diff --git a/changelog.md b/changelog.md
index 22e8aa7..8df2585 100644
--- a/changelog.md
+++ b/changelog.md
@@ -1,5 +1,12 @@
# Changelog
+## 2026-02-24 - 2.2.1 - fix(ts_bundled)
+add generated bundled JavaScript and source map for ts build (bundle.js and bundle.js.map)
+
+- Added ts_bundled/bundle.js (≈168 KB) - compiled/bundled output from ts sources
+- Added ts_bundled/bundle.js.map (≈309 KB) - source map referencing ../ts/index.ts and ../ts_web/index.ts
+- This is generated build output (deno bundle) and does not change runtime API
+
## 2026-02-24 - 2.2.0 - feat(opsserver)
Serve bundled frontend from a dedicated dist_serve directory and update frontend UI/packaging
diff --git a/ts/00_commitinfo_data.ts b/ts/00_commitinfo_data.ts
index 18ed3c8..f6a577b 100644
--- a/ts/00_commitinfo_data.ts
+++ b/ts/00_commitinfo_data.ts
@@ -3,6 +3,6 @@
*/
export const commitinfo = {
name: '@serve.zone/gitops',
- version: '2.2.0',
+ version: '2.2.1',
description: 'GitOps management app for Gitea and GitLab - manage secrets, browse projects, view CI pipelines, and stream build logs'
}
diff --git a/ts_bundled/bundle.js b/ts_bundled/bundle.js
new file mode 100644
index 0000000..47982cb
--- /dev/null
+++ b/ts_bundled/bundle.js
@@ -0,0 +1,166543 @@
+var __create = Object.create;
+var __freeze = Object.freeze;
+var __defProp = Object.defineProperty;
+var __getOwnPropDesc = Object.getOwnPropertyDescriptor;
+var __getOwnPropNames = Object.getOwnPropertyNames;
+var __getProtoOf = Object.getPrototypeOf;
+var __hasOwnProp = Object.prototype.hasOwnProperty;
+var __knownSymbol = (name, symbol) => (symbol = Symbol[name]) ? symbol : /* @__PURE__ */ Symbol.for("Symbol." + name);
+var __typeError = (msg) => {
+ throw TypeError(msg);
+};
+var __defNormalProp = (obj, key2, value2) => key2 in obj ? __defProp(obj, key2, { enumerable: true, configurable: true, writable: true, value: value2 }) : obj[key2] = value2;
+var __name = (target, value2) => __defProp(target, "name", { value: value2, configurable: true });
+var __require = /* @__PURE__ */ ((x4) => typeof require !== "undefined" ? require : typeof Proxy !== "undefined" ? new Proxy(x4, {
+ get: (a5, b5) => (typeof require !== "undefined" ? require : a5)[b5]
+}) : x4)(function(x4) {
+ if (typeof require !== "undefined") return require.apply(this, arguments);
+ throw Error('Dynamic require of "' + x4 + '" is not supported');
+});
+var __esm = (fn, res) => function __init() {
+ return fn && (res = (0, fn[__getOwnPropNames(fn)[0]])(fn = 0)), res;
+};
+var __commonJS = (cb, mod) => function __require2() {
+ return mod || (0, cb[__getOwnPropNames(cb)[0]])((mod = { exports: {} }).exports, mod), mod.exports;
+};
+var __export = (target, all3) => {
+ for (var name in all3)
+ __defProp(target, name, { get: all3[name], enumerable: true });
+};
+var __copyProps = (to, from2, except, desc) => {
+ if (from2 && typeof from2 === "object" || typeof from2 === "function") {
+ for (let key2 of __getOwnPropNames(from2))
+ if (!__hasOwnProp.call(to, key2) && key2 !== except)
+ __defProp(to, key2, { get: () => from2[key2], enumerable: !(desc = __getOwnPropDesc(from2, key2)) || desc.enumerable });
+ }
+ return to;
+};
+var __toESM = (mod, isNodeMode, target) => (target = mod != null ? __create(__getProtoOf(mod)) : {}, __copyProps(
+ // If the importer is in node compatibility mode or this is not an ESM
+ // file that has been converted to a CommonJS file using a Babel-
+ // compatible transform (i.e. "__esModule" has not been set), then set
+ // "default" to the CommonJS "module.exports" for node compatibility.
+ isNodeMode || !mod || !mod.__esModule ? __defProp(target, "default", { value: mod, enumerable: true }) : target,
+ mod
+));
+var __decoratorStart = (base) => [, , , __create(base?.[__knownSymbol("metadata")] ?? null)];
+var __decoratorStrings = ["class", "method", "getter", "setter", "accessor", "field", "value", "get", "set"];
+var __expectFn = (fn) => fn !== void 0 && typeof fn !== "function" ? __typeError("Function expected") : fn;
+var __decoratorContext = (kind, name, done, metadata, fns) => ({ kind: __decoratorStrings[kind], name, metadata, addInitializer: (fn) => done._ ? __typeError("Already initialized") : fns.push(__expectFn(fn || null)) });
+var __decoratorMetadata = (array, target) => __defNormalProp(target, __knownSymbol("metadata"), array[3]);
+var __runInitializers = (array, flags, self2, value2) => {
+ for (var i11 = 0, fns = array[flags >> 1], n12 = fns && fns.length; i11 < n12; i11++) flags & 1 ? fns[i11].call(self2) : value2 = fns[i11].call(self2, value2);
+ return value2;
+};
+var __decorateElement = (array, flags, name, decorators, target, extra) => {
+ var fn, it, done, ctx, access, k4 = flags & 7, s10 = !!(flags & 8), p7 = !!(flags & 16);
+ var j4 = k4 > 3 ? array.length + 1 : k4 ? s10 ? 1 : 2 : 0, key2 = __decoratorStrings[k4 + 5];
+ var initializers = k4 > 3 && (array[j4 - 1] = []), extraInitializers = array[j4] || (array[j4] = []);
+ var desc = k4 && (!p7 && !s10 && (target = target.prototype), k4 < 5 && (k4 > 3 || !p7) && __getOwnPropDesc(k4 < 4 ? target : { get [name]() {
+ return __privateGet(this, extra);
+ }, set [name](x4) {
+ return __privateSet(this, extra, x4);
+ } }, name));
+ k4 ? p7 && k4 < 4 && __name(extra, (k4 > 2 ? "set " : k4 > 1 ? "get " : "") + name) : __name(target, name);
+ for (var i11 = decorators.length - 1; i11 >= 0; i11--) {
+ ctx = __decoratorContext(k4, name, done = {}, array[3], extraInitializers);
+ if (k4) {
+ ctx.static = s10, ctx.private = p7, access = ctx.access = { has: p7 ? (x4) => __privateIn(target, x4) : (x4) => name in x4 };
+ if (k4 ^ 3) access.get = p7 ? (x4) => (k4 ^ 1 ? __privateGet : __privateMethod)(x4, target, k4 ^ 4 ? extra : desc.get) : (x4) => x4[name];
+ if (k4 > 2) access.set = p7 ? (x4, y4) => __privateSet(x4, target, y4, k4 ^ 4 ? extra : desc.set) : (x4, y4) => x4[name] = y4;
+ }
+ it = (0, decorators[i11])(k4 ? k4 < 4 ? p7 ? extra : desc[key2] : k4 > 4 ? void 0 : { get: desc.get, set: desc.set } : target, ctx), done._ = 1;
+ if (k4 ^ 4 || it === void 0) __expectFn(it) && (k4 > 4 ? initializers.unshift(it) : k4 ? p7 ? extra = it : desc[key2] = it : target = it);
+ else if (typeof it !== "object" || it === null) __typeError("Object expected");
+ else __expectFn(fn = it.get) && (desc.get = fn), __expectFn(fn = it.set) && (desc.set = fn), __expectFn(fn = it.init) && initializers.unshift(fn);
+ }
+ return k4 || __decoratorMetadata(array, target), desc && __defProp(target, name, desc), p7 ? k4 ^ 4 ? extra : desc : target;
+};
+var __publicField = (obj, key2, value2) => __defNormalProp(obj, typeof key2 !== "symbol" ? key2 + "" : key2, value2);
+var __accessCheck = (obj, member, msg) => member.has(obj) || __typeError("Cannot " + msg);
+var __privateIn = (member, obj) => Object(obj) !== obj ? __typeError('Cannot use the "in" operator on this value') : member.has(obj);
+var __privateGet = (obj, member, getter) => (__accessCheck(obj, member, "read from private field"), getter ? getter.call(obj) : member.get(obj));
+var __privateAdd = (obj, member, value2) => member.has(obj) ? __typeError("Cannot add the same private member more than once") : member instanceof WeakSet ? member.add(obj) : member.set(obj, value2);
+var __privateSet = (obj, member, value2, setter) => (__accessCheck(obj, member, "write to private field"), setter ? setter.call(obj, value2) : member.set(obj, value2), value2);
+var __privateMethod = (obj, member, method) => (__accessCheck(obj, member, "access private method"), method);
+var __template = (cooked, raw2) => __freeze(__defProp(cooked, "raw", { value: __freeze(raw2 || cooked.slice()) }));
+
+// node_modules/.pnpm/@lit+reactive-element@2.1.2/node_modules/@lit/reactive-element/css-tag.js
+var t, e, s, o, n, r, i, S, c;
+var init_css_tag = __esm({
+ "node_modules/.pnpm/@lit+reactive-element@2.1.2/node_modules/@lit/reactive-element/css-tag.js"() {
+ t = globalThis, e = t.ShadowRoot && (void 0 === t.ShadyCSS || t.ShadyCSS.nativeShadow) && "adoptedStyleSheets" in Document.prototype && "replace" in CSSStyleSheet.prototype, s = /* @__PURE__ */ Symbol(), o = /* @__PURE__ */ new WeakMap();
+ n = class {
+ constructor(t9, e11, o13) {
+ if (this._$cssResult$ = true, o13 !== s) throw Error("CSSResult is not constructable. Use `unsafeCSS` or `css` instead.");
+ this.cssText = t9, this.t = e11;
+ }
+ get styleSheet() {
+ let t9 = this.o;
+ const s10 = this.t;
+ if (e && void 0 === t9) {
+ const e11 = void 0 !== s10 && 1 === s10.length;
+ e11 && (t9 = o.get(s10)), void 0 === t9 && ((this.o = t9 = new CSSStyleSheet()).replaceSync(this.cssText), e11 && o.set(s10, t9));
+ }
+ return t9;
+ }
+ toString() {
+ return this.cssText;
+ }
+ };
+ r = (t9) => new n("string" == typeof t9 ? t9 : t9 + "", void 0, s), i = (t9, ...e11) => {
+ const o13 = 1 === t9.length ? t9[0] : e11.reduce((e12, s10, o14) => e12 + ((t10) => {
+ if (true === t10._$cssResult$) return t10.cssText;
+ if ("number" == typeof t10) return t10;
+ throw Error("Value passed to 'css' function must be a 'css' function result: " + t10 + ". Use 'unsafeCSS' to pass non-literal values, but take care to ensure page security.");
+ })(s10) + t9[o14 + 1], t9[0]);
+ return new n(o13, t9, s);
+ }, S = (s10, o13) => {
+ if (e) s10.adoptedStyleSheets = o13.map((t9) => t9 instanceof CSSStyleSheet ? t9 : t9.styleSheet);
+ else for (const e11 of o13) {
+ const o14 = document.createElement("style"), n12 = t.litNonce;
+ void 0 !== n12 && o14.setAttribute("nonce", n12), o14.textContent = e11.cssText, s10.appendChild(o14);
+ }
+ }, c = e ? (t9) => t9 : (t9) => t9 instanceof CSSStyleSheet ? ((t10) => {
+ let e11 = "";
+ for (const s10 of t10.cssRules) e11 += s10.cssText;
+ return r(e11);
+ })(t9) : t9;
+ }
+});
+
+// node_modules/.pnpm/@lit+reactive-element@2.1.2/node_modules/@lit/reactive-element/reactive-element.js
+var i2, e2, h, r2, o2, n2, a, c2, l, p, d, u, f, b, y;
+var init_reactive_element = __esm({
+ "node_modules/.pnpm/@lit+reactive-element@2.1.2/node_modules/@lit/reactive-element/reactive-element.js"() {
+ init_css_tag();
+ init_css_tag();
+ ({ is: i2, defineProperty: e2, getOwnPropertyDescriptor: h, getOwnPropertyNames: r2, getOwnPropertySymbols: o2, getPrototypeOf: n2 } = Object), a = globalThis, c2 = a.trustedTypes, l = c2 ? c2.emptyScript : "", p = a.reactiveElementPolyfillSupport, d = (t9, s10) => t9, u = { toAttribute(t9, s10) {
+ switch (s10) {
+ case Boolean:
+ t9 = t9 ? l : null;
+ break;
+ case Object:
+ case Array:
+ t9 = null == t9 ? t9 : JSON.stringify(t9);
+ }
+ return t9;
+ }, fromAttribute(t9, s10) {
+ let i11 = t9;
+ switch (s10) {
+ case Boolean:
+ i11 = null !== t9;
+ break;
+ case Number:
+ i11 = null === t9 ? null : Number(t9);
+ break;
+ case Object:
+ case Array:
+ try {
+ i11 = JSON.parse(t9);
+ } catch (t10) {
+ i11 = null;
+ }
+ }
+ return i11;
+ } }, f = (t9, s10) => !i2(t9, s10), b = { attribute: true, type: String, converter: u, reflect: false, useDefault: false, hasChanged: f };
+ Symbol.metadata ??= /* @__PURE__ */ Symbol("metadata"), a.litPropertyMetadata ??= /* @__PURE__ */ new WeakMap();
+ y = class extends HTMLElement {
+ static addInitializer(t9) {
+ this._$Ei(), (this.l ??= []).push(t9);
+ }
+ static get observedAttributes() {
+ return this.finalize(), this._$Eh && [...this._$Eh.keys()];
+ }
+ static createProperty(t9, s10 = b) {
+ if (s10.state && (s10.attribute = false), this._$Ei(), this.prototype.hasOwnProperty(t9) && ((s10 = Object.create(s10)).wrapped = true), this.elementProperties.set(t9, s10), !s10.noAccessor) {
+ const i11 = /* @__PURE__ */ Symbol(), h8 = this.getPropertyDescriptor(t9, i11, s10);
+ void 0 !== h8 && e2(this.prototype, t9, h8);
+ }
+ }
+ static getPropertyDescriptor(t9, s10, i11) {
+ const { get: e11, set: r11 } = h(this.prototype, t9) ?? { get() {
+ return this[s10];
+ }, set(t10) {
+ this[s10] = t10;
+ } };
+ return { get: e11, set(s11) {
+ const h8 = e11?.call(this);
+ r11?.call(this, s11), this.requestUpdate(t9, h8, i11);
+ }, configurable: true, enumerable: true };
+ }
+ static getPropertyOptions(t9) {
+ return this.elementProperties.get(t9) ?? b;
+ }
+ static _$Ei() {
+ if (this.hasOwnProperty(d("elementProperties"))) return;
+ const t9 = n2(this);
+ t9.finalize(), void 0 !== t9.l && (this.l = [...t9.l]), this.elementProperties = new Map(t9.elementProperties);
+ }
+ static finalize() {
+ if (this.hasOwnProperty(d("finalized"))) return;
+ if (this.finalized = true, this._$Ei(), this.hasOwnProperty(d("properties"))) {
+ const t10 = this.properties, s10 = [...r2(t10), ...o2(t10)];
+ for (const i11 of s10) this.createProperty(i11, t10[i11]);
+ }
+ const t9 = this[Symbol.metadata];
+ if (null !== t9) {
+ const s10 = litPropertyMetadata.get(t9);
+ if (void 0 !== s10) for (const [t10, i11] of s10) this.elementProperties.set(t10, i11);
+ }
+ this._$Eh = /* @__PURE__ */ new Map();
+ for (const [t10, s10] of this.elementProperties) {
+ const i11 = this._$Eu(t10, s10);
+ void 0 !== i11 && this._$Eh.set(i11, t10);
+ }
+ this.elementStyles = this.finalizeStyles(this.styles);
+ }
+ static finalizeStyles(s10) {
+ const i11 = [];
+ if (Array.isArray(s10)) {
+ const e11 = new Set(s10.flat(1 / 0).reverse());
+ for (const s11 of e11) i11.unshift(c(s11));
+ } else void 0 !== s10 && i11.push(c(s10));
+ return i11;
+ }
+ static _$Eu(t9, s10) {
+ const i11 = s10.attribute;
+ return false === i11 ? void 0 : "string" == typeof i11 ? i11 : "string" == typeof t9 ? t9.toLowerCase() : void 0;
+ }
+ constructor() {
+ super(), this._$Ep = void 0, this.isUpdatePending = false, this.hasUpdated = false, this._$Em = null, this._$Ev();
+ }
+ _$Ev() {
+ this._$ES = new Promise((t9) => this.enableUpdating = t9), this._$AL = /* @__PURE__ */ new Map(), this._$E_(), this.requestUpdate(), this.constructor.l?.forEach((t9) => t9(this));
+ }
+ addController(t9) {
+ (this._$EO ??= /* @__PURE__ */ new Set()).add(t9), void 0 !== this.renderRoot && this.isConnected && t9.hostConnected?.();
+ }
+ removeController(t9) {
+ this._$EO?.delete(t9);
+ }
+ _$E_() {
+ const t9 = /* @__PURE__ */ new Map(), s10 = this.constructor.elementProperties;
+ for (const i11 of s10.keys()) this.hasOwnProperty(i11) && (t9.set(i11, this[i11]), delete this[i11]);
+ t9.size > 0 && (this._$Ep = t9);
+ }
+ createRenderRoot() {
+ const t9 = this.shadowRoot ?? this.attachShadow(this.constructor.shadowRootOptions);
+ return S(t9, this.constructor.elementStyles), t9;
+ }
+ connectedCallback() {
+ this.renderRoot ??= this.createRenderRoot(), this.enableUpdating(true), this._$EO?.forEach((t9) => t9.hostConnected?.());
+ }
+ enableUpdating(t9) {
+ }
+ disconnectedCallback() {
+ this._$EO?.forEach((t9) => t9.hostDisconnected?.());
+ }
+ attributeChangedCallback(t9, s10, i11) {
+ this._$AK(t9, i11);
+ }
+ _$ET(t9, s10) {
+ const i11 = this.constructor.elementProperties.get(t9), e11 = this.constructor._$Eu(t9, i11);
+ if (void 0 !== e11 && true === i11.reflect) {
+ const h8 = (void 0 !== i11.converter?.toAttribute ? i11.converter : u).toAttribute(s10, i11.type);
+ this._$Em = t9, null == h8 ? this.removeAttribute(e11) : this.setAttribute(e11, h8), this._$Em = null;
+ }
+ }
+ _$AK(t9, s10) {
+ const i11 = this.constructor, e11 = i11._$Eh.get(t9);
+ if (void 0 !== e11 && this._$Em !== e11) {
+ const t10 = i11.getPropertyOptions(e11), h8 = "function" == typeof t10.converter ? { fromAttribute: t10.converter } : void 0 !== t10.converter?.fromAttribute ? t10.converter : u;
+ this._$Em = e11;
+ const r11 = h8.fromAttribute(s10, t10.type);
+ this[e11] = r11 ?? this._$Ej?.get(e11) ?? r11, this._$Em = null;
+ }
+ }
+ requestUpdate(t9, s10, i11, e11 = false, h8) {
+ if (void 0 !== t9) {
+ const r11 = this.constructor;
+ if (false === e11 && (h8 = this[t9]), i11 ??= r11.getPropertyOptions(t9), !((i11.hasChanged ?? f)(h8, s10) || i11.useDefault && i11.reflect && h8 === this._$Ej?.get(t9) && !this.hasAttribute(r11._$Eu(t9, i11)))) return;
+ this.C(t9, s10, i11);
+ }
+ false === this.isUpdatePending && (this._$ES = this._$EP());
+ }
+ C(t9, s10, { useDefault: i11, reflect: e11, wrapped: h8 }, r11) {
+ i11 && !(this._$Ej ??= /* @__PURE__ */ new Map()).has(t9) && (this._$Ej.set(t9, r11 ?? s10 ?? this[t9]), true !== h8 || void 0 !== r11) || (this._$AL.has(t9) || (this.hasUpdated || i11 || (s10 = void 0), this._$AL.set(t9, s10)), true === e11 && this._$Em !== t9 && (this._$Eq ??= /* @__PURE__ */ new Set()).add(t9));
+ }
+ async _$EP() {
+ this.isUpdatePending = true;
+ try {
+ await this._$ES;
+ } catch (t10) {
+ Promise.reject(t10);
+ }
+ const t9 = this.scheduleUpdate();
+ return null != t9 && await t9, !this.isUpdatePending;
+ }
+ scheduleUpdate() {
+ return this.performUpdate();
+ }
+ performUpdate() {
+ if (!this.isUpdatePending) return;
+ if (!this.hasUpdated) {
+ if (this.renderRoot ??= this.createRenderRoot(), this._$Ep) {
+ for (const [t11, s11] of this._$Ep) this[t11] = s11;
+ this._$Ep = void 0;
+ }
+ const t10 = this.constructor.elementProperties;
+ if (t10.size > 0) for (const [s11, i11] of t10) {
+ const { wrapped: t11 } = i11, e11 = this[s11];
+ true !== t11 || this._$AL.has(s11) || void 0 === e11 || this.C(s11, void 0, i11, e11);
+ }
+ }
+ let t9 = false;
+ const s10 = this._$AL;
+ try {
+ t9 = this.shouldUpdate(s10), t9 ? (this.willUpdate(s10), this._$EO?.forEach((t10) => t10.hostUpdate?.()), this.update(s10)) : this._$EM();
+ } catch (s11) {
+ throw t9 = false, this._$EM(), s11;
+ }
+ t9 && this._$AE(s10);
+ }
+ willUpdate(t9) {
+ }
+ _$AE(t9) {
+ this._$EO?.forEach((t10) => t10.hostUpdated?.()), this.hasUpdated || (this.hasUpdated = true, this.firstUpdated(t9)), this.updated(t9);
+ }
+ _$EM() {
+ this._$AL = /* @__PURE__ */ new Map(), this.isUpdatePending = false;
+ }
+ get updateComplete() {
+ return this.getUpdateComplete();
+ }
+ getUpdateComplete() {
+ return this._$ES;
+ }
+ shouldUpdate(t9) {
+ return true;
+ }
+ update(t9) {
+ this._$Eq &&= this._$Eq.forEach((t10) => this._$ET(t10, this[t10])), this._$EM();
+ }
+ updated(t9) {
+ }
+ firstUpdated(t9) {
+ }
+ };
+ y.elementStyles = [], y.shadowRootOptions = { mode: "open" }, y[d("elementProperties")] = /* @__PURE__ */ new Map(), y[d("finalized")] = /* @__PURE__ */ new Map(), p?.({ ReactiveElement: y }), (a.reactiveElementVersions ??= []).push("2.1.2");
+ }
+});
+
+// node_modules/.pnpm/lit-html@3.3.2/node_modules/lit-html/lit-html.js
+function V(t9, i11) {
+ if (!u2(t9) || !t9.hasOwnProperty("raw")) throw Error("invalid template strings array");
+ return void 0 !== e3 ? e3.createHTML(i11) : i11;
+}
+function M(t9, i11, s10 = t9, e11) {
+ if (i11 === E) return i11;
+ let h8 = void 0 !== e11 ? s10._$Co?.[e11] : s10._$Cl;
+ const o13 = a2(i11) ? void 0 : i11._$litDirective$;
+ return h8?.constructor !== o13 && (h8?._$AO?.(false), void 0 === o13 ? h8 = void 0 : (h8 = new o13(t9), h8._$AT(t9, s10, e11)), void 0 !== e11 ? (s10._$Co ??= [])[e11] = h8 : s10._$Cl = h8), void 0 !== h8 && (i11 = M(t9, h8._$AS(t9, i11.values), h8, e11)), i11;
+}
+var t2, i3, s2, e3, h2, o3, n3, r3, l2, c3, a2, u2, d2, f2, v, _, m, p2, g, $, y2, x, b2, w, T, E, A, C, P, N, S2, R, k, H, I, L, z, Z, j, B, D;
+var init_lit_html = __esm({
+ "node_modules/.pnpm/lit-html@3.3.2/node_modules/lit-html/lit-html.js"() {
+ t2 = globalThis, i3 = (t9) => t9, s2 = t2.trustedTypes, e3 = s2 ? s2.createPolicy("lit-html", { createHTML: (t9) => t9 }) : void 0, h2 = "$lit$", o3 = `lit$${Math.random().toFixed(9).slice(2)}$`, n3 = "?" + o3, r3 = `<${n3}>`, l2 = document, c3 = () => l2.createComment(""), a2 = (t9) => null === t9 || "object" != typeof t9 && "function" != typeof t9, u2 = Array.isArray, d2 = (t9) => u2(t9) || "function" == typeof t9?.[Symbol.iterator], f2 = "[ \n\f\r]", v = /<(?:(!--|\/[^a-zA-Z])|(\/?[a-zA-Z][^>\s]*)|(\/?$))/g, _ = /-->/g, m = />/g, p2 = RegExp(`>|${f2}(?:([^\\s"'>=/]+)(${f2}*=${f2}*(?:[^
+\f\r"'\`<>=]|("|')|))|$)`, "g"), g = /'/g, $ = /"/g, y2 = /^(?:script|style|textarea|title)$/i, x = (t9) => (i11, ...s10) => ({ _$litType$: t9, strings: i11, values: s10 }), b2 = x(1), w = x(2), T = x(3), E = /* @__PURE__ */ Symbol.for("lit-noChange"), A = /* @__PURE__ */ Symbol.for("lit-nothing"), C = /* @__PURE__ */ new WeakMap(), P = l2.createTreeWalker(l2, 129);
+ N = (t9, i11) => {
+ const s10 = t9.length - 1, e11 = [];
+ let n12, l6 = 2 === i11 ? "" : 3 === i11 ? "" : "")), e11];
+ };
+ S2 = class _S {
+ constructor({ strings: t9, _$litType$: i11 }, e11) {
+ let r11;
+ this.parts = [];
+ let l6 = 0, a5 = 0;
+ const u7 = t9.length - 1, d5 = this.parts, [f7, v5] = N(t9, i11);
+ if (this.el = _S.createElement(f7, e11), P.currentNode = this.el.content, 2 === i11 || 3 === i11) {
+ const t10 = this.el.content.firstChild;
+ t10.replaceWith(...t10.childNodes);
+ }
+ for (; null !== (r11 = P.nextNode()) && d5.length < u7; ) {
+ if (1 === r11.nodeType) {
+ if (r11.hasAttributes()) for (const t10 of r11.getAttributeNames()) if (t10.endsWith(h2)) {
+ const i12 = v5[a5++], s10 = r11.getAttribute(t10).split(o3), e12 = /([.?@])?(.*)/.exec(i12);
+ d5.push({ type: 1, index: l6, name: e12[2], strings: s10, ctor: "." === e12[1] ? I : "?" === e12[1] ? L : "@" === e12[1] ? z : H }), r11.removeAttribute(t10);
+ } else t10.startsWith(o3) && (d5.push({ type: 6, index: l6 }), r11.removeAttribute(t10));
+ if (y2.test(r11.tagName)) {
+ const t10 = r11.textContent.split(o3), i12 = t10.length - 1;
+ if (i12 > 0) {
+ r11.textContent = s2 ? s2.emptyScript : "";
+ for (let s10 = 0; s10 < i12; s10++) r11.append(t10[s10], c3()), P.nextNode(), d5.push({ type: 2, index: ++l6 });
+ r11.append(t10[i12], c3());
+ }
+ }
+ } else if (8 === r11.nodeType) if (r11.data === n3) d5.push({ type: 2, index: l6 });
+ else {
+ let t10 = -1;
+ for (; -1 !== (t10 = r11.data.indexOf(o3, t10 + 1)); ) d5.push({ type: 7, index: l6 }), t10 += o3.length - 1;
+ }
+ l6++;
+ }
+ }
+ static createElement(t9, i11) {
+ const s10 = l2.createElement("template");
+ return s10.innerHTML = t9, s10;
+ }
+ };
+ R = class {
+ constructor(t9, i11) {
+ this._$AV = [], this._$AN = void 0, this._$AD = t9, this._$AM = i11;
+ }
+ get parentNode() {
+ return this._$AM.parentNode;
+ }
+ get _$AU() {
+ return this._$AM._$AU;
+ }
+ u(t9) {
+ const { el: { content: i11 }, parts: s10 } = this._$AD, e11 = (t9?.creationScope ?? l2).importNode(i11, true);
+ P.currentNode = e11;
+ let h8 = P.nextNode(), o13 = 0, n12 = 0, r11 = s10[0];
+ for (; void 0 !== r11; ) {
+ if (o13 === r11.index) {
+ let i12;
+ 2 === r11.type ? i12 = new k(h8, h8.nextSibling, this, t9) : 1 === r11.type ? i12 = new r11.ctor(h8, r11.name, r11.strings, this, t9) : 6 === r11.type && (i12 = new Z(h8, this, t9)), this._$AV.push(i12), r11 = s10[++n12];
+ }
+ o13 !== r11?.index && (h8 = P.nextNode(), o13++);
+ }
+ return P.currentNode = l2, e11;
+ }
+ p(t9) {
+ let i11 = 0;
+ for (const s10 of this._$AV) void 0 !== s10 && (void 0 !== s10.strings ? (s10._$AI(t9, s10, i11), i11 += s10.strings.length - 2) : s10._$AI(t9[i11])), i11++;
+ }
+ };
+ k = class _k {
+ get _$AU() {
+ return this._$AM?._$AU ?? this._$Cv;
+ }
+ constructor(t9, i11, s10, e11) {
+ this.type = 2, this._$AH = A, this._$AN = void 0, this._$AA = t9, this._$AB = i11, this._$AM = s10, this.options = e11, this._$Cv = e11?.isConnected ?? true;
+ }
+ get parentNode() {
+ let t9 = this._$AA.parentNode;
+ const i11 = this._$AM;
+ return void 0 !== i11 && 11 === t9?.nodeType && (t9 = i11.parentNode), t9;
+ }
+ get startNode() {
+ return this._$AA;
+ }
+ get endNode() {
+ return this._$AB;
+ }
+ _$AI(t9, i11 = this) {
+ t9 = M(this, t9, i11), a2(t9) ? t9 === A || null == t9 || "" === t9 ? (this._$AH !== A && this._$AR(), this._$AH = A) : t9 !== this._$AH && t9 !== E && this._(t9) : void 0 !== t9._$litType$ ? this.$(t9) : void 0 !== t9.nodeType ? this.T(t9) : d2(t9) ? this.k(t9) : this._(t9);
+ }
+ O(t9) {
+ return this._$AA.parentNode.insertBefore(t9, this._$AB);
+ }
+ T(t9) {
+ this._$AH !== t9 && (this._$AR(), this._$AH = this.O(t9));
+ }
+ _(t9) {
+ this._$AH !== A && a2(this._$AH) ? this._$AA.nextSibling.data = t9 : this.T(l2.createTextNode(t9)), this._$AH = t9;
+ }
+ $(t9) {
+ const { values: i11, _$litType$: s10 } = t9, e11 = "number" == typeof s10 ? this._$AC(t9) : (void 0 === s10.el && (s10.el = S2.createElement(V(s10.h, s10.h[0]), this.options)), s10);
+ if (this._$AH?._$AD === e11) this._$AH.p(i11);
+ else {
+ const t10 = new R(e11, this), s11 = t10.u(this.options);
+ t10.p(i11), this.T(s11), this._$AH = t10;
+ }
+ }
+ _$AC(t9) {
+ let i11 = C.get(t9.strings);
+ return void 0 === i11 && C.set(t9.strings, i11 = new S2(t9)), i11;
+ }
+ k(t9) {
+ u2(this._$AH) || (this._$AH = [], this._$AR());
+ const i11 = this._$AH;
+ let s10, e11 = 0;
+ for (const h8 of t9) e11 === i11.length ? i11.push(s10 = new _k(this.O(c3()), this.O(c3()), this, this.options)) : s10 = i11[e11], s10._$AI(h8), e11++;
+ e11 < i11.length && (this._$AR(s10 && s10._$AB.nextSibling, e11), i11.length = e11);
+ }
+ _$AR(t9 = this._$AA.nextSibling, s10) {
+ for (this._$AP?.(false, true, s10); t9 !== this._$AB; ) {
+ const s11 = i3(t9).nextSibling;
+ i3(t9).remove(), t9 = s11;
+ }
+ }
+ setConnected(t9) {
+ void 0 === this._$AM && (this._$Cv = t9, this._$AP?.(t9));
+ }
+ };
+ H = class {
+ get tagName() {
+ return this.element.tagName;
+ }
+ get _$AU() {
+ return this._$AM._$AU;
+ }
+ constructor(t9, i11, s10, e11, h8) {
+ this.type = 1, this._$AH = A, this._$AN = void 0, this.element = t9, this.name = i11, this._$AM = e11, this.options = h8, s10.length > 2 || "" !== s10[0] || "" !== s10[1] ? (this._$AH = Array(s10.length - 1).fill(new String()), this.strings = s10) : this._$AH = A;
+ }
+ _$AI(t9, i11 = this, s10, e11) {
+ const h8 = this.strings;
+ let o13 = false;
+ if (void 0 === h8) t9 = M(this, t9, i11, 0), o13 = !a2(t9) || t9 !== this._$AH && t9 !== E, o13 && (this._$AH = t9);
+ else {
+ const e12 = t9;
+ let n12, r11;
+ for (t9 = h8[0], n12 = 0; n12 < h8.length - 1; n12++) r11 = M(this, e12[s10 + n12], i11, n12), r11 === E && (r11 = this._$AH[n12]), o13 ||= !a2(r11) || r11 !== this._$AH[n12], r11 === A ? t9 = A : t9 !== A && (t9 += (r11 ?? "") + h8[n12 + 1]), this._$AH[n12] = r11;
+ }
+ o13 && !e11 && this.j(t9);
+ }
+ j(t9) {
+ t9 === A ? this.element.removeAttribute(this.name) : this.element.setAttribute(this.name, t9 ?? "");
+ }
+ };
+ I = class extends H {
+ constructor() {
+ super(...arguments), this.type = 3;
+ }
+ j(t9) {
+ this.element[this.name] = t9 === A ? void 0 : t9;
+ }
+ };
+ L = class extends H {
+ constructor() {
+ super(...arguments), this.type = 4;
+ }
+ j(t9) {
+ this.element.toggleAttribute(this.name, !!t9 && t9 !== A);
+ }
+ };
+ z = class extends H {
+ constructor(t9, i11, s10, e11, h8) {
+ super(t9, i11, s10, e11, h8), this.type = 5;
+ }
+ _$AI(t9, i11 = this) {
+ if ((t9 = M(this, t9, i11, 0) ?? A) === E) return;
+ const s10 = this._$AH, e11 = t9 === A && s10 !== A || t9.capture !== s10.capture || t9.once !== s10.once || t9.passive !== s10.passive, h8 = t9 !== A && (s10 === A || e11);
+ e11 && this.element.removeEventListener(this.name, this, s10), h8 && this.element.addEventListener(this.name, this, t9), this._$AH = t9;
+ }
+ handleEvent(t9) {
+ "function" == typeof this._$AH ? this._$AH.call(this.options?.host ?? this.element, t9) : this._$AH.handleEvent(t9);
+ }
+ };
+ Z = class {
+ constructor(t9, i11, s10) {
+ this.element = t9, this.type = 6, this._$AN = void 0, this._$AM = i11, this.options = s10;
+ }
+ get _$AU() {
+ return this._$AM._$AU;
+ }
+ _$AI(t9) {
+ M(this, t9);
+ }
+ };
+ j = { M: h2, P: o3, A: n3, C: 1, L: N, R, D: d2, V: M, I: k, H, N: L, U: z, B: I, F: Z }, B = t2.litHtmlPolyfillSupport;
+ B?.(S2, k), (t2.litHtmlVersions ??= []).push("3.3.2");
+ D = (t9, i11, s10) => {
+ const e11 = s10?.renderBefore ?? i11;
+ let h8 = e11._$litPart$;
+ if (void 0 === h8) {
+ const t10 = s10?.renderBefore ?? null;
+ e11._$litPart$ = h8 = new k(i11.insertBefore(c3(), t10), t10, void 0, s10 ?? {});
+ }
+ return h8._$AI(t9), h8;
+ };
+ }
+});
+
+// node_modules/.pnpm/lit-element@4.2.2/node_modules/lit-element/lit-element.js
+var s3, i4, o4, n4;
+var init_lit_element = __esm({
+ "node_modules/.pnpm/lit-element@4.2.2/node_modules/lit-element/lit-element.js"() {
+ init_reactive_element();
+ init_reactive_element();
+ init_lit_html();
+ init_lit_html();
+ s3 = globalThis;
+ i4 = class extends y {
+ constructor() {
+ super(...arguments), this.renderOptions = { host: this }, this._$Do = void 0;
+ }
+ createRenderRoot() {
+ const t9 = super.createRenderRoot();
+ return this.renderOptions.renderBefore ??= t9.firstChild, t9;
+ }
+ update(t9) {
+ const r11 = this.render();
+ this.hasUpdated || (this.renderOptions.isConnected = this.isConnected), super.update(t9), this._$Do = D(r11, this.renderRoot, this.renderOptions);
+ }
+ connectedCallback() {
+ super.connectedCallback(), this._$Do?.setConnected(true);
+ }
+ disconnectedCallback() {
+ super.disconnectedCallback(), this._$Do?.setConnected(false);
+ }
+ render() {
+ return E;
+ }
+ };
+ i4._$litElement$ = true, i4["finalized"] = true, s3.litElementHydrateSupport?.({ LitElement: i4 });
+ o4 = s3.litElementPolyfillSupport;
+ o4?.({ LitElement: i4 });
+ n4 = { _$AK: (t9, e11, r11) => {
+ t9._$AK(e11, r11);
+ }, _$AL: (t9) => t9._$AL };
+ (s3.litElementVersions ??= []).push("4.2.2");
+ }
+});
+
+// node_modules/.pnpm/lit-html@3.3.2/node_modules/lit-html/is-server.js
+var o5;
+var init_is_server = __esm({
+ "node_modules/.pnpm/lit-html@3.3.2/node_modules/lit-html/is-server.js"() {
+ o5 = false;
+ }
+});
+
+// node_modules/.pnpm/lit@3.3.2/node_modules/lit/index.js
+var init_lit = __esm({
+ "node_modules/.pnpm/lit@3.3.2/node_modules/lit/index.js"() {
+ init_reactive_element();
+ init_lit_html();
+ init_lit_element();
+ init_is_server();
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+isounique@1.0.5/node_modules/@push.rocks/isounique/dist_ts/index.js
+var require_dist_ts = __commonJS({
+ "node_modules/.pnpm/@push.rocks+isounique@1.0.5/node_modules/@push.rocks/isounique/dist_ts/index.js"(exports) {
+ "use strict";
+ Object.defineProperty(exports, "__esModule", { value: true });
+ exports.uni = void 0;
+ var uni3 = (prefix4 = "uni") => {
+ return `${prefix4}_${`xxxxxxxxxxxxxxxxxxxxxxxx`.replace(/[xy]/g, (c11) => {
+ const r11 = Math.random() * 16 | 0;
+ const v5 = c11 === "x" ? r11 : r11 & 3 | 8;
+ return v5.toString(16);
+ })}`;
+ };
+ exports.uni = uni3;
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartpromise@4.2.3/node_modules/@push.rocks/smartpromise/dist_ts/smartpromise.classes.deferred.js
+var Deferred, defer;
+var init_smartpromise_classes_deferred = __esm({
+ "node_modules/.pnpm/@push.rocks+smartpromise@4.2.3/node_modules/@push.rocks/smartpromise/dist_ts/smartpromise.classes.deferred.js"() {
+ Deferred = class {
+ claim() {
+ if (this.claimed) {
+ throw new Error("Deferred already claimed");
+ }
+ this.claimed = true;
+ }
+ get duration() {
+ if (this.stoppedAt) {
+ return this.stoppedAt - this.startedAt;
+ } else {
+ return Date.now() - this.startedAt;
+ }
+ }
+ constructor() {
+ this.claimed = false;
+ this.promise = new Promise((resolve2, reject) => {
+ this.resolve = (valueArg) => {
+ this.status = "fulfilled";
+ this.stoppedAt = Date.now();
+ resolve2(valueArg);
+ };
+ this.reject = (reason) => {
+ this.status = "rejected";
+ this.stoppedAt = Date.now();
+ reject(reason);
+ };
+ this.startedAt = Date.now();
+ this.status = "pending";
+ });
+ }
+ };
+ defer = () => {
+ return new Deferred();
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartpromise@4.2.3/node_modules/@push.rocks/smartpromise/dist_ts/smartpromise.classes.cumulativedeferred.js
+var CumulativeDeferred, cumulativeDefer;
+var init_smartpromise_classes_cumulativedeferred = __esm({
+ "node_modules/.pnpm/@push.rocks+smartpromise@4.2.3/node_modules/@push.rocks/smartpromise/dist_ts/smartpromise.classes.cumulativedeferred.js"() {
+ init_smartpromise_classes_deferred();
+ CumulativeDeferred = class {
+ constructor() {
+ this.accumulatedPromises = [];
+ this.deferred = defer();
+ this.promise = this.deferred.promise;
+ setTimeout(async () => {
+ while (this.accumulatedPromises.length > 0) {
+ const poppedPromise = this.accumulatedPromises.shift();
+ await poppedPromise;
+ }
+ this.deferred.resolve();
+ }, 0);
+ }
+ subDefer() {
+ const done = defer();
+ this.addPromise(done.promise);
+ return done;
+ }
+ addPromise(promiseArg) {
+ this.accumulatedPromises.push(promiseArg);
+ }
+ };
+ cumulativeDefer = () => {
+ return new CumulativeDeferred();
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartpromise@4.2.3/node_modules/@push.rocks/smartpromise/dist_ts/index.js
+var dist_ts_exports = {};
+__export(dist_ts_exports, {
+ CumulativeDeferred: () => CumulativeDeferred,
+ Deferred: () => Deferred,
+ cumulativeDefer: () => cumulativeDefer,
+ defer: () => defer,
+ fromCallback: () => fromCallback,
+ getFirstTrueOrFalse: () => getFirstTrueOrFalse,
+ map: () => map,
+ rejectedPromise: () => rejectedPromise,
+ resolvedPromise: () => resolvedPromise,
+ timeoutAndContinue: () => timeoutAndContinue,
+ timeoutWrap: () => timeoutWrap
+});
+var resolvedPromise, rejectedPromise, map, timeoutWrap, timeoutAndContinue, getFirstTrueOrFalse, fromCallback;
+var init_dist_ts = __esm({
+ "node_modules/.pnpm/@push.rocks+smartpromise@4.2.3/node_modules/@push.rocks/smartpromise/dist_ts/index.js"() {
+ init_smartpromise_classes_deferred();
+ init_smartpromise_classes_cumulativedeferred();
+ init_smartpromise_classes_deferred();
+ resolvedPromise = (value2) => {
+ return Promise.resolve(value2);
+ };
+ rejectedPromise = (err) => {
+ return Promise.reject(err);
+ };
+ map = async (inputArg, functionArg) => {
+ const promiseArray = [];
+ const resultArray = [];
+ for (const item of inputArg) {
+ const promise = functionArg(item);
+ promiseArray.push(promise);
+ promise.then((x4) => {
+ resultArray.push(x4);
+ });
+ }
+ await Promise.all(promiseArray);
+ return resultArray;
+ };
+ timeoutWrap = async (promiseArg, timeoutInMsArg, rejectArg = true) => {
+ return new Promise((resolve2, reject) => {
+ setTimeout(() => {
+ if (rejectArg) {
+ reject(new Error("timeout"));
+ } else {
+ resolve2(null);
+ }
+ }, timeoutInMsArg);
+ promiseArg.then(resolve2, reject);
+ });
+ };
+ timeoutAndContinue = async (promiseArg, timeoutInMsArg = 6e4) => {
+ return timeoutWrap(promiseArg, timeoutInMsArg, false);
+ };
+ getFirstTrueOrFalse = async (promisesArg) => {
+ const done = defer();
+ for (const promiseArg of promisesArg) {
+ promiseArg.then((resultArg) => {
+ if (resultArg === true) {
+ done.resolve(true);
+ }
+ });
+ }
+ Promise.all(promisesArg).then(() => {
+ done.resolve(false);
+ });
+ return done.promise;
+ };
+ fromCallback = (fn) => {
+ return new Promise((resolve2, reject) => {
+ fn((err, result) => {
+ if (err) {
+ reject(err);
+ } else {
+ resolve2(result);
+ }
+ });
+ });
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartrx@3.0.10/node_modules/@push.rocks/smartrx/dist_ts/smartrx.plugins.js
+var init_smartrx_plugins = __esm({
+ "node_modules/.pnpm/@push.rocks+smartrx@3.0.10/node_modules/@push.rocks/smartrx/dist_ts/smartrx.plugins.js"() {
+ init_dist_ts();
+ }
+});
+
+// node_modules/.pnpm/tslib@2.8.1/node_modules/tslib/tslib.es6.mjs
+function __extends(d5, b5) {
+ if (typeof b5 !== "function" && b5 !== null)
+ throw new TypeError("Class extends value " + String(b5) + " is not a constructor or null");
+ extendStatics(d5, b5);
+ function __() {
+ this.constructor = d5;
+ }
+ d5.prototype = b5 === null ? Object.create(b5) : (__.prototype = b5.prototype, new __());
+}
+function __rest(s10, e11) {
+ var t9 = {};
+ for (var p7 in s10) if (Object.prototype.hasOwnProperty.call(s10, p7) && e11.indexOf(p7) < 0)
+ t9[p7] = s10[p7];
+ if (s10 != null && typeof Object.getOwnPropertySymbols === "function")
+ for (var i11 = 0, p7 = Object.getOwnPropertySymbols(s10); i11 < p7.length; i11++) {
+ if (e11.indexOf(p7[i11]) < 0 && Object.prototype.propertyIsEnumerable.call(s10, p7[i11]))
+ t9[p7[i11]] = s10[p7[i11]];
+ }
+ return t9;
+}
+function __decorate(decorators, target, key2, desc) {
+ var c11 = arguments.length, r11 = c11 < 3 ? target : desc === null ? desc = Object.getOwnPropertyDescriptor(target, key2) : desc, d5;
+ if (typeof Reflect === "object" && typeof Reflect.decorate === "function") r11 = Reflect.decorate(decorators, target, key2, desc);
+ else for (var i11 = decorators.length - 1; i11 >= 0; i11--) if (d5 = decorators[i11]) r11 = (c11 < 3 ? d5(r11) : c11 > 3 ? d5(target, key2, r11) : d5(target, key2)) || r11;
+ return c11 > 3 && r11 && Object.defineProperty(target, key2, r11), r11;
+}
+function __param(paramIndex, decorator) {
+ return function(target, key2) {
+ decorator(target, key2, paramIndex);
+ };
+}
+function __esDecorate(ctor, descriptorIn, decorators, contextIn, initializers, extraInitializers) {
+ function accept(f7) {
+ if (f7 !== void 0 && typeof f7 !== "function") throw new TypeError("Function expected");
+ return f7;
+ }
+ var kind = contextIn.kind, key2 = kind === "getter" ? "get" : kind === "setter" ? "set" : "value";
+ var target = !descriptorIn && ctor ? contextIn["static"] ? ctor : ctor.prototype : null;
+ var descriptor = descriptorIn || (target ? Object.getOwnPropertyDescriptor(target, contextIn.name) : {});
+ var _4, done = false;
+ for (var i11 = decorators.length - 1; i11 >= 0; i11--) {
+ var context2 = {};
+ for (var p7 in contextIn) context2[p7] = p7 === "access" ? {} : contextIn[p7];
+ for (var p7 in contextIn.access) context2.access[p7] = contextIn.access[p7];
+ context2.addInitializer = function(f7) {
+ if (done) throw new TypeError("Cannot add initializers after decoration has completed");
+ extraInitializers.push(accept(f7 || null));
+ };
+ var result = (0, decorators[i11])(kind === "accessor" ? { get: descriptor.get, set: descriptor.set } : descriptor[key2], context2);
+ if (kind === "accessor") {
+ if (result === void 0) continue;
+ if (result === null || typeof result !== "object") throw new TypeError("Object expected");
+ if (_4 = accept(result.get)) descriptor.get = _4;
+ if (_4 = accept(result.set)) descriptor.set = _4;
+ if (_4 = accept(result.init)) initializers.unshift(_4);
+ } else if (_4 = accept(result)) {
+ if (kind === "field") initializers.unshift(_4);
+ else descriptor[key2] = _4;
+ }
+ }
+ if (target) Object.defineProperty(target, contextIn.name, descriptor);
+ done = true;
+}
+function __runInitializers2(thisArg, initializers, value2) {
+ var useValue = arguments.length > 2;
+ for (var i11 = 0; i11 < initializers.length; i11++) {
+ value2 = useValue ? initializers[i11].call(thisArg, value2) : initializers[i11].call(thisArg);
+ }
+ return useValue ? value2 : void 0;
+}
+function __propKey(x4) {
+ return typeof x4 === "symbol" ? x4 : "".concat(x4);
+}
+function __setFunctionName(f7, name, prefix4) {
+ if (typeof name === "symbol") name = name.description ? "[".concat(name.description, "]") : "";
+ return Object.defineProperty(f7, "name", { configurable: true, value: prefix4 ? "".concat(prefix4, " ", name) : name });
+}
+function __metadata(metadataKey, metadataValue) {
+ if (typeof Reflect === "object" && typeof Reflect.metadata === "function") return Reflect.metadata(metadataKey, metadataValue);
+}
+function __awaiter(thisArg, _arguments, P4, generator) {
+ function adopt(value2) {
+ return value2 instanceof P4 ? value2 : new P4(function(resolve2) {
+ resolve2(value2);
+ });
+ }
+ return new (P4 || (P4 = Promise))(function(resolve2, reject) {
+ function fulfilled(value2) {
+ try {
+ step(generator.next(value2));
+ } catch (e11) {
+ reject(e11);
+ }
+ }
+ function rejected(value2) {
+ try {
+ step(generator["throw"](value2));
+ } catch (e11) {
+ reject(e11);
+ }
+ }
+ function step(result) {
+ result.done ? resolve2(result.value) : adopt(result.value).then(fulfilled, rejected);
+ }
+ step((generator = generator.apply(thisArg, _arguments || [])).next());
+ });
+}
+function __generator(thisArg, body3) {
+ var _4 = { label: 0, sent: function() {
+ if (t9[0] & 1) throw t9[1];
+ return t9[1];
+ }, trys: [], ops: [] }, f7, y4, t9, g4 = Object.create((typeof Iterator === "function" ? Iterator : Object).prototype);
+ return g4.next = verb(0), g4["throw"] = verb(1), g4["return"] = verb(2), typeof Symbol === "function" && (g4[Symbol.iterator] = function() {
+ return this;
+ }), g4;
+ function verb(n12) {
+ return function(v5) {
+ return step([n12, v5]);
+ };
+ }
+ function step(op) {
+ if (f7) throw new TypeError("Generator is already executing.");
+ while (g4 && (g4 = 0, op[0] && (_4 = 0)), _4) try {
+ if (f7 = 1, y4 && (t9 = op[0] & 2 ? y4["return"] : op[0] ? y4["throw"] || ((t9 = y4["return"]) && t9.call(y4), 0) : y4.next) && !(t9 = t9.call(y4, op[1])).done) return t9;
+ if (y4 = 0, t9) op = [op[0] & 2, t9.value];
+ switch (op[0]) {
+ case 0:
+ case 1:
+ t9 = op;
+ break;
+ case 4:
+ _4.label++;
+ return { value: op[1], done: false };
+ case 5:
+ _4.label++;
+ y4 = op[1];
+ op = [0];
+ continue;
+ case 7:
+ op = _4.ops.pop();
+ _4.trys.pop();
+ continue;
+ default:
+ if (!(t9 = _4.trys, t9 = t9.length > 0 && t9[t9.length - 1]) && (op[0] === 6 || op[0] === 2)) {
+ _4 = 0;
+ continue;
+ }
+ if (op[0] === 3 && (!t9 || op[1] > t9[0] && op[1] < t9[3])) {
+ _4.label = op[1];
+ break;
+ }
+ if (op[0] === 6 && _4.label < t9[1]) {
+ _4.label = t9[1];
+ t9 = op;
+ break;
+ }
+ if (t9 && _4.label < t9[2]) {
+ _4.label = t9[2];
+ _4.ops.push(op);
+ break;
+ }
+ if (t9[2]) _4.ops.pop();
+ _4.trys.pop();
+ continue;
+ }
+ op = body3.call(thisArg, _4);
+ } catch (e11) {
+ op = [6, e11];
+ y4 = 0;
+ } finally {
+ f7 = t9 = 0;
+ }
+ if (op[0] & 5) throw op[1];
+ return { value: op[0] ? op[1] : void 0, done: true };
+ }
+}
+function __exportStar(m6, o13) {
+ for (var p7 in m6) if (p7 !== "default" && !Object.prototype.hasOwnProperty.call(o13, p7)) __createBinding(o13, m6, p7);
+}
+function __values(o13) {
+ var s10 = typeof Symbol === "function" && Symbol.iterator, m6 = s10 && o13[s10], i11 = 0;
+ if (m6) return m6.call(o13);
+ if (o13 && typeof o13.length === "number") return {
+ next: function() {
+ if (o13 && i11 >= o13.length) o13 = void 0;
+ return { value: o13 && o13[i11++], done: !o13 };
+ }
+ };
+ throw new TypeError(s10 ? "Object is not iterable." : "Symbol.iterator is not defined.");
+}
+function __read(o13, n12) {
+ var m6 = typeof Symbol === "function" && o13[Symbol.iterator];
+ if (!m6) return o13;
+ var i11 = m6.call(o13), r11, ar = [], e11;
+ try {
+ while ((n12 === void 0 || n12-- > 0) && !(r11 = i11.next()).done) ar.push(r11.value);
+ } catch (error) {
+ e11 = { error };
+ } finally {
+ try {
+ if (r11 && !r11.done && (m6 = i11["return"])) m6.call(i11);
+ } finally {
+ if (e11) throw e11.error;
+ }
+ }
+ return ar;
+}
+function __spread() {
+ for (var ar = [], i11 = 0; i11 < arguments.length; i11++)
+ ar = ar.concat(__read(arguments[i11]));
+ return ar;
+}
+function __spreadArrays() {
+ for (var s10 = 0, i11 = 0, il = arguments.length; i11 < il; i11++) s10 += arguments[i11].length;
+ for (var r11 = Array(s10), k4 = 0, i11 = 0; i11 < il; i11++)
+ for (var a5 = arguments[i11], j4 = 0, jl = a5.length; j4 < jl; j4++, k4++)
+ r11[k4] = a5[j4];
+ return r11;
+}
+function __spreadArray(to, from2, pack) {
+ if (pack || arguments.length === 2) for (var i11 = 0, l6 = from2.length, ar; i11 < l6; i11++) {
+ if (ar || !(i11 in from2)) {
+ if (!ar) ar = Array.prototype.slice.call(from2, 0, i11);
+ ar[i11] = from2[i11];
+ }
+ }
+ return to.concat(ar || Array.prototype.slice.call(from2));
+}
+function __await(v5) {
+ return this instanceof __await ? (this.v = v5, this) : new __await(v5);
+}
+function __asyncGenerator(thisArg, _arguments, generator) {
+ if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined.");
+ var g4 = generator.apply(thisArg, _arguments || []), i11, q = [];
+ return i11 = Object.create((typeof AsyncIterator === "function" ? AsyncIterator : Object).prototype), verb("next"), verb("throw"), verb("return", awaitReturn), i11[Symbol.asyncIterator] = function() {
+ return this;
+ }, i11;
+ function awaitReturn(f7) {
+ return function(v5) {
+ return Promise.resolve(v5).then(f7, reject);
+ };
+ }
+ function verb(n12, f7) {
+ if (g4[n12]) {
+ i11[n12] = function(v5) {
+ return new Promise(function(a5, b5) {
+ q.push([n12, v5, a5, b5]) > 1 || resume(n12, v5);
+ });
+ };
+ if (f7) i11[n12] = f7(i11[n12]);
+ }
+ }
+ function resume(n12, v5) {
+ try {
+ step(g4[n12](v5));
+ } catch (e11) {
+ settle(q[0][3], e11);
+ }
+ }
+ function step(r11) {
+ r11.value instanceof __await ? Promise.resolve(r11.value.v).then(fulfill, reject) : settle(q[0][2], r11);
+ }
+ function fulfill(value2) {
+ resume("next", value2);
+ }
+ function reject(value2) {
+ resume("throw", value2);
+ }
+ function settle(f7, v5) {
+ if (f7(v5), q.shift(), q.length) resume(q[0][0], q[0][1]);
+ }
+}
+function __asyncDelegator(o13) {
+ var i11, p7;
+ return i11 = {}, verb("next"), verb("throw", function(e11) {
+ throw e11;
+ }), verb("return"), i11[Symbol.iterator] = function() {
+ return this;
+ }, i11;
+ function verb(n12, f7) {
+ i11[n12] = o13[n12] ? function(v5) {
+ return (p7 = !p7) ? { value: __await(o13[n12](v5)), done: false } : f7 ? f7(v5) : v5;
+ } : f7;
+ }
+}
+function __asyncValues(o13) {
+ if (!Symbol.asyncIterator) throw new TypeError("Symbol.asyncIterator is not defined.");
+ var m6 = o13[Symbol.asyncIterator], i11;
+ return m6 ? m6.call(o13) : (o13 = typeof __values === "function" ? __values(o13) : o13[Symbol.iterator](), i11 = {}, verb("next"), verb("throw"), verb("return"), i11[Symbol.asyncIterator] = function() {
+ return this;
+ }, i11);
+ function verb(n12) {
+ i11[n12] = o13[n12] && function(v5) {
+ return new Promise(function(resolve2, reject) {
+ v5 = o13[n12](v5), settle(resolve2, reject, v5.done, v5.value);
+ });
+ };
+ }
+ function settle(resolve2, reject, d5, v5) {
+ Promise.resolve(v5).then(function(v6) {
+ resolve2({ value: v6, done: d5 });
+ }, reject);
+ }
+}
+function __makeTemplateObject(cooked, raw2) {
+ if (Object.defineProperty) {
+ Object.defineProperty(cooked, "raw", { value: raw2 });
+ } else {
+ cooked.raw = raw2;
+ }
+ return cooked;
+}
+function __importStar(mod) {
+ if (mod && mod.__esModule) return mod;
+ var result = {};
+ if (mod != null) {
+ for (var k4 = ownKeys(mod), i11 = 0; i11 < k4.length; i11++) if (k4[i11] !== "default") __createBinding(result, mod, k4[i11]);
+ }
+ __setModuleDefault(result, mod);
+ return result;
+}
+function __importDefault(mod) {
+ return mod && mod.__esModule ? mod : { default: mod };
+}
+function __classPrivateFieldGet(receiver, state, kind, f7) {
+ if (kind === "a" && !f7) throw new TypeError("Private accessor was defined without a getter");
+ if (typeof state === "function" ? receiver !== state || !f7 : !state.has(receiver)) throw new TypeError("Cannot read private member from an object whose class did not declare it");
+ return kind === "m" ? f7 : kind === "a" ? f7.call(receiver) : f7 ? f7.value : state.get(receiver);
+}
+function __classPrivateFieldSet(receiver, state, value2, kind, f7) {
+ if (kind === "m") throw new TypeError("Private method is not writable");
+ if (kind === "a" && !f7) throw new TypeError("Private accessor was defined without a setter");
+ if (typeof state === "function" ? receiver !== state || !f7 : !state.has(receiver)) throw new TypeError("Cannot write private member to an object whose class did not declare it");
+ return kind === "a" ? f7.call(receiver, value2) : f7 ? f7.value = value2 : state.set(receiver, value2), value2;
+}
+function __classPrivateFieldIn(state, receiver) {
+ if (receiver === null || typeof receiver !== "object" && typeof receiver !== "function") throw new TypeError("Cannot use 'in' operator on non-object");
+ return typeof state === "function" ? receiver === state : state.has(receiver);
+}
+function __addDisposableResource(env2, value2, async2) {
+ if (value2 !== null && value2 !== void 0) {
+ if (typeof value2 !== "object" && typeof value2 !== "function") throw new TypeError("Object expected.");
+ var dispose, inner;
+ if (async2) {
+ if (!Symbol.asyncDispose) throw new TypeError("Symbol.asyncDispose is not defined.");
+ dispose = value2[Symbol.asyncDispose];
+ }
+ if (dispose === void 0) {
+ if (!Symbol.dispose) throw new TypeError("Symbol.dispose is not defined.");
+ dispose = value2[Symbol.dispose];
+ if (async2) inner = dispose;
+ }
+ if (typeof dispose !== "function") throw new TypeError("Object not disposable.");
+ if (inner) dispose = function() {
+ try {
+ inner.call(this);
+ } catch (e11) {
+ return Promise.reject(e11);
+ }
+ };
+ env2.stack.push({ value: value2, dispose, async: async2 });
+ } else if (async2) {
+ env2.stack.push({ async: true });
+ }
+ return value2;
+}
+function __disposeResources(env2) {
+ function fail(e11) {
+ env2.error = env2.hasError ? new _SuppressedError(e11, env2.error, "An error was suppressed during disposal.") : e11;
+ env2.hasError = true;
+ }
+ var r11, s10 = 0;
+ function next2() {
+ while (r11 = env2.stack.pop()) {
+ try {
+ if (!r11.async && s10 === 1) return s10 = 0, env2.stack.push(r11), Promise.resolve().then(next2);
+ if (r11.dispose) {
+ var result = r11.dispose.call(r11.value);
+ if (r11.async) return s10 |= 2, Promise.resolve(result).then(next2, function(e11) {
+ fail(e11);
+ return next2();
+ });
+ } else s10 |= 1;
+ } catch (e11) {
+ fail(e11);
+ }
+ }
+ if (s10 === 1) return env2.hasError ? Promise.reject(env2.error) : Promise.resolve();
+ if (env2.hasError) throw env2.error;
+ }
+ return next2();
+}
+function __rewriteRelativeImportExtension(path2, preserveJsx) {
+ if (typeof path2 === "string" && /^\.\.?\//.test(path2)) {
+ return path2.replace(/\.(tsx)$|((?:\.d)?)((?:\.[^./]+?)?)\.([cm]?)ts$/i, function(m6, tsx, d5, ext, cm) {
+ return tsx ? preserveJsx ? ".jsx" : ".js" : d5 && (!ext || !cm) ? m6 : d5 + ext + "." + cm.toLowerCase() + "js";
+ });
+ }
+ return path2;
+}
+var extendStatics, __assign, __createBinding, __setModuleDefault, ownKeys, _SuppressedError, tslib_es6_default;
+var init_tslib_es6 = __esm({
+ "node_modules/.pnpm/tslib@2.8.1/node_modules/tslib/tslib.es6.mjs"() {
+ extendStatics = function(d5, b5) {
+ extendStatics = Object.setPrototypeOf || { __proto__: [] } instanceof Array && function(d6, b6) {
+ d6.__proto__ = b6;
+ } || function(d6, b6) {
+ for (var p7 in b6) if (Object.prototype.hasOwnProperty.call(b6, p7)) d6[p7] = b6[p7];
+ };
+ return extendStatics(d5, b5);
+ };
+ __assign = function() {
+ __assign = Object.assign || function __assign2(t9) {
+ for (var s10, i11 = 1, n12 = arguments.length; i11 < n12; i11++) {
+ s10 = arguments[i11];
+ for (var p7 in s10) if (Object.prototype.hasOwnProperty.call(s10, p7)) t9[p7] = s10[p7];
+ }
+ return t9;
+ };
+ return __assign.apply(this, arguments);
+ };
+ ;
+ ;
+ ;
+ ;
+ __createBinding = Object.create ? (function(o13, m6, k4, k22) {
+ if (k22 === void 0) k22 = k4;
+ var desc = Object.getOwnPropertyDescriptor(m6, k4);
+ if (!desc || ("get" in desc ? !m6.__esModule : desc.writable || desc.configurable)) {
+ desc = { enumerable: true, get: function() {
+ return m6[k4];
+ } };
+ }
+ Object.defineProperty(o13, k22, desc);
+ }) : (function(o13, m6, k4, k22) {
+ if (k22 === void 0) k22 = k4;
+ o13[k22] = m6[k4];
+ });
+ ;
+ __setModuleDefault = Object.create ? (function(o13, v5) {
+ Object.defineProperty(o13, "default", { enumerable: true, value: v5 });
+ }) : function(o13, v5) {
+ o13["default"] = v5;
+ };
+ ownKeys = function(o13) {
+ ownKeys = Object.getOwnPropertyNames || function(o14) {
+ var ar = [];
+ for (var k4 in o14) if (Object.prototype.hasOwnProperty.call(o14, k4)) ar[ar.length] = k4;
+ return ar;
+ };
+ return ownKeys(o13);
+ };
+ _SuppressedError = typeof SuppressedError === "function" ? SuppressedError : function(error, suppressed, message2) {
+ var e11 = new Error(message2);
+ return e11.name = "SuppressedError", e11.error = error, e11.suppressed = suppressed, e11;
+ };
+ tslib_es6_default = {
+ __extends,
+ __assign,
+ __rest,
+ __decorate,
+ __param,
+ __esDecorate,
+ __runInitializers: __runInitializers2,
+ __propKey,
+ __setFunctionName,
+ __metadata,
+ __awaiter,
+ __generator,
+ __createBinding,
+ __exportStar,
+ __values,
+ __read,
+ __spread,
+ __spreadArrays,
+ __spreadArray,
+ __await,
+ __asyncGenerator,
+ __asyncDelegator,
+ __asyncValues,
+ __makeTemplateObject,
+ __importStar,
+ __importDefault,
+ __classPrivateFieldGet,
+ __classPrivateFieldSet,
+ __classPrivateFieldIn,
+ __addDisposableResource,
+ __disposeResources,
+ __rewriteRelativeImportExtension
+ };
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isFunction.js
+function isFunction(value2) {
+ return typeof value2 === "function";
+}
+var init_isFunction = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isFunction.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/createErrorClass.js
+function createErrorClass(createImpl) {
+ var _super = function(instance) {
+ Error.call(instance);
+ instance.stack = new Error().stack;
+ };
+ var ctorFunc = createImpl(_super);
+ ctorFunc.prototype = Object.create(Error.prototype);
+ ctorFunc.prototype.constructor = ctorFunc;
+ return ctorFunc;
+}
+var init_createErrorClass = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/createErrorClass.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/UnsubscriptionError.js
+var UnsubscriptionError;
+var init_UnsubscriptionError = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/UnsubscriptionError.js"() {
+ init_createErrorClass();
+ UnsubscriptionError = createErrorClass(function(_super) {
+ return function UnsubscriptionErrorImpl(errors) {
+ _super(this);
+ this.message = errors ? errors.length + " errors occurred during unsubscription:\n" + errors.map(function(err, i11) {
+ return i11 + 1 + ") " + err.toString();
+ }).join("\n ") : "";
+ this.name = "UnsubscriptionError";
+ this.errors = errors;
+ };
+ });
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/arrRemove.js
+function arrRemove(arr, item) {
+ if (arr) {
+ var index2 = arr.indexOf(item);
+ 0 <= index2 && arr.splice(index2, 1);
+ }
+}
+var init_arrRemove = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/arrRemove.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/Subscription.js
+function isSubscription(value2) {
+ return value2 instanceof Subscription || value2 && "closed" in value2 && isFunction(value2.remove) && isFunction(value2.add) && isFunction(value2.unsubscribe);
+}
+function execFinalizer(finalizer) {
+ if (isFunction(finalizer)) {
+ finalizer();
+ } else {
+ finalizer.unsubscribe();
+ }
+}
+var Subscription, EMPTY_SUBSCRIPTION;
+var init_Subscription = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/Subscription.js"() {
+ init_tslib_es6();
+ init_isFunction();
+ init_UnsubscriptionError();
+ init_arrRemove();
+ Subscription = (function() {
+ function Subscription2(initialTeardown) {
+ this.initialTeardown = initialTeardown;
+ this.closed = false;
+ this._parentage = null;
+ this._finalizers = null;
+ }
+ Subscription2.prototype.unsubscribe = function() {
+ var e_1, _a12, e_2, _b;
+ var errors;
+ if (!this.closed) {
+ this.closed = true;
+ var _parentage = this._parentage;
+ if (_parentage) {
+ this._parentage = null;
+ if (Array.isArray(_parentage)) {
+ try {
+ for (var _parentage_1 = __values(_parentage), _parentage_1_1 = _parentage_1.next(); !_parentage_1_1.done; _parentage_1_1 = _parentage_1.next()) {
+ var parent_1 = _parentage_1_1.value;
+ parent_1.remove(this);
+ }
+ } catch (e_1_1) {
+ e_1 = { error: e_1_1 };
+ } finally {
+ try {
+ if (_parentage_1_1 && !_parentage_1_1.done && (_a12 = _parentage_1.return)) _a12.call(_parentage_1);
+ } finally {
+ if (e_1) throw e_1.error;
+ }
+ }
+ } else {
+ _parentage.remove(this);
+ }
+ }
+ var initialFinalizer = this.initialTeardown;
+ if (isFunction(initialFinalizer)) {
+ try {
+ initialFinalizer();
+ } catch (e11) {
+ errors = e11 instanceof UnsubscriptionError ? e11.errors : [e11];
+ }
+ }
+ var _finalizers = this._finalizers;
+ if (_finalizers) {
+ this._finalizers = null;
+ try {
+ for (var _finalizers_1 = __values(_finalizers), _finalizers_1_1 = _finalizers_1.next(); !_finalizers_1_1.done; _finalizers_1_1 = _finalizers_1.next()) {
+ var finalizer = _finalizers_1_1.value;
+ try {
+ execFinalizer(finalizer);
+ } catch (err) {
+ errors = errors !== null && errors !== void 0 ? errors : [];
+ if (err instanceof UnsubscriptionError) {
+ errors = __spreadArray(__spreadArray([], __read(errors)), __read(err.errors));
+ } else {
+ errors.push(err);
+ }
+ }
+ }
+ } catch (e_2_1) {
+ e_2 = { error: e_2_1 };
+ } finally {
+ try {
+ if (_finalizers_1_1 && !_finalizers_1_1.done && (_b = _finalizers_1.return)) _b.call(_finalizers_1);
+ } finally {
+ if (e_2) throw e_2.error;
+ }
+ }
+ }
+ if (errors) {
+ throw new UnsubscriptionError(errors);
+ }
+ }
+ };
+ Subscription2.prototype.add = function(teardown) {
+ var _a12;
+ if (teardown && teardown !== this) {
+ if (this.closed) {
+ execFinalizer(teardown);
+ } else {
+ if (teardown instanceof Subscription2) {
+ if (teardown.closed || teardown._hasParent(this)) {
+ return;
+ }
+ teardown._addParent(this);
+ }
+ (this._finalizers = (_a12 = this._finalizers) !== null && _a12 !== void 0 ? _a12 : []).push(teardown);
+ }
+ }
+ };
+ Subscription2.prototype._hasParent = function(parent) {
+ var _parentage = this._parentage;
+ return _parentage === parent || Array.isArray(_parentage) && _parentage.includes(parent);
+ };
+ Subscription2.prototype._addParent = function(parent) {
+ var _parentage = this._parentage;
+ this._parentage = Array.isArray(_parentage) ? (_parentage.push(parent), _parentage) : _parentage ? [_parentage, parent] : parent;
+ };
+ Subscription2.prototype._removeParent = function(parent) {
+ var _parentage = this._parentage;
+ if (_parentage === parent) {
+ this._parentage = null;
+ } else if (Array.isArray(_parentage)) {
+ arrRemove(_parentage, parent);
+ }
+ };
+ Subscription2.prototype.remove = function(teardown) {
+ var _finalizers = this._finalizers;
+ _finalizers && arrRemove(_finalizers, teardown);
+ if (teardown instanceof Subscription2) {
+ teardown._removeParent(this);
+ }
+ };
+ Subscription2.EMPTY = (function() {
+ var empty4 = new Subscription2();
+ empty4.closed = true;
+ return empty4;
+ })();
+ return Subscription2;
+ })();
+ EMPTY_SUBSCRIPTION = Subscription.EMPTY;
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/config.js
+var config;
+var init_config = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/config.js"() {
+ config = {
+ onUnhandledError: null,
+ onStoppedNotification: null,
+ Promise: void 0,
+ useDeprecatedSynchronousErrorHandling: false,
+ useDeprecatedNextContext: false
+ };
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/timeoutProvider.js
+var timeoutProvider;
+var init_timeoutProvider = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/timeoutProvider.js"() {
+ init_tslib_es6();
+ timeoutProvider = {
+ setTimeout: function(handler2, timeout2) {
+ var args = [];
+ for (var _i = 2; _i < arguments.length; _i++) {
+ args[_i - 2] = arguments[_i];
+ }
+ var delegate = timeoutProvider.delegate;
+ if (delegate === null || delegate === void 0 ? void 0 : delegate.setTimeout) {
+ return delegate.setTimeout.apply(delegate, __spreadArray([handler2, timeout2], __read(args)));
+ }
+ return setTimeout.apply(void 0, __spreadArray([handler2, timeout2], __read(args)));
+ },
+ clearTimeout: function(handle3) {
+ var delegate = timeoutProvider.delegate;
+ return ((delegate === null || delegate === void 0 ? void 0 : delegate.clearTimeout) || clearTimeout)(handle3);
+ },
+ delegate: void 0
+ };
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/reportUnhandledError.js
+function reportUnhandledError(err) {
+ timeoutProvider.setTimeout(function() {
+ var onUnhandledError = config.onUnhandledError;
+ if (onUnhandledError) {
+ onUnhandledError(err);
+ } else {
+ throw err;
+ }
+ });
+}
+var init_reportUnhandledError = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/reportUnhandledError.js"() {
+ init_config();
+ init_timeoutProvider();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/noop.js
+function noop() {
+}
+var init_noop = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/noop.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/NotificationFactories.js
+function errorNotification(error) {
+ return createNotification("E", void 0, error);
+}
+function nextNotification(value2) {
+ return createNotification("N", value2, void 0);
+}
+function createNotification(kind, value2, error) {
+ return {
+ kind,
+ value: value2,
+ error
+ };
+}
+var COMPLETE_NOTIFICATION;
+var init_NotificationFactories = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/NotificationFactories.js"() {
+ COMPLETE_NOTIFICATION = (function() {
+ return createNotification("C", void 0, void 0);
+ })();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/errorContext.js
+function errorContext(cb) {
+ if (config.useDeprecatedSynchronousErrorHandling) {
+ var isRoot = !context;
+ if (isRoot) {
+ context = { errorThrown: false, error: null };
+ }
+ cb();
+ if (isRoot) {
+ var _a12 = context, errorThrown = _a12.errorThrown, error = _a12.error;
+ context = null;
+ if (errorThrown) {
+ throw error;
+ }
+ }
+ } else {
+ cb();
+ }
+}
+function captureError(err) {
+ if (config.useDeprecatedSynchronousErrorHandling && context) {
+ context.errorThrown = true;
+ context.error = err;
+ }
+}
+var context;
+var init_errorContext = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/errorContext.js"() {
+ init_config();
+ context = null;
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/Subscriber.js
+function bind(fn, thisArg) {
+ return _bind.call(fn, thisArg);
+}
+function handleUnhandledError(error) {
+ if (config.useDeprecatedSynchronousErrorHandling) {
+ captureError(error);
+ } else {
+ reportUnhandledError(error);
+ }
+}
+function defaultErrorHandler(err) {
+ throw err;
+}
+function handleStoppedNotification(notification, subscriber) {
+ var onStoppedNotification = config.onStoppedNotification;
+ onStoppedNotification && timeoutProvider.setTimeout(function() {
+ return onStoppedNotification(notification, subscriber);
+ });
+}
+var Subscriber, _bind, ConsumerObserver, SafeSubscriber, EMPTY_OBSERVER;
+var init_Subscriber = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/Subscriber.js"() {
+ init_tslib_es6();
+ init_isFunction();
+ init_Subscription();
+ init_config();
+ init_reportUnhandledError();
+ init_noop();
+ init_NotificationFactories();
+ init_timeoutProvider();
+ init_errorContext();
+ Subscriber = (function(_super) {
+ __extends(Subscriber2, _super);
+ function Subscriber2(destination) {
+ var _this = _super.call(this) || this;
+ _this.isStopped = false;
+ if (destination) {
+ _this.destination = destination;
+ if (isSubscription(destination)) {
+ destination.add(_this);
+ }
+ } else {
+ _this.destination = EMPTY_OBSERVER;
+ }
+ return _this;
+ }
+ Subscriber2.create = function(next2, error, complete) {
+ return new SafeSubscriber(next2, error, complete);
+ };
+ Subscriber2.prototype.next = function(value2) {
+ if (this.isStopped) {
+ handleStoppedNotification(nextNotification(value2), this);
+ } else {
+ this._next(value2);
+ }
+ };
+ Subscriber2.prototype.error = function(err) {
+ if (this.isStopped) {
+ handleStoppedNotification(errorNotification(err), this);
+ } else {
+ this.isStopped = true;
+ this._error(err);
+ }
+ };
+ Subscriber2.prototype.complete = function() {
+ if (this.isStopped) {
+ handleStoppedNotification(COMPLETE_NOTIFICATION, this);
+ } else {
+ this.isStopped = true;
+ this._complete();
+ }
+ };
+ Subscriber2.prototype.unsubscribe = function() {
+ if (!this.closed) {
+ this.isStopped = true;
+ _super.prototype.unsubscribe.call(this);
+ this.destination = null;
+ }
+ };
+ Subscriber2.prototype._next = function(value2) {
+ this.destination.next(value2);
+ };
+ Subscriber2.prototype._error = function(err) {
+ try {
+ this.destination.error(err);
+ } finally {
+ this.unsubscribe();
+ }
+ };
+ Subscriber2.prototype._complete = function() {
+ try {
+ this.destination.complete();
+ } finally {
+ this.unsubscribe();
+ }
+ };
+ return Subscriber2;
+ })(Subscription);
+ _bind = Function.prototype.bind;
+ ConsumerObserver = (function() {
+ function ConsumerObserver2(partialObserver) {
+ this.partialObserver = partialObserver;
+ }
+ ConsumerObserver2.prototype.next = function(value2) {
+ var partialObserver = this.partialObserver;
+ if (partialObserver.next) {
+ try {
+ partialObserver.next(value2);
+ } catch (error) {
+ handleUnhandledError(error);
+ }
+ }
+ };
+ ConsumerObserver2.prototype.error = function(err) {
+ var partialObserver = this.partialObserver;
+ if (partialObserver.error) {
+ try {
+ partialObserver.error(err);
+ } catch (error) {
+ handleUnhandledError(error);
+ }
+ } else {
+ handleUnhandledError(err);
+ }
+ };
+ ConsumerObserver2.prototype.complete = function() {
+ var partialObserver = this.partialObserver;
+ if (partialObserver.complete) {
+ try {
+ partialObserver.complete();
+ } catch (error) {
+ handleUnhandledError(error);
+ }
+ }
+ };
+ return ConsumerObserver2;
+ })();
+ SafeSubscriber = (function(_super) {
+ __extends(SafeSubscriber2, _super);
+ function SafeSubscriber2(observerOrNext, error, complete) {
+ var _this = _super.call(this) || this;
+ var partialObserver;
+ if (isFunction(observerOrNext) || !observerOrNext) {
+ partialObserver = {
+ next: observerOrNext !== null && observerOrNext !== void 0 ? observerOrNext : void 0,
+ error: error !== null && error !== void 0 ? error : void 0,
+ complete: complete !== null && complete !== void 0 ? complete : void 0
+ };
+ } else {
+ var context_1;
+ if (_this && config.useDeprecatedNextContext) {
+ context_1 = Object.create(observerOrNext);
+ context_1.unsubscribe = function() {
+ return _this.unsubscribe();
+ };
+ partialObserver = {
+ next: observerOrNext.next && bind(observerOrNext.next, context_1),
+ error: observerOrNext.error && bind(observerOrNext.error, context_1),
+ complete: observerOrNext.complete && bind(observerOrNext.complete, context_1)
+ };
+ } else {
+ partialObserver = observerOrNext;
+ }
+ }
+ _this.destination = new ConsumerObserver(partialObserver);
+ return _this;
+ }
+ return SafeSubscriber2;
+ })(Subscriber);
+ EMPTY_OBSERVER = {
+ closed: true,
+ next: noop,
+ error: defaultErrorHandler,
+ complete: noop
+ };
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/symbol/observable.js
+var observable;
+var init_observable = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/symbol/observable.js"() {
+ observable = (function() {
+ return typeof Symbol === "function" && Symbol.observable || "@@observable";
+ })();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/identity.js
+function identity(x4) {
+ return x4;
+}
+var init_identity = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/identity.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/pipe.js
+function pipe() {
+ var fns = [];
+ for (var _i = 0; _i < arguments.length; _i++) {
+ fns[_i] = arguments[_i];
+ }
+ return pipeFromArray(fns);
+}
+function pipeFromArray(fns) {
+ if (fns.length === 0) {
+ return identity;
+ }
+ if (fns.length === 1) {
+ return fns[0];
+ }
+ return function piped(input) {
+ return fns.reduce(function(prev, fn) {
+ return fn(prev);
+ }, input);
+ };
+}
+var init_pipe = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/pipe.js"() {
+ init_identity();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/Observable.js
+function getPromiseCtor(promiseCtor) {
+ var _a12;
+ return (_a12 = promiseCtor !== null && promiseCtor !== void 0 ? promiseCtor : config.Promise) !== null && _a12 !== void 0 ? _a12 : Promise;
+}
+function isObserver(value2) {
+ return value2 && isFunction(value2.next) && isFunction(value2.error) && isFunction(value2.complete);
+}
+function isSubscriber(value2) {
+ return value2 && value2 instanceof Subscriber || isObserver(value2) && isSubscription(value2);
+}
+var Observable;
+var init_Observable = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/Observable.js"() {
+ init_Subscriber();
+ init_Subscription();
+ init_observable();
+ init_pipe();
+ init_config();
+ init_isFunction();
+ init_errorContext();
+ Observable = (function() {
+ function Observable2(subscribe2) {
+ if (subscribe2) {
+ this._subscribe = subscribe2;
+ }
+ }
+ Observable2.prototype.lift = function(operator) {
+ var observable2 = new Observable2();
+ observable2.source = this;
+ observable2.operator = operator;
+ return observable2;
+ };
+ Observable2.prototype.subscribe = function(observerOrNext, error, complete) {
+ var _this = this;
+ var subscriber = isSubscriber(observerOrNext) ? observerOrNext : new SafeSubscriber(observerOrNext, error, complete);
+ errorContext(function() {
+ var _a12 = _this, operator = _a12.operator, source = _a12.source;
+ subscriber.add(operator ? operator.call(subscriber, source) : source ? _this._subscribe(subscriber) : _this._trySubscribe(subscriber));
+ });
+ return subscriber;
+ };
+ Observable2.prototype._trySubscribe = function(sink) {
+ try {
+ return this._subscribe(sink);
+ } catch (err) {
+ sink.error(err);
+ }
+ };
+ Observable2.prototype.forEach = function(next2, promiseCtor) {
+ var _this = this;
+ promiseCtor = getPromiseCtor(promiseCtor);
+ return new promiseCtor(function(resolve2, reject) {
+ var subscriber = new SafeSubscriber({
+ next: function(value2) {
+ try {
+ next2(value2);
+ } catch (err) {
+ reject(err);
+ subscriber.unsubscribe();
+ }
+ },
+ error: reject,
+ complete: resolve2
+ });
+ _this.subscribe(subscriber);
+ });
+ };
+ Observable2.prototype._subscribe = function(subscriber) {
+ var _a12;
+ return (_a12 = this.source) === null || _a12 === void 0 ? void 0 : _a12.subscribe(subscriber);
+ };
+ Observable2.prototype[observable] = function() {
+ return this;
+ };
+ Observable2.prototype.pipe = function() {
+ var operations = [];
+ for (var _i = 0; _i < arguments.length; _i++) {
+ operations[_i] = arguments[_i];
+ }
+ return pipeFromArray(operations)(this);
+ };
+ Observable2.prototype.toPromise = function(promiseCtor) {
+ var _this = this;
+ promiseCtor = getPromiseCtor(promiseCtor);
+ return new promiseCtor(function(resolve2, reject) {
+ var value2;
+ _this.subscribe(function(x4) {
+ return value2 = x4;
+ }, function(err) {
+ return reject(err);
+ }, function() {
+ return resolve2(value2);
+ });
+ });
+ };
+ Observable2.create = function(subscribe2) {
+ return new Observable2(subscribe2);
+ };
+ return Observable2;
+ })();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/lift.js
+function hasLift(source) {
+ return isFunction(source === null || source === void 0 ? void 0 : source.lift);
+}
+function operate(init) {
+ return function(source) {
+ if (hasLift(source)) {
+ return source.lift(function(liftedSource) {
+ try {
+ return init(liftedSource, this);
+ } catch (err) {
+ this.error(err);
+ }
+ });
+ }
+ throw new TypeError("Unable to lift unknown Observable type");
+ };
+}
+var init_lift = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/lift.js"() {
+ init_isFunction();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/OperatorSubscriber.js
+function createOperatorSubscriber(destination, onNext, onComplete, onError, onFinalize) {
+ return new OperatorSubscriber(destination, onNext, onComplete, onError, onFinalize);
+}
+var OperatorSubscriber;
+var init_OperatorSubscriber = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/OperatorSubscriber.js"() {
+ init_tslib_es6();
+ init_Subscriber();
+ OperatorSubscriber = (function(_super) {
+ __extends(OperatorSubscriber2, _super);
+ function OperatorSubscriber2(destination, onNext, onComplete, onError, onFinalize, shouldUnsubscribe) {
+ var _this = _super.call(this, destination) || this;
+ _this.onFinalize = onFinalize;
+ _this.shouldUnsubscribe = shouldUnsubscribe;
+ _this._next = onNext ? function(value2) {
+ try {
+ onNext(value2);
+ } catch (err) {
+ destination.error(err);
+ }
+ } : _super.prototype._next;
+ _this._error = onError ? function(err) {
+ try {
+ onError(err);
+ } catch (err2) {
+ destination.error(err2);
+ } finally {
+ this.unsubscribe();
+ }
+ } : _super.prototype._error;
+ _this._complete = onComplete ? function() {
+ try {
+ onComplete();
+ } catch (err) {
+ destination.error(err);
+ } finally {
+ this.unsubscribe();
+ }
+ } : _super.prototype._complete;
+ return _this;
+ }
+ OperatorSubscriber2.prototype.unsubscribe = function() {
+ var _a12;
+ if (!this.shouldUnsubscribe || this.shouldUnsubscribe()) {
+ var closed_1 = this.closed;
+ _super.prototype.unsubscribe.call(this);
+ !closed_1 && ((_a12 = this.onFinalize) === null || _a12 === void 0 ? void 0 : _a12.call(this));
+ }
+ };
+ return OperatorSubscriber2;
+ })(Subscriber);
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/refCount.js
+function refCount() {
+ return operate(function(source, subscriber) {
+ var connection = null;
+ source._refCount++;
+ var refCounter = createOperatorSubscriber(subscriber, void 0, void 0, void 0, function() {
+ if (!source || source._refCount <= 0 || 0 < --source._refCount) {
+ connection = null;
+ return;
+ }
+ var sharedConnection = source._connection;
+ var conn = connection;
+ connection = null;
+ if (sharedConnection && (!conn || sharedConnection === conn)) {
+ sharedConnection.unsubscribe();
+ }
+ subscriber.unsubscribe();
+ });
+ source.subscribe(refCounter);
+ if (!refCounter.closed) {
+ connection = source.connect();
+ }
+ });
+}
+var init_refCount = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/refCount.js"() {
+ init_lift();
+ init_OperatorSubscriber();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/ConnectableObservable.js
+var ConnectableObservable;
+var init_ConnectableObservable = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/ConnectableObservable.js"() {
+ init_tslib_es6();
+ init_Observable();
+ init_Subscription();
+ init_refCount();
+ init_OperatorSubscriber();
+ init_lift();
+ ConnectableObservable = (function(_super) {
+ __extends(ConnectableObservable2, _super);
+ function ConnectableObservable2(source, subjectFactory) {
+ var _this = _super.call(this) || this;
+ _this.source = source;
+ _this.subjectFactory = subjectFactory;
+ _this._subject = null;
+ _this._refCount = 0;
+ _this._connection = null;
+ if (hasLift(source)) {
+ _this.lift = source.lift;
+ }
+ return _this;
+ }
+ ConnectableObservable2.prototype._subscribe = function(subscriber) {
+ return this.getSubject().subscribe(subscriber);
+ };
+ ConnectableObservable2.prototype.getSubject = function() {
+ var subject = this._subject;
+ if (!subject || subject.isStopped) {
+ this._subject = this.subjectFactory();
+ }
+ return this._subject;
+ };
+ ConnectableObservable2.prototype._teardown = function() {
+ this._refCount = 0;
+ var _connection = this._connection;
+ this._subject = this._connection = null;
+ _connection === null || _connection === void 0 ? void 0 : _connection.unsubscribe();
+ };
+ ConnectableObservable2.prototype.connect = function() {
+ var _this = this;
+ var connection = this._connection;
+ if (!connection) {
+ connection = this._connection = new Subscription();
+ var subject_1 = this.getSubject();
+ connection.add(this.source.subscribe(createOperatorSubscriber(subject_1, void 0, function() {
+ _this._teardown();
+ subject_1.complete();
+ }, function(err) {
+ _this._teardown();
+ subject_1.error(err);
+ }, function() {
+ return _this._teardown();
+ })));
+ if (connection.closed) {
+ this._connection = null;
+ connection = Subscription.EMPTY;
+ }
+ }
+ return connection;
+ };
+ ConnectableObservable2.prototype.refCount = function() {
+ return refCount()(this);
+ };
+ return ConnectableObservable2;
+ })(Observable);
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/performanceTimestampProvider.js
+var performanceTimestampProvider;
+var init_performanceTimestampProvider = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/performanceTimestampProvider.js"() {
+ performanceTimestampProvider = {
+ now: function() {
+ return (performanceTimestampProvider.delegate || performance).now();
+ },
+ delegate: void 0
+ };
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/animationFrameProvider.js
+var animationFrameProvider;
+var init_animationFrameProvider = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/animationFrameProvider.js"() {
+ init_tslib_es6();
+ init_Subscription();
+ animationFrameProvider = {
+ schedule: function(callback) {
+ var request = requestAnimationFrame;
+ var cancel = cancelAnimationFrame;
+ var delegate = animationFrameProvider.delegate;
+ if (delegate) {
+ request = delegate.requestAnimationFrame;
+ cancel = delegate.cancelAnimationFrame;
+ }
+ var handle3 = request(function(timestamp2) {
+ cancel = void 0;
+ callback(timestamp2);
+ });
+ return new Subscription(function() {
+ return cancel === null || cancel === void 0 ? void 0 : cancel(handle3);
+ });
+ },
+ requestAnimationFrame: function() {
+ var args = [];
+ for (var _i = 0; _i < arguments.length; _i++) {
+ args[_i] = arguments[_i];
+ }
+ var delegate = animationFrameProvider.delegate;
+ return ((delegate === null || delegate === void 0 ? void 0 : delegate.requestAnimationFrame) || requestAnimationFrame).apply(void 0, __spreadArray([], __read(args)));
+ },
+ cancelAnimationFrame: function() {
+ var args = [];
+ for (var _i = 0; _i < arguments.length; _i++) {
+ args[_i] = arguments[_i];
+ }
+ var delegate = animationFrameProvider.delegate;
+ return ((delegate === null || delegate === void 0 ? void 0 : delegate.cancelAnimationFrame) || cancelAnimationFrame).apply(void 0, __spreadArray([], __read(args)));
+ },
+ delegate: void 0
+ };
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/dom/animationFrames.js
+function animationFrames(timestampProvider) {
+ return timestampProvider ? animationFramesFactory(timestampProvider) : DEFAULT_ANIMATION_FRAMES;
+}
+function animationFramesFactory(timestampProvider) {
+ return new Observable(function(subscriber) {
+ var provider = timestampProvider || performanceTimestampProvider;
+ var start = provider.now();
+ var id = 0;
+ var run = function() {
+ if (!subscriber.closed) {
+ id = animationFrameProvider.requestAnimationFrame(function(timestamp2) {
+ id = 0;
+ var now2 = provider.now();
+ subscriber.next({
+ timestamp: timestampProvider ? now2 : timestamp2,
+ elapsed: now2 - start
+ });
+ run();
+ });
+ }
+ };
+ run();
+ return function() {
+ if (id) {
+ animationFrameProvider.cancelAnimationFrame(id);
+ }
+ };
+ });
+}
+var DEFAULT_ANIMATION_FRAMES;
+var init_animationFrames = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/dom/animationFrames.js"() {
+ init_Observable();
+ init_performanceTimestampProvider();
+ init_animationFrameProvider();
+ DEFAULT_ANIMATION_FRAMES = animationFramesFactory();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/ObjectUnsubscribedError.js
+var ObjectUnsubscribedError;
+var init_ObjectUnsubscribedError = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/ObjectUnsubscribedError.js"() {
+ init_createErrorClass();
+ ObjectUnsubscribedError = createErrorClass(function(_super) {
+ return function ObjectUnsubscribedErrorImpl() {
+ _super(this);
+ this.name = "ObjectUnsubscribedError";
+ this.message = "object unsubscribed";
+ };
+ });
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/Subject.js
+var Subject, AnonymousSubject;
+var init_Subject = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/Subject.js"() {
+ init_tslib_es6();
+ init_Observable();
+ init_Subscription();
+ init_ObjectUnsubscribedError();
+ init_arrRemove();
+ init_errorContext();
+ Subject = (function(_super) {
+ __extends(Subject2, _super);
+ function Subject2() {
+ var _this = _super.call(this) || this;
+ _this.closed = false;
+ _this.currentObservers = null;
+ _this.observers = [];
+ _this.isStopped = false;
+ _this.hasError = false;
+ _this.thrownError = null;
+ return _this;
+ }
+ Subject2.prototype.lift = function(operator) {
+ var subject = new AnonymousSubject(this, this);
+ subject.operator = operator;
+ return subject;
+ };
+ Subject2.prototype._throwIfClosed = function() {
+ if (this.closed) {
+ throw new ObjectUnsubscribedError();
+ }
+ };
+ Subject2.prototype.next = function(value2) {
+ var _this = this;
+ errorContext(function() {
+ var e_1, _a12;
+ _this._throwIfClosed();
+ if (!_this.isStopped) {
+ if (!_this.currentObservers) {
+ _this.currentObservers = Array.from(_this.observers);
+ }
+ try {
+ for (var _b = __values(_this.currentObservers), _c = _b.next(); !_c.done; _c = _b.next()) {
+ var observer = _c.value;
+ observer.next(value2);
+ }
+ } catch (e_1_1) {
+ e_1 = { error: e_1_1 };
+ } finally {
+ try {
+ if (_c && !_c.done && (_a12 = _b.return)) _a12.call(_b);
+ } finally {
+ if (e_1) throw e_1.error;
+ }
+ }
+ }
+ });
+ };
+ Subject2.prototype.error = function(err) {
+ var _this = this;
+ errorContext(function() {
+ _this._throwIfClosed();
+ if (!_this.isStopped) {
+ _this.hasError = _this.isStopped = true;
+ _this.thrownError = err;
+ var observers = _this.observers;
+ while (observers.length) {
+ observers.shift().error(err);
+ }
+ }
+ });
+ };
+ Subject2.prototype.complete = function() {
+ var _this = this;
+ errorContext(function() {
+ _this._throwIfClosed();
+ if (!_this.isStopped) {
+ _this.isStopped = true;
+ var observers = _this.observers;
+ while (observers.length) {
+ observers.shift().complete();
+ }
+ }
+ });
+ };
+ Subject2.prototype.unsubscribe = function() {
+ this.isStopped = this.closed = true;
+ this.observers = this.currentObservers = null;
+ };
+ Object.defineProperty(Subject2.prototype, "observed", {
+ get: function() {
+ var _a12;
+ return ((_a12 = this.observers) === null || _a12 === void 0 ? void 0 : _a12.length) > 0;
+ },
+ enumerable: false,
+ configurable: true
+ });
+ Subject2.prototype._trySubscribe = function(subscriber) {
+ this._throwIfClosed();
+ return _super.prototype._trySubscribe.call(this, subscriber);
+ };
+ Subject2.prototype._subscribe = function(subscriber) {
+ this._throwIfClosed();
+ this._checkFinalizedStatuses(subscriber);
+ return this._innerSubscribe(subscriber);
+ };
+ Subject2.prototype._innerSubscribe = function(subscriber) {
+ var _this = this;
+ var _a12 = this, hasError = _a12.hasError, isStopped = _a12.isStopped, observers = _a12.observers;
+ if (hasError || isStopped) {
+ return EMPTY_SUBSCRIPTION;
+ }
+ this.currentObservers = null;
+ observers.push(subscriber);
+ return new Subscription(function() {
+ _this.currentObservers = null;
+ arrRemove(observers, subscriber);
+ });
+ };
+ Subject2.prototype._checkFinalizedStatuses = function(subscriber) {
+ var _a12 = this, hasError = _a12.hasError, thrownError = _a12.thrownError, isStopped = _a12.isStopped;
+ if (hasError) {
+ subscriber.error(thrownError);
+ } else if (isStopped) {
+ subscriber.complete();
+ }
+ };
+ Subject2.prototype.asObservable = function() {
+ var observable2 = new Observable();
+ observable2.source = this;
+ return observable2;
+ };
+ Subject2.create = function(destination, source) {
+ return new AnonymousSubject(destination, source);
+ };
+ return Subject2;
+ })(Observable);
+ AnonymousSubject = (function(_super) {
+ __extends(AnonymousSubject2, _super);
+ function AnonymousSubject2(destination, source) {
+ var _this = _super.call(this) || this;
+ _this.destination = destination;
+ _this.source = source;
+ return _this;
+ }
+ AnonymousSubject2.prototype.next = function(value2) {
+ var _a12, _b;
+ (_b = (_a12 = this.destination) === null || _a12 === void 0 ? void 0 : _a12.next) === null || _b === void 0 ? void 0 : _b.call(_a12, value2);
+ };
+ AnonymousSubject2.prototype.error = function(err) {
+ var _a12, _b;
+ (_b = (_a12 = this.destination) === null || _a12 === void 0 ? void 0 : _a12.error) === null || _b === void 0 ? void 0 : _b.call(_a12, err);
+ };
+ AnonymousSubject2.prototype.complete = function() {
+ var _a12, _b;
+ (_b = (_a12 = this.destination) === null || _a12 === void 0 ? void 0 : _a12.complete) === null || _b === void 0 ? void 0 : _b.call(_a12);
+ };
+ AnonymousSubject2.prototype._subscribe = function(subscriber) {
+ var _a12, _b;
+ return (_b = (_a12 = this.source) === null || _a12 === void 0 ? void 0 : _a12.subscribe(subscriber)) !== null && _b !== void 0 ? _b : EMPTY_SUBSCRIPTION;
+ };
+ return AnonymousSubject2;
+ })(Subject);
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/BehaviorSubject.js
+var BehaviorSubject;
+var init_BehaviorSubject = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/BehaviorSubject.js"() {
+ init_tslib_es6();
+ init_Subject();
+ BehaviorSubject = (function(_super) {
+ __extends(BehaviorSubject2, _super);
+ function BehaviorSubject2(_value) {
+ var _this = _super.call(this) || this;
+ _this._value = _value;
+ return _this;
+ }
+ Object.defineProperty(BehaviorSubject2.prototype, "value", {
+ get: function() {
+ return this.getValue();
+ },
+ enumerable: false,
+ configurable: true
+ });
+ BehaviorSubject2.prototype._subscribe = function(subscriber) {
+ var subscription = _super.prototype._subscribe.call(this, subscriber);
+ !subscription.closed && subscriber.next(this._value);
+ return subscription;
+ };
+ BehaviorSubject2.prototype.getValue = function() {
+ var _a12 = this, hasError = _a12.hasError, thrownError = _a12.thrownError, _value = _a12._value;
+ if (hasError) {
+ throw thrownError;
+ }
+ this._throwIfClosed();
+ return _value;
+ };
+ BehaviorSubject2.prototype.next = function(value2) {
+ _super.prototype.next.call(this, this._value = value2);
+ };
+ return BehaviorSubject2;
+ })(Subject);
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/dateTimestampProvider.js
+var dateTimestampProvider;
+var init_dateTimestampProvider = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/dateTimestampProvider.js"() {
+ dateTimestampProvider = {
+ now: function() {
+ return (dateTimestampProvider.delegate || Date).now();
+ },
+ delegate: void 0
+ };
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/ReplaySubject.js
+var ReplaySubject;
+var init_ReplaySubject = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/ReplaySubject.js"() {
+ init_tslib_es6();
+ init_Subject();
+ init_dateTimestampProvider();
+ ReplaySubject = (function(_super) {
+ __extends(ReplaySubject2, _super);
+ function ReplaySubject2(_bufferSize, _windowTime, _timestampProvider) {
+ if (_bufferSize === void 0) {
+ _bufferSize = Infinity;
+ }
+ if (_windowTime === void 0) {
+ _windowTime = Infinity;
+ }
+ if (_timestampProvider === void 0) {
+ _timestampProvider = dateTimestampProvider;
+ }
+ var _this = _super.call(this) || this;
+ _this._bufferSize = _bufferSize;
+ _this._windowTime = _windowTime;
+ _this._timestampProvider = _timestampProvider;
+ _this._buffer = [];
+ _this._infiniteTimeWindow = true;
+ _this._infiniteTimeWindow = _windowTime === Infinity;
+ _this._bufferSize = Math.max(1, _bufferSize);
+ _this._windowTime = Math.max(1, _windowTime);
+ return _this;
+ }
+ ReplaySubject2.prototype.next = function(value2) {
+ var _a12 = this, isStopped = _a12.isStopped, _buffer = _a12._buffer, _infiniteTimeWindow = _a12._infiniteTimeWindow, _timestampProvider = _a12._timestampProvider, _windowTime = _a12._windowTime;
+ if (!isStopped) {
+ _buffer.push(value2);
+ !_infiniteTimeWindow && _buffer.push(_timestampProvider.now() + _windowTime);
+ }
+ this._trimBuffer();
+ _super.prototype.next.call(this, value2);
+ };
+ ReplaySubject2.prototype._subscribe = function(subscriber) {
+ this._throwIfClosed();
+ this._trimBuffer();
+ var subscription = this._innerSubscribe(subscriber);
+ var _a12 = this, _infiniteTimeWindow = _a12._infiniteTimeWindow, _buffer = _a12._buffer;
+ var copy = _buffer.slice();
+ for (var i11 = 0; i11 < copy.length && !subscriber.closed; i11 += _infiniteTimeWindow ? 1 : 2) {
+ subscriber.next(copy[i11]);
+ }
+ this._checkFinalizedStatuses(subscriber);
+ return subscription;
+ };
+ ReplaySubject2.prototype._trimBuffer = function() {
+ var _a12 = this, _bufferSize = _a12._bufferSize, _timestampProvider = _a12._timestampProvider, _buffer = _a12._buffer, _infiniteTimeWindow = _a12._infiniteTimeWindow;
+ var adjustedBufferSize = (_infiniteTimeWindow ? 1 : 2) * _bufferSize;
+ _bufferSize < Infinity && adjustedBufferSize < _buffer.length && _buffer.splice(0, _buffer.length - adjustedBufferSize);
+ if (!_infiniteTimeWindow) {
+ var now2 = _timestampProvider.now();
+ var last3 = 0;
+ for (var i11 = 1; i11 < _buffer.length && _buffer[i11] <= now2; i11 += 2) {
+ last3 = i11;
+ }
+ last3 && _buffer.splice(0, last3 + 1);
+ }
+ };
+ return ReplaySubject2;
+ })(Subject);
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/AsyncSubject.js
+var AsyncSubject;
+var init_AsyncSubject = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/AsyncSubject.js"() {
+ init_tslib_es6();
+ init_Subject();
+ AsyncSubject = (function(_super) {
+ __extends(AsyncSubject2, _super);
+ function AsyncSubject2() {
+ var _this = _super !== null && _super.apply(this, arguments) || this;
+ _this._value = null;
+ _this._hasValue = false;
+ _this._isComplete = false;
+ return _this;
+ }
