if (this.successActionLabel) {
|
||||
return this.successActionLabel;
|
||||
}
|
||||
|
||||
if (this.onSuccessAction) {
|
||||
return 'Continuing automatically';
|
||||
}
|
||||
|
||||
if (this.successAction === 'reload') {
|
||||
return 'Reloading application';
|
||||
}
|
||||
|
||||
return 'Closing updater';
|
||||
}
|
||||
|
||||
private getSuccessCountdownLabel(secondsArg: number): string {
|
||||
return `${this.getSuccessActionDisplayLabel()} in ${secondsArg}s`;
|
||||
}
|
||||
|
||||
private getSuccessCountdownStatus(secondsArg: number): string {
|
||||
const secondLabel = secondsArg === 1 ? 'second' : 'seconds';
|
||||
return `${this.getSuccessActionDisplayLabel()} in ${secondsArg} ${secondLabel}.`;
|
||||
}
|
||||
|
||||
private getSuccessActionNowLabel(): string {
|
||||
return `${this.getSuccessActionDisplayLabel()} now...`;
|
||||
}
|
||||
|
||||
private getLinkMenuOptions() {
|
||||
const menuOptions: Array<{ name: string; action: () => Promise<void> }> = [];
|
||||
|
||||
if (this.moreInfoUrl) {
|
||||
menuOptions.push({
|
||||
name: 'More info',
|
||||
action: async () => {
|
||||
this.openExternalUrl(this.moreInfoUrl);
|
||||
},
|
||||
});
|
||||
}
|
||||
|
||||
if (this.changelogUrl) {
|
||||
menuOptions.push({
|
||||
name: 'Changelog',
|
||||
action: async () => {
|
||||
this.openExternalUrl(this.changelogUrl);
|
||||
},
|
||||
});
|
||||
}
|
||||
|
||||
return menuOptions;
|
||||
}
|
||||
|
||||
private renderProgressContent(): TemplateResult {
|
||||
return html`
|
||||
<div style="display: grid; gap: 12px; color: var(--dees-color-text-secondary); line-height: 1.6;">
|
||||
<p style="margin: 0; text-align: center;">
|
||||
Downloading and applying the latest application release.
|
||||
${this.currentVersion && this.updatedVersion
|
||||
? html`Moving from <strong>${this.currentVersion}</strong> to <strong>${this.updatedVersion}</strong>.`
|
||||
: this.updatedVersion
|
||||
? html`Preparing <strong>${this.updatedVersion}</strong>.`
|
||||
: ''}
|
||||
</p>
|
||||
<p style="margin: 0; text-align: center; font-size: 13px; color: var(--dees-color-text-muted);">
|
||||
The updater advances automatically once the new build is installed and verified.
|
||||
</p>
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
|
||||
private renderReadyContent(): TemplateResult {
|
||||
const successDelaySeconds = this.getSuccessDelaySeconds();
|
||||
|
||||
return html`
|
||||
<div style="display: grid; gap: 12px; color: var(--dees-color-text-secondary); line-height: 1.6;">
|
||||
<p style="margin: 0; text-align: center;">
|
||||
${this.updatedVersion
|
||||
? html`Version <strong>${this.updatedVersion}</strong> is ready to use.`
|
||||
: 'The new version is ready to use.'}
|
||||
</p>
|
||||
<p style="margin: 0; text-align: center; font-size: 13px; color: var(--dees-color-text-muted);">
|
||||
Configured next action: ${this.getSuccessActionDisplayLabel()}. It runs automatically in ${successDelaySeconds} seconds.
|
||||
</p>
|
||||
</div>
|
||||
`;
|
||||
}
|
||||
|
||||
private async runSuccessCountdown(
|
||||
stepperArg: DeesStepper,
|
||||
stepArg: IStep,
|
||||
signal?: AbortSignal,
|
||||
): Promise<void> {
|
||||
const totalDuration = Math.max(1000, this.successDelayMs);
|
||||
const startTime = Date.now();
|
||||
|
||||
while (!signal?.aborted) {
|
||||
const elapsed = Math.min(totalDuration, Date.now() - startTime);
|
||||
const remainingMilliseconds = Math.max(0, totalDuration - elapsed);
|
||||
const remainingSeconds = Math.max(0, Math.ceil(remainingMilliseconds / 1000));
|
||||
|
||||
stepperArg.updateProgressStep(
|
||||
{
|
||||
label: remainingMilliseconds > 0
|
||||
? this.getSuccessCountdownLabel(remainingSeconds)
|
||||
: this.getSuccessActionNowLabel(),
|
||||
percentage: (elapsed / totalDuration) * 100,
|
||||
indeterminate: false,
|
||||
showPercentage: false,
|
||||
statusText: remainingMilliseconds > 0
|
||||
? this.getSuccessCountdownStatus(remainingSeconds)
|
||||
: this.getSuccessActionNowLabel(),
|
||||
},
|
||||
stepArg,
|
||||
);
|
||||
|
||||
if (remainingMilliseconds <= 0) {
|
||||
break;
|
||||
}
|
||||
|
||||
const completed = await this.waitForCountdownTick(100, signal);
|
||||
if (!completed) {
|
||||
return;
|
||||
}
|
||||
}
|
||||
|
||||
await this.runConfiguredSuccessAction();
|
||||
}
|
||||
|
||||
private async waitForCountdownTick(timeoutArg: number, signal?: AbortSignal): Promise<boolean> {
|
||||
return new Promise((resolve) => {
|
||||
let completed = false;
|
||||
|
||||
const finish = (result: boolean) => {
|
||||
if (completed) {
|
||||
return;
|
||||
}
|
||||
|
||||
completed = true;
|
||||
if (signal) {
|
||||
signal.removeEventListener('abort', handleAbort);
|
||||
}
|
||||
resolve(result);
|
||||
};
|
||||
|
||||
const handleAbort = () => {
|
||||
window.clearTimeout(timeoutId);
|
||||
finish(false);
|
||||
};
|
||||
|
||||
const timeoutId = window.setTimeout(() => {
|
||||
finish(true);
|
||||
}, timeoutArg);
|
||||
|
||||
if (signal) {
|
||||
signal.addEventListener('abort', handleAbort, { once: true });
|
||||
}
|
||||
});
|
||||
}
|
||||
|
||||
private async runConfiguredSuccessAction(): Promise<void> {
|
||||
if (this.onSuccessAction) {
|
||||
await this.onSuccessAction();
|
||||
return;
|
||||
}
|
||||
|
||||
if (this.successAction === 'reload') {
|
||||
await this.destroy();
|
||||
window.location.reload();
|
||||
return;
|
||||
}
|
||||
|
||||
await this.destroy();
|
||||
}
|
||||
|
||||
private openExternalUrl(urlArg: string) {
|
||||
window.open(urlArg, '_blank', 'noopener,noreferrer');
|
||||
}
|
||||
}
|
||||
|
||||
Reference in New Issue
Block a user