+ AsyncSubject2.prototype._checkFinalizedStatuses = function(subscriber) {
+ var _a12 = this, hasError = _a12.hasError, _hasValue = _a12._hasValue, _value = _a12._value, thrownError = _a12.thrownError, isStopped = _a12.isStopped, _isComplete = _a12._isComplete;
+ if (hasError) {
+ subscriber.error(thrownError);
+ } else if (isStopped || _isComplete) {
+ _hasValue && subscriber.next(_value);
+ subscriber.complete();
+ }
+ };
+ AsyncSubject2.prototype.next = function(value2) {
+ if (!this.isStopped) {
+ this._value = value2;
+ this._hasValue = true;
+ }
+ };
+ AsyncSubject2.prototype.complete = function() {
+ var _a12 = this, _hasValue = _a12._hasValue, _value = _a12._value, _isComplete = _a12._isComplete;
+ if (!_isComplete) {
+ this._isComplete = true;
+ _hasValue && _super.prototype.next.call(this, _value);
+ _super.prototype.complete.call(this);
+ }
+ };
+ return AsyncSubject2;
+ })(Subject);
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/Action.js
+var Action;
+var init_Action = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/Action.js"() {
+ init_tslib_es6();
+ init_Subscription();
+ Action = (function(_super) {
+ __extends(Action2, _super);
+ function Action2(scheduler, work) {
+ return _super.call(this) || this;
+ }
+ Action2.prototype.schedule = function(state, delay2) {
+ if (delay2 === void 0) {
+ delay2 = 0;
+ }
+ return this;
+ };
+ return Action2;
+ })(Subscription);
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/intervalProvider.js
+var intervalProvider;
+var init_intervalProvider = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/intervalProvider.js"() {
+ init_tslib_es6();
+ intervalProvider = {
+ setInterval: function(handler2, timeout2) {
+ var args = [];
+ for (var _i = 2; _i < arguments.length; _i++) {
+ args[_i - 2] = arguments[_i];
+ }
+ var delegate = intervalProvider.delegate;
+ if (delegate === null || delegate === void 0 ? void 0 : delegate.setInterval) {
+ return delegate.setInterval.apply(delegate, __spreadArray([handler2, timeout2], __read(args)));
+ }
+ return setInterval.apply(void 0, __spreadArray([handler2, timeout2], __read(args)));
+ },
+ clearInterval: function(handle3) {
+ var delegate = intervalProvider.delegate;
+ return ((delegate === null || delegate === void 0 ? void 0 : delegate.clearInterval) || clearInterval)(handle3);
+ },
+ delegate: void 0
+ };
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/AsyncAction.js
+var AsyncAction;
+var init_AsyncAction = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/AsyncAction.js"() {
+ init_tslib_es6();
+ init_Action();
+ init_intervalProvider();
+ init_arrRemove();
+ AsyncAction = (function(_super) {
+ __extends(AsyncAction2, _super);
+ function AsyncAction2(scheduler, work) {
+ var _this = _super.call(this, scheduler, work) || this;
+ _this.scheduler = scheduler;
+ _this.work = work;
+ _this.pending = false;
+ return _this;
+ }
+ AsyncAction2.prototype.schedule = function(state, delay2) {
+ var _a12;
+ if (delay2 === void 0) {
+ delay2 = 0;
+ }
+ if (this.closed) {
+ return this;
+ }
+ this.state = state;
+ var id = this.id;
+ var scheduler = this.scheduler;
+ if (id != null) {
+ this.id = this.recycleAsyncId(scheduler, id, delay2);
+ }
+ this.pending = true;
+ this.delay = delay2;
+ this.id = (_a12 = this.id) !== null && _a12 !== void 0 ? _a12 : this.requestAsyncId(scheduler, this.id, delay2);
+ return this;
+ };
+ AsyncAction2.prototype.requestAsyncId = function(scheduler, _id, delay2) {
+ if (delay2 === void 0) {
+ delay2 = 0;
+ }
+ return intervalProvider.setInterval(scheduler.flush.bind(scheduler, this), delay2);
+ };
+ AsyncAction2.prototype.recycleAsyncId = function(_scheduler, id, delay2) {
+ if (delay2 === void 0) {
+ delay2 = 0;
+ }
+ if (delay2 != null && this.delay === delay2 && this.pending === false) {
+ return id;
+ }
+ if (id != null) {
+ intervalProvider.clearInterval(id);
+ }
+ return void 0;
+ };
+ AsyncAction2.prototype.execute = function(state, delay2) {
+ if (this.closed) {
+ return new Error("executing a cancelled action");
+ }
+ this.pending = false;
+ var error = this._execute(state, delay2);
+ if (error) {
+ return error;
+ } else if (this.pending === false && this.id != null) {
+ this.id = this.recycleAsyncId(this.scheduler, this.id, null);
+ }
+ };
+ AsyncAction2.prototype._execute = function(state, _delay) {
+ var errored = false;
+ var errorValue;
+ try {
+ this.work(state);
+ } catch (e11) {
+ errored = true;
+ errorValue = e11 ? e11 : new Error("Scheduled action threw falsy error");
+ }
+ if (errored) {
+ this.unsubscribe();
+ return errorValue;
+ }
+ };
+ AsyncAction2.prototype.unsubscribe = function() {
+ if (!this.closed) {
+ var _a12 = this, id = _a12.id, scheduler = _a12.scheduler;
+ var actions = scheduler.actions;
+ this.work = this.state = this.scheduler = null;
+ this.pending = false;
+ arrRemove(actions, this);
+ if (id != null) {
+ this.id = this.recycleAsyncId(scheduler, id, null);
+ }
+ this.delay = null;
+ _super.prototype.unsubscribe.call(this);
+ }
+ };
+ return AsyncAction2;
+ })(Action);
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/Immediate.js
+function findAndClearHandle(handle3) {
+ if (handle3 in activeHandles) {
+ delete activeHandles[handle3];
+ return true;
+ }
+ return false;
+}
+var nextHandle, resolved, activeHandles, Immediate, TestTools;
+var init_Immediate = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/Immediate.js"() {
+ nextHandle = 1;
+ activeHandles = {};
+ Immediate = {
+ setImmediate: function(cb) {
+ var handle3 = nextHandle++;
+ activeHandles[handle3] = true;
+ if (!resolved) {
+ resolved = Promise.resolve();
+ }
+ resolved.then(function() {
+ return findAndClearHandle(handle3) && cb();
+ });
+ return handle3;
+ },
+ clearImmediate: function(handle3) {
+ findAndClearHandle(handle3);
+ }
+ };
+ TestTools = {
+ pending: function() {
+ return Object.keys(activeHandles).length;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/immediateProvider.js
+var setImmediate, clearImmediate, immediateProvider;
+var init_immediateProvider = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/immediateProvider.js"() {
+ init_tslib_es6();
+ init_Immediate();
+ setImmediate = Immediate.setImmediate, clearImmediate = Immediate.clearImmediate;
+ immediateProvider = {
+ setImmediate: function() {
+ var args = [];
+ for (var _i = 0; _i < arguments.length; _i++) {
+ args[_i] = arguments[_i];
+ }
+ var delegate = immediateProvider.delegate;
+ return ((delegate === null || delegate === void 0 ? void 0 : delegate.setImmediate) || setImmediate).apply(void 0, __spreadArray([], __read(args)));
+ },
+ clearImmediate: function(handle3) {
+ var delegate = immediateProvider.delegate;
+ return ((delegate === null || delegate === void 0 ? void 0 : delegate.clearImmediate) || clearImmediate)(handle3);
+ },
+ delegate: void 0
+ };
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/AsapAction.js
+var AsapAction;
+var init_AsapAction = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/AsapAction.js"() {
+ init_tslib_es6();
+ init_AsyncAction();
+ init_immediateProvider();
+ AsapAction = (function(_super) {
+ __extends(AsapAction2, _super);
+ function AsapAction2(scheduler, work) {
+ var _this = _super.call(this, scheduler, work) || this;
+ _this.scheduler = scheduler;
+ _this.work = work;
+ return _this;
+ }
+ AsapAction2.prototype.requestAsyncId = function(scheduler, id, delay2) {
+ if (delay2 === void 0) {
+ delay2 = 0;
+ }
+ if (delay2 !== null && delay2 > 0) {
+ return _super.prototype.requestAsyncId.call(this, scheduler, id, delay2);
+ }
+ scheduler.actions.push(this);
+ return scheduler._scheduled || (scheduler._scheduled = immediateProvider.setImmediate(scheduler.flush.bind(scheduler, void 0)));
+ };
+ AsapAction2.prototype.recycleAsyncId = function(scheduler, id, delay2) {
+ var _a12;
+ if (delay2 === void 0) {
+ delay2 = 0;
+ }
+ if (delay2 != null ? delay2 > 0 : this.delay > 0) {
+ return _super.prototype.recycleAsyncId.call(this, scheduler, id, delay2);
+ }
+ var actions = scheduler.actions;
+ if (id != null && ((_a12 = actions[actions.length - 1]) === null || _a12 === void 0 ? void 0 : _a12.id) !== id) {
+ immediateProvider.clearImmediate(id);
+ if (scheduler._scheduled === id) {
+ scheduler._scheduled = void 0;
+ }
+ }
+ return void 0;
+ };
+ return AsapAction2;
+ })(AsyncAction);
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/Scheduler.js
+var Scheduler;
+var init_Scheduler = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/Scheduler.js"() {
+ init_dateTimestampProvider();
+ Scheduler = (function() {
+ function Scheduler2(schedulerActionCtor, now2) {
+ if (now2 === void 0) {
+ now2 = Scheduler2.now;
+ }
+ this.schedulerActionCtor = schedulerActionCtor;
+ this.now = now2;
+ }
+ Scheduler2.prototype.schedule = function(work, delay2, state) {
+ if (delay2 === void 0) {
+ delay2 = 0;
+ }
+ return new this.schedulerActionCtor(this, work).schedule(state, delay2);
+ };
+ Scheduler2.now = dateTimestampProvider.now;
+ return Scheduler2;
+ })();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/AsyncScheduler.js
+var AsyncScheduler;
+var init_AsyncScheduler = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/AsyncScheduler.js"() {
+ init_tslib_es6();
+ init_Scheduler();
+ AsyncScheduler = (function(_super) {
+ __extends(AsyncScheduler2, _super);
+ function AsyncScheduler2(SchedulerAction, now2) {
+ if (now2 === void 0) {
+ now2 = Scheduler.now;
+ }
+ var _this = _super.call(this, SchedulerAction, now2) || this;
+ _this.actions = [];
+ _this._active = false;
+ return _this;
+ }
+ AsyncScheduler2.prototype.flush = function(action) {
+ var actions = this.actions;
+ if (this._active) {
+ actions.push(action);
+ return;
+ }
+ var error;
+ this._active = true;
+ do {
+ if (error = action.execute(action.state, action.delay)) {
+ break;
+ }
+ } while (action = actions.shift());
+ this._active = false;
+ if (error) {
+ while (action = actions.shift()) {
+ action.unsubscribe();
+ }
+ throw error;
+ }
+ };
+ return AsyncScheduler2;
+ })(Scheduler);
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/AsapScheduler.js
+var AsapScheduler;
+var init_AsapScheduler = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/AsapScheduler.js"() {
+ init_tslib_es6();
+ init_AsyncScheduler();
+ AsapScheduler = (function(_super) {
+ __extends(AsapScheduler2, _super);
+ function AsapScheduler2() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ AsapScheduler2.prototype.flush = function(action) {
+ this._active = true;
+ var flushId = this._scheduled;
+ this._scheduled = void 0;
+ var actions = this.actions;
+ var error;
+ action = action || actions.shift();
+ do {
+ if (error = action.execute(action.state, action.delay)) {
+ break;
+ }
+ } while ((action = actions[0]) && action.id === flushId && actions.shift());
+ this._active = false;
+ if (error) {
+ while ((action = actions[0]) && action.id === flushId && actions.shift()) {
+ action.unsubscribe();
+ }
+ throw error;
+ }
+ };
+ return AsapScheduler2;
+ })(AsyncScheduler);
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/asap.js
+var asapScheduler, asap;
+var init_asap = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/asap.js"() {
+ init_AsapAction();
+ init_AsapScheduler();
+ asapScheduler = new AsapScheduler(AsapAction);
+ asap = asapScheduler;
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/async.js
+var asyncScheduler, async;
+var init_async = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/async.js"() {
+ init_AsyncAction();
+ init_AsyncScheduler();
+ asyncScheduler = new AsyncScheduler(AsyncAction);
+ async = asyncScheduler;
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/QueueAction.js
+var QueueAction;
+var init_QueueAction = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/QueueAction.js"() {
+ init_tslib_es6();
+ init_AsyncAction();
+ QueueAction = (function(_super) {
+ __extends(QueueAction2, _super);
+ function QueueAction2(scheduler, work) {
+ var _this = _super.call(this, scheduler, work) || this;
+ _this.scheduler = scheduler;
+ _this.work = work;
+ return _this;
+ }
+ QueueAction2.prototype.schedule = function(state, delay2) {
+ if (delay2 === void 0) {
+ delay2 = 0;
+ }
+ if (delay2 > 0) {
+ return _super.prototype.schedule.call(this, state, delay2);
+ }
+ this.delay = delay2;
+ this.state = state;
+ this.scheduler.flush(this);
+ return this;
+ };
+ QueueAction2.prototype.execute = function(state, delay2) {
+ return delay2 > 0 || this.closed ? _super.prototype.execute.call(this, state, delay2) : this._execute(state, delay2);
+ };
+ QueueAction2.prototype.requestAsyncId = function(scheduler, id, delay2) {
+ if (delay2 === void 0) {
+ delay2 = 0;
+ }
+ if (delay2 != null && delay2 > 0 || delay2 == null && this.delay > 0) {
+ return _super.prototype.requestAsyncId.call(this, scheduler, id, delay2);
+ }
+ scheduler.flush(this);
+ return 0;
+ };
+ return QueueAction2;
+ })(AsyncAction);
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/QueueScheduler.js
+var QueueScheduler;
+var init_QueueScheduler = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/QueueScheduler.js"() {
+ init_tslib_es6();
+ init_AsyncScheduler();
+ QueueScheduler = (function(_super) {
+ __extends(QueueScheduler2, _super);
+ function QueueScheduler2() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ return QueueScheduler2;
+ })(AsyncScheduler);
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/queue.js
+var queueScheduler, queue;
+var init_queue = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/queue.js"() {
+ init_QueueAction();
+ init_QueueScheduler();
+ queueScheduler = new QueueScheduler(QueueAction);
+ queue = queueScheduler;
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/AnimationFrameAction.js
+var AnimationFrameAction;
+var init_AnimationFrameAction = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/AnimationFrameAction.js"() {
+ init_tslib_es6();
+ init_AsyncAction();
+ init_animationFrameProvider();
+ AnimationFrameAction = (function(_super) {
+ __extends(AnimationFrameAction2, _super);
+ function AnimationFrameAction2(scheduler, work) {
+ var _this = _super.call(this, scheduler, work) || this;
+ _this.scheduler = scheduler;
+ _this.work = work;
+ return _this;
+ }
+ AnimationFrameAction2.prototype.requestAsyncId = function(scheduler, id, delay2) {
+ if (delay2 === void 0) {
+ delay2 = 0;
+ }
+ if (delay2 !== null && delay2 > 0) {
+ return _super.prototype.requestAsyncId.call(this, scheduler, id, delay2);
+ }
+ scheduler.actions.push(this);
+ return scheduler._scheduled || (scheduler._scheduled = animationFrameProvider.requestAnimationFrame(function() {
+ return scheduler.flush(void 0);
+ }));
+ };
+ AnimationFrameAction2.prototype.recycleAsyncId = function(scheduler, id, delay2) {
+ var _a12;
+ if (delay2 === void 0) {
+ delay2 = 0;
+ }
+ if (delay2 != null ? delay2 > 0 : this.delay > 0) {
+ return _super.prototype.recycleAsyncId.call(this, scheduler, id, delay2);
+ }
+ var actions = scheduler.actions;
+ if (id != null && id === scheduler._scheduled && ((_a12 = actions[actions.length - 1]) === null || _a12 === void 0 ? void 0 : _a12.id) !== id) {
+ animationFrameProvider.cancelAnimationFrame(id);
+ scheduler._scheduled = void 0;
+ }
+ return void 0;
+ };
+ return AnimationFrameAction2;
+ })(AsyncAction);
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/AnimationFrameScheduler.js
+var AnimationFrameScheduler;
+var init_AnimationFrameScheduler = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/AnimationFrameScheduler.js"() {
+ init_tslib_es6();
+ init_AsyncScheduler();
+ AnimationFrameScheduler = (function(_super) {
+ __extends(AnimationFrameScheduler2, _super);
+ function AnimationFrameScheduler2() {
+ return _super !== null && _super.apply(this, arguments) || this;
+ }
+ AnimationFrameScheduler2.prototype.flush = function(action) {
+ this._active = true;
+ var flushId;
+ if (action) {
+ flushId = action.id;
+ } else {
+ flushId = this._scheduled;
+ this._scheduled = void 0;
+ }
+ var actions = this.actions;
+ var error;
+ action = action || actions.shift();
+ do {
+ if (error = action.execute(action.state, action.delay)) {
+ break;
+ }
+ } while ((action = actions[0]) && action.id === flushId && actions.shift());
+ this._active = false;
+ if (error) {
+ while ((action = actions[0]) && action.id === flushId && actions.shift()) {
+ action.unsubscribe();
+ }
+ throw error;
+ }
+ };
+ return AnimationFrameScheduler2;
+ })(AsyncScheduler);
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/animationFrame.js
+var animationFrameScheduler, animationFrame;
+var init_animationFrame = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/animationFrame.js"() {
+ init_AnimationFrameAction();
+ init_AnimationFrameScheduler();
+ animationFrameScheduler = new AnimationFrameScheduler(AnimationFrameAction);
+ animationFrame = animationFrameScheduler;
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/VirtualTimeScheduler.js
+var VirtualTimeScheduler, VirtualAction;
+var init_VirtualTimeScheduler = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduler/VirtualTimeScheduler.js"() {
+ init_tslib_es6();
+ init_AsyncAction();
+ init_Subscription();
+ init_AsyncScheduler();
+ VirtualTimeScheduler = (function(_super) {
+ __extends(VirtualTimeScheduler2, _super);
+ function VirtualTimeScheduler2(schedulerActionCtor, maxFrames) {
+ if (schedulerActionCtor === void 0) {
+ schedulerActionCtor = VirtualAction;
+ }
+ if (maxFrames === void 0) {
+ maxFrames = Infinity;
+ }
+ var _this = _super.call(this, schedulerActionCtor, function() {
+ return _this.frame;
+ }) || this;
+ _this.maxFrames = maxFrames;
+ _this.frame = 0;
+ _this.index = -1;
+ return _this;
+ }
+ VirtualTimeScheduler2.prototype.flush = function() {
+ var _a12 = this, actions = _a12.actions, maxFrames = _a12.maxFrames;
+ var error;
+ var action;
+ while ((action = actions[0]) && action.delay <= maxFrames) {
+ actions.shift();
+ this.frame = action.delay;
+ if (error = action.execute(action.state, action.delay)) {
+ break;
+ }
+ }
+ if (error) {
+ while (action = actions.shift()) {
+ action.unsubscribe();
+ }
+ throw error;
+ }
+ };
+ VirtualTimeScheduler2.frameTimeFactor = 10;
+ return VirtualTimeScheduler2;
+ })(AsyncScheduler);
+ VirtualAction = (function(_super) {
+ __extends(VirtualAction2, _super);
+ function VirtualAction2(scheduler, work, index2) {
+ if (index2 === void 0) {
+ index2 = scheduler.index += 1;
+ }
+ var _this = _super.call(this, scheduler, work) || this;
+ _this.scheduler = scheduler;
+ _this.work = work;
+ _this.index = index2;
+ _this.active = true;
+ _this.index = scheduler.index = index2;
+ return _this;
+ }
+ VirtualAction2.prototype.schedule = function(state, delay2) {
+ if (delay2 === void 0) {
+ delay2 = 0;
+ }
+ if (Number.isFinite(delay2)) {
+ if (!this.id) {
+ return _super.prototype.schedule.call(this, state, delay2);
+ }
+ this.active = false;
+ var action = new VirtualAction2(this.scheduler, this.work);
+ this.add(action);
+ return action.schedule(state, delay2);
+ } else {
+ return Subscription.EMPTY;
+ }
+ };
+ VirtualAction2.prototype.requestAsyncId = function(scheduler, id, delay2) {
+ if (delay2 === void 0) {
+ delay2 = 0;
+ }
+ this.delay = scheduler.frame + delay2;
+ var actions = scheduler.actions;
+ actions.push(this);
+ actions.sort(VirtualAction2.sortActions);
+ return 1;
+ };
+ VirtualAction2.prototype.recycleAsyncId = function(scheduler, id, delay2) {
+ if (delay2 === void 0) {
+ delay2 = 0;
+ }
+ return void 0;
+ };
+ VirtualAction2.prototype._execute = function(state, delay2) {
+ if (this.active === true) {
+ return _super.prototype._execute.call(this, state, delay2);
+ }
+ };
+ VirtualAction2.sortActions = function(a5, b5) {
+ if (a5.delay === b5.delay) {
+ if (a5.index === b5.index) {
+ return 0;
+ } else if (a5.index > b5.index) {
+ return 1;
+ } else {
+ return -1;
+ }
+ } else if (a5.delay > b5.delay) {
+ return 1;
+ } else {
+ return -1;
+ }
+ };
+ return VirtualAction2;
+ })(AsyncAction);
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/empty.js
+function empty(scheduler) {
+ return scheduler ? emptyScheduled(scheduler) : EMPTY;
+}
+function emptyScheduled(scheduler) {
+ return new Observable(function(subscriber) {
+ return scheduler.schedule(function() {
+ return subscriber.complete();
+ });
+ });
+}
+var EMPTY;
+var init_empty = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/empty.js"() {
+ init_Observable();
+ EMPTY = new Observable(function(subscriber) {
+ return subscriber.complete();
+ });
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isScheduler.js
+function isScheduler(value2) {
+ return value2 && isFunction(value2.schedule);
+}
+var init_isScheduler = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isScheduler.js"() {
+ init_isFunction();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/args.js
+function last(arr) {
+ return arr[arr.length - 1];
+}
+function popResultSelector(args) {
+ return isFunction(last(args)) ? args.pop() : void 0;
+}
+function popScheduler(args) {
+ return isScheduler(last(args)) ? args.pop() : void 0;
+}
+function popNumber(args, defaultValue) {
+ return typeof last(args) === "number" ? args.pop() : defaultValue;
+}
+var init_args = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/args.js"() {
+ init_isFunction();
+ init_isScheduler();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isArrayLike.js
+var isArrayLike;
+var init_isArrayLike = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isArrayLike.js"() {
+ isArrayLike = (function(x4) {
+ return x4 && typeof x4.length === "number" && typeof x4 !== "function";
+ });
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isPromise.js
+function isPromise(value2) {
+ return isFunction(value2 === null || value2 === void 0 ? void 0 : value2.then);
+}
+var init_isPromise = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isPromise.js"() {
+ init_isFunction();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isInteropObservable.js
+function isInteropObservable(input) {
+ return isFunction(input[observable]);
+}
+var init_isInteropObservable = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isInteropObservable.js"() {
+ init_observable();
+ init_isFunction();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isAsyncIterable.js
+function isAsyncIterable(obj) {
+ return Symbol.asyncIterator && isFunction(obj === null || obj === void 0 ? void 0 : obj[Symbol.asyncIterator]);
+}
+var init_isAsyncIterable = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isAsyncIterable.js"() {
+ init_isFunction();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/throwUnobservableError.js
+function createInvalidObservableTypeError(input) {
+ return new TypeError("You provided " + (input !== null && typeof input === "object" ? "an invalid object" : "'" + input + "'") + " where a stream was expected. You can provide an Observable, Promise, ReadableStream, Array, AsyncIterable, or Iterable.");
+}
+var init_throwUnobservableError = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/throwUnobservableError.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/symbol/iterator.js
+function getSymbolIterator() {
+ if (typeof Symbol !== "function" || !Symbol.iterator) {
+ return "@@iterator";
+ }
+ return Symbol.iterator;
+}
+var iterator;
+var init_iterator = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/symbol/iterator.js"() {
+ iterator = getSymbolIterator();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isIterable.js
+function isIterable(input) {
+ return isFunction(input === null || input === void 0 ? void 0 : input[iterator]);
+}
+var init_isIterable = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isIterable.js"() {
+ init_iterator();
+ init_isFunction();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isReadableStreamLike.js
+function readableStreamLikeToAsyncGenerator(readableStream) {
+ return __asyncGenerator(this, arguments, function readableStreamLikeToAsyncGenerator_1() {
+ var reader, _a12, value2, done;
+ return __generator(this, function(_b) {
+ switch (_b.label) {
+ case 0:
+ reader = readableStream.getReader();
+ _b.label = 1;
+ case 1:
+ _b.trys.push([1, , 9, 10]);
+ _b.label = 2;
+ case 2:
+ if (false) return [3, 8];
+ return [4, __await(reader.read())];
+ case 3:
+ _a12 = _b.sent(), value2 = _a12.value, done = _a12.done;
+ if (!done) return [3, 5];
+ return [4, __await(void 0)];
+ case 4:
+ return [2, _b.sent()];
+ case 5:
+ return [4, __await(value2)];
+ case 6:
+ return [4, _b.sent()];
+ case 7:
+ _b.sent();
+ return [3, 2];
+ case 8:
+ return [3, 10];
+ case 9:
+ reader.releaseLock();
+ return [7];
+ case 10:
+ return [2];
+ }
+ });
+ });
+}
+function isReadableStreamLike(obj) {
+ return isFunction(obj === null || obj === void 0 ? void 0 : obj.getReader);
+}
+var init_isReadableStreamLike = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isReadableStreamLike.js"() {
+ init_tslib_es6();
+ init_isFunction();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/innerFrom.js
+function innerFrom(input) {
+ if (input instanceof Observable) {
+ return input;
+ }
+ if (input != null) {
+ if (isInteropObservable(input)) {
+ return fromInteropObservable(input);
+ }
+ if (isArrayLike(input)) {
+ return fromArrayLike(input);
+ }
+ if (isPromise(input)) {
+ return fromPromise(input);
+ }
+ if (isAsyncIterable(input)) {
+ return fromAsyncIterable(input);
+ }
+ if (isIterable(input)) {
+ return fromIterable(input);
+ }
+ if (isReadableStreamLike(input)) {
+ return fromReadableStreamLike(input);
+ }
+ }
+ throw createInvalidObservableTypeError(input);
+}
+function fromInteropObservable(obj) {
+ return new Observable(function(subscriber) {
+ var obs = obj[observable]();
+ if (isFunction(obs.subscribe)) {
+ return obs.subscribe(subscriber);
+ }
+ throw new TypeError("Provided object does not correctly implement Symbol.observable");
+ });
+}
+function fromArrayLike(array) {
+ return new Observable(function(subscriber) {
+ for (var i11 = 0; i11 < array.length && !subscriber.closed; i11++) {
+ subscriber.next(array[i11]);
+ }
+ subscriber.complete();
+ });
+}
+function fromPromise(promise) {
+ return new Observable(function(subscriber) {
+ promise.then(function(value2) {
+ if (!subscriber.closed) {
+ subscriber.next(value2);
+ subscriber.complete();
+ }
+ }, function(err) {
+ return subscriber.error(err);
+ }).then(null, reportUnhandledError);
+ });
+}
+function fromIterable(iterable) {
+ return new Observable(function(subscriber) {
+ var e_1, _a12;
+ try {
+ for (var iterable_1 = __values(iterable), iterable_1_1 = iterable_1.next(); !iterable_1_1.done; iterable_1_1 = iterable_1.next()) {
+ var value2 = iterable_1_1.value;
+ subscriber.next(value2);
+ if (subscriber.closed) {
+ return;
+ }
+ }
+ } catch (e_1_1) {
+ e_1 = { error: e_1_1 };
+ } finally {
+ try {
+ if (iterable_1_1 && !iterable_1_1.done && (_a12 = iterable_1.return)) _a12.call(iterable_1);
+ } finally {
+ if (e_1) throw e_1.error;
+ }
+ }
+ subscriber.complete();
+ });
+}
+function fromAsyncIterable(asyncIterable) {
+ return new Observable(function(subscriber) {
+ process2(asyncIterable, subscriber).catch(function(err) {
+ return subscriber.error(err);
+ });
+ });
+}
+function fromReadableStreamLike(readableStream) {
+ return fromAsyncIterable(readableStreamLikeToAsyncGenerator(readableStream));
+}
+function process2(asyncIterable, subscriber) {
+ var asyncIterable_1, asyncIterable_1_1;
+ var e_2, _a12;
+ return __awaiter(this, void 0, void 0, function() {
+ var value2, e_2_1;
+ return __generator(this, function(_b) {
+ switch (_b.label) {
+ case 0:
+ _b.trys.push([0, 5, 6, 11]);
+ asyncIterable_1 = __asyncValues(asyncIterable);
+ _b.label = 1;
+ case 1:
+ return [4, asyncIterable_1.next()];
+ case 2:
+ if (!(asyncIterable_1_1 = _b.sent(), !asyncIterable_1_1.done)) return [3, 4];
+ value2 = asyncIterable_1_1.value;
+ subscriber.next(value2);
+ if (subscriber.closed) {
+ return [2];
+ }
+ _b.label = 3;
+ case 3:
+ return [3, 1];
+ case 4:
+ return [3, 11];
+ case 5:
+ e_2_1 = _b.sent();
+ e_2 = { error: e_2_1 };
+ return [3, 11];
+ case 6:
+ _b.trys.push([6, , 9, 10]);
+ if (!(asyncIterable_1_1 && !asyncIterable_1_1.done && (_a12 = asyncIterable_1.return))) return [3, 8];
+ return [4, _a12.call(asyncIterable_1)];
+ case 7:
+ _b.sent();
+ _b.label = 8;
+ case 8:
+ return [3, 10];
+ case 9:
+ if (e_2) throw e_2.error;
+ return [7];
+ case 10:
+ return [7];
+ case 11:
+ subscriber.complete();
+ return [2];
+ }
+ });
+ });
+}
+var init_innerFrom = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/innerFrom.js"() {
+ init_tslib_es6();
+ init_isArrayLike();
+ init_isPromise();
+ init_Observable();
+ init_isInteropObservable();
+ init_isAsyncIterable();
+ init_throwUnobservableError();
+ init_isIterable();
+ init_isReadableStreamLike();
+ init_isFunction();
+ init_reportUnhandledError();
+ init_observable();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/executeSchedule.js
+function executeSchedule(parentSubscription, scheduler, work, delay2, repeat3) {
+ if (delay2 === void 0) {
+ delay2 = 0;
+ }
+ if (repeat3 === void 0) {
+ repeat3 = false;
+ }
+ var scheduleSubscription = scheduler.schedule(function() {
+ work();
+ if (repeat3) {
+ parentSubscription.add(this.schedule(null, delay2));
+ } else {
+ this.unsubscribe();
+ }
+ }, delay2);
+ parentSubscription.add(scheduleSubscription);
+ if (!repeat3) {
+ return scheduleSubscription;
+ }
+}
+var init_executeSchedule = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/executeSchedule.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/observeOn.js
+function observeOn(scheduler, delay2) {
+ if (delay2 === void 0) {
+ delay2 = 0;
+ }
+ return operate(function(source, subscriber) {
+ source.subscribe(createOperatorSubscriber(subscriber, function(value2) {
+ return executeSchedule(subscriber, scheduler, function() {
+ return subscriber.next(value2);
+ }, delay2);
+ }, function() {
+ return executeSchedule(subscriber, scheduler, function() {
+ return subscriber.complete();
+ }, delay2);
+ }, function(err) {
+ return executeSchedule(subscriber, scheduler, function() {
+ return subscriber.error(err);
+ }, delay2);
+ }));
+ });
+}
+var init_observeOn = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/observeOn.js"() {
+ init_executeSchedule();
+ init_lift();
+ init_OperatorSubscriber();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/subscribeOn.js
+function subscribeOn(scheduler, delay2) {
+ if (delay2 === void 0) {
+ delay2 = 0;
+ }
+ return operate(function(source, subscriber) {
+ subscriber.add(scheduler.schedule(function() {
+ return source.subscribe(subscriber);
+ }, delay2));
+ });
+}
+var init_subscribeOn = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/subscribeOn.js"() {
+ init_lift();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduled/scheduleObservable.js
+function scheduleObservable(input, scheduler) {
+ return innerFrom(input).pipe(subscribeOn(scheduler), observeOn(scheduler));
+}
+var init_scheduleObservable = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduled/scheduleObservable.js"() {
+ init_innerFrom();
+ init_observeOn();
+ init_subscribeOn();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduled/schedulePromise.js
+function schedulePromise(input, scheduler) {
+ return innerFrom(input).pipe(subscribeOn(scheduler), observeOn(scheduler));
+}
+var init_schedulePromise = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduled/schedulePromise.js"() {
+ init_innerFrom();
+ init_observeOn();
+ init_subscribeOn();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduled/scheduleArray.js
+function scheduleArray(input, scheduler) {
+ return new Observable(function(subscriber) {
+ var i11 = 0;
+ return scheduler.schedule(function() {
+ if (i11 === input.length) {
+ subscriber.complete();
+ } else {
+ subscriber.next(input[i11++]);
+ if (!subscriber.closed) {
+ this.schedule();
+ }
+ }
+ });
+ });
+}
+var init_scheduleArray = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduled/scheduleArray.js"() {
+ init_Observable();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduled/scheduleIterable.js
+function scheduleIterable(input, scheduler) {
+ return new Observable(function(subscriber) {
+ var iterator2;
+ executeSchedule(subscriber, scheduler, function() {
+ iterator2 = input[iterator]();
+ executeSchedule(subscriber, scheduler, function() {
+ var _a12;
+ var value2;
+ var done;
+ try {
+ _a12 = iterator2.next(), value2 = _a12.value, done = _a12.done;
+ } catch (err) {
+ subscriber.error(err);
+ return;
+ }
+ if (done) {
+ subscriber.complete();
+ } else {
+ subscriber.next(value2);
+ }
+ }, 0, true);
+ });
+ return function() {
+ return isFunction(iterator2 === null || iterator2 === void 0 ? void 0 : iterator2.return) && iterator2.return();
+ };
+ });
+}
+var init_scheduleIterable = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduled/scheduleIterable.js"() {
+ init_Observable();
+ init_iterator();
+ init_isFunction();
+ init_executeSchedule();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduled/scheduleAsyncIterable.js
+function scheduleAsyncIterable(input, scheduler) {
+ if (!input) {
+ throw new Error("Iterable cannot be null");
+ }
+ return new Observable(function(subscriber) {
+ executeSchedule(subscriber, scheduler, function() {
+ var iterator2 = input[Symbol.asyncIterator]();
+ executeSchedule(subscriber, scheduler, function() {
+ iterator2.next().then(function(result) {
+ if (result.done) {
+ subscriber.complete();
+ } else {
+ subscriber.next(result.value);
+ }
+ });
+ }, 0, true);
+ });
+ });
+}
+var init_scheduleAsyncIterable = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduled/scheduleAsyncIterable.js"() {
+ init_Observable();
+ init_executeSchedule();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduled/scheduleReadableStreamLike.js
+function scheduleReadableStreamLike(input, scheduler) {
+ return scheduleAsyncIterable(readableStreamLikeToAsyncGenerator(input), scheduler);
+}
+var init_scheduleReadableStreamLike = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduled/scheduleReadableStreamLike.js"() {
+ init_scheduleAsyncIterable();
+ init_isReadableStreamLike();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduled/scheduled.js
+function scheduled(input, scheduler) {
+ if (input != null) {
+ if (isInteropObservable(input)) {
+ return scheduleObservable(input, scheduler);
+ }
+ if (isArrayLike(input)) {
+ return scheduleArray(input, scheduler);
+ }
+ if (isPromise(input)) {
+ return schedulePromise(input, scheduler);
+ }
+ if (isAsyncIterable(input)) {
+ return scheduleAsyncIterable(input, scheduler);
+ }
+ if (isIterable(input)) {
+ return scheduleIterable(input, scheduler);
+ }
+ if (isReadableStreamLike(input)) {
+ return scheduleReadableStreamLike(input, scheduler);
+ }
+ }
+ throw createInvalidObservableTypeError(input);
+}
+var init_scheduled = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/scheduled/scheduled.js"() {
+ init_scheduleObservable();
+ init_schedulePromise();
+ init_scheduleArray();
+ init_scheduleIterable();
+ init_scheduleAsyncIterable();
+ init_isInteropObservable();
+ init_isPromise();
+ init_isArrayLike();
+ init_isIterable();
+ init_isAsyncIterable();
+ init_throwUnobservableError();
+ init_isReadableStreamLike();
+ init_scheduleReadableStreamLike();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/from.js
+function from(input, scheduler) {
+ return scheduler ? scheduled(input, scheduler) : innerFrom(input);
+}
+var init_from = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/from.js"() {
+ init_scheduled();
+ init_innerFrom();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/of.js
+function of() {
+ var args = [];
+ for (var _i = 0; _i < arguments.length; _i++) {
+ args[_i] = arguments[_i];
+ }
+ var scheduler = popScheduler(args);
+ return from(args, scheduler);
+}
+var init_of = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/of.js"() {
+ init_args();
+ init_from();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/throwError.js
+function throwError(errorOrErrorFactory, scheduler) {
+ var errorFactory = isFunction(errorOrErrorFactory) ? errorOrErrorFactory : function() {
+ return errorOrErrorFactory;
+ };
+ var init = function(subscriber) {
+ return subscriber.error(errorFactory());
+ };
+ return new Observable(scheduler ? function(subscriber) {
+ return scheduler.schedule(init, 0, subscriber);
+ } : init);
+}
+var init_throwError = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/throwError.js"() {
+ init_Observable();
+ init_isFunction();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/Notification.js
+function observeNotification(notification, observer) {
+ var _a12, _b, _c;
+ var _d = notification, kind = _d.kind, value2 = _d.value, error = _d.error;
+ if (typeof kind !== "string") {
+ throw new TypeError('Invalid notification, missing "kind"');
+ }
+ kind === "N" ? (_a12 = observer.next) === null || _a12 === void 0 ? void 0 : _a12.call(observer, value2) : kind === "E" ? (_b = observer.error) === null || _b === void 0 ? void 0 : _b.call(observer, error) : (_c = observer.complete) === null || _c === void 0 ? void 0 : _c.call(observer);
+}
+var NotificationKind, Notification;
+var init_Notification = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/Notification.js"() {
+ init_empty();
+ init_of();
+ init_throwError();
+ init_isFunction();
+ (function(NotificationKind2) {
+ NotificationKind2["NEXT"] = "N";
+ NotificationKind2["ERROR"] = "E";
+ NotificationKind2["COMPLETE"] = "C";
+ })(NotificationKind || (NotificationKind = {}));
+ Notification = (function() {
+ function Notification2(kind, value2, error) {
+ this.kind = kind;
+ this.value = value2;
+ this.error = error;
+ this.hasValue = kind === "N";
+ }
+ Notification2.prototype.observe = function(observer) {
+ return observeNotification(this, observer);
+ };
+ Notification2.prototype.do = function(nextHandler, errorHandler, completeHandler) {
+ var _a12 = this, kind = _a12.kind, value2 = _a12.value, error = _a12.error;
+ return kind === "N" ? nextHandler === null || nextHandler === void 0 ? void 0 : nextHandler(value2) : kind === "E" ? errorHandler === null || errorHandler === void 0 ? void 0 : errorHandler(error) : completeHandler === null || completeHandler === void 0 ? void 0 : completeHandler();
+ };
+ Notification2.prototype.accept = function(nextOrObserver, error, complete) {
+ var _a12;
+ return isFunction((_a12 = nextOrObserver) === null || _a12 === void 0 ? void 0 : _a12.next) ? this.observe(nextOrObserver) : this.do(nextOrObserver, error, complete);
+ };
+ Notification2.prototype.toObservable = function() {
+ var _a12 = this, kind = _a12.kind, value2 = _a12.value, error = _a12.error;
+ var result = kind === "N" ? of(value2) : kind === "E" ? throwError(function() {
+ return error;
+ }) : kind === "C" ? EMPTY : 0;
+ if (!result) {
+ throw new TypeError("Unexpected notification kind " + kind);
+ }
+ return result;
+ };
+ Notification2.createNext = function(value2) {
+ return new Notification2("N", value2);
+ };
+ Notification2.createError = function(err) {
+ return new Notification2("E", void 0, err);
+ };
+ Notification2.createComplete = function() {
+ return Notification2.completeNotification;
+ };
+ Notification2.completeNotification = new Notification2("C");
+ return Notification2;
+ })();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isObservable.js
+var init_isObservable = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isObservable.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/EmptyError.js
+var EmptyError;
+var init_EmptyError = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/EmptyError.js"() {
+ init_createErrorClass();
+ EmptyError = createErrorClass(function(_super) {
+ return function EmptyErrorImpl() {
+ _super(this);
+ this.name = "EmptyError";
+ this.message = "no elements in sequence";
+ };
+ });
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/lastValueFrom.js
+var init_lastValueFrom = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/lastValueFrom.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/firstValueFrom.js
+var init_firstValueFrom = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/firstValueFrom.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/ArgumentOutOfRangeError.js
+var ArgumentOutOfRangeError;
+var init_ArgumentOutOfRangeError = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/ArgumentOutOfRangeError.js"() {
+ init_createErrorClass();
+ ArgumentOutOfRangeError = createErrorClass(function(_super) {
+ return function ArgumentOutOfRangeErrorImpl() {
+ _super(this);
+ this.name = "ArgumentOutOfRangeError";
+ this.message = "argument out of range";
+ };
+ });
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/NotFoundError.js
+var NotFoundError;
+var init_NotFoundError = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/NotFoundError.js"() {
+ init_createErrorClass();
+ NotFoundError = createErrorClass(function(_super) {
+ return function NotFoundErrorImpl(message2) {
+ _super(this);
+ this.name = "NotFoundError";
+ this.message = message2;
+ };
+ });
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/SequenceError.js
+var SequenceError;
+var init_SequenceError = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/SequenceError.js"() {
+ init_createErrorClass();
+ SequenceError = createErrorClass(function(_super) {
+ return function SequenceErrorImpl(message2) {
+ _super(this);
+ this.name = "SequenceError";
+ this.message = message2;
+ };
+ });
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isDate.js
+function isValidDate(value2) {
+ return value2 instanceof Date && !isNaN(value2);
+}
+var init_isDate = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/isDate.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/timeout.js
+function timeout(config3, schedulerArg) {
+ var _a12 = isValidDate(config3) ? { first: config3 } : typeof config3 === "number" ? { each: config3 } : config3, first2 = _a12.first, each = _a12.each, _b = _a12.with, _with = _b === void 0 ? timeoutErrorFactory : _b, _c = _a12.scheduler, scheduler = _c === void 0 ? schedulerArg !== null && schedulerArg !== void 0 ? schedulerArg : asyncScheduler : _c, _d = _a12.meta, meta = _d === void 0 ? null : _d;
+ if (first2 == null && each == null) {
+ throw new TypeError("No timeout provided.");
+ }
+ return operate(function(source, subscriber) {
+ var originalSourceSubscription;
+ var timerSubscription;
+ var lastValue = null;
+ var seen = 0;
+ var startTimer = function(delay2) {
+ timerSubscription = executeSchedule(subscriber, scheduler, function() {
+ try {
+ originalSourceSubscription.unsubscribe();
+ innerFrom(_with({
+ meta,
+ lastValue,
+ seen
+ })).subscribe(subscriber);
+ } catch (err) {
+ subscriber.error(err);
+ }
+ }, delay2);
+ };
+ originalSourceSubscription = source.subscribe(createOperatorSubscriber(subscriber, function(value2) {
+ timerSubscription === null || timerSubscription === void 0 ? void 0 : timerSubscription.unsubscribe();
+ seen++;
+ subscriber.next(lastValue = value2);
+ each > 0 && startTimer(each);
+ }, void 0, void 0, function() {
+ if (!(timerSubscription === null || timerSubscription === void 0 ? void 0 : timerSubscription.closed)) {
+ timerSubscription === null || timerSubscription === void 0 ? void 0 : timerSubscription.unsubscribe();
+ }
+ lastValue = null;
+ }));
+ !seen && startTimer(first2 != null ? typeof first2 === "number" ? first2 : +first2 - scheduler.now() : each);
+ });
+}
+function timeoutErrorFactory(info) {
+ throw new TimeoutError(info);
+}
+var TimeoutError;
+var init_timeout = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/timeout.js"() {
+ init_async();
+ init_isDate();
+ init_lift();
+ init_innerFrom();
+ init_createErrorClass();
+ init_OperatorSubscriber();
+ init_executeSchedule();
+ TimeoutError = createErrorClass(function(_super) {
+ return function TimeoutErrorImpl(info) {
+ if (info === void 0) {
+ info = null;
+ }
+ _super(this);
+ this.message = "Timeout has occurred";
+ this.name = "TimeoutError";
+ this.info = info;
+ };
+ });
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/map.js
+function map2(project, thisArg) {
+ return operate(function(source, subscriber) {
+ var index2 = 0;
+ source.subscribe(createOperatorSubscriber(subscriber, function(value2) {
+ subscriber.next(project.call(thisArg, value2, index2++));
+ }));
+ });
+}
+var init_map = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/map.js"() {
+ init_lift();
+ init_OperatorSubscriber();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/mapOneOrManyArgs.js
+function callOrApply(fn, args) {
+ return isArray(args) ? fn.apply(void 0, __spreadArray([], __read(args))) : fn(args);
+}
+function mapOneOrManyArgs(fn) {
+ return map2(function(args) {
+ return callOrApply(fn, args);
+ });
+}
+var isArray;
+var init_mapOneOrManyArgs = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/util/mapOneOrManyArgs.js"() {
+ init_tslib_es6();
+ init_map();
+ isArray = Array.isArray;
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/bindCallback.js
+var init_bindCallback = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/bindCallback.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/bindNodeCallback.js
+var init_bindNodeCallback = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/bindNodeCallback.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/combineLatest.js
+var init_combineLatest = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/combineLatest.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/mergeInternals.js
+function mergeInternals(source, subscriber, project, concurrent, onBeforeNext, expand2, innerSubScheduler, additionalFinalizer) {
+ var buffer2 = [];
+ var active = 0;
+ var index2 = 0;
+ var isComplete = false;
+ var checkComplete = function() {
+ if (isComplete && !buffer2.length && !active) {
+ subscriber.complete();
+ }
+ };
+ var outerNext = function(value2) {
+ return active < concurrent ? doInnerSub(value2) : buffer2.push(value2);
+ };
+ var doInnerSub = function(value2) {
+ expand2 && subscriber.next(value2);
+ active++;
+ var innerComplete = false;
+ innerFrom(project(value2, index2++)).subscribe(createOperatorSubscriber(subscriber, function(innerValue) {
+ onBeforeNext === null || onBeforeNext === void 0 ? void 0 : onBeforeNext(innerValue);
+ if (expand2) {
+ outerNext(innerValue);
+ } else {
+ subscriber.next(innerValue);
+ }
+ }, function() {
+ innerComplete = true;
+ }, void 0, function() {
+ if (innerComplete) {
+ try {
+ active--;
+ var _loop_1 = function() {
+ var bufferedValue = buffer2.shift();
+ if (innerSubScheduler) {
+ executeSchedule(subscriber, innerSubScheduler, function() {
+ return doInnerSub(bufferedValue);
+ });
+ } else {
+ doInnerSub(bufferedValue);
+ }
+ };
+ while (buffer2.length && active < concurrent) {
+ _loop_1();
+ }
+ checkComplete();
+ } catch (err) {
+ subscriber.error(err);
+ }
+ }
+ }));
+ };
+ source.subscribe(createOperatorSubscriber(subscriber, outerNext, function() {
+ isComplete = true;
+ checkComplete();
+ }));
+ return function() {
+ additionalFinalizer === null || additionalFinalizer === void 0 ? void 0 : additionalFinalizer();
+ };
+}
+var init_mergeInternals = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/mergeInternals.js"() {
+ init_innerFrom();
+ init_executeSchedule();
+ init_OperatorSubscriber();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/mergeMap.js
+function mergeMap(project, resultSelector, concurrent) {
+ if (concurrent === void 0) {
+ concurrent = Infinity;
+ }
+ if (isFunction(resultSelector)) {
+ return mergeMap(function(a5, i11) {
+ return map2(function(b5, ii) {
+ return resultSelector(a5, b5, i11, ii);
+ })(innerFrom(project(a5, i11)));
+ }, concurrent);
+ } else if (typeof resultSelector === "number") {
+ concurrent = resultSelector;
+ }
+ return operate(function(source, subscriber) {
+ return mergeInternals(source, subscriber, project, concurrent);
+ });
+}
+var init_mergeMap = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/mergeMap.js"() {
+ init_map();
+ init_innerFrom();
+ init_lift();
+ init_mergeInternals();
+ init_isFunction();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/mergeAll.js
+function mergeAll(concurrent) {
+ if (concurrent === void 0) {
+ concurrent = Infinity;
+ }
+ return mergeMap(identity, concurrent);
+}
+var init_mergeAll = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/mergeAll.js"() {
+ init_mergeMap();
+ init_identity();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/concatAll.js
+function concatAll() {
+ return mergeAll(1);
+}
+var init_concatAll = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/concatAll.js"() {
+ init_mergeAll();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/concat.js
+function concat() {
+ var args = [];
+ for (var _i = 0; _i < arguments.length; _i++) {
+ args[_i] = arguments[_i];
+ }
+ return concatAll()(from(args, popScheduler(args)));
+}
+var init_concat = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/concat.js"() {
+ init_concatAll();
+ init_args();
+ init_from();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/defer.js
+var init_defer = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/defer.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/connectable.js
+var init_connectable = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/connectable.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/forkJoin.js
+var init_forkJoin = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/forkJoin.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/fromEvent.js
+function fromEvent(target, eventName, options, resultSelector) {
+ if (isFunction(options)) {
+ resultSelector = options;
+ options = void 0;
+ }
+ if (resultSelector) {
+ return fromEvent(target, eventName, options).pipe(mapOneOrManyArgs(resultSelector));
+ }
+ var _a12 = __read(isEventTarget(target) ? eventTargetMethods.map(function(methodName) {
+ return function(handler2) {
+ return target[methodName](eventName, handler2, options);
+ };
+ }) : isNodeStyleEventEmitter(target) ? nodeEventEmitterMethods.map(toCommonHandlerRegistry(target, eventName)) : isJQueryStyleEventEmitter(target) ? jqueryMethods.map(toCommonHandlerRegistry(target, eventName)) : [], 2), add3 = _a12[0], remove2 = _a12[1];
+ if (!add3) {
+ if (isArrayLike(target)) {
+ return mergeMap(function(subTarget) {
+ return fromEvent(subTarget, eventName, options);
+ })(innerFrom(target));
+ }
+ }
+ if (!add3) {
+ throw new TypeError("Invalid event target");
+ }
+ return new Observable(function(subscriber) {
+ var handler2 = function() {
+ var args = [];
+ for (var _i = 0; _i < arguments.length; _i++) {
+ args[_i] = arguments[_i];
+ }
+ return subscriber.next(1 < args.length ? args : args[0]);
+ };
+ add3(handler2);
+ return function() {
+ return remove2(handler2);
+ };
+ });
+}
+function toCommonHandlerRegistry(target, eventName) {
+ return function(methodName) {
+ return function(handler2) {
+ return target[methodName](eventName, handler2);
+ };
+ };
+}
+function isNodeStyleEventEmitter(target) {
+ return isFunction(target.addListener) && isFunction(target.removeListener);
+}
+function isJQueryStyleEventEmitter(target) {
+ return isFunction(target.on) && isFunction(target.off);
+}
+function isEventTarget(target) {
+ return isFunction(target.addEventListener) && isFunction(target.removeEventListener);
+}
+var nodeEventEmitterMethods, eventTargetMethods, jqueryMethods;
+var init_fromEvent = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/fromEvent.js"() {
+ init_tslib_es6();
+ init_innerFrom();
+ init_Observable();
+ init_mergeMap();
+ init_isArrayLike();
+ init_isFunction();
+ init_mapOneOrManyArgs();
+ nodeEventEmitterMethods = ["addListener", "removeListener"];
+ eventTargetMethods = ["addEventListener", "removeEventListener"];
+ jqueryMethods = ["on", "off"];
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/fromEventPattern.js
+var init_fromEventPattern = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/fromEventPattern.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/generate.js
+var init_generate = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/generate.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/iif.js
+var init_iif = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/iif.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/timer.js
+function timer(dueTime, intervalOrScheduler, scheduler) {
+ if (dueTime === void 0) {
+ dueTime = 0;
+ }
+ if (scheduler === void 0) {
+ scheduler = async;
+ }
+ var intervalDuration = -1;
+ if (intervalOrScheduler != null) {
+ if (isScheduler(intervalOrScheduler)) {
+ scheduler = intervalOrScheduler;
+ } else {
+ intervalDuration = intervalOrScheduler;
+ }
+ }
+ return new Observable(function(subscriber) {
+ var due = isValidDate(dueTime) ? +dueTime - scheduler.now() : dueTime;
+ if (due < 0) {
+ due = 0;
+ }
+ var n12 = 0;
+ return scheduler.schedule(function() {
+ if (!subscriber.closed) {
+ subscriber.next(n12++);
+ if (0 <= intervalDuration) {
+ this.schedule(void 0, intervalDuration);
+ } else {
+ subscriber.complete();
+ }
+ }
+ }, due);
+ });
+}
+var init_timer = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/timer.js"() {
+ init_Observable();
+ init_async();
+ init_isScheduler();
+ init_isDate();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/interval.js
+var init_interval = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/interval.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/merge.js
+var init_merge = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/merge.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/never.js
+function never() {
+ return NEVER;
+}
+var NEVER;
+var init_never = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/never.js"() {
+ init_Observable();
+ init_noop();
+ NEVER = new Observable(noop);
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/onErrorResumeNext.js
+var init_onErrorResumeNext = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/onErrorResumeNext.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/pairs.js
+var init_pairs = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/pairs.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/filter.js
+function filter(predicate, thisArg) {
+ return operate(function(source, subscriber) {
+ var index2 = 0;
+ source.subscribe(createOperatorSubscriber(subscriber, function(value2) {
+ return predicate.call(thisArg, value2, index2++) && subscriber.next(value2);
+ }));
+ });
+}
+var init_filter = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/filter.js"() {
+ init_lift();
+ init_OperatorSubscriber();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/partition.js
+var init_partition = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/partition.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/race.js
+var init_race = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/race.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/range.js
+var init_range = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/range.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/using.js
+var init_using = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/using.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/zip.js
+var init_zip = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/observable/zip.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/types.js
+var init_types = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/types.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/audit.js
+var init_audit = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/audit.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/auditTime.js
+var init_auditTime = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/auditTime.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/buffer.js
+function buffer(closingNotifier) {
+ return operate(function(source, subscriber) {
+ var currentBuffer = [];
+ source.subscribe(createOperatorSubscriber(subscriber, function(value2) {
+ return currentBuffer.push(value2);
+ }, function() {
+ subscriber.next(currentBuffer);
+ subscriber.complete();
+ }));
+ innerFrom(closingNotifier).subscribe(createOperatorSubscriber(subscriber, function() {
+ var b5 = currentBuffer;
+ currentBuffer = [];
+ subscriber.next(b5);
+ }, noop));
+ return function() {
+ currentBuffer = null;
+ };
+ });
+}
+var init_buffer = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/buffer.js"() {
+ init_lift();
+ init_noop();
+ init_OperatorSubscriber();
+ init_innerFrom();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/bufferCount.js
+function bufferCount(bufferSize, startBufferEvery) {
+ if (startBufferEvery === void 0) {
+ startBufferEvery = null;
+ }
+ startBufferEvery = startBufferEvery !== null && startBufferEvery !== void 0 ? startBufferEvery : bufferSize;
+ return operate(function(source, subscriber) {
+ var buffers = [];
+ var count2 = 0;
+ source.subscribe(createOperatorSubscriber(subscriber, function(value2) {
+ var e_1, _a12, e_2, _b;
+ var toEmit = null;
+ if (count2++ % startBufferEvery === 0) {
+ buffers.push([]);
+ }
+ try {
+ for (var buffers_1 = __values(buffers), buffers_1_1 = buffers_1.next(); !buffers_1_1.done; buffers_1_1 = buffers_1.next()) {
+ var buffer2 = buffers_1_1.value;
+ buffer2.push(value2);
+ if (bufferSize <= buffer2.length) {
+ toEmit = toEmit !== null && toEmit !== void 0 ? toEmit : [];
+ toEmit.push(buffer2);
+ }
+ }
+ } catch (e_1_1) {
+ e_1 = { error: e_1_1 };
+ } finally {
+ try {
+ if (buffers_1_1 && !buffers_1_1.done && (_a12 = buffers_1.return)) _a12.call(buffers_1);
+ } finally {
+ if (e_1) throw e_1.error;
+ }
+ }
+ if (toEmit) {
+ try {
+ for (var toEmit_1 = __values(toEmit), toEmit_1_1 = toEmit_1.next(); !toEmit_1_1.done; toEmit_1_1 = toEmit_1.next()) {
+ var buffer2 = toEmit_1_1.value;
+ arrRemove(buffers, buffer2);
+ subscriber.next(buffer2);
+ }
+ } catch (e_2_1) {
+ e_2 = { error: e_2_1 };
+ } finally {
+ try {
+ if (toEmit_1_1 && !toEmit_1_1.done && (_b = toEmit_1.return)) _b.call(toEmit_1);
+ } finally {
+ if (e_2) throw e_2.error;
+ }
+ }
+ }
+ }, function() {
+ var e_3, _a12;
+ try {
+ for (var buffers_2 = __values(buffers), buffers_2_1 = buffers_2.next(); !buffers_2_1.done; buffers_2_1 = buffers_2.next()) {
+ var buffer2 = buffers_2_1.value;
+ subscriber.next(buffer2);
+ }
+ } catch (e_3_1) {
+ e_3 = { error: e_3_1 };
+ } finally {
+ try {
+ if (buffers_2_1 && !buffers_2_1.done && (_a12 = buffers_2.return)) _a12.call(buffers_2);
+ } finally {
+ if (e_3) throw e_3.error;
+ }
+ }
+ subscriber.complete();
+ }, void 0, function() {
+ buffers = null;
+ }));
+ });
+}
+var init_bufferCount = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/bufferCount.js"() {
+ init_tslib_es6();
+ init_lift();
+ init_OperatorSubscriber();
+ init_arrRemove();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/bufferTime.js
+function bufferTime(bufferTimeSpan) {
+ var _a12, _b;
+ var otherArgs = [];
+ for (var _i = 1; _i < arguments.length; _i++) {
+ otherArgs[_i - 1] = arguments[_i];
+ }
+ var scheduler = (_a12 = popScheduler(otherArgs)) !== null && _a12 !== void 0 ? _a12 : asyncScheduler;
+ var bufferCreationInterval = (_b = otherArgs[0]) !== null && _b !== void 0 ? _b : null;
+ var maxBufferSize = otherArgs[1] || Infinity;
+ return operate(function(source, subscriber) {
+ var bufferRecords = [];
+ var restartOnEmit = false;
+ var emit = function(record) {
+ var buffer2 = record.buffer, subs = record.subs;
+ subs.unsubscribe();
+ arrRemove(bufferRecords, record);
+ subscriber.next(buffer2);
+ restartOnEmit && startBuffer();
+ };
+ var startBuffer = function() {
+ if (bufferRecords) {
+ var subs = new Subscription();
+ subscriber.add(subs);
+ var buffer2 = [];
+ var record_1 = {
+ buffer: buffer2,
+ subs
+ };
+ bufferRecords.push(record_1);
+ executeSchedule(subs, scheduler, function() {
+ return emit(record_1);
+ }, bufferTimeSpan);
+ }
+ };
+ if (bufferCreationInterval !== null && bufferCreationInterval >= 0) {
+ executeSchedule(subscriber, scheduler, startBuffer, bufferCreationInterval, true);
+ } else {
+ restartOnEmit = true;
+ }
+ startBuffer();
+ var bufferTimeSubscriber = createOperatorSubscriber(subscriber, function(value2) {
+ var e_1, _a13;
+ var recordsCopy = bufferRecords.slice();
+ try {
+ for (var recordsCopy_1 = __values(recordsCopy), recordsCopy_1_1 = recordsCopy_1.next(); !recordsCopy_1_1.done; recordsCopy_1_1 = recordsCopy_1.next()) {
+ var record = recordsCopy_1_1.value;
+ var buffer2 = record.buffer;
+ buffer2.push(value2);
+ maxBufferSize <= buffer2.length && emit(record);
+ }
+ } catch (e_1_1) {
+ e_1 = { error: e_1_1 };
+ } finally {
+ try {
+ if (recordsCopy_1_1 && !recordsCopy_1_1.done && (_a13 = recordsCopy_1.return)) _a13.call(recordsCopy_1);
+ } finally {
+ if (e_1) throw e_1.error;
+ }
+ }
+ }, function() {
+ while (bufferRecords === null || bufferRecords === void 0 ? void 0 : bufferRecords.length) {
+ subscriber.next(bufferRecords.shift().buffer);
+ }
+ bufferTimeSubscriber === null || bufferTimeSubscriber === void 0 ? void 0 : bufferTimeSubscriber.unsubscribe();
+ subscriber.complete();
+ subscriber.unsubscribe();
+ }, void 0, function() {
+ return bufferRecords = null;
+ });
+ source.subscribe(bufferTimeSubscriber);
+ });
+}
+var init_bufferTime = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/bufferTime.js"() {
+ init_tslib_es6();
+ init_Subscription();
+ init_lift();
+ init_OperatorSubscriber();
+ init_arrRemove();
+ init_async();
+ init_args();
+ init_executeSchedule();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/bufferToggle.js
+var init_bufferToggle = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/bufferToggle.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/bufferWhen.js
+var init_bufferWhen = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/bufferWhen.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/catchError.js
+var init_catchError = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/catchError.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/reduce.js
+var init_reduce = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/reduce.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/toArray.js
+var init_toArray = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/toArray.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/combineLatestAll.js
+var init_combineLatestAll = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/combineLatestAll.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/combineAll.js
+var init_combineAll = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/combineAll.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/combineLatest.js
+var init_combineLatest2 = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/combineLatest.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/combineLatestWith.js
+var init_combineLatestWith = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/combineLatestWith.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/concatMap.js
+var init_concatMap = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/concatMap.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/concatMapTo.js
+var init_concatMapTo = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/concatMapTo.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/concat.js
+var init_concat2 = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/concat.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/concatWith.js
+var init_concatWith = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/concatWith.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/connect.js
+var init_connect = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/connect.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/count.js
+var init_count = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/count.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/debounce.js
+function debounce(durationSelector) {
+ return operate(function(source, subscriber) {
+ var hasValue = false;
+ var lastValue = null;
+ var durationSubscriber = null;
+ var emit = function() {
+ durationSubscriber === null || durationSubscriber === void 0 ? void 0 : durationSubscriber.unsubscribe();
+ durationSubscriber = null;
+ if (hasValue) {
+ hasValue = false;
+ var value2 = lastValue;
+ lastValue = null;
+ subscriber.next(value2);
+ }
+ };
+ source.subscribe(createOperatorSubscriber(subscriber, function(value2) {
+ durationSubscriber === null || durationSubscriber === void 0 ? void 0 : durationSubscriber.unsubscribe();
+ hasValue = true;
+ lastValue = value2;
+ durationSubscriber = createOperatorSubscriber(subscriber, emit, noop);
+ innerFrom(durationSelector(value2)).subscribe(durationSubscriber);
+ }, function() {
+ emit();
+ subscriber.complete();
+ }, void 0, function() {
+ lastValue = durationSubscriber = null;
+ }));
+ });
+}
+var init_debounce = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/debounce.js"() {
+ init_lift();
+ init_noop();
+ init_OperatorSubscriber();
+ init_innerFrom();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/debounceTime.js
+function debounceTime(dueTime, scheduler) {
+ if (scheduler === void 0) {
+ scheduler = asyncScheduler;
+ }
+ return operate(function(source, subscriber) {
+ var activeTask = null;
+ var lastValue = null;
+ var lastTime = null;
+ var emit = function() {
+ if (activeTask) {
+ activeTask.unsubscribe();
+ activeTask = null;
+ var value2 = lastValue;
+ lastValue = null;
+ subscriber.next(value2);
+ }
+ };
+ function emitWhenIdle() {
+ var targetTime = lastTime + dueTime;
+ var now2 = scheduler.now();
+ if (now2 < targetTime) {
+ activeTask = this.schedule(void 0, targetTime - now2);
+ subscriber.add(activeTask);
+ return;
+ }
+ emit();
+ }
+ source.subscribe(createOperatorSubscriber(subscriber, function(value2) {
+ lastValue = value2;
+ lastTime = scheduler.now();
+ if (!activeTask) {
+ activeTask = scheduler.schedule(emitWhenIdle, dueTime);
+ subscriber.add(activeTask);
+ }
+ }, function() {
+ emit();
+ subscriber.complete();
+ }, void 0, function() {
+ lastValue = activeTask = null;
+ }));
+ });
+}
+var init_debounceTime = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/debounceTime.js"() {
+ init_async();
+ init_lift();
+ init_OperatorSubscriber();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/defaultIfEmpty.js
+var init_defaultIfEmpty = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/defaultIfEmpty.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/take.js
+var init_take = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/take.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/ignoreElements.js
+var init_ignoreElements = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/ignoreElements.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/mapTo.js
+var init_mapTo = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/mapTo.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/delayWhen.js
+var init_delayWhen = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/delayWhen.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/delay.js
+var init_delay = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/delay.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/dematerialize.js
+var init_dematerialize = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/dematerialize.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/distinct.js
+var init_distinct = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/distinct.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/distinctUntilChanged.js
+var init_distinctUntilChanged = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/distinctUntilChanged.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/distinctUntilKeyChanged.js
+var init_distinctUntilKeyChanged = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/distinctUntilKeyChanged.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/throwIfEmpty.js
+var init_throwIfEmpty = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/throwIfEmpty.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/elementAt.js
+var init_elementAt = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/elementAt.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/endWith.js
+var init_endWith = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/endWith.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/every.js
+var init_every = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/every.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/exhaustMap.js
+var init_exhaustMap = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/exhaustMap.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/exhaustAll.js
+var init_exhaustAll = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/exhaustAll.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/exhaust.js
+var init_exhaust = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/exhaust.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/expand.js
+var init_expand = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/expand.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/finalize.js
+var init_finalize = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/finalize.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/find.js
+var init_find = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/find.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/findIndex.js
+var init_findIndex = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/findIndex.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/first.js
+var init_first = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/first.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/groupBy.js
+var init_groupBy = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/groupBy.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/isEmpty.js
+var init_isEmpty = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/isEmpty.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/takeLast.js
+var init_takeLast = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/takeLast.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/last.js
+var init_last = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/last.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/materialize.js
+var init_materialize = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/materialize.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/max.js
+var init_max = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/max.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/flatMap.js
+var init_flatMap = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/flatMap.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/mergeMapTo.js
+var init_mergeMapTo = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/mergeMapTo.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/mergeScan.js
+var init_mergeScan = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/mergeScan.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/merge.js
+var init_merge2 = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/merge.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/mergeWith.js
+var init_mergeWith = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/mergeWith.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/min.js
+var init_min = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/min.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/multicast.js
+var init_multicast = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/multicast.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/onErrorResumeNextWith.js
+var init_onErrorResumeNextWith = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/onErrorResumeNextWith.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/pairwise.js
+var init_pairwise = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/pairwise.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/pluck.js
+var init_pluck = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/pluck.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/publish.js
+var init_publish = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/publish.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/publishBehavior.js
+var init_publishBehavior = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/publishBehavior.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/publishLast.js
+var init_publishLast = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/publishLast.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/publishReplay.js
+var init_publishReplay = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/publishReplay.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/raceWith.js
+var init_raceWith = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/raceWith.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/repeat.js
+var init_repeat = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/repeat.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/repeatWhen.js
+var init_repeatWhen = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/repeatWhen.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/retry.js
+var init_retry = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/retry.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/retryWhen.js
+var init_retryWhen = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/retryWhen.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/sample.js
+var init_sample = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/sample.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/sampleTime.js
+var init_sampleTime = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/sampleTime.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/scan.js
+var init_scan = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/scan.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/sequenceEqual.js
+var init_sequenceEqual = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/sequenceEqual.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/share.js
+var init_share = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/share.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/shareReplay.js
+var init_shareReplay = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/shareReplay.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/single.js
+var init_single = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/single.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/skip.js
+var init_skip = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/skip.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/skipLast.js
+var init_skipLast = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/skipLast.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/skipUntil.js
+var init_skipUntil = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/skipUntil.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/skipWhile.js
+var init_skipWhile = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/skipWhile.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/startWith.js
+function startWith() {
+ var values = [];
+ for (var _i = 0; _i < arguments.length; _i++) {
+ values[_i] = arguments[_i];
+ }
+ var scheduler = popScheduler(values);
+ return operate(function(source, subscriber) {
+ (scheduler ? concat(values, source, scheduler) : concat(values, source)).subscribe(subscriber);
+ });
+}
+var init_startWith = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/startWith.js"() {
+ init_concat();
+ init_args();
+ init_lift();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/switchMap.js
+var init_switchMap = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/switchMap.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/switchAll.js
+var init_switchAll = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/switchAll.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/switchMapTo.js
+var init_switchMapTo = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/switchMapTo.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/switchScan.js
+var init_switchScan = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/switchScan.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/takeUntil.js
+function takeUntil(notifier) {
+ return operate(function(source, subscriber) {
+ innerFrom(notifier).subscribe(createOperatorSubscriber(subscriber, function() {
+ return subscriber.complete();
+ }, noop));
+ !subscriber.closed && source.subscribe(subscriber);
+ });
+}
+var init_takeUntil = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/takeUntil.js"() {
+ init_lift();
+ init_OperatorSubscriber();
+ init_innerFrom();
+ init_noop();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/takeWhile.js
+var init_takeWhile = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/takeWhile.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/tap.js
+var init_tap = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/tap.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/throttle.js
+function throttle(durationSelector, config3) {
+ return operate(function(source, subscriber) {
+ var _a12 = config3 !== null && config3 !== void 0 ? config3 : {}, _b = _a12.leading, leading = _b === void 0 ? true : _b, _c = _a12.trailing, trailing = _c === void 0 ? false : _c;
+ var hasValue = false;
+ var sendValue = null;
+ var throttled = null;
+ var isComplete = false;
+ var endThrottling = function() {
+ throttled === null || throttled === void 0 ? void 0 : throttled.unsubscribe();
+ throttled = null;
+ if (trailing) {
+ send();
+ isComplete && subscriber.complete();
+ }
+ };
+ var cleanupThrottling = function() {
+ throttled = null;
+ isComplete && subscriber.complete();
+ };
+ var startThrottle = function(value2) {
+ return throttled = innerFrom(durationSelector(value2)).subscribe(createOperatorSubscriber(subscriber, endThrottling, cleanupThrottling));
+ };
+ var send = function() {
+ if (hasValue) {
+ hasValue = false;
+ var value2 = sendValue;
+ sendValue = null;
+ subscriber.next(value2);
+ !isComplete && startThrottle(value2);
+ }
+ };
+ source.subscribe(createOperatorSubscriber(subscriber, function(value2) {
+ hasValue = true;
+ sendValue = value2;
+ !(throttled && !throttled.closed) && (leading ? send() : startThrottle(value2));
+ }, function() {
+ isComplete = true;
+ !(trailing && hasValue && throttled && !throttled.closed) && subscriber.complete();
+ }));
+ });
+}
+var init_throttle = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/throttle.js"() {
+ init_lift();
+ init_OperatorSubscriber();
+ init_innerFrom();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/throttleTime.js
+function throttleTime(duration, scheduler, config3) {
+ if (scheduler === void 0) {
+ scheduler = asyncScheduler;
+ }
+ var duration$ = timer(duration, scheduler);
+ return throttle(function() {
+ return duration$;
+ }, config3);
+}
+var init_throttleTime = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/throttleTime.js"() {
+ init_async();
+ init_throttle();
+ init_timer();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/timeInterval.js
+var init_timeInterval = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/timeInterval.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/timeoutWith.js
+var init_timeoutWith = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/timeoutWith.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/timestamp.js
+var init_timestamp = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/timestamp.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/window.js
+var init_window = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/window.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/windowCount.js
+var init_windowCount = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/windowCount.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/windowTime.js
+var init_windowTime = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/windowTime.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/windowToggle.js
+var init_windowToggle = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/windowToggle.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/windowWhen.js
+var init_windowWhen = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/windowWhen.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/withLatestFrom.js
+var init_withLatestFrom = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/withLatestFrom.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/zipAll.js
+var init_zipAll = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/zipAll.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/zip.js
+var init_zip2 = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/zip.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/zipWith.js
+var init_zipWith = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/zipWith.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/index.js
+var init_esm5 = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/index.js"() {
+ init_Observable();
+ init_ConnectableObservable();
+ init_observable();
+ init_animationFrames();
+ init_Subject();
+ init_BehaviorSubject();
+ init_ReplaySubject();
+ init_AsyncSubject();
+ init_asap();
+ init_async();
+ init_queue();
+ init_animationFrame();
+ init_VirtualTimeScheduler();
+ init_Scheduler();
+ init_Subscription();
+ init_Subscriber();
+ init_Notification();
+ init_pipe();
+ init_noop();
+ init_identity();
+ init_isObservable();
+ init_lastValueFrom();
+ init_firstValueFrom();
+ init_ArgumentOutOfRangeError();
+ init_EmptyError();
+ init_NotFoundError();
+ init_ObjectUnsubscribedError();
+ init_SequenceError();
+ init_timeout();
+ init_UnsubscriptionError();
+ init_bindCallback();
+ init_bindNodeCallback();
+ init_combineLatest();
+ init_concat();
+ init_connectable();
+ init_defer();
+ init_empty();
+ init_forkJoin();
+ init_from();
+ init_fromEvent();
+ init_fromEventPattern();
+ init_generate();
+ init_iif();
+ init_interval();
+ init_merge();
+ init_never();
+ init_of();
+ init_onErrorResumeNext();
+ init_pairs();
+ init_partition();
+ init_race();
+ init_range();
+ init_throwError();
+ init_timer();
+ init_using();
+ init_zip();
+ init_scheduled();
+ init_empty();
+ init_never();
+ init_types();
+ init_config();
+ init_audit();
+ init_auditTime();
+ init_buffer();
+ init_bufferCount();
+ init_bufferTime();
+ init_bufferToggle();
+ init_bufferWhen();
+ init_catchError();
+ init_combineAll();
+ init_combineLatestAll();
+ init_combineLatestWith();
+ init_concatAll();
+ init_concatMap();
+ init_concatMapTo();
+ init_concatWith();
+ init_connect();
+ init_count();
+ init_debounce();
+ init_debounceTime();
+ init_defaultIfEmpty();
+ init_delay();
+ init_delayWhen();
+ init_dematerialize();
+ init_distinct();
+ init_distinctUntilChanged();
+ init_distinctUntilKeyChanged();
+ init_elementAt();
+ init_endWith();
+ init_every();
+ init_exhaust();
+ init_exhaustAll();
+ init_exhaustMap();
+ init_expand();
+ init_filter();
+ init_finalize();
+ init_find();
+ init_findIndex();
+ init_first();
+ init_groupBy();
+ init_ignoreElements();
+ init_isEmpty();
+ init_last();
+ init_map();
+ init_mapTo();
+ init_materialize();
+ init_max();
+ init_mergeAll();
+ init_flatMap();
+ init_mergeMap();
+ init_mergeMapTo();
+ init_mergeScan();
+ init_mergeWith();
+ init_min();
+ init_multicast();
+ init_observeOn();
+ init_onErrorResumeNextWith();
+ init_pairwise();
+ init_pluck();
+ init_publish();
+ init_publishBehavior();
+ init_publishLast();
+ init_publishReplay();
+ init_raceWith();
+ init_reduce();
+ init_repeat();
+ init_repeatWhen();
+ init_retry();
+ init_retryWhen();
+ init_refCount();
+ init_sample();
+ init_sampleTime();
+ init_scan();
+ init_sequenceEqual();
+ init_share();
+ init_shareReplay();
+ init_single();
+ init_skip();
+ init_skipLast();
+ init_skipUntil();
+ init_skipWhile();
+ init_startWith();
+ init_subscribeOn();
+ init_switchAll();
+ init_switchMap();
+ init_switchMapTo();
+ init_switchScan();
+ init_take();
+ init_takeLast();
+ init_takeUntil();
+ init_takeWhile();
+ init_tap();
+ init_throttle();
+ init_throttleTime();
+ init_throwIfEmpty();
+ init_timeInterval();
+ init_timeout();
+ init_timeoutWith();
+ init_timestamp();
+ init_toArray();
+ init_window();
+ init_windowCount();
+ init_windowTime();
+ init_windowToggle();
+ init_windowWhen();
+ init_withLatestFrom();
+ init_zipAll();
+ init_zipWith();
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/partition.js
+var init_partition2 = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/partition.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/race.js
+var init_race2 = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/internal/operators/race.js"() {
+ }
+});
+
+// node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/operators/index.js
+var init_operators = __esm({
+ "node_modules/.pnpm/rxjs@7.8.2/node_modules/rxjs/dist/esm5/operators/index.js"() {
+ init_audit();
+ init_auditTime();
+ init_buffer();
+ init_bufferCount();
+ init_bufferTime();
+ init_bufferToggle();
+ init_bufferWhen();
+ init_catchError();
+ init_combineAll();
+ init_combineLatestAll();
+ init_combineLatest2();
+ init_combineLatestWith();
+ init_concat2();
+ init_concatAll();
+ init_concatMap();
+ init_concatMapTo();
+ init_concatWith();
+ init_connect();
+ init_count();
+ init_debounce();
+ init_debounceTime();
+ init_defaultIfEmpty();
+ init_delay();
+ init_delayWhen();
+ init_dematerialize();
+ init_distinct();
+ init_distinctUntilChanged();
+ init_distinctUntilKeyChanged();
+ init_elementAt();
+ init_endWith();
+ init_every();
+ init_exhaust();
+ init_exhaustAll();
+ init_exhaustMap();
+ init_expand();
+ init_filter();
+ init_finalize();
+ init_find();
+ init_findIndex();
+ init_first();
+ init_groupBy();
+ init_ignoreElements();
+ init_isEmpty();
+ init_last();
+ init_map();
+ init_mapTo();
+ init_materialize();
+ init_max();
+ init_merge2();
+ init_mergeAll();
+ init_flatMap();
+ init_mergeMap();
+ init_mergeMapTo();
+ init_mergeScan();
+ init_mergeWith();
+ init_min();
+ init_multicast();
+ init_observeOn();
+ init_onErrorResumeNextWith();
+ init_pairwise();
+ init_partition2();
+ init_pluck();
+ init_publish();
+ init_publishBehavior();
+ init_publishLast();
+ init_publishReplay();
+ init_race2();
+ init_raceWith();
+ init_reduce();
+ init_repeat();
+ init_repeatWhen();
+ init_retry();
+ init_retryWhen();
+ init_refCount();
+ init_sample();
+ init_sampleTime();
+ init_scan();
+ init_sequenceEqual();
+ init_share();
+ init_shareReplay();
+ init_single();
+ init_skip();
+ init_skipLast();
+ init_skipUntil();
+ init_skipWhile();
+ init_startWith();
+ init_subscribeOn();
+ init_switchAll();
+ init_switchMap();
+ init_switchMapTo();
+ init_switchScan();
+ init_take();
+ init_takeLast();
+ init_takeUntil();
+ init_takeWhile();
+ init_tap();
+ init_throttle();
+ init_throttleTime();
+ init_throwIfEmpty();
+ init_timeInterval();
+ init_timeout();
+ init_timeoutWith();
+ init_timestamp();
+ init_toArray();
+ init_window();
+ init_windowCount();
+ init_windowTime();
+ init_windowToggle();
+ init_windowWhen();
+ init_withLatestFrom();
+ init_zip2();
+ init_zipAll();
+ init_zipWith();
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartrx@3.0.10/node_modules/@push.rocks/smartrx/dist_ts/smartrx.plugins.rxjs.js
+var smartrx_plugins_rxjs_exports = {};
+__export(smartrx_plugins_rxjs_exports, {
+ Observable: () => Observable,
+ ReplaySubject: () => ReplaySubject,
+ Subject: () => Subject,
+ Subscription: () => Subscription,
+ from: () => from,
+ fromEvent: () => fromEvent,
+ of: () => of,
+ ops: () => ops
+});
+var ops;
+var init_smartrx_plugins_rxjs = __esm({
+ "node_modules/.pnpm/@push.rocks+smartrx@3.0.10/node_modules/@push.rocks/smartrx/dist_ts/smartrx.plugins.rxjs.js"() {
+ init_esm5();
+ init_operators();
+ ops = {
+ buffer,
+ bufferCount,
+ bufferTime,
+ debounce,
+ debounceTime,
+ filter,
+ map: map2,
+ startWith,
+ takeUntil,
+ throttleTime
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartrx@3.0.10/node_modules/@push.rocks/smartrx/dist_ts/smartrx.classes.observablemap.js
+var Observablemap;
+var init_smartrx_classes_observablemap = __esm({
+ "node_modules/.pnpm/@push.rocks+smartrx@3.0.10/node_modules/@push.rocks/smartrx/dist_ts/smartrx.classes.observablemap.js"() {
+ init_smartrx_plugins();
+ init_smartrx_plugins_rxjs();
+ Observablemap = class {
+ constructor() {
+ this.observableEventEmitterBundleArray = new Array();
+ this.observableEventTargetBundleArray = new Array();
+ }
+ /**
+ * creates a hot subject if not yet registered for the event.
+ * In case event has been registered before the same observable is returned.
+ */
+ getSubjectForEmitterEvent(emitterArg, eventArg) {
+ const existingBundle = this.observableEventEmitterBundleArray.find((bundleArg) => {
+ return bundleArg.eventRef === emitterArg && bundleArg.event === eventArg;
+ });
+ if (existingBundle) {
+ return existingBundle.subject;
+ } else {
+ const emitterObservable = fromEvent(emitterArg, eventArg);
+ const emitterSubject = new Subject();
+ emitterObservable.subscribe(emitterSubject);
+ const newBundle = {
+ subject: emitterSubject,
+ eventRef: emitterArg,
+ event: eventArg
+ };
+ this.observableEventEmitterBundleArray.push(newBundle);
+ return newBundle.subject;
+ }
+ }
+ getSubjectForEventTarget(eventTargetArg, eventNameArg) {
+ const existingBundle = this.observableEventTargetBundleArray.find((bundleArg) => {
+ return bundleArg.eventRef === eventTargetArg && bundleArg.event === eventNameArg;
+ });
+ if (existingBundle) {
+ return existingBundle.subject;
+ } else {
+ const emitterSubject = new Subject();
+ const newBundle = {
+ subject: emitterSubject,
+ eventRef: eventTargetArg,
+ event: eventNameArg
+ };
+ this.observableEventTargetBundleArray.push(newBundle);
+ return newBundle.subject;
+ }
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartrx@3.0.10/node_modules/@push.rocks/smartrx/dist_ts/smartrx.classes.observableintake.js
+var ObservableIntake;
+var init_smartrx_classes_observableintake = __esm({
+ "node_modules/.pnpm/@push.rocks+smartrx@3.0.10/node_modules/@push.rocks/smartrx/dist_ts/smartrx.classes.observableintake.js"() {
+ init_smartrx_plugins();
+ init_smartrx_plugins_rxjs();
+ ObservableIntake = class {
+ constructor() {
+ this.observableFunctions = {
+ next: (payloadArg) => {
+ },
+ complete: (payloadArg) => {
+ }
+ };
+ this.generator = null;
+ this.buffered = false;
+ this.payloadBuffer = [];
+ this.observable = new Observable((observerArg) => {
+ this.observableFunctions.next = (...args) => {
+ return observerArg.next(args);
+ };
+ this.observableFunctions.complete = () => {
+ this.completedDeffered.resolve();
+ return observerArg.complete();
+ };
+ });
+ this.completedDeffered = dist_ts_exports.defer();
+ this.completed = this.completedDeffered.promise;
+ }
+ setObservable(observableFunc) {
+ this.observable = observableFunc;
+ }
+ push(payloadArg) {
+ if (this.buffered) {
+ this.payloadBuffer.push(payloadArg);
+ } else {
+ this.internalPush(payloadArg);
+ }
+ }
+ /**
+ * pushes many payloads as array
+ * @param payloadArgArray
+ */
+ pushMany(payloadArgArray) {
+ for (const item of payloadArgArray) {
+ this.push(item);
+ }
+ }
+ /**
+ * sets a generator to query the next pushed value
+ * @param generatorArg
+ */
+ setGenerator(generatorArg) {
+ this.generator = generatorArg;
+ }
+ makeBuffered() {
+ this.buffered = true;
+ }
+ subscribe(...args) {
+ return this.observable.subscribe(...args);
+ }
+ /**
+ * request the next values in the quantity specified
+ * @param howManyArg if a generator is set, of a buffer exists, this allows retrieving values
+ */
+ request(howManyArg) {
+ if (howManyArg === 0) {
+ return;
+ } else {
+ for (let i11 = 0; i11 !== howManyArg; i11++) {
+ if (this.payloadBuffer.length > 0) {
+ this.internalPush(this.payloadBuffer.shift());
+ } else {
+ const nextPayload = this.generator.next();
+ this.internalPush(nextPayload.value);
+ }
+ }
+ }
+ }
+ /**
+ * signals the completion of this observable
+ */
+ signalComplete() {
+ this.observableFunctions.complete();
+ }
+ internalPush(payloadArg) {
+ this.observableFunctions.next(payloadArg);
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartrx@3.0.10/node_modules/@push.rocks/smartrx/dist_ts/smartrx.functions.js
+function fromStreamWithBackpressure(stream) {
+ return new Observable((subscriber) => {
+ const pauseStream = () => stream.pause();
+ const resumeStream = () => process.nextTick(() => stream.resume());
+ const onData = (data8) => {
+ pauseStream();
+ subscriber.next(data8);
+ resumeStream();
+ };
+ stream.on("data", onData);
+ stream.on("error", (error) => subscriber.error(error));
+ stream.on("end", () => subscriber.complete());
+ stream.on("close", () => subscriber.complete());
+ return () => {
+ stream.removeListener("data", onData);
+ stream.removeListener("error", subscriber.error);
+ stream.removeListener("end", subscriber.complete);
+ stream.removeListener("close", subscriber.complete);
+ };
+ });
+}
+var init_smartrx_functions = __esm({
+ "node_modules/.pnpm/@push.rocks+smartrx@3.0.10/node_modules/@push.rocks/smartrx/dist_ts/smartrx.functions.js"() {
+ init_esm5();
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartrx@3.0.10/node_modules/@push.rocks/smartrx/dist_ts/index.js
+var dist_ts_exports2 = {};
+__export(dist_ts_exports2, {
+ ObservableIntake: () => ObservableIntake,
+ Observablemap: () => Observablemap,
+ fromStreamWithBackpressure: () => fromStreamWithBackpressure,
+ rxjs: () => smartrx_plugins_rxjs_exports
+});
+var init_dist_ts2 = __esm({
+ "node_modules/.pnpm/@push.rocks+smartrx@3.0.10/node_modules/@push.rocks/smartrx/dist_ts/index.js"() {
+ init_smartrx_plugins();
+ init_smartrx_classes_observablemap();
+ init_smartrx_classes_observableintake();
+ init_smartrx_functions();
+ init_smartrx_plugins_rxjs();
+ }
+});
+
+// node_modules/.pnpm/@lit+reactive-element@2.1.2/node_modules/@lit/reactive-element/decorators/property.js
+function n5(t9) {
+ return (e11, o13) => "object" == typeof o13 ? r4(t9, e11, o13) : ((t10, e12, o14) => {
+ const r11 = e12.hasOwnProperty(o14);
+ return e12.constructor.createProperty(o14, t10), r11 ? Object.getOwnPropertyDescriptor(e12, o14) : void 0;
+ })(t9, e11, o13);
+}
+var o6, r4;
+var init_property = __esm({
+ "node_modules/.pnpm/@lit+reactive-element@2.1.2/node_modules/@lit/reactive-element/decorators/property.js"() {
+ init_reactive_element();
+ o6 = { attribute: true, type: String, converter: u, reflect: false, hasChanged: f }, r4 = (t9 = o6, e11, r11) => {
+ const { kind: n12, metadata: i11 } = r11;
+ let s10 = globalThis.litPropertyMetadata.get(i11);
+ if (void 0 === s10 && globalThis.litPropertyMetadata.set(i11, s10 = /* @__PURE__ */ new Map()), "setter" === n12 && ((t9 = Object.create(t9)).wrapped = true), s10.set(r11.name, t9), "accessor" === n12) {
+ const { name: o13 } = r11;
+ return { set(r12) {
+ const n13 = e11.get.call(this);
+ e11.set.call(this, r12), this.requestUpdate(o13, n13, t9, true, r12);
+ }, init(e12) {
+ return void 0 !== e12 && this.C(o13, void 0, t9, e12), e12;
+ } };
+ }
+ if ("setter" === n12) {
+ const { name: o13 } = r11;
+ return function(r12) {
+ const n13 = this[o13];
+ e11.call(this, r12), this.requestUpdate(o13, n13, t9, true, r12);
+ };
+ }
+ throw Error("Unsupported decorator location: " + n12);
+ };
+ }
+});
+
+// node_modules/.pnpm/lit@3.3.2/node_modules/lit/decorators/property.js
+var init_property2 = __esm({
+ "node_modules/.pnpm/lit@3.3.2/node_modules/lit/decorators/property.js"() {
+ init_property();
+ }
+});
+
+// node_modules/.pnpm/@design.estate+dees-domtools@2.3.8/node_modules/@design.estate/dees-domtools/dist_ts/domtools.colors.js
+var init_domtools_colors = __esm({
+ "node_modules/.pnpm/@design.estate+dees-domtools@2.3.8/node_modules/@design.estate/dees-domtools/dist_ts/domtools.colors.js"() {
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartdelay@3.0.5/node_modules/@push.rocks/smartdelay/dist_ts/index.js
+var dist_ts_exports3 = {};
+__export(dist_ts_exports3, {
+ Timeout: () => Timeout,
+ delayFor: () => delayFor,
+ delayForRandom: () => delayForRandom
+});
+var delayFor, delayForRandom, Timeout;
+var init_dist_ts3 = __esm({
+ "node_modules/.pnpm/@push.rocks+smartdelay@3.0.5/node_modules/@push.rocks/smartdelay/dist_ts/index.js"() {
+ init_dist_ts();
+ delayFor = async (timeInMillisecondArg, passOnArg, unrefedArg = false) => {
+ const timeout2 = new Timeout(timeInMillisecondArg, null, unrefedArg);
+ await timeout2.promise;
+ return passOnArg;
+ };
+ delayForRandom = async (timeMinInMillisecondArg, timeMaxInMillisecondArg, passOnArg, unrefedArg = false) => {
+ await delayFor(Math.random() * (timeMaxInMillisecondArg - timeMinInMillisecondArg) + timeMinInMillisecondArg, null, unrefedArg);
+ return passOnArg;
+ };
+ Timeout = class {
+ constructor(timeInMillisecondArg, passOn, unrefedArg = false) {
+ this._cancelled = false;
+ this.timeoutInMillis = timeInMillisecondArg;
+ this._deferred = defer();
+ this.promise = this._deferred.promise;
+ this._timeout = setTimeout(() => {
+ if (!this._cancelled) {
+ this._deferred.resolve(passOn);
+ }
+ }, timeInMillisecondArg);
+ this.started = Date.now();
+ if (unrefedArg) {
+ this.makeUnrefed();
+ }
+ }
+ /**
+ * unreffing a timeout causes the node process to not wait for completion before exit
+ */
+ makeUnrefed() {
+ this._timeout.unref();
+ }
+ /**
+ * cancels the timer
+ */
+ cancel() {
+ this._cancelled = true;
+ clearTimeout(this._timeout);
+ }
+ getTimeLeft() {
+ const result = this.started + this.timeoutInMillis - Date.now();
+ return result > 0 ? result : 0;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@api.global+typedrequest-interfaces@3.0.19/node_modules/@api.global/typedrequest-interfaces/dist_ts/index.js
+var dist_ts_exports4 = {};
+var init_dist_ts4 = __esm({
+ "node_modules/.pnpm/@api.global+typedrequest-interfaces@3.0.19/node_modules/@api.global/typedrequest-interfaces/dist_ts/index.js"() {
+ }
+});
+
+// node_modules/.pnpm/escape-string-regexp@5.0.0/node_modules/escape-string-regexp/index.js
+function escapeStringRegexp(string3) {
+ if (typeof string3 !== "string") {
+ throw new TypeError("Expected a string");
+ }
+ return string3.replace(/[|\\{}()[\]^$+*?.]/g, "\\$&").replace(/-/g, "\\x2d");
+}
+var init_escape_string_regexp = __esm({
+ "node_modules/.pnpm/escape-string-regexp@5.0.0/node_modules/escape-string-regexp/index.js"() {
+ }
+});
+
+// node_modules/.pnpm/matcher@5.0.0/node_modules/matcher/index.js
+var matcher_exports = {};
+__export(matcher_exports, {
+ isMatch: () => isMatch,
+ matcher: () => matcher
+});
+function matcher(inputs, patterns2, options) {
+ return baseMatcher(inputs, patterns2, options, false);
+}
+function isMatch(inputs, patterns2, options) {
+ return baseMatcher(inputs, patterns2, options, true).length > 0;
+}
+var regexpCache, sanitizeArray, makeRegexp, baseMatcher;
+var init_matcher = __esm({
+ "node_modules/.pnpm/matcher@5.0.0/node_modules/matcher/index.js"() {
+ init_escape_string_regexp();
+ regexpCache = /* @__PURE__ */ new Map();
+ sanitizeArray = (input, inputName) => {
+ if (!Array.isArray(input)) {
+ switch (typeof input) {
+ case "string":
+ input = [input];
+ break;
+ case "undefined":
+ input = [];
+ break;
+ default:
+ throw new TypeError(`Expected '${inputName}' to be a string or an array, but got a type of '${typeof input}'`);
+ }
+ }
+ return input.filter((string3) => {
+ if (typeof string3 !== "string") {
+ if (typeof string3 === "undefined") {
+ return false;
+ }
+ throw new TypeError(`Expected '${inputName}' to be an array of strings, but found a type of '${typeof string3}' in the array`);
+ }
+ return true;
+ });
+ };
+ makeRegexp = (pattern, options) => {
+ options = {
+ caseSensitive: false,
+ ...options
+ };
+ const cacheKey = pattern + JSON.stringify(options);
+ if (regexpCache.has(cacheKey)) {
+ return regexpCache.get(cacheKey);
+ }
+ const negated = pattern[0] === "!";
+ if (negated) {
+ pattern = pattern.slice(1);
+ }
+ pattern = escapeStringRegexp(pattern).replace(/\\\*/g, "[\\s\\S]*");
+ const regexp = new RegExp(`^${pattern}$`, options.caseSensitive ? "" : "i");
+ regexp.negated = negated;
+ regexpCache.set(cacheKey, regexp);
+ return regexp;
+ };
+ baseMatcher = (inputs, patterns2, options, firstMatchOnly) => {
+ inputs = sanitizeArray(inputs, "inputs");
+ patterns2 = sanitizeArray(patterns2, "patterns");
+ if (patterns2.length === 0) {
+ return [];
+ }
+ patterns2 = patterns2.map((pattern) => makeRegexp(pattern, options));
+ const { allPatterns } = options || {};
+ const result = [];
+ for (const input of inputs) {
+ let matches;
+ const didFit = [...patterns2].fill(false);
+ for (const [index2, pattern] of patterns2.entries()) {
+ if (pattern.test(input)) {
+ didFit[index2] = true;
+ matches = !pattern.negated;
+ if (!matches) {
+ break;
+ }
+ }
+ }
+ if (!(matches === false || matches === void 0 && patterns2.some((pattern) => !pattern.negated) || allPatterns && didFit.some((yes, index2) => !yes && !patterns2[index2].negated))) {
+ result.push(input);
+ if (firstMatchOnly) {
+ break;
+ }
+ }
+ }
+ return result;
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartmatch@2.0.0/node_modules/@push.rocks/smartmatch/dist_ts/smartmatch.plugins.js
+var init_smartmatch_plugins = __esm({
+ "node_modules/.pnpm/@push.rocks+smartmatch@2.0.0/node_modules/@push.rocks/smartmatch/dist_ts/smartmatch.plugins.js"() {
+ init_matcher();
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartmatch@2.0.0/node_modules/@push.rocks/smartmatch/dist_ts/index.js
+var dist_ts_exports5 = {};
+__export(dist_ts_exports5, {
+ SmartMatch: () => SmartMatch
+});
+var SmartMatch;
+var init_dist_ts5 = __esm({
+ "node_modules/.pnpm/@push.rocks+smartmatch@2.0.0/node_modules/@push.rocks/smartmatch/dist_ts/index.js"() {
+ init_smartmatch_plugins();
+ SmartMatch = class {
+ constructor(wildcardArg) {
+ this.wildcard = wildcardArg;
+ }
+ match(matchStringArg) {
+ return matcher_exports.isMatch(matchStringArg, this.wildcard);
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/croner@10.0.1/node_modules/croner/dist/croner.js
+var croner_exports = {};
+__export(croner_exports, {
+ Cron: () => E2,
+ CronDate: () => m2,
+ CronPattern: () => C2,
+ scheduledJobs: () => w2
+});
+function T2(s10) {
+ return Date.UTC(s10.y, s10.m - 1, s10.d, s10.h, s10.i, s10.s);
+}
+function D2(s10, e11) {
+ return s10.y === e11.y && s10.m === e11.m && s10.d === e11.d && s10.h === e11.h && s10.i === e11.i && s10.s === e11.s;
+}
+function A2(s10, e11) {
+ let t9 = new Date(Date.parse(s10));
+ if (isNaN(t9)) throw new Error("Invalid ISO8601 passed to timezone parser.");
+ let r11 = s10.substring(9);
+ return r11.includes("Z") || r11.includes("+") || r11.includes("-") ? b3(t9.getUTCFullYear(), t9.getUTCMonth() + 1, t9.getUTCDate(), t9.getUTCHours(), t9.getUTCMinutes(), t9.getUTCSeconds(), "Etc/UTC") : b3(t9.getFullYear(), t9.getMonth() + 1, t9.getDate(), t9.getHours(), t9.getMinutes(), t9.getSeconds(), e11);
+}
+function v2(s10, e11, t9) {
+ return k2(A2(s10, e11), t9);
+}
+function k2(s10, e11) {
+ let t9 = new Date(T2(s10)), r11 = g2(t9, s10.tz), n12 = T2(s10), i11 = T2(r11), a5 = n12 - i11, o13 = new Date(t9.getTime() + a5), h8 = g2(o13, s10.tz);
+ if (D2(h8, s10)) {
+ let u7 = new Date(o13.getTime() - 36e5), d5 = g2(u7, s10.tz);
+ return D2(d5, s10) ? u7 : o13;
+ }
+ let l6 = new Date(o13.getTime() + T2(s10) - T2(h8)), y4 = g2(l6, s10.tz);
+ if (D2(y4, s10)) return l6;
+ if (e11) throw new Error("Invalid date passed to fromTZ()");
+ return o13.getTime() > l6.getTime() ? o13 : l6;
+}
+function g2(s10, e11) {
+ let t9, r11;
+ try {
+ t9 = new Intl.DateTimeFormat("en-US", { timeZone: e11, year: "numeric", month: "numeric", day: "numeric", hour: "numeric", minute: "numeric", second: "numeric", hour12: false }), r11 = t9.formatToParts(s10);
+ } catch (i11) {
+ let a5 = i11 instanceof Error ? i11.message : String(i11);
+ throw new RangeError(`toTZ: Invalid timezone '${e11}' or date. Please provide a valid IANA timezone (e.g., 'America/New_York', 'Europe/Stockholm'). Original error: ${a5}`);
+ }
+ let n12 = { year: 0, month: 0, day: 0, hour: 0, minute: 0, second: 0 };
+ for (let i11 of r11) (i11.type === "year" || i11.type === "month" || i11.type === "day" || i11.type === "hour" || i11.type === "minute" || i11.type === "second") && (n12[i11.type] = parseInt(i11.value, 10));
+ if (isNaN(n12.year) || isNaN(n12.month) || isNaN(n12.day) || isNaN(n12.hour) || isNaN(n12.minute) || isNaN(n12.second)) throw new Error(`toTZ: Failed to parse all date components from timezone '${e11}'. This may indicate an invalid date or timezone configuration. Parsed components: ${JSON.stringify(n12)}`);
+ return n12.hour === 24 && (n12.hour = 0), { y: n12.year, m: n12.month, d: n12.day, h: n12.hour, i: n12.minute, s: n12.second, tz: e11 };
+}
+function b3(s10, e11, t9, r11, n12, i11, a5) {
+ return { y: s10, m: e11, d: t9, h: r11, i: n12, s: i11, tz: a5 };
+}
+function R2(s10) {
+ if (s10 === void 0 && (s10 = {}), delete s10.name, s10.legacyMode !== void 0 && s10.domAndDow === void 0 ? s10.domAndDow = !s10.legacyMode : s10.domAndDow === void 0 && (s10.domAndDow = false), s10.legacyMode = !s10.domAndDow, s10.paused = s10.paused === void 0 ? false : s10.paused, s10.maxRuns = s10.maxRuns === void 0 ? 1 / 0 : s10.maxRuns, s10.catch = s10.catch === void 0 ? false : s10.catch, s10.interval = s10.interval === void 0 ? 0 : parseInt(s10.interval.toString(), 10), s10.utcOffset = s10.utcOffset === void 0 ? void 0 : parseInt(s10.utcOffset.toString(), 10), s10.dayOffset = s10.dayOffset === void 0 ? 0 : parseInt(s10.dayOffset.toString(), 10), s10.unref = s10.unref === void 0 ? false : s10.unref, s10.mode = s10.mode === void 0 ? "auto" : s10.mode, s10.alternativeWeekdays = s10.alternativeWeekdays === void 0 ? false : s10.alternativeWeekdays, s10.sloppyRanges = s10.sloppyRanges === void 0 ? false : s10.sloppyRanges, !["auto", "5-part", "6-part", "7-part", "5-or-6-parts", "6-or-7-parts"].includes(s10.mode)) throw new Error("CronOptions: mode must be one of 'auto', '5-part', '6-part', '7-part', '5-or-6-parts', or '6-or-7-parts'.");
+ if (s10.startAt && (s10.startAt = new m2(s10.startAt, s10.timezone)), s10.stopAt && (s10.stopAt = new m2(s10.stopAt, s10.timezone)), s10.interval !== null) {
+ if (isNaN(s10.interval)) throw new Error("CronOptions: Supplied value for interval is not a number");
+ if (s10.interval < 0) throw new Error("CronOptions: Supplied value for interval can not be negative");
+ }
+ if (s10.utcOffset !== void 0) {
+ if (isNaN(s10.utcOffset)) throw new Error("CronOptions: Invalid value passed for utcOffset, should be number representing minutes offset from UTC.");
+ if (s10.utcOffset < -870 || s10.utcOffset > 870) throw new Error("CronOptions: utcOffset out of bounds.");
+ if (s10.utcOffset !== void 0 && s10.timezone) throw new Error("CronOptions: Combining 'utcOffset' with 'timezone' is not allowed.");
+ }
+ if (s10.unref !== true && s10.unref !== false) throw new Error("CronOptions: Unref should be either true, false or undefined(false).");
+ if (s10.dayOffset !== void 0 && s10.dayOffset !== 0 && isNaN(s10.dayOffset)) throw new Error("CronOptions: Invalid value passed for dayOffset, should be a number representing days to offset.");
+ return s10;
+}
+function p3(s10) {
+ return Object.prototype.toString.call(s10) === "[object Function]" || typeof s10 == "function" || s10 instanceof Function;
+}
+function _2(s10) {
+ return p3(s10);
+}
+function x2(s10) {
+ typeof Deno < "u" && typeof Deno.unrefTimer < "u" ? Deno.unrefTimer(s10) : s10 && typeof s10.unref < "u" && s10.unref();
+}
+var O, C2, P2, f3, m2, W, w2, E2;
+var init_croner = __esm({
+ "node_modules/.pnpm/croner@10.0.1/node_modules/croner/dist/croner.js"() {
+ O = [1, 2, 4, 8, 16], C2 = class {
+ pattern;
+ timezone;
+ mode;
+ alternativeWeekdays;
+ sloppyRanges;
+ second;
+ minute;
+ hour;
+ day;
+ month;
+ dayOfWeek;
+ year;
+ lastDayOfMonth;
+ lastWeekday;
+ nearestWeekdays;
+ starDOM;
+ starDOW;
+ starYear;
+ useAndLogic;
+ constructor(e11, t9, r11) {
+ this.pattern = e11, this.timezone = t9, this.mode = r11?.mode ?? "auto", this.alternativeWeekdays = r11?.alternativeWeekdays ?? false, this.sloppyRanges = r11?.sloppyRanges ?? false, this.second = Array(60).fill(0), this.minute = Array(60).fill(0), this.hour = Array(24).fill(0), this.day = Array(31).fill(0), this.month = Array(12).fill(0), this.dayOfWeek = Array(7).fill(0), this.year = Array(1e4).fill(0), this.lastDayOfMonth = false, this.lastWeekday = false, this.nearestWeekdays = Array(31).fill(0), this.starDOM = false, this.starDOW = false, this.starYear = false, this.useAndLogic = false, this.parse();
+ }
+ parse() {
+ if (!(typeof this.pattern == "string" || this.pattern instanceof String)) throw new TypeError("CronPattern: Pattern has to be of type string.");
+ this.pattern.indexOf("@") >= 0 && (this.pattern = this.handleNicknames(this.pattern).trim());
+ let e11 = this.pattern.match(/\S+/g) || [""], t9 = e11.length;
+ if (e11.length < 5 || e11.length > 7) throw new TypeError("CronPattern: invalid configuration format ('" + this.pattern + "'), exactly five, six, or seven space separated parts are required.");
+ if (this.mode !== "auto") {
+ let n12;
+ switch (this.mode) {
+ case "5-part":
+ n12 = 5;
+ break;
+ case "6-part":
+ n12 = 6;
+ break;
+ case "7-part":
+ n12 = 7;
+ break;
+ case "5-or-6-parts":
+ n12 = [5, 6];
+ break;
+ case "6-or-7-parts":
+ n12 = [6, 7];
+ break;
+ default:
+ n12 = 0;
+ }
+ if (!(Array.isArray(n12) ? n12.includes(t9) : t9 === n12)) {
+ let a5 = Array.isArray(n12) ? n12.join(" or ") : n12.toString();
+ throw new TypeError(`CronPattern: mode '${this.mode}' requires exactly ${a5} parts, but pattern '${this.pattern}' has ${t9} parts.`);
+ }
+ }
+ if (e11.length === 5 && e11.unshift("0"), e11.length === 6 && e11.push("*"), e11[3].toUpperCase() === "LW" ? (this.lastWeekday = true, e11[3] = "") : e11[3].toUpperCase().indexOf("L") >= 0 && (e11[3] = e11[3].replace(/L/gi, ""), this.lastDayOfMonth = true), e11[3] == "*" && (this.starDOM = true), e11[6] == "*" && (this.starYear = true), e11[4].length >= 3 && (e11[4] = this.replaceAlphaMonths(e11[4])), e11[5].length >= 3 && (e11[5] = this.alternativeWeekdays ? this.replaceAlphaDaysQuartz(e11[5]) : this.replaceAlphaDays(e11[5])), e11[5].startsWith("+") && (this.useAndLogic = true, e11[5] = e11[5].substring(1), e11[5] === "")) throw new TypeError("CronPattern: Day-of-week field cannot be empty after '+' modifier.");
+ switch (e11[5] == "*" && (this.starDOW = true), this.pattern.indexOf("?") >= 0 && (e11[0] = e11[0].replace(/\?/g, "*"), e11[1] = e11[1].replace(/\?/g, "*"), e11[2] = e11[2].replace(/\?/g, "*"), e11[3] = e11[3].replace(/\?/g, "*"), e11[4] = e11[4].replace(/\?/g, "*"), e11[5] = e11[5].replace(/\?/g, "*"), e11[6] && (e11[6] = e11[6].replace(/\?/g, "*"))), this.mode) {
+ case "5-part":
+ e11[0] = "0", e11[6] = "*";
+ break;
+ case "6-part":
+ e11[6] = "*";
+ break;
+ case "5-or-6-parts":
+ e11[6] = "*";
+ break;
+ case "6-or-7-parts":
+ break;
+ case "7-part":
+ case "auto":
+ break;
+ }
+ this.throwAtIllegalCharacters(e11), this.partToArray("second", e11[0], 0, 1), this.partToArray("minute", e11[1], 0, 1), this.partToArray("hour", e11[2], 0, 1), this.partToArray("day", e11[3], -1, 1), this.partToArray("month", e11[4], -1, 1);
+ let r11 = this.alternativeWeekdays ? -1 : 0;
+ this.partToArray("dayOfWeek", e11[5], r11, 63), this.partToArray("year", e11[6], 0, 1), !this.alternativeWeekdays && this.dayOfWeek[7] && (this.dayOfWeek[0] = this.dayOfWeek[7]);
+ }
+ partToArray(e11, t9, r11, n12) {
+ let i11 = this[e11], a5 = e11 === "day" && this.lastDayOfMonth, o13 = e11 === "day" && this.lastWeekday;
+ if (t9 === "" && !a5 && !o13) throw new TypeError("CronPattern: configuration entry " + e11 + " (" + t9 + ") is empty, check for trailing spaces.");
+ if (t9 === "*") return i11.fill(n12);
+ let h8 = t9.split(",");
+ if (h8.length > 1) for (let l6 = 0; l6 < h8.length; l6++) this.partToArray(e11, h8[l6], r11, n12);
+ else t9.indexOf("-") !== -1 && t9.indexOf("/") !== -1 ? this.handleRangeWithStepping(t9, e11, r11, n12) : t9.indexOf("-") !== -1 ? this.handleRange(t9, e11, r11, n12) : t9.indexOf("/") !== -1 ? this.handleStepping(t9, e11, r11, n12) : t9 !== "" && this.handleNumber(t9, e11, r11, n12);
+ }
+ throwAtIllegalCharacters(e11) {
+ for (let t9 = 0; t9 < e11.length; t9++) if ((t9 === 3 ? /[^/*0-9,\-WwLl]+/ : t9 === 5 ? /[^/*0-9,\-#Ll]+/ : /[^/*0-9,\-]+/).test(e11[t9])) throw new TypeError("CronPattern: configuration entry " + t9 + " (" + e11[t9] + ") contains illegal characters.");
+ }
+ handleNumber(e11, t9, r11, n12) {
+ let i11 = this.extractNth(e11, t9), a5 = e11.toUpperCase().includes("W");
+ if (t9 !== "day" && a5) throw new TypeError("CronPattern: Nearest weekday modifier (W) only allowed in day-of-month.");
+ a5 && (t9 = "nearestWeekdays");
+ let o13 = parseInt(i11[0], 10) + r11;
+ if (isNaN(o13)) throw new TypeError("CronPattern: " + t9 + " is not a number: '" + e11 + "'");
+ this.setPart(t9, o13, i11[1] || n12);
+ }
+ setPart(e11, t9, r11) {
+ if (!Object.prototype.hasOwnProperty.call(this, e11)) throw new TypeError("CronPattern: Invalid part specified: " + e11);
+ if (e11 === "dayOfWeek") {
+ if (t9 === 7 && (t9 = 0), t9 < 0 || t9 > 6) throw new RangeError("CronPattern: Invalid value for dayOfWeek: " + t9);
+ this.setNthWeekdayOfMonth(t9, r11);
+ return;
+ }
+ if (e11 === "second" || e11 === "minute") {
+ if (t9 < 0 || t9 >= 60) throw new RangeError("CronPattern: Invalid value for " + e11 + ": " + t9);
+ } else if (e11 === "hour") {
+ if (t9 < 0 || t9 >= 24) throw new RangeError("CronPattern: Invalid value for " + e11 + ": " + t9);
+ } else if (e11 === "day" || e11 === "nearestWeekdays") {
+ if (t9 < 0 || t9 >= 31) throw new RangeError("CronPattern: Invalid value for " + e11 + ": " + t9);
+ } else if (e11 === "month") {
+ if (t9 < 0 || t9 >= 12) throw new RangeError("CronPattern: Invalid value for " + e11 + ": " + t9);
+ } else if (e11 === "year" && (t9 < 1 || t9 >= 1e4)) throw new RangeError("CronPattern: Invalid value for " + e11 + ": " + t9 + " (supported range: 1-9999)");
+ this[e11][t9] = r11;
+ }
+ validateNotNaN(e11, t9) {
+ if (isNaN(e11)) throw new TypeError(t9);
+ }
+ validateRange(e11, t9, r11, n12, i11) {
+ if (e11 > t9) throw new TypeError("CronPattern: From value is larger than to value: '" + i11 + "'");
+ if (r11 !== void 0) {
+ if (r11 === 0) throw new TypeError("CronPattern: Syntax error, illegal stepping: 0");
+ if (r11 > this[n12].length) throw new TypeError("CronPattern: Syntax error, steps cannot be greater than maximum value of part (" + this[n12].length + ")");
+ }
+ }
+ handleRangeWithStepping(e11, t9, r11, n12) {
+ if (e11.toUpperCase().includes("W")) throw new TypeError("CronPattern: Syntax error, W is not allowed in ranges with stepping.");
+ let i11 = this.extractNth(e11, t9), a5 = i11[0].match(/^(\d+)-(\d+)\/(\d+)$/);
+ if (a5 === null) throw new TypeError("CronPattern: Syntax error, illegal range with stepping: '" + e11 + "'");
+ let [, o13, h8, l6] = a5, y4 = parseInt(o13, 10) + r11, u7 = parseInt(h8, 10) + r11, d5 = parseInt(l6, 10);
+ this.validateNotNaN(y4, "CronPattern: Syntax error, illegal lower range (NaN)"), this.validateNotNaN(u7, "CronPattern: Syntax error, illegal upper range (NaN)"), this.validateNotNaN(d5, "CronPattern: Syntax error, illegal stepping: (NaN)"), this.validateRange(y4, u7, d5, t9, e11);
+ for (let c11 = y4; c11 <= u7; c11 += d5) this.setPart(t9, c11, i11[1] || n12);
+ }
+ extractNth(e11, t9) {
+ let r11 = e11, n12;
+ if (r11.includes("#")) {
+ if (t9 !== "dayOfWeek") throw new Error("CronPattern: nth (#) only allowed in day-of-week field");
+ n12 = r11.split("#")[1], r11 = r11.split("#")[0];
+ } else if (r11.toUpperCase().endsWith("L")) {
+ if (t9 !== "dayOfWeek") throw new Error("CronPattern: L modifier only allowed in day-of-week field (use L alone for day-of-month)");
+ n12 = "L", r11 = r11.slice(0, -1);
+ }
+ return [r11, n12];
+ }
+ handleRange(e11, t9, r11, n12) {
+ if (e11.toUpperCase().includes("W")) throw new TypeError("CronPattern: Syntax error, W is not allowed in a range.");
+ let i11 = this.extractNth(e11, t9), a5 = i11[0].split("-");
+ if (a5.length !== 2) throw new TypeError("CronPattern: Syntax error, illegal range: '" + e11 + "'");
+ let o13 = parseInt(a5[0], 10) + r11, h8 = parseInt(a5[1], 10) + r11;
+ this.validateNotNaN(o13, "CronPattern: Syntax error, illegal lower range (NaN)"), this.validateNotNaN(h8, "CronPattern: Syntax error, illegal upper range (NaN)"), this.validateRange(o13, h8, void 0, t9, e11);
+ for (let l6 = o13; l6 <= h8; l6++) this.setPart(t9, l6, i11[1] || n12);
+ }
+ handleStepping(e11, t9, r11, n12) {
+ if (e11.toUpperCase().includes("W")) throw new TypeError("CronPattern: Syntax error, W is not allowed in parts with stepping.");
+ let i11 = this.extractNth(e11, t9), a5 = i11[0].split("/");
+ if (a5.length !== 2) throw new TypeError("CronPattern: Syntax error, illegal stepping: '" + e11 + "'");
+ if (this.sloppyRanges) a5[0] === "" && (a5[0] = "*");
+ else {
+ if (a5[0] === "") throw new TypeError("CronPattern: Syntax error, stepping with missing prefix ('" + e11 + "') is not allowed. Use wildcard (*/step) or range (min-max/step) instead.");
+ if (a5[0] !== "*") throw new TypeError("CronPattern: Syntax error, stepping with numeric prefix ('" + e11 + "') is not allowed. Use wildcard (*/step) or range (min-max/step) instead.");
+ }
+ let o13 = 0;
+ a5[0] !== "*" && (o13 = parseInt(a5[0], 10) + r11);
+ let h8 = parseInt(a5[1], 10);
+ this.validateNotNaN(h8, "CronPattern: Syntax error, illegal stepping: (NaN)"), this.validateRange(0, this[t9].length - 1, h8, t9, e11);
+ for (let l6 = o13; l6 < this[t9].length; l6 += h8) this.setPart(t9, l6, i11[1] || n12);
+ }
+ replaceAlphaDays(e11) {
+ return e11.replace(/-sun/gi, "-7").replace(/sun/gi, "0").replace(/mon/gi, "1").replace(/tue/gi, "2").replace(/wed/gi, "3").replace(/thu/gi, "4").replace(/fri/gi, "5").replace(/sat/gi, "6");
+ }
+ replaceAlphaDaysQuartz(e11) {
+ return e11.replace(/sun/gi, "1").replace(/mon/gi, "2").replace(/tue/gi, "3").replace(/wed/gi, "4").replace(/thu/gi, "5").replace(/fri/gi, "6").replace(/sat/gi, "7");
+ }
+ replaceAlphaMonths(e11) {
+ return e11.replace(/jan/gi, "1").replace(/feb/gi, "2").replace(/mar/gi, "3").replace(/apr/gi, "4").replace(/may/gi, "5").replace(/jun/gi, "6").replace(/jul/gi, "7").replace(/aug/gi, "8").replace(/sep/gi, "9").replace(/oct/gi, "10").replace(/nov/gi, "11").replace(/dec/gi, "12");
+ }
+ handleNicknames(e11) {
+ let t9 = e11.trim().toLowerCase();
+ if (t9 === "@yearly" || t9 === "@annually") return "0 0 1 1 *";
+ if (t9 === "@monthly") return "0 0 1 * *";
+ if (t9 === "@weekly") return "0 0 * * 0";
+ if (t9 === "@daily" || t9 === "@midnight") return "0 0 * * *";
+ if (t9 === "@hourly") return "0 * * * *";
+ if (t9 === "@reboot") throw new TypeError("CronPattern: @reboot is not supported in this environment. This is an event-based trigger that requires system startup detection.");
+ return e11;
+ }
+ setNthWeekdayOfMonth(e11, t9) {
+ if (typeof t9 != "number" && t9.toUpperCase() === "L") this.dayOfWeek[e11] = this.dayOfWeek[e11] | 32;
+ else if (t9 === 63) this.dayOfWeek[e11] = 63;
+ else if (t9 < 6 && t9 > 0) this.dayOfWeek[e11] = this.dayOfWeek[e11] | O[t9 - 1];
+ else throw new TypeError(`CronPattern: nth weekday out of range, should be 1-5 or L. Value: ${t9}, Type: ${typeof t9}`);
+ }
+ };
+ P2 = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31], f3 = [["month", "year", 0], ["day", "month", -1], ["hour", "day", 0], ["minute", "hour", 0], ["second", "minute", 0]], m2 = class s4 {
+ tz;
+ ms;
+ second;
+ minute;
+ hour;
+ day;
+ month;
+ year;
+ constructor(e11, t9) {
+ if (this.tz = t9, e11 && e11 instanceof Date) if (!isNaN(e11)) this.fromDate(e11);
+ else throw new TypeError("CronDate: Invalid date passed to CronDate constructor");
+ else if (e11 == null) this.fromDate(/* @__PURE__ */ new Date());
+ else if (e11 && typeof e11 == "string") this.fromString(e11);
+ else if (e11 instanceof s4) this.fromCronDate(e11);
+ else throw new TypeError("CronDate: Invalid type (" + typeof e11 + ") passed to CronDate constructor");
+ }
+ getLastDayOfMonth(e11, t9) {
+ return t9 !== 1 ? P2[t9] : new Date(Date.UTC(e11, t9 + 1, 0)).getUTCDate();
+ }
+ getLastWeekday(e11, t9) {
+ let r11 = this.getLastDayOfMonth(e11, t9), i11 = new Date(Date.UTC(e11, t9, r11)).getUTCDay();
+ return i11 === 0 ? r11 - 2 : i11 === 6 ? r11 - 1 : r11;
+ }
+ getNearestWeekday(e11, t9, r11) {
+ let n12 = this.getLastDayOfMonth(e11, t9);
+ if (r11 > n12) return -1;
+ let a5 = new Date(Date.UTC(e11, t9, r11)).getUTCDay();
+ return a5 === 0 ? r11 === n12 ? r11 - 2 : r11 + 1 : a5 === 6 ? r11 === 1 ? r11 + 2 : r11 - 1 : r11;
+ }
+ isNthWeekdayOfMonth(e11, t9, r11, n12) {
+ let a5 = new Date(Date.UTC(e11, t9, r11)).getUTCDay(), o13 = 0;
+ for (let h8 = 1; h8 <= r11; h8++) new Date(Date.UTC(e11, t9, h8)).getUTCDay() === a5 && o13++;
+ if (n12 & 63 && O[o13 - 1] & n12) return true;
+ if (n12 & 32) {
+ let h8 = this.getLastDayOfMonth(e11, t9);
+ for (let l6 = r11 + 1; l6 <= h8; l6++) if (new Date(Date.UTC(e11, t9, l6)).getUTCDay() === a5) return false;
+ return true;
+ }
+ return false;
+ }
+ fromDate(e11) {
+ if (this.tz !== void 0) if (typeof this.tz == "number") this.ms = e11.getUTCMilliseconds(), this.second = e11.getUTCSeconds(), this.minute = e11.getUTCMinutes() + this.tz, this.hour = e11.getUTCHours(), this.day = e11.getUTCDate(), this.month = e11.getUTCMonth(), this.year = e11.getUTCFullYear(), this.apply();
+ else try {
+ let t9 = g2(e11, this.tz);
+ this.ms = e11.getMilliseconds(), this.second = t9.s, this.minute = t9.i, this.hour = t9.h, this.day = t9.d, this.month = t9.m - 1, this.year = t9.y;
+ } catch (t9) {
+ let r11 = t9 instanceof Error ? t9.message : String(t9);
+ throw new TypeError(`CronDate: Failed to convert date to timezone '${this.tz}'. This may happen with invalid timezone names or dates. Original error: ${r11}`);
+ }
+ else this.ms = e11.getMilliseconds(), this.second = e11.getSeconds(), this.minute = e11.getMinutes(), this.hour = e11.getHours(), this.day = e11.getDate(), this.month = e11.getMonth(), this.year = e11.getFullYear();
+ }
+ fromCronDate(e11) {
+ this.tz = e11.tz, this.year = e11.year, this.month = e11.month, this.day = e11.day, this.hour = e11.hour, this.minute = e11.minute, this.second = e11.second, this.ms = e11.ms;
+ }
+ apply() {
+ if (this.month > 11 || this.month < 0 || this.day > P2[this.month] || this.day < 1 || this.hour > 59 || this.minute > 59 || this.second > 59 || this.hour < 0 || this.minute < 0 || this.second < 0) {
+ let e11 = new Date(Date.UTC(this.year, this.month, this.day, this.hour, this.minute, this.second, this.ms));
+ return this.ms = e11.getUTCMilliseconds(), this.second = e11.getUTCSeconds(), this.minute = e11.getUTCMinutes(), this.hour = e11.getUTCHours(), this.day = e11.getUTCDate(), this.month = e11.getUTCMonth(), this.year = e11.getUTCFullYear(), true;
+ } else return false;
+ }
+ fromString(e11) {
+ if (typeof this.tz == "number") {
+ let t9 = v2(e11);
+ this.ms = t9.getUTCMilliseconds(), this.second = t9.getUTCSeconds(), this.minute = t9.getUTCMinutes(), this.hour = t9.getUTCHours(), this.day = t9.getUTCDate(), this.month = t9.getUTCMonth(), this.year = t9.getUTCFullYear(), this.apply();
+ } else return this.fromDate(v2(e11, this.tz));
+ }
+ findNext(e11, t9, r11, n12) {
+ return this._findMatch(e11, t9, r11, n12, 1);
+ }
+ _findMatch(e11, t9, r11, n12, i11) {
+ let a5 = this[t9], o13;
+ r11.lastDayOfMonth && (o13 = this.getLastDayOfMonth(this.year, this.month));
+ let h8 = !r11.starDOW && t9 == "day" ? new Date(Date.UTC(this.year, this.month, 1, 0, 0, 0, 0)).getUTCDay() : void 0, l6 = this[t9] + n12, y4 = i11 === 1 ? (u7) => u7 < r11[t9].length : (u7) => u7 >= 0;
+ for (let u7 = l6; y4(u7); u7 += i11) {
+ let d5 = r11[t9][u7];
+ if (t9 === "day" && !d5) {
+ for (let c11 = 0; c11 < r11.nearestWeekdays.length; c11++) if (r11.nearestWeekdays[c11]) {
+ let M4 = this.getNearestWeekday(this.year, this.month, c11 - n12);
+ if (M4 === -1) continue;
+ if (M4 === u7 - n12) {
+ d5 = 1;
+ break;
+ }
+ }
+ }
+ if (t9 === "day" && r11.lastWeekday) {
+ let c11 = this.getLastWeekday(this.year, this.month);
+ u7 - n12 === c11 && (d5 = 1);
+ }
+ if (t9 === "day" && r11.lastDayOfMonth && u7 - n12 == o13 && (d5 = 1), t9 === "day" && !r11.starDOW) {
+ let c11 = r11.dayOfWeek[(h8 + (u7 - n12 - 1)) % 7];
+ if (c11 && c11 & 63) c11 = this.isNthWeekdayOfMonth(this.year, this.month, u7 - n12, c11) ? 1 : 0;
+ else if (c11) throw new Error(`CronDate: Invalid value for dayOfWeek encountered. ${c11}`);
+ r11.useAndLogic ? d5 = d5 && c11 : !e11.domAndDow && !r11.starDOM ? d5 = d5 || c11 : d5 = d5 && c11;
+ }
+ if (d5) return this[t9] = u7 - n12, a5 !== this[t9] ? 2 : 1;
+ }
+ return 3;
+ }
+ recurse(e11, t9, r11) {
+ if (r11 === 0 && !e11.starYear) {
+ if (this.year >= 0 && this.year < e11.year.length && e11.year[this.year] === 0) {
+ let i11 = -1;
+ for (let a5 = this.year + 1; a5 < e11.year.length && a5 < 1e4; a5++) if (e11.year[a5] === 1) {
+ i11 = a5;
+ break;
+ }
+ if (i11 === -1) return null;
+ this.year = i11, this.month = 0, this.day = 1, this.hour = 0, this.minute = 0, this.second = 0, this.ms = 0;
+ }
+ if (this.year >= 1e4) return null;
+ }
+ let n12 = this.findNext(t9, f3[r11][0], e11, f3[r11][2]);
+ if (n12 > 1) {
+ let i11 = r11 + 1;
+ for (; i11 < f3.length; ) this[f3[i11][0]] = -f3[i11][2], i11++;
+ if (n12 === 3) {
+ if (this[f3[r11][1]]++, this[f3[r11][0]] = -f3[r11][2], this.apply(), r11 === 0 && !e11.starYear) {
+ for (; this.year >= 0 && this.year < e11.year.length && e11.year[this.year] === 0 && this.year < 1e4; ) this.year++;
+ if (this.year >= 1e4 || this.year >= e11.year.length) return null;
+ }
+ return this.recurse(e11, t9, 0);
+ } else if (this.apply()) return this.recurse(e11, t9, r11 - 1);
+ }
+ return r11 += 1, r11 >= f3.length ? this : (e11.starYear ? this.year >= 3e3 : this.year >= 1e4) ? null : this.recurse(e11, t9, r11);
+ }
+ increment(e11, t9, r11) {
+ return this.second += t9.interval !== void 0 && t9.interval > 1 && r11 ? t9.interval : 1, this.ms = 0, this.apply(), this.recurse(e11, t9, 0);
+ }
+ decrement(e11, t9) {
+ return this.second -= t9.interval !== void 0 && t9.interval > 1 ? t9.interval : 1, this.ms = 0, this.apply(), this.recurseBackward(e11, t9, 0, 0);
+ }
+ recurseBackward(e11, t9, r11, n12 = 0) {
+ if (n12 > 1e4) return null;
+ if (r11 === 0 && !e11.starYear) {
+ if (this.year >= 0 && this.year < e11.year.length && e11.year[this.year] === 0) {
+ let a5 = -1;
+ for (let o13 = this.year - 1; o13 >= 0; o13--) if (e11.year[o13] === 1) {
+ a5 = o13;
+ break;
+ }
+ if (a5 === -1) return null;
+ this.year = a5, this.month = 11, this.day = 31, this.hour = 23, this.minute = 59, this.second = 59, this.ms = 0;
+ }
+ if (this.year < 0) return null;
+ }
+ let i11 = this.findPrevious(t9, f3[r11][0], e11, f3[r11][2]);
+ if (i11 > 1) {
+ let a5 = r11 + 1;
+ for (; a5 < f3.length; ) {
+ let o13 = f3[a5][0], h8 = f3[a5][2], l6 = this.getMaxPatternValue(o13, e11, h8);
+ this[o13] = l6, a5++;
+ }
+ if (i11 === 3) {
+ if (this[f3[r11][1]]--, r11 === 0) {
+ let y4 = this.getLastDayOfMonth(this.year, this.month);
+ this.day > y4 && (this.day = y4);
+ }
+ if (r11 === 1) if (this.day <= 0) this.day = 1;
+ else {
+ let y4 = this.year, u7 = this.month;
+ for (; u7 < 0; ) u7 += 12, y4--;
+ for (; u7 > 11; ) u7 -= 12, y4++;
+ let d5 = u7 !== 1 ? P2[u7] : new Date(Date.UTC(y4, u7 + 1, 0)).getUTCDate();
+ this.day > d5 && (this.day = d5);
+ }
+ this.apply();
+ let o13 = f3[r11][0], h8 = f3[r11][2], l6 = this.getMaxPatternValue(o13, e11, h8);
+ if (o13 === "day") {
+ let y4 = this.getLastDayOfMonth(this.year, this.month);
+ this[o13] = Math.min(l6, y4);
+ } else this[o13] = l6;
+ if (this.apply(), r11 === 0) {
+ let y4 = f3[1][2], u7 = this.getMaxPatternValue("day", e11, y4), d5 = this.getLastDayOfMonth(this.year, this.month), c11 = Math.min(u7, d5);
+ c11 !== this.day && (this.day = c11, this.hour = this.getMaxPatternValue("hour", e11, f3[2][2]), this.minute = this.getMaxPatternValue("minute", e11, f3[3][2]), this.second = this.getMaxPatternValue("second", e11, f3[4][2]));
+ }
+ if (r11 === 0 && !e11.starYear) {
+ for (; this.year >= 0 && this.year < e11.year.length && e11.year[this.year] === 0; ) this.year--;
+ if (this.year < 0) return null;
+ }
+ return this.recurseBackward(e11, t9, 0, n12 + 1);
+ } else if (this.apply()) return this.recurseBackward(e11, t9, r11 - 1, n12 + 1);
+ }
+ return r11 += 1, r11 >= f3.length ? this : this.year < 0 ? null : this.recurseBackward(e11, t9, r11, n12 + 1);
+ }
+ getMaxPatternValue(e11, t9, r11) {
+ if (e11 === "day" && t9.lastDayOfMonth) return this.getLastDayOfMonth(this.year, this.month);
+ if (e11 === "day" && !t9.starDOW) return this.getLastDayOfMonth(this.year, this.month);
+ for (let n12 = t9[e11].length - 1; n12 >= 0; n12--) if (t9[e11][n12]) return n12 - r11;
+ return t9[e11].length - 1 - r11;
+ }
+ findPrevious(e11, t9, r11, n12) {
+ return this._findMatch(e11, t9, r11, n12, -1);
+ }
+ getDate(e11) {
+ return e11 || this.tz === void 0 ? new Date(this.year, this.month, this.day, this.hour, this.minute, this.second, this.ms) : typeof this.tz == "number" ? new Date(Date.UTC(this.year, this.month, this.day, this.hour, this.minute - this.tz, this.second, this.ms)) : k2(b3(this.year, this.month + 1, this.day, this.hour, this.minute, this.second, this.tz), false);
+ }
+ getTime() {
+ return this.getDate(false).getTime();
+ }
+ match(e11, t9) {
+ if (!e11.starYear && (this.year < 0 || this.year >= e11.year.length || e11.year[this.year] === 0)) return false;
+ for (let r11 = 0; r11 < f3.length; r11++) {
+ let n12 = f3[r11][0], i11 = f3[r11][2], a5 = this[n12];
+ if (a5 + i11 < 0 || a5 + i11 >= e11[n12].length) return false;
+ let o13 = e11[n12][a5 + i11];
+ if (n12 === "day") {
+ if (!o13) {
+ for (let h8 = 0; h8 < e11.nearestWeekdays.length; h8++) if (e11.nearestWeekdays[h8]) {
+ let l6 = this.getNearestWeekday(this.year, this.month, h8 - i11);
+ if (l6 !== -1 && l6 === a5) {
+ o13 = 1;
+ break;
+ }
+ }
+ }
+ if (e11.lastWeekday) {
+ let h8 = this.getLastWeekday(this.year, this.month);
+ a5 === h8 && (o13 = 1);
+ }
+ if (e11.lastDayOfMonth) {
+ let h8 = this.getLastDayOfMonth(this.year, this.month);
+ a5 === h8 && (o13 = 1);
+ }
+ if (!e11.starDOW) {
+ let h8 = new Date(Date.UTC(this.year, this.month, 1, 0, 0, 0, 0)).getUTCDay(), l6 = e11.dayOfWeek[(h8 + (a5 - 1)) % 7];
+ l6 && l6 & 63 && (l6 = this.isNthWeekdayOfMonth(this.year, this.month, a5, l6) ? 1 : 0), e11.useAndLogic ? o13 = o13 && l6 : !t9.domAndDow && !e11.starDOM ? o13 = o13 || l6 : o13 = o13 && l6;
+ }
+ }
+ if (!o13) return false;
+ }
+ return true;
+ }
+ };
+ W = 30 * 1e3, w2 = [], E2 = class {
+ name;
+ options;
+ _states;
+ fn;
+ getTz() {
+ return this.options.timezone || this.options.utcOffset;
+ }
+ applyDayOffset(e11) {
+ if (this.options.dayOffset !== void 0 && this.options.dayOffset !== 0) {
+ let t9 = this.options.dayOffset * 24 * 60 * 60 * 1e3;
+ return new Date(e11.getTime() + t9);
+ }
+ return e11;
+ }
+ constructor(e11, t9, r11) {
+ let n12, i11;
+ if (p3(t9)) i11 = t9;
+ else if (typeof t9 == "object") n12 = t9;
+ else if (t9 !== void 0) throw new Error("Cron: Invalid argument passed for optionsIn. Should be one of function, or object (options).");
+ if (p3(r11)) i11 = r11;
+ else if (typeof r11 == "object") n12 = r11;
+ else if (r11 !== void 0) throw new Error("Cron: Invalid argument passed for funcIn. Should be one of function, or object (options).");
+ if (this.name = n12?.name, this.options = R2(n12), this._states = { kill: false, blocking: false, previousRun: void 0, currentRun: void 0, once: void 0, currentTimeout: void 0, maxRuns: n12 ? n12.maxRuns : void 0, paused: n12 ? n12.paused : false, pattern: new C2("* * * * *", void 0, { mode: "auto" }) }, e11 && (e11 instanceof Date || typeof e11 == "string" && e11.indexOf(":") > 0) ? this._states.once = new m2(e11, this.getTz()) : this._states.pattern = new C2(e11, this.options.timezone, { mode: this.options.mode, alternativeWeekdays: this.options.alternativeWeekdays, sloppyRanges: this.options.sloppyRanges }), this.name) {
+ if (w2.find((o13) => o13.name === this.name)) throw new Error("Cron: Tried to initialize new named job '" + this.name + "', but name already taken.");
+ w2.push(this);
+ }
+ return i11 !== void 0 && _2(i11) && (this.fn = i11, this.schedule()), this;
+ }
+ nextRun(e11) {
+ let t9 = this._next(e11);
+ return t9 ? this.applyDayOffset(t9.getDate(false)) : null;
+ }
+ nextRuns(e11, t9) {
+ this._states.maxRuns !== void 0 && e11 > this._states.maxRuns && (e11 = this._states.maxRuns);
+ let r11 = t9 || this._states.currentRun || void 0;
+ return this._enumerateRuns(e11, r11, "next");
+ }
+ previousRuns(e11, t9) {
+ return this._enumerateRuns(e11, t9 || void 0, "previous");
+ }
+ _enumerateRuns(e11, t9, r11) {
+ let n12 = [], i11 = t9 ? new m2(t9, this.getTz()) : null, a5 = r11 === "next" ? this._next : this._previous;
+ for (; e11--; ) {
+ let o13 = a5.call(this, i11);
+ if (!o13) break;
+ let h8 = o13.getDate(false);
+ n12.push(this.applyDayOffset(h8)), i11 = o13;
+ }
+ return n12;
+ }
+ match(e11) {
+ if (this._states.once) {
+ let r11 = new m2(e11, this.getTz());
+ r11.ms = 0;
+ let n12 = new m2(this._states.once, this.getTz());
+ return n12.ms = 0, r11.getTime() === n12.getTime();
+ }
+ let t9 = new m2(e11, this.getTz());
+ return t9.ms = 0, t9.match(this._states.pattern, this.options);
+ }
+ getPattern() {
+ if (!this._states.once) return this._states.pattern ? this._states.pattern.pattern : void 0;
+ }
+ getOnce() {
+ return this._states.once ? this._states.once.getDate() : null;
+ }
+ isRunning() {
+ let e11 = this.nextRun(this._states.currentRun), t9 = !this._states.paused, r11 = this.fn !== void 0, n12 = !this._states.kill;
+ return t9 && r11 && n12 && e11 !== null;
+ }
+ isStopped() {
+ return this._states.kill;
+ }
+ isBusy() {
+ return this._states.blocking;
+ }
+ currentRun() {
+ return this._states.currentRun ? this._states.currentRun.getDate() : null;
+ }
+ previousRun() {
+ return this._states.previousRun ? this._states.previousRun.getDate() : null;
+ }
+ msToNext(e11) {
+ let t9 = this._next(e11);
+ return t9 ? e11 instanceof m2 || e11 instanceof Date ? t9.getTime() - e11.getTime() : t9.getTime() - new m2(e11).getTime() : null;
+ }
+ stop() {
+ this._states.kill = true, this._states.currentTimeout && clearTimeout(this._states.currentTimeout);
+ let e11 = w2.indexOf(this);
+ e11 >= 0 && w2.splice(e11, 1);
+ }
+ pause() {
+ return this._states.paused = true, !this._states.kill;
+ }
+ resume() {
+ return this._states.paused = false, !this._states.kill;
+ }
+ schedule(e11) {
+ if (e11 && this.fn) throw new Error("Cron: It is not allowed to schedule two functions using the same Croner instance.");
+ e11 && (this.fn = e11);
+ let t9 = this.msToNext(), r11 = this.nextRun(this._states.currentRun);
+ return t9 == null || isNaN(t9) || r11 === null ? this : (t9 > W && (t9 = W), this._states.currentTimeout = setTimeout(() => this._checkTrigger(r11), t9), this._states.currentTimeout && this.options.unref && x2(this._states.currentTimeout), this);
+ }
+ async _trigger(e11) {
+ this._states.blocking = true, this._states.currentRun = new m2(void 0, this.getTz());
+ try {
+ if (this.options.catch) try {
+ this.fn !== void 0 && await this.fn(this, this.options.context);
+ } catch (t9) {
+ if (p3(this.options.catch)) try {
+ this.options.catch(t9, this);
+ } catch {
+ }
+ }
+ else this.fn !== void 0 && await this.fn(this, this.options.context);
+ } finally {
+ this._states.previousRun = new m2(e11, this.getTz()), this._states.blocking = false;
+ }
+ }
+ async trigger() {
+ await this._trigger();
+ }
+ runsLeft() {
+ return this._states.maxRuns;
+ }
+ _checkTrigger(e11) {
+ let t9 = /* @__PURE__ */ new Date(), r11 = !this._states.paused && t9.getTime() >= e11.getTime(), n12 = this._states.blocking && this.options.protect;
+ r11 && !n12 ? (this._states.maxRuns !== void 0 && this._states.maxRuns--, this._trigger()) : r11 && n12 && p3(this.options.protect) && setTimeout(() => this.options.protect(this), 0), this.schedule();
+ }
+ _next(e11) {
+ let t9 = !!(e11 || this._states.currentRun), r11 = false;
+ !e11 && this.options.startAt && this.options.interval && ([e11, t9] = this._calculatePreviousRun(e11, t9), r11 = !e11), e11 = new m2(e11, this.getTz()), this.options.startAt && e11 && e11.getTime() < this.options.startAt.getTime() && (e11 = this.options.startAt);
+ let n12 = this._states.once || new m2(e11, this.getTz());
+ return !r11 && n12 !== this._states.once && (n12 = n12.increment(this._states.pattern, this.options, t9)), this._states.once && this._states.once.getTime() <= e11.getTime() || n12 === null || this._states.maxRuns !== void 0 && this._states.maxRuns <= 0 || this._states.kill || this.options.stopAt && n12.getTime() >= this.options.stopAt.getTime() ? null : n12;
+ }
+ _previous(e11) {
+ let t9 = new m2(e11, this.getTz());
+ this.options.stopAt && t9.getTime() > this.options.stopAt.getTime() && (t9 = this.options.stopAt);
+ let r11 = new m2(t9, this.getTz());
+ return this._states.once ? this._states.once.getTime() < t9.getTime() ? this._states.once : null : (r11 = r11.decrement(this._states.pattern, this.options), r11 === null || this.options.startAt && r11.getTime() < this.options.startAt.getTime() ? null : r11);
+ }
+ _calculatePreviousRun(e11, t9) {
+ let r11 = new m2(void 0, this.getTz()), n12 = e11;
+ if (this.options.startAt.getTime() <= r11.getTime()) {
+ n12 = this.options.startAt;
+ let i11 = n12.getTime() + this.options.interval * 1e3;
+ for (; i11 <= r11.getTime(); ) n12 = new m2(n12, this.getTz()).increment(this._states.pattern, this.options, true), i11 = n12.getTime() + this.options.interval * 1e3;
+ t9 = true;
+ }
+ return n12 === null && (n12 = void 0), [n12, t9];
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/constants.js
+var daysInWeek, daysInYear, maxTime, minTime, millisecondsInWeek, millisecondsInDay, millisecondsInMinute, millisecondsInHour, millisecondsInSecond, minutesInYear, minutesInMonth, minutesInDay, minutesInHour, monthsInQuarter, monthsInYear, quartersInYear, secondsInHour, secondsInMinute, secondsInDay, secondsInWeek, secondsInYear, secondsInMonth, secondsInQuarter, constructFromSymbol;
+var init_constants = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/constants.js"() {
+ daysInWeek = 7;
+ daysInYear = 365.2425;
+ maxTime = Math.pow(10, 8) * 24 * 60 * 60 * 1e3;
+ minTime = -maxTime;
+ millisecondsInWeek = 6048e5;
+ millisecondsInDay = 864e5;
+ millisecondsInMinute = 6e4;
+ millisecondsInHour = 36e5;
+ millisecondsInSecond = 1e3;
+ minutesInYear = 525600;
+ minutesInMonth = 43200;
+ minutesInDay = 1440;
+ minutesInHour = 60;
+ monthsInQuarter = 3;
+ monthsInYear = 12;
+ quartersInYear = 4;
+ secondsInHour = 3600;
+ secondsInMinute = 60;
+ secondsInDay = secondsInHour * 24;
+ secondsInWeek = secondsInDay * 7;
+ secondsInYear = secondsInDay * daysInYear;
+ secondsInMonth = secondsInYear / 12;
+ secondsInQuarter = secondsInMonth * 3;
+ constructFromSymbol = /* @__PURE__ */ Symbol.for("constructDateFrom");
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/constructFrom.js
+function constructFrom(date, value2) {
+ if (typeof date === "function") return date(value2);
+ if (date && typeof date === "object" && constructFromSymbol in date)
+ return date[constructFromSymbol](value2);
+ if (date instanceof Date) return new date.constructor(value2);
+ return new Date(value2);
+}
+var constructFrom_default;
+var init_constructFrom = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/constructFrom.js"() {
+ init_constants();
+ constructFrom_default = constructFrom;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/toDate.js
+function toDate(argument, context2) {
+ return constructFrom(context2 || argument, argument);
+}
+var toDate_default;
+var init_toDate = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/toDate.js"() {
+ init_constructFrom();
+ toDate_default = toDate;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addDays.js
+function addDays(date, amount, options) {
+ const _date = toDate(date, options?.in);
+ if (isNaN(amount)) return constructFrom(options?.in || date, NaN);
+ if (!amount) return _date;
+ _date.setDate(_date.getDate() + amount);
+ return _date;
+}
+var addDays_default;
+var init_addDays = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addDays.js"() {
+ init_constructFrom();
+ init_toDate();
+ addDays_default = addDays;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addMonths.js
+function addMonths(date, amount, options) {
+ const _date = toDate(date, options?.in);
+ if (isNaN(amount)) return constructFrom(options?.in || date, NaN);
+ if (!amount) {
+ return _date;
+ }
+ const dayOfMonth = _date.getDate();
+ const endOfDesiredMonth = constructFrom(options?.in || date, _date.getTime());
+ endOfDesiredMonth.setMonth(_date.getMonth() + amount + 1, 0);
+ const daysInMonth = endOfDesiredMonth.getDate();
+ if (dayOfMonth >= daysInMonth) {
+ return endOfDesiredMonth;
+ } else {
+ _date.setFullYear(
+ endOfDesiredMonth.getFullYear(),
+ endOfDesiredMonth.getMonth(),
+ dayOfMonth
+ );
+ return _date;
+ }
+}
+var addMonths_default;
+var init_addMonths = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addMonths.js"() {
+ init_constructFrom();
+ init_toDate();
+ addMonths_default = addMonths;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/add.js
+function add(date, duration, options) {
+ const {
+ years = 0,
+ months: months2 = 0,
+ weeks = 0,
+ days: days2 = 0,
+ hours = 0,
+ minutes = 0,
+ seconds = 0
+ } = duration;
+ const _date = toDate(date, options?.in);
+ const dateWithMonths = months2 || years ? addMonths(_date, months2 + years * 12) : _date;
+ const dateWithDays = days2 || weeks ? addDays(dateWithMonths, days2 + weeks * 7) : dateWithMonths;
+ const minutesToAdd = minutes + hours * 60;
+ const secondsToAdd = seconds + minutesToAdd * 60;
+ const msToAdd = secondsToAdd * 1e3;
+ return constructFrom(options?.in || date, +dateWithDays + msToAdd);
+}
+var add_default;
+var init_add = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/add.js"() {
+ init_addDays();
+ init_addMonths();
+ init_constructFrom();
+ init_toDate();
+ add_default = add;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSaturday.js
+function isSaturday(date, options) {
+ return toDate(date, options?.in).getDay() === 6;
+}
+var isSaturday_default;
+var init_isSaturday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSaturday.js"() {
+ init_toDate();
+ isSaturday_default = isSaturday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSunday.js
+function isSunday(date, options) {
+ return toDate(date, options?.in).getDay() === 0;
+}
+var isSunday_default;
+var init_isSunday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSunday.js"() {
+ init_toDate();
+ isSunday_default = isSunday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isWeekend.js
+function isWeekend(date, options) {
+ const day = toDate(date, options?.in).getDay();
+ return day === 0 || day === 6;
+}
+var isWeekend_default;
+var init_isWeekend = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isWeekend.js"() {
+ init_toDate();
+ isWeekend_default = isWeekend;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addBusinessDays.js
+function addBusinessDays(date, amount, options) {
+ const _date = toDate(date, options?.in);
+ const startedOnWeekend = isWeekend(_date, options);
+ if (isNaN(amount)) return constructFrom(options?.in, NaN);
+ const hours = _date.getHours();
+ const sign = amount < 0 ? -1 : 1;
+ const fullWeeks = Math.trunc(amount / 5);
+ _date.setDate(_date.getDate() + fullWeeks * 7);
+ let restDays = Math.abs(amount % 5);
+ while (restDays > 0) {
+ _date.setDate(_date.getDate() + sign);
+ if (!isWeekend(_date, options)) restDays -= 1;
+ }
+ if (startedOnWeekend && isWeekend(_date, options) && amount !== 0) {
+ if (isSaturday(_date, options))
+ _date.setDate(_date.getDate() + (sign < 0 ? 2 : -1));
+ if (isSunday(_date, options))
+ _date.setDate(_date.getDate() + (sign < 0 ? 1 : -2));
+ }
+ _date.setHours(hours);
+ return _date;
+}
+var addBusinessDays_default;
+var init_addBusinessDays = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addBusinessDays.js"() {
+ init_constructFrom();
+ init_isSaturday();
+ init_isSunday();
+ init_isWeekend();
+ init_toDate();
+ addBusinessDays_default = addBusinessDays;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addMilliseconds.js
+function addMilliseconds(date, amount, options) {
+ return constructFrom(options?.in || date, +toDate(date) + amount);
+}
+var addMilliseconds_default;
+var init_addMilliseconds = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addMilliseconds.js"() {
+ init_constructFrom();
+ init_toDate();
+ addMilliseconds_default = addMilliseconds;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addHours.js
+function addHours(date, amount, options) {
+ return addMilliseconds(date, amount * millisecondsInHour, options);
+}
+var addHours_default;
+var init_addHours = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addHours.js"() {
+ init_addMilliseconds();
+ init_constants();
+ addHours_default = addHours;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/defaultOptions.js
+function getDefaultOptions() {
+ return defaultOptions;
+}
+function setDefaultOptions(newOptions) {
+ defaultOptions = newOptions;
+}
+var defaultOptions;
+var init_defaultOptions = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/defaultOptions.js"() {
+ defaultOptions = {};
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfWeek.js
+function startOfWeek(date, options) {
+ const defaultOptions2 = getDefaultOptions();
+ const weekStartsOn = options?.weekStartsOn ?? options?.locale?.options?.weekStartsOn ?? defaultOptions2.weekStartsOn ?? defaultOptions2.locale?.options?.weekStartsOn ?? 0;
+ const _date = toDate(date, options?.in);
+ const day = _date.getDay();
+ const diff = (day < weekStartsOn ? 7 : 0) + day - weekStartsOn;
+ _date.setDate(_date.getDate() - diff);
+ _date.setHours(0, 0, 0, 0);
+ return _date;
+}
+var startOfWeek_default;
+var init_startOfWeek = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfWeek.js"() {
+ init_defaultOptions();
+ init_toDate();
+ startOfWeek_default = startOfWeek;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfISOWeek.js
+function startOfISOWeek(date, options) {
+ return startOfWeek(date, { ...options, weekStartsOn: 1 });
+}
+var startOfISOWeek_default;
+var init_startOfISOWeek = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfISOWeek.js"() {
+ init_startOfWeek();
+ startOfISOWeek_default = startOfISOWeek;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getISOWeekYear.js
+function getISOWeekYear(date, options) {
+ const _date = toDate(date, options?.in);
+ const year = _date.getFullYear();
+ const fourthOfJanuaryOfNextYear = constructFrom(_date, 0);
+ fourthOfJanuaryOfNextYear.setFullYear(year + 1, 0, 4);
+ fourthOfJanuaryOfNextYear.setHours(0, 0, 0, 0);
+ const startOfNextYear = startOfISOWeek(fourthOfJanuaryOfNextYear);
+ const fourthOfJanuaryOfThisYear = constructFrom(_date, 0);
+ fourthOfJanuaryOfThisYear.setFullYear(year, 0, 4);
+ fourthOfJanuaryOfThisYear.setHours(0, 0, 0, 0);
+ const startOfThisYear = startOfISOWeek(fourthOfJanuaryOfThisYear);
+ if (_date.getTime() >= startOfNextYear.getTime()) {
+ return year + 1;
+ } else if (_date.getTime() >= startOfThisYear.getTime()) {
+ return year;
+ } else {
+ return year - 1;
+ }
+}
+var getISOWeekYear_default;
+var init_getISOWeekYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getISOWeekYear.js"() {
+ init_constructFrom();
+ init_startOfISOWeek();
+ init_toDate();
+ getISOWeekYear_default = getISOWeekYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/getTimezoneOffsetInMilliseconds.js
+function getTimezoneOffsetInMilliseconds(date) {
+ const _date = toDate(date);
+ const utcDate = new Date(
+ Date.UTC(
+ _date.getFullYear(),
+ _date.getMonth(),
+ _date.getDate(),
+ _date.getHours(),
+ _date.getMinutes(),
+ _date.getSeconds(),
+ _date.getMilliseconds()
+ )
+ );
+ utcDate.setUTCFullYear(_date.getFullYear());
+ return +date - +utcDate;
+}
+var init_getTimezoneOffsetInMilliseconds = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/getTimezoneOffsetInMilliseconds.js"() {
+ init_toDate();
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/normalizeDates.js
+function normalizeDates(context2, ...dates) {
+ const normalize4 = constructFrom.bind(
+ null,
+ context2 || dates.find((date) => typeof date === "object")
+ );
+ return dates.map(normalize4);
+}
+var init_normalizeDates = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/normalizeDates.js"() {
+ init_constructFrom();
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfDay.js
+function startOfDay(date, options) {
+ const _date = toDate(date, options?.in);
+ _date.setHours(0, 0, 0, 0);
+ return _date;
+}
+var startOfDay_default;
+var init_startOfDay = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfDay.js"() {
+ init_toDate();
+ startOfDay_default = startOfDay;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInCalendarDays.js
+function differenceInCalendarDays(laterDate, earlierDate, options) {
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ const laterStartOfDay = startOfDay(laterDate_);
+ const earlierStartOfDay = startOfDay(earlierDate_);
+ const laterTimestamp = +laterStartOfDay - getTimezoneOffsetInMilliseconds(laterStartOfDay);
+ const earlierTimestamp = +earlierStartOfDay - getTimezoneOffsetInMilliseconds(earlierStartOfDay);
+ return Math.round((laterTimestamp - earlierTimestamp) / millisecondsInDay);
+}
+var differenceInCalendarDays_default;
+var init_differenceInCalendarDays = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInCalendarDays.js"() {
+ init_getTimezoneOffsetInMilliseconds();
+ init_normalizeDates();
+ init_constants();
+ init_startOfDay();
+ differenceInCalendarDays_default = differenceInCalendarDays;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfISOWeekYear.js
+function startOfISOWeekYear(date, options) {
+ const year = getISOWeekYear(date, options);
+ const fourthOfJanuary = constructFrom(options?.in || date, 0);
+ fourthOfJanuary.setFullYear(year, 0, 4);
+ fourthOfJanuary.setHours(0, 0, 0, 0);
+ return startOfISOWeek(fourthOfJanuary);
+}
+var startOfISOWeekYear_default;
+var init_startOfISOWeekYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfISOWeekYear.js"() {
+ init_constructFrom();
+ init_getISOWeekYear();
+ init_startOfISOWeek();
+ startOfISOWeekYear_default = startOfISOWeekYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setISOWeekYear.js
+function setISOWeekYear(date, weekYear, options) {
+ let _date = toDate(date, options?.in);
+ const diff = differenceInCalendarDays(
+ _date,
+ startOfISOWeekYear(_date, options)
+ );
+ const fourthOfJanuary = constructFrom(options?.in || date, 0);
+ fourthOfJanuary.setFullYear(weekYear, 0, 4);
+ fourthOfJanuary.setHours(0, 0, 0, 0);
+ _date = startOfISOWeekYear(fourthOfJanuary);
+ _date.setDate(_date.getDate() + diff);
+ return _date;
+}
+var setISOWeekYear_default;
+var init_setISOWeekYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setISOWeekYear.js"() {
+ init_constructFrom();
+ init_differenceInCalendarDays();
+ init_startOfISOWeekYear();
+ init_toDate();
+ setISOWeekYear_default = setISOWeekYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addISOWeekYears.js
+function addISOWeekYears(date, amount, options) {
+ return setISOWeekYear(date, getISOWeekYear(date, options) + amount, options);
+}
+var addISOWeekYears_default;
+var init_addISOWeekYears = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addISOWeekYears.js"() {
+ init_getISOWeekYear();
+ init_setISOWeekYear();
+ addISOWeekYears_default = addISOWeekYears;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addMinutes.js
+function addMinutes(date, amount, options) {
+ const _date = toDate(date, options?.in);
+ _date.setTime(_date.getTime() + amount * millisecondsInMinute);
+ return _date;
+}
+var addMinutes_default;
+var init_addMinutes = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addMinutes.js"() {
+ init_constants();
+ init_toDate();
+ addMinutes_default = addMinutes;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addQuarters.js
+function addQuarters(date, amount, options) {
+ return addMonths(date, amount * 3, options);
+}
+var addQuarters_default;
+var init_addQuarters = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addQuarters.js"() {
+ init_addMonths();
+ addQuarters_default = addQuarters;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addSeconds.js
+function addSeconds(date, amount, options) {
+ return addMilliseconds(date, amount * 1e3, options);
+}
+var addSeconds_default;
+var init_addSeconds = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addSeconds.js"() {
+ init_addMilliseconds();
+ addSeconds_default = addSeconds;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addWeeks.js
+function addWeeks(date, amount, options) {
+ return addDays(date, amount * 7, options);
+}
+var addWeeks_default;
+var init_addWeeks = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addWeeks.js"() {
+ init_addDays();
+ addWeeks_default = addWeeks;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addYears.js
+function addYears(date, amount, options) {
+ return addMonths(date, amount * 12, options);
+}
+var addYears_default;
+var init_addYears = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/addYears.js"() {
+ init_addMonths();
+ addYears_default = addYears;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/areIntervalsOverlapping.js
+function areIntervalsOverlapping(intervalLeft, intervalRight, options) {
+ const [leftStartTime, leftEndTime] = [
+ +toDate(intervalLeft.start, options?.in),
+ +toDate(intervalLeft.end, options?.in)
+ ].sort((a5, b5) => a5 - b5);
+ const [rightStartTime, rightEndTime] = [
+ +toDate(intervalRight.start, options?.in),
+ +toDate(intervalRight.end, options?.in)
+ ].sort((a5, b5) => a5 - b5);
+ if (options?.inclusive)
+ return leftStartTime <= rightEndTime && rightStartTime <= leftEndTime;
+ return leftStartTime < rightEndTime && rightStartTime < leftEndTime;
+}
+var areIntervalsOverlapping_default;
+var init_areIntervalsOverlapping = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/areIntervalsOverlapping.js"() {
+ init_toDate();
+ areIntervalsOverlapping_default = areIntervalsOverlapping;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/max.js
+function max2(dates, options) {
+ let result;
+ let context2 = options?.in;
+ dates.forEach((date) => {
+ if (!context2 && typeof date === "object")
+ context2 = constructFrom.bind(null, date);
+ const date_ = toDate(date, context2);
+ if (!result || result < date_ || isNaN(+date_)) result = date_;
+ });
+ return constructFrom(context2, result || NaN);
+}
+var max_default;
+var init_max2 = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/max.js"() {
+ init_constructFrom();
+ init_toDate();
+ max_default = max2;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/min.js
+function min2(dates, options) {
+ let result;
+ let context2 = options?.in;
+ dates.forEach((date) => {
+ if (!context2 && typeof date === "object")
+ context2 = constructFrom.bind(null, date);
+ const date_ = toDate(date, context2);
+ if (!result || result > date_ || isNaN(+date_)) result = date_;
+ });
+ return constructFrom(context2, result || NaN);
+}
+var min_default;
+var init_min2 = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/min.js"() {
+ init_constructFrom();
+ init_toDate();
+ min_default = min2;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/clamp.js
+function clamp(date, interval3, options) {
+ const [date_, start, end3] = normalizeDates(
+ options?.in,
+ date,
+ interval3.start,
+ interval3.end
+ );
+ return min2([max2([date_, start], options), end3], options);
+}
+var clamp_default;
+var init_clamp = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/clamp.js"() {
+ init_normalizeDates();
+ init_max2();
+ init_min2();
+ clamp_default = clamp;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/closestIndexTo.js
+function closestIndexTo(dateToCompare, dates) {
+ const timeToCompare = +toDate(dateToCompare);
+ if (isNaN(timeToCompare)) return NaN;
+ let result;
+ let minDistance;
+ dates.forEach((date, index2) => {
+ const date_ = toDate(date);
+ if (isNaN(+date_)) {
+ result = NaN;
+ minDistance = NaN;
+ return;
+ }
+ const distance = Math.abs(timeToCompare - +date_);
+ if (result == null || distance < minDistance) {
+ result = index2;
+ minDistance = distance;
+ }
+ });
+ return result;
+}
+var closestIndexTo_default;
+var init_closestIndexTo = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/closestIndexTo.js"() {
+ init_toDate();
+ closestIndexTo_default = closestIndexTo;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/closestTo.js
+function closestTo(dateToCompare, dates, options) {
+ const [dateToCompare_, ...dates_] = normalizeDates(
+ options?.in,
+ dateToCompare,
+ ...dates
+ );
+ const index2 = closestIndexTo(dateToCompare_, dates_);
+ if (typeof index2 === "number" && isNaN(index2))
+ return constructFrom(dateToCompare_, NaN);
+ if (index2 !== void 0) return dates_[index2];
+}
+var closestTo_default;
+var init_closestTo = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/closestTo.js"() {
+ init_normalizeDates();
+ init_closestIndexTo();
+ init_constructFrom();
+ closestTo_default = closestTo;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/compareAsc.js
+function compareAsc(dateLeft, dateRight) {
+ const diff = +toDate(dateLeft) - +toDate(dateRight);
+ if (diff < 0) return -1;
+ else if (diff > 0) return 1;
+ return diff;
+}
+var compareAsc_default;
+var init_compareAsc = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/compareAsc.js"() {
+ init_toDate();
+ compareAsc_default = compareAsc;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/compareDesc.js
+function compareDesc(dateLeft, dateRight) {
+ const diff = +toDate(dateLeft) - +toDate(dateRight);
+ if (diff > 0) return -1;
+ else if (diff < 0) return 1;
+ return diff;
+}
+var compareDesc_default;
+var init_compareDesc = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/compareDesc.js"() {
+ init_toDate();
+ compareDesc_default = compareDesc;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/constructNow.js
+function constructNow(date) {
+ return constructFrom(date, Date.now());
+}
+var constructNow_default;
+var init_constructNow = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/constructNow.js"() {
+ init_constructFrom();
+ constructNow_default = constructNow;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/daysToWeeks.js
+function daysToWeeks(days2) {
+ const result = Math.trunc(days2 / daysInWeek);
+ return result === 0 ? 0 : result;
+}
+var daysToWeeks_default;
+var init_daysToWeeks = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/daysToWeeks.js"() {
+ init_constants();
+ daysToWeeks_default = daysToWeeks;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameDay.js
+function isSameDay(laterDate, earlierDate, options) {
+ const [dateLeft_, dateRight_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ return +startOfDay(dateLeft_) === +startOfDay(dateRight_);
+}
+var isSameDay_default;
+var init_isSameDay = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameDay.js"() {
+ init_normalizeDates();
+ init_startOfDay();
+ isSameDay_default = isSameDay;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isDate.js
+function isDate(value2) {
+ return value2 instanceof Date || typeof value2 === "object" && Object.prototype.toString.call(value2) === "[object Date]";
+}
+var isDate_default;
+var init_isDate2 = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isDate.js"() {
+ isDate_default = isDate;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isValid.js
+function isValid(date) {
+ return !(!isDate(date) && typeof date !== "number" || isNaN(+toDate(date)));
+}
+var isValid_default;
+var init_isValid = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isValid.js"() {
+ init_isDate2();
+ init_toDate();
+ isValid_default = isValid;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInBusinessDays.js
+function differenceInBusinessDays(laterDate, earlierDate, options) {
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ if (!isValid(laterDate_) || !isValid(earlierDate_)) return NaN;
+ const diff = differenceInCalendarDays(laterDate_, earlierDate_);
+ const sign = diff < 0 ? -1 : 1;
+ const weeks = Math.trunc(diff / 7);
+ let result = weeks * 5;
+ let movingDate = addDays(earlierDate_, weeks * 7);
+ while (!isSameDay(laterDate_, movingDate)) {
+ result += isWeekend(movingDate, options) ? 0 : sign;
+ movingDate = addDays(movingDate, sign);
+ }
+ return result === 0 ? 0 : result;
+}
+var differenceInBusinessDays_default;
+var init_differenceInBusinessDays = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInBusinessDays.js"() {
+ init_normalizeDates();
+ init_addDays();
+ init_differenceInCalendarDays();
+ init_isSameDay();
+ init_isValid();
+ init_isWeekend();
+ differenceInBusinessDays_default = differenceInBusinessDays;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInCalendarISOWeekYears.js
+function differenceInCalendarISOWeekYears(laterDate, earlierDate, options) {
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ return getISOWeekYear(laterDate_, options) - getISOWeekYear(earlierDate_, options);
+}
+var differenceInCalendarISOWeekYears_default;
+var init_differenceInCalendarISOWeekYears = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInCalendarISOWeekYears.js"() {
+ init_normalizeDates();
+ init_getISOWeekYear();
+ differenceInCalendarISOWeekYears_default = differenceInCalendarISOWeekYears;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInCalendarISOWeeks.js
+function differenceInCalendarISOWeeks(laterDate, earlierDate, options) {
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ const startOfISOWeekLeft = startOfISOWeek(laterDate_);
+ const startOfISOWeekRight = startOfISOWeek(earlierDate_);
+ const timestampLeft = +startOfISOWeekLeft - getTimezoneOffsetInMilliseconds(startOfISOWeekLeft);
+ const timestampRight = +startOfISOWeekRight - getTimezoneOffsetInMilliseconds(startOfISOWeekRight);
+ return Math.round((timestampLeft - timestampRight) / millisecondsInWeek);
+}
+var differenceInCalendarISOWeeks_default;
+var init_differenceInCalendarISOWeeks = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInCalendarISOWeeks.js"() {
+ init_getTimezoneOffsetInMilliseconds();
+ init_normalizeDates();
+ init_constants();
+ init_startOfISOWeek();
+ differenceInCalendarISOWeeks_default = differenceInCalendarISOWeeks;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInCalendarMonths.js
+function differenceInCalendarMonths(laterDate, earlierDate, options) {
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ const yearsDiff = laterDate_.getFullYear() - earlierDate_.getFullYear();
+ const monthsDiff = laterDate_.getMonth() - earlierDate_.getMonth();
+ return yearsDiff * 12 + monthsDiff;
+}
+var differenceInCalendarMonths_default;
+var init_differenceInCalendarMonths = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInCalendarMonths.js"() {
+ init_normalizeDates();
+ differenceInCalendarMonths_default = differenceInCalendarMonths;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getQuarter.js
+function getQuarter(date, options) {
+ const _date = toDate(date, options?.in);
+ const quarter = Math.trunc(_date.getMonth() / 3) + 1;
+ return quarter;
+}
+var getQuarter_default;
+var init_getQuarter = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getQuarter.js"() {
+ init_toDate();
+ getQuarter_default = getQuarter;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInCalendarQuarters.js
+function differenceInCalendarQuarters(laterDate, earlierDate, options) {
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ const yearsDiff = laterDate_.getFullYear() - earlierDate_.getFullYear();
+ const quartersDiff = getQuarter(laterDate_) - getQuarter(earlierDate_);
+ return yearsDiff * 4 + quartersDiff;
+}
+var differenceInCalendarQuarters_default;
+var init_differenceInCalendarQuarters = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInCalendarQuarters.js"() {
+ init_normalizeDates();
+ init_getQuarter();
+ differenceInCalendarQuarters_default = differenceInCalendarQuarters;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInCalendarWeeks.js
+function differenceInCalendarWeeks(laterDate, earlierDate, options) {
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ const laterStartOfWeek = startOfWeek(laterDate_, options);
+ const earlierStartOfWeek = startOfWeek(earlierDate_, options);
+ const laterTimestamp = +laterStartOfWeek - getTimezoneOffsetInMilliseconds(laterStartOfWeek);
+ const earlierTimestamp = +earlierStartOfWeek - getTimezoneOffsetInMilliseconds(earlierStartOfWeek);
+ return Math.round((laterTimestamp - earlierTimestamp) / millisecondsInWeek);
+}
+var differenceInCalendarWeeks_default;
+var init_differenceInCalendarWeeks = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInCalendarWeeks.js"() {
+ init_getTimezoneOffsetInMilliseconds();
+ init_normalizeDates();
+ init_constants();
+ init_startOfWeek();
+ differenceInCalendarWeeks_default = differenceInCalendarWeeks;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInCalendarYears.js
+function differenceInCalendarYears(laterDate, earlierDate, options) {
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ return laterDate_.getFullYear() - earlierDate_.getFullYear();
+}
+var differenceInCalendarYears_default;
+var init_differenceInCalendarYears = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInCalendarYears.js"() {
+ init_normalizeDates();
+ differenceInCalendarYears_default = differenceInCalendarYears;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInDays.js
+function differenceInDays(laterDate, earlierDate, options) {
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ const sign = compareLocalAsc(laterDate_, earlierDate_);
+ const difference = Math.abs(
+ differenceInCalendarDays(laterDate_, earlierDate_)
+ );
+ laterDate_.setDate(laterDate_.getDate() - sign * difference);
+ const isLastDayNotFull = Number(
+ compareLocalAsc(laterDate_, earlierDate_) === -sign
+ );
+ const result = sign * (difference - isLastDayNotFull);
+ return result === 0 ? 0 : result;
+}
+function compareLocalAsc(laterDate, earlierDate) {
+ const diff = laterDate.getFullYear() - earlierDate.getFullYear() || laterDate.getMonth() - earlierDate.getMonth() || laterDate.getDate() - earlierDate.getDate() || laterDate.getHours() - earlierDate.getHours() || laterDate.getMinutes() - earlierDate.getMinutes() || laterDate.getSeconds() - earlierDate.getSeconds() || laterDate.getMilliseconds() - earlierDate.getMilliseconds();
+ if (diff < 0) return -1;
+ if (diff > 0) return 1;
+ return diff;
+}
+var differenceInDays_default;
+var init_differenceInDays = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInDays.js"() {
+ init_normalizeDates();
+ init_differenceInCalendarDays();
+ differenceInDays_default = differenceInDays;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/getRoundingMethod.js
+function getRoundingMethod(method) {
+ return (number2) => {
+ const round = method ? Math[method] : Math.trunc;
+ const result = round(number2);
+ return result === 0 ? 0 : result;
+ };
+}
+var init_getRoundingMethod = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/getRoundingMethod.js"() {
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInHours.js
+function differenceInHours(laterDate, earlierDate, options) {
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ const diff = (+laterDate_ - +earlierDate_) / millisecondsInHour;
+ return getRoundingMethod(options?.roundingMethod)(diff);
+}
+var differenceInHours_default;
+var init_differenceInHours = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInHours.js"() {
+ init_getRoundingMethod();
+ init_normalizeDates();
+ init_constants();
+ differenceInHours_default = differenceInHours;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subISOWeekYears.js
+function subISOWeekYears(date, amount, options) {
+ return addISOWeekYears(date, -amount, options);
+}
+var subISOWeekYears_default;
+var init_subISOWeekYears = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subISOWeekYears.js"() {
+ init_addISOWeekYears();
+ subISOWeekYears_default = subISOWeekYears;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInISOWeekYears.js
+function differenceInISOWeekYears(laterDate, earlierDate, options) {
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ const sign = compareAsc(laterDate_, earlierDate_);
+ const diff = Math.abs(
+ differenceInCalendarISOWeekYears(laterDate_, earlierDate_, options)
+ );
+ const adjustedDate = subISOWeekYears(laterDate_, sign * diff, options);
+ const isLastISOWeekYearNotFull = Number(
+ compareAsc(adjustedDate, earlierDate_) === -sign
+ );
+ const result = sign * (diff - isLastISOWeekYearNotFull);
+ return result === 0 ? 0 : result;
+}
+var differenceInISOWeekYears_default;
+var init_differenceInISOWeekYears = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInISOWeekYears.js"() {
+ init_normalizeDates();
+ init_compareAsc();
+ init_differenceInCalendarISOWeekYears();
+ init_subISOWeekYears();
+ differenceInISOWeekYears_default = differenceInISOWeekYears;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInMilliseconds.js
+function differenceInMilliseconds(laterDate, earlierDate) {
+ return +toDate(laterDate) - +toDate(earlierDate);
+}
+var differenceInMilliseconds_default;
+var init_differenceInMilliseconds = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInMilliseconds.js"() {
+ init_toDate();
+ differenceInMilliseconds_default = differenceInMilliseconds;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInMinutes.js
+function differenceInMinutes(dateLeft, dateRight, options) {
+ const diff = differenceInMilliseconds(dateLeft, dateRight) / millisecondsInMinute;
+ return getRoundingMethod(options?.roundingMethod)(diff);
+}
+var differenceInMinutes_default;
+var init_differenceInMinutes = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInMinutes.js"() {
+ init_getRoundingMethod();
+ init_constants();
+ init_differenceInMilliseconds();
+ differenceInMinutes_default = differenceInMinutes;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfDay.js
+function endOfDay(date, options) {
+ const _date = toDate(date, options?.in);
+ _date.setHours(23, 59, 59, 999);
+ return _date;
+}
+var endOfDay_default;
+var init_endOfDay = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfDay.js"() {
+ init_toDate();
+ endOfDay_default = endOfDay;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfMonth.js
+function endOfMonth(date, options) {
+ const _date = toDate(date, options?.in);
+ const month = _date.getMonth();
+ _date.setFullYear(_date.getFullYear(), month + 1, 0);
+ _date.setHours(23, 59, 59, 999);
+ return _date;
+}
+var endOfMonth_default;
+var init_endOfMonth = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfMonth.js"() {
+ init_toDate();
+ endOfMonth_default = endOfMonth;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isLastDayOfMonth.js
+function isLastDayOfMonth(date, options) {
+ const _date = toDate(date, options?.in);
+ return +endOfDay(_date, options) === +endOfMonth(_date, options);
+}
+var isLastDayOfMonth_default;
+var init_isLastDayOfMonth = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isLastDayOfMonth.js"() {
+ init_endOfDay();
+ init_endOfMonth();
+ init_toDate();
+ isLastDayOfMonth_default = isLastDayOfMonth;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInMonths.js
+function differenceInMonths(laterDate, earlierDate, options) {
+ const [laterDate_, workingLaterDate, earlierDate_] = normalizeDates(
+ options?.in,
+ laterDate,
+ laterDate,
+ earlierDate
+ );
+ const sign = compareAsc(workingLaterDate, earlierDate_);
+ const difference = Math.abs(
+ differenceInCalendarMonths(workingLaterDate, earlierDate_)
+ );
+ if (difference < 1) return 0;
+ if (workingLaterDate.getMonth() === 1 && workingLaterDate.getDate() > 27)
+ workingLaterDate.setDate(30);
+ workingLaterDate.setMonth(workingLaterDate.getMonth() - sign * difference);
+ let isLastMonthNotFull = compareAsc(workingLaterDate, earlierDate_) === -sign;
+ if (isLastDayOfMonth(laterDate_) && difference === 1 && compareAsc(laterDate_, earlierDate_) === 1) {
+ isLastMonthNotFull = false;
+ }
+ const result = sign * (difference - +isLastMonthNotFull);
+ return result === 0 ? 0 : result;
+}
+var differenceInMonths_default;
+var init_differenceInMonths = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInMonths.js"() {
+ init_normalizeDates();
+ init_compareAsc();
+ init_differenceInCalendarMonths();
+ init_isLastDayOfMonth();
+ differenceInMonths_default = differenceInMonths;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInQuarters.js
+function differenceInQuarters(laterDate, earlierDate, options) {
+ const diff = differenceInMonths(laterDate, earlierDate, options) / 3;
+ return getRoundingMethod(options?.roundingMethod)(diff);
+}
+var differenceInQuarters_default;
+var init_differenceInQuarters = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInQuarters.js"() {
+ init_getRoundingMethod();
+ init_differenceInMonths();
+ differenceInQuarters_default = differenceInQuarters;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInSeconds.js
+function differenceInSeconds(laterDate, earlierDate, options) {
+ const diff = differenceInMilliseconds(laterDate, earlierDate) / 1e3;
+ return getRoundingMethod(options?.roundingMethod)(diff);
+}
+var differenceInSeconds_default;
+var init_differenceInSeconds = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInSeconds.js"() {
+ init_getRoundingMethod();
+ init_differenceInMilliseconds();
+ differenceInSeconds_default = differenceInSeconds;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInWeeks.js
+function differenceInWeeks(laterDate, earlierDate, options) {
+ const diff = differenceInDays(laterDate, earlierDate, options) / 7;
+ return getRoundingMethod(options?.roundingMethod)(diff);
+}
+var differenceInWeeks_default;
+var init_differenceInWeeks = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInWeeks.js"() {
+ init_getRoundingMethod();
+ init_differenceInDays();
+ differenceInWeeks_default = differenceInWeeks;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInYears.js
+function differenceInYears(laterDate, earlierDate, options) {
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ const sign = compareAsc(laterDate_, earlierDate_);
+ const diff = Math.abs(differenceInCalendarYears(laterDate_, earlierDate_));
+ laterDate_.setFullYear(1584);
+ earlierDate_.setFullYear(1584);
+ const partial = compareAsc(laterDate_, earlierDate_) === -sign;
+ const result = sign * (diff - +partial);
+ return result === 0 ? 0 : result;
+}
+var differenceInYears_default;
+var init_differenceInYears = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/differenceInYears.js"() {
+ init_normalizeDates();
+ init_compareAsc();
+ init_differenceInCalendarYears();
+ differenceInYears_default = differenceInYears;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/normalizeInterval.js
+function normalizeInterval(context2, interval3) {
+ const [start, end3] = normalizeDates(context2, interval3.start, interval3.end);
+ return { start, end: end3 };
+}
+var init_normalizeInterval = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/normalizeInterval.js"() {
+ init_normalizeDates();
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachDayOfInterval.js
+function eachDayOfInterval(interval3, options) {
+ const { start, end: end3 } = normalizeInterval(options?.in, interval3);
+ let reversed = +start > +end3;
+ const endTime = reversed ? +start : +end3;
+ const date = reversed ? end3 : start;
+ date.setHours(0, 0, 0, 0);
+ let step = options?.step ?? 1;
+ if (!step) return [];
+ if (step < 0) {
+ step = -step;
+ reversed = !reversed;
+ }
+ const dates = [];
+ while (+date <= endTime) {
+ dates.push(constructFrom(start, date));
+ date.setDate(date.getDate() + step);
+ date.setHours(0, 0, 0, 0);
+ }
+ return reversed ? dates.reverse() : dates;
+}
+var eachDayOfInterval_default;
+var init_eachDayOfInterval = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachDayOfInterval.js"() {
+ init_normalizeInterval();
+ init_constructFrom();
+ eachDayOfInterval_default = eachDayOfInterval;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachHourOfInterval.js
+function eachHourOfInterval(interval3, options) {
+ const { start, end: end3 } = normalizeInterval(options?.in, interval3);
+ let reversed = +start > +end3;
+ const endTime = reversed ? +start : +end3;
+ const date = reversed ? end3 : start;
+ date.setMinutes(0, 0, 0);
+ let step = options?.step ?? 1;
+ if (!step) return [];
+ if (step < 0) {
+ step = -step;
+ reversed = !reversed;
+ }
+ const dates = [];
+ while (+date <= endTime) {
+ dates.push(constructFrom(start, date));
+ date.setHours(date.getHours() + step);
+ }
+ return reversed ? dates.reverse() : dates;
+}
+var eachHourOfInterval_default;
+var init_eachHourOfInterval = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachHourOfInterval.js"() {
+ init_normalizeInterval();
+ init_constructFrom();
+ eachHourOfInterval_default = eachHourOfInterval;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachMinuteOfInterval.js
+function eachMinuteOfInterval(interval3, options) {
+ const { start, end: end3 } = normalizeInterval(options?.in, interval3);
+ start.setSeconds(0, 0);
+ let reversed = +start > +end3;
+ const endTime = reversed ? +start : +end3;
+ let date = reversed ? end3 : start;
+ let step = options?.step ?? 1;
+ if (!step) return [];
+ if (step < 0) {
+ step = -step;
+ reversed = !reversed;
+ }
+ const dates = [];
+ while (+date <= endTime) {
+ dates.push(constructFrom(start, date));
+ date = addMinutes(date, step);
+ }
+ return reversed ? dates.reverse() : dates;
+}
+var eachMinuteOfInterval_default;
+var init_eachMinuteOfInterval = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachMinuteOfInterval.js"() {
+ init_normalizeInterval();
+ init_addMinutes();
+ init_constructFrom();
+ eachMinuteOfInterval_default = eachMinuteOfInterval;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachMonthOfInterval.js
+function eachMonthOfInterval(interval3, options) {
+ const { start, end: end3 } = normalizeInterval(options?.in, interval3);
+ let reversed = +start > +end3;
+ const endTime = reversed ? +start : +end3;
+ const date = reversed ? end3 : start;
+ date.setHours(0, 0, 0, 0);
+ date.setDate(1);
+ let step = options?.step ?? 1;
+ if (!step) return [];
+ if (step < 0) {
+ step = -step;
+ reversed = !reversed;
+ }
+ const dates = [];
+ while (+date <= endTime) {
+ dates.push(constructFrom(start, date));
+ date.setMonth(date.getMonth() + step);
+ }
+ return reversed ? dates.reverse() : dates;
+}
+var eachMonthOfInterval_default;
+var init_eachMonthOfInterval = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachMonthOfInterval.js"() {
+ init_normalizeInterval();
+ init_constructFrom();
+ eachMonthOfInterval_default = eachMonthOfInterval;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfQuarter.js
+function startOfQuarter(date, options) {
+ const _date = toDate(date, options?.in);
+ const currentMonth = _date.getMonth();
+ const month = currentMonth - currentMonth % 3;
+ _date.setMonth(month, 1);
+ _date.setHours(0, 0, 0, 0);
+ return _date;
+}
+var startOfQuarter_default;
+var init_startOfQuarter = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfQuarter.js"() {
+ init_toDate();
+ startOfQuarter_default = startOfQuarter;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachQuarterOfInterval.js
+function eachQuarterOfInterval(interval3, options) {
+ const { start, end: end3 } = normalizeInterval(options?.in, interval3);
+ let reversed = +start > +end3;
+ const endTime = reversed ? +startOfQuarter(start) : +startOfQuarter(end3);
+ let date = reversed ? startOfQuarter(end3) : startOfQuarter(start);
+ let step = options?.step ?? 1;
+ if (!step) return [];
+ if (step < 0) {
+ step = -step;
+ reversed = !reversed;
+ }
+ const dates = [];
+ while (+date <= endTime) {
+ dates.push(constructFrom(start, date));
+ date = addQuarters(date, step);
+ }
+ return reversed ? dates.reverse() : dates;
+}
+var eachQuarterOfInterval_default;
+var init_eachQuarterOfInterval = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachQuarterOfInterval.js"() {
+ init_normalizeInterval();
+ init_addQuarters();
+ init_constructFrom();
+ init_startOfQuarter();
+ eachQuarterOfInterval_default = eachQuarterOfInterval;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachWeekOfInterval.js
+function eachWeekOfInterval(interval3, options) {
+ const { start, end: end3 } = normalizeInterval(options?.in, interval3);
+ let reversed = +start > +end3;
+ const startDateWeek = reversed ? startOfWeek(end3, options) : startOfWeek(start, options);
+ const endDateWeek = reversed ? startOfWeek(start, options) : startOfWeek(end3, options);
+ startDateWeek.setHours(15);
+ endDateWeek.setHours(15);
+ const endTime = +endDateWeek.getTime();
+ let currentDate = startDateWeek;
+ let step = options?.step ?? 1;
+ if (!step) return [];
+ if (step < 0) {
+ step = -step;
+ reversed = !reversed;
+ }
+ const dates = [];
+ while (+currentDate <= endTime) {
+ currentDate.setHours(0);
+ dates.push(constructFrom(start, currentDate));
+ currentDate = addWeeks(currentDate, step);
+ currentDate.setHours(15);
+ }
+ return reversed ? dates.reverse() : dates;
+}
+var eachWeekOfInterval_default;
+var init_eachWeekOfInterval = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachWeekOfInterval.js"() {
+ init_normalizeInterval();
+ init_addWeeks();
+ init_constructFrom();
+ init_startOfWeek();
+ eachWeekOfInterval_default = eachWeekOfInterval;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachWeekendOfInterval.js
+function eachWeekendOfInterval(interval3, options) {
+ const { start, end: end3 } = normalizeInterval(options?.in, interval3);
+ const dateInterval = eachDayOfInterval({ start, end: end3 }, options);
+ const weekends = [];
+ let index2 = 0;
+ while (index2 < dateInterval.length) {
+ const date = dateInterval[index2++];
+ if (isWeekend(date)) weekends.push(constructFrom(start, date));
+ }
+ return weekends;
+}
+var eachWeekendOfInterval_default;
+var init_eachWeekendOfInterval = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachWeekendOfInterval.js"() {
+ init_normalizeInterval();
+ init_constructFrom();
+ init_eachDayOfInterval();
+ init_isWeekend();
+ eachWeekendOfInterval_default = eachWeekendOfInterval;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfMonth.js
+function startOfMonth(date, options) {
+ const _date = toDate(date, options?.in);
+ _date.setDate(1);
+ _date.setHours(0, 0, 0, 0);
+ return _date;
+}
+var startOfMonth_default;
+var init_startOfMonth = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfMonth.js"() {
+ init_toDate();
+ startOfMonth_default = startOfMonth;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachWeekendOfMonth.js
+function eachWeekendOfMonth(date, options) {
+ const start = startOfMonth(date, options);
+ const end3 = endOfMonth(date, options);
+ return eachWeekendOfInterval({ start, end: end3 }, options);
+}
+var eachWeekendOfMonth_default;
+var init_eachWeekendOfMonth = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachWeekendOfMonth.js"() {
+ init_eachWeekendOfInterval();
+ init_endOfMonth();
+ init_startOfMonth();
+ eachWeekendOfMonth_default = eachWeekendOfMonth;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfYear.js
+function endOfYear(date, options) {
+ const _date = toDate(date, options?.in);
+ const year = _date.getFullYear();
+ _date.setFullYear(year + 1, 0, 0);
+ _date.setHours(23, 59, 59, 999);
+ return _date;
+}
+var endOfYear_default;
+var init_endOfYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfYear.js"() {
+ init_toDate();
+ endOfYear_default = endOfYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfYear.js
+function startOfYear(date, options) {
+ const date_ = toDate(date, options?.in);
+ date_.setFullYear(date_.getFullYear(), 0, 1);
+ date_.setHours(0, 0, 0, 0);
+ return date_;
+}
+var startOfYear_default;
+var init_startOfYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfYear.js"() {
+ init_toDate();
+ startOfYear_default = startOfYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachWeekendOfYear.js
+function eachWeekendOfYear(date, options) {
+ const start = startOfYear(date, options);
+ const end3 = endOfYear(date, options);
+ return eachWeekendOfInterval({ start, end: end3 }, options);
+}
+var eachWeekendOfYear_default;
+var init_eachWeekendOfYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachWeekendOfYear.js"() {
+ init_eachWeekendOfInterval();
+ init_endOfYear();
+ init_startOfYear();
+ eachWeekendOfYear_default = eachWeekendOfYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachYearOfInterval.js
+function eachYearOfInterval(interval3, options) {
+ const { start, end: end3 } = normalizeInterval(options?.in, interval3);
+ let reversed = +start > +end3;
+ const endTime = reversed ? +start : +end3;
+ const date = reversed ? end3 : start;
+ date.setHours(0, 0, 0, 0);
+ date.setMonth(0, 1);
+ let step = options?.step ?? 1;
+ if (!step) return [];
+ if (step < 0) {
+ step = -step;
+ reversed = !reversed;
+ }
+ const dates = [];
+ while (+date <= endTime) {
+ dates.push(constructFrom(start, date));
+ date.setFullYear(date.getFullYear() + step);
+ }
+ return reversed ? dates.reverse() : dates;
+}
+var eachYearOfInterval_default;
+var init_eachYearOfInterval = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/eachYearOfInterval.js"() {
+ init_normalizeInterval();
+ init_constructFrom();
+ eachYearOfInterval_default = eachYearOfInterval;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfDecade.js
+function endOfDecade(date, options) {
+ const _date = toDate(date, options?.in);
+ const year = _date.getFullYear();
+ const decade = 9 + Math.floor(year / 10) * 10;
+ _date.setFullYear(decade, 11, 31);
+ _date.setHours(23, 59, 59, 999);
+ return _date;
+}
+var endOfDecade_default;
+var init_endOfDecade = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfDecade.js"() {
+ init_toDate();
+ endOfDecade_default = endOfDecade;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfHour.js
+function endOfHour(date, options) {
+ const _date = toDate(date, options?.in);
+ _date.setMinutes(59, 59, 999);
+ return _date;
+}
+var endOfHour_default;
+var init_endOfHour = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfHour.js"() {
+ init_toDate();
+ endOfHour_default = endOfHour;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfWeek.js
+function endOfWeek(date, options) {
+ const defaultOptions2 = getDefaultOptions();
+ const weekStartsOn = options?.weekStartsOn ?? options?.locale?.options?.weekStartsOn ?? defaultOptions2.weekStartsOn ?? defaultOptions2.locale?.options?.weekStartsOn ?? 0;
+ const _date = toDate(date, options?.in);
+ const day = _date.getDay();
+ const diff = (day < weekStartsOn ? -7 : 0) + 6 - (day - weekStartsOn);
+ _date.setDate(_date.getDate() + diff);
+ _date.setHours(23, 59, 59, 999);
+ return _date;
+}
+var endOfWeek_default;
+var init_endOfWeek = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfWeek.js"() {
+ init_defaultOptions();
+ init_toDate();
+ endOfWeek_default = endOfWeek;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfISOWeek.js
+function endOfISOWeek(date, options) {
+ return endOfWeek(date, { ...options, weekStartsOn: 1 });
+}
+var endOfISOWeek_default;
+var init_endOfISOWeek = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfISOWeek.js"() {
+ init_endOfWeek();
+ endOfISOWeek_default = endOfISOWeek;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfISOWeekYear.js
+function endOfISOWeekYear(date, options) {
+ const year = getISOWeekYear(date, options);
+ const fourthOfJanuaryOfNextYear = constructFrom(options?.in || date, 0);
+ fourthOfJanuaryOfNextYear.setFullYear(year + 1, 0, 4);
+ fourthOfJanuaryOfNextYear.setHours(0, 0, 0, 0);
+ const _date = startOfISOWeek(fourthOfJanuaryOfNextYear, options);
+ _date.setMilliseconds(_date.getMilliseconds() - 1);
+ return _date;
+}
+var endOfISOWeekYear_default;
+var init_endOfISOWeekYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfISOWeekYear.js"() {
+ init_constructFrom();
+ init_getISOWeekYear();
+ init_startOfISOWeek();
+ endOfISOWeekYear_default = endOfISOWeekYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfMinute.js
+function endOfMinute(date, options) {
+ const _date = toDate(date, options?.in);
+ _date.setSeconds(59, 999);
+ return _date;
+}
+var endOfMinute_default;
+var init_endOfMinute = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfMinute.js"() {
+ init_toDate();
+ endOfMinute_default = endOfMinute;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfQuarter.js
+function endOfQuarter(date, options) {
+ const _date = toDate(date, options?.in);
+ const currentMonth = _date.getMonth();
+ const month = currentMonth - currentMonth % 3 + 3;
+ _date.setMonth(month, 0);
+ _date.setHours(23, 59, 59, 999);
+ return _date;
+}
+var endOfQuarter_default;
+var init_endOfQuarter = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfQuarter.js"() {
+ init_toDate();
+ endOfQuarter_default = endOfQuarter;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfSecond.js
+function endOfSecond(date, options) {
+ const _date = toDate(date, options?.in);
+ _date.setMilliseconds(999);
+ return _date;
+}
+var endOfSecond_default;
+var init_endOfSecond = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfSecond.js"() {
+ init_toDate();
+ endOfSecond_default = endOfSecond;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfToday.js
+function endOfToday(options) {
+ return endOfDay(Date.now(), options);
+}
+var endOfToday_default;
+var init_endOfToday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfToday.js"() {
+ init_endOfDay();
+ endOfToday_default = endOfToday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfTomorrow.js
+function endOfTomorrow(options) {
+ const now2 = constructNow(options?.in);
+ const year = now2.getFullYear();
+ const month = now2.getMonth();
+ const day = now2.getDate();
+ const date = constructNow(options?.in);
+ date.setFullYear(year, month, day + 1);
+ date.setHours(23, 59, 59, 999);
+ return options?.in ? options.in(date) : date;
+}
+var endOfTomorrow_default;
+var init_endOfTomorrow = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfTomorrow.js"() {
+ init_constructNow();
+ endOfTomorrow_default = endOfTomorrow;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfYesterday.js
+function endOfYesterday(options) {
+ const now2 = constructNow(options?.in);
+ const date = constructFrom(options?.in, 0);
+ date.setFullYear(now2.getFullYear(), now2.getMonth(), now2.getDate() - 1);
+ date.setHours(23, 59, 59, 999);
+ return date;
+}
+var endOfYesterday_default;
+var init_endOfYesterday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/endOfYesterday.js"() {
+ init_constructFrom();
+ init_constructNow();
+ endOfYesterday_default = endOfYesterday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-US/_lib/formatDistance.js
+var formatDistanceLocale, formatDistance;
+var init_formatDistance = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-US/_lib/formatDistance.js"() {
+ formatDistanceLocale = {
+ lessThanXSeconds: {
+ one: "less than a second",
+ other: "less than {{count}} seconds"
+ },
+ xSeconds: {
+ one: "1 second",
+ other: "{{count}} seconds"
+ },
+ halfAMinute: "half a minute",
+ lessThanXMinutes: {
+ one: "less than a minute",
+ other: "less than {{count}} minutes"
+ },
+ xMinutes: {
+ one: "1 minute",
+ other: "{{count}} minutes"
+ },
+ aboutXHours: {
+ one: "about 1 hour",
+ other: "about {{count}} hours"
+ },
+ xHours: {
+ one: "1 hour",
+ other: "{{count}} hours"
+ },
+ xDays: {
+ one: "1 day",
+ other: "{{count}} days"
+ },
+ aboutXWeeks: {
+ one: "about 1 week",
+ other: "about {{count}} weeks"
+ },
+ xWeeks: {
+ one: "1 week",
+ other: "{{count}} weeks"
+ },
+ aboutXMonths: {
+ one: "about 1 month",
+ other: "about {{count}} months"
+ },
+ xMonths: {
+ one: "1 month",
+ other: "{{count}} months"
+ },
+ aboutXYears: {
+ one: "about 1 year",
+ other: "about {{count}} years"
+ },
+ xYears: {
+ one: "1 year",
+ other: "{{count}} years"
+ },
+ overXYears: {
+ one: "over 1 year",
+ other: "over {{count}} years"
+ },
+ almostXYears: {
+ one: "almost 1 year",
+ other: "almost {{count}} years"
+ }
+ };
+ formatDistance = (token, count2, options) => {
+ let result;
+ const tokenValue = formatDistanceLocale[token];
+ if (typeof tokenValue === "string") {
+ result = tokenValue;
+ } else if (count2 === 1) {
+ result = tokenValue.one;
+ } else {
+ result = tokenValue.other.replace("{{count}}", count2.toString());
+ }
+ if (options?.addSuffix) {
+ if (options.comparison && options.comparison > 0) {
+ return "in " + result;
+ } else {
+ return result + " ago";
+ }
+ }
+ return result;
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/_lib/buildFormatLongFn.js
+function buildFormatLongFn(args) {
+ return (options = {}) => {
+ const width = options.width ? String(options.width) : args.defaultWidth;
+ const format2 = args.formats[width] || args.formats[args.defaultWidth];
+ return format2;
+ };
+}
+var init_buildFormatLongFn = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/_lib/buildFormatLongFn.js"() {
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-US/_lib/formatLong.js
+var dateFormats, timeFormats, dateTimeFormats, formatLong;
+var init_formatLong = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-US/_lib/formatLong.js"() {
+ init_buildFormatLongFn();
+ dateFormats = {
+ full: "EEEE, MMMM do, y",
+ long: "MMMM do, y",
+ medium: "MMM d, y",
+ short: "MM/dd/yyyy"
+ };
+ timeFormats = {
+ full: "h:mm:ss a zzzz",
+ long: "h:mm:ss a z",
+ medium: "h:mm:ss a",
+ short: "h:mm a"
+ };
+ dateTimeFormats = {
+ full: "{{date}} 'at' {{time}}",
+ long: "{{date}} 'at' {{time}}",
+ medium: "{{date}}, {{time}}",
+ short: "{{date}}, {{time}}"
+ };
+ formatLong = {
+ date: buildFormatLongFn({
+ formats: dateFormats,
+ defaultWidth: "full"
+ }),
+ time: buildFormatLongFn({
+ formats: timeFormats,
+ defaultWidth: "full"
+ }),
+ dateTime: buildFormatLongFn({
+ formats: dateTimeFormats,
+ defaultWidth: "full"
+ })
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-US/_lib/formatRelative.js
+var formatRelativeLocale, formatRelative;
+var init_formatRelative = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-US/_lib/formatRelative.js"() {
+ formatRelativeLocale = {
+ lastWeek: "'last' eeee 'at' p",
+ yesterday: "'yesterday at' p",
+ today: "'today at' p",
+ tomorrow: "'tomorrow at' p",
+ nextWeek: "eeee 'at' p",
+ other: "P"
+ };
+ formatRelative = (token, _date, _baseDate, _options) => formatRelativeLocale[token];
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/_lib/buildLocalizeFn.js
+function buildLocalizeFn(args) {
+ return (value2, options) => {
+ const context2 = options?.context ? String(options.context) : "standalone";
+ let valuesArray;
+ if (context2 === "formatting" && args.formattingValues) {
+ const defaultWidth = args.defaultFormattingWidth || args.defaultWidth;
+ const width = options?.width ? String(options.width) : defaultWidth;
+ valuesArray = args.formattingValues[width] || args.formattingValues[defaultWidth];
+ } else {
+ const defaultWidth = args.defaultWidth;
+ const width = options?.width ? String(options.width) : args.defaultWidth;
+ valuesArray = args.values[width] || args.values[defaultWidth];
+ }
+ const index2 = args.argumentCallback ? args.argumentCallback(value2) : value2;
+ return valuesArray[index2];
+ };
+}
+var init_buildLocalizeFn = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/_lib/buildLocalizeFn.js"() {
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-US/_lib/localize.js
+var eraValues, quarterValues, monthValues, dayValues, dayPeriodValues, formattingDayPeriodValues, ordinalNumber, localize;
+var init_localize = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-US/_lib/localize.js"() {
+ init_buildLocalizeFn();
+ eraValues = {
+ narrow: ["B", "A"],
+ abbreviated: ["BC", "AD"],
+ wide: ["Before Christ", "Anno Domini"]
+ };
+ quarterValues = {
+ narrow: ["1", "2", "3", "4"],
+ abbreviated: ["Q1", "Q2", "Q3", "Q4"],
+ wide: ["1st quarter", "2nd quarter", "3rd quarter", "4th quarter"]
+ };
+ monthValues = {
+ narrow: ["J", "F", "M", "A", "M", "J", "J", "A", "S", "O", "N", "D"],
+ abbreviated: [
+ "Jan",
+ "Feb",
+ "Mar",
+ "Apr",
+ "May",
+ "Jun",
+ "Jul",
+ "Aug",
+ "Sep",
+ "Oct",
+ "Nov",
+ "Dec"
+ ],
+ wide: [
+ "January",
+ "February",
+ "March",
+ "April",
+ "May",
+ "June",
+ "July",
+ "August",
+ "September",
+ "October",
+ "November",
+ "December"
+ ]
+ };
+ dayValues = {
+ narrow: ["S", "M", "T", "W", "T", "F", "S"],
+ short: ["Su", "Mo", "Tu", "We", "Th", "Fr", "Sa"],
+ abbreviated: ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"],
+ wide: [
+ "Sunday",
+ "Monday",
+ "Tuesday",
+ "Wednesday",
+ "Thursday",
+ "Friday",
+ "Saturday"
+ ]
+ };
+ dayPeriodValues = {
+ narrow: {
+ am: "a",
+ pm: "p",
+ midnight: "mi",
+ noon: "n",
+ morning: "morning",
+ afternoon: "afternoon",
+ evening: "evening",
+ night: "night"
+ },
+ abbreviated: {
+ am: "AM",
+ pm: "PM",
+ midnight: "midnight",
+ noon: "noon",
+ morning: "morning",
+ afternoon: "afternoon",
+ evening: "evening",
+ night: "night"
+ },
+ wide: {
+ am: "a.m.",
+ pm: "p.m.",
+ midnight: "midnight",
+ noon: "noon",
+ morning: "morning",
+ afternoon: "afternoon",
+ evening: "evening",
+ night: "night"
+ }
+ };
+ formattingDayPeriodValues = {
+ narrow: {
+ am: "a",
+ pm: "p",
+ midnight: "mi",
+ noon: "n",
+ morning: "in the morning",
+ afternoon: "in the afternoon",
+ evening: "in the evening",
+ night: "at night"
+ },
+ abbreviated: {
+ am: "AM",
+ pm: "PM",
+ midnight: "midnight",
+ noon: "noon",
+ morning: "in the morning",
+ afternoon: "in the afternoon",
+ evening: "in the evening",
+ night: "at night"
+ },
+ wide: {
+ am: "a.m.",
+ pm: "p.m.",
+ midnight: "midnight",
+ noon: "noon",
+ morning: "in the morning",
+ afternoon: "in the afternoon",
+ evening: "in the evening",
+ night: "at night"
+ }
+ };
+ ordinalNumber = (dirtyNumber, _options) => {
+ const number2 = Number(dirtyNumber);
+ const rem100 = number2 % 100;
+ if (rem100 > 20 || rem100 < 10) {
+ switch (rem100 % 10) {
+ case 1:
+ return number2 + "st";
+ case 2:
+ return number2 + "nd";
+ case 3:
+ return number2 + "rd";
+ }
+ }
+ return number2 + "th";
+ };
+ localize = {
+ ordinalNumber,
+ era: buildLocalizeFn({
+ values: eraValues,
+ defaultWidth: "wide"
+ }),
+ quarter: buildLocalizeFn({
+ values: quarterValues,
+ defaultWidth: "wide",
+ argumentCallback: (quarter) => quarter - 1
+ }),
+ month: buildLocalizeFn({
+ values: monthValues,
+ defaultWidth: "wide"
+ }),
+ day: buildLocalizeFn({
+ values: dayValues,
+ defaultWidth: "wide"
+ }),
+ dayPeriod: buildLocalizeFn({
+ values: dayPeriodValues,
+ defaultWidth: "wide",
+ formattingValues: formattingDayPeriodValues,
+ defaultFormattingWidth: "wide"
+ })
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/_lib/buildMatchFn.js
+function buildMatchFn(args) {
+ return (string3, options = {}) => {
+ const width = options.width;
+ const matchPattern = width && args.matchPatterns[width] || args.matchPatterns[args.defaultMatchWidth];
+ const matchResult = string3.match(matchPattern);
+ if (!matchResult) {
+ return null;
+ }
+ const matchedString = matchResult[0];
+ const parsePatterns = width && args.parsePatterns[width] || args.parsePatterns[args.defaultParseWidth];
+ const key2 = Array.isArray(parsePatterns) ? findIndex2(parsePatterns, (pattern) => pattern.test(matchedString)) : (
+ // [TODO] -- I challenge you to fix the type
+ findKey(parsePatterns, (pattern) => pattern.test(matchedString))
+ );
+ let value2;
+ value2 = args.valueCallback ? args.valueCallback(key2) : key2;
+ value2 = options.valueCallback ? (
+ // [TODO] -- I challenge you to fix the type
+ options.valueCallback(value2)
+ ) : value2;
+ const rest = string3.slice(matchedString.length);
+ return { value: value2, rest };
+ };
+}
+function findKey(object, predicate) {
+ for (const key2 in object) {
+ if (Object.prototype.hasOwnProperty.call(object, key2) && predicate(object[key2])) {
+ return key2;
+ }
+ }
+ return void 0;
+}
+function findIndex2(array, predicate) {
+ for (let key2 = 0; key2 < array.length; key2++) {
+ if (predicate(array[key2])) {
+ return key2;
+ }
+ }
+ return void 0;
+}
+var init_buildMatchFn = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/_lib/buildMatchFn.js"() {
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/_lib/buildMatchPatternFn.js
+function buildMatchPatternFn(args) {
+ return (string3, options = {}) => {
+ const matchResult = string3.match(args.matchPattern);
+ if (!matchResult) return null;
+ const matchedString = matchResult[0];
+ const parseResult = string3.match(args.parsePattern);
+ if (!parseResult) return null;
+ let value2 = args.valueCallback ? args.valueCallback(parseResult[0]) : parseResult[0];
+ value2 = options.valueCallback ? options.valueCallback(value2) : value2;
+ const rest = string3.slice(matchedString.length);
+ return { value: value2, rest };
+ };
+}
+var init_buildMatchPatternFn = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/_lib/buildMatchPatternFn.js"() {
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-US/_lib/match.js
+var matchOrdinalNumberPattern, parseOrdinalNumberPattern, matchEraPatterns, parseEraPatterns, matchQuarterPatterns, parseQuarterPatterns, matchMonthPatterns, parseMonthPatterns, matchDayPatterns, parseDayPatterns, matchDayPeriodPatterns, parseDayPeriodPatterns, match;
+var init_match = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-US/_lib/match.js"() {
+ init_buildMatchFn();
+ init_buildMatchPatternFn();
+ matchOrdinalNumberPattern = /^(\d+)(th|st|nd|rd)?/i;
+ parseOrdinalNumberPattern = /\d+/i;
+ matchEraPatterns = {
+ narrow: /^(b|a)/i,
+ abbreviated: /^(b\.?\s?c\.?|b\.?\s?c\.?\s?e\.?|a\.?\s?d\.?|c\.?\s?e\.?)/i,
+ wide: /^(before christ|before common era|anno domini|common era)/i
+ };
+ parseEraPatterns = {
+ any: [/^b/i, /^(a|c)/i]
+ };
+ matchQuarterPatterns = {
+ narrow: /^[1234]/i,
+ abbreviated: /^q[1234]/i,
+ wide: /^[1234](th|st|nd|rd)? quarter/i
+ };
+ parseQuarterPatterns = {
+ any: [/1/i, /2/i, /3/i, /4/i]
+ };
+ matchMonthPatterns = {
+ narrow: /^[jfmasond]/i,
+ abbreviated: /^(jan|feb|mar|apr|may|jun|jul|aug|sep|oct|nov|dec)/i,
+ wide: /^(january|february|march|april|may|june|july|august|september|october|november|december)/i
+ };
+ parseMonthPatterns = {
+ narrow: [
+ /^j/i,
+ /^f/i,
+ /^m/i,
+ /^a/i,
+ /^m/i,
+ /^j/i,
+ /^j/i,
+ /^a/i,
+ /^s/i,
+ /^o/i,
+ /^n/i,
+ /^d/i
+ ],
+ any: [
+ /^ja/i,
+ /^f/i,
+ /^mar/i,
+ /^ap/i,
+ /^may/i,
+ /^jun/i,
+ /^jul/i,
+ /^au/i,
+ /^s/i,
+ /^o/i,
+ /^n/i,
+ /^d/i
+ ]
+ };
+ matchDayPatterns = {
+ narrow: /^[smtwf]/i,
+ short: /^(su|mo|tu|we|th|fr|sa)/i,
+ abbreviated: /^(sun|mon|tue|wed|thu|fri|sat)/i,
+ wide: /^(sunday|monday|tuesday|wednesday|thursday|friday|saturday)/i
+ };
+ parseDayPatterns = {
+ narrow: [/^s/i, /^m/i, /^t/i, /^w/i, /^t/i, /^f/i, /^s/i],
+ any: [/^su/i, /^m/i, /^tu/i, /^w/i, /^th/i, /^f/i, /^sa/i]
+ };
+ matchDayPeriodPatterns = {
+ narrow: /^(a|p|mi|n|(in the|at) (morning|afternoon|evening|night))/i,
+ any: /^([ap]\.?\s?m\.?|midnight|noon|(in the|at) (morning|afternoon|evening|night))/i
+ };
+ parseDayPeriodPatterns = {
+ any: {
+ am: /^a/i,
+ pm: /^p/i,
+ midnight: /^mi/i,
+ noon: /^no/i,
+ morning: /morning/i,
+ afternoon: /afternoon/i,
+ evening: /evening/i,
+ night: /night/i
+ }
+ };
+ match = {
+ ordinalNumber: buildMatchPatternFn({
+ matchPattern: matchOrdinalNumberPattern,
+ parsePattern: parseOrdinalNumberPattern,
+ valueCallback: (value2) => parseInt(value2, 10)
+ }),
+ era: buildMatchFn({
+ matchPatterns: matchEraPatterns,
+ defaultMatchWidth: "wide",
+ parsePatterns: parseEraPatterns,
+ defaultParseWidth: "any"
+ }),
+ quarter: buildMatchFn({
+ matchPatterns: matchQuarterPatterns,
+ defaultMatchWidth: "wide",
+ parsePatterns: parseQuarterPatterns,
+ defaultParseWidth: "any",
+ valueCallback: (index2) => index2 + 1
+ }),
+ month: buildMatchFn({
+ matchPatterns: matchMonthPatterns,
+ defaultMatchWidth: "wide",
+ parsePatterns: parseMonthPatterns,
+ defaultParseWidth: "any"
+ }),
+ day: buildMatchFn({
+ matchPatterns: matchDayPatterns,
+ defaultMatchWidth: "wide",
+ parsePatterns: parseDayPatterns,
+ defaultParseWidth: "any"
+ }),
+ dayPeriod: buildMatchFn({
+ matchPatterns: matchDayPeriodPatterns,
+ defaultMatchWidth: "any",
+ parsePatterns: parseDayPeriodPatterns,
+ defaultParseWidth: "any"
+ })
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-US.js
+var enUS, en_US_default;
+var init_en_US = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/locale/en-US.js"() {
+ init_formatDistance();
+ init_formatLong();
+ init_formatRelative();
+ init_localize();
+ init_match();
+ enUS = {
+ code: "en-US",
+ formatDistance,
+ formatLong,
+ formatRelative,
+ localize,
+ match,
+ options: {
+ weekStartsOn: 0,
+ firstWeekContainsDate: 1
+ }
+ };
+ en_US_default = enUS;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/defaultLocale.js
+var init_defaultLocale = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/defaultLocale.js"() {
+ init_en_US();
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getDayOfYear.js
+function getDayOfYear(date, options) {
+ const _date = toDate(date, options?.in);
+ const diff = differenceInCalendarDays(_date, startOfYear(_date));
+ const dayOfYear = diff + 1;
+ return dayOfYear;
+}
+var getDayOfYear_default;
+var init_getDayOfYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getDayOfYear.js"() {
+ init_differenceInCalendarDays();
+ init_startOfYear();
+ init_toDate();
+ getDayOfYear_default = getDayOfYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getISOWeek.js
+function getISOWeek(date, options) {
+ const _date = toDate(date, options?.in);
+ const diff = +startOfISOWeek(_date) - +startOfISOWeekYear(_date);
+ return Math.round(diff / millisecondsInWeek) + 1;
+}
+var getISOWeek_default;
+var init_getISOWeek = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getISOWeek.js"() {
+ init_constants();
+ init_startOfISOWeek();
+ init_startOfISOWeekYear();
+ init_toDate();
+ getISOWeek_default = getISOWeek;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getWeekYear.js
+function getWeekYear(date, options) {
+ const _date = toDate(date, options?.in);
+ const year = _date.getFullYear();
+ const defaultOptions2 = getDefaultOptions();
+ const firstWeekContainsDate = options?.firstWeekContainsDate ?? options?.locale?.options?.firstWeekContainsDate ?? defaultOptions2.firstWeekContainsDate ?? defaultOptions2.locale?.options?.firstWeekContainsDate ?? 1;
+ const firstWeekOfNextYear = constructFrom(options?.in || date, 0);
+ firstWeekOfNextYear.setFullYear(year + 1, 0, firstWeekContainsDate);
+ firstWeekOfNextYear.setHours(0, 0, 0, 0);
+ const startOfNextYear = startOfWeek(firstWeekOfNextYear, options);
+ const firstWeekOfThisYear = constructFrom(options?.in || date, 0);
+ firstWeekOfThisYear.setFullYear(year, 0, firstWeekContainsDate);
+ firstWeekOfThisYear.setHours(0, 0, 0, 0);
+ const startOfThisYear = startOfWeek(firstWeekOfThisYear, options);
+ if (+_date >= +startOfNextYear) {
+ return year + 1;
+ } else if (+_date >= +startOfThisYear) {
+ return year;
+ } else {
+ return year - 1;
+ }
+}
+var getWeekYear_default;
+var init_getWeekYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getWeekYear.js"() {
+ init_defaultOptions();
+ init_constructFrom();
+ init_startOfWeek();
+ init_toDate();
+ getWeekYear_default = getWeekYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfWeekYear.js
+function startOfWeekYear(date, options) {
+ const defaultOptions2 = getDefaultOptions();
+ const firstWeekContainsDate = options?.firstWeekContainsDate ?? options?.locale?.options?.firstWeekContainsDate ?? defaultOptions2.firstWeekContainsDate ?? defaultOptions2.locale?.options?.firstWeekContainsDate ?? 1;
+ const year = getWeekYear(date, options);
+ const firstWeek = constructFrom(options?.in || date, 0);
+ firstWeek.setFullYear(year, 0, firstWeekContainsDate);
+ firstWeek.setHours(0, 0, 0, 0);
+ const _date = startOfWeek(firstWeek, options);
+ return _date;
+}
+var startOfWeekYear_default;
+var init_startOfWeekYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfWeekYear.js"() {
+ init_defaultOptions();
+ init_constructFrom();
+ init_getWeekYear();
+ init_startOfWeek();
+ startOfWeekYear_default = startOfWeekYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getWeek.js
+function getWeek(date, options) {
+ const _date = toDate(date, options?.in);
+ const diff = +startOfWeek(_date, options) - +startOfWeekYear(_date, options);
+ return Math.round(diff / millisecondsInWeek) + 1;
+}
+var getWeek_default;
+var init_getWeek = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getWeek.js"() {
+ init_constants();
+ init_startOfWeek();
+ init_startOfWeekYear();
+ init_toDate();
+ getWeek_default = getWeek;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/addLeadingZeros.js
+function addLeadingZeros(number2, targetLength) {
+ const sign = number2 < 0 ? "-" : "";
+ const output = Math.abs(number2).toString().padStart(targetLength, "0");
+ return sign + output;
+}
+var init_addLeadingZeros = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/addLeadingZeros.js"() {
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/format/lightFormatters.js
+var lightFormatters;
+var init_lightFormatters = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/format/lightFormatters.js"() {
+ init_addLeadingZeros();
+ lightFormatters = {
+ // Year
+ y(date, token) {
+ const signedYear = date.getFullYear();
+ const year = signedYear > 0 ? signedYear : 1 - signedYear;
+ return addLeadingZeros(token === "yy" ? year % 100 : year, token.length);
+ },
+ // Month
+ M(date, token) {
+ const month = date.getMonth();
+ return token === "M" ? String(month + 1) : addLeadingZeros(month + 1, 2);
+ },
+ // Day of the month
+ d(date, token) {
+ return addLeadingZeros(date.getDate(), token.length);
+ },
+ // AM or PM
+ a(date, token) {
+ const dayPeriodEnumValue = date.getHours() / 12 >= 1 ? "pm" : "am";
+ switch (token) {
+ case "a":
+ case "aa":
+ return dayPeriodEnumValue.toUpperCase();
+ case "aaa":
+ return dayPeriodEnumValue;
+ case "aaaaa":
+ return dayPeriodEnumValue[0];
+ case "aaaa":
+ default:
+ return dayPeriodEnumValue === "am" ? "a.m." : "p.m.";
+ }
+ },
+ // Hour [1-12]
+ h(date, token) {
+ return addLeadingZeros(date.getHours() % 12 || 12, token.length);
+ },
+ // Hour [0-23]
+ H(date, token) {
+ return addLeadingZeros(date.getHours(), token.length);
+ },
+ // Minute
+ m(date, token) {
+ return addLeadingZeros(date.getMinutes(), token.length);
+ },
+ // Second
+ s(date, token) {
+ return addLeadingZeros(date.getSeconds(), token.length);
+ },
+ // Fraction of second
+ S(date, token) {
+ const numberOfDigits = token.length;
+ const milliseconds2 = date.getMilliseconds();
+ const fractionalSeconds = Math.trunc(
+ milliseconds2 * Math.pow(10, numberOfDigits - 3)
+ );
+ return addLeadingZeros(fractionalSeconds, token.length);
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/format/formatters.js
+function formatTimezoneShort(offset, delimiter = "") {
+ const sign = offset > 0 ? "-" : "+";
+ const absOffset = Math.abs(offset);
+ const hours = Math.trunc(absOffset / 60);
+ const minutes = absOffset % 60;
+ if (minutes === 0) {
+ return sign + String(hours);
+ }
+ return sign + String(hours) + delimiter + addLeadingZeros(minutes, 2);
+}
+function formatTimezoneWithOptionalMinutes(offset, delimiter) {
+ if (offset % 60 === 0) {
+ const sign = offset > 0 ? "-" : "+";
+ return sign + addLeadingZeros(Math.abs(offset) / 60, 2);
+ }
+ return formatTimezone(offset, delimiter);
+}
+function formatTimezone(offset, delimiter = "") {
+ const sign = offset > 0 ? "-" : "+";
+ const absOffset = Math.abs(offset);
+ const hours = addLeadingZeros(Math.trunc(absOffset / 60), 2);
+ const minutes = addLeadingZeros(absOffset % 60, 2);
+ return sign + hours + delimiter + minutes;
+}
+var dayPeriodEnum, formatters;
+var init_formatters = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/format/formatters.js"() {
+ init_getDayOfYear();
+ init_getISOWeek();
+ init_getISOWeekYear();
+ init_getWeek();
+ init_getWeekYear();
+ init_addLeadingZeros();
+ init_lightFormatters();
+ dayPeriodEnum = {
+ am: "am",
+ pm: "pm",
+ midnight: "midnight",
+ noon: "noon",
+ morning: "morning",
+ afternoon: "afternoon",
+ evening: "evening",
+ night: "night"
+ };
+ formatters = {
+ // Era
+ G: function(date, token, localize2) {
+ const era = date.getFullYear() > 0 ? 1 : 0;
+ switch (token) {
+ // AD, BC
+ case "G":
+ case "GG":
+ case "GGG":
+ return localize2.era(era, { width: "abbreviated" });
+ // A, B
+ case "GGGGG":
+ return localize2.era(era, { width: "narrow" });
+ // Anno Domini, Before Christ
+ case "GGGG":
+ default:
+ return localize2.era(era, { width: "wide" });
+ }
+ },
+ // Year
+ y: function(date, token, localize2) {
+ if (token === "yo") {
+ const signedYear = date.getFullYear();
+ const year = signedYear > 0 ? signedYear : 1 - signedYear;
+ return localize2.ordinalNumber(year, { unit: "year" });
+ }
+ return lightFormatters.y(date, token);
+ },
+ // Local week-numbering year
+ Y: function(date, token, localize2, options) {
+ const signedWeekYear = getWeekYear(date, options);
+ const weekYear = signedWeekYear > 0 ? signedWeekYear : 1 - signedWeekYear;
+ if (token === "YY") {
+ const twoDigitYear = weekYear % 100;
+ return addLeadingZeros(twoDigitYear, 2);
+ }
+ if (token === "Yo") {
+ return localize2.ordinalNumber(weekYear, { unit: "year" });
+ }
+ return addLeadingZeros(weekYear, token.length);
+ },
+ // ISO week-numbering year
+ R: function(date, token) {
+ const isoWeekYear = getISOWeekYear(date);
+ return addLeadingZeros(isoWeekYear, token.length);
+ },
+ // Extended year. This is a single number designating the year of this calendar system.
+ // The main difference between `y` and `u` localizers are B.C. years:
+ // | Year | `y` | `u` |
+ // |------|-----|-----|
+ // | AC 1 | 1 | 1 |
+ // | BC 1 | 1 | 0 |
+ // | BC 2 | 2 | -1 |
+ // Also `yy` always returns the last two digits of a year,
+ // while `uu` pads single digit years to 2 characters and returns other years unchanged.
+ u: function(date, token) {
+ const year = date.getFullYear();
+ return addLeadingZeros(year, token.length);
+ },
+ // Quarter
+ Q: function(date, token, localize2) {
+ const quarter = Math.ceil((date.getMonth() + 1) / 3);
+ switch (token) {
+ // 1, 2, 3, 4
+ case "Q":
+ return String(quarter);
+ // 01, 02, 03, 04
+ case "QQ":
+ return addLeadingZeros(quarter, 2);
+ // 1st, 2nd, 3rd, 4th
+ case "Qo":
+ return localize2.ordinalNumber(quarter, { unit: "quarter" });
+ // Q1, Q2, Q3, Q4
+ case "QQQ":
+ return localize2.quarter(quarter, {
+ width: "abbreviated",
+ context: "formatting"
+ });
+ // 1, 2, 3, 4 (narrow quarter; could be not numerical)
+ case "QQQQQ":
+ return localize2.quarter(quarter, {
+ width: "narrow",
+ context: "formatting"
+ });
+ // 1st quarter, 2nd quarter, ...
+ case "QQQQ":
+ default:
+ return localize2.quarter(quarter, {
+ width: "wide",
+ context: "formatting"
+ });
+ }
+ },
+ // Stand-alone quarter
+ q: function(date, token, localize2) {
+ const quarter = Math.ceil((date.getMonth() + 1) / 3);
+ switch (token) {
+ // 1, 2, 3, 4
+ case "q":
+ return String(quarter);
+ // 01, 02, 03, 04
+ case "qq":
+ return addLeadingZeros(quarter, 2);
+ // 1st, 2nd, 3rd, 4th
+ case "qo":
+ return localize2.ordinalNumber(quarter, { unit: "quarter" });
+ // Q1, Q2, Q3, Q4
+ case "qqq":
+ return localize2.quarter(quarter, {
+ width: "abbreviated",
+ context: "standalone"
+ });
+ // 1, 2, 3, 4 (narrow quarter; could be not numerical)
+ case "qqqqq":
+ return localize2.quarter(quarter, {
+ width: "narrow",
+ context: "standalone"
+ });
+ // 1st quarter, 2nd quarter, ...
+ case "qqqq":
+ default:
+ return localize2.quarter(quarter, {
+ width: "wide",
+ context: "standalone"
+ });
+ }
+ },
+ // Month
+ M: function(date, token, localize2) {
+ const month = date.getMonth();
+ switch (token) {
+ case "M":
+ case "MM":
+ return lightFormatters.M(date, token);
+ // 1st, 2nd, ..., 12th
+ case "Mo":
+ return localize2.ordinalNumber(month + 1, { unit: "month" });
+ // Jan, Feb, ..., Dec
+ case "MMM":
+ return localize2.month(month, {
+ width: "abbreviated",
+ context: "formatting"
+ });
+ // J, F, ..., D
+ case "MMMMM":
+ return localize2.month(month, {
+ width: "narrow",
+ context: "formatting"
+ });
+ // January, February, ..., December
+ case "MMMM":
+ default:
+ return localize2.month(month, { width: "wide", context: "formatting" });
+ }
+ },
+ // Stand-alone month
+ L: function(date, token, localize2) {
+ const month = date.getMonth();
+ switch (token) {
+ // 1, 2, ..., 12
+ case "L":
+ return String(month + 1);
+ // 01, 02, ..., 12
+ case "LL":
+ return addLeadingZeros(month + 1, 2);
+ // 1st, 2nd, ..., 12th
+ case "Lo":
+ return localize2.ordinalNumber(month + 1, { unit: "month" });
+ // Jan, Feb, ..., Dec
+ case "LLL":
+ return localize2.month(month, {
+ width: "abbreviated",
+ context: "standalone"
+ });
+ // J, F, ..., D
+ case "LLLLL":
+ return localize2.month(month, {
+ width: "narrow",
+ context: "standalone"
+ });
+ // January, February, ..., December
+ case "LLLL":
+ default:
+ return localize2.month(month, { width: "wide", context: "standalone" });
+ }
+ },
+ // Local week of year
+ w: function(date, token, localize2, options) {
+ const week = getWeek(date, options);
+ if (token === "wo") {
+ return localize2.ordinalNumber(week, { unit: "week" });
+ }
+ return addLeadingZeros(week, token.length);
+ },
+ // ISO week of year
+ I: function(date, token, localize2) {
+ const isoWeek = getISOWeek(date);
+ if (token === "Io") {
+ return localize2.ordinalNumber(isoWeek, { unit: "week" });
+ }
+ return addLeadingZeros(isoWeek, token.length);
+ },
+ // Day of the month
+ d: function(date, token, localize2) {
+ if (token === "do") {
+ return localize2.ordinalNumber(date.getDate(), { unit: "date" });
+ }
+ return lightFormatters.d(date, token);
+ },
+ // Day of year
+ D: function(date, token, localize2) {
+ const dayOfYear = getDayOfYear(date);
+ if (token === "Do") {
+ return localize2.ordinalNumber(dayOfYear, { unit: "dayOfYear" });
+ }
+ return addLeadingZeros(dayOfYear, token.length);
+ },
+ // Day of week
+ E: function(date, token, localize2) {
+ const dayOfWeek = date.getDay();
+ switch (token) {
+ // Tue
+ case "E":
+ case "EE":
+ case "EEE":
+ return localize2.day(dayOfWeek, {
+ width: "abbreviated",
+ context: "formatting"
+ });
+ // T
+ case "EEEEE":
+ return localize2.day(dayOfWeek, {
+ width: "narrow",
+ context: "formatting"
+ });
+ // Tu
+ case "EEEEEE":
+ return localize2.day(dayOfWeek, {
+ width: "short",
+ context: "formatting"
+ });
+ // Tuesday
+ case "EEEE":
+ default:
+ return localize2.day(dayOfWeek, {
+ width: "wide",
+ context: "formatting"
+ });
+ }
+ },
+ // Local day of week
+ e: function(date, token, localize2, options) {
+ const dayOfWeek = date.getDay();
+ const localDayOfWeek = (dayOfWeek - options.weekStartsOn + 8) % 7 || 7;
+ switch (token) {
+ // Numerical value (Nth day of week with current locale or weekStartsOn)
+ case "e":
+ return String(localDayOfWeek);
+ // Padded numerical value
+ case "ee":
+ return addLeadingZeros(localDayOfWeek, 2);
+ // 1st, 2nd, ..., 7th
+ case "eo":
+ return localize2.ordinalNumber(localDayOfWeek, { unit: "day" });
+ case "eee":
+ return localize2.day(dayOfWeek, {
+ width: "abbreviated",
+ context: "formatting"
+ });
+ // T
+ case "eeeee":
+ return localize2.day(dayOfWeek, {
+ width: "narrow",
+ context: "formatting"
+ });
+ // Tu
+ case "eeeeee":
+ return localize2.day(dayOfWeek, {
+ width: "short",
+ context: "formatting"
+ });
+ // Tuesday
+ case "eeee":
+ default:
+ return localize2.day(dayOfWeek, {
+ width: "wide",
+ context: "formatting"
+ });
+ }
+ },
+ // Stand-alone local day of week
+ c: function(date, token, localize2, options) {
+ const dayOfWeek = date.getDay();
+ const localDayOfWeek = (dayOfWeek - options.weekStartsOn + 8) % 7 || 7;
+ switch (token) {
+ // Numerical value (same as in `e`)
+ case "c":
+ return String(localDayOfWeek);
+ // Padded numerical value
+ case "cc":
+ return addLeadingZeros(localDayOfWeek, token.length);
+ // 1st, 2nd, ..., 7th
+ case "co":
+ return localize2.ordinalNumber(localDayOfWeek, { unit: "day" });
+ case "ccc":
+ return localize2.day(dayOfWeek, {
+ width: "abbreviated",
+ context: "standalone"
+ });
+ // T
+ case "ccccc":
+ return localize2.day(dayOfWeek, {
+ width: "narrow",
+ context: "standalone"
+ });
+ // Tu
+ case "cccccc":
+ return localize2.day(dayOfWeek, {
+ width: "short",
+ context: "standalone"
+ });
+ // Tuesday
+ case "cccc":
+ default:
+ return localize2.day(dayOfWeek, {
+ width: "wide",
+ context: "standalone"
+ });
+ }
+ },
+ // ISO day of week
+ i: function(date, token, localize2) {
+ const dayOfWeek = date.getDay();
+ const isoDayOfWeek = dayOfWeek === 0 ? 7 : dayOfWeek;
+ switch (token) {
+ // 2
+ case "i":
+ return String(isoDayOfWeek);
+ // 02
+ case "ii":
+ return addLeadingZeros(isoDayOfWeek, token.length);
+ // 2nd
+ case "io":
+ return localize2.ordinalNumber(isoDayOfWeek, { unit: "day" });
+ // Tue
+ case "iii":
+ return localize2.day(dayOfWeek, {
+ width: "abbreviated",
+ context: "formatting"
+ });
+ // T
+ case "iiiii":
+ return localize2.day(dayOfWeek, {
+ width: "narrow",
+ context: "formatting"
+ });
+ // Tu
+ case "iiiiii":
+ return localize2.day(dayOfWeek, {
+ width: "short",
+ context: "formatting"
+ });
+ // Tuesday
+ case "iiii":
+ default:
+ return localize2.day(dayOfWeek, {
+ width: "wide",
+ context: "formatting"
+ });
+ }
+ },
+ // AM or PM
+ a: function(date, token, localize2) {
+ const hours = date.getHours();
+ const dayPeriodEnumValue = hours / 12 >= 1 ? "pm" : "am";
+ switch (token) {
+ case "a":
+ case "aa":
+ return localize2.dayPeriod(dayPeriodEnumValue, {
+ width: "abbreviated",
+ context: "formatting"
+ });
+ case "aaa":
+ return localize2.dayPeriod(dayPeriodEnumValue, {
+ width: "abbreviated",
+ context: "formatting"
+ }).toLowerCase();
+ case "aaaaa":
+ return localize2.dayPeriod(dayPeriodEnumValue, {
+ width: "narrow",
+ context: "formatting"
+ });
+ case "aaaa":
+ default:
+ return localize2.dayPeriod(dayPeriodEnumValue, {
+ width: "wide",
+ context: "formatting"
+ });
+ }
+ },
+ // AM, PM, midnight, noon
+ b: function(date, token, localize2) {
+ const hours = date.getHours();
+ let dayPeriodEnumValue;
+ if (hours === 12) {
+ dayPeriodEnumValue = dayPeriodEnum.noon;
+ } else if (hours === 0) {
+ dayPeriodEnumValue = dayPeriodEnum.midnight;
+ } else {
+ dayPeriodEnumValue = hours / 12 >= 1 ? "pm" : "am";
+ }
+ switch (token) {
+ case "b":
+ case "bb":
+ return localize2.dayPeriod(dayPeriodEnumValue, {
+ width: "abbreviated",
+ context: "formatting"
+ });
+ case "bbb":
+ return localize2.dayPeriod(dayPeriodEnumValue, {
+ width: "abbreviated",
+ context: "formatting"
+ }).toLowerCase();
+ case "bbbbb":
+ return localize2.dayPeriod(dayPeriodEnumValue, {
+ width: "narrow",
+ context: "formatting"
+ });
+ case "bbbb":
+ default:
+ return localize2.dayPeriod(dayPeriodEnumValue, {
+ width: "wide",
+ context: "formatting"
+ });
+ }
+ },
+ // in the morning, in the afternoon, in the evening, at night
+ B: function(date, token, localize2) {
+ const hours = date.getHours();
+ let dayPeriodEnumValue;
+ if (hours >= 17) {
+ dayPeriodEnumValue = dayPeriodEnum.evening;
+ } else if (hours >= 12) {
+ dayPeriodEnumValue = dayPeriodEnum.afternoon;
+ } else if (hours >= 4) {
+ dayPeriodEnumValue = dayPeriodEnum.morning;
+ } else {
+ dayPeriodEnumValue = dayPeriodEnum.night;
+ }
+ switch (token) {
+ case "B":
+ case "BB":
+ case "BBB":
+ return localize2.dayPeriod(dayPeriodEnumValue, {
+ width: "abbreviated",
+ context: "formatting"
+ });
+ case "BBBBB":
+ return localize2.dayPeriod(dayPeriodEnumValue, {
+ width: "narrow",
+ context: "formatting"
+ });
+ case "BBBB":
+ default:
+ return localize2.dayPeriod(dayPeriodEnumValue, {
+ width: "wide",
+ context: "formatting"
+ });
+ }
+ },
+ // Hour [1-12]
+ h: function(date, token, localize2) {
+ if (token === "ho") {
+ let hours = date.getHours() % 12;
+ if (hours === 0) hours = 12;
+ return localize2.ordinalNumber(hours, { unit: "hour" });
+ }
+ return lightFormatters.h(date, token);
+ },
+ // Hour [0-23]
+ H: function(date, token, localize2) {
+ if (token === "Ho") {
+ return localize2.ordinalNumber(date.getHours(), { unit: "hour" });
+ }
+ return lightFormatters.H(date, token);
+ },
+ // Hour [0-11]
+ K: function(date, token, localize2) {
+ const hours = date.getHours() % 12;
+ if (token === "Ko") {
+ return localize2.ordinalNumber(hours, { unit: "hour" });
+ }
+ return addLeadingZeros(hours, token.length);
+ },
+ // Hour [1-24]
+ k: function(date, token, localize2) {
+ let hours = date.getHours();
+ if (hours === 0) hours = 24;
+ if (token === "ko") {
+ return localize2.ordinalNumber(hours, { unit: "hour" });
+ }
+ return addLeadingZeros(hours, token.length);
+ },
+ // Minute
+ m: function(date, token, localize2) {
+ if (token === "mo") {
+ return localize2.ordinalNumber(date.getMinutes(), { unit: "minute" });
+ }
+ return lightFormatters.m(date, token);
+ },
+ // Second
+ s: function(date, token, localize2) {
+ if (token === "so") {
+ return localize2.ordinalNumber(date.getSeconds(), { unit: "second" });
+ }
+ return lightFormatters.s(date, token);
+ },
+ // Fraction of second
+ S: function(date, token) {
+ return lightFormatters.S(date, token);
+ },
+ // Timezone (ISO-8601. If offset is 0, output is always `'Z'`)
+ X: function(date, token, _localize) {
+ const timezoneOffset = date.getTimezoneOffset();
+ if (timezoneOffset === 0) {
+ return "Z";
+ }
+ switch (token) {
+ // Hours and optional minutes
+ case "X":
+ return formatTimezoneWithOptionalMinutes(timezoneOffset);
+ // Hours, minutes and optional seconds without `:` delimiter
+ // Note: neither ISO-8601 nor JavaScript supports seconds in timezone offsets
+ // so this token always has the same output as `XX`
+ case "XXXX":
+ case "XX":
+ return formatTimezone(timezoneOffset);
+ // Hours, minutes and optional seconds with `:` delimiter
+ // Note: neither ISO-8601 nor JavaScript supports seconds in timezone offsets
+ // so this token always has the same output as `XXX`
+ case "XXXXX":
+ case "XXX":
+ // Hours and minutes with `:` delimiter
+ default:
+ return formatTimezone(timezoneOffset, ":");
+ }
+ },
+ // Timezone (ISO-8601. If offset is 0, output is `'+00:00'` or equivalent)
+ x: function(date, token, _localize) {
+ const timezoneOffset = date.getTimezoneOffset();
+ switch (token) {
+ // Hours and optional minutes
+ case "x":
+ return formatTimezoneWithOptionalMinutes(timezoneOffset);
+ // Hours, minutes and optional seconds without `:` delimiter
+ // Note: neither ISO-8601 nor JavaScript supports seconds in timezone offsets
+ // so this token always has the same output as `xx`
+ case "xxxx":
+ case "xx":
+ return formatTimezone(timezoneOffset);
+ // Hours, minutes and optional seconds with `:` delimiter
+ // Note: neither ISO-8601 nor JavaScript supports seconds in timezone offsets
+ // so this token always has the same output as `xxx`
+ case "xxxxx":
+ case "xxx":
+ // Hours and minutes with `:` delimiter
+ default:
+ return formatTimezone(timezoneOffset, ":");
+ }
+ },
+ // Timezone (GMT)
+ O: function(date, token, _localize) {
+ const timezoneOffset = date.getTimezoneOffset();
+ switch (token) {
+ // Short
+ case "O":
+ case "OO":
+ case "OOO":
+ return "GMT" + formatTimezoneShort(timezoneOffset, ":");
+ // Long
+ case "OOOO":
+ default:
+ return "GMT" + formatTimezone(timezoneOffset, ":");
+ }
+ },
+ // Timezone (specific non-location)
+ z: function(date, token, _localize) {
+ const timezoneOffset = date.getTimezoneOffset();
+ switch (token) {
+ // Short
+ case "z":
+ case "zz":
+ case "zzz":
+ return "GMT" + formatTimezoneShort(timezoneOffset, ":");
+ // Long
+ case "zzzz":
+ default:
+ return "GMT" + formatTimezone(timezoneOffset, ":");
+ }
+ },
+ // Seconds timestamp
+ t: function(date, token, _localize) {
+ const timestamp2 = Math.trunc(+date / 1e3);
+ return addLeadingZeros(timestamp2, token.length);
+ },
+ // Milliseconds timestamp
+ T: function(date, token, _localize) {
+ return addLeadingZeros(+date, token.length);
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/format/longFormatters.js
+var dateLongFormatter, timeLongFormatter, dateTimeLongFormatter, longFormatters;
+var init_longFormatters = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/format/longFormatters.js"() {
+ dateLongFormatter = (pattern, formatLong2) => {
+ switch (pattern) {
+ case "P":
+ return formatLong2.date({ width: "short" });
+ case "PP":
+ return formatLong2.date({ width: "medium" });
+ case "PPP":
+ return formatLong2.date({ width: "long" });
+ case "PPPP":
+ default:
+ return formatLong2.date({ width: "full" });
+ }
+ };
+ timeLongFormatter = (pattern, formatLong2) => {
+ switch (pattern) {
+ case "p":
+ return formatLong2.time({ width: "short" });
+ case "pp":
+ return formatLong2.time({ width: "medium" });
+ case "ppp":
+ return formatLong2.time({ width: "long" });
+ case "pppp":
+ default:
+ return formatLong2.time({ width: "full" });
+ }
+ };
+ dateTimeLongFormatter = (pattern, formatLong2) => {
+ const matchResult = pattern.match(/(P+)(p+)?/) || [];
+ const datePattern = matchResult[1];
+ const timePattern = matchResult[2];
+ if (!timePattern) {
+ return dateLongFormatter(pattern, formatLong2);
+ }
+ let dateTimeFormat;
+ switch (datePattern) {
+ case "P":
+ dateTimeFormat = formatLong2.dateTime({ width: "short" });
+ break;
+ case "PP":
+ dateTimeFormat = formatLong2.dateTime({ width: "medium" });
+ break;
+ case "PPP":
+ dateTimeFormat = formatLong2.dateTime({ width: "long" });
+ break;
+ case "PPPP":
+ default:
+ dateTimeFormat = formatLong2.dateTime({ width: "full" });
+ break;
+ }
+ return dateTimeFormat.replace("{{date}}", dateLongFormatter(datePattern, formatLong2)).replace("{{time}}", timeLongFormatter(timePattern, formatLong2));
+ };
+ longFormatters = {
+ p: timeLongFormatter,
+ P: dateTimeLongFormatter
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/protectedTokens.js
+function isProtectedDayOfYearToken(token) {
+ return dayOfYearTokenRE.test(token);
+}
+function isProtectedWeekYearToken(token) {
+ return weekYearTokenRE.test(token);
+}
+function warnOrThrowProtectedError(token, format2, input) {
+ const _message = message(token, format2, input);
+ console.warn(_message);
+ if (throwTokens.includes(token)) throw new RangeError(_message);
+}
+function message(token, format2, input) {
+ const subject = token[0] === "Y" ? "years" : "days of the month";
+ return `Use \`${token.toLowerCase()}\` instead of \`${token}\` (in \`${format2}\`) for formatting ${subject} to the input \`${input}\`; see: https://github.com/date-fns/date-fns/blob/master/docs/unicodeTokens.md`;
+}
+var dayOfYearTokenRE, weekYearTokenRE, throwTokens;
+var init_protectedTokens = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/_lib/protectedTokens.js"() {
+ dayOfYearTokenRE = /^D+$/;
+ weekYearTokenRE = /^Y+$/;
+ throwTokens = ["D", "DD", "YY", "YYYY"];
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/format.js
+function format(date, formatStr, options) {
+ const defaultOptions2 = getDefaultOptions();
+ const locale = options?.locale ?? defaultOptions2.locale ?? enUS;
+ const firstWeekContainsDate = options?.firstWeekContainsDate ?? options?.locale?.options?.firstWeekContainsDate ?? defaultOptions2.firstWeekContainsDate ?? defaultOptions2.locale?.options?.firstWeekContainsDate ?? 1;
+ const weekStartsOn = options?.weekStartsOn ?? options?.locale?.options?.weekStartsOn ?? defaultOptions2.weekStartsOn ?? defaultOptions2.locale?.options?.weekStartsOn ?? 0;
+ const originalDate = toDate(date, options?.in);
+ if (!isValid(originalDate)) {
+ throw new RangeError("Invalid time value");
+ }
+ let parts = formatStr.match(longFormattingTokensRegExp).map((substring) => {
+ const firstCharacter = substring[0];
+ if (firstCharacter === "p" || firstCharacter === "P") {
+ const longFormatter = longFormatters[firstCharacter];
+ return longFormatter(substring, locale.formatLong);
+ }
+ return substring;
+ }).join("").match(formattingTokensRegExp).map((substring) => {
+ if (substring === "''") {
+ return { isToken: false, value: "'" };
+ }
+ const firstCharacter = substring[0];
+ if (firstCharacter === "'") {
+ return { isToken: false, value: cleanEscapedString(substring) };
+ }
+ if (formatters[firstCharacter]) {
+ return { isToken: true, value: substring };
+ }
+ if (firstCharacter.match(unescapedLatinCharacterRegExp)) {
+ throw new RangeError(
+ "Format string contains an unescaped latin alphabet character `" + firstCharacter + "`"
+ );
+ }
+ return { isToken: false, value: substring };
+ });
+ if (locale.localize.preprocessor) {
+ parts = locale.localize.preprocessor(originalDate, parts);
+ }
+ const formatterOptions = {
+ firstWeekContainsDate,
+ weekStartsOn,
+ locale
+ };
+ return parts.map((part) => {
+ if (!part.isToken) return part.value;
+ const token = part.value;
+ if (!options?.useAdditionalWeekYearTokens && isProtectedWeekYearToken(token) || !options?.useAdditionalDayOfYearTokens && isProtectedDayOfYearToken(token)) {
+ warnOrThrowProtectedError(token, formatStr, String(date));
+ }
+ const formatter2 = formatters[token[0]];
+ return formatter2(originalDate, token, locale.localize, formatterOptions);
+ }).join("");
+}
+function cleanEscapedString(input) {
+ const matched = input.match(escapedStringRegExp);
+ if (!matched) {
+ return input;
+ }
+ return matched[1].replace(doubleQuoteRegExp, "'");
+}
+var formattingTokensRegExp, longFormattingTokensRegExp, escapedStringRegExp, doubleQuoteRegExp, unescapedLatinCharacterRegExp, format_default;
+var init_format = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/format.js"() {
+ init_defaultLocale();
+ init_defaultOptions();
+ init_formatters();
+ init_longFormatters();
+ init_protectedTokens();
+ init_isValid();
+ init_toDate();
+ formattingTokensRegExp = /[yYQqMLwIdDecihHKkms]o|(\w)\1*|''|'(''|[^'])+('|$)|./g;
+ longFormattingTokensRegExp = /P+p+|P+|p+|''|'(''|[^'])+('|$)|./g;
+ escapedStringRegExp = /^'([^]*?)'?$/;
+ doubleQuoteRegExp = /''/g;
+ unescapedLatinCharacterRegExp = /[a-zA-Z]/;
+ format_default = format;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatDistance.js
+function formatDistance2(laterDate, earlierDate, options) {
+ const defaultOptions2 = getDefaultOptions();
+ const locale = options?.locale ?? defaultOptions2.locale ?? enUS;
+ const minutesInAlmostTwoDays = 2520;
+ const comparison = compareAsc(laterDate, earlierDate);
+ if (isNaN(comparison)) throw new RangeError("Invalid time value");
+ const localizeOptions = Object.assign({}, options, {
+ addSuffix: options?.addSuffix,
+ comparison
+ });
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ ...comparison > 0 ? [earlierDate, laterDate] : [laterDate, earlierDate]
+ );
+ const seconds = differenceInSeconds(earlierDate_, laterDate_);
+ const offsetInSeconds = (getTimezoneOffsetInMilliseconds(earlierDate_) - getTimezoneOffsetInMilliseconds(laterDate_)) / 1e3;
+ const minutes = Math.round((seconds - offsetInSeconds) / 60);
+ let months2;
+ if (minutes < 2) {
+ if (options?.includeSeconds) {
+ if (seconds < 5) {
+ return locale.formatDistance("lessThanXSeconds", 5, localizeOptions);
+ } else if (seconds < 10) {
+ return locale.formatDistance("lessThanXSeconds", 10, localizeOptions);
+ } else if (seconds < 20) {
+ return locale.formatDistance("lessThanXSeconds", 20, localizeOptions);
+ } else if (seconds < 40) {
+ return locale.formatDistance("halfAMinute", 0, localizeOptions);
+ } else if (seconds < 60) {
+ return locale.formatDistance("lessThanXMinutes", 1, localizeOptions);
+ } else {
+ return locale.formatDistance("xMinutes", 1, localizeOptions);
+ }
+ } else {
+ if (minutes === 0) {
+ return locale.formatDistance("lessThanXMinutes", 1, localizeOptions);
+ } else {
+ return locale.formatDistance("xMinutes", minutes, localizeOptions);
+ }
+ }
+ } else if (minutes < 45) {
+ return locale.formatDistance("xMinutes", minutes, localizeOptions);
+ } else if (minutes < 90) {
+ return locale.formatDistance("aboutXHours", 1, localizeOptions);
+ } else if (minutes < minutesInDay) {
+ const hours = Math.round(minutes / 60);
+ return locale.formatDistance("aboutXHours", hours, localizeOptions);
+ } else if (minutes < minutesInAlmostTwoDays) {
+ return locale.formatDistance("xDays", 1, localizeOptions);
+ } else if (minutes < minutesInMonth) {
+ const days2 = Math.round(minutes / minutesInDay);
+ return locale.formatDistance("xDays", days2, localizeOptions);
+ } else if (minutes < minutesInMonth * 2) {
+ months2 = Math.round(minutes / minutesInMonth);
+ return locale.formatDistance("aboutXMonths", months2, localizeOptions);
+ }
+ months2 = differenceInMonths(earlierDate_, laterDate_);
+ if (months2 < 12) {
+ const nearestMonth = Math.round(minutes / minutesInMonth);
+ return locale.formatDistance("xMonths", nearestMonth, localizeOptions);
+ } else {
+ const monthsSinceStartOfYear = months2 % 12;
+ const years = Math.trunc(months2 / 12);
+ if (monthsSinceStartOfYear < 3) {
+ return locale.formatDistance("aboutXYears", years, localizeOptions);
+ } else if (monthsSinceStartOfYear < 9) {
+ return locale.formatDistance("overXYears", years, localizeOptions);
+ } else {
+ return locale.formatDistance("almostXYears", years + 1, localizeOptions);
+ }
+ }
+}
+var formatDistance_default;
+var init_formatDistance2 = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatDistance.js"() {
+ init_defaultLocale();
+ init_defaultOptions();
+ init_getTimezoneOffsetInMilliseconds();
+ init_normalizeDates();
+ init_compareAsc();
+ init_constants();
+ init_differenceInMonths();
+ init_differenceInSeconds();
+ formatDistance_default = formatDistance2;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatDistanceStrict.js
+function formatDistanceStrict(laterDate, earlierDate, options) {
+ const defaultOptions2 = getDefaultOptions();
+ const locale = options?.locale ?? defaultOptions2.locale ?? enUS;
+ const comparison = compareAsc(laterDate, earlierDate);
+ if (isNaN(comparison)) {
+ throw new RangeError("Invalid time value");
+ }
+ const localizeOptions = Object.assign({}, options, {
+ addSuffix: options?.addSuffix,
+ comparison
+ });
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ ...comparison > 0 ? [earlierDate, laterDate] : [laterDate, earlierDate]
+ );
+ const roundingMethod = getRoundingMethod(options?.roundingMethod ?? "round");
+ const milliseconds2 = earlierDate_.getTime() - laterDate_.getTime();
+ const minutes = milliseconds2 / millisecondsInMinute;
+ const timezoneOffset = getTimezoneOffsetInMilliseconds(earlierDate_) - getTimezoneOffsetInMilliseconds(laterDate_);
+ const dstNormalizedMinutes = (milliseconds2 - timezoneOffset) / millisecondsInMinute;
+ const defaultUnit = options?.unit;
+ let unit;
+ if (!defaultUnit) {
+ if (minutes < 1) {
+ unit = "second";
+ } else if (minutes < 60) {
+ unit = "minute";
+ } else if (minutes < minutesInDay) {
+ unit = "hour";
+ } else if (dstNormalizedMinutes < minutesInMonth) {
+ unit = "day";
+ } else if (dstNormalizedMinutes < minutesInYear) {
+ unit = "month";
+ } else {
+ unit = "year";
+ }
+ } else {
+ unit = defaultUnit;
+ }
+ if (unit === "second") {
+ const seconds = roundingMethod(milliseconds2 / 1e3);
+ return locale.formatDistance("xSeconds", seconds, localizeOptions);
+ } else if (unit === "minute") {
+ const roundedMinutes = roundingMethod(minutes);
+ return locale.formatDistance("xMinutes", roundedMinutes, localizeOptions);
+ } else if (unit === "hour") {
+ const hours = roundingMethod(minutes / 60);
+ return locale.formatDistance("xHours", hours, localizeOptions);
+ } else if (unit === "day") {
+ const days2 = roundingMethod(dstNormalizedMinutes / minutesInDay);
+ return locale.formatDistance("xDays", days2, localizeOptions);
+ } else if (unit === "month") {
+ const months2 = roundingMethod(dstNormalizedMinutes / minutesInMonth);
+ return months2 === 12 && defaultUnit !== "month" ? locale.formatDistance("xYears", 1, localizeOptions) : locale.formatDistance("xMonths", months2, localizeOptions);
+ } else {
+ const years = roundingMethod(dstNormalizedMinutes / minutesInYear);
+ return locale.formatDistance("xYears", years, localizeOptions);
+ }
+}
+var formatDistanceStrict_default;
+var init_formatDistanceStrict = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatDistanceStrict.js"() {
+ init_defaultLocale();
+ init_defaultOptions();
+ init_getRoundingMethod();
+ init_getTimezoneOffsetInMilliseconds();
+ init_normalizeDates();
+ init_compareAsc();
+ init_constants();
+ formatDistanceStrict_default = formatDistanceStrict;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatDistanceToNow.js
+function formatDistanceToNow(date, options) {
+ return formatDistance2(date, constructNow(date), options);
+}
+var formatDistanceToNow_default;
+var init_formatDistanceToNow = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatDistanceToNow.js"() {
+ init_constructNow();
+ init_formatDistance2();
+ formatDistanceToNow_default = formatDistanceToNow;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatDistanceToNowStrict.js
+function formatDistanceToNowStrict(date, options) {
+ return formatDistanceStrict(date, constructNow(date), options);
+}
+var formatDistanceToNowStrict_default;
+var init_formatDistanceToNowStrict = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatDistanceToNowStrict.js"() {
+ init_constructNow();
+ init_formatDistanceStrict();
+ formatDistanceToNowStrict_default = formatDistanceToNowStrict;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatDuration.js
+function formatDuration(duration, options) {
+ const defaultOptions2 = getDefaultOptions();
+ const locale = options?.locale ?? defaultOptions2.locale ?? enUS;
+ const format2 = options?.format ?? defaultFormat;
+ const zero = options?.zero ?? false;
+ const delimiter = options?.delimiter ?? " ";
+ if (!locale.formatDistance) {
+ return "";
+ }
+ const result = format2.reduce((acc, unit) => {
+ const token = `x${unit.replace(/(^.)/, (m6) => m6.toUpperCase())}`;
+ const value2 = duration[unit];
+ if (value2 !== void 0 && (zero || duration[unit])) {
+ return acc.concat(locale.formatDistance(token, value2));
+ }
+ return acc;
+ }, []).join(delimiter);
+ return result;
+}
+var defaultFormat, formatDuration_default;
+var init_formatDuration = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatDuration.js"() {
+ init_defaultLocale();
+ init_defaultOptions();
+ defaultFormat = [
+ "years",
+ "months",
+ "weeks",
+ "days",
+ "hours",
+ "minutes",
+ "seconds"
+ ];
+ formatDuration_default = formatDuration;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatISO.js
+function formatISO(date, options) {
+ const date_ = toDate(date, options?.in);
+ if (isNaN(+date_)) {
+ throw new RangeError("Invalid time value");
+ }
+ const format2 = options?.format ?? "extended";
+ const representation = options?.representation ?? "complete";
+ let result = "";
+ let tzOffset = "";
+ const dateDelimiter = format2 === "extended" ? "-" : "";
+ const timeDelimiter = format2 === "extended" ? ":" : "";
+ if (representation !== "time") {
+ const day = addLeadingZeros(date_.getDate(), 2);
+ const month = addLeadingZeros(date_.getMonth() + 1, 2);
+ const year = addLeadingZeros(date_.getFullYear(), 4);
+ result = `${year}${dateDelimiter}${month}${dateDelimiter}${day}`;
+ }
+ if (representation !== "date") {
+ const offset = date_.getTimezoneOffset();
+ if (offset !== 0) {
+ const absoluteOffset = Math.abs(offset);
+ const hourOffset = addLeadingZeros(Math.trunc(absoluteOffset / 60), 2);
+ const minuteOffset = addLeadingZeros(absoluteOffset % 60, 2);
+ const sign = offset < 0 ? "+" : "-";
+ tzOffset = `${sign}${hourOffset}:${minuteOffset}`;
+ } else {
+ tzOffset = "Z";
+ }
+ const hour = addLeadingZeros(date_.getHours(), 2);
+ const minute = addLeadingZeros(date_.getMinutes(), 2);
+ const second = addLeadingZeros(date_.getSeconds(), 2);
+ const separator = result === "" ? "" : "T";
+ const time = [hour, minute, second].join(timeDelimiter);
+ result = `${result}${separator}${time}${tzOffset}`;
+ }
+ return result;
+}
+var formatISO_default;
+var init_formatISO = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatISO.js"() {
+ init_addLeadingZeros();
+ init_toDate();
+ formatISO_default = formatISO;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatISO9075.js
+function formatISO9075(date, options) {
+ const date_ = toDate(date, options?.in);
+ if (!isValid(date_)) {
+ throw new RangeError("Invalid time value");
+ }
+ const format2 = options?.format ?? "extended";
+ const representation = options?.representation ?? "complete";
+ let result = "";
+ const dateDelimiter = format2 === "extended" ? "-" : "";
+ const timeDelimiter = format2 === "extended" ? ":" : "";
+ if (representation !== "time") {
+ const day = addLeadingZeros(date_.getDate(), 2);
+ const month = addLeadingZeros(date_.getMonth() + 1, 2);
+ const year = addLeadingZeros(date_.getFullYear(), 4);
+ result = `${year}${dateDelimiter}${month}${dateDelimiter}${day}`;
+ }
+ if (representation !== "date") {
+ const hour = addLeadingZeros(date_.getHours(), 2);
+ const minute = addLeadingZeros(date_.getMinutes(), 2);
+ const second = addLeadingZeros(date_.getSeconds(), 2);
+ const separator = result === "" ? "" : " ";
+ result = `${result}${separator}${hour}${timeDelimiter}${minute}${timeDelimiter}${second}`;
+ }
+ return result;
+}
+var formatISO9075_default;
+var init_formatISO9075 = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatISO9075.js"() {
+ init_addLeadingZeros();
+ init_isValid();
+ init_toDate();
+ formatISO9075_default = formatISO9075;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatISODuration.js
+function formatISODuration(duration) {
+ const {
+ years = 0,
+ months: months2 = 0,
+ days: days2 = 0,
+ hours = 0,
+ minutes = 0,
+ seconds = 0
+ } = duration;
+ return `P${years}Y${months2}M${days2}DT${hours}H${minutes}M${seconds}S`;
+}
+var formatISODuration_default;
+var init_formatISODuration = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatISODuration.js"() {
+ formatISODuration_default = formatISODuration;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatRFC3339.js
+function formatRFC3339(date, options) {
+ const date_ = toDate(date, options?.in);
+ if (!isValid(date_)) {
+ throw new RangeError("Invalid time value");
+ }
+ const fractionDigits = options?.fractionDigits ?? 0;
+ const day = addLeadingZeros(date_.getDate(), 2);
+ const month = addLeadingZeros(date_.getMonth() + 1, 2);
+ const year = date_.getFullYear();
+ const hour = addLeadingZeros(date_.getHours(), 2);
+ const minute = addLeadingZeros(date_.getMinutes(), 2);
+ const second = addLeadingZeros(date_.getSeconds(), 2);
+ let fractionalSecond = "";
+ if (fractionDigits > 0) {
+ const milliseconds2 = date_.getMilliseconds();
+ const fractionalSeconds = Math.trunc(
+ milliseconds2 * Math.pow(10, fractionDigits - 3)
+ );
+ fractionalSecond = "." + addLeadingZeros(fractionalSeconds, fractionDigits);
+ }
+ let offset = "";
+ const tzOffset = date_.getTimezoneOffset();
+ if (tzOffset !== 0) {
+ const absoluteOffset = Math.abs(tzOffset);
+ const hourOffset = addLeadingZeros(Math.trunc(absoluteOffset / 60), 2);
+ const minuteOffset = addLeadingZeros(absoluteOffset % 60, 2);
+ const sign = tzOffset < 0 ? "+" : "-";
+ offset = `${sign}${hourOffset}:${minuteOffset}`;
+ } else {
+ offset = "Z";
+ }
+ return `${year}-${month}-${day}T${hour}:${minute}:${second}${fractionalSecond}${offset}`;
+}
+var formatRFC3339_default;
+var init_formatRFC3339 = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatRFC3339.js"() {
+ init_addLeadingZeros();
+ init_isValid();
+ init_toDate();
+ formatRFC3339_default = formatRFC3339;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatRFC7231.js
+function formatRFC7231(date) {
+ const _date = toDate(date);
+ if (!isValid(_date)) {
+ throw new RangeError("Invalid time value");
+ }
+ const dayName = days[_date.getUTCDay()];
+ const dayOfMonth = addLeadingZeros(_date.getUTCDate(), 2);
+ const monthName = months[_date.getUTCMonth()];
+ const year = _date.getUTCFullYear();
+ const hour = addLeadingZeros(_date.getUTCHours(), 2);
+ const minute = addLeadingZeros(_date.getUTCMinutes(), 2);
+ const second = addLeadingZeros(_date.getUTCSeconds(), 2);
+ return `${dayName}, ${dayOfMonth} ${monthName} ${year} ${hour}:${minute}:${second} GMT`;
+}
+var days, months, formatRFC7231_default;
+var init_formatRFC7231 = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatRFC7231.js"() {
+ init_addLeadingZeros();
+ init_isValid();
+ init_toDate();
+ days = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"];
+ months = [
+ "Jan",
+ "Feb",
+ "Mar",
+ "Apr",
+ "May",
+ "Jun",
+ "Jul",
+ "Aug",
+ "Sep",
+ "Oct",
+ "Nov",
+ "Dec"
+ ];
+ formatRFC7231_default = formatRFC7231;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatRelative.js
+function formatRelative2(date, baseDate, options) {
+ const [date_, baseDate_] = normalizeDates(options?.in, date, baseDate);
+ const defaultOptions2 = getDefaultOptions();
+ const locale = options?.locale ?? defaultOptions2.locale ?? enUS;
+ const weekStartsOn = options?.weekStartsOn ?? options?.locale?.options?.weekStartsOn ?? defaultOptions2.weekStartsOn ?? defaultOptions2.locale?.options?.weekStartsOn ?? 0;
+ const diff = differenceInCalendarDays(date_, baseDate_);
+ if (isNaN(diff)) {
+ throw new RangeError("Invalid time value");
+ }
+ let token;
+ if (diff < -6) {
+ token = "other";
+ } else if (diff < -1) {
+ token = "lastWeek";
+ } else if (diff < 0) {
+ token = "yesterday";
+ } else if (diff < 1) {
+ token = "today";
+ } else if (diff < 2) {
+ token = "tomorrow";
+ } else if (diff < 7) {
+ token = "nextWeek";
+ } else {
+ token = "other";
+ }
+ const formatStr = locale.formatRelative(token, date_, baseDate_, {
+ locale,
+ weekStartsOn
+ });
+ return format(date_, formatStr, { locale, weekStartsOn });
+}
+var formatRelative_default;
+var init_formatRelative2 = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/formatRelative.js"() {
+ init_defaultLocale();
+ init_defaultOptions();
+ init_normalizeDates();
+ init_differenceInCalendarDays();
+ init_format();
+ formatRelative_default = formatRelative2;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/fromUnixTime.js
+function fromUnixTime(unixTime, options) {
+ return toDate(unixTime * 1e3, options?.in);
+}
+var fromUnixTime_default;
+var init_fromUnixTime = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/fromUnixTime.js"() {
+ init_toDate();
+ fromUnixTime_default = fromUnixTime;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getDate.js
+function getDate(date, options) {
+ return toDate(date, options?.in).getDate();
+}
+var getDate_default;
+var init_getDate = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getDate.js"() {
+ init_toDate();
+ getDate_default = getDate;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getDay.js
+function getDay(date, options) {
+ return toDate(date, options?.in).getDay();
+}
+var getDay_default;
+var init_getDay = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getDay.js"() {
+ init_toDate();
+ getDay_default = getDay;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getDaysInMonth.js
+function getDaysInMonth(date, options) {
+ const _date = toDate(date, options?.in);
+ const year = _date.getFullYear();
+ const monthIndex = _date.getMonth();
+ const lastDayOfMonth2 = constructFrom(_date, 0);
+ lastDayOfMonth2.setFullYear(year, monthIndex + 1, 0);
+ lastDayOfMonth2.setHours(0, 0, 0, 0);
+ return lastDayOfMonth2.getDate();
+}
+var getDaysInMonth_default;
+var init_getDaysInMonth = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getDaysInMonth.js"() {
+ init_constructFrom();
+ init_toDate();
+ getDaysInMonth_default = getDaysInMonth;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isLeapYear.js
+function isLeapYear(date, options) {
+ const _date = toDate(date, options?.in);
+ const year = _date.getFullYear();
+ return year % 400 === 0 || year % 4 === 0 && year % 100 !== 0;
+}
+var isLeapYear_default;
+var init_isLeapYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isLeapYear.js"() {
+ init_toDate();
+ isLeapYear_default = isLeapYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getDaysInYear.js
+function getDaysInYear(date, options) {
+ const _date = toDate(date, options?.in);
+ if (Number.isNaN(+_date)) return NaN;
+ return isLeapYear(_date) ? 366 : 365;
+}
+var getDaysInYear_default;
+var init_getDaysInYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getDaysInYear.js"() {
+ init_isLeapYear();
+ init_toDate();
+ getDaysInYear_default = getDaysInYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getDecade.js
+function getDecade(date, options) {
+ const _date = toDate(date, options?.in);
+ const year = _date.getFullYear();
+ const decade = Math.floor(year / 10) * 10;
+ return decade;
+}
+var getDecade_default;
+var init_getDecade = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getDecade.js"() {
+ init_toDate();
+ getDecade_default = getDecade;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getDefaultOptions.js
+function getDefaultOptions2() {
+ return Object.assign({}, getDefaultOptions());
+}
+var getDefaultOptions_default;
+var init_getDefaultOptions = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getDefaultOptions.js"() {
+ init_defaultOptions();
+ getDefaultOptions_default = getDefaultOptions2;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getHours.js
+function getHours(date, options) {
+ return toDate(date, options?.in).getHours();
+}
+var getHours_default;
+var init_getHours = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getHours.js"() {
+ init_toDate();
+ getHours_default = getHours;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getISODay.js
+function getISODay(date, options) {
+ const day = toDate(date, options?.in).getDay();
+ return day === 0 ? 7 : day;
+}
+var getISODay_default;
+var init_getISODay = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getISODay.js"() {
+ init_toDate();
+ getISODay_default = getISODay;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getISOWeeksInYear.js
+function getISOWeeksInYear(date, options) {
+ const thisYear = startOfISOWeekYear(date, options);
+ const nextYear = startOfISOWeekYear(addWeeks(thisYear, 60));
+ const diff = +nextYear - +thisYear;
+ return Math.round(diff / millisecondsInWeek);
+}
+var getISOWeeksInYear_default;
+var init_getISOWeeksInYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getISOWeeksInYear.js"() {
+ init_addWeeks();
+ init_constants();
+ init_startOfISOWeekYear();
+ getISOWeeksInYear_default = getISOWeeksInYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getMilliseconds.js
+function getMilliseconds(date) {
+ return toDate(date).getMilliseconds();
+}
+var getMilliseconds_default;
+var init_getMilliseconds = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getMilliseconds.js"() {
+ init_toDate();
+ getMilliseconds_default = getMilliseconds;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getMinutes.js
+function getMinutes(date, options) {
+ return toDate(date, options?.in).getMinutes();
+}
+var getMinutes_default;
+var init_getMinutes = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getMinutes.js"() {
+ init_toDate();
+ getMinutes_default = getMinutes;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getMonth.js
+function getMonth(date, options) {
+ return toDate(date, options?.in).getMonth();
+}
+var getMonth_default;
+var init_getMonth = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getMonth.js"() {
+ init_toDate();
+ getMonth_default = getMonth;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getOverlappingDaysInIntervals.js
+function getOverlappingDaysInIntervals(intervalLeft, intervalRight) {
+ const [leftStart, leftEnd] = [
+ +toDate(intervalLeft.start),
+ +toDate(intervalLeft.end)
+ ].sort((a5, b5) => a5 - b5);
+ const [rightStart, rightEnd] = [
+ +toDate(intervalRight.start),
+ +toDate(intervalRight.end)
+ ].sort((a5, b5) => a5 - b5);
+ const isOverlapping = leftStart < rightEnd && rightStart < leftEnd;
+ if (!isOverlapping) return 0;
+ const overlapLeft = rightStart < leftStart ? leftStart : rightStart;
+ const left = overlapLeft - getTimezoneOffsetInMilliseconds(overlapLeft);
+ const overlapRight = rightEnd > leftEnd ? leftEnd : rightEnd;
+ const right = overlapRight - getTimezoneOffsetInMilliseconds(overlapRight);
+ return Math.ceil((right - left) / millisecondsInDay);
+}
+var getOverlappingDaysInIntervals_default;
+var init_getOverlappingDaysInIntervals = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getOverlappingDaysInIntervals.js"() {
+ init_getTimezoneOffsetInMilliseconds();
+ init_constants();
+ init_toDate();
+ getOverlappingDaysInIntervals_default = getOverlappingDaysInIntervals;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getSeconds.js
+function getSeconds(date) {
+ return toDate(date).getSeconds();
+}
+var getSeconds_default;
+var init_getSeconds = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getSeconds.js"() {
+ init_toDate();
+ getSeconds_default = getSeconds;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getTime.js
+function getTime(date) {
+ return +toDate(date);
+}
+var getTime_default;
+var init_getTime = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getTime.js"() {
+ init_toDate();
+ getTime_default = getTime;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getUnixTime.js
+function getUnixTime(date) {
+ return Math.trunc(+toDate(date) / 1e3);
+}
+var getUnixTime_default;
+var init_getUnixTime = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getUnixTime.js"() {
+ init_toDate();
+ getUnixTime_default = getUnixTime;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getWeekOfMonth.js
+function getWeekOfMonth(date, options) {
+ const defaultOptions2 = getDefaultOptions();
+ const weekStartsOn = options?.weekStartsOn ?? options?.locale?.options?.weekStartsOn ?? defaultOptions2.weekStartsOn ?? defaultOptions2.locale?.options?.weekStartsOn ?? 0;
+ const currentDayOfMonth = getDate(toDate(date, options?.in));
+ if (isNaN(currentDayOfMonth)) return NaN;
+ const startWeekDay = getDay(startOfMonth(date, options));
+ let lastDayOfFirstWeek = weekStartsOn - startWeekDay;
+ if (lastDayOfFirstWeek <= 0) lastDayOfFirstWeek += 7;
+ const remainingDaysAfterFirstWeek = currentDayOfMonth - lastDayOfFirstWeek;
+ return Math.ceil(remainingDaysAfterFirstWeek / 7) + 1;
+}
+var getWeekOfMonth_default;
+var init_getWeekOfMonth = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getWeekOfMonth.js"() {
+ init_defaultOptions();
+ init_getDate();
+ init_getDay();
+ init_startOfMonth();
+ init_toDate();
+ getWeekOfMonth_default = getWeekOfMonth;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/lastDayOfMonth.js
+function lastDayOfMonth(date, options) {
+ const _date = toDate(date, options?.in);
+ const month = _date.getMonth();
+ _date.setFullYear(_date.getFullYear(), month + 1, 0);
+ _date.setHours(0, 0, 0, 0);
+ return toDate(_date, options?.in);
+}
+var lastDayOfMonth_default;
+var init_lastDayOfMonth = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/lastDayOfMonth.js"() {
+ init_toDate();
+ lastDayOfMonth_default = lastDayOfMonth;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getWeeksInMonth.js
+function getWeeksInMonth(date, options) {
+ const contextDate = toDate(date, options?.in);
+ return differenceInCalendarWeeks(
+ lastDayOfMonth(contextDate, options),
+ startOfMonth(contextDate, options),
+ options
+ ) + 1;
+}
+var getWeeksInMonth_default;
+var init_getWeeksInMonth = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getWeeksInMonth.js"() {
+ init_differenceInCalendarWeeks();
+ init_lastDayOfMonth();
+ init_startOfMonth();
+ init_toDate();
+ getWeeksInMonth_default = getWeeksInMonth;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getYear.js
+function getYear(date, options) {
+ return toDate(date, options?.in).getFullYear();
+}
+var getYear_default;
+var init_getYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/getYear.js"() {
+ init_toDate();
+ getYear_default = getYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/hoursToMilliseconds.js
+function hoursToMilliseconds(hours) {
+ return Math.trunc(hours * millisecondsInHour);
+}
+var hoursToMilliseconds_default;
+var init_hoursToMilliseconds = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/hoursToMilliseconds.js"() {
+ init_constants();
+ hoursToMilliseconds_default = hoursToMilliseconds;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/hoursToMinutes.js
+function hoursToMinutes(hours) {
+ return Math.trunc(hours * minutesInHour);
+}
+var hoursToMinutes_default;
+var init_hoursToMinutes = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/hoursToMinutes.js"() {
+ init_constants();
+ hoursToMinutes_default = hoursToMinutes;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/hoursToSeconds.js
+function hoursToSeconds(hours) {
+ return Math.trunc(hours * secondsInHour);
+}
+var hoursToSeconds_default;
+var init_hoursToSeconds = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/hoursToSeconds.js"() {
+ init_constants();
+ hoursToSeconds_default = hoursToSeconds;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/interval.js
+function interval2(start, end3, options) {
+ const [_start, _end] = normalizeDates(options?.in, start, end3);
+ if (isNaN(+_start)) throw new TypeError("Start date is invalid");
+ if (isNaN(+_end)) throw new TypeError("End date is invalid");
+ if (options?.assertPositive && +_start > +_end)
+ throw new TypeError("End date must be after start date");
+ return { start: _start, end: _end };
+}
+var interval_default;
+var init_interval2 = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/interval.js"() {
+ init_normalizeDates();
+ interval_default = interval2;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/intervalToDuration.js
+function intervalToDuration(interval3, options) {
+ const { start, end: end3 } = normalizeInterval(options?.in, interval3);
+ const duration = {};
+ const years = differenceInYears(end3, start);
+ if (years) duration.years = years;
+ const remainingMonths = add(start, { years: duration.years });
+ const months2 = differenceInMonths(end3, remainingMonths);
+ if (months2) duration.months = months2;
+ const remainingDays = add(remainingMonths, { months: duration.months });
+ const days2 = differenceInDays(end3, remainingDays);
+ if (days2) duration.days = days2;
+ const remainingHours = add(remainingDays, { days: duration.days });
+ const hours = differenceInHours(end3, remainingHours);
+ if (hours) duration.hours = hours;
+ const remainingMinutes = add(remainingHours, { hours: duration.hours });
+ const minutes = differenceInMinutes(end3, remainingMinutes);
+ if (minutes) duration.minutes = minutes;
+ const remainingSeconds = add(remainingMinutes, { minutes: duration.minutes });
+ const seconds = differenceInSeconds(end3, remainingSeconds);
+ if (seconds) duration.seconds = seconds;
+ return duration;
+}
+var intervalToDuration_default;
+var init_intervalToDuration = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/intervalToDuration.js"() {
+ init_normalizeInterval();
+ init_add();
+ init_differenceInDays();
+ init_differenceInHours();
+ init_differenceInMinutes();
+ init_differenceInMonths();
+ init_differenceInSeconds();
+ init_differenceInYears();
+ intervalToDuration_default = intervalToDuration;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/intlFormat.js
+function intlFormat(date, formatOrLocale, localeOptions) {
+ let formatOptions;
+ if (isFormatOptions(formatOrLocale)) {
+ formatOptions = formatOrLocale;
+ } else {
+ localeOptions = formatOrLocale;
+ }
+ return new Intl.DateTimeFormat(localeOptions?.locale, formatOptions).format(
+ toDate(date)
+ );
+}
+function isFormatOptions(opts) {
+ return opts !== void 0 && !("locale" in opts);
+}
+var intlFormat_default;
+var init_intlFormat = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/intlFormat.js"() {
+ init_toDate();
+ intlFormat_default = intlFormat;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/intlFormatDistance.js
+function intlFormatDistance(laterDate, earlierDate, options) {
+ let value2 = 0;
+ let unit;
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ if (!options?.unit) {
+ const diffInSeconds = differenceInSeconds(laterDate_, earlierDate_);
+ if (Math.abs(diffInSeconds) < secondsInMinute) {
+ value2 = differenceInSeconds(laterDate_, earlierDate_);
+ unit = "second";
+ } else if (Math.abs(diffInSeconds) < secondsInHour) {
+ value2 = differenceInMinutes(laterDate_, earlierDate_);
+ unit = "minute";
+ } else if (Math.abs(diffInSeconds) < secondsInDay && Math.abs(differenceInCalendarDays(laterDate_, earlierDate_)) < 1) {
+ value2 = differenceInHours(laterDate_, earlierDate_);
+ unit = "hour";
+ } else if (Math.abs(diffInSeconds) < secondsInWeek && (value2 = differenceInCalendarDays(laterDate_, earlierDate_)) && Math.abs(value2) < 7) {
+ unit = "day";
+ } else if (Math.abs(diffInSeconds) < secondsInMonth) {
+ value2 = differenceInCalendarWeeks(laterDate_, earlierDate_);
+ unit = "week";
+ } else if (Math.abs(diffInSeconds) < secondsInQuarter) {
+ value2 = differenceInCalendarMonths(laterDate_, earlierDate_);
+ unit = "month";
+ } else if (Math.abs(diffInSeconds) < secondsInYear) {
+ if (differenceInCalendarQuarters(laterDate_, earlierDate_) < 4) {
+ value2 = differenceInCalendarQuarters(laterDate_, earlierDate_);
+ unit = "quarter";
+ } else {
+ value2 = differenceInCalendarYears(laterDate_, earlierDate_);
+ unit = "year";
+ }
+ } else {
+ value2 = differenceInCalendarYears(laterDate_, earlierDate_);
+ unit = "year";
+ }
+ } else {
+ unit = options?.unit;
+ if (unit === "second") {
+ value2 = differenceInSeconds(laterDate_, earlierDate_);
+ } else if (unit === "minute") {
+ value2 = differenceInMinutes(laterDate_, earlierDate_);
+ } else if (unit === "hour") {
+ value2 = differenceInHours(laterDate_, earlierDate_);
+ } else if (unit === "day") {
+ value2 = differenceInCalendarDays(laterDate_, earlierDate_);
+ } else if (unit === "week") {
+ value2 = differenceInCalendarWeeks(laterDate_, earlierDate_);
+ } else if (unit === "month") {
+ value2 = differenceInCalendarMonths(laterDate_, earlierDate_);
+ } else if (unit === "quarter") {
+ value2 = differenceInCalendarQuarters(laterDate_, earlierDate_);
+ } else if (unit === "year") {
+ value2 = differenceInCalendarYears(laterDate_, earlierDate_);
+ }
+ }
+ const rtf = new Intl.RelativeTimeFormat(options?.locale, {
+ numeric: "auto",
+ ...options
+ });
+ return rtf.format(value2, unit);
+}
+var intlFormatDistance_default;
+var init_intlFormatDistance = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/intlFormatDistance.js"() {
+ init_normalizeDates();
+ init_constants();
+ init_differenceInCalendarDays();
+ init_differenceInCalendarMonths();
+ init_differenceInCalendarQuarters();
+ init_differenceInCalendarWeeks();
+ init_differenceInCalendarYears();
+ init_differenceInHours();
+ init_differenceInMinutes();
+ init_differenceInSeconds();
+ intlFormatDistance_default = intlFormatDistance;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isAfter.js
+function isAfter(date, dateToCompare) {
+ return +toDate(date) > +toDate(dateToCompare);
+}
+var isAfter_default;
+var init_isAfter = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isAfter.js"() {
+ init_toDate();
+ isAfter_default = isAfter;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isBefore.js
+function isBefore(date, dateToCompare) {
+ return +toDate(date) < +toDate(dateToCompare);
+}
+var isBefore_default;
+var init_isBefore = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isBefore.js"() {
+ init_toDate();
+ isBefore_default = isBefore;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isEqual.js
+function isEqual(leftDate, rightDate) {
+ return +toDate(leftDate) === +toDate(rightDate);
+}
+var isEqual_default;
+var init_isEqual = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isEqual.js"() {
+ init_toDate();
+ isEqual_default = isEqual;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isExists.js
+function isExists(year, month, day) {
+ const date = new Date(year, month, day);
+ return date.getFullYear() === year && date.getMonth() === month && date.getDate() === day;
+}
+var isExists_default;
+var init_isExists = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isExists.js"() {
+ isExists_default = isExists;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isFirstDayOfMonth.js
+function isFirstDayOfMonth(date, options) {
+ return toDate(date, options?.in).getDate() === 1;
+}
+var isFirstDayOfMonth_default;
+var init_isFirstDayOfMonth = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isFirstDayOfMonth.js"() {
+ init_toDate();
+ isFirstDayOfMonth_default = isFirstDayOfMonth;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isFriday.js
+function isFriday(date, options) {
+ return toDate(date, options?.in).getDay() === 5;
+}
+var isFriday_default;
+var init_isFriday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isFriday.js"() {
+ init_toDate();
+ isFriday_default = isFriday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isFuture.js
+function isFuture(date) {
+ return +toDate(date) > Date.now();
+}
+var isFuture_default;
+var init_isFuture = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isFuture.js"() {
+ init_toDate();
+ isFuture_default = isFuture;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/transpose.js
+function transpose(date, constructor) {
+ const date_ = isConstructor(constructor) ? new constructor(0) : constructFrom(constructor, 0);
+ date_.setFullYear(date.getFullYear(), date.getMonth(), date.getDate());
+ date_.setHours(
+ date.getHours(),
+ date.getMinutes(),
+ date.getSeconds(),
+ date.getMilliseconds()
+ );
+ return date_;
+}
+function isConstructor(constructor) {
+ return typeof constructor === "function" && constructor.prototype?.constructor === constructor;
+}
+var transpose_default;
+var init_transpose = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/transpose.js"() {
+ init_constructFrom();
+ transpose_default = transpose;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/Setter.js
+var TIMEZONE_UNIT_PRIORITY, Setter, ValueSetter, DateTimezoneSetter;
+var init_Setter = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/Setter.js"() {
+ init_constructFrom();
+ init_transpose();
+ TIMEZONE_UNIT_PRIORITY = 10;
+ Setter = class {
+ subPriority = 0;
+ validate(_utcDate, _options) {
+ return true;
+ }
+ };
+ ValueSetter = class extends Setter {
+ constructor(value2, validateValue, setValue, priority, subPriority) {
+ super();
+ this.value = value2;
+ this.validateValue = validateValue;
+ this.setValue = setValue;
+ this.priority = priority;
+ if (subPriority) {
+ this.subPriority = subPriority;
+ }
+ }
+ validate(date, options) {
+ return this.validateValue(date, this.value, options);
+ }
+ set(date, flags, options) {
+ return this.setValue(date, flags, this.value, options);
+ }
+ };
+ DateTimezoneSetter = class extends Setter {
+ priority = TIMEZONE_UNIT_PRIORITY;
+ subPriority = -1;
+ constructor(context2, reference) {
+ super();
+ this.context = context2 || ((date) => constructFrom(reference, date));
+ }
+ set(date, flags) {
+ if (flags.timestampIsSet) return date;
+ return constructFrom(date, transpose(date, this.context));
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/Parser.js
+var Parser;
+var init_Parser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/Parser.js"() {
+ init_Setter();
+ Parser = class {
+ run(dateString, token, match2, options) {
+ const result = this.parse(dateString, token, match2, options);
+ if (!result) {
+ return null;
+ }
+ return {
+ setter: new ValueSetter(
+ result.value,
+ this.validate,
+ this.set,
+ this.priority,
+ this.subPriority
+ ),
+ rest: result.rest
+ };
+ }
+ validate(_utcDate, _value, _options) {
+ return true;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/EraParser.js
+var EraParser;
+var init_EraParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/EraParser.js"() {
+ init_Parser();
+ EraParser = class extends Parser {
+ priority = 140;
+ parse(dateString, token, match2) {
+ switch (token) {
+ // AD, BC
+ case "G":
+ case "GG":
+ case "GGG":
+ return match2.era(dateString, { width: "abbreviated" }) || match2.era(dateString, { width: "narrow" });
+ // A, B
+ case "GGGGG":
+ return match2.era(dateString, { width: "narrow" });
+ // Anno Domini, Before Christ
+ case "GGGG":
+ default:
+ return match2.era(dateString, { width: "wide" }) || match2.era(dateString, { width: "abbreviated" }) || match2.era(dateString, { width: "narrow" });
+ }
+ }
+ set(date, flags, value2) {
+ flags.era = value2;
+ date.setFullYear(value2, 0, 1);
+ date.setHours(0, 0, 0, 0);
+ return date;
+ }
+ incompatibleTokens = ["R", "u", "t", "T"];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/constants.js
+var numericPatterns, timezonePatterns;
+var init_constants2 = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/constants.js"() {
+ numericPatterns = {
+ month: /^(1[0-2]|0?\d)/,
+ // 0 to 12
+ date: /^(3[0-1]|[0-2]?\d)/,
+ // 0 to 31
+ dayOfYear: /^(36[0-6]|3[0-5]\d|[0-2]?\d?\d)/,
+ // 0 to 366
+ week: /^(5[0-3]|[0-4]?\d)/,
+ // 0 to 53
+ hour23h: /^(2[0-3]|[0-1]?\d)/,
+ // 0 to 23
+ hour24h: /^(2[0-4]|[0-1]?\d)/,
+ // 0 to 24
+ hour11h: /^(1[0-1]|0?\d)/,
+ // 0 to 11
+ hour12h: /^(1[0-2]|0?\d)/,
+ // 0 to 12
+ minute: /^[0-5]?\d/,
+ // 0 to 59
+ second: /^[0-5]?\d/,
+ // 0 to 59
+ singleDigit: /^\d/,
+ // 0 to 9
+ twoDigits: /^\d{1,2}/,
+ // 0 to 99
+ threeDigits: /^\d{1,3}/,
+ // 0 to 999
+ fourDigits: /^\d{1,4}/,
+ // 0 to 9999
+ anyDigitsSigned: /^-?\d+/,
+ singleDigitSigned: /^-?\d/,
+ // 0 to 9, -0 to -9
+ twoDigitsSigned: /^-?\d{1,2}/,
+ // 0 to 99, -0 to -99
+ threeDigitsSigned: /^-?\d{1,3}/,
+ // 0 to 999, -0 to -999
+ fourDigitsSigned: /^-?\d{1,4}/
+ // 0 to 9999, -0 to -9999
+ };
+ timezonePatterns = {
+ basicOptionalMinutes: /^([+-])(\d{2})(\d{2})?|Z/,
+ basic: /^([+-])(\d{2})(\d{2})|Z/,
+ basicOptionalSeconds: /^([+-])(\d{2})(\d{2})((\d{2}))?|Z/,
+ extended: /^([+-])(\d{2}):(\d{2})|Z/,
+ extendedOptionalSeconds: /^([+-])(\d{2}):(\d{2})(:(\d{2}))?|Z/
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/utils.js
+function mapValue(parseFnResult, mapFn) {
+ if (!parseFnResult) {
+ return parseFnResult;
+ }
+ return {
+ value: mapFn(parseFnResult.value),
+ rest: parseFnResult.rest
+ };
+}
+function parseNumericPattern(pattern, dateString) {
+ const matchResult = dateString.match(pattern);
+ if (!matchResult) {
+ return null;
+ }
+ return {
+ value: parseInt(matchResult[0], 10),
+ rest: dateString.slice(matchResult[0].length)
+ };
+}
+function parseTimezonePattern(pattern, dateString) {
+ const matchResult = dateString.match(pattern);
+ if (!matchResult) {
+ return null;
+ }
+ if (matchResult[0] === "Z") {
+ return {
+ value: 0,
+ rest: dateString.slice(1)
+ };
+ }
+ const sign = matchResult[1] === "+" ? 1 : -1;
+ const hours = matchResult[2] ? parseInt(matchResult[2], 10) : 0;
+ const minutes = matchResult[3] ? parseInt(matchResult[3], 10) : 0;
+ const seconds = matchResult[5] ? parseInt(matchResult[5], 10) : 0;
+ return {
+ value: sign * (hours * millisecondsInHour + minutes * millisecondsInMinute + seconds * millisecondsInSecond),
+ rest: dateString.slice(matchResult[0].length)
+ };
+}
+function parseAnyDigitsSigned(dateString) {
+ return parseNumericPattern(numericPatterns.anyDigitsSigned, dateString);
+}
+function parseNDigits(n12, dateString) {
+ switch (n12) {
+ case 1:
+ return parseNumericPattern(numericPatterns.singleDigit, dateString);
+ case 2:
+ return parseNumericPattern(numericPatterns.twoDigits, dateString);
+ case 3:
+ return parseNumericPattern(numericPatterns.threeDigits, dateString);
+ case 4:
+ return parseNumericPattern(numericPatterns.fourDigits, dateString);
+ default:
+ return parseNumericPattern(new RegExp("^\\d{1," + n12 + "}"), dateString);
+ }
+}
+function parseNDigitsSigned(n12, dateString) {
+ switch (n12) {
+ case 1:
+ return parseNumericPattern(numericPatterns.singleDigitSigned, dateString);
+ case 2:
+ return parseNumericPattern(numericPatterns.twoDigitsSigned, dateString);
+ case 3:
+ return parseNumericPattern(numericPatterns.threeDigitsSigned, dateString);
+ case 4:
+ return parseNumericPattern(numericPatterns.fourDigitsSigned, dateString);
+ default:
+ return parseNumericPattern(new RegExp("^-?\\d{1," + n12 + "}"), dateString);
+ }
+}
+function dayPeriodEnumToHours(dayPeriod) {
+ switch (dayPeriod) {
+ case "morning":
+ return 4;
+ case "evening":
+ return 17;
+ case "pm":
+ case "noon":
+ case "afternoon":
+ return 12;
+ case "am":
+ case "midnight":
+ case "night":
+ default:
+ return 0;
+ }
+}
+function normalizeTwoDigitYear(twoDigitYear, currentYear) {
+ const isCommonEra = currentYear > 0;
+ const absCurrentYear = isCommonEra ? currentYear : 1 - currentYear;
+ let result;
+ if (absCurrentYear <= 50) {
+ result = twoDigitYear || 100;
+ } else {
+ const rangeEnd = absCurrentYear + 50;
+ const rangeEndCentury = Math.trunc(rangeEnd / 100) * 100;
+ const isPreviousCentury = twoDigitYear >= rangeEnd % 100;
+ result = twoDigitYear + rangeEndCentury - (isPreviousCentury ? 100 : 0);
+ }
+ return isCommonEra ? result : 1 - result;
+}
+function isLeapYearIndex(year) {
+ return year % 400 === 0 || year % 4 === 0 && year % 100 !== 0;
+}
+var init_utils = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/utils.js"() {
+ init_constants();
+ init_constants2();
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/YearParser.js
+var YearParser;
+var init_YearParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/YearParser.js"() {
+ init_Parser();
+ init_utils();
+ YearParser = class extends Parser {
+ priority = 130;
+ incompatibleTokens = ["Y", "R", "u", "w", "I", "i", "e", "c", "t", "T"];
+ parse(dateString, token, match2) {
+ const valueCallback = (year) => ({
+ year,
+ isTwoDigitYear: token === "yy"
+ });
+ switch (token) {
+ case "y":
+ return mapValue(parseNDigits(4, dateString), valueCallback);
+ case "yo":
+ return mapValue(
+ match2.ordinalNumber(dateString, {
+ unit: "year"
+ }),
+ valueCallback
+ );
+ default:
+ return mapValue(parseNDigits(token.length, dateString), valueCallback);
+ }
+ }
+ validate(_date, value2) {
+ return value2.isTwoDigitYear || value2.year > 0;
+ }
+ set(date, flags, value2) {
+ const currentYear = date.getFullYear();
+ if (value2.isTwoDigitYear) {
+ const normalizedTwoDigitYear = normalizeTwoDigitYear(
+ value2.year,
+ currentYear
+ );
+ date.setFullYear(normalizedTwoDigitYear, 0, 1);
+ date.setHours(0, 0, 0, 0);
+ return date;
+ }
+ const year = !("era" in flags) || flags.era === 1 ? value2.year : 1 - value2.year;
+ date.setFullYear(year, 0, 1);
+ date.setHours(0, 0, 0, 0);
+ return date;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/LocalWeekYearParser.js
+var LocalWeekYearParser;
+var init_LocalWeekYearParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/LocalWeekYearParser.js"() {
+ init_getWeekYear();
+ init_startOfWeek();
+ init_Parser();
+ init_utils();
+ LocalWeekYearParser = class extends Parser {
+ priority = 130;
+ parse(dateString, token, match2) {
+ const valueCallback = (year) => ({
+ year,
+ isTwoDigitYear: token === "YY"
+ });
+ switch (token) {
+ case "Y":
+ return mapValue(parseNDigits(4, dateString), valueCallback);
+ case "Yo":
+ return mapValue(
+ match2.ordinalNumber(dateString, {
+ unit: "year"
+ }),
+ valueCallback
+ );
+ default:
+ return mapValue(parseNDigits(token.length, dateString), valueCallback);
+ }
+ }
+ validate(_date, value2) {
+ return value2.isTwoDigitYear || value2.year > 0;
+ }
+ set(date, flags, value2, options) {
+ const currentYear = getWeekYear(date, options);
+ if (value2.isTwoDigitYear) {
+ const normalizedTwoDigitYear = normalizeTwoDigitYear(
+ value2.year,
+ currentYear
+ );
+ date.setFullYear(
+ normalizedTwoDigitYear,
+ 0,
+ options.firstWeekContainsDate
+ );
+ date.setHours(0, 0, 0, 0);
+ return startOfWeek(date, options);
+ }
+ const year = !("era" in flags) || flags.era === 1 ? value2.year : 1 - value2.year;
+ date.setFullYear(year, 0, options.firstWeekContainsDate);
+ date.setHours(0, 0, 0, 0);
+ return startOfWeek(date, options);
+ }
+ incompatibleTokens = [
+ "y",
+ "R",
+ "u",
+ "Q",
+ "q",
+ "M",
+ "L",
+ "I",
+ "d",
+ "D",
+ "i",
+ "t",
+ "T"
+ ];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/ISOWeekYearParser.js
+var ISOWeekYearParser;
+var init_ISOWeekYearParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/ISOWeekYearParser.js"() {
+ init_startOfISOWeek();
+ init_constructFrom();
+ init_Parser();
+ init_utils();
+ ISOWeekYearParser = class extends Parser {
+ priority = 130;
+ parse(dateString, token) {
+ if (token === "R") {
+ return parseNDigitsSigned(4, dateString);
+ }
+ return parseNDigitsSigned(token.length, dateString);
+ }
+ set(date, _flags, value2) {
+ const firstWeekOfYear = constructFrom(date, 0);
+ firstWeekOfYear.setFullYear(value2, 0, 4);
+ firstWeekOfYear.setHours(0, 0, 0, 0);
+ return startOfISOWeek(firstWeekOfYear);
+ }
+ incompatibleTokens = [
+ "G",
+ "y",
+ "Y",
+ "u",
+ "Q",
+ "q",
+ "M",
+ "L",
+ "w",
+ "d",
+ "D",
+ "e",
+ "c",
+ "t",
+ "T"
+ ];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/ExtendedYearParser.js
+var ExtendedYearParser;
+var init_ExtendedYearParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/ExtendedYearParser.js"() {
+ init_Parser();
+ init_utils();
+ ExtendedYearParser = class extends Parser {
+ priority = 130;
+ parse(dateString, token) {
+ if (token === "u") {
+ return parseNDigitsSigned(4, dateString);
+ }
+ return parseNDigitsSigned(token.length, dateString);
+ }
+ set(date, _flags, value2) {
+ date.setFullYear(value2, 0, 1);
+ date.setHours(0, 0, 0, 0);
+ return date;
+ }
+ incompatibleTokens = ["G", "y", "Y", "R", "w", "I", "i", "e", "c", "t", "T"];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/QuarterParser.js
+var QuarterParser;
+var init_QuarterParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/QuarterParser.js"() {
+ init_Parser();
+ init_utils();
+ QuarterParser = class extends Parser {
+ priority = 120;
+ parse(dateString, token, match2) {
+ switch (token) {
+ // 1, 2, 3, 4
+ case "Q":
+ case "QQ":
+ return parseNDigits(token.length, dateString);
+ // 1st, 2nd, 3rd, 4th
+ case "Qo":
+ return match2.ordinalNumber(dateString, { unit: "quarter" });
+ // Q1, Q2, Q3, Q4
+ case "QQQ":
+ return match2.quarter(dateString, {
+ width: "abbreviated",
+ context: "formatting"
+ }) || match2.quarter(dateString, {
+ width: "narrow",
+ context: "formatting"
+ });
+ // 1, 2, 3, 4 (narrow quarter; could be not numerical)
+ case "QQQQQ":
+ return match2.quarter(dateString, {
+ width: "narrow",
+ context: "formatting"
+ });
+ // 1st quarter, 2nd quarter, ...
+ case "QQQQ":
+ default:
+ return match2.quarter(dateString, {
+ width: "wide",
+ context: "formatting"
+ }) || match2.quarter(dateString, {
+ width: "abbreviated",
+ context: "formatting"
+ }) || match2.quarter(dateString, {
+ width: "narrow",
+ context: "formatting"
+ });
+ }
+ }
+ validate(_date, value2) {
+ return value2 >= 1 && value2 <= 4;
+ }
+ set(date, _flags, value2) {
+ date.setMonth((value2 - 1) * 3, 1);
+ date.setHours(0, 0, 0, 0);
+ return date;
+ }
+ incompatibleTokens = [
+ "Y",
+ "R",
+ "q",
+ "M",
+ "L",
+ "w",
+ "I",
+ "d",
+ "D",
+ "i",
+ "e",
+ "c",
+ "t",
+ "T"
+ ];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/StandAloneQuarterParser.js
+var StandAloneQuarterParser;
+var init_StandAloneQuarterParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/StandAloneQuarterParser.js"() {
+ init_Parser();
+ init_utils();
+ StandAloneQuarterParser = class extends Parser {
+ priority = 120;
+ parse(dateString, token, match2) {
+ switch (token) {
+ // 1, 2, 3, 4
+ case "q":
+ case "qq":
+ return parseNDigits(token.length, dateString);
+ // 1st, 2nd, 3rd, 4th
+ case "qo":
+ return match2.ordinalNumber(dateString, { unit: "quarter" });
+ // Q1, Q2, Q3, Q4
+ case "qqq":
+ return match2.quarter(dateString, {
+ width: "abbreviated",
+ context: "standalone"
+ }) || match2.quarter(dateString, {
+ width: "narrow",
+ context: "standalone"
+ });
+ // 1, 2, 3, 4 (narrow quarter; could be not numerical)
+ case "qqqqq":
+ return match2.quarter(dateString, {
+ width: "narrow",
+ context: "standalone"
+ });
+ // 1st quarter, 2nd quarter, ...
+ case "qqqq":
+ default:
+ return match2.quarter(dateString, {
+ width: "wide",
+ context: "standalone"
+ }) || match2.quarter(dateString, {
+ width: "abbreviated",
+ context: "standalone"
+ }) || match2.quarter(dateString, {
+ width: "narrow",
+ context: "standalone"
+ });
+ }
+ }
+ validate(_date, value2) {
+ return value2 >= 1 && value2 <= 4;
+ }
+ set(date, _flags, value2) {
+ date.setMonth((value2 - 1) * 3, 1);
+ date.setHours(0, 0, 0, 0);
+ return date;
+ }
+ incompatibleTokens = [
+ "Y",
+ "R",
+ "Q",
+ "M",
+ "L",
+ "w",
+ "I",
+ "d",
+ "D",
+ "i",
+ "e",
+ "c",
+ "t",
+ "T"
+ ];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/MonthParser.js
+var MonthParser;
+var init_MonthParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/MonthParser.js"() {
+ init_constants2();
+ init_Parser();
+ init_utils();
+ MonthParser = class extends Parser {
+ incompatibleTokens = [
+ "Y",
+ "R",
+ "q",
+ "Q",
+ "L",
+ "w",
+ "I",
+ "D",
+ "i",
+ "e",
+ "c",
+ "t",
+ "T"
+ ];
+ priority = 110;
+ parse(dateString, token, match2) {
+ const valueCallback = (value2) => value2 - 1;
+ switch (token) {
+ // 1, 2, ..., 12
+ case "M":
+ return mapValue(
+ parseNumericPattern(numericPatterns.month, dateString),
+ valueCallback
+ );
+ // 01, 02, ..., 12
+ case "MM":
+ return mapValue(parseNDigits(2, dateString), valueCallback);
+ // 1st, 2nd, ..., 12th
+ case "Mo":
+ return mapValue(
+ match2.ordinalNumber(dateString, {
+ unit: "month"
+ }),
+ valueCallback
+ );
+ // Jan, Feb, ..., Dec
+ case "MMM":
+ return match2.month(dateString, {
+ width: "abbreviated",
+ context: "formatting"
+ }) || match2.month(dateString, { width: "narrow", context: "formatting" });
+ // J, F, ..., D
+ case "MMMMM":
+ return match2.month(dateString, {
+ width: "narrow",
+ context: "formatting"
+ });
+ // January, February, ..., December
+ case "MMMM":
+ default:
+ return match2.month(dateString, { width: "wide", context: "formatting" }) || match2.month(dateString, {
+ width: "abbreviated",
+ context: "formatting"
+ }) || match2.month(dateString, { width: "narrow", context: "formatting" });
+ }
+ }
+ validate(_date, value2) {
+ return value2 >= 0 && value2 <= 11;
+ }
+ set(date, _flags, value2) {
+ date.setMonth(value2, 1);
+ date.setHours(0, 0, 0, 0);
+ return date;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/StandAloneMonthParser.js
+var StandAloneMonthParser;
+var init_StandAloneMonthParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/StandAloneMonthParser.js"() {
+ init_constants2();
+ init_Parser();
+ init_utils();
+ StandAloneMonthParser = class extends Parser {
+ priority = 110;
+ parse(dateString, token, match2) {
+ const valueCallback = (value2) => value2 - 1;
+ switch (token) {
+ // 1, 2, ..., 12
+ case "L":
+ return mapValue(
+ parseNumericPattern(numericPatterns.month, dateString),
+ valueCallback
+ );
+ // 01, 02, ..., 12
+ case "LL":
+ return mapValue(parseNDigits(2, dateString), valueCallback);
+ // 1st, 2nd, ..., 12th
+ case "Lo":
+ return mapValue(
+ match2.ordinalNumber(dateString, {
+ unit: "month"
+ }),
+ valueCallback
+ );
+ // Jan, Feb, ..., Dec
+ case "LLL":
+ return match2.month(dateString, {
+ width: "abbreviated",
+ context: "standalone"
+ }) || match2.month(dateString, { width: "narrow", context: "standalone" });
+ // J, F, ..., D
+ case "LLLLL":
+ return match2.month(dateString, {
+ width: "narrow",
+ context: "standalone"
+ });
+ // January, February, ..., December
+ case "LLLL":
+ default:
+ return match2.month(dateString, { width: "wide", context: "standalone" }) || match2.month(dateString, {
+ width: "abbreviated",
+ context: "standalone"
+ }) || match2.month(dateString, { width: "narrow", context: "standalone" });
+ }
+ }
+ validate(_date, value2) {
+ return value2 >= 0 && value2 <= 11;
+ }
+ set(date, _flags, value2) {
+ date.setMonth(value2, 1);
+ date.setHours(0, 0, 0, 0);
+ return date;
+ }
+ incompatibleTokens = [
+ "Y",
+ "R",
+ "q",
+ "Q",
+ "M",
+ "w",
+ "I",
+ "D",
+ "i",
+ "e",
+ "c",
+ "t",
+ "T"
+ ];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setWeek.js
+function setWeek(date, week, options) {
+ const date_ = toDate(date, options?.in);
+ const diff = getWeek(date_, options) - week;
+ date_.setDate(date_.getDate() - diff * 7);
+ return toDate(date_, options?.in);
+}
+var setWeek_default;
+var init_setWeek = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setWeek.js"() {
+ init_getWeek();
+ init_toDate();
+ setWeek_default = setWeek;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/LocalWeekParser.js
+var LocalWeekParser;
+var init_LocalWeekParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/LocalWeekParser.js"() {
+ init_setWeek();
+ init_startOfWeek();
+ init_constants2();
+ init_Parser();
+ init_utils();
+ LocalWeekParser = class extends Parser {
+ priority = 100;
+ parse(dateString, token, match2) {
+ switch (token) {
+ case "w":
+ return parseNumericPattern(numericPatterns.week, dateString);
+ case "wo":
+ return match2.ordinalNumber(dateString, { unit: "week" });
+ default:
+ return parseNDigits(token.length, dateString);
+ }
+ }
+ validate(_date, value2) {
+ return value2 >= 1 && value2 <= 53;
+ }
+ set(date, _flags, value2, options) {
+ return startOfWeek(setWeek(date, value2, options), options);
+ }
+ incompatibleTokens = [
+ "y",
+ "R",
+ "u",
+ "q",
+ "Q",
+ "M",
+ "L",
+ "I",
+ "d",
+ "D",
+ "i",
+ "t",
+ "T"
+ ];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setISOWeek.js
+function setISOWeek(date, week, options) {
+ const _date = toDate(date, options?.in);
+ const diff = getISOWeek(_date, options) - week;
+ _date.setDate(_date.getDate() - diff * 7);
+ return _date;
+}
+var setISOWeek_default;
+var init_setISOWeek = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setISOWeek.js"() {
+ init_getISOWeek();
+ init_toDate();
+ setISOWeek_default = setISOWeek;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/ISOWeekParser.js
+var ISOWeekParser;
+var init_ISOWeekParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/ISOWeekParser.js"() {
+ init_setISOWeek();
+ init_startOfISOWeek();
+ init_constants2();
+ init_Parser();
+ init_utils();
+ ISOWeekParser = class extends Parser {
+ priority = 100;
+ parse(dateString, token, match2) {
+ switch (token) {
+ case "I":
+ return parseNumericPattern(numericPatterns.week, dateString);
+ case "Io":
+ return match2.ordinalNumber(dateString, { unit: "week" });
+ default:
+ return parseNDigits(token.length, dateString);
+ }
+ }
+ validate(_date, value2) {
+ return value2 >= 1 && value2 <= 53;
+ }
+ set(date, _flags, value2) {
+ return startOfISOWeek(setISOWeek(date, value2));
+ }
+ incompatibleTokens = [
+ "y",
+ "Y",
+ "u",
+ "q",
+ "Q",
+ "M",
+ "L",
+ "w",
+ "d",
+ "D",
+ "e",
+ "c",
+ "t",
+ "T"
+ ];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/DateParser.js
+var DAYS_IN_MONTH, DAYS_IN_MONTH_LEAP_YEAR, DateParser;
+var init_DateParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/DateParser.js"() {
+ init_constants2();
+ init_Parser();
+ init_utils();
+ DAYS_IN_MONTH = [31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31];
+ DAYS_IN_MONTH_LEAP_YEAR = [
+ 31,
+ 29,
+ 31,
+ 30,
+ 31,
+ 30,
+ 31,
+ 31,
+ 30,
+ 31,
+ 30,
+ 31
+ ];
+ DateParser = class extends Parser {
+ priority = 90;
+ subPriority = 1;
+ parse(dateString, token, match2) {
+ switch (token) {
+ case "d":
+ return parseNumericPattern(numericPatterns.date, dateString);
+ case "do":
+ return match2.ordinalNumber(dateString, { unit: "date" });
+ default:
+ return parseNDigits(token.length, dateString);
+ }
+ }
+ validate(date, value2) {
+ const year = date.getFullYear();
+ const isLeapYear2 = isLeapYearIndex(year);
+ const month = date.getMonth();
+ if (isLeapYear2) {
+ return value2 >= 1 && value2 <= DAYS_IN_MONTH_LEAP_YEAR[month];
+ } else {
+ return value2 >= 1 && value2 <= DAYS_IN_MONTH[month];
+ }
+ }
+ set(date, _flags, value2) {
+ date.setDate(value2);
+ date.setHours(0, 0, 0, 0);
+ return date;
+ }
+ incompatibleTokens = [
+ "Y",
+ "R",
+ "q",
+ "Q",
+ "w",
+ "I",
+ "D",
+ "i",
+ "e",
+ "c",
+ "t",
+ "T"
+ ];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/DayOfYearParser.js
+var DayOfYearParser;
+var init_DayOfYearParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/DayOfYearParser.js"() {
+ init_constants2();
+ init_Parser();
+ init_utils();
+ DayOfYearParser = class extends Parser {
+ priority = 90;
+ subpriority = 1;
+ parse(dateString, token, match2) {
+ switch (token) {
+ case "D":
+ case "DD":
+ return parseNumericPattern(numericPatterns.dayOfYear, dateString);
+ case "Do":
+ return match2.ordinalNumber(dateString, { unit: "date" });
+ default:
+ return parseNDigits(token.length, dateString);
+ }
+ }
+ validate(date, value2) {
+ const year = date.getFullYear();
+ const isLeapYear2 = isLeapYearIndex(year);
+ if (isLeapYear2) {
+ return value2 >= 1 && value2 <= 366;
+ } else {
+ return value2 >= 1 && value2 <= 365;
+ }
+ }
+ set(date, _flags, value2) {
+ date.setMonth(0, value2);
+ date.setHours(0, 0, 0, 0);
+ return date;
+ }
+ incompatibleTokens = [
+ "Y",
+ "R",
+ "q",
+ "Q",
+ "M",
+ "L",
+ "w",
+ "I",
+ "d",
+ "E",
+ "i",
+ "e",
+ "c",
+ "t",
+ "T"
+ ];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setDay.js
+function setDay(date, day, options) {
+ const defaultOptions2 = getDefaultOptions();
+ const weekStartsOn = options?.weekStartsOn ?? options?.locale?.options?.weekStartsOn ?? defaultOptions2.weekStartsOn ?? defaultOptions2.locale?.options?.weekStartsOn ?? 0;
+ const date_ = toDate(date, options?.in);
+ const currentDay = date_.getDay();
+ const remainder = day % 7;
+ const dayIndex = (remainder + 7) % 7;
+ const delta = 7 - weekStartsOn;
+ const diff = day < 0 || day > 6 ? day - (currentDay + delta) % 7 : (dayIndex + delta) % 7 - (currentDay + delta) % 7;
+ return addDays(date_, diff, options);
+}
+var setDay_default;
+var init_setDay = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setDay.js"() {
+ init_defaultOptions();
+ init_addDays();
+ init_toDate();
+ setDay_default = setDay;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/DayParser.js
+var DayParser;
+var init_DayParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/DayParser.js"() {
+ init_setDay();
+ init_Parser();
+ DayParser = class extends Parser {
+ priority = 90;
+ parse(dateString, token, match2) {
+ switch (token) {
+ // Tue
+ case "E":
+ case "EE":
+ case "EEE":
+ return match2.day(dateString, {
+ width: "abbreviated",
+ context: "formatting"
+ }) || match2.day(dateString, { width: "short", context: "formatting" }) || match2.day(dateString, { width: "narrow", context: "formatting" });
+ // T
+ case "EEEEE":
+ return match2.day(dateString, {
+ width: "narrow",
+ context: "formatting"
+ });
+ // Tu
+ case "EEEEEE":
+ return match2.day(dateString, { width: "short", context: "formatting" }) || match2.day(dateString, { width: "narrow", context: "formatting" });
+ // Tuesday
+ case "EEEE":
+ default:
+ return match2.day(dateString, { width: "wide", context: "formatting" }) || match2.day(dateString, {
+ width: "abbreviated",
+ context: "formatting"
+ }) || match2.day(dateString, { width: "short", context: "formatting" }) || match2.day(dateString, { width: "narrow", context: "formatting" });
+ }
+ }
+ validate(_date, value2) {
+ return value2 >= 0 && value2 <= 6;
+ }
+ set(date, _flags, value2, options) {
+ date = setDay(date, value2, options);
+ date.setHours(0, 0, 0, 0);
+ return date;
+ }
+ incompatibleTokens = ["D", "i", "e", "c", "t", "T"];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/LocalDayParser.js
+var LocalDayParser;
+var init_LocalDayParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/LocalDayParser.js"() {
+ init_setDay();
+ init_Parser();
+ init_utils();
+ LocalDayParser = class extends Parser {
+ priority = 90;
+ parse(dateString, token, match2, options) {
+ const valueCallback = (value2) => {
+ const wholeWeekDays = Math.floor((value2 - 1) / 7) * 7;
+ return (value2 + options.weekStartsOn + 6) % 7 + wholeWeekDays;
+ };
+ switch (token) {
+ // 3
+ case "e":
+ case "ee":
+ return mapValue(parseNDigits(token.length, dateString), valueCallback);
+ // 3rd
+ case "eo":
+ return mapValue(
+ match2.ordinalNumber(dateString, {
+ unit: "day"
+ }),
+ valueCallback
+ );
+ // Tue
+ case "eee":
+ return match2.day(dateString, {
+ width: "abbreviated",
+ context: "formatting"
+ }) || match2.day(dateString, { width: "short", context: "formatting" }) || match2.day(dateString, { width: "narrow", context: "formatting" });
+ // T
+ case "eeeee":
+ return match2.day(dateString, {
+ width: "narrow",
+ context: "formatting"
+ });
+ // Tu
+ case "eeeeee":
+ return match2.day(dateString, { width: "short", context: "formatting" }) || match2.day(dateString, { width: "narrow", context: "formatting" });
+ // Tuesday
+ case "eeee":
+ default:
+ return match2.day(dateString, { width: "wide", context: "formatting" }) || match2.day(dateString, {
+ width: "abbreviated",
+ context: "formatting"
+ }) || match2.day(dateString, { width: "short", context: "formatting" }) || match2.day(dateString, { width: "narrow", context: "formatting" });
+ }
+ }
+ validate(_date, value2) {
+ return value2 >= 0 && value2 <= 6;
+ }
+ set(date, _flags, value2, options) {
+ date = setDay(date, value2, options);
+ date.setHours(0, 0, 0, 0);
+ return date;
+ }
+ incompatibleTokens = [
+ "y",
+ "R",
+ "u",
+ "q",
+ "Q",
+ "M",
+ "L",
+ "I",
+ "d",
+ "D",
+ "E",
+ "i",
+ "c",
+ "t",
+ "T"
+ ];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/StandAloneLocalDayParser.js
+var StandAloneLocalDayParser;
+var init_StandAloneLocalDayParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/StandAloneLocalDayParser.js"() {
+ init_setDay();
+ init_Parser();
+ init_utils();
+ StandAloneLocalDayParser = class extends Parser {
+ priority = 90;
+ parse(dateString, token, match2, options) {
+ const valueCallback = (value2) => {
+ const wholeWeekDays = Math.floor((value2 - 1) / 7) * 7;
+ return (value2 + options.weekStartsOn + 6) % 7 + wholeWeekDays;
+ };
+ switch (token) {
+ // 3
+ case "c":
+ case "cc":
+ return mapValue(parseNDigits(token.length, dateString), valueCallback);
+ // 3rd
+ case "co":
+ return mapValue(
+ match2.ordinalNumber(dateString, {
+ unit: "day"
+ }),
+ valueCallback
+ );
+ // Tue
+ case "ccc":
+ return match2.day(dateString, {
+ width: "abbreviated",
+ context: "standalone"
+ }) || match2.day(dateString, { width: "short", context: "standalone" }) || match2.day(dateString, { width: "narrow", context: "standalone" });
+ // T
+ case "ccccc":
+ return match2.day(dateString, {
+ width: "narrow",
+ context: "standalone"
+ });
+ // Tu
+ case "cccccc":
+ return match2.day(dateString, { width: "short", context: "standalone" }) || match2.day(dateString, { width: "narrow", context: "standalone" });
+ // Tuesday
+ case "cccc":
+ default:
+ return match2.day(dateString, { width: "wide", context: "standalone" }) || match2.day(dateString, {
+ width: "abbreviated",
+ context: "standalone"
+ }) || match2.day(dateString, { width: "short", context: "standalone" }) || match2.day(dateString, { width: "narrow", context: "standalone" });
+ }
+ }
+ validate(_date, value2) {
+ return value2 >= 0 && value2 <= 6;
+ }
+ set(date, _flags, value2, options) {
+ date = setDay(date, value2, options);
+ date.setHours(0, 0, 0, 0);
+ return date;
+ }
+ incompatibleTokens = [
+ "y",
+ "R",
+ "u",
+ "q",
+ "Q",
+ "M",
+ "L",
+ "I",
+ "d",
+ "D",
+ "E",
+ "i",
+ "e",
+ "t",
+ "T"
+ ];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setISODay.js
+function setISODay(date, day, options) {
+ const date_ = toDate(date, options?.in);
+ const currentDay = getISODay(date_, options);
+ const diff = day - currentDay;
+ return addDays(date_, diff, options);
+}
+var setISODay_default;
+var init_setISODay = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setISODay.js"() {
+ init_addDays();
+ init_getISODay();
+ init_toDate();
+ setISODay_default = setISODay;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/ISODayParser.js
+var ISODayParser;
+var init_ISODayParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/ISODayParser.js"() {
+ init_setISODay();
+ init_Parser();
+ init_utils();
+ ISODayParser = class extends Parser {
+ priority = 90;
+ parse(dateString, token, match2) {
+ const valueCallback = (value2) => {
+ if (value2 === 0) {
+ return 7;
+ }
+ return value2;
+ };
+ switch (token) {
+ // 2
+ case "i":
+ case "ii":
+ return parseNDigits(token.length, dateString);
+ // 2nd
+ case "io":
+ return match2.ordinalNumber(dateString, { unit: "day" });
+ // Tue
+ case "iii":
+ return mapValue(
+ match2.day(dateString, {
+ width: "abbreviated",
+ context: "formatting"
+ }) || match2.day(dateString, {
+ width: "short",
+ context: "formatting"
+ }) || match2.day(dateString, {
+ width: "narrow",
+ context: "formatting"
+ }),
+ valueCallback
+ );
+ // T
+ case "iiiii":
+ return mapValue(
+ match2.day(dateString, {
+ width: "narrow",
+ context: "formatting"
+ }),
+ valueCallback
+ );
+ // Tu
+ case "iiiiii":
+ return mapValue(
+ match2.day(dateString, {
+ width: "short",
+ context: "formatting"
+ }) || match2.day(dateString, {
+ width: "narrow",
+ context: "formatting"
+ }),
+ valueCallback
+ );
+ // Tuesday
+ case "iiii":
+ default:
+ return mapValue(
+ match2.day(dateString, {
+ width: "wide",
+ context: "formatting"
+ }) || match2.day(dateString, {
+ width: "abbreviated",
+ context: "formatting"
+ }) || match2.day(dateString, {
+ width: "short",
+ context: "formatting"
+ }) || match2.day(dateString, {
+ width: "narrow",
+ context: "formatting"
+ }),
+ valueCallback
+ );
+ }
+ }
+ validate(_date, value2) {
+ return value2 >= 1 && value2 <= 7;
+ }
+ set(date, _flags, value2) {
+ date = setISODay(date, value2);
+ date.setHours(0, 0, 0, 0);
+ return date;
+ }
+ incompatibleTokens = [
+ "y",
+ "Y",
+ "u",
+ "q",
+ "Q",
+ "M",
+ "L",
+ "w",
+ "d",
+ "D",
+ "E",
+ "e",
+ "c",
+ "t",
+ "T"
+ ];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/AMPMParser.js
+var AMPMParser;
+var init_AMPMParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/AMPMParser.js"() {
+ init_Parser();
+ init_utils();
+ AMPMParser = class extends Parser {
+ priority = 80;
+ parse(dateString, token, match2) {
+ switch (token) {
+ case "a":
+ case "aa":
+ case "aaa":
+ return match2.dayPeriod(dateString, {
+ width: "abbreviated",
+ context: "formatting"
+ }) || match2.dayPeriod(dateString, {
+ width: "narrow",
+ context: "formatting"
+ });
+ case "aaaaa":
+ return match2.dayPeriod(dateString, {
+ width: "narrow",
+ context: "formatting"
+ });
+ case "aaaa":
+ default:
+ return match2.dayPeriod(dateString, {
+ width: "wide",
+ context: "formatting"
+ }) || match2.dayPeriod(dateString, {
+ width: "abbreviated",
+ context: "formatting"
+ }) || match2.dayPeriod(dateString, {
+ width: "narrow",
+ context: "formatting"
+ });
+ }
+ }
+ set(date, _flags, value2) {
+ date.setHours(dayPeriodEnumToHours(value2), 0, 0, 0);
+ return date;
+ }
+ incompatibleTokens = ["b", "B", "H", "k", "t", "T"];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/AMPMMidnightParser.js
+var AMPMMidnightParser;
+var init_AMPMMidnightParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/AMPMMidnightParser.js"() {
+ init_Parser();
+ init_utils();
+ AMPMMidnightParser = class extends Parser {
+ priority = 80;
+ parse(dateString, token, match2) {
+ switch (token) {
+ case "b":
+ case "bb":
+ case "bbb":
+ return match2.dayPeriod(dateString, {
+ width: "abbreviated",
+ context: "formatting"
+ }) || match2.dayPeriod(dateString, {
+ width: "narrow",
+ context: "formatting"
+ });
+ case "bbbbb":
+ return match2.dayPeriod(dateString, {
+ width: "narrow",
+ context: "formatting"
+ });
+ case "bbbb":
+ default:
+ return match2.dayPeriod(dateString, {
+ width: "wide",
+ context: "formatting"
+ }) || match2.dayPeriod(dateString, {
+ width: "abbreviated",
+ context: "formatting"
+ }) || match2.dayPeriod(dateString, {
+ width: "narrow",
+ context: "formatting"
+ });
+ }
+ }
+ set(date, _flags, value2) {
+ date.setHours(dayPeriodEnumToHours(value2), 0, 0, 0);
+ return date;
+ }
+ incompatibleTokens = ["a", "B", "H", "k", "t", "T"];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/DayPeriodParser.js
+var DayPeriodParser;
+var init_DayPeriodParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/DayPeriodParser.js"() {
+ init_Parser();
+ init_utils();
+ DayPeriodParser = class extends Parser {
+ priority = 80;
+ parse(dateString, token, match2) {
+ switch (token) {
+ case "B":
+ case "BB":
+ case "BBB":
+ return match2.dayPeriod(dateString, {
+ width: "abbreviated",
+ context: "formatting"
+ }) || match2.dayPeriod(dateString, {
+ width: "narrow",
+ context: "formatting"
+ });
+ case "BBBBB":
+ return match2.dayPeriod(dateString, {
+ width: "narrow",
+ context: "formatting"
+ });
+ case "BBBB":
+ default:
+ return match2.dayPeriod(dateString, {
+ width: "wide",
+ context: "formatting"
+ }) || match2.dayPeriod(dateString, {
+ width: "abbreviated",
+ context: "formatting"
+ }) || match2.dayPeriod(dateString, {
+ width: "narrow",
+ context: "formatting"
+ });
+ }
+ }
+ set(date, _flags, value2) {
+ date.setHours(dayPeriodEnumToHours(value2), 0, 0, 0);
+ return date;
+ }
+ incompatibleTokens = ["a", "b", "t", "T"];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/Hour1to12Parser.js
+var Hour1to12Parser;
+var init_Hour1to12Parser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/Hour1to12Parser.js"() {
+ init_constants2();
+ init_Parser();
+ init_utils();
+ Hour1to12Parser = class extends Parser {
+ priority = 70;
+ parse(dateString, token, match2) {
+ switch (token) {
+ case "h":
+ return parseNumericPattern(numericPatterns.hour12h, dateString);
+ case "ho":
+ return match2.ordinalNumber(dateString, { unit: "hour" });
+ default:
+ return parseNDigits(token.length, dateString);
+ }
+ }
+ validate(_date, value2) {
+ return value2 >= 1 && value2 <= 12;
+ }
+ set(date, _flags, value2) {
+ const isPM = date.getHours() >= 12;
+ if (isPM && value2 < 12) {
+ date.setHours(value2 + 12, 0, 0, 0);
+ } else if (!isPM && value2 === 12) {
+ date.setHours(0, 0, 0, 0);
+ } else {
+ date.setHours(value2, 0, 0, 0);
+ }
+ return date;
+ }
+ incompatibleTokens = ["H", "K", "k", "t", "T"];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/Hour0to23Parser.js
+var Hour0to23Parser;
+var init_Hour0to23Parser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/Hour0to23Parser.js"() {
+ init_constants2();
+ init_Parser();
+ init_utils();
+ Hour0to23Parser = class extends Parser {
+ priority = 70;
+ parse(dateString, token, match2) {
+ switch (token) {
+ case "H":
+ return parseNumericPattern(numericPatterns.hour23h, dateString);
+ case "Ho":
+ return match2.ordinalNumber(dateString, { unit: "hour" });
+ default:
+ return parseNDigits(token.length, dateString);
+ }
+ }
+ validate(_date, value2) {
+ return value2 >= 0 && value2 <= 23;
+ }
+ set(date, _flags, value2) {
+ date.setHours(value2, 0, 0, 0);
+ return date;
+ }
+ incompatibleTokens = ["a", "b", "h", "K", "k", "t", "T"];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/Hour0To11Parser.js
+var Hour0To11Parser;
+var init_Hour0To11Parser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/Hour0To11Parser.js"() {
+ init_constants2();
+ init_Parser();
+ init_utils();
+ Hour0To11Parser = class extends Parser {
+ priority = 70;
+ parse(dateString, token, match2) {
+ switch (token) {
+ case "K":
+ return parseNumericPattern(numericPatterns.hour11h, dateString);
+ case "Ko":
+ return match2.ordinalNumber(dateString, { unit: "hour" });
+ default:
+ return parseNDigits(token.length, dateString);
+ }
+ }
+ validate(_date, value2) {
+ return value2 >= 0 && value2 <= 11;
+ }
+ set(date, _flags, value2) {
+ const isPM = date.getHours() >= 12;
+ if (isPM && value2 < 12) {
+ date.setHours(value2 + 12, 0, 0, 0);
+ } else {
+ date.setHours(value2, 0, 0, 0);
+ }
+ return date;
+ }
+ incompatibleTokens = ["h", "H", "k", "t", "T"];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/Hour1To24Parser.js
+var Hour1To24Parser;
+var init_Hour1To24Parser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/Hour1To24Parser.js"() {
+ init_constants2();
+ init_Parser();
+ init_utils();
+ Hour1To24Parser = class extends Parser {
+ priority = 70;
+ parse(dateString, token, match2) {
+ switch (token) {
+ case "k":
+ return parseNumericPattern(numericPatterns.hour24h, dateString);
+ case "ko":
+ return match2.ordinalNumber(dateString, { unit: "hour" });
+ default:
+ return parseNDigits(token.length, dateString);
+ }
+ }
+ validate(_date, value2) {
+ return value2 >= 1 && value2 <= 24;
+ }
+ set(date, _flags, value2) {
+ const hours = value2 <= 24 ? value2 % 24 : value2;
+ date.setHours(hours, 0, 0, 0);
+ return date;
+ }
+ incompatibleTokens = ["a", "b", "h", "H", "K", "t", "T"];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/MinuteParser.js
+var MinuteParser;
+var init_MinuteParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/MinuteParser.js"() {
+ init_constants2();
+ init_Parser();
+ init_utils();
+ MinuteParser = class extends Parser {
+ priority = 60;
+ parse(dateString, token, match2) {
+ switch (token) {
+ case "m":
+ return parseNumericPattern(numericPatterns.minute, dateString);
+ case "mo":
+ return match2.ordinalNumber(dateString, { unit: "minute" });
+ default:
+ return parseNDigits(token.length, dateString);
+ }
+ }
+ validate(_date, value2) {
+ return value2 >= 0 && value2 <= 59;
+ }
+ set(date, _flags, value2) {
+ date.setMinutes(value2, 0, 0);
+ return date;
+ }
+ incompatibleTokens = ["t", "T"];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/SecondParser.js
+var SecondParser;
+var init_SecondParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/SecondParser.js"() {
+ init_constants2();
+ init_Parser();
+ init_utils();
+ SecondParser = class extends Parser {
+ priority = 50;
+ parse(dateString, token, match2) {
+ switch (token) {
+ case "s":
+ return parseNumericPattern(numericPatterns.second, dateString);
+ case "so":
+ return match2.ordinalNumber(dateString, { unit: "second" });
+ default:
+ return parseNDigits(token.length, dateString);
+ }
+ }
+ validate(_date, value2) {
+ return value2 >= 0 && value2 <= 59;
+ }
+ set(date, _flags, value2) {
+ date.setSeconds(value2, 0);
+ return date;
+ }
+ incompatibleTokens = ["t", "T"];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/FractionOfSecondParser.js
+var FractionOfSecondParser;
+var init_FractionOfSecondParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/FractionOfSecondParser.js"() {
+ init_Parser();
+ init_utils();
+ FractionOfSecondParser = class extends Parser {
+ priority = 30;
+ parse(dateString, token) {
+ const valueCallback = (value2) => Math.trunc(value2 * Math.pow(10, -token.length + 3));
+ return mapValue(parseNDigits(token.length, dateString), valueCallback);
+ }
+ set(date, _flags, value2) {
+ date.setMilliseconds(value2);
+ return date;
+ }
+ incompatibleTokens = ["t", "T"];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/ISOTimezoneWithZParser.js
+var ISOTimezoneWithZParser;
+var init_ISOTimezoneWithZParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/ISOTimezoneWithZParser.js"() {
+ init_constructFrom();
+ init_getTimezoneOffsetInMilliseconds();
+ init_constants2();
+ init_Parser();
+ init_utils();
+ ISOTimezoneWithZParser = class extends Parser {
+ priority = 10;
+ parse(dateString, token) {
+ switch (token) {
+ case "X":
+ return parseTimezonePattern(
+ timezonePatterns.basicOptionalMinutes,
+ dateString
+ );
+ case "XX":
+ return parseTimezonePattern(timezonePatterns.basic, dateString);
+ case "XXXX":
+ return parseTimezonePattern(
+ timezonePatterns.basicOptionalSeconds,
+ dateString
+ );
+ case "XXXXX":
+ return parseTimezonePattern(
+ timezonePatterns.extendedOptionalSeconds,
+ dateString
+ );
+ case "XXX":
+ default:
+ return parseTimezonePattern(timezonePatterns.extended, dateString);
+ }
+ }
+ set(date, flags, value2) {
+ if (flags.timestampIsSet) return date;
+ return constructFrom(
+ date,
+ date.getTime() - getTimezoneOffsetInMilliseconds(date) - value2
+ );
+ }
+ incompatibleTokens = ["t", "T", "x"];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/ISOTimezoneParser.js
+var ISOTimezoneParser;
+var init_ISOTimezoneParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/ISOTimezoneParser.js"() {
+ init_constructFrom();
+ init_getTimezoneOffsetInMilliseconds();
+ init_constants2();
+ init_Parser();
+ init_utils();
+ ISOTimezoneParser = class extends Parser {
+ priority = 10;
+ parse(dateString, token) {
+ switch (token) {
+ case "x":
+ return parseTimezonePattern(
+ timezonePatterns.basicOptionalMinutes,
+ dateString
+ );
+ case "xx":
+ return parseTimezonePattern(timezonePatterns.basic, dateString);
+ case "xxxx":
+ return parseTimezonePattern(
+ timezonePatterns.basicOptionalSeconds,
+ dateString
+ );
+ case "xxxxx":
+ return parseTimezonePattern(
+ timezonePatterns.extendedOptionalSeconds,
+ dateString
+ );
+ case "xxx":
+ default:
+ return parseTimezonePattern(timezonePatterns.extended, dateString);
+ }
+ }
+ set(date, flags, value2) {
+ if (flags.timestampIsSet) return date;
+ return constructFrom(
+ date,
+ date.getTime() - getTimezoneOffsetInMilliseconds(date) - value2
+ );
+ }
+ incompatibleTokens = ["t", "T", "X"];
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/TimestampSecondsParser.js
+var TimestampSecondsParser;
+var init_TimestampSecondsParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/TimestampSecondsParser.js"() {
+ init_constructFrom();
+ init_Parser();
+ init_utils();
+ TimestampSecondsParser = class extends Parser {
+ priority = 40;
+ parse(dateString) {
+ return parseAnyDigitsSigned(dateString);
+ }
+ set(date, _flags, value2) {
+ return [constructFrom(date, value2 * 1e3), { timestampIsSet: true }];
+ }
+ incompatibleTokens = "*";
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/TimestampMillisecondsParser.js
+var TimestampMillisecondsParser;
+var init_TimestampMillisecondsParser = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers/TimestampMillisecondsParser.js"() {
+ init_constructFrom();
+ init_Parser();
+ init_utils();
+ TimestampMillisecondsParser = class extends Parser {
+ priority = 20;
+ parse(dateString) {
+ return parseAnyDigitsSigned(dateString);
+ }
+ set(date, _flags, value2) {
+ return [constructFrom(date, value2), { timestampIsSet: true }];
+ }
+ incompatibleTokens = "*";
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers.js
+var parsers;
+var init_parsers = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse/_lib/parsers.js"() {
+ init_EraParser();
+ init_YearParser();
+ init_LocalWeekYearParser();
+ init_ISOWeekYearParser();
+ init_ExtendedYearParser();
+ init_QuarterParser();
+ init_StandAloneQuarterParser();
+ init_MonthParser();
+ init_StandAloneMonthParser();
+ init_LocalWeekParser();
+ init_ISOWeekParser();
+ init_DateParser();
+ init_DayOfYearParser();
+ init_DayParser();
+ init_LocalDayParser();
+ init_StandAloneLocalDayParser();
+ init_ISODayParser();
+ init_AMPMParser();
+ init_AMPMMidnightParser();
+ init_DayPeriodParser();
+ init_Hour1to12Parser();
+ init_Hour0to23Parser();
+ init_Hour0To11Parser();
+ init_Hour1To24Parser();
+ init_MinuteParser();
+ init_SecondParser();
+ init_FractionOfSecondParser();
+ init_ISOTimezoneWithZParser();
+ init_ISOTimezoneParser();
+ init_TimestampSecondsParser();
+ init_TimestampMillisecondsParser();
+ parsers = {
+ G: new EraParser(),
+ y: new YearParser(),
+ Y: new LocalWeekYearParser(),
+ R: new ISOWeekYearParser(),
+ u: new ExtendedYearParser(),
+ Q: new QuarterParser(),
+ q: new StandAloneQuarterParser(),
+ M: new MonthParser(),
+ L: new StandAloneMonthParser(),
+ w: new LocalWeekParser(),
+ I: new ISOWeekParser(),
+ d: new DateParser(),
+ D: new DayOfYearParser(),
+ E: new DayParser(),
+ e: new LocalDayParser(),
+ c: new StandAloneLocalDayParser(),
+ i: new ISODayParser(),
+ a: new AMPMParser(),
+ b: new AMPMMidnightParser(),
+ B: new DayPeriodParser(),
+ h: new Hour1to12Parser(),
+ H: new Hour0to23Parser(),
+ K: new Hour0To11Parser(),
+ k: new Hour1To24Parser(),
+ m: new MinuteParser(),
+ s: new SecondParser(),
+ S: new FractionOfSecondParser(),
+ X: new ISOTimezoneWithZParser(),
+ x: new ISOTimezoneParser(),
+ t: new TimestampSecondsParser(),
+ T: new TimestampMillisecondsParser()
+ };
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse.js
+function parse(dateStr, formatStr, referenceDate, options) {
+ const invalidDate = () => constructFrom(options?.in || referenceDate, NaN);
+ const defaultOptions2 = getDefaultOptions2();
+ const locale = options?.locale ?? defaultOptions2.locale ?? enUS;
+ const firstWeekContainsDate = options?.firstWeekContainsDate ?? options?.locale?.options?.firstWeekContainsDate ?? defaultOptions2.firstWeekContainsDate ?? defaultOptions2.locale?.options?.firstWeekContainsDate ?? 1;
+ const weekStartsOn = options?.weekStartsOn ?? options?.locale?.options?.weekStartsOn ?? defaultOptions2.weekStartsOn ?? defaultOptions2.locale?.options?.weekStartsOn ?? 0;
+ if (!formatStr)
+ return dateStr ? invalidDate() : toDate(referenceDate, options?.in);
+ const subFnOptions = {
+ firstWeekContainsDate,
+ weekStartsOn,
+ locale
+ };
+ const setters = [new DateTimezoneSetter(options?.in, referenceDate)];
+ const tokens = formatStr.match(longFormattingTokensRegExp2).map((substring) => {
+ const firstCharacter = substring[0];
+ if (firstCharacter in longFormatters) {
+ const longFormatter = longFormatters[firstCharacter];
+ return longFormatter(substring, locale.formatLong);
+ }
+ return substring;
+ }).join("").match(formattingTokensRegExp2);
+ const usedTokens = [];
+ for (let token of tokens) {
+ if (!options?.useAdditionalWeekYearTokens && isProtectedWeekYearToken(token)) {
+ warnOrThrowProtectedError(token, formatStr, dateStr);
+ }
+ if (!options?.useAdditionalDayOfYearTokens && isProtectedDayOfYearToken(token)) {
+ warnOrThrowProtectedError(token, formatStr, dateStr);
+ }
+ const firstCharacter = token[0];
+ const parser = parsers[firstCharacter];
+ if (parser) {
+ const { incompatibleTokens } = parser;
+ if (Array.isArray(incompatibleTokens)) {
+ const incompatibleToken = usedTokens.find(
+ (usedToken) => incompatibleTokens.includes(usedToken.token) || usedToken.token === firstCharacter
+ );
+ if (incompatibleToken) {
+ throw new RangeError(
+ `The format string mustn't contain \`${incompatibleToken.fullToken}\` and \`${token}\` at the same time`
+ );
+ }
+ } else if (parser.incompatibleTokens === "*" && usedTokens.length > 0) {
+ throw new RangeError(
+ `The format string mustn't contain \`${token}\` and any other token at the same time`
+ );
+ }
+ usedTokens.push({ token: firstCharacter, fullToken: token });
+ const parseResult = parser.run(
+ dateStr,
+ token,
+ locale.match,
+ subFnOptions
+ );
+ if (!parseResult) {
+ return invalidDate();
+ }
+ setters.push(parseResult.setter);
+ dateStr = parseResult.rest;
+ } else {
+ if (firstCharacter.match(unescapedLatinCharacterRegExp2)) {
+ throw new RangeError(
+ "Format string contains an unescaped latin alphabet character `" + firstCharacter + "`"
+ );
+ }
+ if (token === "''") {
+ token = "'";
+ } else if (firstCharacter === "'") {
+ token = cleanEscapedString2(token);
+ }
+ if (dateStr.indexOf(token) === 0) {
+ dateStr = dateStr.slice(token.length);
+ } else {
+ return invalidDate();
+ }
+ }
+ }
+ if (dateStr.length > 0 && notWhitespaceRegExp.test(dateStr)) {
+ return invalidDate();
+ }
+ const uniquePrioritySetters = setters.map((setter) => setter.priority).sort((a5, b5) => b5 - a5).filter((priority, index2, array) => array.indexOf(priority) === index2).map(
+ (priority) => setters.filter((setter) => setter.priority === priority).sort((a5, b5) => b5.subPriority - a5.subPriority)
+ ).map((setterArray) => setterArray[0]);
+ let date = toDate(referenceDate, options?.in);
+ if (isNaN(+date)) return invalidDate();
+ const flags = {};
+ for (const setter of uniquePrioritySetters) {
+ if (!setter.validate(date, subFnOptions)) {
+ return invalidDate();
+ }
+ const result = setter.set(date, flags, subFnOptions);
+ if (Array.isArray(result)) {
+ date = result[0];
+ Object.assign(flags, result[1]);
+ } else {
+ date = result;
+ }
+ }
+ return date;
+}
+function cleanEscapedString2(input) {
+ return input.match(escapedStringRegExp2)[1].replace(doubleQuoteRegExp2, "'");
+}
+var formattingTokensRegExp2, longFormattingTokensRegExp2, escapedStringRegExp2, doubleQuoteRegExp2, notWhitespaceRegExp, unescapedLatinCharacterRegExp2, parse_default;
+var init_parse = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parse.js"() {
+ init_defaultLocale();
+ init_longFormatters();
+ init_protectedTokens();
+ init_constructFrom();
+ init_getDefaultOptions();
+ init_toDate();
+ init_Setter();
+ init_parsers();
+ formattingTokensRegExp2 = /[yYQqMLwIdDecihHKkms]o|(\w)\1*|''|'(''|[^'])+('|$)|./g;
+ longFormattingTokensRegExp2 = /P+p+|P+|p+|''|'(''|[^'])+('|$)|./g;
+ escapedStringRegExp2 = /^'([^]*?)'?$/;
+ doubleQuoteRegExp2 = /''/g;
+ notWhitespaceRegExp = /\S/;
+ unescapedLatinCharacterRegExp2 = /[a-zA-Z]/;
+ parse_default = parse;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isMatch.js
+function isMatch2(dateStr, formatStr, options) {
+ return isValid(parse(dateStr, formatStr, /* @__PURE__ */ new Date(), options));
+}
+var isMatch_default;
+var init_isMatch = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isMatch.js"() {
+ init_isValid();
+ init_parse();
+ isMatch_default = isMatch2;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isMonday.js
+function isMonday(date, options) {
+ return toDate(date, options?.in).getDay() === 1;
+}
+var isMonday_default;
+var init_isMonday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isMonday.js"() {
+ init_toDate();
+ isMonday_default = isMonday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isPast.js
+function isPast(date) {
+ return +toDate(date) < Date.now();
+}
+var isPast_default;
+var init_isPast = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isPast.js"() {
+ init_toDate();
+ isPast_default = isPast;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfHour.js
+function startOfHour(date, options) {
+ const _date = toDate(date, options?.in);
+ _date.setMinutes(0, 0, 0);
+ return _date;
+}
+var startOfHour_default;
+var init_startOfHour = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfHour.js"() {
+ init_toDate();
+ startOfHour_default = startOfHour;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameHour.js
+function isSameHour(dateLeft, dateRight, options) {
+ const [dateLeft_, dateRight_] = normalizeDates(
+ options?.in,
+ dateLeft,
+ dateRight
+ );
+ return +startOfHour(dateLeft_) === +startOfHour(dateRight_);
+}
+var isSameHour_default;
+var init_isSameHour = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameHour.js"() {
+ init_normalizeDates();
+ init_startOfHour();
+ isSameHour_default = isSameHour;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameWeek.js
+function isSameWeek(laterDate, earlierDate, options) {
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ return +startOfWeek(laterDate_, options) === +startOfWeek(earlierDate_, options);
+}
+var isSameWeek_default;
+var init_isSameWeek = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameWeek.js"() {
+ init_normalizeDates();
+ init_startOfWeek();
+ isSameWeek_default = isSameWeek;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameISOWeek.js
+function isSameISOWeek(laterDate, earlierDate, options) {
+ return isSameWeek(laterDate, earlierDate, { ...options, weekStartsOn: 1 });
+}
+var isSameISOWeek_default;
+var init_isSameISOWeek = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameISOWeek.js"() {
+ init_isSameWeek();
+ isSameISOWeek_default = isSameISOWeek;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameISOWeekYear.js
+function isSameISOWeekYear(laterDate, earlierDate, options) {
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ return +startOfISOWeekYear(laterDate_) === +startOfISOWeekYear(earlierDate_);
+}
+var isSameISOWeekYear_default;
+var init_isSameISOWeekYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameISOWeekYear.js"() {
+ init_startOfISOWeekYear();
+ init_normalizeDates();
+ isSameISOWeekYear_default = isSameISOWeekYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfMinute.js
+function startOfMinute(date, options) {
+ const date_ = toDate(date, options?.in);
+ date_.setSeconds(0, 0);
+ return date_;
+}
+var startOfMinute_default;
+var init_startOfMinute = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfMinute.js"() {
+ init_toDate();
+ startOfMinute_default = startOfMinute;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameMinute.js
+function isSameMinute(laterDate, earlierDate) {
+ return +startOfMinute(laterDate) === +startOfMinute(earlierDate);
+}
+var isSameMinute_default;
+var init_isSameMinute = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameMinute.js"() {
+ init_startOfMinute();
+ isSameMinute_default = isSameMinute;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameMonth.js
+function isSameMonth(laterDate, earlierDate, options) {
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ return laterDate_.getFullYear() === earlierDate_.getFullYear() && laterDate_.getMonth() === earlierDate_.getMonth();
+}
+var isSameMonth_default;
+var init_isSameMonth = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameMonth.js"() {
+ init_normalizeDates();
+ isSameMonth_default = isSameMonth;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameQuarter.js
+function isSameQuarter(laterDate, earlierDate, options) {
+ const [dateLeft_, dateRight_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ return +startOfQuarter(dateLeft_) === +startOfQuarter(dateRight_);
+}
+var isSameQuarter_default;
+var init_isSameQuarter = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameQuarter.js"() {
+ init_normalizeDates();
+ init_startOfQuarter();
+ isSameQuarter_default = isSameQuarter;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfSecond.js
+function startOfSecond(date, options) {
+ const date_ = toDate(date, options?.in);
+ date_.setMilliseconds(0);
+ return date_;
+}
+var startOfSecond_default;
+var init_startOfSecond = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfSecond.js"() {
+ init_toDate();
+ startOfSecond_default = startOfSecond;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameSecond.js
+function isSameSecond(laterDate, earlierDate) {
+ return +startOfSecond(laterDate) === +startOfSecond(earlierDate);
+}
+var isSameSecond_default;
+var init_isSameSecond = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameSecond.js"() {
+ init_startOfSecond();
+ isSameSecond_default = isSameSecond;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameYear.js
+function isSameYear(laterDate, earlierDate, options) {
+ const [laterDate_, earlierDate_] = normalizeDates(
+ options?.in,
+ laterDate,
+ earlierDate
+ );
+ return laterDate_.getFullYear() === earlierDate_.getFullYear();
+}
+var isSameYear_default;
+var init_isSameYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isSameYear.js"() {
+ init_normalizeDates();
+ isSameYear_default = isSameYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isThisHour.js
+function isThisHour(date, options) {
+ return isSameHour(
+ toDate(date, options?.in),
+ constructNow(options?.in || date)
+ );
+}
+var isThisHour_default;
+var init_isThisHour = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isThisHour.js"() {
+ init_constructNow();
+ init_isSameHour();
+ init_toDate();
+ isThisHour_default = isThisHour;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isThisISOWeek.js
+function isThisISOWeek(date, options) {
+ return isSameISOWeek(
+ constructFrom(options?.in || date, date),
+ constructNow(options?.in || date)
+ );
+}
+var isThisISOWeek_default;
+var init_isThisISOWeek = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isThisISOWeek.js"() {
+ init_constructFrom();
+ init_constructNow();
+ init_isSameISOWeek();
+ isThisISOWeek_default = isThisISOWeek;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isThisMinute.js
+function isThisMinute(date) {
+ return isSameMinute(date, constructNow(date));
+}
+var isThisMinute_default;
+var init_isThisMinute = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isThisMinute.js"() {
+ init_constructNow();
+ init_isSameMinute();
+ isThisMinute_default = isThisMinute;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isThisMonth.js
+function isThisMonth(date, options) {
+ return isSameMonth(
+ constructFrom(options?.in || date, date),
+ constructNow(options?.in || date)
+ );
+}
+var isThisMonth_default;
+var init_isThisMonth = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isThisMonth.js"() {
+ init_constructFrom();
+ init_constructNow();
+ init_isSameMonth();
+ isThisMonth_default = isThisMonth;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isThisQuarter.js
+function isThisQuarter(date, options) {
+ return isSameQuarter(
+ constructFrom(options?.in || date, date),
+ constructNow(options?.in || date)
+ );
+}
+var isThisQuarter_default;
+var init_isThisQuarter = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isThisQuarter.js"() {
+ init_constructFrom();
+ init_constructNow();
+ init_isSameQuarter();
+ isThisQuarter_default = isThisQuarter;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isThisSecond.js
+function isThisSecond(date) {
+ return isSameSecond(date, constructNow(date));
+}
+var isThisSecond_default;
+var init_isThisSecond = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isThisSecond.js"() {
+ init_constructNow();
+ init_isSameSecond();
+ isThisSecond_default = isThisSecond;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isThisWeek.js
+function isThisWeek(date, options) {
+ return isSameWeek(
+ constructFrom(options?.in || date, date),
+ constructNow(options?.in || date),
+ options
+ );
+}
+var isThisWeek_default;
+var init_isThisWeek = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isThisWeek.js"() {
+ init_constructFrom();
+ init_constructNow();
+ init_isSameWeek();
+ isThisWeek_default = isThisWeek;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isThisYear.js
+function isThisYear(date, options) {
+ return isSameYear(
+ constructFrom(options?.in || date, date),
+ constructNow(options?.in || date)
+ );
+}
+var isThisYear_default;
+var init_isThisYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isThisYear.js"() {
+ init_constructFrom();
+ init_constructNow();
+ init_isSameYear();
+ isThisYear_default = isThisYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isThursday.js
+function isThursday(date, options) {
+ return toDate(date, options?.in).getDay() === 4;
+}
+var isThursday_default;
+var init_isThursday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isThursday.js"() {
+ init_toDate();
+ isThursday_default = isThursday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isToday.js
+function isToday(date, options) {
+ return isSameDay(
+ constructFrom(options?.in || date, date),
+ constructNow(options?.in || date)
+ );
+}
+var isToday_default;
+var init_isToday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isToday.js"() {
+ init_constructFrom();
+ init_constructNow();
+ init_isSameDay();
+ isToday_default = isToday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isTomorrow.js
+function isTomorrow(date, options) {
+ return isSameDay(
+ date,
+ addDays(constructNow(options?.in || date), 1),
+ options
+ );
+}
+var isTomorrow_default;
+var init_isTomorrow = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isTomorrow.js"() {
+ init_addDays();
+ init_constructNow();
+ init_isSameDay();
+ isTomorrow_default = isTomorrow;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isTuesday.js
+function isTuesday(date, options) {
+ return toDate(date, options?.in).getDay() === 2;
+}
+var isTuesday_default;
+var init_isTuesday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isTuesday.js"() {
+ init_toDate();
+ isTuesday_default = isTuesday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isWednesday.js
+function isWednesday(date, options) {
+ return toDate(date, options?.in).getDay() === 3;
+}
+var isWednesday_default;
+var init_isWednesday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isWednesday.js"() {
+ init_toDate();
+ isWednesday_default = isWednesday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isWithinInterval.js
+function isWithinInterval(date, interval3, options) {
+ const time = +toDate(date, options?.in);
+ const [startTime, endTime] = [
+ +toDate(interval3.start, options?.in),
+ +toDate(interval3.end, options?.in)
+ ].sort((a5, b5) => a5 - b5);
+ return time >= startTime && time <= endTime;
+}
+var isWithinInterval_default;
+var init_isWithinInterval = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isWithinInterval.js"() {
+ init_toDate();
+ isWithinInterval_default = isWithinInterval;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subDays.js
+function subDays(date, amount, options) {
+ return addDays(date, -amount, options);
+}
+var subDays_default;
+var init_subDays = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subDays.js"() {
+ init_addDays();
+ subDays_default = subDays;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isYesterday.js
+function isYesterday(date, options) {
+ return isSameDay(
+ constructFrom(options?.in || date, date),
+ subDays(constructNow(options?.in || date), 1)
+ );
+}
+var isYesterday_default;
+var init_isYesterday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/isYesterday.js"() {
+ init_constructFrom();
+ init_constructNow();
+ init_isSameDay();
+ init_subDays();
+ isYesterday_default = isYesterday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/lastDayOfDecade.js
+function lastDayOfDecade(date, options) {
+ const _date = toDate(date, options?.in);
+ const year = _date.getFullYear();
+ const decade = 9 + Math.floor(year / 10) * 10;
+ _date.setFullYear(decade + 1, 0, 0);
+ _date.setHours(0, 0, 0, 0);
+ return toDate(_date, options?.in);
+}
+var lastDayOfDecade_default;
+var init_lastDayOfDecade = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/lastDayOfDecade.js"() {
+ init_toDate();
+ lastDayOfDecade_default = lastDayOfDecade;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/lastDayOfWeek.js
+function lastDayOfWeek(date, options) {
+ const defaultOptions2 = getDefaultOptions();
+ const weekStartsOn = options?.weekStartsOn ?? options?.locale?.options?.weekStartsOn ?? defaultOptions2.weekStartsOn ?? defaultOptions2.locale?.options?.weekStartsOn ?? 0;
+ const _date = toDate(date, options?.in);
+ const day = _date.getDay();
+ const diff = (day < weekStartsOn ? -7 : 0) + 6 - (day - weekStartsOn);
+ _date.setHours(0, 0, 0, 0);
+ _date.setDate(_date.getDate() + diff);
+ return _date;
+}
+var lastDayOfWeek_default;
+var init_lastDayOfWeek = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/lastDayOfWeek.js"() {
+ init_defaultOptions();
+ init_toDate();
+ lastDayOfWeek_default = lastDayOfWeek;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/lastDayOfISOWeek.js
+function lastDayOfISOWeek(date, options) {
+ return lastDayOfWeek(date, { ...options, weekStartsOn: 1 });
+}
+var lastDayOfISOWeek_default;
+var init_lastDayOfISOWeek = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/lastDayOfISOWeek.js"() {
+ init_lastDayOfWeek();
+ lastDayOfISOWeek_default = lastDayOfISOWeek;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/lastDayOfISOWeekYear.js
+function lastDayOfISOWeekYear(date, options) {
+ const year = getISOWeekYear(date, options);
+ const fourthOfJanuary = constructFrom(options?.in || date, 0);
+ fourthOfJanuary.setFullYear(year + 1, 0, 4);
+ fourthOfJanuary.setHours(0, 0, 0, 0);
+ const date_ = startOfISOWeek(fourthOfJanuary, options);
+ date_.setDate(date_.getDate() - 1);
+ return date_;
+}
+var lastDayOfISOWeekYear_default;
+var init_lastDayOfISOWeekYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/lastDayOfISOWeekYear.js"() {
+ init_constructFrom();
+ init_getISOWeekYear();
+ init_startOfISOWeek();
+ lastDayOfISOWeekYear_default = lastDayOfISOWeekYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/lastDayOfQuarter.js
+function lastDayOfQuarter(date, options) {
+ const date_ = toDate(date, options?.in);
+ const currentMonth = date_.getMonth();
+ const month = currentMonth - currentMonth % 3 + 3;
+ date_.setMonth(month, 0);
+ date_.setHours(0, 0, 0, 0);
+ return date_;
+}
+var lastDayOfQuarter_default;
+var init_lastDayOfQuarter = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/lastDayOfQuarter.js"() {
+ init_toDate();
+ lastDayOfQuarter_default = lastDayOfQuarter;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/lastDayOfYear.js
+function lastDayOfYear(date, options) {
+ const date_ = toDate(date, options?.in);
+ const year = date_.getFullYear();
+ date_.setFullYear(year + 1, 0, 0);
+ date_.setHours(0, 0, 0, 0);
+ return date_;
+}
+var lastDayOfYear_default;
+var init_lastDayOfYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/lastDayOfYear.js"() {
+ init_toDate();
+ lastDayOfYear_default = lastDayOfYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/lightFormat.js
+function lightFormat(date, formatStr) {
+ const date_ = toDate(date);
+ if (!isValid(date_)) {
+ throw new RangeError("Invalid time value");
+ }
+ const tokens = formatStr.match(formattingTokensRegExp3);
+ if (!tokens) return "";
+ const result = tokens.map((substring) => {
+ if (substring === "''") {
+ return "'";
+ }
+ const firstCharacter = substring[0];
+ if (firstCharacter === "'") {
+ return cleanEscapedString3(substring);
+ }
+ const formatter2 = lightFormatters[firstCharacter];
+ if (formatter2) {
+ return formatter2(date_, substring);
+ }
+ if (firstCharacter.match(unescapedLatinCharacterRegExp3)) {
+ throw new RangeError(
+ "Format string contains an unescaped latin alphabet character `" + firstCharacter + "`"
+ );
+ }
+ return substring;
+ }).join("");
+ return result;
+}
+function cleanEscapedString3(input) {
+ const matches = input.match(escapedStringRegExp3);
+ if (!matches) return input;
+ return matches[1].replace(doubleQuoteRegExp3, "'");
+}
+var formattingTokensRegExp3, escapedStringRegExp3, doubleQuoteRegExp3, unescapedLatinCharacterRegExp3, lightFormat_default;
+var init_lightFormat = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/lightFormat.js"() {
+ init_lightFormatters();
+ init_isValid();
+ init_toDate();
+ formattingTokensRegExp3 = /(\w)\1*|''|'(''|[^'])+('|$)|./g;
+ escapedStringRegExp3 = /^'([^]*?)'?$/;
+ doubleQuoteRegExp3 = /''/g;
+ unescapedLatinCharacterRegExp3 = /[a-zA-Z]/;
+ lightFormat_default = lightFormat;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/milliseconds.js
+function milliseconds({
+ years,
+ months: months2,
+ weeks,
+ days: days2,
+ hours,
+ minutes,
+ seconds
+}) {
+ let totalDays = 0;
+ if (years) totalDays += years * daysInYear;
+ if (months2) totalDays += months2 * (daysInYear / 12);
+ if (weeks) totalDays += weeks * 7;
+ if (days2) totalDays += days2;
+ let totalSeconds = totalDays * 24 * 60 * 60;
+ if (hours) totalSeconds += hours * 60 * 60;
+ if (minutes) totalSeconds += minutes * 60;
+ if (seconds) totalSeconds += seconds;
+ return Math.trunc(totalSeconds * 1e3);
+}
+var milliseconds_default;
+var init_milliseconds = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/milliseconds.js"() {
+ init_constants();
+ milliseconds_default = milliseconds;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/millisecondsToHours.js
+function millisecondsToHours(milliseconds2) {
+ const hours = milliseconds2 / millisecondsInHour;
+ return Math.trunc(hours);
+}
+var millisecondsToHours_default;
+var init_millisecondsToHours = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/millisecondsToHours.js"() {
+ init_constants();
+ millisecondsToHours_default = millisecondsToHours;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/millisecondsToMinutes.js
+function millisecondsToMinutes(milliseconds2) {
+ const minutes = milliseconds2 / millisecondsInMinute;
+ return Math.trunc(minutes);
+}
+var millisecondsToMinutes_default;
+var init_millisecondsToMinutes = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/millisecondsToMinutes.js"() {
+ init_constants();
+ millisecondsToMinutes_default = millisecondsToMinutes;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/millisecondsToSeconds.js
+function millisecondsToSeconds(milliseconds2) {
+ const seconds = milliseconds2 / millisecondsInSecond;
+ return Math.trunc(seconds);
+}
+var millisecondsToSeconds_default;
+var init_millisecondsToSeconds = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/millisecondsToSeconds.js"() {
+ init_constants();
+ millisecondsToSeconds_default = millisecondsToSeconds;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/minutesToHours.js
+function minutesToHours(minutes) {
+ const hours = minutes / minutesInHour;
+ return Math.trunc(hours);
+}
+var minutesToHours_default;
+var init_minutesToHours = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/minutesToHours.js"() {
+ init_constants();
+ minutesToHours_default = minutesToHours;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/minutesToMilliseconds.js
+function minutesToMilliseconds(minutes) {
+ return Math.trunc(minutes * millisecondsInMinute);
+}
+var minutesToMilliseconds_default;
+var init_minutesToMilliseconds = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/minutesToMilliseconds.js"() {
+ init_constants();
+ minutesToMilliseconds_default = minutesToMilliseconds;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/minutesToSeconds.js
+function minutesToSeconds(minutes) {
+ return Math.trunc(minutes * secondsInMinute);
+}
+var minutesToSeconds_default;
+var init_minutesToSeconds = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/minutesToSeconds.js"() {
+ init_constants();
+ minutesToSeconds_default = minutesToSeconds;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/monthsToQuarters.js
+function monthsToQuarters(months2) {
+ const quarters = months2 / monthsInQuarter;
+ return Math.trunc(quarters);
+}
+var monthsToQuarters_default;
+var init_monthsToQuarters = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/monthsToQuarters.js"() {
+ init_constants();
+ monthsToQuarters_default = monthsToQuarters;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/monthsToYears.js
+function monthsToYears(months2) {
+ const years = months2 / monthsInYear;
+ return Math.trunc(years);
+}
+var monthsToYears_default;
+var init_monthsToYears = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/monthsToYears.js"() {
+ init_constants();
+ monthsToYears_default = monthsToYears;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/nextDay.js
+function nextDay(date, day, options) {
+ let delta = day - getDay(date, options);
+ if (delta <= 0) delta += 7;
+ return addDays(date, delta, options);
+}
+var nextDay_default;
+var init_nextDay = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/nextDay.js"() {
+ init_addDays();
+ init_getDay();
+ nextDay_default = nextDay;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/nextFriday.js
+function nextFriday(date, options) {
+ return nextDay(date, 5, options);
+}
+var nextFriday_default;
+var init_nextFriday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/nextFriday.js"() {
+ init_nextDay();
+ nextFriday_default = nextFriday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/nextMonday.js
+function nextMonday(date, options) {
+ return nextDay(date, 1, options);
+}
+var nextMonday_default;
+var init_nextMonday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/nextMonday.js"() {
+ init_nextDay();
+ nextMonday_default = nextMonday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/nextSaturday.js
+function nextSaturday(date, options) {
+ return nextDay(date, 6, options);
+}
+var nextSaturday_default;
+var init_nextSaturday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/nextSaturday.js"() {
+ init_nextDay();
+ nextSaturday_default = nextSaturday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/nextSunday.js
+function nextSunday(date, options) {
+ return nextDay(date, 0, options);
+}
+var nextSunday_default;
+var init_nextSunday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/nextSunday.js"() {
+ init_nextDay();
+ nextSunday_default = nextSunday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/nextThursday.js
+function nextThursday(date, options) {
+ return nextDay(date, 4, options);
+}
+var nextThursday_default;
+var init_nextThursday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/nextThursday.js"() {
+ init_nextDay();
+ nextThursday_default = nextThursday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/nextTuesday.js
+function nextTuesday(date, options) {
+ return nextDay(date, 2, options);
+}
+var nextTuesday_default;
+var init_nextTuesday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/nextTuesday.js"() {
+ init_nextDay();
+ nextTuesday_default = nextTuesday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/nextWednesday.js
+function nextWednesday(date, options) {
+ return nextDay(date, 3, options);
+}
+var nextWednesday_default;
+var init_nextWednesday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/nextWednesday.js"() {
+ init_nextDay();
+ nextWednesday_default = nextWednesday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parseISO.js
+function parseISO(argument, options) {
+ const invalidDate = () => constructFrom(options?.in, NaN);
+ const additionalDigits = options?.additionalDigits ?? 2;
+ const dateStrings = splitDateString(argument);
+ let date;
+ if (dateStrings.date) {
+ const parseYearResult = parseYear(dateStrings.date, additionalDigits);
+ date = parseDate(parseYearResult.restDateString, parseYearResult.year);
+ }
+ if (!date || isNaN(+date)) return invalidDate();
+ const timestamp2 = +date;
+ let time = 0;
+ let offset;
+ if (dateStrings.time) {
+ time = parseTime(dateStrings.time);
+ if (isNaN(time)) return invalidDate();
+ }
+ if (dateStrings.timezone) {
+ offset = parseTimezone(dateStrings.timezone);
+ if (isNaN(offset)) return invalidDate();
+ } else {
+ const tmpDate = new Date(timestamp2 + time);
+ const result = toDate(0, options?.in);
+ result.setFullYear(
+ tmpDate.getUTCFullYear(),
+ tmpDate.getUTCMonth(),
+ tmpDate.getUTCDate()
+ );
+ result.setHours(
+ tmpDate.getUTCHours(),
+ tmpDate.getUTCMinutes(),
+ tmpDate.getUTCSeconds(),
+ tmpDate.getUTCMilliseconds()
+ );
+ return result;
+ }
+ return toDate(timestamp2 + time + offset, options?.in);
+}
+function splitDateString(dateString) {
+ const dateStrings = {};
+ const array = dateString.split(patterns.dateTimeDelimiter);
+ let timeString;
+ if (array.length > 2) {
+ return dateStrings;
+ }
+ if (/:/.test(array[0])) {
+ timeString = array[0];
+ } else {
+ dateStrings.date = array[0];
+ timeString = array[1];
+ if (patterns.timeZoneDelimiter.test(dateStrings.date)) {
+ dateStrings.date = dateString.split(patterns.timeZoneDelimiter)[0];
+ timeString = dateString.substr(
+ dateStrings.date.length,
+ dateString.length
+ );
+ }
+ }
+ if (timeString) {
+ const token = patterns.timezone.exec(timeString);
+ if (token) {
+ dateStrings.time = timeString.replace(token[1], "");
+ dateStrings.timezone = token[1];
+ } else {
+ dateStrings.time = timeString;
+ }
+ }
+ return dateStrings;
+}
+function parseYear(dateString, additionalDigits) {
+ const regex = new RegExp(
+ "^(?:(\\d{4}|[+-]\\d{" + (4 + additionalDigits) + "})|(\\d{2}|[+-]\\d{" + (2 + additionalDigits) + "})$)"
+ );
+ const captures = dateString.match(regex);
+ if (!captures) return { year: NaN, restDateString: "" };
+ const year = captures[1] ? parseInt(captures[1]) : null;
+ const century = captures[2] ? parseInt(captures[2]) : null;
+ return {
+ year: century === null ? year : century * 100,
+ restDateString: dateString.slice((captures[1] || captures[2]).length)
+ };
+}
+function parseDate(dateString, year) {
+ if (year === null) return /* @__PURE__ */ new Date(NaN);
+ const captures = dateString.match(dateRegex);
+ if (!captures) return /* @__PURE__ */ new Date(NaN);
+ const isWeekDate = !!captures[4];
+ const dayOfYear = parseDateUnit(captures[1]);
+ const month = parseDateUnit(captures[2]) - 1;
+ const day = parseDateUnit(captures[3]);
+ const week = parseDateUnit(captures[4]);
+ const dayOfWeek = parseDateUnit(captures[5]) - 1;
+ if (isWeekDate) {
+ if (!validateWeekDate(year, week, dayOfWeek)) {
+ return /* @__PURE__ */ new Date(NaN);
+ }
+ return dayOfISOWeekYear(year, week, dayOfWeek);
+ } else {
+ const date = /* @__PURE__ */ new Date(0);
+ if (!validateDate(year, month, day) || !validateDayOfYearDate(year, dayOfYear)) {
+ return /* @__PURE__ */ new Date(NaN);
+ }
+ date.setUTCFullYear(year, month, Math.max(dayOfYear, day));
+ return date;
+ }
+}
+function parseDateUnit(value2) {
+ return value2 ? parseInt(value2) : 1;
+}
+function parseTime(timeString) {
+ const captures = timeString.match(timeRegex);
+ if (!captures) return NaN;
+ const hours = parseTimeUnit(captures[1]);
+ const minutes = parseTimeUnit(captures[2]);
+ const seconds = parseTimeUnit(captures[3]);
+ if (!validateTime(hours, minutes, seconds)) {
+ return NaN;
+ }
+ return hours * millisecondsInHour + minutes * millisecondsInMinute + seconds * 1e3;
+}
+function parseTimeUnit(value2) {
+ return value2 && parseFloat(value2.replace(",", ".")) || 0;
+}
+function parseTimezone(timezoneString) {
+ if (timezoneString === "Z") return 0;
+ const captures = timezoneString.match(timezoneRegex);
+ if (!captures) return 0;
+ const sign = captures[1] === "+" ? -1 : 1;
+ const hours = parseInt(captures[2]);
+ const minutes = captures[3] && parseInt(captures[3]) || 0;
+ if (!validateTimezone(hours, minutes)) {
+ return NaN;
+ }
+ return sign * (hours * millisecondsInHour + minutes * millisecondsInMinute);
+}
+function dayOfISOWeekYear(isoWeekYear, week, day) {
+ const date = /* @__PURE__ */ new Date(0);
+ date.setUTCFullYear(isoWeekYear, 0, 4);
+ const fourthOfJanuaryDay = date.getUTCDay() || 7;
+ const diff = (week - 1) * 7 + day + 1 - fourthOfJanuaryDay;
+ date.setUTCDate(date.getUTCDate() + diff);
+ return date;
+}
+function isLeapYearIndex2(year) {
+ return year % 400 === 0 || year % 4 === 0 && year % 100 !== 0;
+}
+function validateDate(year, month, date) {
+ return month >= 0 && month <= 11 && date >= 1 && date <= (daysInMonths[month] || (isLeapYearIndex2(year) ? 29 : 28));
+}
+function validateDayOfYearDate(year, dayOfYear) {
+ return dayOfYear >= 1 && dayOfYear <= (isLeapYearIndex2(year) ? 366 : 365);
+}
+function validateWeekDate(_year, week, day) {
+ return week >= 1 && week <= 53 && day >= 0 && day <= 6;
+}
+function validateTime(hours, minutes, seconds) {
+ if (hours === 24) {
+ return minutes === 0 && seconds === 0;
+ }
+ return seconds >= 0 && seconds < 60 && minutes >= 0 && minutes < 60 && hours >= 0 && hours < 25;
+}
+function validateTimezone(_hours, minutes) {
+ return minutes >= 0 && minutes <= 59;
+}
+var patterns, dateRegex, timeRegex, timezoneRegex, daysInMonths, parseISO_default;
+var init_parseISO = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parseISO.js"() {
+ init_constants();
+ init_constructFrom();
+ init_toDate();
+ patterns = {
+ dateTimeDelimiter: /[T ]/,
+ timeZoneDelimiter: /[Z ]/i,
+ timezone: /([Z+-].*)$/
+ };
+ dateRegex = /^-?(?:(\d{3})|(\d{2})(?:-?(\d{2}))?|W(\d{2})(?:-?(\d{1}))?|)$/;
+ timeRegex = /^(\d{2}(?:[.,]\d*)?)(?::?(\d{2}(?:[.,]\d*)?))?(?::?(\d{2}(?:[.,]\d*)?))?$/;
+ timezoneRegex = /^([+-])(\d{2})(?::?(\d{2}))?$/;
+ daysInMonths = [31, null, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31];
+ parseISO_default = parseISO;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parseJSON.js
+function parseJSON(dateStr, options) {
+ const parts = dateStr.match(
+ /(\d{4})-(\d{2})-(\d{2})[T ](\d{2}):(\d{2}):(\d{2})(?:\.(\d{0,7}))?(?:Z|(.)(\d{2}):?(\d{2})?)?/
+ );
+ if (!parts) return toDate(NaN, options?.in);
+ return toDate(
+ Date.UTC(
+ +parts[1],
+ +parts[2] - 1,
+ +parts[3],
+ +parts[4] - (+parts[9] || 0) * (parts[8] == "-" ? -1 : 1),
+ +parts[5] - (+parts[10] || 0) * (parts[8] == "-" ? -1 : 1),
+ +parts[6],
+ +((parts[7] || "0") + "00").substring(0, 3)
+ ),
+ options?.in
+ );
+}
+var parseJSON_default;
+var init_parseJSON = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/parseJSON.js"() {
+ init_toDate();
+ parseJSON_default = parseJSON;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/previousDay.js
+function previousDay(date, day, options) {
+ let delta = getDay(date, options) - day;
+ if (delta <= 0) delta += 7;
+ return subDays(date, delta, options);
+}
+var previousDay_default;
+var init_previousDay = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/previousDay.js"() {
+ init_getDay();
+ init_subDays();
+ previousDay_default = previousDay;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/previousFriday.js
+function previousFriday(date, options) {
+ return previousDay(date, 5, options);
+}
+var previousFriday_default;
+var init_previousFriday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/previousFriday.js"() {
+ init_previousDay();
+ previousFriday_default = previousFriday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/previousMonday.js
+function previousMonday(date, options) {
+ return previousDay(date, 1, options);
+}
+var previousMonday_default;
+var init_previousMonday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/previousMonday.js"() {
+ init_previousDay();
+ previousMonday_default = previousMonday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/previousSaturday.js
+function previousSaturday(date, options) {
+ return previousDay(date, 6, options);
+}
+var previousSaturday_default;
+var init_previousSaturday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/previousSaturday.js"() {
+ init_previousDay();
+ previousSaturday_default = previousSaturday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/previousSunday.js
+function previousSunday(date, options) {
+ return previousDay(date, 0, options);
+}
+var previousSunday_default;
+var init_previousSunday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/previousSunday.js"() {
+ init_previousDay();
+ previousSunday_default = previousSunday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/previousThursday.js
+function previousThursday(date, options) {
+ return previousDay(date, 4, options);
+}
+var previousThursday_default;
+var init_previousThursday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/previousThursday.js"() {
+ init_previousDay();
+ previousThursday_default = previousThursday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/previousTuesday.js
+function previousTuesday(date, options) {
+ return previousDay(date, 2, options);
+}
+var previousTuesday_default;
+var init_previousTuesday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/previousTuesday.js"() {
+ init_previousDay();
+ previousTuesday_default = previousTuesday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/previousWednesday.js
+function previousWednesday(date, options) {
+ return previousDay(date, 3, options);
+}
+var previousWednesday_default;
+var init_previousWednesday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/previousWednesday.js"() {
+ init_previousDay();
+ previousWednesday_default = previousWednesday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/quartersToMonths.js
+function quartersToMonths(quarters) {
+ return Math.trunc(quarters * monthsInQuarter);
+}
+var quartersToMonths_default;
+var init_quartersToMonths = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/quartersToMonths.js"() {
+ init_constants();
+ quartersToMonths_default = quartersToMonths;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/quartersToYears.js
+function quartersToYears(quarters) {
+ const years = quarters / quartersInYear;
+ return Math.trunc(years);
+}
+var quartersToYears_default;
+var init_quartersToYears = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/quartersToYears.js"() {
+ init_constants();
+ quartersToYears_default = quartersToYears;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/roundToNearestHours.js
+function roundToNearestHours(date, options) {
+ const nearestTo = options?.nearestTo ?? 1;
+ if (nearestTo < 1 || nearestTo > 12)
+ return constructFrom(options?.in || date, NaN);
+ const date_ = toDate(date, options?.in);
+ const fractionalMinutes = date_.getMinutes() / 60;
+ const fractionalSeconds = date_.getSeconds() / 60 / 60;
+ const fractionalMilliseconds = date_.getMilliseconds() / 1e3 / 60 / 60;
+ const hours = date_.getHours() + fractionalMinutes + fractionalSeconds + fractionalMilliseconds;
+ const method = options?.roundingMethod ?? "round";
+ const roundingMethod = getRoundingMethod(method);
+ const roundedHours = roundingMethod(hours / nearestTo) * nearestTo;
+ date_.setHours(roundedHours, 0, 0, 0);
+ return date_;
+}
+var roundToNearestHours_default;
+var init_roundToNearestHours = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/roundToNearestHours.js"() {
+ init_getRoundingMethod();
+ init_constructFrom();
+ init_toDate();
+ roundToNearestHours_default = roundToNearestHours;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/roundToNearestMinutes.js
+function roundToNearestMinutes(date, options) {
+ const nearestTo = options?.nearestTo ?? 1;
+ if (nearestTo < 1 || nearestTo > 30) return constructFrom(date, NaN);
+ const date_ = toDate(date, options?.in);
+ const fractionalSeconds = date_.getSeconds() / 60;
+ const fractionalMilliseconds = date_.getMilliseconds() / 1e3 / 60;
+ const minutes = date_.getMinutes() + fractionalSeconds + fractionalMilliseconds;
+ const method = options?.roundingMethod ?? "round";
+ const roundingMethod = getRoundingMethod(method);
+ const roundedMinutes = roundingMethod(minutes / nearestTo) * nearestTo;
+ date_.setMinutes(roundedMinutes, 0, 0);
+ return date_;
+}
+var roundToNearestMinutes_default;
+var init_roundToNearestMinutes = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/roundToNearestMinutes.js"() {
+ init_getRoundingMethod();
+ init_constructFrom();
+ init_toDate();
+ roundToNearestMinutes_default = roundToNearestMinutes;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/secondsToHours.js
+function secondsToHours(seconds) {
+ const hours = seconds / secondsInHour;
+ return Math.trunc(hours);
+}
+var secondsToHours_default;
+var init_secondsToHours = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/secondsToHours.js"() {
+ init_constants();
+ secondsToHours_default = secondsToHours;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/secondsToMilliseconds.js
+function secondsToMilliseconds(seconds) {
+ return seconds * millisecondsInSecond;
+}
+var secondsToMilliseconds_default;
+var init_secondsToMilliseconds = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/secondsToMilliseconds.js"() {
+ init_constants();
+ secondsToMilliseconds_default = secondsToMilliseconds;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/secondsToMinutes.js
+function secondsToMinutes(seconds) {
+ const minutes = seconds / secondsInMinute;
+ return Math.trunc(minutes);
+}
+var secondsToMinutes_default;
+var init_secondsToMinutes = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/secondsToMinutes.js"() {
+ init_constants();
+ secondsToMinutes_default = secondsToMinutes;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setMonth.js
+function setMonth(date, month, options) {
+ const _date = toDate(date, options?.in);
+ const year = _date.getFullYear();
+ const day = _date.getDate();
+ const midMonth = constructFrom(options?.in || date, 0);
+ midMonth.setFullYear(year, month, 15);
+ midMonth.setHours(0, 0, 0, 0);
+ const daysInMonth = getDaysInMonth(midMonth);
+ _date.setMonth(month, Math.min(day, daysInMonth));
+ return _date;
+}
+var setMonth_default;
+var init_setMonth = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setMonth.js"() {
+ init_constructFrom();
+ init_getDaysInMonth();
+ init_toDate();
+ setMonth_default = setMonth;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/set.js
+function set(date, values, options) {
+ let _date = toDate(date, options?.in);
+ if (isNaN(+_date)) return constructFrom(options?.in || date, NaN);
+ if (values.year != null) _date.setFullYear(values.year);
+ if (values.month != null) _date = setMonth(_date, values.month);
+ if (values.date != null) _date.setDate(values.date);
+ if (values.hours != null) _date.setHours(values.hours);
+ if (values.minutes != null) _date.setMinutes(values.minutes);
+ if (values.seconds != null) _date.setSeconds(values.seconds);
+ if (values.milliseconds != null) _date.setMilliseconds(values.milliseconds);
+ return _date;
+}
+var set_default;
+var init_set = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/set.js"() {
+ init_constructFrom();
+ init_setMonth();
+ init_toDate();
+ set_default = set;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setDate.js
+function setDate(date, dayOfMonth, options) {
+ const _date = toDate(date, options?.in);
+ _date.setDate(dayOfMonth);
+ return _date;
+}
+var setDate_default;
+var init_setDate = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setDate.js"() {
+ init_toDate();
+ setDate_default = setDate;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setDayOfYear.js
+function setDayOfYear(date, dayOfYear, options) {
+ const date_ = toDate(date, options?.in);
+ date_.setMonth(0);
+ date_.setDate(dayOfYear);
+ return date_;
+}
+var setDayOfYear_default;
+var init_setDayOfYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setDayOfYear.js"() {
+ init_toDate();
+ setDayOfYear_default = setDayOfYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setDefaultOptions.js
+function setDefaultOptions2(options) {
+ const result = {};
+ const defaultOptions2 = getDefaultOptions();
+ for (const property in defaultOptions2) {
+ if (Object.prototype.hasOwnProperty.call(defaultOptions2, property)) {
+ result[property] = defaultOptions2[property];
+ }
+ }
+ for (const property in options) {
+ if (Object.prototype.hasOwnProperty.call(options, property)) {
+ if (options[property] === void 0) {
+ delete result[property];
+ } else {
+ result[property] = options[property];
+ }
+ }
+ }
+ setDefaultOptions(result);
+}
+var setDefaultOptions_default;
+var init_setDefaultOptions = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setDefaultOptions.js"() {
+ init_defaultOptions();
+ setDefaultOptions_default = setDefaultOptions2;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setHours.js
+function setHours(date, hours, options) {
+ const _date = toDate(date, options?.in);
+ _date.setHours(hours);
+ return _date;
+}
+var setHours_default;
+var init_setHours = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setHours.js"() {
+ init_toDate();
+ setHours_default = setHours;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setMilliseconds.js
+function setMilliseconds(date, milliseconds2, options) {
+ const _date = toDate(date, options?.in);
+ _date.setMilliseconds(milliseconds2);
+ return _date;
+}
+var setMilliseconds_default;
+var init_setMilliseconds = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setMilliseconds.js"() {
+ init_toDate();
+ setMilliseconds_default = setMilliseconds;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setMinutes.js
+function setMinutes(date, minutes, options) {
+ const date_ = toDate(date, options?.in);
+ date_.setMinutes(minutes);
+ return date_;
+}
+var setMinutes_default;
+var init_setMinutes = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setMinutes.js"() {
+ init_toDate();
+ setMinutes_default = setMinutes;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setQuarter.js
+function setQuarter(date, quarter, options) {
+ const date_ = toDate(date, options?.in);
+ const oldQuarter = Math.trunc(date_.getMonth() / 3) + 1;
+ const diff = quarter - oldQuarter;
+ return setMonth(date_, date_.getMonth() + diff * 3);
+}
+var setQuarter_default;
+var init_setQuarter = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setQuarter.js"() {
+ init_setMonth();
+ init_toDate();
+ setQuarter_default = setQuarter;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setSeconds.js
+function setSeconds(date, seconds, options) {
+ const _date = toDate(date, options?.in);
+ _date.setSeconds(seconds);
+ return _date;
+}
+var setSeconds_default;
+var init_setSeconds = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setSeconds.js"() {
+ init_toDate();
+ setSeconds_default = setSeconds;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setWeekYear.js
+function setWeekYear(date, weekYear, options) {
+ const defaultOptions2 = getDefaultOptions();
+ const firstWeekContainsDate = options?.firstWeekContainsDate ?? options?.locale?.options?.firstWeekContainsDate ?? defaultOptions2.firstWeekContainsDate ?? defaultOptions2.locale?.options?.firstWeekContainsDate ?? 1;
+ const diff = differenceInCalendarDays(
+ toDate(date, options?.in),
+ startOfWeekYear(date, options),
+ options
+ );
+ const firstWeek = constructFrom(options?.in || date, 0);
+ firstWeek.setFullYear(weekYear, 0, firstWeekContainsDate);
+ firstWeek.setHours(0, 0, 0, 0);
+ const date_ = startOfWeekYear(firstWeek, options);
+ date_.setDate(date_.getDate() + diff);
+ return date_;
+}
+var setWeekYear_default;
+var init_setWeekYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setWeekYear.js"() {
+ init_defaultOptions();
+ init_constructFrom();
+ init_differenceInCalendarDays();
+ init_startOfWeekYear();
+ init_toDate();
+ setWeekYear_default = setWeekYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setYear.js
+function setYear(date, year, options) {
+ const date_ = toDate(date, options?.in);
+ if (isNaN(+date_)) return constructFrom(options?.in || date, NaN);
+ date_.setFullYear(year);
+ return date_;
+}
+var setYear_default;
+var init_setYear = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/setYear.js"() {
+ init_constructFrom();
+ init_toDate();
+ setYear_default = setYear;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfDecade.js
+function startOfDecade(date, options) {
+ const _date = toDate(date, options?.in);
+ const year = _date.getFullYear();
+ const decade = Math.floor(year / 10) * 10;
+ _date.setFullYear(decade, 0, 1);
+ _date.setHours(0, 0, 0, 0);
+ return _date;
+}
+var startOfDecade_default;
+var init_startOfDecade = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfDecade.js"() {
+ init_toDate();
+ startOfDecade_default = startOfDecade;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfToday.js
+function startOfToday(options) {
+ return startOfDay(Date.now(), options);
+}
+var startOfToday_default;
+var init_startOfToday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfToday.js"() {
+ init_startOfDay();
+ startOfToday_default = startOfToday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfTomorrow.js
+function startOfTomorrow(options) {
+ const now2 = constructNow(options?.in);
+ const year = now2.getFullYear();
+ const month = now2.getMonth();
+ const day = now2.getDate();
+ const date = constructFrom(options?.in, 0);
+ date.setFullYear(year, month, day + 1);
+ date.setHours(0, 0, 0, 0);
+ return date;
+}
+var startOfTomorrow_default;
+var init_startOfTomorrow = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfTomorrow.js"() {
+ init_constructFrom();
+ init_constructNow();
+ startOfTomorrow_default = startOfTomorrow;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfYesterday.js
+function startOfYesterday(options) {
+ const now2 = constructNow(options?.in);
+ const year = now2.getFullYear();
+ const month = now2.getMonth();
+ const day = now2.getDate();
+ const date = constructNow(options?.in);
+ date.setFullYear(year, month, day - 1);
+ date.setHours(0, 0, 0, 0);
+ return date;
+}
+var startOfYesterday_default;
+var init_startOfYesterday = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/startOfYesterday.js"() {
+ init_constructNow();
+ startOfYesterday_default = startOfYesterday;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subMonths.js
+function subMonths(date, amount, options) {
+ return addMonths(date, -amount, options);
+}
+var subMonths_default;
+var init_subMonths = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subMonths.js"() {
+ init_addMonths();
+ subMonths_default = subMonths;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/sub.js
+function sub(date, duration, options) {
+ const {
+ years = 0,
+ months: months2 = 0,
+ weeks = 0,
+ days: days2 = 0,
+ hours = 0,
+ minutes = 0,
+ seconds = 0
+ } = duration;
+ const withoutMonths = subMonths(date, months2 + years * 12, options);
+ const withoutDays = subDays(withoutMonths, days2 + weeks * 7, options);
+ const minutesToSub = minutes + hours * 60;
+ const secondsToSub = seconds + minutesToSub * 60;
+ const msToSub = secondsToSub * 1e3;
+ return constructFrom(options?.in || date, +withoutDays - msToSub);
+}
+var sub_default;
+var init_sub = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/sub.js"() {
+ init_constructFrom();
+ init_subDays();
+ init_subMonths();
+ sub_default = sub;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subBusinessDays.js
+function subBusinessDays(date, amount, options) {
+ return addBusinessDays(date, -amount, options);
+}
+var subBusinessDays_default;
+var init_subBusinessDays = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subBusinessDays.js"() {
+ init_addBusinessDays();
+ subBusinessDays_default = subBusinessDays;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subHours.js
+function subHours(date, amount, options) {
+ return addHours(date, -amount, options);
+}
+var subHours_default;
+var init_subHours = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subHours.js"() {
+ init_addHours();
+ subHours_default = subHours;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subMilliseconds.js
+function subMilliseconds(date, amount, options) {
+ return addMilliseconds(date, -amount, options);
+}
+var subMilliseconds_default;
+var init_subMilliseconds = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subMilliseconds.js"() {
+ init_addMilliseconds();
+ subMilliseconds_default = subMilliseconds;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subMinutes.js
+function subMinutes(date, amount, options) {
+ return addMinutes(date, -amount, options);
+}
+var subMinutes_default;
+var init_subMinutes = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subMinutes.js"() {
+ init_addMinutes();
+ subMinutes_default = subMinutes;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subQuarters.js
+function subQuarters(date, amount, options) {
+ return addQuarters(date, -amount, options);
+}
+var subQuarters_default;
+var init_subQuarters = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subQuarters.js"() {
+ init_addQuarters();
+ subQuarters_default = subQuarters;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subSeconds.js
+function subSeconds(date, amount, options) {
+ return addSeconds(date, -amount, options);
+}
+var subSeconds_default;
+var init_subSeconds = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subSeconds.js"() {
+ init_addSeconds();
+ subSeconds_default = subSeconds;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subWeeks.js
+function subWeeks(date, amount, options) {
+ return addWeeks(date, -amount, options);
+}
+var subWeeks_default;
+var init_subWeeks = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subWeeks.js"() {
+ init_addWeeks();
+ subWeeks_default = subWeeks;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subYears.js
+function subYears(date, amount, options) {
+ return addYears(date, -amount, options);
+}
+var subYears_default;
+var init_subYears = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/subYears.js"() {
+ init_addYears();
+ subYears_default = subYears;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/weeksToDays.js
+function weeksToDays(weeks) {
+ return Math.trunc(weeks * daysInWeek);
+}
+var weeksToDays_default;
+var init_weeksToDays = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/weeksToDays.js"() {
+ init_constants();
+ weeksToDays_default = weeksToDays;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/yearsToDays.js
+function yearsToDays(years) {
+ return Math.trunc(years * daysInYear);
+}
+var yearsToDays_default;
+var init_yearsToDays = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/yearsToDays.js"() {
+ init_constants();
+ yearsToDays_default = yearsToDays;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/yearsToMonths.js
+function yearsToMonths(years) {
+ return Math.trunc(years * monthsInYear);
+}
+var yearsToMonths_default;
+var init_yearsToMonths = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/yearsToMonths.js"() {
+ init_constants();
+ yearsToMonths_default = yearsToMonths;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/yearsToQuarters.js
+function yearsToQuarters(years) {
+ return Math.trunc(years * quartersInYear);
+}
+var yearsToQuarters_default;
+var init_yearsToQuarters = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/yearsToQuarters.js"() {
+ init_constants();
+ yearsToQuarters_default = yearsToQuarters;
+ }
+});
+
+// node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/index.js
+var date_fns_exports = {};
+__export(date_fns_exports, {
+ add: () => add,
+ addBusinessDays: () => addBusinessDays,
+ addDays: () => addDays,
+ addHours: () => addHours,
+ addISOWeekYears: () => addISOWeekYears,
+ addMilliseconds: () => addMilliseconds,
+ addMinutes: () => addMinutes,
+ addMonths: () => addMonths,
+ addQuarters: () => addQuarters,
+ addSeconds: () => addSeconds,
+ addWeeks: () => addWeeks,
+ addYears: () => addYears,
+ areIntervalsOverlapping: () => areIntervalsOverlapping,
+ clamp: () => clamp,
+ closestIndexTo: () => closestIndexTo,
+ closestTo: () => closestTo,
+ compareAsc: () => compareAsc,
+ compareDesc: () => compareDesc,
+ constructFrom: () => constructFrom,
+ constructNow: () => constructNow,
+ daysToWeeks: () => daysToWeeks,
+ differenceInBusinessDays: () => differenceInBusinessDays,
+ differenceInCalendarDays: () => differenceInCalendarDays,
+ differenceInCalendarISOWeekYears: () => differenceInCalendarISOWeekYears,
+ differenceInCalendarISOWeeks: () => differenceInCalendarISOWeeks,
+ differenceInCalendarMonths: () => differenceInCalendarMonths,
+ differenceInCalendarQuarters: () => differenceInCalendarQuarters,
+ differenceInCalendarWeeks: () => differenceInCalendarWeeks,
+ differenceInCalendarYears: () => differenceInCalendarYears,
+ differenceInDays: () => differenceInDays,
+ differenceInHours: () => differenceInHours,
+ differenceInISOWeekYears: () => differenceInISOWeekYears,
+ differenceInMilliseconds: () => differenceInMilliseconds,
+ differenceInMinutes: () => differenceInMinutes,
+ differenceInMonths: () => differenceInMonths,
+ differenceInQuarters: () => differenceInQuarters,
+ differenceInSeconds: () => differenceInSeconds,
+ differenceInWeeks: () => differenceInWeeks,
+ differenceInYears: () => differenceInYears,
+ eachDayOfInterval: () => eachDayOfInterval,
+ eachHourOfInterval: () => eachHourOfInterval,
+ eachMinuteOfInterval: () => eachMinuteOfInterval,
+ eachMonthOfInterval: () => eachMonthOfInterval,
+ eachQuarterOfInterval: () => eachQuarterOfInterval,
+ eachWeekOfInterval: () => eachWeekOfInterval,
+ eachWeekendOfInterval: () => eachWeekendOfInterval,
+ eachWeekendOfMonth: () => eachWeekendOfMonth,
+ eachWeekendOfYear: () => eachWeekendOfYear,
+ eachYearOfInterval: () => eachYearOfInterval,
+ endOfDay: () => endOfDay,
+ endOfDecade: () => endOfDecade,
+ endOfHour: () => endOfHour,
+ endOfISOWeek: () => endOfISOWeek,
+ endOfISOWeekYear: () => endOfISOWeekYear,
+ endOfMinute: () => endOfMinute,
+ endOfMonth: () => endOfMonth,
+ endOfQuarter: () => endOfQuarter,
+ endOfSecond: () => endOfSecond,
+ endOfToday: () => endOfToday,
+ endOfTomorrow: () => endOfTomorrow,
+ endOfWeek: () => endOfWeek,
+ endOfYear: () => endOfYear,
+ endOfYesterday: () => endOfYesterday,
+ format: () => format,
+ formatDate: () => format,
+ formatDistance: () => formatDistance2,
+ formatDistanceStrict: () => formatDistanceStrict,
+ formatDistanceToNow: () => formatDistanceToNow,
+ formatDistanceToNowStrict: () => formatDistanceToNowStrict,
+ formatDuration: () => formatDuration,
+ formatISO: () => formatISO,
+ formatISO9075: () => formatISO9075,
+ formatISODuration: () => formatISODuration,
+ formatRFC3339: () => formatRFC3339,
+ formatRFC7231: () => formatRFC7231,
+ formatRelative: () => formatRelative2,
+ formatters: () => formatters,
+ fromUnixTime: () => fromUnixTime,
+ getDate: () => getDate,
+ getDay: () => getDay,
+ getDayOfYear: () => getDayOfYear,
+ getDaysInMonth: () => getDaysInMonth,
+ getDaysInYear: () => getDaysInYear,
+ getDecade: () => getDecade,
+ getDefaultOptions: () => getDefaultOptions2,
+ getHours: () => getHours,
+ getISODay: () => getISODay,
+ getISOWeek: () => getISOWeek,
+ getISOWeekYear: () => getISOWeekYear,
+ getISOWeeksInYear: () => getISOWeeksInYear,
+ getMilliseconds: () => getMilliseconds,
+ getMinutes: () => getMinutes,
+ getMonth: () => getMonth,
+ getOverlappingDaysInIntervals: () => getOverlappingDaysInIntervals,
+ getQuarter: () => getQuarter,
+ getSeconds: () => getSeconds,
+ getTime: () => getTime,
+ getUnixTime: () => getUnixTime,
+ getWeek: () => getWeek,
+ getWeekOfMonth: () => getWeekOfMonth,
+ getWeekYear: () => getWeekYear,
+ getWeeksInMonth: () => getWeeksInMonth,
+ getYear: () => getYear,
+ hoursToMilliseconds: () => hoursToMilliseconds,
+ hoursToMinutes: () => hoursToMinutes,
+ hoursToSeconds: () => hoursToSeconds,
+ interval: () => interval2,
+ intervalToDuration: () => intervalToDuration,
+ intlFormat: () => intlFormat,
+ intlFormatDistance: () => intlFormatDistance,
+ isAfter: () => isAfter,
+ isBefore: () => isBefore,
+ isDate: () => isDate,
+ isEqual: () => isEqual,
+ isExists: () => isExists,
+ isFirstDayOfMonth: () => isFirstDayOfMonth,
+ isFriday: () => isFriday,
+ isFuture: () => isFuture,
+ isLastDayOfMonth: () => isLastDayOfMonth,
+ isLeapYear: () => isLeapYear,
+ isMatch: () => isMatch2,
+ isMonday: () => isMonday,
+ isPast: () => isPast,
+ isSameDay: () => isSameDay,
+ isSameHour: () => isSameHour,
+ isSameISOWeek: () => isSameISOWeek,
+ isSameISOWeekYear: () => isSameISOWeekYear,
+ isSameMinute: () => isSameMinute,
+ isSameMonth: () => isSameMonth,
+ isSameQuarter: () => isSameQuarter,
+ isSameSecond: () => isSameSecond,
+ isSameWeek: () => isSameWeek,
+ isSameYear: () => isSameYear,
+ isSaturday: () => isSaturday,
+ isSunday: () => isSunday,
+ isThisHour: () => isThisHour,
+ isThisISOWeek: () => isThisISOWeek,
+ isThisMinute: () => isThisMinute,
+ isThisMonth: () => isThisMonth,
+ isThisQuarter: () => isThisQuarter,
+ isThisSecond: () => isThisSecond,
+ isThisWeek: () => isThisWeek,
+ isThisYear: () => isThisYear,
+ isThursday: () => isThursday,
+ isToday: () => isToday,
+ isTomorrow: () => isTomorrow,
+ isTuesday: () => isTuesday,
+ isValid: () => isValid,
+ isWednesday: () => isWednesday,
+ isWeekend: () => isWeekend,
+ isWithinInterval: () => isWithinInterval,
+ isYesterday: () => isYesterday,
+ lastDayOfDecade: () => lastDayOfDecade,
+ lastDayOfISOWeek: () => lastDayOfISOWeek,
+ lastDayOfISOWeekYear: () => lastDayOfISOWeekYear,
+ lastDayOfMonth: () => lastDayOfMonth,
+ lastDayOfQuarter: () => lastDayOfQuarter,
+ lastDayOfWeek: () => lastDayOfWeek,
+ lastDayOfYear: () => lastDayOfYear,
+ lightFormat: () => lightFormat,
+ lightFormatters: () => lightFormatters,
+ longFormatters: () => longFormatters,
+ max: () => max2,
+ milliseconds: () => milliseconds,
+ millisecondsToHours: () => millisecondsToHours,
+ millisecondsToMinutes: () => millisecondsToMinutes,
+ millisecondsToSeconds: () => millisecondsToSeconds,
+ min: () => min2,
+ minutesToHours: () => minutesToHours,
+ minutesToMilliseconds: () => minutesToMilliseconds,
+ minutesToSeconds: () => minutesToSeconds,
+ monthsToQuarters: () => monthsToQuarters,
+ monthsToYears: () => monthsToYears,
+ nextDay: () => nextDay,
+ nextFriday: () => nextFriday,
+ nextMonday: () => nextMonday,
+ nextSaturday: () => nextSaturday,
+ nextSunday: () => nextSunday,
+ nextThursday: () => nextThursday,
+ nextTuesday: () => nextTuesday,
+ nextWednesday: () => nextWednesday,
+ parse: () => parse,
+ parseISO: () => parseISO,
+ parseJSON: () => parseJSON,
+ parsers: () => parsers,
+ previousDay: () => previousDay,
+ previousFriday: () => previousFriday,
+ previousMonday: () => previousMonday,
+ previousSaturday: () => previousSaturday,
+ previousSunday: () => previousSunday,
+ previousThursday: () => previousThursday,
+ previousTuesday: () => previousTuesday,
+ previousWednesday: () => previousWednesday,
+ quartersToMonths: () => quartersToMonths,
+ quartersToYears: () => quartersToYears,
+ roundToNearestHours: () => roundToNearestHours,
+ roundToNearestMinutes: () => roundToNearestMinutes,
+ secondsToHours: () => secondsToHours,
+ secondsToMilliseconds: () => secondsToMilliseconds,
+ secondsToMinutes: () => secondsToMinutes,
+ set: () => set,
+ setDate: () => setDate,
+ setDay: () => setDay,
+ setDayOfYear: () => setDayOfYear,
+ setDefaultOptions: () => setDefaultOptions2,
+ setHours: () => setHours,
+ setISODay: () => setISODay,
+ setISOWeek: () => setISOWeek,
+ setISOWeekYear: () => setISOWeekYear,
+ setMilliseconds: () => setMilliseconds,
+ setMinutes: () => setMinutes,
+ setMonth: () => setMonth,
+ setQuarter: () => setQuarter,
+ setSeconds: () => setSeconds,
+ setWeek: () => setWeek,
+ setWeekYear: () => setWeekYear,
+ setYear: () => setYear,
+ startOfDay: () => startOfDay,
+ startOfDecade: () => startOfDecade,
+ startOfHour: () => startOfHour,
+ startOfISOWeek: () => startOfISOWeek,
+ startOfISOWeekYear: () => startOfISOWeekYear,
+ startOfMinute: () => startOfMinute,
+ startOfMonth: () => startOfMonth,
+ startOfQuarter: () => startOfQuarter,
+ startOfSecond: () => startOfSecond,
+ startOfToday: () => startOfToday,
+ startOfTomorrow: () => startOfTomorrow,
+ startOfWeek: () => startOfWeek,
+ startOfWeekYear: () => startOfWeekYear,
+ startOfYear: () => startOfYear,
+ startOfYesterday: () => startOfYesterday,
+ sub: () => sub,
+ subBusinessDays: () => subBusinessDays,
+ subDays: () => subDays,
+ subHours: () => subHours,
+ subISOWeekYears: () => subISOWeekYears,
+ subMilliseconds: () => subMilliseconds,
+ subMinutes: () => subMinutes,
+ subMonths: () => subMonths,
+ subQuarters: () => subQuarters,
+ subSeconds: () => subSeconds,
+ subWeeks: () => subWeeks,
+ subYears: () => subYears,
+ toDate: () => toDate,
+ transpose: () => transpose,
+ weeksToDays: () => weeksToDays,
+ yearsToDays: () => yearsToDays,
+ yearsToMonths: () => yearsToMonths,
+ yearsToQuarters: () => yearsToQuarters
+});
+var init_date_fns = __esm({
+ "node_modules/.pnpm/date-fns@4.1.0/node_modules/date-fns/index.js"() {
+ init_add();
+ init_addBusinessDays();
+ init_addDays();
+ init_addHours();
+ init_addISOWeekYears();
+ init_addMilliseconds();
+ init_addMinutes();
+ init_addMonths();
+ init_addQuarters();
+ init_addSeconds();
+ init_addWeeks();
+ init_addYears();
+ init_areIntervalsOverlapping();
+ init_clamp();
+ init_closestIndexTo();
+ init_closestTo();
+ init_compareAsc();
+ init_compareDesc();
+ init_constructFrom();
+ init_constructNow();
+ init_daysToWeeks();
+ init_differenceInBusinessDays();
+ init_differenceInCalendarDays();
+ init_differenceInCalendarISOWeekYears();
+ init_differenceInCalendarISOWeeks();
+ init_differenceInCalendarMonths();
+ init_differenceInCalendarQuarters();
+ init_differenceInCalendarWeeks();
+ init_differenceInCalendarYears();
+ init_differenceInDays();
+ init_differenceInHours();
+ init_differenceInISOWeekYears();
+ init_differenceInMilliseconds();
+ init_differenceInMinutes();
+ init_differenceInMonths();
+ init_differenceInQuarters();
+ init_differenceInSeconds();
+ init_differenceInWeeks();
+ init_differenceInYears();
+ init_eachDayOfInterval();
+ init_eachHourOfInterval();
+ init_eachMinuteOfInterval();
+ init_eachMonthOfInterval();
+ init_eachQuarterOfInterval();
+ init_eachWeekOfInterval();
+ init_eachWeekendOfInterval();
+ init_eachWeekendOfMonth();
+ init_eachWeekendOfYear();
+ init_eachYearOfInterval();
+ init_endOfDay();
+ init_endOfDecade();
+ init_endOfHour();
+ init_endOfISOWeek();
+ init_endOfISOWeekYear();
+ init_endOfMinute();
+ init_endOfMonth();
+ init_endOfQuarter();
+ init_endOfSecond();
+ init_endOfToday();
+ init_endOfTomorrow();
+ init_endOfWeek();
+ init_endOfYear();
+ init_endOfYesterday();
+ init_format();
+ init_formatDistance2();
+ init_formatDistanceStrict();
+ init_formatDistanceToNow();
+ init_formatDistanceToNowStrict();
+ init_formatDuration();
+ init_formatISO();
+ init_formatISO9075();
+ init_formatISODuration();
+ init_formatRFC3339();
+ init_formatRFC7231();
+ init_formatRelative2();
+ init_fromUnixTime();
+ init_getDate();
+ init_getDay();
+ init_getDayOfYear();
+ init_getDaysInMonth();
+ init_getDaysInYear();
+ init_getDecade();
+ init_getDefaultOptions();
+ init_getHours();
+ init_getISODay();
+ init_getISOWeek();
+ init_getISOWeekYear();
+ init_getISOWeeksInYear();
+ init_getMilliseconds();
+ init_getMinutes();
+ init_getMonth();
+ init_getOverlappingDaysInIntervals();
+ init_getQuarter();
+ init_getSeconds();
+ init_getTime();
+ init_getUnixTime();
+ init_getWeek();
+ init_getWeekOfMonth();
+ init_getWeekYear();
+ init_getWeeksInMonth();
+ init_getYear();
+ init_hoursToMilliseconds();
+ init_hoursToMinutes();
+ init_hoursToSeconds();
+ init_interval2();
+ init_intervalToDuration();
+ init_intlFormat();
+ init_intlFormatDistance();
+ init_isAfter();
+ init_isBefore();
+ init_isDate2();
+ init_isEqual();
+ init_isExists();
+ init_isFirstDayOfMonth();
+ init_isFriday();
+ init_isFuture();
+ init_isLastDayOfMonth();
+ init_isLeapYear();
+ init_isMatch();
+ init_isMonday();
+ init_isPast();
+ init_isSameDay();
+ init_isSameHour();
+ init_isSameISOWeek();
+ init_isSameISOWeekYear();
+ init_isSameMinute();
+ init_isSameMonth();
+ init_isSameQuarter();
+ init_isSameSecond();
+ init_isSameWeek();
+ init_isSameYear();
+ init_isSaturday();
+ init_isSunday();
+ init_isThisHour();
+ init_isThisISOWeek();
+ init_isThisMinute();
+ init_isThisMonth();
+ init_isThisQuarter();
+ init_isThisSecond();
+ init_isThisWeek();
+ init_isThisYear();
+ init_isThursday();
+ init_isToday();
+ init_isTomorrow();
+ init_isTuesday();
+ init_isValid();
+ init_isWednesday();
+ init_isWeekend();
+ init_isWithinInterval();
+ init_isYesterday();
+ init_lastDayOfDecade();
+ init_lastDayOfISOWeek();
+ init_lastDayOfISOWeekYear();
+ init_lastDayOfMonth();
+ init_lastDayOfQuarter();
+ init_lastDayOfWeek();
+ init_lastDayOfYear();
+ init_lightFormat();
+ init_max2();
+ init_milliseconds();
+ init_millisecondsToHours();
+ init_millisecondsToMinutes();
+ init_millisecondsToSeconds();
+ init_min2();
+ init_minutesToHours();
+ init_minutesToMilliseconds();
+ init_minutesToSeconds();
+ init_monthsToQuarters();
+ init_monthsToYears();
+ init_nextDay();
+ init_nextFriday();
+ init_nextMonday();
+ init_nextSaturday();
+ init_nextSunday();
+ init_nextThursday();
+ init_nextTuesday();
+ init_nextWednesday();
+ init_parse();
+ init_parseISO();
+ init_parseJSON();
+ init_previousDay();
+ init_previousFriday();
+ init_previousMonday();
+ init_previousSaturday();
+ init_previousSunday();
+ init_previousThursday();
+ init_previousTuesday();
+ init_previousWednesday();
+ init_quartersToMonths();
+ init_quartersToYears();
+ init_roundToNearestHours();
+ init_roundToNearestMinutes();
+ init_secondsToHours();
+ init_secondsToMilliseconds();
+ init_secondsToMinutes();
+ init_set();
+ init_setDate();
+ init_setDay();
+ init_setDayOfYear();
+ init_setDefaultOptions();
+ init_setHours();
+ init_setISODay();
+ init_setISOWeek();
+ init_setISOWeekYear();
+ init_setMilliseconds();
+ init_setMinutes();
+ init_setMonth();
+ init_setQuarter();
+ init_setSeconds();
+ init_setWeek();
+ init_setWeekYear();
+ init_setYear();
+ init_startOfDay();
+ init_startOfDecade();
+ init_startOfHour();
+ init_startOfISOWeek();
+ init_startOfISOWeekYear();
+ init_startOfMinute();
+ init_startOfMonth();
+ init_startOfQuarter();
+ init_startOfSecond();
+ init_startOfToday();
+ init_startOfTomorrow();
+ init_startOfWeek();
+ init_startOfWeekYear();
+ init_startOfYear();
+ init_startOfYesterday();
+ init_sub();
+ init_subBusinessDays();
+ init_subDays();
+ init_subHours();
+ init_subISOWeekYears();
+ init_subMilliseconds();
+ init_subMinutes();
+ init_subMonths();
+ init_subQuarters();
+ init_subSeconds();
+ init_subWeeks();
+ init_subYears();
+ init_toDate();
+ init_transpose();
+ init_weeksToDays();
+ init_yearsToDays();
+ init_yearsToMonths();
+ init_yearsToQuarters();
+ }
+});
+
+// node_modules/.pnpm/dayjs@1.11.19/node_modules/dayjs/dayjs.min.js
+var require_dayjs_min = __commonJS({
+ "node_modules/.pnpm/dayjs@1.11.19/node_modules/dayjs/dayjs.min.js"(exports, module) {
+ !(function(t9, e11) {
+ "object" == typeof exports && "undefined" != typeof module ? module.exports = e11() : "function" == typeof define && define.amd ? define(e11) : (t9 = "undefined" != typeof globalThis ? globalThis : t9 || self).dayjs = e11();
+ })(exports, (function() {
+ "use strict";
+ var t9 = 1e3, e11 = 6e4, n12 = 36e5, r11 = "millisecond", i11 = "second", s10 = "minute", u7 = "hour", a5 = "day", o13 = "week", c11 = "month", f7 = "quarter", h8 = "year", d5 = "date", l6 = "Invalid Date", $4 = /^(\d{4})[-/]?(\d{1,2})?[-/]?(\d{0,2})[Tt\s]*(\d{1,2})?:?(\d{1,2})?:?(\d{1,2})?[.:]?(\d+)?$/, y4 = /\[([^\]]+)]|Y{1,4}|M{1,4}|D{1,2}|d{1,4}|H{1,2}|h{1,2}|a|A|m{1,2}|s{1,2}|Z{1,2}|SSS/g, M4 = { name: "en", weekdays: "Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"), months: "January_February_March_April_May_June_July_August_September_October_November_December".split("_"), ordinal: function(t10) {
+ var e12 = ["th", "st", "nd", "rd"], n13 = t10 % 100;
+ return "[" + t10 + (e12[(n13 - 20) % 10] || e12[n13] || e12[0]) + "]";
+ } }, m6 = function(t10, e12, n13) {
+ var r12 = String(t10);
+ return !r12 || r12.length >= e12 ? t10 : "" + Array(e12 + 1 - r12.length).join(n13) + t10;
+ }, v5 = { s: m6, z: function(t10) {
+ var e12 = -t10.utcOffset(), n13 = Math.abs(e12), r12 = Math.floor(n13 / 60), i12 = n13 % 60;
+ return (e12 <= 0 ? "+" : "-") + m6(r12, 2, "0") + ":" + m6(i12, 2, "0");
+ }, m: function t10(e12, n13) {
+ if (e12.date() < n13.date()) return -t10(n13, e12);
+ var r12 = 12 * (n13.year() - e12.year()) + (n13.month() - e12.month()), i12 = e12.clone().add(r12, c11), s11 = n13 - i12 < 0, u8 = e12.clone().add(r12 + (s11 ? -1 : 1), c11);
+ return +(-(r12 + (n13 - i12) / (s11 ? i12 - u8 : u8 - i12)) || 0);
+ }, a: function(t10) {
+ return t10 < 0 ? Math.ceil(t10) || 0 : Math.floor(t10);
+ }, p: function(t10) {
+ return { M: c11, y: h8, w: o13, d: a5, D: d5, h: u7, m: s10, s: i11, ms: r11, Q: f7 }[t10] || String(t10 || "").toLowerCase().replace(/s$/, "");
+ }, u: function(t10) {
+ return void 0 === t10;
+ } }, g4 = "en", D4 = {};
+ D4[g4] = M4;
+ var p7 = "$isDayjsObject", S4 = function(t10) {
+ return t10 instanceof _4 || !(!t10 || !t10[p7]);
+ }, w4 = function t10(e12, n13, r12) {
+ var i12;
+ if (!e12) return g4;
+ if ("string" == typeof e12) {
+ var s11 = e12.toLowerCase();
+ D4[s11] && (i12 = s11), n13 && (D4[s11] = n13, i12 = s11);
+ var u8 = e12.split("-");
+ if (!i12 && u8.length > 1) return t10(u8[0]);
+ } else {
+ var a6 = e12.name;
+ D4[a6] = e12, i12 = a6;
+ }
+ return !r12 && i12 && (g4 = i12), i12 || !r12 && g4;
+ }, O3 = function(t10, e12) {
+ if (S4(t10)) return t10.clone();
+ var n13 = "object" == typeof e12 ? e12 : {};
+ return n13.date = t10, n13.args = arguments, new _4(n13);
+ }, b5 = v5;
+ b5.l = w4, b5.i = S4, b5.w = function(t10, e12) {
+ return O3(t10, { locale: e12.$L, utc: e12.$u, x: e12.$x, $offset: e12.$offset });
+ };
+ var _4 = (function() {
+ function M5(t10) {
+ this.$L = w4(t10.locale, null, true), this.parse(t10), this.$x = this.$x || t10.x || {}, this[p7] = true;
+ }
+ var m7 = M5.prototype;
+ return m7.parse = function(t10) {
+ this.$d = (function(t11) {
+ var e12 = t11.date, n13 = t11.utc;
+ if (null === e12) return /* @__PURE__ */ new Date(NaN);
+ if (b5.u(e12)) return /* @__PURE__ */ new Date();
+ if (e12 instanceof Date) return new Date(e12);
+ if ("string" == typeof e12 && !/Z$/i.test(e12)) {
+ var r12 = e12.match($4);
+ if (r12) {
+ var i12 = r12[2] - 1 || 0, s11 = (r12[7] || "0").substring(0, 3);
+ return n13 ? new Date(Date.UTC(r12[1], i12, r12[3] || 1, r12[4] || 0, r12[5] || 0, r12[6] || 0, s11)) : new Date(r12[1], i12, r12[3] || 1, r12[4] || 0, r12[5] || 0, r12[6] || 0, s11);
+ }
+ }
+ return new Date(e12);
+ })(t10), this.init();
+ }, m7.init = function() {
+ var t10 = this.$d;
+ this.$y = t10.getFullYear(), this.$M = t10.getMonth(), this.$D = t10.getDate(), this.$W = t10.getDay(), this.$H = t10.getHours(), this.$m = t10.getMinutes(), this.$s = t10.getSeconds(), this.$ms = t10.getMilliseconds();
+ }, m7.$utils = function() {
+ return b5;
+ }, m7.isValid = function() {
+ return !(this.$d.toString() === l6);
+ }, m7.isSame = function(t10, e12) {
+ var n13 = O3(t10);
+ return this.startOf(e12) <= n13 && n13 <= this.endOf(e12);
+ }, m7.isAfter = function(t10, e12) {
+ return O3(t10) < this.startOf(e12);
+ }, m7.isBefore = function(t10, e12) {
+ return this.endOf(e12) < O3(t10);
+ }, m7.$g = function(t10, e12, n13) {
+ return b5.u(t10) ? this[e12] : this.set(n13, t10);
+ }, m7.unix = function() {
+ return Math.floor(this.valueOf() / 1e3);
+ }, m7.valueOf = function() {
+ return this.$d.getTime();
+ }, m7.startOf = function(t10, e12) {
+ var n13 = this, r12 = !!b5.u(e12) || e12, f8 = b5.p(t10), l7 = function(t11, e13) {
+ var i12 = b5.w(n13.$u ? Date.UTC(n13.$y, e13, t11) : new Date(n13.$y, e13, t11), n13);
+ return r12 ? i12 : i12.endOf(a5);
+ }, $5 = function(t11, e13) {
+ return b5.w(n13.toDate()[t11].apply(n13.toDate("s"), (r12 ? [0, 0, 0, 0] : [23, 59, 59, 999]).slice(e13)), n13);
+ }, y5 = this.$W, M6 = this.$M, m8 = this.$D, v6 = "set" + (this.$u ? "UTC" : "");
+ switch (f8) {
+ case h8:
+ return r12 ? l7(1, 0) : l7(31, 11);
+ case c11:
+ return r12 ? l7(1, M6) : l7(0, M6 + 1);
+ case o13:
+ var g5 = this.$locale().weekStart || 0, D5 = (y5 < g5 ? y5 + 7 : y5) - g5;
+ return l7(r12 ? m8 - D5 : m8 + (6 - D5), M6);
+ case a5:
+ case d5:
+ return $5(v6 + "Hours", 0);
+ case u7:
+ return $5(v6 + "Minutes", 1);
+ case s10:
+ return $5(v6 + "Seconds", 2);
+ case i11:
+ return $5(v6 + "Milliseconds", 3);
+ default:
+ return this.clone();
+ }
+ }, m7.endOf = function(t10) {
+ return this.startOf(t10, false);
+ }, m7.$set = function(t10, e12) {
+ var n13, o14 = b5.p(t10), f8 = "set" + (this.$u ? "UTC" : ""), l7 = (n13 = {}, n13[a5] = f8 + "Date", n13[d5] = f8 + "Date", n13[c11] = f8 + "Month", n13[h8] = f8 + "FullYear", n13[u7] = f8 + "Hours", n13[s10] = f8 + "Minutes", n13[i11] = f8 + "Seconds", n13[r11] = f8 + "Milliseconds", n13)[o14], $5 = o14 === a5 ? this.$D + (e12 - this.$W) : e12;
+ if (o14 === c11 || o14 === h8) {
+ var y5 = this.clone().set(d5, 1);
+ y5.$d[l7]($5), y5.init(), this.$d = y5.set(d5, Math.min(this.$D, y5.daysInMonth())).$d;
+ } else l7 && this.$d[l7]($5);
+ return this.init(), this;
+ }, m7.set = function(t10, e12) {
+ return this.clone().$set(t10, e12);
+ }, m7.get = function(t10) {
+ return this[b5.p(t10)]();
+ }, m7.add = function(r12, f8) {
+ var d6, l7 = this;
+ r12 = Number(r12);
+ var $5 = b5.p(f8), y5 = function(t10) {
+ var e12 = O3(l7);
+ return b5.w(e12.date(e12.date() + Math.round(t10 * r12)), l7);
+ };
+ if ($5 === c11) return this.set(c11, this.$M + r12);
+ if ($5 === h8) return this.set(h8, this.$y + r12);
+ if ($5 === a5) return y5(1);
+ if ($5 === o13) return y5(7);
+ var M6 = (d6 = {}, d6[s10] = e11, d6[u7] = n12, d6[i11] = t9, d6)[$5] || 1, m8 = this.$d.getTime() + r12 * M6;
+ return b5.w(m8, this);
+ }, m7.subtract = function(t10, e12) {
+ return this.add(-1 * t10, e12);
+ }, m7.format = function(t10) {
+ var e12 = this, n13 = this.$locale();
+ if (!this.isValid()) return n13.invalidDate || l6;
+ var r12 = t10 || "YYYY-MM-DDTHH:mm:ssZ", i12 = b5.z(this), s11 = this.$H, u8 = this.$m, a6 = this.$M, o14 = n13.weekdays, c12 = n13.months, f8 = n13.meridiem, h9 = function(t11, n14, i13, s12) {
+ return t11 && (t11[n14] || t11(e12, r12)) || i13[n14].slice(0, s12);
+ }, d6 = function(t11) {
+ return b5.s(s11 % 12 || 12, t11, "0");
+ }, $5 = f8 || function(t11, e13, n14) {
+ var r13 = t11 < 12 ? "AM" : "PM";
+ return n14 ? r13.toLowerCase() : r13;
+ };
+ return r12.replace(y4, (function(t11, r13) {
+ return r13 || (function(t12) {
+ switch (t12) {
+ case "YY":
+ return String(e12.$y).slice(-2);
+ case "YYYY":
+ return b5.s(e12.$y, 4, "0");
+ case "M":
+ return a6 + 1;
+ case "MM":
+ return b5.s(a6 + 1, 2, "0");
+ case "MMM":
+ return h9(n13.monthsShort, a6, c12, 3);
+ case "MMMM":
+ return h9(c12, a6);
+ case "D":
+ return e12.$D;
+ case "DD":
+ return b5.s(e12.$D, 2, "0");
+ case "d":
+ return String(e12.$W);
+ case "dd":
+ return h9(n13.weekdaysMin, e12.$W, o14, 2);
+ case "ddd":
+ return h9(n13.weekdaysShort, e12.$W, o14, 3);
+ case "dddd":
+ return o14[e12.$W];
+ case "H":
+ return String(s11);
+ case "HH":
+ return b5.s(s11, 2, "0");
+ case "h":
+ return d6(1);
+ case "hh":
+ return d6(2);
+ case "a":
+ return $5(s11, u8, true);
+ case "A":
+ return $5(s11, u8, false);
+ case "m":
+ return String(u8);
+ case "mm":
+ return b5.s(u8, 2, "0");
+ case "s":
+ return String(e12.$s);
+ case "ss":
+ return b5.s(e12.$s, 2, "0");
+ case "SSS":
+ return b5.s(e12.$ms, 3, "0");
+ case "Z":
+ return i12;
+ }
+ return null;
+ })(t11) || i12.replace(":", "");
+ }));
+ }, m7.utcOffset = function() {
+ return 15 * -Math.round(this.$d.getTimezoneOffset() / 15);
+ }, m7.diff = function(r12, d6, l7) {
+ var $5, y5 = this, M6 = b5.p(d6), m8 = O3(r12), v6 = (m8.utcOffset() - this.utcOffset()) * e11, g5 = this - m8, D5 = function() {
+ return b5.m(y5, m8);
+ };
+ switch (M6) {
+ case h8:
+ $5 = D5() / 12;
+ break;
+ case c11:
+ $5 = D5();
+ break;
+ case f7:
+ $5 = D5() / 3;
+ break;
+ case o13:
+ $5 = (g5 - v6) / 6048e5;
+ break;
+ case a5:
+ $5 = (g5 - v6) / 864e5;
+ break;
+ case u7:
+ $5 = g5 / n12;
+ break;
+ case s10:
+ $5 = g5 / e11;
+ break;
+ case i11:
+ $5 = g5 / t9;
+ break;
+ default:
+ $5 = g5;
+ }
+ return l7 ? $5 : b5.a($5);
+ }, m7.daysInMonth = function() {
+ return this.endOf(c11).$D;
+ }, m7.$locale = function() {
+ return D4[this.$L];
+ }, m7.locale = function(t10, e12) {
+ if (!t10) return this.$L;
+ var n13 = this.clone(), r12 = w4(t10, e12, true);
+ return r12 && (n13.$L = r12), n13;
+ }, m7.clone = function() {
+ return b5.w(this.$d, this);
+ }, m7.toDate = function() {
+ return new Date(this.valueOf());
+ }, m7.toJSON = function() {
+ return this.isValid() ? this.toISOString() : null;
+ }, m7.toISOString = function() {
+ return this.$d.toISOString();
+ }, m7.toString = function() {
+ return this.$d.toUTCString();
+ }, M5;
+ })(), k4 = _4.prototype;
+ return O3.prototype = k4, [["$ms", r11], ["$s", i11], ["$m", s10], ["$H", u7], ["$W", a5], ["$M", c11], ["$y", h8], ["$D", d5]].forEach((function(t10) {
+ k4[t10[1]] = function(e12) {
+ return this.$g(e12, t10[0], t10[1]);
+ };
+ })), O3.extend = function(t10, e12) {
+ return t10.$i || (t10(e12, _4, O3), t10.$i = true), O3;
+ }, O3.locale = w4, O3.isDayjs = S4, O3.unix = function(t10) {
+ return O3(1e3 * t10);
+ }, O3.en = D4[g4], O3.Ls = D4, O3.p = {}, O3;
+ }));
+ }
+});
+
+// node_modules/.pnpm/dayjs@1.11.19/node_modules/dayjs/plugin/isToday.js
+var require_isToday = __commonJS({
+ "node_modules/.pnpm/dayjs@1.11.19/node_modules/dayjs/plugin/isToday.js"(exports, module) {
+ !(function(e11, o13) {
+ "object" == typeof exports && "undefined" != typeof module ? module.exports = o13() : "function" == typeof define && define.amd ? define(o13) : (e11 = "undefined" != typeof globalThis ? globalThis : e11 || self).dayjs_plugin_isToday = o13();
+ })(exports, (function() {
+ "use strict";
+ return function(e11, o13, t9) {
+ o13.prototype.isToday = function() {
+ var e12 = "YYYY-MM-DD", o14 = t9();
+ return this.format(e12) === o14.format(e12);
+ };
+ };
+ }));
+ }
+});
+
+// node_modules/.pnpm/parse-ms@4.0.0/node_modules/parse-ms/index.js
+function parseNumber(milliseconds2) {
+ return {
+ days: Math.trunc(milliseconds2 / 864e5),
+ hours: Math.trunc(milliseconds2 / 36e5 % 24),
+ minutes: Math.trunc(milliseconds2 / 6e4 % 60),
+ seconds: Math.trunc(milliseconds2 / 1e3 % 60),
+ milliseconds: Math.trunc(milliseconds2 % 1e3),
+ microseconds: Math.trunc(toZeroIfInfinity(milliseconds2 * 1e3) % 1e3),
+ nanoseconds: Math.trunc(toZeroIfInfinity(milliseconds2 * 1e6) % 1e3)
+ };
+}
+function parseBigint(milliseconds2) {
+ return {
+ days: milliseconds2 / 86400000n,
+ hours: milliseconds2 / 3600000n % 24n,
+ minutes: milliseconds2 / 60000n % 60n,
+ seconds: milliseconds2 / 1000n % 60n,
+ milliseconds: milliseconds2 % 1000n,
+ microseconds: 0n,
+ nanoseconds: 0n
+ };
+}
+function parseMilliseconds(milliseconds2) {
+ switch (typeof milliseconds2) {
+ case "number": {
+ if (Number.isFinite(milliseconds2)) {
+ return parseNumber(milliseconds2);
+ }
+ break;
+ }
+ case "bigint": {
+ return parseBigint(milliseconds2);
+ }
+ }
+ throw new TypeError("Expected a finite number or bigint");
+}
+var toZeroIfInfinity;
+var init_parse_ms = __esm({
+ "node_modules/.pnpm/parse-ms@4.0.0/node_modules/parse-ms/index.js"() {
+ toZeroIfInfinity = (value2) => Number.isFinite(value2) ? value2 : 0;
+ }
+});
+
+// node_modules/.pnpm/pretty-ms@9.3.0/node_modules/pretty-ms/index.js
+function prettyMilliseconds(milliseconds2, options) {
+ const isBigInt = typeof milliseconds2 === "bigint";
+ if (!isBigInt && !Number.isFinite(milliseconds2)) {
+ throw new TypeError("Expected a finite number or bigint");
+ }
+ options = { ...options };
+ const sign = milliseconds2 < 0 ? "-" : "";
+ milliseconds2 = milliseconds2 < 0 ? -milliseconds2 : milliseconds2;
+ if (options.colonNotation) {
+ options.compact = false;
+ options.formatSubMilliseconds = false;
+ options.separateMilliseconds = false;
+ options.verbose = false;
+ }
+ if (options.compact) {
+ options.unitCount = 1;
+ options.secondsDecimalDigits = 0;
+ options.millisecondsDecimalDigits = 0;
+ }
+ let result = [];
+ const floorDecimals = (value2, decimalDigits) => {
+ const flooredInterimValue = Math.floor(value2 * 10 ** decimalDigits + SECOND_ROUNDING_EPSILON);
+ const flooredValue = Math.round(flooredInterimValue) / 10 ** decimalDigits;
+ return flooredValue.toFixed(decimalDigits);
+ };
+ const add3 = (value2, long, short, valueString) => {
+ if ((result.length === 0 || !options.colonNotation) && isZero(value2) && !(options.colonNotation && short === "m")) {
+ return;
+ }
+ valueString ??= String(value2);
+ if (options.colonNotation) {
+ const wholeDigits = valueString.includes(".") ? valueString.split(".")[0].length : valueString.length;
+ const minLength = result.length > 0 ? 2 : 1;
+ valueString = "0".repeat(Math.max(0, minLength - wholeDigits)) + valueString;
+ } else {
+ valueString += options.verbose ? " " + pluralize(long, value2) : short;
+ }
+ result.push(valueString);
+ };
+ const parsed = parseMilliseconds(milliseconds2);
+ const days2 = BigInt(parsed.days);
+ if (options.hideYearAndDays) {
+ add3(BigInt(days2) * 24n + BigInt(parsed.hours), "hour", "h");
+ } else {
+ if (options.hideYear) {
+ add3(days2, "day", "d");
+ } else {
+ add3(days2 / 365n, "year", "y");
+ add3(days2 % 365n, "day", "d");
+ }
+ add3(Number(parsed.hours), "hour", "h");
+ }
+ add3(Number(parsed.minutes), "minute", "m");
+ if (!options.hideSeconds) {
+ if (options.separateMilliseconds || options.formatSubMilliseconds || !options.colonNotation && milliseconds2 < 1e3 && !options.subSecondsAsDecimals) {
+ const seconds = Number(parsed.seconds);
+ const milliseconds3 = Number(parsed.milliseconds);
+ const microseconds = Number(parsed.microseconds);
+ const nanoseconds = Number(parsed.nanoseconds);
+ add3(seconds, "second", "s");
+ if (options.formatSubMilliseconds) {
+ add3(milliseconds3, "millisecond", "ms");
+ add3(microseconds, "microsecond", "\xB5s");
+ add3(nanoseconds, "nanosecond", "ns");
+ } else {
+ const millisecondsAndBelow = milliseconds3 + microseconds / 1e3 + nanoseconds / 1e6;
+ const millisecondsDecimalDigits = typeof options.millisecondsDecimalDigits === "number" ? options.millisecondsDecimalDigits : 0;
+ const roundedMilliseconds = millisecondsAndBelow >= 1 ? Math.round(millisecondsAndBelow) : Math.ceil(millisecondsAndBelow);
+ const millisecondsString = millisecondsDecimalDigits ? millisecondsAndBelow.toFixed(millisecondsDecimalDigits) : roundedMilliseconds;
+ add3(
+ Number.parseFloat(millisecondsString),
+ "millisecond",
+ "ms",
+ millisecondsString
+ );
+ }
+ } else {
+ const seconds = (isBigInt ? Number(milliseconds2 % ONE_DAY_IN_MILLISECONDS) : milliseconds2) / 1e3 % 60;
+ const secondsDecimalDigits = typeof options.secondsDecimalDigits === "number" ? options.secondsDecimalDigits : 1;
+ const secondsFixed = floorDecimals(seconds, secondsDecimalDigits);
+ const secondsString = options.keepDecimalsOnWholeSeconds ? secondsFixed : secondsFixed.replace(/\.0+$/, "");
+ add3(Number.parseFloat(secondsString), "second", "s", secondsString);
+ }
+ }
+ if (result.length === 0) {
+ return sign + "0" + (options.verbose ? " milliseconds" : "ms");
+ }
+ const separator = options.colonNotation ? ":" : " ";
+ if (typeof options.unitCount === "number") {
+ result = result.slice(0, Math.max(options.unitCount, 1));
+ }
+ return sign + result.join(separator);
+}
+var isZero, pluralize, SECOND_ROUNDING_EPSILON, ONE_DAY_IN_MILLISECONDS;
+var init_pretty_ms = __esm({
+ "node_modules/.pnpm/pretty-ms@9.3.0/node_modules/pretty-ms/index.js"() {
+ init_parse_ms();
+ isZero = (value2) => value2 === 0 || value2 === 0n;
+ pluralize = (word, count2) => count2 === 1 || count2 === 1n ? word : `${word}s`;
+ SECOND_ROUNDING_EPSILON = 1e-7;
+ ONE_DAY_IN_MILLISECONDS = 24n * 60n * 60n * 1000n;
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/smarttime.plugins.js
+var import_dayjs, import_isToday;
+var init_smarttime_plugins = __esm({
+ "node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/smarttime.plugins.js"() {
+ init_dist_ts7();
+ init_dist_ts3();
+ init_dist_ts();
+ init_croner();
+ init_date_fns();
+ import_dayjs = __toESM(require_dayjs_min(), 1);
+ import_isToday = __toESM(require_isToday(), 1);
+ init_pretty_ms();
+ import_dayjs.default.extend(import_isToday.default);
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/smarttime.classes.cronjob.js
+var CronJob;
+var init_smarttime_classes_cronjob = __esm({
+ "node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/smarttime.classes.cronjob.js"() {
+ init_smarttime_plugins();
+ init_smarttime_classes_cronmanager();
+ CronJob = class {
+ constructor(cronManager, cronExpressionArg, jobFunction) {
+ this.status = "initial";
+ this.nextExecutionUnix = 0;
+ this.cronExpression = cronExpressionArg;
+ this.jobFunction = jobFunction;
+ this.cronParser = new croner_exports.Cron(cronExpressionArg);
+ }
+ /**
+ * checks wether the cronjob needs to be executed
+ */
+ checkExecution() {
+ if (this.status === "stopped") {
+ return this.nextExecutionUnix;
+ }
+ if (this.nextExecutionUnix === 0) {
+ this.getNextExecutionTime();
+ }
+ if (Date.now() > this.nextExecutionUnix) {
+ const maybePromise = this.jobFunction(this.nextExecutionUnix);
+ if (maybePromise instanceof Promise) {
+ maybePromise.catch((e11) => console.log(e11));
+ }
+ this.nextExecutionUnix = this.getNextExecutionTime();
+ }
+ return this.nextExecutionUnix;
+ }
+ getNextExecutionTime() {
+ return this.nextExecutionUnix = Date.now() + this.getTimeToNextExecution();
+ }
+ /**
+ * gets the time to next execution
+ */
+ getTimeToNextExecution() {
+ return this.cronParser.msToNext();
+ }
+ start() {
+ this.status = "started";
+ }
+ stop() {
+ this.status = "stopped";
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/smarttime.classes.cronmanager.js
+var CronManager;
+var init_smarttime_classes_cronmanager = __esm({
+ "node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/smarttime.classes.cronmanager.js"() {
+ init_smarttime_plugins();
+ init_smarttime_classes_cronjob();
+ CronManager = class {
+ constructor() {
+ this.status = "stopped";
+ this.cronjobs = new dist_ts_exports6.ObjectMap();
+ this.cycleWakeDeferred = null;
+ }
+ /**
+ * Resolves the current wake deferred, causing the sleeping cycle
+ * to immediately recalculate instead of waiting for its timeout.
+ */
+ wakeCycle() {
+ if (this.cycleWakeDeferred && this.cycleWakeDeferred.status === "pending") {
+ this.cycleWakeDeferred.resolve();
+ }
+ }
+ addCronjob(cronIdentifierArg, cronFunctionArg) {
+ const newCronJob = new CronJob(this, cronIdentifierArg, cronFunctionArg);
+ this.cronjobs.add(newCronJob);
+ if (this.status === "started") {
+ newCronJob.start();
+ this.wakeCycle();
+ }
+ return newCronJob;
+ }
+ removeCronjob(cronjobArg) {
+ cronjobArg.stop();
+ this.cronjobs.remove(cronjobArg);
+ if (this.status === "started") {
+ this.wakeCycle();
+ }
+ }
+ /**
+ * starts the cronjob
+ */
+ start() {
+ if (this.status !== "started") {
+ this.status = "started";
+ for (const cronJob of this.cronjobs.getArray()) {
+ cronJob.start();
+ }
+ this.runCronCycle();
+ }
+ }
+ async runCronCycle() {
+ while (this.status === "started") {
+ this.cycleWakeDeferred = new dist_ts_exports.Deferred();
+ let soonestMs = Infinity;
+ for (const cronJob of this.cronjobs.getArray()) {
+ cronJob.checkExecution();
+ const msToNext = cronJob.getTimeToNextExecution();
+ if (msToNext < soonestMs) {
+ soonestMs = msToNext;
+ }
+ }
+ if (soonestMs < Infinity && soonestMs > 0) {
+ this.executionTimeout = new dist_ts_exports3.Timeout(soonestMs);
+ await Promise.race([
+ this.executionTimeout.promise,
+ this.cycleWakeDeferred.promise
+ ]);
+ this.executionTimeout.cancel();
+ } else if (soonestMs <= 0) {
+ continue;
+ } else {
+ await this.cycleWakeDeferred.promise;
+ }
+ }
+ this.cycleWakeDeferred = null;
+ }
+ /**
+ * stops all cronjobs
+ */
+ stop() {
+ if (this.status === "started") {
+ this.status = "stopped";
+ if (this.executionTimeout) {
+ this.executionTimeout.cancel();
+ }
+ this.wakeCycle();
+ }
+ for (const cron of this.cronjobs.getArray()) {
+ cron.stop();
+ }
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/smarttime.units.js
+var units, getMilliSecondsFromUnits, getMilliSecondsAsHumanReadableString, getMilliSecondsAsHumanReadableAgoTime;
+var init_smarttime_units = __esm({
+ "node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/smarttime.units.js"() {
+ init_smarttime_plugins();
+ units = {
+ years: (timesArg = 1) => {
+ return timesArg * 3154e7;
+ },
+ months: (timesArg = 1) => {
+ return timesArg * 2628e6;
+ },
+ weeks: (timesArg = 1) => {
+ return timesArg * 6048e5;
+ },
+ days: (timesArg = 1) => {
+ return timesArg * 864e5;
+ },
+ hours: (timesArg = 1) => {
+ return timesArg * 36e5;
+ },
+ minutes: (timesArg = 1) => {
+ return timesArg * 6e4;
+ },
+ seconds: (timesArg = 1) => {
+ return timesArg * 1e3;
+ }
+ };
+ getMilliSecondsFromUnits = (combinationArg) => {
+ let timeInMilliseconds = 0;
+ let addMilliSeconds = (milliSecondsArg) => {
+ timeInMilliseconds = timeInMilliseconds + milliSecondsArg;
+ };
+ if (combinationArg.years) {
+ addMilliSeconds(units.years(combinationArg.years));
+ }
+ if (combinationArg.months) {
+ addMilliSeconds(units.months(combinationArg.months));
+ }
+ if (combinationArg.weeks) {
+ addMilliSeconds(units.weeks(combinationArg.weeks));
+ }
+ if (combinationArg.days) {
+ addMilliSeconds(units.days(combinationArg.days));
+ }
+ if (combinationArg.hours) {
+ addMilliSeconds(units.hours(combinationArg.hours));
+ }
+ if (combinationArg.minutes) {
+ addMilliSeconds(units.minutes(combinationArg.minutes));
+ }
+ if (combinationArg.seconds) {
+ addMilliSeconds(units.seconds(combinationArg.seconds));
+ }
+ return timeInMilliseconds;
+ };
+ getMilliSecondsAsHumanReadableString = (milliSecondsArg) => {
+ return prettyMilliseconds(milliSecondsArg);
+ };
+ getMilliSecondsAsHumanReadableAgoTime = (timeStampArg) => {
+ return date_fns_exports.formatDistanceToNow(new Date(timeStampArg));
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/smarttime.classes.extendeddate.js
+var ExtendedDate;
+var init_smarttime_classes_extendeddate = __esm({
+ "node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/smarttime.classes.extendeddate.js"() {
+ init_smarttime_plugins();
+ init_smarttime_units();
+ ExtendedDate = class _ExtendedDate extends Date {
+ // STATIC factories
+ static fromMillis(milliSeconds) {
+ return new _ExtendedDate(milliSeconds);
+ }
+ static fromDate(dateArg) {
+ return new _ExtendedDate(dateArg.getTime());
+ }
+ static fromEuropeanDate(europeanDate) {
+ const dateArray = /(.*)\.(.*)\.(.*)/.exec(europeanDate);
+ const date = new Date(
+ parseFloat(dateArray[3]),
+ // year
+ parseFloat(dateArray[2]) - 1,
+ // month
+ parseFloat(dateArray[1])
+ // day
+ );
+ const unixMilli = date.getTime();
+ return new _ExtendedDate(unixMilli);
+ }
+ /**
+ * creates an Extended date from a hypedDate like "2018-03-28"
+ * @param dateString
+ */
+ static fromHyphedDate(dateString) {
+ const dateMillis = new Date(dateString).getTime();
+ return new _ExtendedDate(dateMillis);
+ }
+ /**
+ * Same as .fromEuropeanDate(), but accepts additional timeArg and zoneArg
+ */
+ static fromEuropeanDateAndTime(europeanDateArg, timeArg = "12:00:00", zoneArg = "Europe/Berlin") {
+ const dateArray = /(.*)\.(.*)\.(.*)/.exec(europeanDateArg);
+ const sliceDate = (dateString) => {
+ return `0${dateString}`.slice(-2);
+ };
+ const dateTimeString = `${dateArray[3]}-${sliceDate(dateArray[2])}-${sliceDate(dateArray[1])}T${timeArg}`;
+ const date = import_dayjs.default(dateTimeString);
+ const unixMilli = date.toDate().getTime();
+ return new _ExtendedDate(unixMilli);
+ }
+ constructor(unixMilli = Date.now()) {
+ super(unixMilli);
+ }
+ //
+ exportToEuropeanDate() {
+ const units2 = this.exportToUnits();
+ return `${units2.dayString}.${units2.monthString}.${units2.yearString}`;
+ }
+ exportToHyphedSortableDate() {
+ const units2 = this.exportToUnits();
+ return `${units2.yearString}-${units2.monthString}-${units2.dayString}`;
+ }
+ /**
+ * exports units
+ */
+ exportToUnits() {
+ const monthsArray = [
+ "January",
+ "February",
+ "March",
+ "April",
+ "May",
+ "June",
+ "July",
+ "August",
+ "September",
+ "October",
+ "November",
+ "December"
+ ];
+ const daysArray = [
+ "Monday",
+ "Tuesday",
+ "Wednesday",
+ "Thursday",
+ "Friday",
+ "Saturday",
+ "Sunday"
+ ];
+ return {
+ year: this.getFullYear(),
+ yearString: `${this.getFullYear()}`,
+ month: this.getMonth() + 1,
+ monthString: ("0" + (this.getMonth() + 1)).slice(-2),
+ monthName: monthsArray[this.getMonth()],
+ day: this.getDate(),
+ dayString: ("0" + this.getDate()).slice(-2),
+ dayOfTheWeek: this.getDay(),
+ dayOfTheWeekName: daysArray[this.getDay()]
+ };
+ }
+ format(formatArg) {
+ return import_dayjs.default(this.getTime()).format(formatArg);
+ }
+ /**
+ * boolean checks
+ */
+ isToday() {
+ return import_dayjs.default(this.getTime()).isToday();
+ }
+ lessTimePassedToNow(unitArgs) {
+ const maxPassedUnixTime = getMilliSecondsFromUnits(unitArgs);
+ const actualPassedUnixTime = Date.now() - this.getTime();
+ return actualPassedUnixTime < maxPassedUnixTime;
+ }
+ moreTimePassedToNow(unitArgs) {
+ return !this.lessTimePassedToNow(unitArgs);
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/smarttime.classes.hrtmeasurement.js
+var HrtMeasurement;
+var init_smarttime_classes_hrtmeasurement = __esm({
+ "node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/smarttime.classes.hrtmeasurement.js"() {
+ HrtMeasurement = class {
+ constructor() {
+ this.nanoSeconds = null;
+ this.milliSeconds = null;
+ this._milliStart = null;
+ this._milliDiff = null;
+ this._started = false;
+ }
+ /**
+ * start the measurement
+ */
+ start() {
+ this._started = true;
+ this._milliStart = Date.now();
+ }
+ /**
+ * stop the measurement
+ */
+ stop() {
+ if (this._started === false) {
+ console.log("Hasn't started yet");
+ return;
+ }
+ this._milliDiff = Date.now() - this._milliStart;
+ this.nanoSeconds = this._milliDiff * 1e3;
+ this.milliSeconds = this._milliDiff;
+ return this;
+ }
+ /**
+ * reset the measurement
+ */
+ reset() {
+ this.nanoSeconds = null;
+ this.milliSeconds = null;
+ this._milliStart = null;
+ this._milliDiff = null;
+ this._started = false;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/smarttime.classes.interval.js
+var Interval;
+var init_smarttime_classes_interval = __esm({
+ "node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/smarttime.classes.interval.js"() {
+ init_smarttime_plugins();
+ Interval = class {
+ constructor(intervalMillisencondsArg) {
+ this.status = "initial";
+ this.statusAuthorization = null;
+ this.intervalJobs = [];
+ this.intervalMilliseconds = intervalMillisencondsArg;
+ }
+ start() {
+ this.status = "started";
+ const statusAuth = /* @__PURE__ */ new Date();
+ this.statusAuthorization = statusAuth;
+ const runInterval = async () => {
+ while (this.status === "started" && this.statusAuthorization === statusAuth) {
+ await dist_ts_exports3.delayFor(this.intervalMilliseconds);
+ this.executeIntervalJobs();
+ }
+ };
+ runInterval();
+ }
+ stop() {
+ this.status = "stopped";
+ this.statusAuthorization = null;
+ }
+ addIntervalJob(funcArg) {
+ this.intervalJobs.push(funcArg);
+ }
+ executeIntervalJobs() {
+ for (const funcArg of this.intervalJobs) {
+ funcArg();
+ }
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/smarttime.classes.timestamp.js
+var TimeStamp;
+var init_smarttime_classes_timestamp = __esm({
+ "node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/smarttime.classes.timestamp.js"() {
+ init_smarttime_plugins();
+ TimeStamp = class _TimeStamp {
+ /**
+ * returns new TimeStamp from milliseconds
+ */
+ static fromMilliSeconds(milliSecondsArg) {
+ return new _TimeStamp(milliSecondsArg);
+ }
+ /**
+ * returns new TimeStamp for now with change set
+ * @param timeStampArg
+ */
+ static fromTimeStamp(timeStampArg) {
+ const localTimeStamp = new _TimeStamp();
+ localTimeStamp.change = localTimeStamp.milliSeconds - timeStampArg.milliSeconds;
+ return localTimeStamp;
+ }
+ constructor(creatorArg) {
+ this.change = null;
+ if (!creatorArg) {
+ this.date = /* @__PURE__ */ new Date();
+ } else if (typeof creatorArg === "number") {
+ this.date = new Date(creatorArg);
+ }
+ this.milliSeconds = this.date.getTime();
+ this.epochtime = Math.floor(this.milliSeconds / 1e3);
+ }
+ /**
+ * returns a boolean for wether the timestamp is older than another timestamp
+ * @param TimeStampArg
+ * @param tresholdTimeArg
+ */
+ isOlderThanOtherTimeStamp(TimeStampArg, tresholdTimeArg = 0) {
+ if (this.milliSeconds < TimeStampArg.milliSeconds - tresholdTimeArg) {
+ return true;
+ } else {
+ return false;
+ }
+ }
+ /**
+ * Is the current instance older than the argument
+ * @param TimeStampArg
+ */
+ isOlderThan(TimeStampArg, tresholdTimeArg = 0) {
+ if (this.milliSeconds + tresholdTimeArg < TimeStampArg.milliSeconds) {
+ return true;
+ } else {
+ return false;
+ }
+ }
+ /**
+ * returns a boolean for wether the timestamp is younger than another timestamp
+ * @param TimeStampArg
+ * @param tresholdTimeArg
+ */
+ isYoungerThanOtherTimeStamp(TimeStampArg, tresholdTimeArg = 0) {
+ if (this.milliSeconds > TimeStampArg.milliSeconds + tresholdTimeArg) {
+ return true;
+ } else {
+ return false;
+ }
+ }
+ isYoungerThanMilliSeconds(millisecondArg) {
+ const nowTimeStamp = new _TimeStamp();
+ const compareEpochTime = nowTimeStamp.epochtime - millisecondArg;
+ const compareTimeStamp = new _TimeStamp(compareEpochTime);
+ return this.isYoungerThanOtherTimeStamp(compareTimeStamp);
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/smarttime.classes.timer.js
+var Timer;
+var init_smarttime_classes_timer = __esm({
+ "node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/smarttime.classes.timer.js"() {
+ init_smarttime_plugins();
+ init_smarttime_classes_timestamp();
+ Timer = class {
+ get timeLeft() {
+ return this.timeInMilliseconds - this.pausedAt.change;
+ }
+ constructor(timeInMillisecondsArg) {
+ this.state = "initiated";
+ this.completedDeferred = dist_ts_exports.defer();
+ this.timeInMilliseconds = timeInMillisecondsArg;
+ this.completed = this.completedDeferred.promise;
+ }
+ /**
+ * starts the timer
+ */
+ start() {
+ if (!this.startedAt) {
+ this.currentTimeout = setTimeout(() => {
+ this.completedDeferred.resolve();
+ }, this.timeInMilliseconds);
+ this.startedAt = new TimeStamp();
+ } else {
+ throw new Error("timer has been started before. Please use resume instead");
+ }
+ }
+ pause() {
+ if (this.startedAt) {
+ clearTimeout(this.currentTimeout);
+ this.currentTimeout = null;
+ this.pausedAt = TimeStamp.fromTimeStamp(this.startedAt);
+ }
+ }
+ resume() {
+ if (this.startedAt) {
+ this.currentTimeout = setTimeout(() => {
+ this.completedDeferred.resolve();
+ }, this.timeLeft);
+ } else {
+ throw new Error("timer has NOT been started before. Please use .start() instead");
+ }
+ }
+ reset() {
+ this.pause();
+ this.startedAt = null;
+ this.pausedAt = null;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/index.js
+var dist_ts_exports7 = {};
+__export(dist_ts_exports7, {
+ CronJob: () => CronJob,
+ CronManager: () => CronManager,
+ ExtendedDate: () => ExtendedDate,
+ HrtMeasurement: () => HrtMeasurement,
+ Interval: () => Interval,
+ TimeStamp: () => TimeStamp,
+ Timer: () => Timer,
+ getMilliSecondsAsHumanReadableAgoTime: () => getMilliSecondsAsHumanReadableAgoTime,
+ getMilliSecondsAsHumanReadableString: () => getMilliSecondsAsHumanReadableString,
+ getMilliSecondsFromUnits: () => getMilliSecondsFromUnits,
+ units: () => units
+});
+var init_dist_ts6 = __esm({
+ "node_modules/.pnpm/@push.rocks+smarttime@4.2.3/node_modules/@push.rocks/smarttime/dist_ts/index.js"() {
+ init_smarttime_classes_cronmanager();
+ init_smarttime_classes_cronjob();
+ init_smarttime_classes_extendeddate();
+ init_smarttime_classes_hrtmeasurement();
+ init_smarttime_classes_interval();
+ init_smarttime_classes_timer();
+ init_smarttime_classes_timestamp();
+ init_smarttime_units();
+ }
+});
+
+// node_modules/.pnpm/symbol-tree@3.2.4/node_modules/symbol-tree/lib/SymbolTreeNode.js
+var require_SymbolTreeNode = __commonJS({
+ "node_modules/.pnpm/symbol-tree@3.2.4/node_modules/symbol-tree/lib/SymbolTreeNode.js"(exports, module) {
+ "use strict";
+ module.exports = class SymbolTreeNode {
+ constructor() {
+ this.parent = null;
+ this.previousSibling = null;
+ this.nextSibling = null;
+ this.firstChild = null;
+ this.lastChild = null;
+ this.childrenVersion = 0;
+ this.childIndexCachedUpTo = null;
+ this.cachedIndex = -1;
+ this.cachedIndexVersion = NaN;
+ }
+ get isAttached() {
+ return Boolean(this.parent || this.previousSibling || this.nextSibling);
+ }
+ get hasChildren() {
+ return Boolean(this.firstChild);
+ }
+ childrenChanged() {
+ this.childrenVersion = this.childrenVersion + 1 & 4294967295;
+ this.childIndexCachedUpTo = null;
+ }
+ getCachedIndex(parentNode) {
+ if (this.cachedIndexVersion !== parentNode.childrenVersion) {
+ this.cachedIndexVersion = NaN;
+ return -1;
+ }
+ return this.cachedIndex;
+ }
+ setCachedIndex(parentNode, index2) {
+ this.cachedIndexVersion = parentNode.childrenVersion;
+ this.cachedIndex = index2;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/symbol-tree@3.2.4/node_modules/symbol-tree/lib/TreePosition.js
+var require_TreePosition = __commonJS({
+ "node_modules/.pnpm/symbol-tree@3.2.4/node_modules/symbol-tree/lib/TreePosition.js"(exports, module) {
+ "use strict";
+ module.exports = Object.freeze({
+ // same as DOM DOCUMENT_POSITION_
+ DISCONNECTED: 1,
+ PRECEDING: 2,
+ FOLLOWING: 4,
+ CONTAINS: 8,
+ CONTAINED_BY: 16
+ });
+ }
+});
+
+// node_modules/.pnpm/symbol-tree@3.2.4/node_modules/symbol-tree/lib/TreeIterator.js
+var require_TreeIterator = __commonJS({
+ "node_modules/.pnpm/symbol-tree@3.2.4/node_modules/symbol-tree/lib/TreeIterator.js"(exports, module) {
+ "use strict";
+ var TREE = /* @__PURE__ */ Symbol();
+ var ROOT = /* @__PURE__ */ Symbol();
+ var NEXT = /* @__PURE__ */ Symbol();
+ var ITERATE_FUNC = /* @__PURE__ */ Symbol();
+ var TreeIterator = class {
+ constructor(tree, root6, firstResult, iterateFunction) {
+ this[TREE] = tree;
+ this[ROOT] = root6;
+ this[NEXT] = firstResult;
+ this[ITERATE_FUNC] = iterateFunction;
+ }
+ next() {
+ const tree = this[TREE];
+ const iterateFunc = this[ITERATE_FUNC];
+ const root6 = this[ROOT];
+ if (!this[NEXT]) {
+ return {
+ done: true,
+ value: root6
+ };
+ }
+ const value2 = this[NEXT];
+ if (iterateFunc === 1) {
+ this[NEXT] = tree._node(value2).previousSibling;
+ } else if (iterateFunc === 2) {
+ this[NEXT] = tree._node(value2).nextSibling;
+ } else if (iterateFunc === 3) {
+ this[NEXT] = tree._node(value2).parent;
+ } else if (iterateFunc === 4) {
+ this[NEXT] = tree.preceding(value2, { root: root6 });
+ } else {
+ this[NEXT] = tree.following(value2, { root: root6 });
+ }
+ return {
+ done: false,
+ value: value2
+ };
+ }
+ };
+ Object.defineProperty(TreeIterator.prototype, Symbol.iterator, {
+ value: function() {
+ return this;
+ },
+ writable: false
+ });
+ TreeIterator.PREV = 1;
+ TreeIterator.NEXT = 2;
+ TreeIterator.PARENT = 3;
+ TreeIterator.PRECEDING = 4;
+ TreeIterator.FOLLOWING = 5;
+ Object.freeze(TreeIterator);
+ Object.freeze(TreeIterator.prototype);
+ module.exports = TreeIterator;
+ }
+});
+
+// node_modules/.pnpm/symbol-tree@3.2.4/node_modules/symbol-tree/lib/SymbolTree.js
+var require_SymbolTree = __commonJS({
+ "node_modules/.pnpm/symbol-tree@3.2.4/node_modules/symbol-tree/lib/SymbolTree.js"(exports, module) {
+ "use strict";
+ var SymbolTreeNode = require_SymbolTreeNode();
+ var TreePosition = require_TreePosition();
+ var TreeIterator = require_TreeIterator();
+ function returnTrue() {
+ return true;
+ }
+ function reverseArrayIndex(array, reverseIndex) {
+ return array[array.length - 1 - reverseIndex];
+ }
+ var SymbolTree = class {
+ /**
+ * @constructor
+ * @alias module:symbol-tree
+ * @param {string} [description='SymbolTree data'] Description used for the Symbol
+ */
+ constructor(description) {
+ this.symbol = Symbol(description || "SymbolTree data");
+ }
+ /**
+ * You can use this function to (optionally) initialize an object right after its creation,
+ * to take advantage of V8's fast properties. Also useful if you would like to
+ * freeze your object.
+ *
+ * `O(1)`
+ *
+ * @method
+ * @alias module:symbol-tree#initialize
+ * @param {Object} object
+ * @return {Object} object
+ */
+ initialize(object) {
+ this._node(object);
+ return object;
+ }
+ _node(object) {
+ if (!object) {
+ return null;
+ }
+ const node2 = object[this.symbol];
+ if (node2) {
+ return node2;
+ }
+ return object[this.symbol] = new SymbolTreeNode();
+ }
+ /**
+ * Returns `true` if the object has any children. Otherwise it returns `false`.
+ *
+ * * `O(1)`
+ *
+ * @method hasChildren
+ * @memberOf module:symbol-tree#
+ * @param {Object} object
+ * @return {Boolean}
+ */
+ hasChildren(object) {
+ return this._node(object).hasChildren;
+ }
+ /**
+ * Returns the first child of the given object.
+ *
+ * * `O(1)`
+ *
+ * @method firstChild
+ * @memberOf module:symbol-tree#
+ * @param {Object} object
+ * @return {Object}
+ */
+ firstChild(object) {
+ return this._node(object).firstChild;
+ }
+ /**
+ * Returns the last child of the given object.
+ *
+ * * `O(1)`
+ *
+ * @method lastChild
+ * @memberOf module:symbol-tree#
+ * @param {Object} object
+ * @return {Object}
+ */
+ lastChild(object) {
+ return this._node(object).lastChild;
+ }
+ /**
+ * Returns the previous sibling of the given object.
+ *
+ * * `O(1)`
+ *
+ * @method previousSibling
+ * @memberOf module:symbol-tree#
+ * @param {Object} object
+ * @return {Object}
+ */
+ previousSibling(object) {
+ return this._node(object).previousSibling;
+ }
+ /**
+ * Returns the next sibling of the given object.
+ *
+ * * `O(1)`
+ *
+ * @method nextSibling
+ * @memberOf module:symbol-tree#
+ * @param {Object} object
+ * @return {Object}
+ */
+ nextSibling(object) {
+ return this._node(object).nextSibling;
+ }
+ /**
+ * Return the parent of the given object.
+ *
+ * * `O(1)`
+ *
+ * @method parent
+ * @memberOf module:symbol-tree#
+ * @param {Object} object
+ * @return {Object}
+ */
+ parent(object) {
+ return this._node(object).parent;
+ }
+ /**
+ * Find the inclusive descendant that is last in tree order of the given object.
+ *
+ * * `O(n)` (worst case) where `n` is the depth of the subtree of `object`
+ *
+ * @method lastInclusiveDescendant
+ * @memberOf module:symbol-tree#
+ * @param {Object} object
+ * @return {Object}
+ */
+ lastInclusiveDescendant(object) {
+ let lastChild;
+ let current = object;
+ while (lastChild = this._node(current).lastChild) {
+ current = lastChild;
+ }
+ return current;
+ }
+ /**
+ * Find the preceding object (A) of the given object (B).
+ * An object A is preceding an object B if A and B are in the same tree
+ * and A comes before B in tree order.
+ *
+ * * `O(n)` (worst case)
+ * * `O(1)` (amortized when walking the entire tree)
+ *
+ * @method preceding
+ * @memberOf module:symbol-tree#
+ * @param {Object} object
+ * @param {Object} [options]
+ * @param {Object} [options.root] If set, `root` must be an inclusive ancestor
+ * of the return value (or else null is returned). This check _assumes_
+ * that `root` is also an inclusive ancestor of the given `object`
+ * @return {?Object}
+ */
+ preceding(object, options) {
+ const treeRoot = options && options.root;
+ if (object === treeRoot) {
+ return null;
+ }
+ const previousSibling = this._node(object).previousSibling;
+ if (previousSibling) {
+ return this.lastInclusiveDescendant(previousSibling);
+ }
+ return this._node(object).parent;
+ }
+ /**
+ * Find the following object (A) of the given object (B).
+ * An object A is following an object B if A and B are in the same tree
+ * and A comes after B in tree order.
+ *
+ * * `O(n)` (worst case) where `n` is the amount of objects in the entire tree
+ * * `O(1)` (amortized when walking the entire tree)
+ *
+ * @method following
+ * @memberOf module:symbol-tree#
+ * @param {!Object} object
+ * @param {Object} [options]
+ * @param {Object} [options.root] If set, `root` must be an inclusive ancestor
+ * of the return value (or else null is returned). This check _assumes_
+ * that `root` is also an inclusive ancestor of the given `object`
+ * @param {Boolean} [options.skipChildren=false] If set, ignore the children of `object`
+ * @return {?Object}
+ */
+ following(object, options) {
+ const treeRoot = options && options.root;
+ const skipChildren = options && options.skipChildren;
+ const firstChild = !skipChildren && this._node(object).firstChild;
+ if (firstChild) {
+ return firstChild;
+ }
+ let current = object;
+ do {
+ if (current === treeRoot) {
+ return null;
+ }
+ const nextSibling = this._node(current).nextSibling;
+ if (nextSibling) {
+ return nextSibling;
+ }
+ current = this._node(current).parent;
+ } while (current);
+ return null;
+ }
+ /**
+ * Append all children of the given object to an array.
+ *
+ * * `O(n)` where `n` is the amount of children of the given `parent`
+ *
+ * @method childrenToArray
+ * @memberOf module:symbol-tree#
+ * @param {Object} parent
+ * @param {Object} [options]
+ * @param {Object[]} [options.array=[]]
+ * @param {Function} [options.filter] Function to test each object before it is added to the array.
+ * Invoked with arguments (object). Should return `true` if an object
+ * is to be included.
+ * @param {*} [options.thisArg] Value to use as `this` when executing `filter`.
+ * @return {Object[]}
+ */
+ childrenToArray(parent, options) {
+ const array = options && options.array || [];
+ const filter2 = options && options.filter || returnTrue;
+ const thisArg = options && options.thisArg || void 0;
+ const parentNode = this._node(parent);
+ let object = parentNode.firstChild;
+ let index2 = 0;
+ while (object) {
+ const node2 = this._node(object);
+ node2.setCachedIndex(parentNode, index2);
+ if (filter2.call(thisArg, object)) {
+ array.push(object);
+ }
+ object = node2.nextSibling;
+ ++index2;
+ }
+ return array;
+ }
+ /**
+ * Append all inclusive ancestors of the given object to an array.
+ *
+ * * `O(n)` where `n` is the amount of ancestors of the given `object`
+ *
+ * @method ancestorsToArray
+ * @memberOf module:symbol-tree#
+ * @param {Object} object
+ * @param {Object} [options]
+ * @param {Object[]} [options.array=[]]
+ * @param {Function} [options.filter] Function to test each object before it is added to the array.
+ * Invoked with arguments (object). Should return `true` if an object
+ * is to be included.
+ * @param {*} [options.thisArg] Value to use as `this` when executing `filter`.
+ * @return {Object[]}
+ */
+ ancestorsToArray(object, options) {
+ const array = options && options.array || [];
+ const filter2 = options && options.filter || returnTrue;
+ const thisArg = options && options.thisArg || void 0;
+ let ancestor = object;
+ while (ancestor) {
+ if (filter2.call(thisArg, ancestor)) {
+ array.push(ancestor);
+ }
+ ancestor = this._node(ancestor).parent;
+ }
+ return array;
+ }
+ /**
+ * Append all descendants of the given object to an array (in tree order).
+ *
+ * * `O(n)` where `n` is the amount of objects in the sub-tree of the given `object`
+ *
+ * @method treeToArray
+ * @memberOf module:symbol-tree#
+ * @param {Object} root
+ * @param {Object} [options]
+ * @param {Object[]} [options.array=[]]
+ * @param {Function} [options.filter] Function to test each object before it is added to the array.
+ * Invoked with arguments (object). Should return `true` if an object
+ * is to be included.
+ * @param {*} [options.thisArg] Value to use as `this` when executing `filter`.
+ * @return {Object[]}
+ */
+ treeToArray(root6, options) {
+ const array = options && options.array || [];
+ const filter2 = options && options.filter || returnTrue;
+ const thisArg = options && options.thisArg || void 0;
+ let object = root6;
+ while (object) {
+ if (filter2.call(thisArg, object)) {
+ array.push(object);
+ }
+ object = this.following(object, { root: root6 });
+ }
+ return array;
+ }
+ /**
+ * Iterate over all children of the given object
+ *
+ * * `O(1)` for a single iteration
+ *
+ * @method childrenIterator
+ * @memberOf module:symbol-tree#
+ * @param {Object} parent
+ * @param {Object} [options]
+ * @param {Boolean} [options.reverse=false]
+ * @return {Object} An iterable iterator (ES6)
+ */
+ childrenIterator(parent, options) {
+ const reverse = options && options.reverse;
+ const parentNode = this._node(parent);
+ return new TreeIterator(
+ this,
+ parent,
+ reverse ? parentNode.lastChild : parentNode.firstChild,
+ reverse ? TreeIterator.PREV : TreeIterator.NEXT
+ );
+ }
+ /**
+ * Iterate over all the previous siblings of the given object. (in reverse tree order)
+ *
+ * * `O(1)` for a single iteration
+ *
+ * @method previousSiblingsIterator
+ * @memberOf module:symbol-tree#
+ * @param {Object} object
+ * @return {Object} An iterable iterator (ES6)
+ */
+ previousSiblingsIterator(object) {
+ return new TreeIterator(
+ this,
+ object,
+ this._node(object).previousSibling,
+ TreeIterator.PREV
+ );
+ }
+ /**
+ * Iterate over all the next siblings of the given object. (in tree order)
+ *
+ * * `O(1)` for a single iteration
+ *
+ * @method nextSiblingsIterator
+ * @memberOf module:symbol-tree#
+ * @param {Object} object
+ * @return {Object} An iterable iterator (ES6)
+ */
+ nextSiblingsIterator(object) {
+ return new TreeIterator(
+ this,
+ object,
+ this._node(object).nextSibling,
+ TreeIterator.NEXT
+ );
+ }
+ /**
+ * Iterate over all inclusive ancestors of the given object
+ *
+ * * `O(1)` for a single iteration
+ *
+ * @method ancestorsIterator
+ * @memberOf module:symbol-tree#
+ * @param {Object} object
+ * @return {Object} An iterable iterator (ES6)
+ */
+ ancestorsIterator(object) {
+ return new TreeIterator(
+ this,
+ object,
+ object,
+ TreeIterator.PARENT
+ );
+ }
+ /**
+ * Iterate over all descendants of the given object (in tree order).
+ *
+ * Where `n` is the amount of objects in the sub-tree of the given `root`:
+ *
+ * * `O(n)` (worst case for a single iteration)
+ * * `O(n)` (amortized, when completing the iterator)
+ *
+ * @method treeIterator
+ * @memberOf module:symbol-tree#
+ * @param {Object} root
+ * @param {Object} options
+ * @param {Boolean} [options.reverse=false]
+ * @return {Object} An iterable iterator (ES6)
+ */
+ treeIterator(root6, options) {
+ const reverse = options && options.reverse;
+ return new TreeIterator(
+ this,
+ root6,
+ reverse ? this.lastInclusiveDescendant(root6) : root6,
+ reverse ? TreeIterator.PRECEDING : TreeIterator.FOLLOWING
+ );
+ }
+ /**
+ * Find the index of the given object (the number of preceding siblings).
+ *
+ * * `O(n)` where `n` is the amount of preceding siblings
+ * * `O(1)` (amortized, if the tree is not modified)
+ *
+ * @method index
+ * @memberOf module:symbol-tree#
+ * @param {Object} child
+ * @return {Number} The number of preceding siblings, or -1 if the object has no parent
+ */
+ index(child) {
+ const childNode = this._node(child);
+ const parentNode = this._node(childNode.parent);
+ if (!parentNode) {
+ return -1;
+ }
+ let currentIndex = childNode.getCachedIndex(parentNode);
+ if (currentIndex >= 0) {
+ return currentIndex;
+ }
+ currentIndex = 0;
+ let object = parentNode.firstChild;
+ if (parentNode.childIndexCachedUpTo) {
+ const cachedUpToNode = this._node(parentNode.childIndexCachedUpTo);
+ object = cachedUpToNode.nextSibling;
+ currentIndex = cachedUpToNode.getCachedIndex(parentNode) + 1;
+ }
+ while (object) {
+ const node2 = this._node(object);
+ node2.setCachedIndex(parentNode, currentIndex);
+ if (object === child) {
+ break;
+ }
+ ++currentIndex;
+ object = node2.nextSibling;
+ }
+ parentNode.childIndexCachedUpTo = child;
+ return currentIndex;
+ }
+ /**
+ * Calculate the number of children.
+ *
+ * * `O(n)` where `n` is the amount of children
+ * * `O(1)` (amortized, if the tree is not modified)
+ *
+ * @method childrenCount
+ * @memberOf module:symbol-tree#
+ * @param {Object} parent
+ * @return {Number}
+ */
+ childrenCount(parent) {
+ const parentNode = this._node(parent);
+ if (!parentNode.lastChild) {
+ return 0;
+ }
+ return this.index(parentNode.lastChild) + 1;
+ }
+ /**
+ * Compare the position of an object relative to another object. A bit set is returned:
+ *
+ *
+ * - DISCONNECTED : 1
+ * - PRECEDING : 2
+ * - FOLLOWING : 4
+ * - CONTAINS : 8
+ * - CONTAINED_BY : 16
+ *
+ *
+ * The semantics are the same as compareDocumentPosition in DOM, with the exception that
+ * DISCONNECTED never occurs with any other bit.
+ *
+ * where `n` and `m` are the amount of ancestors of `left` and `right`;
+ * where `o` is the amount of children of the lowest common ancestor of `left` and `right`:
+ *
+ * * `O(n + m + o)` (worst case)
+ * * `O(n + m)` (amortized, if the tree is not modified)
+ *
+ * @method compareTreePosition
+ * @memberOf module:symbol-tree#
+ * @param {Object} left
+ * @param {Object} right
+ * @return {Number}
+ */
+ compareTreePosition(left, right) {
+ if (left === right) {
+ return 0;
+ }
+ const leftAncestors = [];
+ {
+ let leftAncestor = left;
+ while (leftAncestor) {
+ if (leftAncestor === right) {
+ return TreePosition.CONTAINS | TreePosition.PRECEDING;
+ }
+ leftAncestors.push(leftAncestor);
+ leftAncestor = this.parent(leftAncestor);
+ }
+ }
+ const rightAncestors = [];
+ {
+ let rightAncestor = right;
+ while (rightAncestor) {
+ if (rightAncestor === left) {
+ return TreePosition.CONTAINED_BY | TreePosition.FOLLOWING;
+ }
+ rightAncestors.push(rightAncestor);
+ rightAncestor = this.parent(rightAncestor);
+ }
+ }
+ const root6 = reverseArrayIndex(leftAncestors, 0);
+ if (!root6 || root6 !== reverseArrayIndex(rightAncestors, 0)) {
+ return TreePosition.DISCONNECTED;
+ }
+ let commonAncestorIndex = 0;
+ const ancestorsMinLength = Math.min(leftAncestors.length, rightAncestors.length);
+ for (let i11 = 0; i11 < ancestorsMinLength; ++i11) {
+ const leftAncestor = reverseArrayIndex(leftAncestors, i11);
+ const rightAncestor = reverseArrayIndex(rightAncestors, i11);
+ if (leftAncestor !== rightAncestor) {
+ break;
+ }
+ commonAncestorIndex = i11;
+ }
+ const leftIndex = this.index(reverseArrayIndex(leftAncestors, commonAncestorIndex + 1));
+ const rightIndex = this.index(reverseArrayIndex(rightAncestors, commonAncestorIndex + 1));
+ return rightIndex < leftIndex ? TreePosition.PRECEDING : TreePosition.FOLLOWING;
+ }
+ /**
+ * Remove the object from this tree.
+ * Has no effect if already removed.
+ *
+ * * `O(1)`
+ *
+ * @method remove
+ * @memberOf module:symbol-tree#
+ * @param {Object} removeObject
+ * @return {Object} removeObject
+ */
+ remove(removeObject) {
+ const removeNode = this._node(removeObject);
+ const parentNode = this._node(removeNode.parent);
+ const prevNode = this._node(removeNode.previousSibling);
+ const nextNode = this._node(removeNode.nextSibling);
+ if (parentNode) {
+ if (parentNode.firstChild === removeObject) {
+ parentNode.firstChild = removeNode.nextSibling;
+ }
+ if (parentNode.lastChild === removeObject) {
+ parentNode.lastChild = removeNode.previousSibling;
+ }
+ }
+ if (prevNode) {
+ prevNode.nextSibling = removeNode.nextSibling;
+ }
+ if (nextNode) {
+ nextNode.previousSibling = removeNode.previousSibling;
+ }
+ removeNode.parent = null;
+ removeNode.previousSibling = null;
+ removeNode.nextSibling = null;
+ removeNode.cachedIndex = -1;
+ removeNode.cachedIndexVersion = NaN;
+ if (parentNode) {
+ parentNode.childrenChanged();
+ }
+ return removeObject;
+ }
+ /**
+ * Insert the given object before the reference object.
+ * `newObject` is now the previous sibling of `referenceObject`.
+ *
+ * * `O(1)`
+ *
+ * @method insertBefore
+ * @memberOf module:symbol-tree#
+ * @param {Object} referenceObject
+ * @param {Object} newObject
+ * @throws {Error} If the newObject is already present in this SymbolTree
+ * @return {Object} newObject
+ */
+ insertBefore(referenceObject, newObject) {
+ const referenceNode = this._node(referenceObject);
+ const prevNode = this._node(referenceNode.previousSibling);
+ const newNode = this._node(newObject);
+ const parentNode = this._node(referenceNode.parent);
+ if (newNode.isAttached) {
+ throw Error("Given object is already present in this SymbolTree, remove it first");
+ }
+ newNode.parent = referenceNode.parent;
+ newNode.previousSibling = referenceNode.previousSibling;
+ newNode.nextSibling = referenceObject;
+ referenceNode.previousSibling = newObject;
+ if (prevNode) {
+ prevNode.nextSibling = newObject;
+ }
+ if (parentNode && parentNode.firstChild === referenceObject) {
+ parentNode.firstChild = newObject;
+ }
+ if (parentNode) {
+ parentNode.childrenChanged();
+ }
+ return newObject;
+ }
+ /**
+ * Insert the given object after the reference object.
+ * `newObject` is now the next sibling of `referenceObject`.
+ *
+ * * `O(1)`
+ *
+ * @method insertAfter
+ * @memberOf module:symbol-tree#
+ * @param {Object} referenceObject
+ * @param {Object} newObject
+ * @throws {Error} If the newObject is already present in this SymbolTree
+ * @return {Object} newObject
+ */
+ insertAfter(referenceObject, newObject) {
+ const referenceNode = this._node(referenceObject);
+ const nextNode = this._node(referenceNode.nextSibling);
+ const newNode = this._node(newObject);
+ const parentNode = this._node(referenceNode.parent);
+ if (newNode.isAttached) {
+ throw Error("Given object is already present in this SymbolTree, remove it first");
+ }
+ newNode.parent = referenceNode.parent;
+ newNode.previousSibling = referenceObject;
+ newNode.nextSibling = referenceNode.nextSibling;
+ referenceNode.nextSibling = newObject;
+ if (nextNode) {
+ nextNode.previousSibling = newObject;
+ }
+ if (parentNode && parentNode.lastChild === referenceObject) {
+ parentNode.lastChild = newObject;
+ }
+ if (parentNode) {
+ parentNode.childrenChanged();
+ }
+ return newObject;
+ }
+ /**
+ * Insert the given object as the first child of the given reference object.
+ * `newObject` is now the first child of `referenceObject`.
+ *
+ * * `O(1)`
+ *
+ * @method prependChild
+ * @memberOf module:symbol-tree#
+ * @param {Object} referenceObject
+ * @param {Object} newObject
+ * @throws {Error} If the newObject is already present in this SymbolTree
+ * @return {Object} newObject
+ */
+ prependChild(referenceObject, newObject) {
+ const referenceNode = this._node(referenceObject);
+ const newNode = this._node(newObject);
+ if (newNode.isAttached) {
+ throw Error("Given object is already present in this SymbolTree, remove it first");
+ }
+ if (referenceNode.hasChildren) {
+ this.insertBefore(referenceNode.firstChild, newObject);
+ } else {
+ newNode.parent = referenceObject;
+ referenceNode.firstChild = newObject;
+ referenceNode.lastChild = newObject;
+ referenceNode.childrenChanged();
+ }
+ return newObject;
+ }
+ /**
+ * Insert the given object as the last child of the given reference object.
+ * `newObject` is now the last child of `referenceObject`.
+ *
+ * * `O(1)`
+ *
+ * @method appendChild
+ * @memberOf module:symbol-tree#
+ * @param {Object} referenceObject
+ * @param {Object} newObject
+ * @throws {Error} If the newObject is already present in this SymbolTree
+ * @return {Object} newObject
+ */
+ appendChild(referenceObject, newObject) {
+ const referenceNode = this._node(referenceObject);
+ const newNode = this._node(newObject);
+ if (newNode.isAttached) {
+ throw Error("Given object is already present in this SymbolTree, remove it first");
+ }
+ if (referenceNode.hasChildren) {
+ this.insertAfter(referenceNode.lastChild, newObject);
+ } else {
+ newNode.parent = referenceObject;
+ referenceNode.firstChild = newObject;
+ referenceNode.lastChild = newObject;
+ referenceNode.childrenChanged();
+ }
+ return newObject;
+ }
+ };
+ module.exports = SymbolTree;
+ SymbolTree.TreePosition = TreePosition;
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.plugins.js
+var import_symbol_tree;
+var init_classes_plugins = __esm({
+ "node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.plugins.js"() {
+ init_dist_ts3();
+ init_dist_ts5();
+ init_dist_ts();
+ init_dist_ts2();
+ init_dist_ts6();
+ import_symbol_tree = __toESM(require_SymbolTree(), 1);
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.asyncexecutionstack.js
+var AsyncExecutionStack;
+var init_classes_asyncexecutionstack = __esm({
+ "node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.asyncexecutionstack.js"() {
+ init_classes_plugins();
+ AsyncExecutionStack = class {
+ constructor() {
+ this.executionSlots = [];
+ this.isProcessing = false;
+ this.nonExclusiveMaxConcurrency = Infinity;
+ this.nonExclusiveCurrentCount = 0;
+ this.nonExclusivePendingQueue = [];
+ }
+ async getExclusiveExecutionSlot(funcArg, timeoutArg) {
+ const executionDeferred = dist_ts_exports.defer();
+ const executionSlot = {
+ funcToExecute: funcArg,
+ executionDeferred,
+ timeout: timeoutArg,
+ mode: "exclusive"
+ };
+ this.executionSlots.push(executionSlot);
+ this.processExecutionSlots();
+ return executionDeferred.promise;
+ }
+ async getNonExclusiveExecutionSlot(funcArg, timeoutArg) {
+ const executionDeferred = dist_ts_exports.defer();
+ const executionSlot = {
+ funcToExecute: funcArg,
+ executionDeferred,
+ timeout: timeoutArg,
+ mode: "nonexclusive"
+ };
+ this.executionSlots.push(executionSlot);
+ this.processExecutionSlots();
+ return executionDeferred.promise;
+ }
+ /**
+ * Set the maximum number of concurrent non-exclusive tasks.
+ * @param concurrency minimum 1 (Infinity means unlimited)
+ */
+ setNonExclusiveMaxConcurrency(concurrency) {
+ if (!Number.isFinite(concurrency) || concurrency < 1) {
+ throw new Error("nonExclusiveMaxConcurrency must be a finite number >= 1");
+ }
+ this.nonExclusiveMaxConcurrency = concurrency;
+ }
+ /** Get the configured max concurrency for non-exclusive tasks */
+ getNonExclusiveMaxConcurrency() {
+ return this.nonExclusiveMaxConcurrency;
+ }
+ /** Number of non-exclusive tasks currently running */
+ getActiveNonExclusiveCount() {
+ return this.nonExclusiveCurrentCount;
+ }
+ /** Number of non-exclusive tasks waiting for a free slot */
+ getPendingNonExclusiveCount() {
+ return this.nonExclusivePendingQueue.length;
+ }
+ async processExecutionSlots() {
+ if (this.isProcessing) {
+ return;
+ }
+ this.isProcessing = true;
+ while (this.executionSlots.length > 0) {
+ const currentSlot = this.executionSlots[0];
+ if (currentSlot.mode === "exclusive") {
+ await this.executeExclusiveSlot(currentSlot);
+ this.executionSlots.shift();
+ } else {
+ const nonExclusiveSlots = [];
+ while (this.executionSlots.length > 0 && this.executionSlots[0].mode === "nonexclusive") {
+ nonExclusiveSlots.push(this.executionSlots.shift());
+ }
+ await this.executeNonExclusiveSlots(nonExclusiveSlots);
+ }
+ }
+ this.isProcessing = false;
+ }
+ async executeExclusiveSlot(slot) {
+ try {
+ if (slot.timeout) {
+ const result = await Promise.race([
+ slot.funcToExecute(),
+ dist_ts_exports3.delayFor(slot.timeout).then(() => {
+ throw new Error("Timeout reached");
+ })
+ ]);
+ slot.executionDeferred.resolve(result);
+ } else {
+ const result = await slot.funcToExecute();
+ slot.executionDeferred.resolve(result);
+ }
+ } catch (error) {
+ slot.executionDeferred.reject(error);
+ }
+ }
+ async executeNonExclusiveSlots(slots) {
+ const promises = slots.map(async (slot) => {
+ await this.waitForNonExclusiveSlot();
+ try {
+ if (slot.timeout) {
+ const result = await Promise.race([
+ slot.funcToExecute(),
+ dist_ts_exports3.delayFor(slot.timeout).then(() => {
+ throw new Error("Timeout reached");
+ })
+ ]);
+ slot.executionDeferred.resolve(result);
+ } else {
+ const result = await slot.funcToExecute();
+ slot.executionDeferred.resolve(result);
+ }
+ } catch (error) {
+ slot.executionDeferred.reject(error);
+ } finally {
+ this.releaseNonExclusiveSlot();
+ }
+ });
+ await Promise.all(promises);
+ }
+ /**
+ * Wait until a non-exclusive slot is available (respects max concurrency).
+ */
+ waitForNonExclusiveSlot() {
+ if (this.nonExclusiveCurrentCount < this.nonExclusiveMaxConcurrency) {
+ this.nonExclusiveCurrentCount++;
+ return Promise.resolve();
+ }
+ return new Promise((resolve2) => {
+ this.nonExclusivePendingQueue.push(() => {
+ this.nonExclusiveCurrentCount++;
+ resolve2();
+ });
+ });
+ }
+ /** Release a non-exclusive slot and wake the next waiter, if any. */
+ releaseNonExclusiveSlot() {
+ this.nonExclusiveCurrentCount--;
+ const next2 = this.nonExclusivePendingQueue.shift();
+ if (next2) {
+ next2();
+ }
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.backpressuredarray.js
+var BackpressuredArray;
+var init_classes_backpressuredarray = __esm({
+ "node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.backpressuredarray.js"() {
+ init_classes_plugins();
+ BackpressuredArray = class {
+ constructor(highWaterMark = 16) {
+ this.hasSpace = new dist_ts_exports2.rxjs.Subject();
+ this.itemsAvailable = new dist_ts_exports2.rxjs.Subject();
+ this.data = [];
+ this.highWaterMark = highWaterMark;
+ }
+ push(item) {
+ this.data.push(item);
+ this.itemsAvailable.next("itemsAvailable");
+ const spaceAvailable = this.checkSpaceAvailable();
+ if (spaceAvailable) {
+ this.hasSpace.next("hasSpace");
+ }
+ return spaceAvailable;
+ }
+ shift() {
+ const item = this.data.shift();
+ if (this.checkSpaceAvailable()) {
+ this.hasSpace.next("hasSpace");
+ }
+ return item;
+ }
+ checkSpaceAvailable() {
+ return this.data.length < this.highWaterMark;
+ }
+ checkHasItems() {
+ return this.data.length > 0;
+ }
+ waitForSpace() {
+ return new Promise((resolve2) => {
+ if (this.checkSpaceAvailable()) {
+ resolve2();
+ } else {
+ const subscription = this.hasSpace.subscribe(() => {
+ subscription.unsubscribe();
+ resolve2();
+ });
+ }
+ });
+ }
+ waitForItems() {
+ return new Promise((resolve2) => {
+ if (this.data.length > 0) {
+ resolve2();
+ } else {
+ const subscription = this.itemsAvailable.subscribe(() => {
+ subscription.unsubscribe();
+ resolve2();
+ });
+ }
+ });
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.fastmap.js
+var FastMap;
+var init_classes_fastmap = __esm({
+ "node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.fastmap.js"() {
+ init_classes_plugins();
+ FastMap = class _FastMap {
+ constructor() {
+ this.mapObject = {};
+ }
+ isUniqueKey(keyArg) {
+ return this.mapObject[keyArg] ? false : true;
+ }
+ addToMap(keyArg, objectArg, optionsArg) {
+ if (this.isUniqueKey(keyArg) || optionsArg && optionsArg.force) {
+ this.mapObject[keyArg] = objectArg;
+ return true;
+ } else {
+ return false;
+ }
+ }
+ getByKey(keyArg) {
+ return this.mapObject[keyArg];
+ }
+ removeFromMap(keyArg) {
+ const removedItem = this.getByKey(keyArg);
+ delete this.mapObject[keyArg];
+ return removedItem;
+ }
+ getKeys() {
+ const keys2 = [];
+ for (const keyArg in this.mapObject) {
+ if (this.mapObject[keyArg]) {
+ keys2.push(keyArg);
+ }
+ }
+ return keys2;
+ }
+ clean() {
+ this.mapObject = {};
+ }
+ /**
+ * returns a new Fastmap that includes all values from this and all from the fastmap in the argument
+ */
+ concat(fastMapArg) {
+ const concatedFastmap = new _FastMap();
+ for (const key2 of this.getKeys()) {
+ concatedFastmap.addToMap(key2, this.getByKey(key2));
+ }
+ for (const key2 of fastMapArg.getKeys()) {
+ concatedFastmap.addToMap(key2, fastMapArg.getByKey(key2), {
+ force: true
+ });
+ }
+ return concatedFastmap;
+ }
+ /**
+ * tries to merge another Fastmap
+ * Note: uniqueKeyCollisions will cause overwrite
+ * @param fastMapArg
+ */
+ addAllFromOther(fastMapArg) {
+ for (const key2 of fastMapArg.getKeys()) {
+ this.addToMap(key2, fastMapArg.getByKey(key2), {
+ force: true
+ });
+ }
+ }
+ async find(findFunctionArg) {
+ for (const key2 of this.getKeys()) {
+ const item = this.getByKey(key2);
+ const findFunctionResult = await findFunctionArg(item);
+ if (findFunctionResult) {
+ return item;
+ }
+ }
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.objectmap.js
+var uni, ObjectMap;
+var init_classes_objectmap = __esm({
+ "node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.objectmap.js"() {
+ init_classes_plugins();
+ init_classes_fastmap();
+ uni = (prefix4 = "uni") => {
+ return `${prefix4}xxxxxxxxxxx`.replace(/[xy]/g, (c11) => {
+ const r11 = Math.random() * 16 | 0;
+ const v5 = c11 === "x" ? r11 : r11 & 3 | 8;
+ return v5.toString(16);
+ });
+ };
+ ObjectMap = class _ObjectMap {
+ /**
+ * returns a new instance
+ */
+ constructor() {
+ this.fastMap = new FastMap();
+ this.eventSubject = new dist_ts_exports2.rxjs.Subject();
+ }
+ /**
+ * adds an object mapped to a string
+ * the string must be unique
+ */
+ addMappedUnique(uniqueKeyArg, objectArg) {
+ this.fastMap.addToMap(uniqueKeyArg, objectArg);
+ }
+ /**
+ * fastest way to get an object from the map
+ * @param uniqueKey
+ */
+ getMappedUnique(uniqueKeyArg) {
+ return this.fastMap.getByKey(uniqueKeyArg);
+ }
+ /**
+ * remove key
+ * @param functionArg
+ */
+ removeMappedUnique(uniqueKey) {
+ const object = this.getMappedUnique(uniqueKey);
+ }
+ /**
+ * add object to Objectmap
+ * returns false if the object is already in the map
+ * returns true if the object was added successfully
+ */
+ add(objectArg) {
+ for (const keyArg of this.fastMap.getKeys()) {
+ const object = this.fastMap.getByKey(keyArg);
+ if (object === objectArg) {
+ return keyArg;
+ }
+ }
+ const uniqueKey = uni("key");
+ this.addMappedUnique(uniqueKey, objectArg);
+ this.eventSubject.next({
+ operation: "add",
+ payload: objectArg
+ });
+ return uniqueKey;
+ }
+ /**
+ * like .add but adds an whole array of objects
+ */
+ addArray(objectArrayArg) {
+ for (const item of objectArrayArg) {
+ this.add(item);
+ }
+ }
+ /**
+ * check if object is in Objectmap
+ */
+ checkForObject(objectArg) {
+ return !!this.getKeyForObject(objectArg);
+ }
+ /**
+ * get key for object
+ * @param findFunction
+ */
+ getKeyForObject(objectArg) {
+ let foundKey = null;
+ for (const keyArg of this.fastMap.getKeys()) {
+ if (!foundKey && this.fastMap.getByKey(keyArg) === objectArg) {
+ foundKey = keyArg;
+ } else {
+ continue;
+ }
+ }
+ return foundKey;
+ }
+ /**
+ * find object
+ */
+ async find(findFunction) {
+ return this.fastMap.find(findFunction);
+ }
+ findSync(findFunction) {
+ for (const keyArg of this.fastMap.getKeys()) {
+ if (findFunction(this.fastMap.getByKey(keyArg))) {
+ return this.getMappedUnique(keyArg);
+ }
+ }
+ }
+ /**
+ * finds a specific element and then removes it
+ */
+ async findOneAndRemove(findFunction) {
+ const foundElement = await this.find(findFunction);
+ if (foundElement) {
+ this.remove(foundElement);
+ }
+ return foundElement;
+ }
+ findOneAndRemoveSync(findFunction) {
+ const foundElement = this.findSync(findFunction);
+ if (foundElement) {
+ this.remove(foundElement);
+ }
+ return foundElement;
+ }
+ /**
+ * run function for each item in Objectmap
+ */
+ async forEach(functionArg) {
+ for (const keyArg of this.fastMap.getKeys()) {
+ await functionArg(this.fastMap.getByKey(keyArg));
+ }
+ }
+ /**
+ * gets an object in the Observablemap and removes it, so it can't be retrieved again
+ */
+ getOneAndRemove() {
+ const keys2 = this.fastMap.getKeys();
+ if (keys2.length === 0) {
+ return null;
+ } else {
+ const keyToUse = keys2[0];
+ const removedItem = this.fastMap.removeFromMap(keyToUse);
+ this.eventSubject.next({
+ operation: "remove",
+ payload: removedItem
+ });
+ return removedItem;
+ }
+ }
+ /**
+ * returns a cloned array of all the objects currently in the Objectmap
+ */
+ getArray() {
+ const returnArray = [];
+ for (const keyArg of this.fastMap.getKeys()) {
+ returnArray.push(this.fastMap.getByKey(keyArg));
+ }
+ return returnArray;
+ }
+ /**
+ * check if Objectmap ist empty
+ */
+ isEmpty() {
+ return this.fastMap.getKeys().length === 0;
+ }
+ /**
+ * remove object from Objectmap
+ */
+ remove(objectArg) {
+ if (this.checkForObject(objectArg)) {
+ const keyArg = this.getKeyForObject(objectArg);
+ const removedObject = this.fastMap.removeFromMap(keyArg);
+ this.eventSubject.next({
+ operation: "remove",
+ payload: removedObject
+ });
+ return removedObject;
+ }
+ return null;
+ }
+ /**
+ * wipe Objectmap
+ */
+ wipe() {
+ for (const keyArg of this.fastMap.getKeys()) {
+ this.fastMap.removeFromMap(keyArg);
+ }
+ }
+ /**
+ * returns a new Objectmap that includes
+ */
+ concat(objectMapArg) {
+ const concattedObjectMap = new _ObjectMap();
+ concattedObjectMap.fastMap.addAllFromOther(this.fastMap);
+ concattedObjectMap.fastMap.addAllFromOther(objectMapArg.fastMap);
+ return concattedObjectMap;
+ }
+ /**
+ * tries to merge another Objectmap
+ * Note: uniqueKeyCollisions will cause overwrite
+ * @param objectMapArg
+ */
+ addAllFromOther(objectMapArg) {
+ this.fastMap.addAllFromOther(objectMapArg.fastMap);
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.interestmap.interest.js
+var Interest;
+var init_classes_interestmap_interest = __esm({
+ "node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.interestmap.interest.js"() {
+ init_classes_plugins();
+ init_classes_interestmap();
+ Interest = class {
+ /**
+ * quick access to a string that makes the interest comparable for checking for similar interests
+ */
+ get comparisonString() {
+ return this.comparisonFunc(this.originalInterest);
+ }
+ /**
+ * fullfill the interest
+ */
+ fullfillInterest(objectArg) {
+ this.isFullfilled = true;
+ this.fullfillmentStore = [];
+ this.interestDeferred.resolve(objectArg);
+ }
+ /**
+ *
+ */
+ constructor(interestMapArg, interestArg, comparisonFuncArg, optionsArg) {
+ this.destructionTimer = new dist_ts_exports7.Timer(1e4);
+ this.isFullfilled = false;
+ this.fullfillmentStore = [];
+ this.interestDeferred = new dist_ts_exports.Deferred();
+ this.interestFullfilled = this.interestDeferred.promise;
+ this.interestMapRef = interestMapArg;
+ this.originalInterest = interestArg;
+ this.comparisonFunc = comparisonFuncArg;
+ this.options = optionsArg;
+ this.destructionTimer.completed.then(() => {
+ this.destroy();
+ });
+ if (this.options?.markLostAfterDefault) {
+ dist_ts_exports3.delayFor(this.options.markLostAfterDefault).then(this.markLost);
+ }
+ }
+ // ===============================
+ // LIFECYCLE MANAGEMENT
+ // ===============================
+ /**
+ * self destructs the interest
+ */
+ destroy() {
+ this.interestMapRef.removeInterest(this);
+ if (!this.isFullfilled && this.options.defaultFullfillment) {
+ this.fullfillInterest(this.options.defaultFullfillment);
+ }
+ }
+ /**
+ * notifies the interest that the interest in it has been lost
+ */
+ markLost() {
+ this.destructionTimer.start();
+ }
+ /**
+ * notifies the interest that the interest in it has been restored
+ */
+ renew() {
+ this.destructionTimer.reset();
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.interestmap.js
+var InterestMap;
+var init_classes_interestmap = __esm({
+ "node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.interestmap.js"() {
+ init_classes_plugins();
+ init_classes_objectmap();
+ init_classes_interestmap_interest();
+ InterestMap = class {
+ constructor(comparisonFuncArg, optionsArg = {}) {
+ this.interestObjectMap = new ObjectMap();
+ this.interestObservable = new dist_ts_exports2.ObservableIntake();
+ this.comparisonFunc = comparisonFuncArg;
+ this.options = optionsArg;
+ }
+ /**
+ * adds an interest to the InterestMap
+ * @param interestId
+ */
+ async addInterest(interestId, defaultFullfillmentArg) {
+ const comparisonString = this.comparisonFunc(interestId);
+ let returnInterest;
+ const newInterest = new Interest(this, interestId, this.comparisonFunc, {
+ markLostAfterDefault: this.options.markLostAfterDefault,
+ defaultFullfillment: defaultFullfillmentArg
+ });
+ let interestExists = false;
+ await this.interestObjectMap.forEach((interestArg) => {
+ if (!interestExists && interestArg.comparisonString === newInterest.comparisonString) {
+ console.log("info", `interest already exists for ${newInterest.comparisonString}`);
+ interestExists = true;
+ returnInterest = interestArg;
+ returnInterest.renew();
+ }
+ });
+ if (!returnInterest) {
+ returnInterest = newInterest;
+ this.interestObjectMap.add(returnInterest);
+ }
+ this.interestObservable.push(returnInterest);
+ return returnInterest;
+ }
+ /**
+ * removes an interest from the interest map
+ */
+ removeInterest(interestArg) {
+ const interestToRemove = this.interestObjectMap.findOneAndRemoveSync((interestArg2) => {
+ return interestArg.comparisonString === interestArg2.comparisonString;
+ });
+ }
+ /**
+ * check interest
+ */
+ checkInterest(objectArg) {
+ const comparisonString = this.comparisonFunc(objectArg);
+ return this.checkInterestByString(comparisonString);
+ }
+ /**
+ * checks an interest
+ * @param comparisonStringArg
+ */
+ checkInterestByString(comparisonStringArg) {
+ const foundInterest = this.interestObjectMap.findSync((interest) => {
+ return interest.comparisonString === comparisonStringArg;
+ });
+ if (foundInterest) {
+ return true;
+ } else {
+ return false;
+ }
+ }
+ /**
+ * inform lost interest
+ * @param interestId
+ */
+ informLostInterest(interestId) {
+ const wantedInterest = this.findInterest(interestId);
+ if (wantedInterest) {
+ wantedInterest.markLost();
+ }
+ }
+ /**
+ * finds an interest
+ * @param interestId
+ */
+ findInterest(interestId) {
+ const comparableString = this.comparisonFunc(interestId);
+ const interest = this.interestObjectMap.findSync((interestArg) => {
+ return interestArg.comparisonString === comparableString;
+ });
+ return interest;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.limitedarray.js
+var LimitedArray;
+var init_classes_limitedarray = __esm({
+ "node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.limitedarray.js"() {
+ init_classes_plugins();
+ LimitedArray = class {
+ constructor(limitArg) {
+ this.array = [];
+ this.arrayLimit = limitArg;
+ }
+ addOne(objectArg) {
+ this.array.unshift(objectArg);
+ if (this.array.length > this.arrayLimit) {
+ this.array.length = this.arrayLimit;
+ }
+ }
+ addMany(objectArrayArg) {
+ for (let objectArg of objectArrayArg) {
+ this.addOne(objectArg);
+ }
+ }
+ setLimit(limitArg) {
+ this.arrayLimit = limitArg;
+ if (this.array.length > this.arrayLimit) {
+ this.array.length = this.arrayLimit;
+ }
+ }
+ getAverage() {
+ if (typeof this.array[0] === "number") {
+ let sum = 0;
+ for (let localNumber of this.array) {
+ let localNumberAny = localNumber;
+ sum = sum + localNumberAny;
+ }
+ return sum / this.array.length;
+ } else {
+ return null;
+ }
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.looptracker.js
+var LoopTracker;
+var init_classes_looptracker = __esm({
+ "node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.looptracker.js"() {
+ init_classes_plugins();
+ init_classes_objectmap();
+ LoopTracker = class {
+ constructor() {
+ this.referenceObjectMap = new ObjectMap();
+ }
+ /**
+ * checks and tracks an object
+ * @param objectArg
+ */
+ checkAndTrack(objectArg) {
+ if (!this.referenceObjectMap.checkForObject(objectArg)) {
+ this.referenceObjectMap.add(objectArg);
+ return true;
+ } else {
+ return false;
+ }
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.stringmap.js
+var Stringmap;
+var init_classes_stringmap = __esm({
+ "node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.stringmap.js"() {
+ init_classes_plugins();
+ Stringmap = class {
+ constructor() {
+ this._stringArray = [];
+ this._triggerUntilTrueFunctionArray = [];
+ }
+ /**
+ * add a string to the Stringmap
+ */
+ addString(stringArg) {
+ this._stringArray.push(stringArg);
+ this.notifyTrigger();
+ }
+ /**
+ * like addString, but accepts an array of strings
+ */
+ addStringArray(stringArrayArg) {
+ for (const stringItem of stringArrayArg) {
+ this.addString(stringItem);
+ }
+ }
+ /**
+ * removes a string from Stringmap
+ */
+ removeString(stringArg) {
+ for (const keyArg in this._stringArray) {
+ if (this._stringArray[keyArg] === stringArg) {
+ this._stringArray.splice(parseInt(keyArg), 1);
+ }
+ }
+ this.notifyTrigger();
+ }
+ /**
+ * wipes the Stringmap
+ */
+ wipe() {
+ this._stringArray = [];
+ this.notifyTrigger();
+ }
+ /**
+ * check if string is in Stringmap
+ */
+ checkString(stringArg) {
+ return this._stringArray.indexOf(stringArg) !== -1;
+ }
+ /**
+ * checks stringPresence with minimatch
+ */
+ checkMinimatch(miniMatchStringArg) {
+ const smartMatchInstance = new dist_ts_exports5.SmartMatch(miniMatchStringArg);
+ let foundMatch = false;
+ for (const stringItem of this._stringArray) {
+ if (smartMatchInstance.match(stringItem)) {
+ foundMatch = true;
+ }
+ }
+ return foundMatch;
+ }
+ /**
+ * checks if the Stringmap is empty
+ */
+ checkIsEmpty() {
+ return this._stringArray.length === 0;
+ }
+ /**
+ * gets a cloned copy of the current string Array
+ */
+ getStringArray() {
+ const returnArray = [];
+ for (const stringItem of this._stringArray) {
+ returnArray.push(stringItem);
+ }
+ return returnArray;
+ }
+ // trigger registering
+ /**
+ * register a new trigger
+ */
+ registerUntilTrue(functionArg, callbackArg) {
+ const trueDeferred = dist_ts_exports.defer();
+ this._triggerUntilTrueFunctionArray.push(() => {
+ const result = functionArg(this.getStringArray());
+ if (result === true) {
+ if (callbackArg) {
+ callbackArg();
+ }
+ trueDeferred.resolve();
+ }
+ return result;
+ });
+ this.notifyTrigger();
+ return trueDeferred.promise;
+ }
+ /**
+ * notifies triggers
+ */
+ notifyTrigger() {
+ const filteredArray = this._triggerUntilTrueFunctionArray.filter((functionArg) => {
+ return !functionArg();
+ });
+ this._triggerUntilTrueFunctionArray = filteredArray;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.timedaggregator.js
+var TimedAggregtor;
+var init_classes_timedaggregator = __esm({
+ "node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.timedaggregator.js"() {
+ init_classes_plugins();
+ TimedAggregtor = class {
+ constructor(optionsArg) {
+ this.storageArray = [];
+ this.options = optionsArg;
+ }
+ checkAggregationStatus() {
+ const addAggregationTimer = () => {
+ this.aggregationTimer = new dist_ts_exports7.Timer(this.options.aggregationIntervalInMillis);
+ this.aggregationTimer.completed.then(() => {
+ const aggregateForProcessing = this.storageArray;
+ if (aggregateForProcessing.length === 0) {
+ this.aggregationTimer = null;
+ return;
+ }
+ this.storageArray = [];
+ addAggregationTimer();
+ this.options.functionForAggregation(aggregateForProcessing);
+ });
+ this.aggregationTimer.start();
+ };
+ if (!this.aggregationTimer) {
+ addAggregationTimer();
+ }
+ }
+ add(aggregationArg) {
+ this.storageArray.push(aggregationArg);
+ this.checkAggregationStatus();
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.tree.js
+var Tree;
+var init_classes_tree = __esm({
+ "node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/classes.tree.js"() {
+ init_classes_plugins();
+ Tree = class {
+ constructor() {
+ this.symbolTree = new import_symbol_tree.default();
+ }
+ // =======================================
+ // Functions that map to the functionality of symbol-tree
+ // =======================================
+ /**
+ *
+ * @param objectArg
+ */
+ initialize(objectArg) {
+ return this.symbolTree.initialize(objectArg);
+ }
+ hasChildren(objectArg) {
+ return this.symbolTree.hasChildren(objectArg);
+ }
+ firstChild(objectArg) {
+ return this.symbolTree.firstChild(objectArg);
+ }
+ lastChild(objectArg) {
+ return this.symbolTree.lastChild(objectArg);
+ }
+ previousSibling(objectArg) {
+ return this.symbolTree.previousSibling(objectArg);
+ }
+ nextSibling(objectArg) {
+ return this.symbolTree.nextSibling(objectArg);
+ }
+ parent(objectArg) {
+ return this.symbolTree.parent(objectArg);
+ }
+ lastInclusiveDescendant(objectArg) {
+ return this.symbolTree.lastInclusiveDescendant(objectArg);
+ }
+ preceding(objectArg, optionsArg) {
+ return this.symbolTree.preceding(objectArg, optionsArg);
+ }
+ following(object, optionsArg) {
+ return this.symbolTree.following(object, optionsArg);
+ }
+ childrenToArray(parentArg, optionsArg) {
+ return this.symbolTree.childrenToArray(parentArg, optionsArg);
+ }
+ ancestorsToArray(objectArg, optionsArg) {
+ return this.symbolTree.ancestorsToArray(objectArg, optionsArg);
+ }
+ treeToArray(rootArg, optionsArg) {
+ return this.symbolTree.treeToArray(rootArg, optionsArg);
+ }
+ childrenIterator(parentArg, optionsArg) {
+ return this.symbolTree.childrenIterator(parentArg, optionsArg);
+ }
+ previousSiblingsIterator(objectArg) {
+ return this.symbolTree.previousSiblingsIterator(objectArg);
+ }
+ nextSiblingsIterator(objectArg) {
+ return this.symbolTree.nextSiblingsIterator();
+ }
+ ancestorsIterator(objectArg) {
+ this.symbolTree.ancestorsIterator();
+ }
+ treeIterator(rootArg, optionsArg) {
+ return this.symbolTree.treeIterator(rootArg);
+ }
+ index(childArg) {
+ return this.symbolTree.index(childArg);
+ }
+ childrenCount(parentArg) {
+ return this.symbolTree.childrenCount(parentArg);
+ }
+ compareTreePosition(leftArg, rightArg) {
+ return this.compareTreePosition(leftArg, rightArg);
+ }
+ remove(removeObjectArg) {
+ return this.symbolTree.remove(removeObjectArg);
+ }
+ insertBefore(referenceObjectArg, newObjectArg) {
+ return this.symbolTree.insertBefore(referenceObjectArg, newObjectArg);
+ }
+ insertAfter(referenceObject, newObjectArg) {
+ return this.symbolTree.insertAfter(referenceObject, newObjectArg);
+ }
+ prependChild(referenceObjectArg, newObjectArg) {
+ return this.symbolTree.prependChild(referenceObjectArg, newObjectArg);
+ }
+ appendChild(referenceObjectArg, newObjectArg) {
+ return this.symbolTree.appendChild(referenceObjectArg, newObjectArg);
+ }
+ // ===========================================
+ // Functionionality that extends symbol-tree
+ // ===========================================
+ /**
+ * returns a branch of the tree as JSON
+ * can be user
+ */
+ toJsonWithHierachy(rootElement) {
+ const treeIterable = this.treeIterator(rootElement, {});
+ for (const treeItem of treeIterable) {
+ console.log(treeItem);
+ }
+ }
+ /**
+ * builds a tree from a JSON with hierachy
+ * @param rootElement
+ */
+ fromJsonWithHierachy(rootElement) {
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/index.js
+var dist_ts_exports6 = {};
+__export(dist_ts_exports6, {
+ AsyncExecutionStack: () => AsyncExecutionStack,
+ BackpressuredArray: () => BackpressuredArray,
+ FastMap: () => FastMap,
+ Interest: () => Interest,
+ InterestMap: () => InterestMap,
+ LimitedArray: () => LimitedArray,
+ LoopTracker: () => LoopTracker,
+ ObjectMap: () => ObjectMap,
+ Stringmap: () => Stringmap,
+ TimedAggregtor: () => TimedAggregtor,
+ Tree: () => Tree,
+ uni: () => uni
+});
+var init_dist_ts7 = __esm({
+ "node_modules/.pnpm/@push.rocks+lik@6.2.2/node_modules/@push.rocks/lik/dist_ts/index.js"() {
+ init_classes_asyncexecutionstack();
+ init_classes_backpressuredarray();
+ init_classes_fastmap();
+ init_classes_interestmap();
+ init_classes_interestmap_interest();
+ init_classes_limitedarray();
+ init_classes_looptracker();
+ init_classes_objectmap();
+ init_classes_stringmap();
+ init_classes_timedaggregator();
+ init_classes_tree();
+ }
+});
+
+// node_modules/.pnpm/uint8array-extras@1.5.0/node_modules/uint8array-extras/index.js
+var uint8array_extras_exports = {};
+__export(uint8array_extras_exports, {
+ areUint8ArraysEqual: () => areUint8ArraysEqual,
+ assertUint8Array: () => assertUint8Array,
+ assertUint8ArrayOrArrayBuffer: () => assertUint8ArrayOrArrayBuffer,
+ base64ToString: () => base64ToString,
+ base64ToUint8Array: () => base64ToUint8Array,
+ compareUint8Arrays: () => compareUint8Arrays,
+ concatUint8Arrays: () => concatUint8Arrays,
+ getUintBE: () => getUintBE,
+ hexToUint8Array: () => hexToUint8Array,
+ includes: () => includes,
+ indexOf: () => indexOf,
+ isUint8Array: () => isUint8Array,
+ stringToBase64: () => stringToBase64,
+ stringToUint8Array: () => stringToUint8Array,
+ toUint8Array: () => toUint8Array,
+ uint8ArrayToBase64: () => uint8ArrayToBase64,
+ uint8ArrayToHex: () => uint8ArrayToHex,
+ uint8ArrayToString: () => uint8ArrayToString
+});
+function isType(value2, typeConstructor, typeStringified) {
+ if (!value2) {
+ return false;
+ }
+ if (value2.constructor === typeConstructor) {
+ return true;
+ }
+ return objectToString.call(value2) === typeStringified;
+}
+function isUint8Array(value2) {
+ return isType(value2, Uint8Array, uint8ArrayStringified);
+}
+function isArrayBuffer(value2) {
+ return isType(value2, ArrayBuffer, arrayBufferStringified);
+}
+function isUint8ArrayOrArrayBuffer(value2) {
+ return isUint8Array(value2) || isArrayBuffer(value2);
+}
+function assertUint8Array(value2) {
+ if (!isUint8Array(value2)) {
+ throw new TypeError(`Expected \`Uint8Array\`, got \`${typeof value2}\``);
+ }
+}
+function assertUint8ArrayOrArrayBuffer(value2) {
+ if (!isUint8ArrayOrArrayBuffer(value2)) {
+ throw new TypeError(`Expected \`Uint8Array\` or \`ArrayBuffer\`, got \`${typeof value2}\``);
+ }
+}
+function toUint8Array(value2) {
+ if (value2 instanceof ArrayBuffer) {
+ return new Uint8Array(value2);
+ }
+ if (ArrayBuffer.isView(value2)) {
+ return new Uint8Array(value2.buffer, value2.byteOffset, value2.byteLength);
+ }
+ throw new TypeError(`Unsupported value, got \`${typeof value2}\`.`);
+}
+function concatUint8Arrays(arrays, totalLength) {
+ if (arrays.length === 0) {
+ return new Uint8Array(0);
+ }
+ totalLength ??= arrays.reduce((accumulator, currentValue) => accumulator + currentValue.length, 0);
+ const returnValue = new Uint8Array(totalLength);
+ let offset = 0;
+ for (const array of arrays) {
+ assertUint8Array(array);
+ returnValue.set(array, offset);
+ offset += array.length;
+ }
+ return returnValue;
+}
+function areUint8ArraysEqual(a5, b5) {
+ assertUint8Array(a5);
+ assertUint8Array(b5);
+ if (a5 === b5) {
+ return true;
+ }
+ if (a5.length !== b5.length) {
+ return false;
+ }
+ for (let index2 = 0; index2 < a5.length; index2++) {
+ if (a5[index2] !== b5[index2]) {
+ return false;
+ }
+ }
+ return true;
+}
+function compareUint8Arrays(a5, b5) {
+ assertUint8Array(a5);
+ assertUint8Array(b5);
+ const length = Math.min(a5.length, b5.length);
+ for (let index2 = 0; index2 < length; index2++) {
+ const diff = a5[index2] - b5[index2];
+ if (diff !== 0) {
+ return Math.sign(diff);
+ }
+ }
+ return Math.sign(a5.length - b5.length);
+}
+function uint8ArrayToString(array, encoding = "utf8") {
+ assertUint8ArrayOrArrayBuffer(array);
+ cachedDecoders[encoding] ??= new globalThis.TextDecoder(encoding);
+ return cachedDecoders[encoding].decode(array);
+}
+function assertString(value2) {
+ if (typeof value2 !== "string") {
+ throw new TypeError(`Expected \`string\`, got \`${typeof value2}\``);
+ }
+}
+function stringToUint8Array(string3) {
+ assertString(string3);
+ return cachedEncoder.encode(string3);
+}
+function base64ToBase64Url(base642) {
+ return base642.replaceAll("+", "-").replaceAll("/", "_").replace(/=+$/, "");
+}
+function base64UrlToBase64(base64url) {
+ const base642 = base64url.replaceAll("-", "+").replaceAll("_", "/");
+ const padding = (4 - base642.length % 4) % 4;
+ return base642 + "=".repeat(padding);
+}
+function uint8ArrayToBase64(array, { urlSafe = false } = {}) {
+ assertUint8Array(array);
+ let base642 = "";
+ for (let index2 = 0; index2 < array.length; index2 += MAX_BLOCK_SIZE) {
+ const chunk = array.subarray(index2, index2 + MAX_BLOCK_SIZE);
+ base642 += globalThis.btoa(String.fromCodePoint.apply(void 0, chunk));
+ }
+ return urlSafe ? base64ToBase64Url(base642) : base642;
+}
+function base64ToUint8Array(base64String) {
+ assertString(base64String);
+ return Uint8Array.from(globalThis.atob(base64UrlToBase64(base64String)), (x4) => x4.codePointAt(0));
+}
+function stringToBase64(string3, { urlSafe = false } = {}) {
+ assertString(string3);
+ return uint8ArrayToBase64(stringToUint8Array(string3), { urlSafe });
+}
+function base64ToString(base64String) {
+ assertString(base64String);
+ return uint8ArrayToString(base64ToUint8Array(base64String));
+}
+function uint8ArrayToHex(array) {
+ assertUint8Array(array);
+ let hexString = "";
+ for (let index2 = 0; index2 < array.length; index2++) {
+ hexString += byteToHexLookupTable[array[index2]];
+ }
+ return hexString;
+}
+function hexToUint8Array(hexString) {
+ assertString(hexString);
+ if (hexString.length % 2 !== 0) {
+ throw new Error("Invalid Hex string length.");
+ }
+ const resultLength = hexString.length / 2;
+ const bytes = new Uint8Array(resultLength);
+ for (let index2 = 0; index2 < resultLength; index2++) {
+ const highNibble = hexToDecimalLookupTable[hexString[index2 * 2]];
+ const lowNibble = hexToDecimalLookupTable[hexString[index2 * 2 + 1]];
+ if (highNibble === void 0 || lowNibble === void 0) {
+ throw new Error(`Invalid Hex character encountered at position ${index2 * 2}`);
+ }
+ bytes[index2] = highNibble << 4 | lowNibble;
+ }
+ return bytes;
+}
+function getUintBE(view) {
+ const { byteLength } = view;
+ if (byteLength === 6) {
+ return view.getUint16(0) * 2 ** 32 + view.getUint32(2);
+ }
+ if (byteLength === 5) {
+ return view.getUint8(0) * 2 ** 32 + view.getUint32(1);
+ }
+ if (byteLength === 4) {
+ return view.getUint32(0);
+ }
+ if (byteLength === 3) {
+ return view.getUint8(0) * 2 ** 16 + view.getUint16(1);
+ }
+ if (byteLength === 2) {
+ return view.getUint16(0);
+ }
+ if (byteLength === 1) {
+ return view.getUint8(0);
+ }
+}
+function indexOf(array, value2) {
+ const arrayLength = array.length;
+ const valueLength = value2.length;
+ if (valueLength === 0) {
+ return -1;
+ }
+ if (valueLength > arrayLength) {
+ return -1;
+ }
+ const validOffsetLength = arrayLength - valueLength;
+ for (let index2 = 0; index2 <= validOffsetLength; index2++) {
+ let isMatch3 = true;
+ for (let index22 = 0; index22 < valueLength; index22++) {
+ if (array[index2 + index22] !== value2[index22]) {
+ isMatch3 = false;
+ break;
+ }
+ }
+ if (isMatch3) {
+ return index2;
+ }
+ }
+ return -1;
+}
+function includes(array, value2) {
+ return indexOf(array, value2) !== -1;
+}
+var objectToString, uint8ArrayStringified, arrayBufferStringified, cachedDecoders, cachedEncoder, MAX_BLOCK_SIZE, byteToHexLookupTable, hexToDecimalLookupTable;
+var init_uint8array_extras = __esm({
+ "node_modules/.pnpm/uint8array-extras@1.5.0/node_modules/uint8array-extras/index.js"() {
+ objectToString = Object.prototype.toString;
+ uint8ArrayStringified = "[object Uint8Array]";
+ arrayBufferStringified = "[object ArrayBuffer]";
+ cachedDecoders = {
+ utf8: new globalThis.TextDecoder("utf8")
+ };
+ cachedEncoder = new globalThis.TextEncoder();
+ MAX_BLOCK_SIZE = 65535;
+ byteToHexLookupTable = Array.from({ length: 256 }, (_4, index2) => index2.toString(16).padStart(2, "0"));
+ hexToDecimalLookupTable = {
+ 0: 0,
+ 1: 1,
+ 2: 2,
+ 3: 3,
+ 4: 4,
+ 5: 5,
+ 6: 6,
+ 7: 7,
+ 8: 8,
+ 9: 9,
+ a: 10,
+ b: 11,
+ c: 12,
+ d: 13,
+ e: 14,
+ f: 15,
+ A: 10,
+ B: 11,
+ C: 12,
+ D: 13,
+ E: 14,
+ F: 15
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartbuffer@3.0.5/node_modules/@push.rocks/smartbuffer/dist_ts/smartbuffer.plugins.js
+var init_smartbuffer_plugins = __esm({
+ "node_modules/.pnpm/@push.rocks+smartbuffer@3.0.5/node_modules/@push.rocks/smartbuffer/dist_ts/smartbuffer.plugins.js"() {
+ init_uint8array_extras();
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartbuffer@3.0.5/node_modules/@push.rocks/smartbuffer/dist_ts/index.js
+var dist_ts_exports8 = {};
+__export(dist_ts_exports8, {
+ base64ToUint8Array: () => base64ToUint8Array2,
+ ensurePureUint8Array: () => ensurePureUint8Array,
+ isBufferLike: () => isBufferLike,
+ isUint8Array: () => isUint8Array2,
+ uInt8ArrayExtras: () => uInt8ArrayExtras,
+ uInt8ArrayToBase64: () => uInt8ArrayToBase64
+});
+function uInt8ArrayToBase64(uInt8Array) {
+ return uint8array_extras_exports.uint8ArrayToBase64(uInt8Array);
+}
+function base64ToUint8Array2(base642) {
+ return uint8array_extras_exports.base64ToUint8Array(base642);
+}
+function isBufferLike(obj) {
+ if (obj && typeof obj.byteLength === "number") {
+ return true;
+ }
+ if (typeof Buffer !== "undefined" && Buffer.isBuffer) {
+ return Buffer.isBuffer(obj);
+ }
+ return false;
+}
+function ensurePureUint8Array(bufferArg) {
+ const uint8Array = new Uint8Array(bufferArg.length);
+ uint8Array.set(bufferArg);
+ return uint8Array;
+}
+var uInt8ArrayExtras, isUint8Array2;
+var init_dist_ts8 = __esm({
+ "node_modules/.pnpm/@push.rocks+smartbuffer@3.0.5/node_modules/@push.rocks/smartbuffer/dist_ts/index.js"() {
+ init_smartbuffer_plugins();
+ uInt8ArrayExtras = uint8array_extras_exports;
+ isUint8Array2 = (obj) => {
+ return uint8array_extras_exports.isUint8Array(obj);
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartguard@3.1.0/node_modules/@push.rocks/smartguard/dist_ts/smartguard.plugins.js
+var init_smartguard_plugins = __esm({
+ "node_modules/.pnpm/@push.rocks+smartguard@3.1.0/node_modules/@push.rocks/smartguard/dist_ts/smartguard.plugins.js"() {
+ init_dist_ts();
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartguard@3.1.0/node_modules/@push.rocks/smartguard/dist_ts/classes.guard.js
+var Guard;
+var init_classes_guard = __esm({
+ "node_modules/.pnpm/@push.rocks+smartguard@3.1.0/node_modules/@push.rocks/smartguard/dist_ts/classes.guard.js"() {
+ init_smartguard_plugins();
+ Guard = class {
+ constructor(guardFunctionArg, optionsArg) {
+ this.guardFunction = guardFunctionArg;
+ this.options = optionsArg;
+ }
+ /**
+ * executes the guard against a data argument;
+ * @param dataArg
+ */
+ async exec(dataArg) {
+ const result = await this.guardFunction(dataArg);
+ return result;
+ }
+ async getFailedHint(dataArg) {
+ const result = await this.exec(dataArg);
+ if (!result) {
+ return this.options.failedHint;
+ } else {
+ return null;
+ }
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartguard@3.1.0/node_modules/@push.rocks/smartguard/dist_ts/classes.guarderror.js
+var GuardError;
+var init_classes_guarderror = __esm({
+ "node_modules/.pnpm/@push.rocks+smartguard@3.1.0/node_modules/@push.rocks/smartguard/dist_ts/classes.guarderror.js"() {
+ init_smartguard_plugins();
+ GuardError = class extends Error {
+ constructor(message2) {
+ super(message2);
+ this.name = "GuardError";
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartguard@3.1.0/node_modules/@push.rocks/smartguard/dist_ts/classes.guardset.js
+var GuardSet;
+var init_classes_guardset = __esm({
+ "node_modules/.pnpm/@push.rocks+smartguard@3.1.0/node_modules/@push.rocks/smartguard/dist_ts/classes.guardset.js"() {
+ init_smartguard_plugins();
+ init_classes_guard();
+ GuardSet = class extends Guard {
+ constructor(guardArray = []) {
+ super(async (dataArg) => {
+ return this.allGuardsPass(dataArg);
+ });
+ this.guards = guardArray;
+ }
+ /**
+ * executes all guards in all guardSets against a data argument
+ * @param dataArg
+ */
+ async execAllWithData(dataArg, optionsArg = {
+ mode: "parallel",
+ stopOnFail: false
+ }) {
+ const resultPromises = [];
+ for (const guard of this.guards) {
+ const guardResultPromise = guard.exec(dataArg);
+ if (optionsArg.mode === "serial") {
+ await guardResultPromise;
+ }
+ resultPromises.push(guardResultPromise);
+ if (optionsArg.stopOnFail) {
+ if (!await guardResultPromise) {
+ return await Promise.all(resultPromises);
+ }
+ }
+ }
+ const results = await Promise.all(resultPromises);
+ return results;
+ }
+ /**
+ * checks if all guards pass
+ * @param dataArg
+ */
+ async allGuardsPass(dataArg, optionsArg = {
+ mode: "parallel",
+ stopOnFail: false
+ }) {
+ const results = await this.execAllWithData(dataArg, optionsArg);
+ return results.every((result) => result);
+ }
+ /**
+ * checks if any guard passes
+ * @param dataArg
+ */
+ async anyGuardsPass(dataArg) {
+ const results = await this.execAllWithData(dataArg, {
+ mode: "parallel",
+ stopOnFail: false
+ });
+ return results.some((result) => result);
+ }
+ /**
+ * returns the first reason for why something fails
+ * @param dataArg
+ * @returns
+ */
+ getFailedHint(dataArg) {
+ for (const guard of this.guards) {
+ const failedHint = guard.getFailedHint(dataArg);
+ if (failedHint) {
+ return failedHint;
+ }
+ }
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartguard@3.1.0/node_modules/@push.rocks/smartguard/dist_ts/index.js
+var dist_ts_exports9 = {};
+__export(dist_ts_exports9, {
+ Guard: () => Guard,
+ GuardError: () => GuardError,
+ GuardSet: () => GuardSet,
+ passGuardsOrReject: () => passGuardsOrReject
+});
+var passGuardsOrReject;
+var init_dist_ts9 = __esm({
+ "node_modules/.pnpm/@push.rocks+smartguard@3.1.0/node_modules/@push.rocks/smartguard/dist_ts/index.js"() {
+ init_smartguard_plugins();
+ init_classes_guard();
+ init_classes_guarderror();
+ init_classes_guard();
+ init_classes_guardset();
+ init_classes_guardset();
+ init_classes_guarderror();
+ passGuardsOrReject = async (dataArg, guards) => {
+ const guardSet = new GuardSet(guards);
+ const result = await guardSet.allGuardsPass(dataArg);
+ if (!result) {
+ const failedHint = await guardSet.getFailedHint(dataArg);
+ throw new GuardError(`Guards failed:
+${failedHint}
+ `);
+ }
+ return;
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/interceptors/interceptor.manager.js
+var InterceptorManager;
+var init_interceptor_manager = __esm({
+ "node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/interceptors/interceptor.manager.js"() {
+ InterceptorManager = class {
+ constructor() {
+ this.requestInterceptors = [];
+ this.responseInterceptors = [];
+ this.errorInterceptors = [];
+ }
+ /**
+ * Add a request interceptor
+ */
+ addRequestInterceptor(interceptor) {
+ this.requestInterceptors.push(interceptor);
+ }
+ /**
+ * Add a response interceptor
+ */
+ addResponseInterceptor(interceptor) {
+ this.responseInterceptors.push(interceptor);
+ }
+ /**
+ * Add an error interceptor
+ */
+ addErrorInterceptor(interceptor) {
+ this.errorInterceptors.push(interceptor);
+ }
+ /**
+ * Remove a request interceptor
+ */
+ removeRequestInterceptor(interceptor) {
+ const index2 = this.requestInterceptors.indexOf(interceptor);
+ if (index2 > -1) {
+ this.requestInterceptors.splice(index2, 1);
+ }
+ }
+ /**
+ * Remove a response interceptor
+ */
+ removeResponseInterceptor(interceptor) {
+ const index2 = this.responseInterceptors.indexOf(interceptor);
+ if (index2 > -1) {
+ this.responseInterceptors.splice(index2, 1);
+ }
+ }
+ /**
+ * Remove an error interceptor
+ */
+ removeErrorInterceptor(interceptor) {
+ const index2 = this.errorInterceptors.indexOf(interceptor);
+ if (index2 > -1) {
+ this.errorInterceptors.splice(index2, 1);
+ }
+ }
+ /**
+ * Clear all interceptors
+ */
+ clearAll() {
+ this.requestInterceptors = [];
+ this.responseInterceptors = [];
+ this.errorInterceptors = [];
+ }
+ /**
+ * Process request through all request interceptors
+ */
+ async processRequest(request) {
+ let processedRequest = request;
+ for (const interceptor of this.requestInterceptors) {
+ try {
+ processedRequest = await interceptor(processedRequest);
+ } catch (error) {
+ throw await this.processError(error instanceof Error ? error : new Error(String(error)));
+ }
+ }
+ return processedRequest;
+ }
+ /**
+ * Process response through all response interceptors
+ */
+ async processResponse(response) {
+ let processedResponse = response;
+ for (const interceptor of this.responseInterceptors) {
+ try {
+ processedResponse = await interceptor(processedResponse);
+ } catch (error) {
+ throw await this.processError(error instanceof Error ? error : new Error(String(error)));
+ }
+ }
+ return processedResponse;
+ }
+ /**
+ * Process error through all error interceptors
+ */
+ async processError(error) {
+ let processedError = error;
+ for (const interceptor of this.errorInterceptors) {
+ try {
+ processedError = await interceptor(processedError);
+ } catch (newError) {
+ processedError = newError instanceof Error ? newError : new Error(String(newError));
+ }
+ }
+ return processedError;
+ }
+ /**
+ * Get count of registered interceptors
+ */
+ getInterceptorCounts() {
+ return {
+ request: this.requestInterceptors.length,
+ response: this.responseInterceptors.length,
+ error: this.errorInterceptors.length
+ };
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartenv@5.0.13/node_modules/@push.rocks/smartenv/dist_ts/smartenv.plugins.js
+var init_smartenv_plugins = __esm({
+ "node_modules/.pnpm/@push.rocks+smartenv@5.0.13/node_modules/@push.rocks/smartenv/dist_ts/smartenv.plugins.js"() {
+ init_dist_ts();
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartenv@5.0.13/node_modules/@push.rocks/smartenv/dist_ts/interfaces/index.js
+var init_interfaces = __esm({
+ "node_modules/.pnpm/@push.rocks+smartenv@5.0.13/node_modules/@push.rocks/smartenv/dist_ts/interfaces/index.js"() {
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartenv@5.0.13/node_modules/@push.rocks/smartenv/dist_ts/smartenv.classes.smartenv.js
+var Smartenv;
+var init_smartenv_classes_smartenv = __esm({
+ "node_modules/.pnpm/@push.rocks+smartenv@5.0.13/node_modules/@push.rocks/smartenv/dist_ts/smartenv.classes.smartenv.js"() {
+ init_smartenv_plugins();
+ init_interfaces();
+ Smartenv = class {
+ constructor() {
+ this.loadedScripts = [];
+ }
+ async getEnvAwareModule(optionsArg) {
+ if (this.isNode) {
+ const moduleResult = await this.getSafeNodeModule(optionsArg.nodeModuleName);
+ return moduleResult;
+ } else if (this.isBrowser) {
+ const moduleResult = await this.getSafeWebModule(optionsArg.webUrlArg, optionsArg.getFunction);
+ return moduleResult;
+ } else {
+ console.error("platform for loading not supported by smartenv");
+ }
+ }
+ async getSafeNodeModule(moduleNameArg, runAfterFunc) {
+ if (!this.isNode) {
+ console.error(`You tried to load a node module in a wrong context: ${moduleNameArg}. This does not throw.`);
+ return;
+ }
+ const returnValue = await new Function(`return import('${moduleNameArg}')`)();
+ if (runAfterFunc) {
+ await runAfterFunc(returnValue);
+ }
+ return returnValue;
+ }
+ async getSafeWebModule(urlArg, getFunctionArg) {
+ if (!this.isBrowser) {
+ console.error("You tried to load a web module in a wrong context");
+ return;
+ }
+ if (this.loadedScripts.includes(urlArg)) {
+ return getFunctionArg();
+ } else {
+ this.loadedScripts.push(urlArg);
+ }
+ const done = dist_ts_exports.defer();
+ if (globalThis.importScripts) {
+ globalThis.importScripts(urlArg);
+ done.resolve();
+ } else {
+ const script = document.createElement("script");
+ script.onload = () => {
+ done.resolve();
+ };
+ script.src = urlArg;
+ document.head.appendChild(script);
+ }
+ await done.promise;
+ return getFunctionArg();
+ }
+ get runtimeEnv() {
+ if (typeof process !== "undefined") {
+ return "node";
+ } else {
+ return "browser";
+ }
+ }
+ get isBrowser() {
+ return !this.isNode;
+ }
+ get userAgent() {
+ if (this.isBrowser) {
+ return navigator.userAgent;
+ } else {
+ return "undefined";
+ }
+ }
+ get isNode() {
+ return this.runtimeEnv === "node";
+ }
+ get nodeVersion() {
+ return process.version;
+ }
+ get isCI() {
+ if (this.isNode) {
+ if (process.env.CI) {
+ return true;
+ } else {
+ return false;
+ }
+ } else {
+ return false;
+ }
+ }
+ async isMacAsync() {
+ if (this.isNode) {
+ const os = await this.getSafeNodeModule("os");
+ return os.platform() === "darwin";
+ } else {
+ return false;
+ }
+ }
+ async isWindowsAsync() {
+ if (this.isNode) {
+ const os = await this.getSafeNodeModule("os");
+ return os.platform() === "win32";
+ } else {
+ return false;
+ }
+ }
+ async isLinuxAsync() {
+ if (this.isNode) {
+ const os = await this.getSafeNodeModule("os");
+ return os.platform() === "linux";
+ } else {
+ return false;
+ }
+ }
+ /**
+ * prints the environment to console
+ */
+ async printEnv() {
+ if (this.isNode) {
+ console.log("running on NODE");
+ console.log("node version is " + this.nodeVersion);
+ } else {
+ console.log("running on BROWSER");
+ console.log("browser is " + this.userAgent);
+ }
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartenv@5.0.13/node_modules/@push.rocks/smartenv/dist_ts/index.js
+var dist_ts_exports10 = {};
+__export(dist_ts_exports10, {
+ Smartenv: () => Smartenv
+});
+var init_dist_ts10 = __esm({
+ "node_modules/.pnpm/@push.rocks+smartenv@5.0.13/node_modules/@push.rocks/smartenv/dist_ts/index.js"() {
+ init_smartenv_classes_smartenv();
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/smartstring.plugins.js
+var isounique;
+var init_smartstring_plugins = __esm({
+ "node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/smartstring.plugins.js"() {
+ isounique = __toESM(require_dist_ts(), 1);
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/smartstring.create.js
+var smartstring_create_exports = {};
+__export(smartstring_create_exports, {
+ createCryptoRandomString: () => createCryptoRandomString,
+ createRandomString: () => createRandomString
+});
+var getRandomInt, customRandomatic, createRandomString, createCryptoRandomString;
+var init_smartstring_create = __esm({
+ "node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/smartstring.create.js"() {
+ init_smartstring_plugins();
+ getRandomInt = (min3, max3) => {
+ if (typeof globalThis !== "undefined" && globalThis.crypto && globalThis.crypto.getRandomValues) {
+ const range2 = max3 - min3;
+ const array = new Uint32Array(1);
+ globalThis.crypto.getRandomValues(array);
+ return min3 + array[0] % range2;
+ } else {
+ return Math.floor(Math.random() * (max3 - min3)) + min3;
+ }
+ };
+ customRandomatic = (pattern, length, options) => {
+ const charSets = {
+ "A": "ABCDEFGHIJKLMNOPQRSTUVWXYZ",
+ "a": "abcdefghijklmnopqrstuvwxyz",
+ "0": "0123456789",
+ "!": "!@#$%^&*()_+-=[]{}|;:,.<>?",
+ "*": "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789!@#$%^&*()_+-=[]{}|;:,.<>?"
+ };
+ let actualPattern = pattern;
+ if (length && length > pattern.length) {
+ actualPattern = pattern.repeat(Math.ceil(length / pattern.length)).slice(0, length);
+ } else if (length) {
+ actualPattern = pattern.slice(0, length);
+ }
+ let result = "";
+ for (const char of actualPattern) {
+ if (charSets[char]) {
+ const charSet = charSets[char];
+ const randomIndex = getRandomInt(0, charSet.length);
+ result += charSet[randomIndex];
+ } else {
+ result += char;
+ }
+ }
+ return result;
+ };
+ createRandomString = (patternArg, lengthArg, optionsArg) => {
+ return customRandomatic(patternArg, lengthArg, optionsArg);
+ };
+ createCryptoRandomString = () => {
+ return isounique.uni();
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/smartstring.docker.js
+var smartstring_docker_exports = {};
+__export(smartstring_docker_exports, {
+ makeEnvObject: () => makeEnvObject
+});
+var makeEnvObject;
+var init_smartstring_docker = __esm({
+ "node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/smartstring.docker.js"() {
+ init_smartstring_plugins();
+ makeEnvObject = function(envArrayArg) {
+ let returnObject = {};
+ let regexString = /(.*)=(.*)/;
+ if (typeof envArrayArg !== "undefined") {
+ for (let envKey in envArrayArg) {
+ let regexMatches = regexString.exec(envArrayArg[envKey]);
+ returnObject[regexMatches[1]] = regexMatches[2];
+ }
+ }
+ return returnObject;
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/smartstring.indent.js
+var smartstring_indent_exports = {};
+__export(smartstring_indent_exports, {
+ indent: () => indent,
+ indentWithPrefix: () => indentWithPrefix,
+ normalize: () => normalize
+});
+var splitStringAtLineBreak, joinStringWithLineBreaks, cleanStringArray, indent, indentWithPrefix, normalize;
+var init_smartstring_indent = __esm({
+ "node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/smartstring.indent.js"() {
+ init_smartstring_plugins();
+ splitStringAtLineBreak = (stringArg) => {
+ let resultArray = stringArg.split("\n");
+ return cleanStringArray(resultArray);
+ };
+ joinStringWithLineBreaks = (stringArrayArg) => {
+ let resultString = "";
+ for (let line of stringArrayArg) {
+ resultString = resultString + line + "\n";
+ }
+ return resultString;
+ };
+ cleanStringArray = (stringArrayArg) => {
+ let testRegex = /^[\s]*$/;
+ if (testRegex.test(stringArrayArg[0])) {
+ stringArrayArg.shift();
+ }
+ if (testRegex.test(stringArrayArg[stringArrayArg.length - 1])) {
+ stringArrayArg.pop();
+ }
+ return stringArrayArg;
+ };
+ indent = (stringArg, spaceAmount) => {
+ let localStringArray = splitStringAtLineBreak(stringArg);
+ for (let stringArg2 of localStringArray) {
+ stringArg2 = " ".repeat(spaceAmount) + stringArg2;
+ }
+ let resultString = joinStringWithLineBreaks(localStringArray);
+ return resultString;
+ };
+ indentWithPrefix = (stringArg, prefixArg) => {
+ let resultString;
+ let stringArray = splitStringAtLineBreak(stringArg);
+ let resultArray = [];
+ for (let stringItem of stringArray) {
+ resultArray.push(prefixArg + stringItem);
+ }
+ resultString = joinStringWithLineBreaks(resultArray);
+ return resultString;
+ };
+ normalize = (stringArg) => {
+ let resultString;
+ let splitStringArray = splitStringAtLineBreak(stringArg);
+ let minCommonLeftOffset;
+ const deIndentRegex = /^(\s*)/;
+ const emptyLineRegex = /^(\s*)$/;
+ for (let stringItem of splitStringArray) {
+ let offsetString = deIndentRegex.exec(stringItem)[1];
+ if ((typeof minCommonLeftOffset === "undefined" || offsetString.length < minCommonLeftOffset) && !emptyLineRegex.test(stringItem)) {
+ minCommonLeftOffset = offsetString.length;
+ }
+ }
+ let resultSplitStringArray = [];
+ for (let stringItem of splitStringArray) {
+ resultSplitStringArray.push(stringItem.substr(minCommonLeftOffset));
+ }
+ resultString = joinStringWithLineBreaks(resultSplitStringArray);
+ return resultString;
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/smartstring.normalize.js
+var smartstring_normalize_exports = {};
+__export(smartstring_normalize_exports, {
+ replaceAll: () => replaceAll,
+ standard: () => standard
+});
+var replaceAll, stripIndent, standard;
+var init_smartstring_normalize = __esm({
+ "node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/smartstring.normalize.js"() {
+ replaceAll = (stringArg, searchPattern, replacementString) => {
+ return stringArg.replace(new RegExp(searchPattern, "g"), replacementString);
+ };
+ stripIndent = (str) => {
+ const lines = str.split("\n");
+ let minIndent = Infinity;
+ for (const line of lines) {
+ if (line.trim().length > 0) {
+ const match2 = line.match(/^(\s*)/);
+ if (match2) {
+ minIndent = Math.min(minIndent, match2[1].length);
+ }
+ }
+ }
+ if (minIndent === Infinity || minIndent === 0) {
+ return str;
+ }
+ return lines.map((line) => {
+ if (line.length >= minIndent) {
+ return line.slice(minIndent);
+ }
+ return line;
+ }).join("\n");
+ };
+ standard = (stringArg, options) => {
+ let result = stringArg;
+ if (!options || options.stripIndent) {
+ result = stripIndent(result);
+ }
+ if (!options || options.normalizeNewline) {
+ result = result.replace(/\r\n/g, "\n");
+ }
+ if (!options || options.replaceTabs) {
+ result = replaceAll(result, " /", " ");
+ }
+ if (!options || options.stripLeadingTrailingEmptyLines) {
+ result = result.replace(/^\s*[\r\n]/gm, "").replace(/\s*[\r\n]$/gm, "");
+ }
+ if (!options || options.stripAllEmptyLines) {
+ result = result.replace(/^\s*[\r\n]/gm, "");
+ }
+ return result;
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/smartstring.base64.js
+var universalBase64, Base64, base64;
+var init_smartstring_base64 = __esm({
+ "node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/smartstring.base64.js"() {
+ universalBase64 = {
+ encode: (str) => {
+ if (typeof Buffer !== "undefined") {
+ return Buffer.from(str, "utf8").toString("base64");
+ } else if (typeof btoa !== "undefined") {
+ const utf8Bytes = new TextEncoder().encode(str);
+ const binaryString = Array.from(utf8Bytes, (byte) => String.fromCharCode(byte)).join("");
+ return btoa(binaryString);
+ } else {
+ const chars = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/";
+ const bytes = new TextEncoder().encode(str);
+ let result = "";
+ let i11 = 0;
+ while (i11 < bytes.length) {
+ const a5 = bytes[i11++];
+ const b5 = i11 < bytes.length ? bytes[i11++] : 0;
+ const c11 = i11 < bytes.length ? bytes[i11++] : 0;
+ const bitmap = a5 << 16 | b5 << 8 | c11;
+ result += chars.charAt(bitmap >> 18 & 63);
+ result += chars.charAt(bitmap >> 12 & 63);
+ result += i11 - 2 < bytes.length ? chars.charAt(bitmap >> 6 & 63) : "=";
+ result += i11 - 1 < bytes.length ? chars.charAt(bitmap & 63) : "=";
+ }
+ return result;
+ }
+ },
+ decode: (str) => {
+ const base64String = str.replace(/-/g, "+").replace(/_/g, "/").padEnd(str.length + (4 - str.length % 4) % 4, "=");
+ if (typeof Buffer !== "undefined") {
+ return Buffer.from(base64String, "base64").toString("utf8");
+ } else if (typeof atob !== "undefined") {
+ const binaryString = atob(base64String);
+ const bytes = new Uint8Array(binaryString.length);
+ for (let i11 = 0; i11 < binaryString.length; i11++) {
+ bytes[i11] = binaryString.charCodeAt(i11);
+ }
+ return new TextDecoder().decode(bytes);
+ } else {
+ const chars = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/";
+ let bytes = [];
+ let i11 = 0;
+ while (i11 < base64String.length) {
+ const encoded1 = chars.indexOf(base64String.charAt(i11++));
+ const encoded2 = chars.indexOf(base64String.charAt(i11++));
+ const encoded3 = chars.indexOf(base64String.charAt(i11++));
+ const encoded4 = chars.indexOf(base64String.charAt(i11++));
+ const bitmap = encoded1 << 18 | encoded2 << 12 | encoded3 << 6 | encoded4;
+ bytes.push(bitmap >> 16 & 255);
+ if (encoded3 !== 64)
+ bytes.push(bitmap >> 8 & 255);
+ if (encoded4 !== 64)
+ bytes.push(bitmap & 255);
+ }
+ return new TextDecoder().decode(new Uint8Array(bytes));
+ }
+ }
+ };
+ Base64 = class {
+ constructor(inputStringArg, typeArg) {
+ switch (typeArg) {
+ case "string":
+ this.refString = inputStringArg;
+ break;
+ case "base64":
+ this.refString = base64.decode(inputStringArg);
+ break;
+ case "base64uri":
+ this.refString = base64.decode(inputStringArg);
+ }
+ }
+ /**
+ * the simple string (unencoded)
+ */
+ get simpleString() {
+ return this.refString;
+ }
+ /**
+ * the base64 encoded version of the original string
+ */
+ get base64String() {
+ return base64.encode(this.refString);
+ }
+ /**
+ * the base64uri encoded version of the original string
+ */
+ get base64UriString() {
+ return base64.encodeUri(this.refString);
+ }
+ };
+ base64 = {
+ /**
+ * encodes the string
+ */
+ encode: (stringArg) => {
+ return universalBase64.encode(stringArg);
+ },
+ /**
+ * encodes a stringArg to base64 uri style
+ */
+ encodeUri: (stringArg) => {
+ return universalBase64.encode(stringArg).replace(/\+/g, "-").replace(/\//g, "_").replace(/=/g, "");
+ },
+ /**
+ * decodes a base64 encoded string
+ */
+ decode: (stringArg) => {
+ return universalBase64.decode(stringArg);
+ },
+ /**
+ *
+ * @param stringArg
+ * checks wether the string is base64 encoded
+ */
+ isBase64: (stringArg) => {
+ const regex = /^([A-Za-z0-9+/]{4})*([A-Za-z0-9+/]{3}=|[A-Za-z0-9+/]{2}==)?$/;
+ return regex.test(stringArg);
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/smartstring.type.js
+var smartstring_type_exports = {};
+__export(smartstring_type_exports, {
+ isBase64: () => isBase64,
+ isUtf8: () => isUtf8
+});
+var isUtf8, isBase64;
+var init_smartstring_type = __esm({
+ "node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/smartstring.type.js"() {
+ init_smartstring_plugins();
+ init_smartstring_base64();
+ isUtf8 = (stringArg) => {
+ const encoder2 = new TextEncoder();
+ const bytes = encoder2.encode(stringArg);
+ let i11 = 0;
+ while (i11 < bytes.length) {
+ if (
+ // ASCII
+ bytes[i11] === 9 || bytes[i11] === 10 || bytes[i11] === 13 || 32 <= bytes[i11] && bytes[i11] <= 126
+ ) {
+ i11 += 1;
+ continue;
+ }
+ if (
+ // non-overlong 2-byte
+ 194 <= bytes[i11] && bytes[i11] <= 223 && 128 <= bytes[i11 + 1] && bytes[i11 + 1] <= 191
+ ) {
+ i11 += 2;
+ continue;
+ }
+ if (
+ // excluding overlongs
+ bytes[i11] === 224 && 160 <= bytes[i11 + 1] && bytes[i11 + 1] <= 191 && 128 <= bytes[i11 + 2] && bytes[i11 + 2] <= 191 || // straight 3-byte
+ (225 <= bytes[i11] && bytes[i11] <= 236 || bytes[i11] === 238 || bytes[i11] === 239) && 128 <= bytes[i11 + 1] && bytes[i11 + 1] <= 191 && 128 <= bytes[i11 + 2] && bytes[i11 + 2] <= 191 || // excluding surrogates
+ bytes[i11] === 237 && 128 <= bytes[i11 + 1] && bytes[i11 + 1] <= 159 && 128 <= bytes[i11 + 2] && bytes[i11 + 2] <= 191
+ ) {
+ i11 += 3;
+ continue;
+ }
+ if (
+ // planes 1-3
+ bytes[i11] === 240 && 144 <= bytes[i11 + 1] && bytes[i11 + 1] <= 191 && 128 <= bytes[i11 + 2] && bytes[i11 + 2] <= 191 && 128 <= bytes[i11 + 3] && bytes[i11 + 3] <= 191 || // planes 4-15
+ 241 <= bytes[i11] && bytes[i11] <= 243 && 128 <= bytes[i11 + 1] && bytes[i11 + 1] <= 191 && 128 <= bytes[i11 + 2] && bytes[i11 + 2] <= 191 && 128 <= bytes[i11 + 3] && bytes[i11 + 3] <= 191 || // plane 16
+ bytes[i11] === 244 && 128 <= bytes[i11 + 1] && bytes[i11 + 1] <= 143 && 128 <= bytes[i11 + 2] && bytes[i11 + 2] <= 191 && 128 <= bytes[i11 + 3] && bytes[i11 + 3] <= 191
+ ) {
+ i11 += 4;
+ continue;
+ }
+ return false;
+ }
+ return true;
+ };
+ isBase64 = (stringArg) => {
+ const notBase64 = /[^A-Z0-9+\/=]/i;
+ const len = stringArg.length;
+ if (!len || len % 4 !== 0 || notBase64.test(stringArg)) {
+ return false;
+ }
+ const firstPaddingChar = stringArg.indexOf("=");
+ return firstPaddingChar === -1 || firstPaddingChar === len - 1 || firstPaddingChar === len - 2 && stringArg[len - 1] === "=";
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/smartstring.domain.js
+var Domain;
+var init_smartstring_domain = __esm({
+ "node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/smartstring.domain.js"() {
+ Domain = class {
+ constructor(domainStringArg) {
+ this.protocol = this._protocolRegex(domainStringArg);
+ if (!this.protocol) {
+ domainStringArg = `https://${domainStringArg}`;
+ }
+ this.nodeParsedUrl = new URL(domainStringArg);
+ this.port = this.nodeParsedUrl.port;
+ const regexMatches = this._domainRegex(domainStringArg.replace(this.nodeParsedUrl.pathname, ""));
+ this.fullName = "";
+ for (let i11 = 1; i11 <= 5; i11++) {
+ if (regexMatches[i11 - 1]) {
+ const localMatch = regexMatches[i11 - 1];
+ this["level" + i11.toString()] = localMatch;
+ if (this.fullName === "") {
+ this.fullName = localMatch;
+ } else {
+ this.fullName = localMatch + "." + this.fullName;
+ }
+ } else {
+ this["level" + i11.toString()] = void 0;
+ }
+ }
+ this.zoneName = this.level2 + "." + this.level1;
+ this.topLevel = this.level1;
+ this.domainName = this.level2;
+ this.subDomain = this.level3;
+ }
+ // helper functions
+ /** */
+ _domainRegex(stringArg) {
+ const regexString = /([a-zA-Z0-9\-\_]*)\.{0,1}([a-zA-Z0-9\-\_]*)\.{0,1}([a-zA-Z0-9\-\_]*)\.{0,1}([a-zA-Z0-9\-\_]*)\.{0,1}([a-zA-Z0-9\-\_]*)\.{0,1}$/;
+ const regexMatches = regexString.exec(stringArg);
+ regexMatches.reverse();
+ regexMatches.pop();
+ const regexMatchesFiltered = regexMatches.filter(function(stringArg2) {
+ return stringArg2 !== "";
+ });
+ return regexMatchesFiltered;
+ }
+ _protocolRegex(stringArg) {
+ const regexString = /^([a-zA-Z0-9]*):\/\//;
+ const regexMatches = regexString.exec(stringArg);
+ if (regexMatches) {
+ return regexMatches[1];
+ } else {
+ return void 0;
+ }
+ }
+ _portRegex(stringArg) {
+ const regexString = /^([a-zA-Z0-9]*):\/\//;
+ const regexMatches = regexString.exec(stringArg);
+ if (regexMatches) {
+ return regexMatches[1];
+ } else {
+ return void 0;
+ }
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/smartstring.git.js
+var GitRepo, gitRegex, gitLink;
+var init_smartstring_git = __esm({
+ "node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/smartstring.git.js"() {
+ init_smartstring_plugins();
+ GitRepo = class {
+ constructor(stringArg, tokenArg) {
+ let regexMatches = gitRegex(stringArg);
+ this.host = regexMatches[1];
+ this.user = regexMatches[2];
+ this.repo = regexMatches[3];
+ this.accessToken = tokenArg;
+ this.sshUrl = gitLink(this.host, this.user, this.repo, this.accessToken, "ssh");
+ this.httpsUrl = gitLink(this.host, this.user, this.repo, this.accessToken, "https");
+ }
+ };
+ gitRegex = function(stringArg) {
+ const regexString = /([a-zA-Z0-9\-_\.]*)(?:\/|\:)([a-zA-Z0-9\-_\.]*)(?:\/)([a-zA-Z0-9\-_\.]*)(?:\.git)/;
+ let regexMatches = regexString.exec(stringArg);
+ return regexMatches;
+ };
+ gitLink = function(hostArg, userArg, repoArg, tokenArg = "", linkTypeArg) {
+ let returnString;
+ if (tokenArg !== "") {
+ tokenArg = tokenArg + "@";
+ }
+ switch (linkTypeArg) {
+ case "https":
+ returnString = "https://" + tokenArg + hostArg + "/" + userArg + "/" + repoArg + ".git";
+ break;
+ case "ssh":
+ returnString = "git@" + hostArg + ":" + userArg + "/" + repoArg + ".git";
+ break;
+ default:
+ console.error("Link Type " + linkTypeArg + " not known");
+ break;
+ }
+ return returnString;
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/index.js
+var dist_ts_exports11 = {};
+__export(dist_ts_exports11, {
+ Base64: () => Base64,
+ Domain: () => Domain,
+ GitRepo: () => GitRepo,
+ base64: () => base64,
+ create: () => smartstring_create_exports,
+ docker: () => smartstring_docker_exports,
+ indent: () => smartstring_indent_exports,
+ normalize: () => smartstring_normalize_exports,
+ type: () => smartstring_type_exports
+});
+var init_dist_ts11 = __esm({
+ "node_modules/.pnpm/@push.rocks+smartstring@4.1.0/node_modules/@push.rocks/smartstring/dist_ts/index.js"() {
+ init_smartstring_create();
+ init_smartstring_docker();
+ init_smartstring_indent();
+ init_smartstring_normalize();
+ init_smartstring_type();
+ init_smartstring_base64();
+ init_smartstring_domain();
+ init_smartstring_git();
+ }
+});
+
+// node_modules/.pnpm/lodash.clonedeep@4.5.0/node_modules/lodash.clonedeep/index.js
+var require_lodash = __commonJS({
+ "node_modules/.pnpm/lodash.clonedeep@4.5.0/node_modules/lodash.clonedeep/index.js"(exports, module) {
+ var LARGE_ARRAY_SIZE = 200;
+ var HASH_UNDEFINED = "__lodash_hash_undefined__";
+ var MAX_SAFE_INTEGER = 9007199254740991;
+ var argsTag = "[object Arguments]", arrayTag = "[object Array]", boolTag = "[object Boolean]", dateTag = "[object Date]", errorTag = "[object Error]", funcTag = "[object Function]", genTag = "[object GeneratorFunction]", mapTag = "[object Map]", numberTag = "[object Number]", objectTag = "[object Object]", promiseTag = "[object Promise]", regexpTag = "[object RegExp]", setTag = "[object Set]", stringTag = "[object String]", symbolTag = "[object Symbol]", weakMapTag = "[object WeakMap]";
+ var arrayBufferTag = "[object ArrayBuffer]", dataViewTag = "[object DataView]", float32Tag = "[object Float32Array]", float64Tag = "[object Float64Array]", int8Tag = "[object Int8Array]", int16Tag = "[object Int16Array]", int32Tag = "[object Int32Array]", uint8Tag = "[object Uint8Array]", uint8ClampedTag = "[object Uint8ClampedArray]", uint16Tag = "[object Uint16Array]", uint32Tag = "[object Uint32Array]";
+ var reRegExpChar = /[\\^$.*+?()[\]{}|]/g;
+ var reFlags = /\w*$/;
+ var reIsHostCtor = /^\[object .+?Constructor\]$/;
+ var reIsUint = /^(?:0|[1-9]\d*)$/;
+ var cloneableTags = {};
+ cloneableTags[argsTag] = cloneableTags[arrayTag] = cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] = cloneableTags[boolTag] = cloneableTags[dateTag] = cloneableTags[float32Tag] = cloneableTags[float64Tag] = cloneableTags[int8Tag] = cloneableTags[int16Tag] = cloneableTags[int32Tag] = cloneableTags[mapTag] = cloneableTags[numberTag] = cloneableTags[objectTag] = cloneableTags[regexpTag] = cloneableTags[setTag] = cloneableTags[stringTag] = cloneableTags[symbolTag] = cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true;
+ cloneableTags[errorTag] = cloneableTags[funcTag] = cloneableTags[weakMapTag] = false;
+ var freeGlobal = typeof global == "object" && global && global.Object === Object && global;
+ var freeSelf = typeof self == "object" && self && self.Object === Object && self;
+ var root6 = freeGlobal || freeSelf || Function("return this")();
+ var freeExports = typeof exports == "object" && exports && !exports.nodeType && exports;
+ var freeModule = freeExports && typeof module == "object" && module && !module.nodeType && module;
+ var moduleExports = freeModule && freeModule.exports === freeExports;
+ function addMapEntry(map7, pair) {
+ map7.set(pair[0], pair[1]);
+ return map7;
+ }
+ function addSetEntry(set3, value2) {
+ set3.add(value2);
+ return set3;
+ }
+ function arrayEach(array, iteratee) {
+ var index2 = -1, length = array ? array.length : 0;
+ while (++index2 < length) {
+ if (iteratee(array[index2], index2, array) === false) {
+ break;
+ }
+ }
+ return array;
+ }
+ function arrayPush(array, values) {
+ var index2 = -1, length = values.length, offset = array.length;
+ while (++index2 < length) {
+ array[offset + index2] = values[index2];
+ }
+ return array;
+ }
+ function arrayReduce(array, iteratee, accumulator, initAccum) {
+ var index2 = -1, length = array ? array.length : 0;
+ if (initAccum && length) {
+ accumulator = array[++index2];
+ }
+ while (++index2 < length) {
+ accumulator = iteratee(accumulator, array[index2], index2, array);
+ }
+ return accumulator;
+ }
+ function baseTimes(n12, iteratee) {
+ var index2 = -1, result = Array(n12);
+ while (++index2 < n12) {
+ result[index2] = iteratee(index2);
+ }
+ return result;
+ }
+ function getValue(object, key2) {
+ return object == null ? void 0 : object[key2];
+ }
+ function isHostObject(value2) {
+ var result = false;
+ if (value2 != null && typeof value2.toString != "function") {
+ try {
+ result = !!(value2 + "");
+ } catch (e11) {
+ }
+ }
+ return result;
+ }
+ function mapToArray(map7) {
+ var index2 = -1, result = Array(map7.size);
+ map7.forEach(function(value2, key2) {
+ result[++index2] = [key2, value2];
+ });
+ return result;
+ }
+ function overArg(func, transform2) {
+ return function(arg) {
+ return func(transform2(arg));
+ };
+ }
+ function setToArray(set3) {
+ var index2 = -1, result = Array(set3.size);
+ set3.forEach(function(value2) {
+ result[++index2] = value2;
+ });
+ return result;
+ }
+ var arrayProto = Array.prototype, funcProto = Function.prototype, objectProto = Object.prototype;
+ var coreJsData = root6["__core-js_shared__"];
+ var maskSrcKey = (function() {
+ var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || "");
+ return uid ? "Symbol(src)_1." + uid : "";
+ })();
+ var funcToString = funcProto.toString;
+ var hasOwnProperty3 = objectProto.hasOwnProperty;
+ var objectToString2 = objectProto.toString;
+ var reIsNative = RegExp(
+ "^" + funcToString.call(hasOwnProperty3).replace(reRegExpChar, "\\$&").replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, "$1.*?") + "$"
+ );
+ var Buffer2 = moduleExports ? root6.Buffer : void 0, Symbol2 = root6.Symbol, Uint8Array2 = root6.Uint8Array, getPrototype = overArg(Object.getPrototypeOf, Object), objectCreate = Object.create, propertyIsEnumerable = objectProto.propertyIsEnumerable, splice2 = arrayProto.splice;
+ var nativeGetSymbols = Object.getOwnPropertySymbols, nativeIsBuffer = Buffer2 ? Buffer2.isBuffer : void 0, nativeKeys = overArg(Object.keys, Object);
+ var DataView2 = getNative(root6, "DataView"), Map2 = getNative(root6, "Map"), Promise2 = getNative(root6, "Promise"), Set2 = getNative(root6, "Set"), WeakMap2 = getNative(root6, "WeakMap"), nativeCreate = getNative(Object, "create");
+ var dataViewCtorString = toSource(DataView2), mapCtorString = toSource(Map2), promiseCtorString = toSource(Promise2), setCtorString = toSource(Set2), weakMapCtorString = toSource(WeakMap2);
+ var symbolProto = Symbol2 ? Symbol2.prototype : void 0, symbolValueOf = symbolProto ? symbolProto.valueOf : void 0;
+ function Hash(entries) {
+ var index2 = -1, length = entries ? entries.length : 0;
+ this.clear();
+ while (++index2 < length) {
+ var entry = entries[index2];
+ this.set(entry[0], entry[1]);
+ }
+ }
+ function hashClear() {
+ this.__data__ = nativeCreate ? nativeCreate(null) : {};
+ }
+ function hashDelete(key2) {
+ return this.has(key2) && delete this.__data__[key2];
+ }
+ function hashGet(key2) {
+ var data8 = this.__data__;
+ if (nativeCreate) {
+ var result = data8[key2];
+ return result === HASH_UNDEFINED ? void 0 : result;
+ }
+ return hasOwnProperty3.call(data8, key2) ? data8[key2] : void 0;
+ }
+ function hashHas(key2) {
+ var data8 = this.__data__;
+ return nativeCreate ? data8[key2] !== void 0 : hasOwnProperty3.call(data8, key2);
+ }
+ function hashSet(key2, value2) {
+ var data8 = this.__data__;
+ data8[key2] = nativeCreate && value2 === void 0 ? HASH_UNDEFINED : value2;
+ return this;
+ }
+ Hash.prototype.clear = hashClear;
+ Hash.prototype["delete"] = hashDelete;
+ Hash.prototype.get = hashGet;
+ Hash.prototype.has = hashHas;
+ Hash.prototype.set = hashSet;
+ function ListCache(entries) {
+ var index2 = -1, length = entries ? entries.length : 0;
+ this.clear();
+ while (++index2 < length) {
+ var entry = entries[index2];
+ this.set(entry[0], entry[1]);
+ }
+ }
+ function listCacheClear() {
+ this.__data__ = [];
+ }
+ function listCacheDelete(key2) {
+ var data8 = this.__data__, index2 = assocIndexOf(data8, key2);
+ if (index2 < 0) {
+ return false;
+ }
+ var lastIndex = data8.length - 1;
+ if (index2 == lastIndex) {
+ data8.pop();
+ } else {
+ splice2.call(data8, index2, 1);
+ }
+ return true;
+ }
+ function listCacheGet(key2) {
+ var data8 = this.__data__, index2 = assocIndexOf(data8, key2);
+ return index2 < 0 ? void 0 : data8[index2][1];
+ }
+ function listCacheHas(key2) {
+ return assocIndexOf(this.__data__, key2) > -1;
+ }
+ function listCacheSet(key2, value2) {
+ var data8 = this.__data__, index2 = assocIndexOf(data8, key2);
+ if (index2 < 0) {
+ data8.push([key2, value2]);
+ } else {
+ data8[index2][1] = value2;
+ }
+ return this;
+ }
+ ListCache.prototype.clear = listCacheClear;
+ ListCache.prototype["delete"] = listCacheDelete;
+ ListCache.prototype.get = listCacheGet;
+ ListCache.prototype.has = listCacheHas;
+ ListCache.prototype.set = listCacheSet;
+ function MapCache(entries) {
+ var index2 = -1, length = entries ? entries.length : 0;
+ this.clear();
+ while (++index2 < length) {
+ var entry = entries[index2];
+ this.set(entry[0], entry[1]);
+ }
+ }
+ function mapCacheClear() {
+ this.__data__ = {
+ "hash": new Hash(),
+ "map": new (Map2 || ListCache)(),
+ "string": new Hash()
+ };
+ }
+ function mapCacheDelete(key2) {
+ return getMapData(this, key2)["delete"](key2);
+ }
+ function mapCacheGet(key2) {
+ return getMapData(this, key2).get(key2);
+ }
+ function mapCacheHas(key2) {
+ return getMapData(this, key2).has(key2);
+ }
+ function mapCacheSet(key2, value2) {
+ getMapData(this, key2).set(key2, value2);
+ return this;
+ }
+ MapCache.prototype.clear = mapCacheClear;
+ MapCache.prototype["delete"] = mapCacheDelete;
+ MapCache.prototype.get = mapCacheGet;
+ MapCache.prototype.has = mapCacheHas;
+ MapCache.prototype.set = mapCacheSet;
+ function Stack(entries) {
+ this.__data__ = new ListCache(entries);
+ }
+ function stackClear() {
+ this.__data__ = new ListCache();
+ }
+ function stackDelete(key2) {
+ return this.__data__["delete"](key2);
+ }
+ function stackGet(key2) {
+ return this.__data__.get(key2);
+ }
+ function stackHas(key2) {
+ return this.__data__.has(key2);
+ }
+ function stackSet(key2, value2) {
+ var cache = this.__data__;
+ if (cache instanceof ListCache) {
+ var pairs2 = cache.__data__;
+ if (!Map2 || pairs2.length < LARGE_ARRAY_SIZE - 1) {
+ pairs2.push([key2, value2]);
+ return this;
+ }
+ cache = this.__data__ = new MapCache(pairs2);
+ }
+ cache.set(key2, value2);
+ return this;
+ }
+ Stack.prototype.clear = stackClear;
+ Stack.prototype["delete"] = stackDelete;
+ Stack.prototype.get = stackGet;
+ Stack.prototype.has = stackHas;
+ Stack.prototype.set = stackSet;
+ function arrayLikeKeys(value2, inherited) {
+ var result = isArray4(value2) || isArguments(value2) ? baseTimes(value2.length, String) : [];
+ var length = result.length, skipIndexes = !!length;
+ for (var key2 in value2) {
+ if ((inherited || hasOwnProperty3.call(value2, key2)) && !(skipIndexes && (key2 == "length" || isIndex(key2, length)))) {
+ result.push(key2);
+ }
+ }
+ return result;
+ }
+ function assignValue(object, key2, value2) {
+ var objValue = object[key2];
+ if (!(hasOwnProperty3.call(object, key2) && eq(objValue, value2)) || value2 === void 0 && !(key2 in object)) {
+ object[key2] = value2;
+ }
+ }
+ function assocIndexOf(array, key2) {
+ var length = array.length;
+ while (length--) {
+ if (eq(array[length][0], key2)) {
+ return length;
+ }
+ }
+ return -1;
+ }
+ function baseAssign(object, source) {
+ return object && copyObject(source, keys2(source), object);
+ }
+ function baseClone(value2, isDeep, isFull, customizer, key2, object, stack) {
+ var result;
+ if (customizer) {
+ result = object ? customizer(value2, key2, object, stack) : customizer(value2);
+ }
+ if (result !== void 0) {
+ return result;
+ }
+ if (!isObject4(value2)) {
+ return value2;
+ }
+ var isArr = isArray4(value2);
+ if (isArr) {
+ result = initCloneArray(value2);
+ if (!isDeep) {
+ return copyArray(value2, result);
+ }
+ } else {
+ var tag = getTag(value2), isFunc = tag == funcTag || tag == genTag;
+ if (isBuffer(value2)) {
+ return cloneBuffer(value2, isDeep);
+ }
+ if (tag == objectTag || tag == argsTag || isFunc && !object) {
+ if (isHostObject(value2)) {
+ return object ? value2 : {};
+ }
+ result = initCloneObject(isFunc ? {} : value2);
+ if (!isDeep) {
+ return copySymbols(value2, baseAssign(result, value2));
+ }
+ } else {
+ if (!cloneableTags[tag]) {
+ return object ? value2 : {};
+ }
+ result = initCloneByTag(value2, tag, baseClone, isDeep);
+ }
+ }
+ stack || (stack = new Stack());
+ var stacked = stack.get(value2);
+ if (stacked) {
+ return stacked;
+ }
+ stack.set(value2, result);
+ if (!isArr) {
+ var props = isFull ? getAllKeys(value2) : keys2(value2);
+ }
+ arrayEach(props || value2, function(subValue, key3) {
+ if (props) {
+ key3 = subValue;
+ subValue = value2[key3];
+ }
+ assignValue(result, key3, baseClone(subValue, isDeep, isFull, customizer, key3, value2, stack));
+ });
+ return result;
+ }
+ function baseCreate(proto) {
+ return isObject4(proto) ? objectCreate(proto) : {};
+ }
+ function baseGetAllKeys(object, keysFunc, symbolsFunc) {
+ var result = keysFunc(object);
+ return isArray4(object) ? result : arrayPush(result, symbolsFunc(object));
+ }
+ function baseGetTag(value2) {
+ return objectToString2.call(value2);
+ }
+ function baseIsNative(value2) {
+ if (!isObject4(value2) || isMasked(value2)) {
+ return false;
+ }
+ var pattern = isFunction2(value2) || isHostObject(value2) ? reIsNative : reIsHostCtor;
+ return pattern.test(toSource(value2));
+ }
+ function baseKeys(object) {
+ if (!isPrototype(object)) {
+ return nativeKeys(object);
+ }
+ var result = [];
+ for (var key2 in Object(object)) {
+ if (hasOwnProperty3.call(object, key2) && key2 != "constructor") {
+ result.push(key2);
+ }
+ }
+ return result;
+ }
+ function cloneBuffer(buffer2, isDeep) {
+ if (isDeep) {
+ return buffer2.slice();
+ }
+ var result = new buffer2.constructor(buffer2.length);
+ buffer2.copy(result);
+ return result;
+ }
+ function cloneArrayBuffer(arrayBuffer) {
+ var result = new arrayBuffer.constructor(arrayBuffer.byteLength);
+ new Uint8Array2(result).set(new Uint8Array2(arrayBuffer));
+ return result;
+ }
+ function cloneDataView(dataView, isDeep) {
+ var buffer2 = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer;
+ return new dataView.constructor(buffer2, dataView.byteOffset, dataView.byteLength);
+ }
+ function cloneMap(map7, isDeep, cloneFunc) {
+ var array = isDeep ? cloneFunc(mapToArray(map7), true) : mapToArray(map7);
+ return arrayReduce(array, addMapEntry, new map7.constructor());
+ }
+ function cloneRegExp(regexp) {
+ var result = new regexp.constructor(regexp.source, reFlags.exec(regexp));
+ result.lastIndex = regexp.lastIndex;
+ return result;
+ }
+ function cloneSet(set3, isDeep, cloneFunc) {
+ var array = isDeep ? cloneFunc(setToArray(set3), true) : setToArray(set3);
+ return arrayReduce(array, addSetEntry, new set3.constructor());
+ }
+ function cloneSymbol(symbol) {
+ return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {};
+ }
+ function cloneTypedArray(typedArray, isDeep) {
+ var buffer2 = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer;
+ return new typedArray.constructor(buffer2, typedArray.byteOffset, typedArray.length);
+ }
+ function copyArray(source, array) {
+ var index2 = -1, length = source.length;
+ array || (array = Array(length));
+ while (++index2 < length) {
+ array[index2] = source[index2];
+ }
+ return array;
+ }
+ function copyObject(source, props, object, customizer) {
+ object || (object = {});
+ var index2 = -1, length = props.length;
+ while (++index2 < length) {
+ var key2 = props[index2];
+ var newValue = customizer ? customizer(object[key2], source[key2], key2, object, source) : void 0;
+ assignValue(object, key2, newValue === void 0 ? source[key2] : newValue);
+ }
+ return object;
+ }
+ function copySymbols(source, object) {
+ return copyObject(source, getSymbols(source), object);
+ }
+ function getAllKeys(object) {
+ return baseGetAllKeys(object, keys2, getSymbols);
+ }
+ function getMapData(map7, key2) {
+ var data8 = map7.__data__;
+ return isKeyable(key2) ? data8[typeof key2 == "string" ? "string" : "hash"] : data8.map;
+ }
+ function getNative(object, key2) {
+ var value2 = getValue(object, key2);
+ return baseIsNative(value2) ? value2 : void 0;
+ }
+ var getSymbols = nativeGetSymbols ? overArg(nativeGetSymbols, Object) : stubArray;
+ var getTag = baseGetTag;
+ if (DataView2 && getTag(new DataView2(new ArrayBuffer(1))) != dataViewTag || Map2 && getTag(new Map2()) != mapTag || Promise2 && getTag(Promise2.resolve()) != promiseTag || Set2 && getTag(new Set2()) != setTag || WeakMap2 && getTag(new WeakMap2()) != weakMapTag) {
+ getTag = function(value2) {
+ var result = objectToString2.call(value2), Ctor = result == objectTag ? value2.constructor : void 0, ctorString = Ctor ? toSource(Ctor) : void 0;
+ if (ctorString) {
+ switch (ctorString) {
+ case dataViewCtorString:
+ return dataViewTag;
+ case mapCtorString:
+ return mapTag;
+ case promiseCtorString:
+ return promiseTag;
+ case setCtorString:
+ return setTag;
+ case weakMapCtorString:
+ return weakMapTag;
+ }
+ }
+ return result;
+ };
+ }
+ function initCloneArray(array) {
+ var length = array.length, result = array.constructor(length);
+ if (length && typeof array[0] == "string" && hasOwnProperty3.call(array, "index")) {
+ result.index = array.index;
+ result.input = array.input;
+ }
+ return result;
+ }
+ function initCloneObject(object) {
+ return typeof object.constructor == "function" && !isPrototype(object) ? baseCreate(getPrototype(object)) : {};
+ }
+ function initCloneByTag(object, tag, cloneFunc, isDeep) {
+ var Ctor = object.constructor;
+ switch (tag) {
+ case arrayBufferTag:
+ return cloneArrayBuffer(object);
+ case boolTag:
+ case dateTag:
+ return new Ctor(+object);
+ case dataViewTag:
+ return cloneDataView(object, isDeep);
+ case float32Tag:
+ case float64Tag:
+ case int8Tag:
+ case int16Tag:
+ case int32Tag:
+ case uint8Tag:
+ case uint8ClampedTag:
+ case uint16Tag:
+ case uint32Tag:
+ return cloneTypedArray(object, isDeep);
+ case mapTag:
+ return cloneMap(object, isDeep, cloneFunc);
+ case numberTag:
+ case stringTag:
+ return new Ctor(object);
+ case regexpTag:
+ return cloneRegExp(object);
+ case setTag:
+ return cloneSet(object, isDeep, cloneFunc);
+ case symbolTag:
+ return cloneSymbol(object);
+ }
+ }
+ function isIndex(value2, length) {
+ length = length == null ? MAX_SAFE_INTEGER : length;
+ return !!length && (typeof value2 == "number" || reIsUint.test(value2)) && (value2 > -1 && value2 % 1 == 0 && value2 < length);
+ }
+ function isKeyable(value2) {
+ var type5 = typeof value2;
+ return type5 == "string" || type5 == "number" || type5 == "symbol" || type5 == "boolean" ? value2 !== "__proto__" : value2 === null;
+ }
+ function isMasked(func) {
+ return !!maskSrcKey && maskSrcKey in func;
+ }
+ function isPrototype(value2) {
+ var Ctor = value2 && value2.constructor, proto = typeof Ctor == "function" && Ctor.prototype || objectProto;
+ return value2 === proto;
+ }
+ function toSource(func) {
+ if (func != null) {
+ try {
+ return funcToString.call(func);
+ } catch (e11) {
+ }
+ try {
+ return func + "";
+ } catch (e11) {
+ }
+ }
+ return "";
+ }
+ function cloneDeep(value2) {
+ return baseClone(value2, true, true);
+ }
+ function eq(value2, other) {
+ return value2 === other || value2 !== value2 && other !== other;
+ }
+ function isArguments(value2) {
+ return isArrayLikeObject(value2) && hasOwnProperty3.call(value2, "callee") && (!propertyIsEnumerable.call(value2, "callee") || objectToString2.call(value2) == argsTag);
+ }
+ var isArray4 = Array.isArray;
+ function isArrayLike2(value2) {
+ return value2 != null && isLength(value2.length) && !isFunction2(value2);
+ }
+ function isArrayLikeObject(value2) {
+ return isObjectLike(value2) && isArrayLike2(value2);
+ }
+ var isBuffer = nativeIsBuffer || stubFalse;
+ function isFunction2(value2) {
+ var tag = isObject4(value2) ? objectToString2.call(value2) : "";
+ return tag == funcTag || tag == genTag;
+ }
+ function isLength(value2) {
+ return typeof value2 == "number" && value2 > -1 && value2 % 1 == 0 && value2 <= MAX_SAFE_INTEGER;
+ }
+ function isObject4(value2) {
+ var type5 = typeof value2;
+ return !!value2 && (type5 == "object" || type5 == "function");
+ }
+ function isObjectLike(value2) {
+ return !!value2 && typeof value2 == "object";
+ }
+ function keys2(object) {
+ return isArrayLike2(object) ? arrayLikeKeys(object) : baseKeys(object);
+ }
+ function stubArray() {
+ return [];
+ }
+ function stubFalse() {
+ return false;
+ }
+ module.exports = cloneDeep;
+ }
+});
+
+// node_modules/.pnpm/fast-json-stable-stringify@2.1.0/node_modules/fast-json-stable-stringify/index.js
+var require_fast_json_stable_stringify = __commonJS({
+ "node_modules/.pnpm/fast-json-stable-stringify@2.1.0/node_modules/fast-json-stable-stringify/index.js"(exports, module) {
+ "use strict";
+ module.exports = function(data8, opts) {
+ if (!opts) opts = {};
+ if (typeof opts === "function") opts = { cmp: opts };
+ var cycles = typeof opts.cycles === "boolean" ? opts.cycles : false;
+ var cmp = opts.cmp && /* @__PURE__ */ (function(f7) {
+ return function(node2) {
+ return function(a5, b5) {
+ var aobj = { key: a5, value: node2[a5] };
+ var bobj = { key: b5, value: node2[b5] };
+ return f7(aobj, bobj);
+ };
+ };
+ })(opts.cmp);
+ var seen = [];
+ return (function stringify7(node2) {
+ if (node2 && node2.toJSON && typeof node2.toJSON === "function") {
+ node2 = node2.toJSON();
+ }
+ if (node2 === void 0) return;
+ if (typeof node2 == "number") return isFinite(node2) ? "" + node2 : "null";
+ if (typeof node2 !== "object") return JSON.stringify(node2);
+ var i11, out;
+ if (Array.isArray(node2)) {
+ out = "[";
+ for (i11 = 0; i11 < node2.length; i11++) {
+ if (i11) out += ",";
+ out += stringify7(node2[i11]) || "null";
+ }
+ return out + "]";
+ }
+ if (node2 === null) return "null";
+ if (seen.indexOf(node2) !== -1) {
+ if (cycles) return JSON.stringify("__cycle__");
+ throw new TypeError("Converting circular structure to JSON");
+ }
+ var seenIndex = seen.push(node2) - 1;
+ var keys2 = Object.keys(node2).sort(cmp && cmp(node2));
+ out = "";
+ for (i11 = 0; i11 < keys2.length; i11++) {
+ var key2 = keys2[i11];
+ var value2 = stringify7(node2[key2]);
+ if (!value2) continue;
+ if (out) out += ",";
+ out += JSON.stringify(key2) + ":" + value2;
+ }
+ seen.splice(seenIndex, 1);
+ return "{" + out + "}";
+ })(data8);
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartjson@5.2.0/node_modules/@push.rocks/smartjson/dist_ts/smartjson.plugins.js
+var import_lodash, import_fast_json_stable_stringify, stableJson;
+var init_smartjson_plugins = __esm({
+ "node_modules/.pnpm/@push.rocks+smartjson@5.2.0/node_modules/@push.rocks/smartjson/dist_ts/smartjson.plugins.js"() {
+ init_dist_ts10();
+ init_dist_ts11();
+ import_lodash = __toESM(require_lodash(), 1);
+ import_fast_json_stable_stringify = __toESM(require_fast_json_stable_stringify(), 1);
+ stableJson = import_fast_json_stable_stringify.default;
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartjson@5.2.0/node_modules/@push.rocks/smartjson/dist_ts/bufferhandling.js
+function base64Encode(data8) {
+ if (typeof Buffer !== "undefined") {
+ return Buffer.from(data8).toString("base64");
+ }
+ return btoa(String.fromCharCode(...data8));
+}
+function base64Decode(str) {
+ if (typeof Buffer !== "undefined") {
+ const buf = Buffer.from(str, "base64");
+ return new Uint8Array(buf.buffer, buf.byteOffset, buf.byteLength);
+ }
+ return new Uint8Array(Array.from(atob(str)).map((char) => char.charCodeAt(0)));
+}
+function stringify(value2, space2) {
+ return JSON.stringify(value2, replacer, space2);
+}
+function parse2(text9) {
+ return JSON.parse(text9, reviver);
+}
+function isEncodedBuffer(x4) {
+ return isObject(x4) && x4.type === "EncodedBuffer" && isString(x4.data);
+}
+function isBufferLike2(x4) {
+ return isObject(x4) && (x4.type === "Buffer" && (isArray2(x4.data) || isString(x4.data))) || x4 instanceof Uint8Array;
+}
+function isArray2(x4) {
+ return Array.isArray(x4);
+}
+function isString(x4) {
+ return typeof x4 === "string";
+}
+function isObject(x4) {
+ return typeof x4 === "object" && x4 !== null;
+}
+var replacer, reviver;
+var init_bufferhandling = __esm({
+ "node_modules/.pnpm/@push.rocks+smartjson@5.2.0/node_modules/@push.rocks/smartjson/dist_ts/bufferhandling.js"() {
+ init_smartjson_plugins();
+ replacer = (key2, value2) => {
+ if (isBufferLike2(value2)) {
+ let bufferData;
+ if ("data" in value2 && isArray2(value2.data)) {
+ bufferData = new Uint8Array(value2.data);
+ } else if (value2 instanceof Uint8Array) {
+ bufferData = value2;
+ } else {
+ return value2;
+ }
+ const base64Data = "base64:" + base64Encode(bufferData);
+ return {
+ type: "EncodedBuffer",
+ data: base64Data
+ };
+ }
+ return value2;
+ };
+ reviver = (key2, value2) => {
+ if (isEncodedBuffer(value2)) {
+ if (isString(value2.data) && value2.data.startsWith("base64:")) {
+ const base64Data = value2.data.slice(7);
+ const buffer2 = base64Decode(base64Data);
+ return buffer2;
+ }
+ }
+ return value2;
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartjson@5.2.0/node_modules/@push.rocks/smartjson/dist_ts/index.js
+var dist_ts_exports12 = {};
+__export(dist_ts_exports12, {
+ Smartjson: () => Smartjson,
+ deepEqualJsonLStrings: () => deepEqualJsonLStrings,
+ deepEqualObjects: () => deepEqualObjects,
+ foldDec: () => foldDec,
+ parse: () => parse3,
+ parseBase64: () => parseBase64,
+ parseJsonL: () => parseJsonL,
+ stableOneWayStringify: () => stableOneWayStringify,
+ stringify: () => stringify2,
+ stringifyBase64: () => stringifyBase64,
+ stringifyJsonL: () => stringifyJsonL,
+ stringifyPretty: () => stringifyPretty
+});
+var parse3, parseJsonL, stringifyJsonL, stableOneWayStringify, stringify2, stringifyPretty, stringifyBase64, parseBase64, Smartjson, foldDec, deepEqualObjects, deepEqualJsonLStrings;
+var init_dist_ts12 = __esm({
+ "node_modules/.pnpm/@push.rocks+smartjson@5.2.0/node_modules/@push.rocks/smartjson/dist_ts/index.js"() {
+ init_smartjson_plugins();
+ init_bufferhandling();
+ parse3 = parse2;
+ parseJsonL = (jsonlData) => {
+ const lines = jsonlData.split("\n");
+ const parsedData = lines.reduce((acc, line) => {
+ const trimmed = line.trim();
+ if (trimmed.length > 0) {
+ acc.push(parse3(trimmed));
+ }
+ return acc;
+ }, []);
+ return parsedData;
+ };
+ stringifyJsonL = (items) => {
+ return items.map((item) => stringify2(item)).join("\n");
+ };
+ stableOneWayStringify = (objArg, simpleOrderArray, optionsArg = {}) => {
+ const visited = /* @__PURE__ */ new WeakSet();
+ const sanitize2 = (val) => {
+ if (val === null || typeof val !== "object") {
+ return val;
+ }
+ const replaced = replacer("", val);
+ if (replaced && replaced.type === "EncodedBuffer" && typeof replaced.data === "string") {
+ return replaced;
+ }
+ if (visited.has(val)) {
+ return "__cycle__";
+ }
+ visited.add(val);
+ if (Array.isArray(val)) {
+ return val.map((item) => sanitize2(item));
+ }
+ const out = {};
+ for (const key2 of Object.keys(val)) {
+ try {
+ out[key2] = sanitize2(val[key2]);
+ } catch (e11) {
+ out[key2] = "__unserializable__";
+ }
+ }
+ return out;
+ };
+ const obj = sanitize2(objArg);
+ const options = {
+ ...optionsArg,
+ cycles: true
+ };
+ if (simpleOrderArray && !options.cmp) {
+ const order2 = /* @__PURE__ */ new Map();
+ simpleOrderArray.forEach((key2, idx) => order2.set(key2, idx));
+ options.cmp = (a5, b5) => {
+ const aIdx = order2.has(a5.key) ? order2.get(a5.key) : Number.POSITIVE_INFINITY;
+ const bIdx = order2.has(b5.key) ? order2.get(b5.key) : Number.POSITIVE_INFINITY;
+ if (aIdx !== bIdx)
+ return aIdx - bIdx;
+ return a5.key < b5.key ? -1 : a5.key > b5.key ? 1 : 0;
+ };
+ }
+ return stableJson(obj, options);
+ };
+ stringify2 = (objArg, simpleOrderArray, optionsArg = {}) => {
+ const bufferedJson = stringify(objArg);
+ objArg = JSON.parse(bufferedJson);
+ let options = { ...optionsArg };
+ if (simpleOrderArray && !options.cmp) {
+ const order2 = /* @__PURE__ */ new Map();
+ simpleOrderArray.forEach((key2, idx) => order2.set(key2, idx));
+ options.cmp = (a5, b5) => {
+ const aIdx = order2.has(a5.key) ? order2.get(a5.key) : Number.POSITIVE_INFINITY;
+ const bIdx = order2.has(b5.key) ? order2.get(b5.key) : Number.POSITIVE_INFINITY;
+ if (aIdx !== bIdx)
+ return aIdx - bIdx;
+ return a5.key < b5.key ? -1 : a5.key > b5.key ? 1 : 0;
+ };
+ }
+ let returnJson = stableJson(objArg, options);
+ return returnJson;
+ };
+ stringifyPretty = (objectArg) => {
+ const stringified = stringify2(objectArg);
+ const object = JSON.parse(stringified);
+ return JSON.stringify(object, null, 2);
+ };
+ stringifyBase64 = (...args) => {
+ const stringifiedResult = stringify2(...args);
+ return dist_ts_exports11.base64.encodeUri(stringifiedResult);
+ };
+ parseBase64 = (base64JsonStringArg) => {
+ const base642 = dist_ts_exports11.base64;
+ const decodeFn = base642.decodeUri || base642.decode;
+ const simpleStringified = decodeFn(base64JsonStringArg);
+ return parse3(simpleStringified);
+ };
+ Smartjson = class _Smartjson {
+ /**
+ * enfolds data from an object
+ */
+ static enfoldFromObject(objectArg) {
+ const newInstance = new this();
+ const saveables = newInstance.saveableProperties || [];
+ for (const keyName in objectArg) {
+ if (saveables.indexOf(keyName) !== -1) {
+ newInstance[keyName] = objectArg[keyName];
+ }
+ }
+ return newInstance;
+ }
+ /**
+ * enfold from json
+ */
+ static enfoldFromJson(jsonArg) {
+ const objectFromJson = parse3(jsonArg);
+ return this.enfoldFromObject(objectFromJson);
+ }
+ /**
+ * folds a class into an object
+ */
+ foldToObject() {
+ const trackSet = /* @__PURE__ */ new Set();
+ trackSet.add(this);
+ return this.foldToObjectInternal(trackSet);
+ }
+ foldToObjectInternal(trackSet) {
+ const result = {};
+ const foldValue = (val) => {
+ if (val instanceof _Smartjson) {
+ if (trackSet.has(val)) {
+ throw new Error("cycle detected");
+ }
+ trackSet.add(val);
+ return val.foldToObjectInternal(trackSet);
+ }
+ if (Array.isArray(val)) {
+ return val.map((item) => foldValue(item));
+ }
+ return import_lodash.default(val);
+ };
+ const props = this.saveableProperties || [];
+ for (const keyName of props) {
+ const value2 = this[keyName];
+ result[keyName] = foldValue(value2);
+ }
+ return result;
+ }
+ /**
+ * folds a class into an object
+ */
+ foldToJson() {
+ const foldedObject = this.foldToObject();
+ return stringify2(foldedObject);
+ }
+ };
+ foldDec = () => {
+ return (target, key2) => {
+ if (!target.saveableProperties) {
+ target.saveableProperties = [];
+ }
+ target.saveableProperties.push(key2);
+ };
+ };
+ deepEqualObjects = (object1, object2) => {
+ const object1String = stringify2(object1);
+ const object2String = stringify2(object2);
+ return object1String === object2String;
+ };
+ deepEqualJsonLStrings = (jsonLString1, jsonLString2) => {
+ const firstArray = parseJsonL(jsonLString1);
+ const secondArray = parseJsonL(jsonLString2);
+ return deepEqualObjects(firstArray, secondArray);
+ };
+ }
+});
+
+// node_modules/.pnpm/@tempfix+idb@8.0.3/node_modules/@tempfix/idb/build/index.js
+var build_exports = {};
+__export(build_exports, {
+ deleteDB: () => deleteDB,
+ openDB: () => openDB,
+ unwrap: () => unwrap,
+ wrap: () => wrap
+});
+function getIdbProxyableTypes() {
+ return idbProxyableTypes || (idbProxyableTypes = [
+ IDBDatabase,
+ IDBObjectStore,
+ IDBIndex,
+ IDBCursor,
+ IDBTransaction
+ ]);
+}
+function getCursorAdvanceMethods() {
+ return cursorAdvanceMethods || (cursorAdvanceMethods = [
+ IDBCursor.prototype.advance,
+ IDBCursor.prototype.continue,
+ IDBCursor.prototype.continuePrimaryKey
+ ]);
+}
+function promisifyRequest(request) {
+ const promise = new Promise((resolve2, reject) => {
+ const unlisten = () => {
+ request.removeEventListener("success", success);
+ request.removeEventListener("error", error);
+ };
+ const success = () => {
+ resolve2(wrap(request.result));
+ unlisten();
+ };
+ const error = () => {
+ reject(request.error);
+ unlisten();
+ };
+ request.addEventListener("success", success);
+ request.addEventListener("error", error);
+ });
+ reverseTransformCache.set(promise, request);
+ return promise;
+}
+function cacheDonePromiseForTransaction(tx) {
+ if (transactionDoneMap.has(tx))
+ return;
+ const done = new Promise((resolve2, reject) => {
+ const unlisten = () => {
+ tx.removeEventListener("complete", complete);
+ tx.removeEventListener("error", error);
+ tx.removeEventListener("abort", error);
+ };
+ const complete = () => {
+ resolve2();
+ unlisten();
+ };
+ const error = () => {
+ reject(tx.error || new DOMException("AbortError", "AbortError"));
+ unlisten();
+ };
+ tx.addEventListener("complete", complete);
+ tx.addEventListener("error", error);
+ tx.addEventListener("abort", error);
+ });
+ transactionDoneMap.set(tx, done);
+}
+function replaceTraps(callback) {
+ idbProxyTraps = callback(idbProxyTraps);
+}
+function wrapFunction(func) {
+ if (getCursorAdvanceMethods().includes(func)) {
+ return function(...args) {
+ func.apply(unwrap(this), args);
+ return wrap(this.request);
+ };
+ }
+ return function(...args) {
+ return wrap(func.apply(unwrap(this), args));
+ };
+}
+function transformCachableValue(value2) {
+ if (typeof value2 === "function")
+ return wrapFunction(value2);
+ if (value2 instanceof IDBTransaction)
+ cacheDonePromiseForTransaction(value2);
+ if (instanceOfAny(value2, getIdbProxyableTypes()))
+ return new Proxy(value2, idbProxyTraps);
+ return value2;
+}
+function wrap(value2) {
+ if (value2 instanceof IDBRequest)
+ return promisifyRequest(value2);
+ if (transformCache.has(value2))
+ return transformCache.get(value2);
+ const newValue = transformCachableValue(value2);
+ if (newValue !== value2) {
+ transformCache.set(value2, newValue);
+ reverseTransformCache.set(newValue, value2);
+ }
+ return newValue;
+}
+function openDB(name, version2, { blocked, upgrade, blocking, terminated } = {}) {
+ const request = indexedDB.open(name, version2);
+ const openPromise = wrap(request);
+ if (upgrade) {
+ request.addEventListener("upgradeneeded", (event) => {
+ upgrade(wrap(request.result), event.oldVersion, event.newVersion, wrap(request.transaction), event);
+ });
+ }
+ if (blocked) {
+ request.addEventListener("blocked", (event) => blocked(
+ // Casting due to https://github.com/microsoft/TypeScript-DOM-lib-generator/pull/1405
+ event.oldVersion,
+ event.newVersion,
+ event
+ ));
+ }
+ openPromise.then((db) => {
+ if (terminated)
+ db.addEventListener("close", () => terminated());
+ if (blocking) {
+ db.addEventListener("versionchange", (event) => blocking(event.oldVersion, event.newVersion, event));
+ }
+ }).catch(() => {
+ });
+ return openPromise;
+}
+function deleteDB(name, { blocked } = {}) {
+ const request = indexedDB.deleteDatabase(name);
+ if (blocked) {
+ request.addEventListener("blocked", (event) => blocked(
+ // Casting due to https://github.com/microsoft/TypeScript-DOM-lib-generator/pull/1405
+ event.oldVersion,
+ event
+ ));
+ }
+ return wrap(request).then(() => void 0);
+}
+function getMethod(target, prop) {
+ if (!(target instanceof IDBDatabase && !(prop in target) && typeof prop === "string")) {
+ return;
+ }
+ if (cachedMethods.get(prop))
+ return cachedMethods.get(prop);
+ const targetFuncName = prop.replace(/FromIndex$/, "");
+ const useIndex = prop !== targetFuncName;
+ const isWrite = writeMethods.includes(targetFuncName);
+ if (
+ // Bail if the target doesn't exist on the target. Eg, getAll isn't in Edge.
+ !(targetFuncName in (useIndex ? IDBIndex : IDBObjectStore).prototype) || !(isWrite || readMethods.includes(targetFuncName))
+ ) {
+ return;
+ }
+ const method = async function(storeName, ...args) {
+ const tx = this.transaction(storeName, isWrite ? "readwrite" : "readonly");
+ let target2 = tx.store;
+ if (useIndex)
+ target2 = target2.index(args.shift());
+ return (await Promise.all([
+ target2[targetFuncName](...args),
+ isWrite && tx.done
+ ]))[0];
+ };
+ cachedMethods.set(prop, method);
+ return method;
+}
+async function* iterate(...args) {
+ let cursor = this;
+ if (!(cursor instanceof IDBCursor)) {
+ cursor = await cursor.openCursor(...args);
+ }
+ if (!cursor)
+ return;
+ cursor = cursor;
+ const proxiedCursor = new Proxy(cursor, cursorIteratorTraps);
+ ittrProxiedCursorToOriginalProxy.set(proxiedCursor, cursor);
+ reverseTransformCache.set(proxiedCursor, unwrap(cursor));
+ while (cursor) {
+ yield proxiedCursor;
+ cursor = await (advanceResults.get(proxiedCursor) || cursor.continue());
+ advanceResults.delete(proxiedCursor);
+ }
+}
+function isIteratorProp(target, prop) {
+ return prop === Symbol.asyncIterator && instanceOfAny(target, [IDBIndex, IDBObjectStore, IDBCursor]) || prop === "iterate" && instanceOfAny(target, [IDBIndex, IDBObjectStore]);
+}
+var instanceOfAny, idbProxyableTypes, cursorAdvanceMethods, transactionDoneMap, transformCache, reverseTransformCache, idbProxyTraps, unwrap, readMethods, writeMethods, cachedMethods, advanceMethodProps, methodMap, advanceResults, ittrProxiedCursorToOriginalProxy, cursorIteratorTraps;
+var init_build = __esm({
+ "node_modules/.pnpm/@tempfix+idb@8.0.3/node_modules/@tempfix/idb/build/index.js"() {
+ instanceOfAny = (object, constructors) => constructors.some((c11) => object instanceof c11);
+ transactionDoneMap = /* @__PURE__ */ new WeakMap();
+ transformCache = /* @__PURE__ */ new WeakMap();
+ reverseTransformCache = /* @__PURE__ */ new WeakMap();
+ idbProxyTraps = {
+ get(target, prop, receiver) {
+ if (target instanceof IDBTransaction) {
+ if (prop === "done")
+ return transactionDoneMap.get(target);
+ if (prop === "store") {
+ return receiver.objectStoreNames[1] ? void 0 : receiver.objectStore(receiver.objectStoreNames[0]);
+ }
+ }
+ return wrap(target[prop]);
+ },
+ set(target, prop, value2) {
+ target[prop] = value2;
+ return true;
+ },
+ has(target, prop) {
+ if (target instanceof IDBTransaction && (prop === "done" || prop === "store")) {
+ return true;
+ }
+ return prop in target;
+ }
+ };
+ unwrap = (value2) => reverseTransformCache.get(value2);
+ readMethods = ["get", "getKey", "getAll", "getAllKeys", "count"];
+ writeMethods = ["put", "add", "delete", "clear"];
+ cachedMethods = /* @__PURE__ */ new Map();
+ replaceTraps((oldTraps) => ({
+ ...oldTraps,
+ get: (target, prop, receiver) => getMethod(target, prop) || oldTraps.get(target, prop, receiver),
+ has: (target, prop) => !!getMethod(target, prop) || oldTraps.has(target, prop)
+ }));
+ advanceMethodProps = ["continue", "continuePrimaryKey", "advance"];
+ methodMap = {};
+ advanceResults = /* @__PURE__ */ new WeakMap();
+ ittrProxiedCursorToOriginalProxy = /* @__PURE__ */ new WeakMap();
+ cursorIteratorTraps = {
+ get(target, prop) {
+ if (!advanceMethodProps.includes(prop))
+ return target[prop];
+ let cachedFunc = methodMap[prop];
+ if (!cachedFunc) {
+ cachedFunc = methodMap[prop] = function(...args) {
+ advanceResults.set(this, ittrProxiedCursorToOriginalProxy.get(this)[prop](...args));
+ };
+ }
+ return cachedFunc;
+ }
+ };
+ replaceTraps((oldTraps) => ({
+ ...oldTraps,
+ get(target, prop, receiver) {
+ if (isIteratorProp(target, prop))
+ return iterate;
+ return oldTraps.get(target, prop, receiver);
+ },
+ has(target, prop) {
+ return isIteratorProp(target, prop) || oldTraps.has(target, prop);
+ }
+ }));
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+webstore@2.0.20/node_modules/@push.rocks/webstore/dist_ts/webstore.plugins.js
+var init_webstore_plugins = __esm({
+ "node_modules/.pnpm/@push.rocks+webstore@2.0.20/node_modules/@push.rocks/webstore/dist_ts/webstore.plugins.js"() {
+ init_dist_ts7();
+ init_dist_ts10();
+ init_dist_ts12();
+ init_dist_ts();
+ init_dist_ts2();
+ init_dist_ts4();
+ init_build();
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+webstore@2.0.20/node_modules/@push.rocks/webstore/dist_ts/webstore.classes.webstore.js
+var WebStore;
+var init_webstore_classes_webstore = __esm({
+ "node_modules/.pnpm/@push.rocks+webstore@2.0.20/node_modules/@push.rocks/webstore/dist_ts/webstore.classes.webstore.js"() {
+ init_webstore_plugins();
+ WebStore = class {
+ constructor(optionsArg) {
+ this.initCalled = false;
+ this.readyDeferred = dist_ts_exports.defer();
+ this.options = optionsArg;
+ }
+ async init() {
+ if (this.initCalled) {
+ await this.readyDeferred.promise;
+ return;
+ }
+ this.initCalled = true;
+ const smartenv = new dist_ts_exports10.Smartenv();
+ if (!smartenv.isBrowser && !globalThis.indexedDB) {
+ console.log("hey");
+ console.log(globalThis.indexedDB);
+ await smartenv.getSafeNodeModule("fake-indexeddb/auto");
+ if (!globalThis.indexedDB) {
+ const mod = await smartenv.getSafeNodeModule("fake-indexeddb");
+ globalThis.indexedDB = new mod.IDBFactory();
+ }
+ }
+ this.db = await build_exports.openDB(this.options.dbName, 1, {
+ upgrade: (db) => {
+ db.createObjectStore(this.options.storeName);
+ }
+ });
+ this.readyDeferred.resolve();
+ return;
+ }
+ async get(key2) {
+ await this.init();
+ return this.db.get(this.options.storeName, key2);
+ }
+ async check(keyArg) {
+ await this.init();
+ const result = await this.get(keyArg);
+ return !!result;
+ }
+ async set(key2, val) {
+ await this.init();
+ return this.db.put(this.options.storeName, val, key2);
+ }
+ async delete(key2) {
+ await this.init();
+ return this.db.delete(this.options.storeName, key2);
+ }
+ async clear() {
+ await this.init();
+ return this.db.clear(this.options.storeName);
+ }
+ async keys() {
+ await this.init();
+ return this.db.getAllKeys(this.options.storeName);
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+webstore@2.0.20/node_modules/@push.rocks/webstore/dist_ts/webstore.classes.typedrequestcache.js
+var TypedrequestCache;
+var init_webstore_classes_typedrequestcache = __esm({
+ "node_modules/.pnpm/@push.rocks+webstore@2.0.20/node_modules/@push.rocks/webstore/dist_ts/webstore.classes.typedrequestcache.js"() {
+ init_webstore_classes_webstore();
+ init_webstore_plugins();
+ TypedrequestCache = class {
+ constructor(domainArg = "default") {
+ this.webstore = new WebStore({
+ dbName: "trStore",
+ storeName: `trStore-${domainArg}`
+ });
+ }
+ buildKey(requestArg) {
+ return dist_ts_exports12.stringify({
+ method: requestArg.method,
+ request: requestArg.request
+ });
+ }
+ /**
+ * stores by request
+ * @param typedrequestarg
+ */
+ async setByRequest(typedrequestArg) {
+ if (!typedrequestArg.response) {
+ throw new Error("You cannot store requests without a response present");
+ }
+ await this.webstore.set(this.buildKey(typedrequestArg), typedrequestArg);
+ }
+ /**
+ * get by full tyoedrequest by partial typedrequest
+ * @param typedrequestarg
+ */
+ async getByRequest(typedrequestArg) {
+ const result = await this.webstore.get(this.buildKey(typedrequestArg));
+ return result;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+webstore@2.0.20/node_modules/@push.rocks/webstore/dist_ts/index.js
+var dist_ts_exports13 = {};
+__export(dist_ts_exports13, {
+ TypedrequestCache: () => TypedrequestCache,
+ WebStore: () => WebStore
+});
+var init_dist_ts13 = __esm({
+ "node_modules/.pnpm/@push.rocks+webstore@2.0.20/node_modules/@push.rocks/webstore/dist_ts/index.js"() {
+ init_webstore_classes_typedrequestcache();
+ init_webstore_classes_webstore();
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/webrequest.plugins.js
+var init_webrequest_plugins = __esm({
+ "node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/webrequest.plugins.js"() {
+ init_dist_ts3();
+ init_dist_ts10();
+ init_dist_ts12();
+ init_dist_ts();
+ init_dist_ts13();
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/cache/cache.store.js
+var CacheStore;
+var init_cache_store = __esm({
+ "node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/cache/cache.store.js"() {
+ init_webrequest_plugins();
+ CacheStore = class {
+ constructor(dbName = "webrequest-v4", storeName = "cache") {
+ this.webstore = new dist_ts_exports13.WebStore({
+ dbName,
+ storeName
+ });
+ this.initPromise = this.init();
+ }
+ /**
+ * Initialize the store
+ */
+ async init() {
+ }
+ /**
+ * Generate a cache key from a request
+ */
+ generateCacheKey(request) {
+ const url = request.url;
+ const method = request.method;
+ if (method === "GET") {
+ return url;
+ }
+ return `${method}:${url}`;
+ }
+ /**
+ * Store a response in the cache
+ */
+ async set(cacheKey, entry) {
+ await this.initPromise;
+ await this.webstore.set(cacheKey, entry);
+ }
+ /**
+ * Retrieve a cached response
+ */
+ async get(cacheKey) {
+ await this.initPromise;
+ try {
+ const entry = await this.webstore.get(cacheKey);
+ return entry || null;
+ } catch (error) {
+ return null;
+ }
+ }
+ /**
+ * Check if a cache entry exists
+ */
+ async has(cacheKey) {
+ await this.initPromise;
+ return await this.webstore.check(cacheKey);
+ }
+ /**
+ * Delete a cache entry
+ */
+ async delete(cacheKey) {
+ await this.initPromise;
+ await this.webstore.delete(cacheKey);
+ }
+ /**
+ * Clear all cache entries
+ */
+ async clear() {
+ await this.initPromise;
+ await this.webstore.clear();
+ }
+ /**
+ * Create a Response object from a cache entry
+ */
+ responseFromCacheEntry(entry) {
+ const headers = new Headers(entry.headers);
+ return new Response(entry.response, {
+ status: entry.status,
+ statusText: entry.statusText,
+ headers
+ });
+ }
+ /**
+ * Create a cache entry from a Response object
+ */
+ async cacheEntryFromResponse(url, response, metadata) {
+ const clonedResponse = response.clone();
+ const buffer2 = await clonedResponse.arrayBuffer();
+ const headers = {};
+ clonedResponse.headers.forEach((value2, key2) => {
+ headers[key2] = value2;
+ });
+ return {
+ response: buffer2,
+ headers,
+ timestamp: Date.now(),
+ etag: metadata?.etag || clonedResponse.headers.get("etag") || void 0,
+ lastModified: metadata?.lastModified || clonedResponse.headers.get("last-modified") || void 0,
+ maxAge: metadata?.maxAge,
+ url,
+ status: clonedResponse.status,
+ statusText: clonedResponse.statusText
+ };
+ }
+ /**
+ * Prune expired entries (garbage collection)
+ * Returns the number of entries deleted
+ */
+ async pruneExpired() {
+ await this.initPromise;
+ return 0;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/cache/cache.headers.js
+function parseCacheControl(cacheControlHeader) {
+ const metadata = {
+ maxAge: 0,
+ immutable: false,
+ noCache: false,
+ noStore: false,
+ mustRevalidate: false
+ };
+ if (!cacheControlHeader) {
+ return metadata;
+ }
+ const directives = cacheControlHeader.toLowerCase().split(",").map((d5) => d5.trim());
+ for (const directive of directives) {
+ if (directive === "no-cache") {
+ metadata.noCache = true;
+ } else if (directive === "no-store") {
+ metadata.noStore = true;
+ } else if (directive === "immutable") {
+ metadata.immutable = true;
+ } else if (directive === "must-revalidate") {
+ metadata.mustRevalidate = true;
+ } else if (directive.startsWith("max-age=")) {
+ const maxAge = parseInt(directive.split("=")[1], 10);
+ if (!isNaN(maxAge)) {
+ metadata.maxAge = maxAge * 1e3;
+ }
+ }
+ }
+ return metadata;
+}
+function parseExpires(expiresHeader) {
+ if (!expiresHeader) {
+ return void 0;
+ }
+ try {
+ const date = new Date(expiresHeader);
+ return date.getTime();
+ } catch {
+ return void 0;
+ }
+}
+function extractCacheMetadata(headers) {
+ const cacheControl = headers.get("cache-control");
+ const expires = headers.get("expires");
+ const etag = headers.get("etag");
+ const lastModified = headers.get("last-modified");
+ const metadata = parseCacheControl(cacheControl);
+ if (metadata.maxAge === 0 && expires) {
+ const expiresTime = parseExpires(expires);
+ if (expiresTime) {
+ metadata.maxAge = Math.max(0, expiresTime - Date.now());
+ }
+ }
+ return {
+ maxAge: metadata.maxAge || 0,
+ etag: etag || void 0,
+ lastModified: lastModified || void 0,
+ immutable: metadata.immutable || false,
+ noCache: metadata.noCache || false,
+ noStore: metadata.noStore || false,
+ mustRevalidate: metadata.mustRevalidate || false
+ };
+}
+function isFresh(cacheEntry, metadata) {
+ if (metadata.noStore) {
+ return false;
+ }
+ if (metadata.immutable) {
+ return true;
+ }
+ const age = Date.now() - cacheEntry.timestamp;
+ const maxAge = cacheEntry.maxAge || metadata.maxAge || 0;
+ if (maxAge === 0) {
+ return false;
+ }
+ return age < maxAge;
+}
+function requiresRevalidation(metadata) {
+ return metadata.noCache || metadata.mustRevalidate;
+}
+function createConditionalHeaders(cacheEntry) {
+ const headers = {};
+ if (cacheEntry.etag) {
+ headers["if-none-match"] = cacheEntry.etag;
+ }
+ if (cacheEntry.lastModified) {
+ headers["if-modified-since"] = cacheEntry.lastModified;
+ }
+ return headers;
+}
+function headersToObject(headers) {
+ const obj = {};
+ headers.forEach((value2, key2) => {
+ obj[key2] = value2;
+ });
+ return obj;
+}
+function objectToHeaders(obj) {
+ const headers = new Headers();
+ Object.entries(obj).forEach(([key2, value2]) => {
+ headers.set(key2, value2);
+ });
+ return headers;
+}
+var init_cache_headers = __esm({
+ "node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/cache/cache.headers.js"() {
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/cache/cache.strategies.js
+function getStrategyHandler(strategy) {
+ switch (strategy) {
+ case "network-first":
+ return new NetworkFirstStrategy();
+ case "cache-first":
+ return new CacheFirstStrategy();
+ case "stale-while-revalidate":
+ return new StaleWhileRevalidateStrategy();
+ case "network-only":
+ return new NetworkOnlyStrategy();
+ case "cache-only":
+ return new CacheOnlyStrategy();
+ default:
+ return new NetworkFirstStrategy();
+ }
+}
+var NetworkFirstStrategy, CacheFirstStrategy, StaleWhileRevalidateStrategy, NetworkOnlyStrategy, CacheOnlyStrategy;
+var init_cache_strategies = __esm({
+ "node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/cache/cache.strategies.js"() {
+ init_cache_store();
+ init_cache_headers();
+ NetworkFirstStrategy = class {
+ async execute(context2) {
+ try {
+ const response = await context2.fetchFn(context2.request);
+ if (response.ok) {
+ await this.cacheResponse(context2, response);
+ }
+ return {
+ response,
+ fromCache: false,
+ revalidated: false
+ };
+ } catch (error) {
+ if (context2.logging) {
+ console.log("[webrequest] Network failed, trying cache:", error);
+ }
+ const cachedEntry = await context2.cacheStore.get(context2.cacheKey);
+ if (cachedEntry) {
+ return {
+ response: context2.cacheStore.responseFromCacheEntry(cachedEntry),
+ fromCache: true,
+ revalidated: false
+ };
+ }
+ throw error;
+ }
+ }
+ async cacheResponse(context2, response) {
+ const metadata = extractCacheMetadata(response.headers);
+ if (metadata.noStore) {
+ return;
+ }
+ const entry = await context2.cacheStore.cacheEntryFromResponse(context2.request.url, response, metadata);
+ await context2.cacheStore.set(context2.cacheKey, entry);
+ }
+ };
+ CacheFirstStrategy = class {
+ async execute(context2) {
+ const cachedEntry = await context2.cacheStore.get(context2.cacheKey);
+ if (cachedEntry) {
+ const metadata2 = extractCacheMetadata(new Headers(cachedEntry.headers));
+ if (isFresh(cachedEntry, metadata2)) {
+ if (context2.logging) {
+ console.log("[webrequest] Cache hit (fresh):", context2.request.url);
+ }
+ return {
+ response: context2.cacheStore.responseFromCacheEntry(cachedEntry),
+ fromCache: true,
+ revalidated: false
+ };
+ }
+ if (requiresRevalidation(metadata2) && (cachedEntry.etag || cachedEntry.lastModified)) {
+ return await this.revalidate(context2, cachedEntry);
+ }
+ }
+ if (context2.logging) {
+ console.log("[webrequest] Cache miss, fetching:", context2.request.url);
+ }
+ const response = await context2.fetchFn(context2.request);
+ const metadata = extractCacheMetadata(response.headers);
+ if (!metadata.noStore) {
+ const entry = await context2.cacheStore.cacheEntryFromResponse(context2.request.url, response, metadata);
+ await context2.cacheStore.set(context2.cacheKey, entry);
+ }
+ return {
+ response,
+ fromCache: false,
+ revalidated: false
+ };
+ }
+ async revalidate(context2, cachedEntry) {
+ const conditionalHeaders = createConditionalHeaders(cachedEntry);
+ const revalidateRequest = new Request(context2.request.url, {
+ method: context2.request.method,
+ headers: {
+ ...headersToObject(context2.request.headers),
+ ...conditionalHeaders
+ }
+ });
+ try {
+ const response = await context2.fetchFn(revalidateRequest);
+ if (response.status === 304) {
+ if (context2.logging) {
+ console.log("[webrequest] Cache revalidated (304):", context2.request.url);
+ }
+ cachedEntry.timestamp = Date.now();
+ await context2.cacheStore.set(context2.cacheKey, cachedEntry);
+ return {
+ response: context2.cacheStore.responseFromCacheEntry(cachedEntry),
+ fromCache: true,
+ revalidated: true
+ };
+ }
+ if (response.ok) {
+ const metadata = extractCacheMetadata(response.headers);
+ if (!metadata.noStore) {
+ const entry = await context2.cacheStore.cacheEntryFromResponse(context2.request.url, response, metadata);
+ await context2.cacheStore.set(context2.cacheKey, entry);
+ }
+ }
+ return {
+ response,
+ fromCache: false,
+ revalidated: true
+ };
+ } catch (error) {
+ if (context2.logging) {
+ console.log("[webrequest] Revalidation failed, using cache:", error);
+ }
+ return {
+ response: context2.cacheStore.responseFromCacheEntry(cachedEntry),
+ fromCache: true,
+ revalidated: false
+ };
+ }
+ }
+ };
+ StaleWhileRevalidateStrategy = class {
+ async execute(context2) {
+ const cachedEntry = await context2.cacheStore.get(context2.cacheKey);
+ if (cachedEntry) {
+ const cachedResponse = context2.cacheStore.responseFromCacheEntry(cachedEntry);
+ this.revalidateInBackground(context2, cachedEntry).catch((error) => {
+ if (context2.logging) {
+ console.warn("[webrequest] Background revalidation failed:", error);
+ }
+ });
+ return {
+ response: cachedResponse,
+ fromCache: true,
+ revalidated: false
+ };
+ }
+ const response = await context2.fetchFn(context2.request);
+ const metadata = extractCacheMetadata(response.headers);
+ if (!metadata.noStore && response.ok) {
+ const entry = await context2.cacheStore.cacheEntryFromResponse(context2.request.url, response, metadata);
+ await context2.cacheStore.set(context2.cacheKey, entry);
+ }
+ return {
+ response,
+ fromCache: false,
+ revalidated: false
+ };
+ }
+ async revalidateInBackground(context2, cachedEntry) {
+ const metadata = extractCacheMetadata(new Headers(cachedEntry.headers));
+ if (isFresh(cachedEntry, metadata) && !requiresRevalidation(metadata)) {
+ return;
+ }
+ try {
+ const response = await context2.fetchFn(context2.request);
+ if (response.ok) {
+ const newMetadata = extractCacheMetadata(response.headers);
+ if (!newMetadata.noStore) {
+ const entry = await context2.cacheStore.cacheEntryFromResponse(context2.request.url, response, newMetadata);
+ await context2.cacheStore.set(context2.cacheKey, entry);
+ if (context2.logging) {
+ console.log("[webrequest] Background revalidation complete:", context2.request.url);
+ }
+ }
+ }
+ } catch (error) {
+ if (context2.logging) {
+ console.warn("[webrequest] Background revalidation failed:", error);
+ }
+ }
+ }
+ };
+ NetworkOnlyStrategy = class {
+ async execute(context2) {
+ const response = await context2.fetchFn(context2.request);
+ return {
+ response,
+ fromCache: false,
+ revalidated: false
+ };
+ }
+ };
+ CacheOnlyStrategy = class {
+ async execute(context2) {
+ const cachedEntry = await context2.cacheStore.get(context2.cacheKey);
+ if (!cachedEntry) {
+ throw new Error(`Cache miss for ${context2.request.url} (cache-only mode)`);
+ }
+ return {
+ response: context2.cacheStore.responseFromCacheEntry(cachedEntry),
+ fromCache: true,
+ revalidated: false
+ };
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/cache/cache.manager.js
+var CacheManager;
+var init_cache_manager = __esm({
+ "node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/cache/cache.manager.js"() {
+ init_cache_store();
+ init_cache_strategies();
+ init_cache_headers();
+ CacheManager = class {
+ constructor(dbName, storeName) {
+ this.cacheStore = new CacheStore(dbName, storeName);
+ }
+ /**
+ * Execute a request with caching
+ */
+ async execute(request, options, fetchFn) {
+ const strategy = this.determineStrategy(request, options);
+ if (strategy === "network-only") {
+ const response = await fetchFn(request);
+ return {
+ response,
+ fromCache: false,
+ revalidated: false
+ };
+ }
+ const cacheKey = this.generateCacheKey(request, options);
+ const handler2 = getStrategyHandler(strategy);
+ const context2 = {
+ request,
+ cacheKey,
+ cacheStore: this.cacheStore,
+ fetchFn,
+ logging: options.logging
+ };
+ return await handler2.execute(context2);
+ }
+ /**
+ * Determine the caching strategy based on options and request
+ */
+ determineStrategy(request, options) {
+ if (options.cacheStrategy) {
+ return options.cacheStrategy;
+ }
+ if (options.cache) {
+ return this.mapCacheModeToStrategy(options.cache);
+ }
+ if (request.cache) {
+ return this.mapCacheModeToStrategy(request.cache);
+ }
+ return "network-first";
+ }
+ /**
+ * Map standard fetch cache modes to our strategies
+ */
+ mapCacheModeToStrategy(cacheMode) {
+ switch (cacheMode) {
+ case "default":
+ return "network-first";
+ case "no-store":
+ case "reload":
+ return "network-only";
+ case "no-cache":
+ return "network-first";
+ // Will use revalidation
+ case "force-cache":
+ return "cache-first";
+ case "only-if-cached":
+ return "cache-only";
+ default:
+ return "network-first";
+ }
+ }
+ /**
+ * Generate cache key
+ */
+ generateCacheKey(request, options) {
+ if (options.cacheKey) {
+ if (typeof options.cacheKey === "function") {
+ return options.cacheKey(request);
+ }
+ return options.cacheKey;
+ }
+ return this.cacheStore.generateCacheKey(request);
+ }
+ /**
+ * Clear the cache
+ */
+ async clear() {
+ await this.cacheStore.clear();
+ }
+ /**
+ * Delete a specific cache entry
+ */
+ async delete(cacheKey) {
+ await this.cacheStore.delete(cacheKey);
+ }
+ /**
+ * Check if a cache entry exists
+ */
+ async has(cacheKey) {
+ return await this.cacheStore.has(cacheKey);
+ }
+ /**
+ * Get the underlying cache store
+ */
+ getStore() {
+ return this.cacheStore;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/retry/retry.strategies.js
+function getBackoffCalculator(strategy) {
+ switch (strategy) {
+ case "exponential":
+ return new ExponentialBackoff();
+ case "linear":
+ return new LinearBackoff();
+ case "constant":
+ return new ConstantBackoff();
+ default:
+ return new ExponentialBackoff();
+ }
+}
+function addJitter(delay2, jitterFactor = 0.1) {
+ const jitter = delay2 * jitterFactor * Math.random();
+ return delay2 + jitter;
+}
+var ExponentialBackoff, LinearBackoff, ConstantBackoff;
+var init_retry_strategies = __esm({
+ "node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/retry/retry.strategies.js"() {
+ ExponentialBackoff = class {
+ calculate(attempt, initialDelay, maxDelay) {
+ const delay2 = initialDelay * Math.pow(2, attempt - 1);
+ return Math.min(delay2, maxDelay);
+ }
+ };
+ LinearBackoff = class {
+ calculate(attempt, initialDelay, maxDelay) {
+ const delay2 = initialDelay * attempt;
+ return Math.min(delay2, maxDelay);
+ }
+ };
+ ConstantBackoff = class {
+ calculate(attempt, initialDelay, maxDelay) {
+ return Math.min(initialDelay, maxDelay);
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/retry/retry.manager.js
+var RetryManager;
+var init_retry_manager = __esm({
+ "node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/retry/retry.manager.js"() {
+ init_webrequest_plugins();
+ init_retry_strategies();
+ RetryManager = class {
+ constructor(options = {}) {
+ this.options = {
+ maxAttempts: options.maxAttempts ?? 3,
+ backoff: options.backoff ?? "exponential",
+ initialDelay: options.initialDelay ?? 1e3,
+ maxDelay: options.maxDelay ?? 3e4,
+ retryOn: options.retryOn ?? [408, 429, 500, 502, 503, 504],
+ onRetry: options.onRetry ?? (() => {
+ })
+ };
+ }
+ /**
+ * Execute a request with retry logic
+ */
+ async execute(executeFn, shouldRetryFn) {
+ let lastError;
+ let lastResponse;
+ for (let attempt = 1; attempt <= this.options.maxAttempts; attempt++) {
+ try {
+ const result = await executeFn();
+ if (result instanceof Response) {
+ if (this.shouldRetryResponse(result)) {
+ lastResponse = result;
+ if (attempt === this.options.maxAttempts) {
+ return result;
+ }
+ const delay2 = this.calculateDelay(attempt);
+ this.options.onRetry(attempt, new Error(`HTTP ${result.status}`), delay2);
+ await this.delay(delay2);
+ continue;
+ }
+ }
+ return result;
+ } catch (error) {
+ lastError = error instanceof Error ? error : new Error(String(error));
+ const shouldRetry = shouldRetryFn ? shouldRetryFn(error, attempt) : this.shouldRetryError(error);
+ if (attempt === this.options.maxAttempts || !shouldRetry) {
+ throw lastError;
+ }
+ const delay2 = this.calculateDelay(attempt);
+ this.options.onRetry(attempt, lastError, delay2);
+ await this.delay(delay2);
+ }
+ }
+ throw lastError || new Error("Max retry attempts reached");
+ }
+ /**
+ * Execute with multiple fallback URLs
+ */
+ async executeWithFallbacks(urls, requestInit, fetchFn) {
+ if (urls.length === 0) {
+ throw new Error("No URLs provided for fallback execution");
+ }
+ let lastError;
+ const failedUrls = [];
+ for (const url of urls) {
+ try {
+ const response = await this.execute(async () => {
+ return await fetchFn(url, requestInit);
+ });
+ if (response.status < 400) {
+ return response;
+ }
+ if (response.status >= 400 && response.status < 500 && response.status !== 408) {
+ return response;
+ }
+ failedUrls.push(url);
+ lastError = new Error(`Request failed with status ${response.status}`);
+ } catch (error) {
+ failedUrls.push(url);
+ lastError = error instanceof Error ? error : new Error(String(error));
+ }
+ }
+ throw new Error(`All URLs failed: ${failedUrls.join(", ")}. Last error: ${lastError?.message || "Unknown error"}`);
+ }
+ /**
+ * Check if we should retry based on response status
+ */
+ shouldRetryResponse(response) {
+ const retryOn = this.options.retryOn;
+ if (typeof retryOn === "function") {
+ return retryOn(response);
+ }
+ if (Array.isArray(retryOn)) {
+ return retryOn.includes(response.status);
+ }
+ return false;
+ }
+ /**
+ * Check if we should retry based on error
+ */
+ shouldRetryError(error) {
+ if (error instanceof TypeError && error.message.includes("fetch")) {
+ return true;
+ }
+ if (error.name === "AbortError" || error.message.includes("timeout")) {
+ return true;
+ }
+ const retryOn = this.options.retryOn;
+ if (typeof retryOn === "function") {
+ return retryOn(void 0, error);
+ }
+ return false;
+ }
+ /**
+ * Calculate delay for next retry
+ */
+ calculateDelay(attempt) {
+ const calculator = getBackoffCalculator(this.options.backoff);
+ const baseDelay = calculator.calculate(attempt, this.options.initialDelay, this.options.maxDelay);
+ return addJitter(baseDelay);
+ }
+ /**
+ * Delay execution
+ */
+ async delay(ms) {
+ await dist_ts_exports3.delayFor(ms);
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/utils/deduplicator.js
+var RequestDeduplicator;
+var init_deduplicator = __esm({
+ "node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/utils/deduplicator.js"() {
+ init_webrequest_plugins();
+ RequestDeduplicator = class {
+ constructor() {
+ this.inFlightRequests = /* @__PURE__ */ new Map();
+ }
+ /**
+ * Generate a deduplication key from a request
+ */
+ generateKey(request) {
+ const url = request.url;
+ const method = request.method;
+ if (method === "GET" || method === "HEAD") {
+ return `${method}:${url}`;
+ }
+ return `${method}:${url}:${Date.now()}`;
+ }
+ /**
+ * Execute a request with deduplication
+ */
+ async execute(key2, executeFn) {
+ const existingDeferred = this.inFlightRequests.get(key2);
+ if (existingDeferred) {
+ const response = await existingDeferred.promise;
+ return {
+ response: response.clone(),
+ wasDeduplicated: true
+ };
+ }
+ const deferred2 = dist_ts_exports.defer();
+ this.inFlightRequests.set(key2, deferred2);
+ try {
+ const response = await executeFn();
+ deferred2.resolve(response);
+ this.inFlightRequests.delete(key2);
+ return {
+ response,
+ wasDeduplicated: false
+ };
+ } catch (error) {
+ deferred2.reject(error);
+ this.inFlightRequests.delete(key2);
+ throw error;
+ }
+ }
+ /**
+ * Check if a request is currently in flight
+ */
+ isInFlight(key2) {
+ return this.inFlightRequests.has(key2);
+ }
+ /**
+ * Get the number of in-flight requests
+ */
+ getInFlightCount() {
+ return this.inFlightRequests.size;
+ }
+ /**
+ * Clear all in-flight requests
+ */
+ clear() {
+ this.inFlightRequests.clear();
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/utils/timeout.js
+function createTimeoutController(timeoutMs) {
+ const controller = new AbortController();
+ const timeout2 = new dist_ts_exports3.Timeout(timeoutMs, null);
+ timeout2.promise.then(() => {
+ controller.abort();
+ });
+ const cleanup = () => {
+ timeout2.cancel();
+ };
+ return { controller, cleanup };
+}
+async function fetchWithTimeout(url, init, timeoutMs) {
+ const { controller, cleanup } = createTimeoutController(timeoutMs);
+ try {
+ const response = await fetch(url, {
+ ...init,
+ signal: controller.signal
+ });
+ cleanup();
+ return response;
+ } catch (error) {
+ cleanup();
+ if (error instanceof Error && error.name === "AbortError") {
+ throw new Error(`Request timeout after ${timeoutMs}ms: ${url}`);
+ }
+ throw error;
+ }
+}
+var init_timeout2 = __esm({
+ "node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/utils/timeout.js"() {
+ init_webrequest_plugins();
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/webrequest.client.js
+var WebrequestClient;
+var init_webrequest_client = __esm({
+ "node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/webrequest.client.js"() {
+ init_interceptor_manager();
+ init_cache_manager();
+ init_retry_manager();
+ init_deduplicator();
+ init_timeout2();
+ WebrequestClient = class {
+ constructor(options = {}) {
+ this.defaultOptions = options;
+ this.interceptorManager = new InterceptorManager();
+ this.cacheManager = new CacheManager();
+ this.deduplicator = new RequestDeduplicator();
+ }
+ /**
+ * Add a global request interceptor
+ */
+ addRequestInterceptor(interceptor) {
+ this.interceptorManager.addRequestInterceptor(interceptor);
+ }
+ /**
+ * Add a global response interceptor
+ */
+ addResponseInterceptor(interceptor) {
+ this.interceptorManager.addResponseInterceptor(interceptor);
+ }
+ /**
+ * Add a global error interceptor
+ */
+ addErrorInterceptor(interceptor) {
+ this.interceptorManager.addErrorInterceptor(interceptor);
+ }
+ /**
+ * Remove a request interceptor
+ */
+ removeRequestInterceptor(interceptor) {
+ this.interceptorManager.removeRequestInterceptor(interceptor);
+ }
+ /**
+ * Remove a response interceptor
+ */
+ removeResponseInterceptor(interceptor) {
+ this.interceptorManager.removeResponseInterceptor(interceptor);
+ }
+ /**
+ * Remove an error interceptor
+ */
+ removeErrorInterceptor(interceptor) {
+ this.interceptorManager.removeErrorInterceptor(interceptor);
+ }
+ /**
+ * Clear all interceptors
+ */
+ clearInterceptors() {
+ this.interceptorManager.clearAll();
+ }
+ /**
+ * Clear the cache
+ */
+ async clearCache() {
+ await this.cacheManager.clear();
+ }
+ /**
+ * Execute a request with all configured features
+ */
+ async request(url, options = {}) {
+ const mergedOptions = {
+ ...this.defaultOptions,
+ ...options
+ };
+ let request;
+ if (typeof url === "string") {
+ request = new Request(url, mergedOptions);
+ } else {
+ request = url;
+ }
+ request = await this.interceptorManager.processRequest(request);
+ if (mergedOptions.interceptors?.request) {
+ for (const interceptor of mergedOptions.interceptors.request) {
+ request = await interceptor(request);
+ }
+ }
+ const deduplicate = mergedOptions.deduplicate ?? false;
+ if (deduplicate) {
+ const dedupeKey = this.deduplicator.generateKey(request);
+ const result = await this.deduplicator.execute(dedupeKey, async () => {
+ return await this.executeRequest(request, mergedOptions);
+ });
+ return result.response;
+ }
+ return await this.executeRequest(request, mergedOptions);
+ }
+ /**
+ * Internal request execution with caching and retry
+ */
+ async executeRequest(request, options) {
+ try {
+ const retryOptions = typeof options.retry === "object" ? options.retry : options.retry ? {} : void 0;
+ const fetchFnForRequest = async (req) => {
+ const timeout2 = options.timeout ?? 6e4;
+ return await fetchWithTimeout(req.url, {
+ method: req.method,
+ headers: req.headers,
+ body: req.body,
+ ...options
+ }, timeout2);
+ };
+ const fetchFnForFallbacks = async (url, init) => {
+ const timeout2 = options.timeout ?? 6e4;
+ return await fetchWithTimeout(url, init, timeout2);
+ };
+ let response;
+ if (retryOptions) {
+ const retryManager = new RetryManager(retryOptions);
+ if (options.fallbackUrls && options.fallbackUrls.length > 0) {
+ const allUrls = [request.url, ...options.fallbackUrls];
+ response = await retryManager.executeWithFallbacks(allUrls, {
+ method: request.method,
+ headers: request.headers,
+ body: request.body,
+ ...options
+ }, fetchFnForFallbacks);
+ } else {
+ response = await retryManager.execute(async () => {
+ const result = await this.cacheManager.execute(request, options, fetchFnForRequest);
+ return result.response;
+ });
+ }
+ } else {
+ const result = await this.cacheManager.execute(request, options, fetchFnForRequest);
+ response = result.response;
+ }
+ response = await this.interceptorManager.processResponse(response);
+ if (options.interceptors?.response) {
+ for (const interceptor of options.interceptors.response) {
+ response = await interceptor(response);
+ }
+ }
+ return response;
+ } catch (error) {
+ const processedError = await this.interceptorManager.processError(error instanceof Error ? error : new Error(String(error)));
+ throw processedError;
+ }
+ }
+ /**
+ * Convenience method: GET request returning JSON
+ */
+ async getJson(url, options = {}) {
+ const response = await this.request(url, {
+ ...options,
+ method: "GET",
+ headers: {
+ Accept: "application/json",
+ ...options.headers || {}
+ }
+ });
+ if (!response.ok) {
+ throw new Error(`HTTP ${response.status}: ${response.statusText}`);
+ }
+ return await response.json();
+ }
+ /**
+ * Convenience method: POST request with JSON body
+ */
+ async postJson(url, data8, options = {}) {
+ const response = await this.request(url, {
+ ...options,
+ method: "POST",
+ headers: {
+ "Content-Type": "application/json",
+ Accept: "application/json",
+ ...options.headers || {}
+ },
+ body: JSON.stringify(data8)
+ });
+ if (!response.ok) {
+ throw new Error(`HTTP ${response.status}: ${response.statusText}`);
+ }
+ return await response.json();
+ }
+ /**
+ * Convenience method: PUT request with JSON body
+ */
+ async putJson(url, data8, options = {}) {
+ const response = await this.request(url, {
+ ...options,
+ method: "PUT",
+ headers: {
+ "Content-Type": "application/json",
+ Accept: "application/json",
+ ...options.headers || {}
+ },
+ body: JSON.stringify(data8)
+ });
+ if (!response.ok) {
+ throw new Error(`HTTP ${response.status}: ${response.statusText}`);
+ }
+ return await response.json();
+ }
+ /**
+ * Convenience method: DELETE request
+ */
+ async deleteJson(url, options = {}) {
+ const response = await this.request(url, {
+ ...options,
+ method: "DELETE",
+ headers: {
+ Accept: "application/json",
+ ...options.headers || {}
+ }
+ });
+ if (!response.ok) {
+ throw new Error(`HTTP ${response.status}: ${response.statusText}`);
+ }
+ return await response.json();
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/webrequest.function.js
+async function webrequest(input, init) {
+ const url = input instanceof Request ? input.url : String(input);
+ const request = input instanceof Request ? input : new Request(url, init);
+ return await defaultClient.request(request, init);
+}
+var defaultClient;
+var init_webrequest_function = __esm({
+ "node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/webrequest.function.js"() {
+ init_webrequest_client();
+ defaultClient = new WebrequestClient();
+ webrequest.getJson = async function(url, options) {
+ return await defaultClient.getJson(url, options);
+ };
+ webrequest.postJson = async function(url, data8, options) {
+ return await defaultClient.postJson(url, data8, options);
+ };
+ webrequest.putJson = async function(url, data8, options) {
+ return await defaultClient.putJson(url, data8, options);
+ };
+ webrequest.deleteJson = async function(url, options) {
+ return await defaultClient.deleteJson(url, options);
+ };
+ webrequest.addRequestInterceptor = function(interceptor) {
+ defaultClient.addRequestInterceptor(interceptor);
+ };
+ webrequest.addResponseInterceptor = function(interceptor) {
+ defaultClient.addResponseInterceptor(interceptor);
+ };
+ webrequest.addErrorInterceptor = function(interceptor) {
+ defaultClient.addErrorInterceptor(interceptor);
+ };
+ webrequest.clearInterceptors = function() {
+ defaultClient.clearInterceptors();
+ };
+ webrequest.clearCache = async function() {
+ await defaultClient.clearCache();
+ };
+ webrequest.createClient = function(options) {
+ return new WebrequestClient(options);
+ };
+ webrequest.getDefaultClient = function() {
+ return defaultClient;
+ };
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/index.js
+var dist_ts_exports14 = {};
+__export(dist_ts_exports14, {
+ CacheManager: () => CacheManager,
+ CacheStore: () => CacheStore,
+ InterceptorManager: () => InterceptorManager,
+ RequestDeduplicator: () => RequestDeduplicator,
+ RetryManager: () => RetryManager,
+ WebrequestClient: () => WebrequestClient,
+ createConditionalHeaders: () => createConditionalHeaders,
+ extractCacheMetadata: () => extractCacheMetadata,
+ headersToObject: () => headersToObject,
+ isFresh: () => isFresh,
+ objectToHeaders: () => objectToHeaders,
+ requiresRevalidation: () => requiresRevalidation,
+ webrequest: () => webrequest
+});
+var init_dist_ts14 = __esm({
+ "node_modules/.pnpm/@push.rocks+webrequest@4.0.2/node_modules/@push.rocks/webrequest/dist_ts/index.js"() {
+ init_webrequest_function();
+ init_webrequest_client();
+ init_cache_manager();
+ init_cache_store();
+ init_retry_manager();
+ init_interceptor_manager();
+ init_deduplicator();
+ init_cache_headers();
+ }
+});
+
+// node_modules/.pnpm/@api.global+typedrequest@3.2.6/node_modules/@api.global/typedrequest/dist_ts/plugins.js
+var isounique2;
+var init_plugins = __esm({
+ "node_modules/.pnpm/@api.global+typedrequest@3.2.6/node_modules/@api.global/typedrequest/dist_ts/plugins.js"() {
+ init_dist_ts4();
+ isounique2 = __toESM(require_dist_ts(), 1);
+ init_dist_ts7();
+ init_dist_ts8();
+ init_dist_ts3();
+ init_dist_ts9();
+ init_dist_ts();
+ init_dist_ts14();
+ }
+});
+
+// node_modules/.pnpm/@api.global+typedrequest@3.2.6/node_modules/@api.global/typedrequest/dist_ts/classes.typedresponseerror.js
+var TypedResponseError;
+var init_classes_typedresponseerror = __esm({
+ "node_modules/.pnpm/@api.global+typedrequest@3.2.6/node_modules/@api.global/typedrequest/dist_ts/classes.typedresponseerror.js"() {
+ init_plugins();
+ TypedResponseError = class {
+ constructor(errorTextArg, errorDataArg) {
+ this.errorText = errorTextArg;
+ this.errorData = errorDataArg;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@api.global+typedrequest@3.2.6/node_modules/@api.global/typedrequest/dist_ts/classes.typedtools.js
+var TypedTools;
+var init_classes_typedtools = __esm({
+ "node_modules/.pnpm/@api.global+typedrequest@3.2.6/node_modules/@api.global/typedrequest/dist_ts/classes.typedtools.js"() {
+ init_classes_typedresponseerror();
+ init_plugins();
+ TypedTools = class {
+ constructor() {
+ this.localData = {};
+ }
+ async passGuards(guardsArg, dataArg) {
+ const guardSet = new dist_ts_exports9.GuardSet(guardsArg);
+ const guardResult = await guardSet.allGuardsPass(dataArg);
+ if (!guardResult) {
+ const failedHint = await guardSet.getFailedHint(dataArg);
+ throw new TypedResponseError(`guard failed: ${failedHint}`, { failedHint });
+ }
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@api.global+typedrequest@3.2.6/node_modules/@api.global/typedrequest/dist_ts/classes.typedhandler.js
+var TypedHandler;
+var init_classes_typedhandler = __esm({
+ "node_modules/.pnpm/@api.global+typedrequest@3.2.6/node_modules/@api.global/typedrequest/dist_ts/classes.typedhandler.js"() {
+ init_plugins();
+ init_classes_typedresponseerror();
+ init_classes_typedtools();
+ TypedHandler = class {
+ constructor(methodArg, handlerFunctionArg) {
+ this.method = methodArg;
+ this.handlerFunction = handlerFunctionArg;
+ }
+ /**
+ * adds a response to the typedRequest
+ * @param typedRequestArg
+ */
+ async addResponse(typedRequestArg) {
+ if (typedRequestArg.method !== this.method) {
+ throw new Error("this handler has been given a wrong method to answer to. Please use a TypedRouter to filter requests");
+ }
+ let typedResponseError;
+ const typedtoolsInstance = new TypedTools();
+ if (typedRequestArg.localData) {
+ typedtoolsInstance.localData = typedRequestArg.localData;
+ }
+ const response = await this.handlerFunction(typedRequestArg.request, typedtoolsInstance).catch((e11) => {
+ if (e11 instanceof TypedResponseError) {
+ typedResponseError = e11;
+ } else {
+ console.log(e11);
+ }
+ });
+ if (typedResponseError) {
+ typedRequestArg.error = {
+ text: typedResponseError.errorText,
+ data: typedResponseError.errorData
+ };
+ }
+ if (response) {
+ typedRequestArg.response = response;
+ }
+ typedRequestArg?.correlation?.phase ? typedRequestArg.correlation.phase = "response" : null;
+ return typedRequestArg;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@api.global+typedrequest@3.2.6/node_modules/@api.global/typedrequest/dist_ts/classes.typedrouter.js
+var TypedRouter;
+var init_classes_typedrouter = __esm({
+ "node_modules/.pnpm/@api.global+typedrequest@3.2.6/node_modules/@api.global/typedrequest/dist_ts/classes.typedrouter.js"() {
+ init_plugins();
+ init_classes_virtualstream();
+ init_classes_typedhandler();
+ init_classes_typedrequest();
+ TypedRouter = class _TypedRouter {
+ constructor() {
+ this.hooks = {};
+ this.routerMap = new dist_ts_exports6.ObjectMap();
+ this.handlerMap = new dist_ts_exports6.ObjectMap();
+ this.registeredVirtualStreams = new dist_ts_exports6.ObjectMap();
+ this.fireEventInterestMap = new dist_ts_exports6.InterestMap((correlationId) => correlationId);
+ }
+ // Use globalThis for cross-bundle hook sharing
+ static get globalHooks() {
+ if (!globalThis.__typedRouterGlobalHooks) {
+ globalThis.__typedRouterGlobalHooks = {};
+ }
+ return globalThis.__typedRouterGlobalHooks;
+ }
+ static set globalHooks(value2) {
+ globalThis.__typedRouterGlobalHooks = value2;
+ }
+ /**
+ * Set global hooks for monitoring all TypedRequest traffic
+ * Hooks are shared across all bundles via globalThis
+ */
+ static setGlobalHooks(hooks8) {
+ const current = _TypedRouter.globalHooks;
+ _TypedRouter.globalHooks = { ...current, ...hooks8 };
+ }
+ /**
+ * Clear all global hooks
+ */
+ static clearGlobalHooks() {
+ globalThis.__typedRouterGlobalHooks = {};
+ }
+ /**
+ * Set instance-level hooks for monitoring traffic through this router
+ */
+ setHooks(hooks8) {
+ this.hooks = { ...this.hooks, ...hooks8 };
+ }
+ /**
+ * Helper to call both global and instance hooks
+ */
+ callHook(hookName, entry) {
+ try {
+ _TypedRouter.globalHooks[hookName]?.(entry);
+ this.hooks[hookName]?.(entry);
+ } catch (err) {
+ console.error(`TypedRouter hook error (${hookName}):`, err);
+ }
+ }
+ /**
+ * adds the handler to the routing map
+ * @param typedHandlerArg
+ */
+ addTypedHandler(typedHandlerArg) {
+ const existingTypedHandler = this.getTypedHandlerForMethod(typedHandlerArg.method);
+ if (existingTypedHandler) {
+ throw new Error(`a TypedHandler for ${typedHandlerArg.method} alredy exists! Can't add another one.`);
+ }
+ this.handlerMap.add(typedHandlerArg);
+ }
+ /**
+ * adds another sub typedRouter
+ * @param typedRequest
+ */
+ addTypedRouter(typedRouterArg) {
+ const routerExists = this.routerMap.findSync((routerArg) => routerArg === typedRouterArg);
+ if (!routerExists) {
+ this.routerMap.add(typedRouterArg);
+ typedRouterArg.addTypedRouter(this);
+ }
+ }
+ checkForTypedHandler(methodArg) {
+ return !!this.getTypedHandlerForMethod(methodArg);
+ }
+ /**
+ * gets a typed Router from the router chain, upstream and downstream
+ * @param methodArg
+ * @param checkUpstreamRouter
+ */
+ getTypedHandlerForMethod(methodArg, checkedRouters = []) {
+ checkedRouters.push(this);
+ let typedHandler;
+ typedHandler = this.handlerMap.findSync((handler2) => {
+ return handler2.method === methodArg;
+ });
+ if (!typedHandler) {
+ this.routerMap.getArray().forEach((typedRouterArg) => {
+ if (!typedHandler && !checkedRouters.includes(typedRouterArg)) {
+ typedHandler = typedRouterArg.getTypedHandlerForMethod(methodArg, checkedRouters);
+ }
+ });
+ }
+ return typedHandler;
+ }
+ static {
+ this.defaultRouteOptions = {
+ localRequest: false,
+ skipHooks: false
+ };
+ }
+ /**
+ * if typedrequest object has correlation.phase === 'request' -> routes a typed request object to a handler
+ * if typedrequest object has correlation.phase === 'response' -> routes a typed request object to request fire event
+ * @param typedRequestArg
+ * @param optionsArg - Options object with:
+ * - localRequest: treat as local request (default: false)
+ * - skipHooks: skip calling hooks for this routing (default: false, use for broadcast-received messages)
+ */
+ async routeAndAddResponse(typedRequestArg, optionsArg = {}) {
+ const options = { ..._TypedRouter.defaultRouteOptions, ...optionsArg };
+ typedRequestArg = VirtualStream.decodePayloadFromNetwork(typedRequestArg, {
+ typedrouter: this
+ });
+ typedRequestArg.localData = typedRequestArg.localData || {};
+ typedRequestArg.localData.firstTypedrouter = this;
+ if (typedRequestArg.method === "##VirtualStream##") {
+ const result = await this.handleStreamTypedRequest(typedRequestArg);
+ result.localData = null;
+ return result;
+ }
+ if (typedRequestArg?.correlation?.phase === "request" || options.localRequest) {
+ const requestStartTime = Date.now();
+ if (!options.skipHooks) {
+ this.callHook("onIncomingRequest", {
+ correlationId: typedRequestArg.correlation?.id || "unknown",
+ method: typedRequestArg.method,
+ direction: "incoming",
+ phase: "request",
+ timestamp: requestStartTime,
+ payload: typedRequestArg.request
+ });
+ }
+ const typedHandler = this.getTypedHandlerForMethod(typedRequestArg.method);
+ if (!typedHandler) {
+ console.log(`Cannot find handler for methodname ${typedRequestArg.method}`);
+ typedRequestArg.error = {
+ text: "There is no available method for this call on the server side",
+ data: {}
+ };
+ typedRequestArg.correlation.phase = "response";
+ typedRequestArg.localData = null;
+ typedRequestArg = VirtualStream.encodePayloadForNetwork(typedRequestArg, {
+ typedrouter: this
+ });
+ if (!options.skipHooks) {
+ this.callHook("onOutgoingResponse", {
+ correlationId: typedRequestArg.correlation?.id || "unknown",
+ method: typedRequestArg.method,
+ direction: "outgoing",
+ phase: "response",
+ timestamp: Date.now(),
+ durationMs: Date.now() - requestStartTime,
+ payload: typedRequestArg.response,
+ error: typedRequestArg.error?.text
+ });
+ }
+ return typedRequestArg;
+ }
+ typedRequestArg = await typedHandler.addResponse(typedRequestArg);
+ typedRequestArg.localData = null;
+ typedRequestArg = VirtualStream.encodePayloadForNetwork(typedRequestArg, {
+ typedrouter: this
+ });
+ if (!options.skipHooks) {
+ this.callHook("onOutgoingResponse", {
+ correlationId: typedRequestArg.correlation?.id || "unknown",
+ method: typedRequestArg.method,
+ direction: "outgoing",
+ phase: "response",
+ timestamp: Date.now(),
+ durationMs: Date.now() - requestStartTime,
+ payload: typedRequestArg.response,
+ error: typedRequestArg.error?.text
+ });
+ }
+ return typedRequestArg;
+ } else if (typedRequestArg?.correlation?.phase === "response") {
+ if (!options.skipHooks) {
+ this.callHook("onIncomingResponse", {
+ correlationId: typedRequestArg.correlation?.id || "unknown",
+ method: typedRequestArg.method,
+ direction: "incoming",
+ phase: "response",
+ timestamp: Date.now(),
+ payload: typedRequestArg.response,
+ error: typedRequestArg.error?.text
+ });
+ }
+ this.fireEventInterestMap.findInterest(typedRequestArg.correlation.id)?.fullfillInterest(typedRequestArg);
+ return null;
+ } else {
+ console.log("received weirdly shaped request");
+ console.log(typedRequestArg);
+ return null;
+ }
+ }
+ /**
+ * handle streaming
+ * @param streamTrArg
+ */
+ async handleStreamTypedRequest(streamTrArg) {
+ const relevantVirtualStream = await this.registeredVirtualStreams.find(async (virtualStreamArg) => {
+ return virtualStreamArg.streamId === streamTrArg.request.streamId;
+ });
+ if (!relevantVirtualStream) {
+ console.log(`no relevant virtual stream found for stream with id ${streamTrArg.request.streamId}`);
+ console.log(this.registeredVirtualStreams.getArray());
+ return streamTrArg;
+ } else {
+ console.log(`success: found relevant virtual stream with id ${streamTrArg.request.streamId}`);
+ }
+ const result = await relevantVirtualStream.handleStreamTr(streamTrArg);
+ return result;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@api.global+typedrequest@3.2.6/node_modules/@api.global/typedrequest/dist_ts/classes.virtualstream.js
+var closingBit, VirtualStream;
+var init_classes_virtualstream = __esm({
+ "node_modules/.pnpm/@api.global+typedrequest@3.2.6/node_modules/@api.global/typedrequest/dist_ts/classes.virtualstream.js"() {
+ init_plugins();
+ init_classes_typedrouter();
+ closingBit = "#############CLOSING BIT#############";
+ VirtualStream = class _VirtualStream {
+ // STATIC
+ static encodePayloadForNetwork(objectPayload, commFunctions, originalPayload, path2 = []) {
+ if (!objectPayload) {
+ return objectPayload;
+ }
+ if (dist_ts_exports8.isBufferLike(objectPayload)) {
+ return objectPayload;
+ }
+ if (objectPayload instanceof _VirtualStream) {
+ if (!objectPayload.side && commFunctions.sendMethod) {
+ objectPayload.side = "requesting";
+ objectPayload.sendMethod = commFunctions.sendMethod;
+ }
+ if (!objectPayload.side && commFunctions.typedrouter) {
+ objectPayload.side = "responding";
+ objectPayload.typedrouter = commFunctions.typedrouter;
+ commFunctions.typedrouter.registeredVirtualStreams.add(objectPayload);
+ }
+ if (!originalPayload.response || path2.includes("response")) {
+ objectPayload.startKeepAliveLoop();
+ return {
+ _isVirtualStream: true,
+ streamId: objectPayload.streamId
+ };
+ } else {
+ return {
+ _OBMITTED_VIRTUAL_STREAM: true,
+ reason: "path is under .request: obmitted for deduplication reasons in response cycle."
+ };
+ }
+ } else if (Array.isArray(objectPayload)) {
+ return objectPayload.map((item, index2) => _VirtualStream.encodePayloadForNetwork(
+ item,
+ commFunctions,
+ originalPayload || objectPayload,
+ path2.concat(String(index2))
+ // Convert index to string and concatenate to path
+ ));
+ } else if (objectPayload !== null && typeof objectPayload === "object") {
+ return Object.entries(objectPayload).reduce((acc, [key2, value2]) => {
+ const newPath = path2.concat(key2);
+ acc[key2] = _VirtualStream.encodePayloadForNetwork(value2, commFunctions, originalPayload || objectPayload, newPath);
+ return acc;
+ }, {});
+ } else {
+ return objectPayload;
+ }
+ }
+ static decodePayloadFromNetwork(objectPayload, commFunctions) {
+ if (dist_ts_exports8.isBufferLike(objectPayload) || objectPayload instanceof TypedRouter) {
+ return objectPayload;
+ }
+ if (objectPayload !== null && typeof objectPayload === "object") {
+ if (objectPayload instanceof Set || objectPayload instanceof Map || objectPayload instanceof Date || objectPayload instanceof RegExp || objectPayload instanceof Error || objectPayload instanceof Promise || typeof objectPayload.then === "function") {
+ return objectPayload;
+ }
+ if (objectPayload._isVirtualStream) {
+ const virtualStream = new _VirtualStream();
+ virtualStream.streamId = objectPayload.streamId;
+ if (!virtualStream.side && commFunctions.sendMethod) {
+ virtualStream.side = "requesting";
+ virtualStream.sendMethod = commFunctions.sendMethod;
+ }
+ if (!virtualStream.side && commFunctions.typedrouter) {
+ virtualStream.side = "responding";
+ virtualStream.typedrouter = commFunctions.typedrouter;
+ commFunctions.typedrouter.registeredVirtualStreams.add(virtualStream);
+ }
+ virtualStream.startKeepAliveLoop();
+ return virtualStream;
+ } else if (Array.isArray(objectPayload)) {
+ const returnArray = [];
+ for (const item of objectPayload) {
+ returnArray.push(_VirtualStream.decodePayloadFromNetwork(item, commFunctions));
+ }
+ return returnArray;
+ } else {
+ return Object.keys(objectPayload).reduce((acc, key2) => {
+ acc[key2] = _VirtualStream.decodePayloadFromNetwork(objectPayload[key2], commFunctions);
+ return acc;
+ }, {});
+ }
+ } else {
+ return objectPayload;
+ }
+ }
+ constructor() {
+ this.streamId = isounique2.uni();
+ this.keepAlive = true;
+ this.sendBackpressuredArray = new dist_ts_exports6.BackpressuredArray(16);
+ this.receiveBackpressuredArray = new dist_ts_exports6.BackpressuredArray(16);
+ }
+ /**
+ * takes care of sending
+ */
+ async workOnQueue() {
+ if (this.workingDeferred) {
+ return this.workingDeferred.promise;
+ } else {
+ this.workingDeferred = dist_ts_exports.defer();
+ }
+ if (this.side === "requesting") {
+ let thisSideIsBackpressured = !this.receiveBackpressuredArray.checkSpaceAvailable();
+ let otherSideHasNext = false;
+ let otherSideIsBackpressured = false;
+ const getFeedback = async () => {
+ const streamTr = await this.sendMethod({
+ method: "##VirtualStream##",
+ request: {
+ streamId: this.streamId,
+ cycleId: isounique2.uni(),
+ cycle: "request",
+ mainPurpose: "feedback",
+ next: this.sendBackpressuredArray.data.length > 0,
+ backpressure: !this.receiveBackpressuredArray.checkSpaceAvailable()
+ },
+ response: null
+ }).catch(() => {
+ console.log("stream ended immaturely");
+ this.keepAlive = false;
+ });
+ if (streamTr && streamTr.response) {
+ otherSideIsBackpressured = streamTr.response.backpressure;
+ otherSideHasNext = streamTr.response.next;
+ }
+ };
+ await getFeedback();
+ while (this.sendBackpressuredArray.data.length > 0 || otherSideHasNext) {
+ if (otherSideIsBackpressured) {
+ while (otherSideIsBackpressured) {
+ console.log("waiting for feedback because of backpressure...");
+ await dist_ts_exports3.delayFor(50);
+ await getFeedback();
+ }
+ }
+ let dataArg;
+ if (this.sendBackpressuredArray.data.length > 0) {
+ dataArg = this.sendBackpressuredArray.shift();
+ }
+ let streamTr;
+ streamTr = await this.sendMethod({
+ method: "##VirtualStream##",
+ request: {
+ streamId: this.streamId,
+ cycleId: isounique2.uni(),
+ cycle: "request",
+ mainPurpose: dataArg ? "chunk" : "read",
+ backpressure: thisSideIsBackpressured,
+ next: this.sendBackpressuredArray.data.length > 0,
+ ...dataArg ? { chunkData: dataArg } : {}
+ },
+ response: null
+ }).catch(() => {
+ console.log("stream ended immaturely");
+ this.keepAlive = false;
+ return null;
+ });
+ if (streamTr && streamTr.response && streamTr.response.chunkData) {
+ this.receiveBackpressuredArray.push(streamTr.response.chunkData);
+ }
+ otherSideIsBackpressured = streamTr && streamTr.response && streamTr.response.backpressure;
+ thisSideIsBackpressured = !this.receiveBackpressuredArray.checkSpaceAvailable();
+ otherSideHasNext = streamTr && streamTr.response && streamTr.response.next;
+ }
+ }
+ this.workingDeferred.resolve();
+ this.workingDeferred = null;
+ }
+ /**
+ * This method handles the stream only on the responding side
+ * @param streamTrArg
+ * @returns
+ */
+ async handleStreamTr(streamTrArg) {
+ if (streamTrArg.request.keepAlive === true && this.keepAlive === true) {
+ this.lastKeepAliveEvent = Date.now();
+ } else if (streamTrArg.request.keepAlive === false) {
+ this.keepAlive = false;
+ }
+ if (streamTrArg.request.mainPurpose === "keepAlive") {
+ streamTrArg.response = {
+ streamId: this.streamId,
+ cycleId: streamTrArg.request.cycleId,
+ cycle: "response",
+ mainPurpose: "keepAlive",
+ keepAlive: this.keepAlive,
+ next: this.sendBackpressuredArray.data.length > 0,
+ backpressure: !this.receiveBackpressuredArray.checkSpaceAvailable()
+ };
+ }
+ if (streamTrArg.request.mainPurpose === "feedback") {
+ streamTrArg.response = {
+ streamId: this.streamId,
+ cycleId: streamTrArg.request.cycleId,
+ cycle: "response",
+ mainPurpose: "feedback",
+ next: this.sendBackpressuredArray.data.length > 0,
+ backpressure: !this.receiveBackpressuredArray.checkSpaceAvailable()
+ };
+ }
+ if (streamTrArg.request.mainPurpose === "chunk") {
+ this.receiveBackpressuredArray.push(streamTrArg.request.chunkData);
+ if (this.sendBackpressuredArray.data.length > 0 && streamTrArg.response.backpressure === false) {
+ const dataArg = this.sendBackpressuredArray.shift();
+ streamTrArg.response = {
+ streamId: this.streamId,
+ cycleId: streamTrArg.request.cycleId,
+ cycle: "response",
+ mainPurpose: "chunk",
+ next: this.sendBackpressuredArray.data.length > 1,
+ // 1 and not 0 because we call shift a few lines down
+ backpressure: !this.receiveBackpressuredArray.checkSpaceAvailable(),
+ chunkData: this.sendBackpressuredArray.shift()
+ };
+ } else {
+ streamTrArg.response = {
+ streamId: this.streamId,
+ cycleId: streamTrArg.request.cycleId,
+ cycle: "response",
+ mainPurpose: "feedback",
+ next: this.sendBackpressuredArray.data.length > 0,
+ backpressure: !this.receiveBackpressuredArray.checkSpaceAvailable()
+ };
+ }
+ streamTrArg.request = null;
+ }
+ return streamTrArg;
+ }
+ // lifecycle methods
+ /**
+ * closes the virtual stream
+ */
+ async cleanup() {
+ if (this.typedrouter) {
+ this.typedrouter.registeredVirtualStreams.remove(this);
+ }
+ }
+ /**
+ * a keepAlive loop that works across technologies
+ */
+ async startKeepAliveLoop() {
+ if (this.side === "responding") {
+ return;
+ }
+ await dist_ts_exports3.delayFor(0);
+ console.log(`starting keepalive loop on side ${this.side}`);
+ let counter2 = 0;
+ keepAliveLoop: while (this.keepAlive) {
+ await this.triggerKeepAlive();
+ await dist_ts_exports3.delayFor(1e3);
+ }
+ await dist_ts_exports3.delayFor(1e3);
+ await this.cleanup();
+ console.log(`cleaned up for stream ${this.streamId}`);
+ }
+ async triggerKeepAlive() {
+ if (this.side === "requesting") {
+ console.log(`keepalive sent.`);
+ const streamTr = await this.sendMethod({
+ method: "##VirtualStream##",
+ request: {
+ streamId: this.streamId,
+ cycleId: isounique2.uni(),
+ cycle: "request",
+ mainPurpose: "keepAlive",
+ keepAlive: this.keepAlive
+ },
+ response: null
+ }).catch(() => {
+ this.keepAlive = false;
+ });
+ if (streamTr && streamTr.response && streamTr.response.keepAlive === false) {
+ this.keepAlive = false;
+ } else {
+ this.lastKeepAliveEvent = Date.now();
+ }
+ if (streamTr && streamTr.response && streamTr.response.next) {
+ this.workOnQueue();
+ }
+ }
+ if (Date.now() - this.lastKeepAliveEvent > 1e4) {
+ console.log(`closing stream for ${this.streamId}`);
+ this.keepAlive = false;
+ }
+ }
+ // Data sending and receiving
+ async sendData(dataArg) {
+ this.sendBackpressuredArray.push(dataArg);
+ this.workOnQueue();
+ await this.sendBackpressuredArray.waitForSpace();
+ }
+ async fetchData() {
+ if (this.receiveBackpressuredArray.hasSpace) {
+ }
+ await this.receiveBackpressuredArray.waitForItems();
+ const dataPackage = this.receiveBackpressuredArray.shift();
+ return dataPackage;
+ }
+ /**
+ * reads from a Readable and sends it to the other side
+ * @param readableStreamArg
+ */
+ async readFromWebstream(readableStreamArg, closeAfterReading = true) {
+ const reader = readableStreamArg.getReader();
+ let streamIsDone = false;
+ while (!streamIsDone) {
+ const { value: value2, done } = await reader.read();
+ if (value2) {
+ await this.sendData(value2);
+ }
+ streamIsDone = done;
+ }
+ if (closeAfterReading) {
+ await this.close(true);
+ }
+ }
+ async writeToWebstream(writableStreamArg) {
+ const writer = writableStreamArg.getWriter();
+ while (this.keepAlive || this.receiveBackpressuredArray.checkHasItems()) {
+ const value2 = await this.fetchData();
+ if (value2 === closingBit) {
+ writer.releaseLock();
+ await writableStreamArg.close();
+ break;
+ }
+ await writer.write(value2);
+ }
+ }
+ /**
+ * closes the stream
+ * if sendClosingBitArg is true, the stream will send a closing bit
+ * @param sendClosingBitArg
+ */
+ async close(sendClosingBitArg = false) {
+ if (sendClosingBitArg) {
+ this.sendData(closingBit);
+ }
+ this.keepAlive = false;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@api.global+typedrequest@3.2.6/node_modules/@api.global/typedrequest/dist_ts/classes.typedtarget.js
+var TypedTarget;
+var init_classes_typedtarget = __esm({
+ "node_modules/.pnpm/@api.global+typedrequest@3.2.6/node_modules/@api.global/typedrequest/dist_ts/classes.typedtarget.js"() {
+ init_classes_typedrouter();
+ init_plugins();
+ TypedTarget = class {
+ constructor(optionsArg) {
+ if (optionsArg.postMethodWithTypedRouter && !optionsArg.typedRouterRef) {
+ throw new Error("you have to specify a typedrouter when using postmethod with typedrouter");
+ }
+ this.options = optionsArg;
+ }
+ async post(payloadArg) {
+ let responseInterest;
+ if (this.options.typedRouterRef) {
+ responseInterest = await this.options.typedRouterRef.fireEventInterestMap.addInterest(payloadArg.correlation.id, payloadArg);
+ }
+ const postMethod = this.options.postMethod || this.options.postMethodWithTypedRouter;
+ const postMethodReturnValue = await postMethod(payloadArg);
+ let responseBody;
+ if (responseInterest) {
+ responseBody = await responseInterest.interestFullfilled;
+ } else if (postMethodReturnValue) {
+ responseBody = postMethodReturnValue;
+ } else {
+ responseBody = payloadArg;
+ }
+ return responseBody;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@api.global+typedrequest@3.2.6/node_modules/@api.global/typedrequest/dist_ts/classes.typedrequest.js
+function callGlobalHook(hookName, entry) {
+ try {
+ TypedRouter.globalHooks[hookName]?.(entry);
+ } catch (err) {
+ console.error(`TypedRequest hook error (${hookName}):`, err);
+ }
+}
+var webrequestInstance, TypedRequest;
+var init_classes_typedrequest = __esm({
+ "node_modules/.pnpm/@api.global+typedrequest@3.2.6/node_modules/@api.global/typedrequest/dist_ts/classes.typedrequest.js"() {
+ init_plugins();
+ init_classes_virtualstream();
+ init_classes_typedresponseerror();
+ init_classes_typedrouter();
+ init_classes_typedtarget();
+ webrequestInstance = new dist_ts_exports14.WebrequestClient();
+ TypedRequest = class {
+ /**
+ * @param postEndPointArg
+ * @param methodArg
+ */
+ constructor(postTarget, methodArg) {
+ this.skipHooks = false;
+ if (typeof postTarget === "string") {
+ this.urlEndPoint = postTarget;
+ } else {
+ this.typedTarget = postTarget;
+ }
+ this.method = methodArg;
+ }
+ /**
+ * fires the request
+ */
+ async fire(fireArg, useCacheArg = false) {
+ const requestStartTime = Date.now();
+ let payloadSending = {
+ method: this.method,
+ request: fireArg,
+ response: null,
+ correlation: {
+ id: isounique2.uni(),
+ phase: "request"
+ }
+ };
+ payloadSending = VirtualStream.encodePayloadForNetwork(payloadSending, {
+ sendMethod: (payloadArg) => {
+ return this.postTrObject(payloadArg);
+ }
+ });
+ if (!this.skipHooks) {
+ callGlobalHook("onOutgoingRequest", {
+ correlationId: payloadSending.correlation.id,
+ method: this.method,
+ direction: "outgoing",
+ phase: "request",
+ timestamp: requestStartTime,
+ payload: fireArg
+ });
+ }
+ let payloadReceiving;
+ payloadReceiving = await this.postTrObject(payloadSending, useCacheArg);
+ payloadReceiving = VirtualStream.decodePayloadFromNetwork(payloadReceiving, {
+ sendMethod: (payloadArg) => {
+ return this.postTrObject(payloadArg);
+ }
+ });
+ if (!this.skipHooks) {
+ callGlobalHook("onIncomingResponse", {
+ correlationId: payloadSending.correlation.id,
+ method: this.method,
+ direction: "incoming",
+ phase: "response",
+ timestamp: Date.now(),
+ durationMs: Date.now() - requestStartTime,
+ payload: payloadReceiving?.response,
+ error: payloadReceiving?.error?.text
+ });
+ }
+ return payloadReceiving.response;
+ }
+ async postTrObject(payloadSendingArg, useCacheArg = false) {
+ let payloadReceiving;
+ if (this.urlEndPoint) {
+ const response = await webrequestInstance.postJson(this.urlEndPoint, payloadSendingArg, useCacheArg ? { cacheStrategy: "cache-first" } : {});
+ payloadReceiving = response;
+ } else {
+ payloadReceiving = await this.typedTarget.post(payloadSendingArg);
+ }
+ if (payloadReceiving.error) {
+ console.error(`method: >>${this.method}<< got an ERROR: "${payloadReceiving.error.text}" with data ${JSON.stringify(payloadReceiving.error.data, null, 2)}`);
+ if (!payloadReceiving.retry) {
+ throw new TypedResponseError(payloadReceiving.error.text, payloadReceiving.error.data);
+ }
+ return null;
+ }
+ if (payloadReceiving.retry) {
+ console.log(`server requested retry for the following reason: ${payloadReceiving.retry.reason}`);
+ await dist_ts_exports3.delayFor(payloadReceiving.retry.waitForMs);
+ payloadReceiving = await this.postTrObject(payloadSendingArg, useCacheArg);
+ }
+ return payloadReceiving;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@api.global+typedrequest@3.2.6/node_modules/@api.global/typedrequest/dist_ts/index.js
+var dist_ts_exports15 = {};
+__export(dist_ts_exports15, {
+ TypedHandler: () => TypedHandler,
+ TypedRequest: () => TypedRequest,
+ TypedResponseError: () => TypedResponseError,
+ TypedRouter: () => TypedRouter,
+ TypedTarget: () => TypedTarget,
+ VirtualStream: () => VirtualStream
+});
+var init_dist_ts15 = __esm({
+ "node_modules/.pnpm/@api.global+typedrequest@3.2.6/node_modules/@api.global/typedrequest/dist_ts/index.js"() {
+ init_classes_typedrequest();
+ init_classes_typedhandler();
+ init_classes_typedrouter();
+ init_classes_typedresponseerror();
+ init_classes_typedtarget();
+ init_classes_virtualstream();
+ }
+});
+
+// node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/util.js
+function isPromise2(obj) {
+ return obj && typeof obj.then === "function";
+}
+function sleep(time, resolveWith) {
+ if (!time) time = 0;
+ return new Promise(function(res) {
+ return setTimeout(function() {
+ return res(resolveWith);
+ }, time);
+ });
+}
+function randomInt(min3, max3) {
+ return Math.floor(Math.random() * (max3 - min3 + 1) + min3);
+}
+function randomToken() {
+ return Math.random().toString(36).substring(2);
+}
+function microSeconds() {
+ var ret = Date.now() * 1e3;
+ if (ret <= lastMs) {
+ ret = lastMs + 1;
+ }
+ lastMs = ret;
+ return ret;
+}
+function supportsWebLockAPI() {
+ if (typeof navigator !== "undefined" && typeof navigator.locks !== "undefined" && typeof navigator.locks.request === "function") {
+ return true;
+ } else {
+ return false;
+ }
+}
+var PROMISE_RESOLVED_FALSE, PROMISE_RESOLVED_TRUE, PROMISE_RESOLVED_VOID, lastMs;
+var init_util = __esm({
+ "node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/util.js"() {
+ PROMISE_RESOLVED_FALSE = Promise.resolve(false);
+ PROMISE_RESOLVED_TRUE = Promise.resolve(true);
+ PROMISE_RESOLVED_VOID = Promise.resolve();
+ lastMs = 0;
+ }
+});
+
+// node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/methods/native.js
+function create(channelName) {
+ var state = {
+ time: microSeconds(),
+ messagesCallback: null,
+ bc: new BroadcastChannel(channelName),
+ subFns: []
+ // subscriberFunctions
+ };
+ state.bc.onmessage = function(msgEvent) {
+ if (state.messagesCallback) {
+ state.messagesCallback(msgEvent.data);
+ }
+ };
+ return state;
+}
+function close(channelState) {
+ channelState.bc.close();
+ channelState.subFns = [];
+}
+function postMessage(channelState, messageJson) {
+ try {
+ channelState.bc.postMessage(messageJson, false);
+ return PROMISE_RESOLVED_VOID;
+ } catch (err) {
+ return Promise.reject(err);
+ }
+}
+function onMessage(channelState, fn) {
+ channelState.messagesCallback = fn;
+}
+function canBeUsed() {
+ if (typeof globalThis !== "undefined" && globalThis.Deno && globalThis.Deno.args) {
+ return true;
+ }
+ if ((typeof window !== "undefined" || typeof self !== "undefined") && typeof BroadcastChannel === "function") {
+ if (BroadcastChannel._pubkey) {
+ throw new Error("BroadcastChannel: Do not overwrite window.BroadcastChannel with this module, this is not a polyfill");
+ }
+ return true;
+ } else {
+ return false;
+ }
+}
+function averageResponseTime() {
+ return 150;
+}
+var microSeconds2, type, NativeMethod;
+var init_native = __esm({
+ "node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/methods/native.js"() {
+ init_util();
+ microSeconds2 = microSeconds;
+ type = "native";
+ NativeMethod = {
+ create,
+ close,
+ onMessage,
+ postMessage,
+ canBeUsed,
+ type,
+ averageResponseTime,
+ microSeconds: microSeconds2
+ };
+ }
+});
+
+// node_modules/.pnpm/oblivious-set@2.0.0/node_modules/oblivious-set/dist/esm/src/index.js
+function removeTooOldValues(obliviousSet) {
+ const olderThen = now() - obliviousSet.ttl;
+ const iterator2 = obliviousSet.map[Symbol.iterator]();
+ while (true) {
+ const next2 = iterator2.next().value;
+ if (!next2) {
+ break;
+ }
+ const value2 = next2[0];
+ const time = next2[1];
+ if (time < olderThen) {
+ obliviousSet.map.delete(value2);
+ } else {
+ break;
+ }
+ }
+}
+function now() {
+ return Date.now();
+}
+var ObliviousSet;
+var init_src = __esm({
+ "node_modules/.pnpm/oblivious-set@2.0.0/node_modules/oblivious-set/dist/esm/src/index.js"() {
+ ObliviousSet = class {
+ ttl;
+ map = /* @__PURE__ */ new Map();
+ /**
+ * Creating calls to setTimeout() is expensive,
+ * so we only do that if there is not timeout already open.
+ */
+ _to = false;
+ constructor(ttl) {
+ this.ttl = ttl;
+ }
+ has(value2) {
+ const valueTime = this.map.get(value2);
+ if (typeof valueTime === "undefined") {
+ return false;
+ }
+ if (valueTime < now() - this.ttl) {
+ this.map.delete(value2);
+ return false;
+ }
+ return true;
+ }
+ add(value2) {
+ this.map.delete(value2);
+ this.map.set(value2, now());
+ if (!this._to) {
+ this._to = true;
+ setTimeout(() => {
+ this._to = false;
+ removeTooOldValues(this);
+ }, 0);
+ }
+ }
+ clear() {
+ this.map.clear();
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/options.js
+function fillOptionsWithDefaults() {
+ var originalOptions = arguments.length > 0 && arguments[0] !== void 0 ? arguments[0] : {};
+ var options = JSON.parse(JSON.stringify(originalOptions));
+ if (typeof options.webWorkerSupport === "undefined") options.webWorkerSupport = true;
+ if (!options.idb) options.idb = {};
+ if (!options.idb.ttl) options.idb.ttl = 1e3 * 45;
+ if (!options.idb.fallbackInterval) options.idb.fallbackInterval = 150;
+ if (originalOptions.idb && typeof originalOptions.idb.onclose === "function") options.idb.onclose = originalOptions.idb.onclose;
+ if (!options.localstorage) options.localstorage = {};
+ if (!options.localstorage.removeTimeout) options.localstorage.removeTimeout = 1e3 * 60;
+ if (originalOptions.methods) options.methods = originalOptions.methods;
+ if (!options.node) options.node = {};
+ if (!options.node.ttl) options.node.ttl = 1e3 * 60 * 2;
+ if (!options.node.maxParallelWrites) options.node.maxParallelWrites = 2048;
+ if (typeof options.node.useFastPath === "undefined") options.node.useFastPath = true;
+ return options;
+}
+var init_options = __esm({
+ "node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/options.js"() {
+ }
+});
+
+// node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/methods/indexed-db.js
+function getIdb() {
+ if (typeof indexedDB !== "undefined") return indexedDB;
+ if (typeof window !== "undefined") {
+ if (typeof window.mozIndexedDB !== "undefined") return window.mozIndexedDB;
+ if (typeof window.webkitIndexedDB !== "undefined") return window.webkitIndexedDB;
+ if (typeof window.msIndexedDB !== "undefined") return window.msIndexedDB;
+ }
+ return false;
+}
+function commitIndexedDBTransaction(tx) {
+ if (tx.commit) {
+ tx.commit();
+ }
+}
+function createDatabase(channelName) {
+ var IndexedDB = getIdb();
+ var dbName = DB_PREFIX + channelName;
+ var openRequest = IndexedDB.open(dbName);
+ openRequest.onupgradeneeded = function(ev) {
+ var db = ev.target.result;
+ db.createObjectStore(OBJECT_STORE_ID, {
+ keyPath: "id",
+ autoIncrement: true
+ });
+ };
+ return new Promise(function(res, rej) {
+ openRequest.onerror = function(ev) {
+ return rej(ev);
+ };
+ openRequest.onsuccess = function() {
+ res(openRequest.result);
+ };
+ });
+}
+function writeMessage(db, readerUuid, messageJson) {
+ var time = Date.now();
+ var writeObject = {
+ uuid: readerUuid,
+ time,
+ data: messageJson
+ };
+ var tx = db.transaction([OBJECT_STORE_ID], "readwrite", TRANSACTION_SETTINGS);
+ return new Promise(function(res, rej) {
+ tx.oncomplete = function() {
+ return res();
+ };
+ tx.onerror = function(ev) {
+ return rej(ev);
+ };
+ var objectStore = tx.objectStore(OBJECT_STORE_ID);
+ objectStore.add(writeObject);
+ commitIndexedDBTransaction(tx);
+ });
+}
+function getAllMessages(db) {
+ var tx = db.transaction(OBJECT_STORE_ID, "readonly", TRANSACTION_SETTINGS);
+ var objectStore = tx.objectStore(OBJECT_STORE_ID);
+ var ret = [];
+ return new Promise(function(res) {
+ objectStore.openCursor().onsuccess = function(ev) {
+ var cursor = ev.target.result;
+ if (cursor) {
+ ret.push(cursor.value);
+ cursor["continue"]();
+ } else {
+ commitIndexedDBTransaction(tx);
+ res(ret);
+ }
+ };
+ });
+}
+function getMessagesHigherThan(db, lastCursorId) {
+ var tx = db.transaction(OBJECT_STORE_ID, "readonly", TRANSACTION_SETTINGS);
+ var objectStore = tx.objectStore(OBJECT_STORE_ID);
+ var ret = [];
+ var keyRangeValue = IDBKeyRange.bound(lastCursorId + 1, Infinity);
+ if (objectStore.getAll) {
+ var getAllRequest = objectStore.getAll(keyRangeValue);
+ return new Promise(function(res, rej) {
+ getAllRequest.onerror = function(err) {
+ return rej(err);
+ };
+ getAllRequest.onsuccess = function(e11) {
+ res(e11.target.result);
+ };
+ });
+ }
+ function openCursor() {
+ try {
+ keyRangeValue = IDBKeyRange.bound(lastCursorId + 1, Infinity);
+ return objectStore.openCursor(keyRangeValue);
+ } catch (e11) {
+ return objectStore.openCursor();
+ }
+ }
+ return new Promise(function(res, rej) {
+ var openCursorRequest = openCursor();
+ openCursorRequest.onerror = function(err) {
+ return rej(err);
+ };
+ openCursorRequest.onsuccess = function(ev) {
+ var cursor = ev.target.result;
+ if (cursor) {
+ if (cursor.value.id < lastCursorId + 1) {
+ cursor["continue"](lastCursorId + 1);
+ } else {
+ ret.push(cursor.value);
+ cursor["continue"]();
+ }
+ } else {
+ commitIndexedDBTransaction(tx);
+ res(ret);
+ }
+ };
+ });
+}
+function removeMessagesById(channelState, ids) {
+ if (channelState.closed) {
+ return Promise.resolve([]);
+ }
+ var tx = channelState.db.transaction(OBJECT_STORE_ID, "readwrite", TRANSACTION_SETTINGS);
+ var objectStore = tx.objectStore(OBJECT_STORE_ID);
+ return Promise.all(ids.map(function(id) {
+ var deleteRequest = objectStore["delete"](id);
+ return new Promise(function(res) {
+ deleteRequest.onsuccess = function() {
+ return res();
+ };
+ });
+ }));
+}
+function getOldMessages(db, ttl) {
+ var olderThen = Date.now() - ttl;
+ var tx = db.transaction(OBJECT_STORE_ID, "readonly", TRANSACTION_SETTINGS);
+ var objectStore = tx.objectStore(OBJECT_STORE_ID);
+ var ret = [];
+ return new Promise(function(res) {
+ objectStore.openCursor().onsuccess = function(ev) {
+ var cursor = ev.target.result;
+ if (cursor) {
+ var msgObk = cursor.value;
+ if (msgObk.time < olderThen) {
+ ret.push(msgObk);
+ cursor["continue"]();
+ } else {
+ commitIndexedDBTransaction(tx);
+ res(ret);
+ }
+ } else {
+ res(ret);
+ }
+ };
+ });
+}
+function cleanOldMessages(channelState) {
+ return getOldMessages(channelState.db, channelState.options.idb.ttl).then(function(tooOld) {
+ return removeMessagesById(channelState, tooOld.map(function(msg) {
+ return msg.id;
+ }));
+ });
+}
+function create2(channelName, options) {
+ options = fillOptionsWithDefaults(options);
+ return createDatabase(channelName).then(function(db) {
+ var state = {
+ closed: false,
+ lastCursorId: 0,
+ channelName,
+ options,
+ uuid: randomToken(),
+ /**
+ * emittedMessagesIds
+ * contains all messages that have been emitted before
+ * @type {ObliviousSet}
+ */
+ eMIs: new ObliviousSet(options.idb.ttl * 2),
+ // ensures we do not read messages in parallel
+ writeBlockPromise: PROMISE_RESOLVED_VOID,
+ messagesCallback: null,
+ readQueuePromises: [],
+ db
+ };
+ db.onclose = function() {
+ state.closed = true;
+ if (options.idb.onclose) options.idb.onclose();
+ };
+ _readLoop(state);
+ return state;
+ });
+}
+function _readLoop(state) {
+ if (state.closed) return;
+ readNewMessages(state).then(function() {
+ return sleep(state.options.idb.fallbackInterval);
+ }).then(function() {
+ return _readLoop(state);
+ });
+}
+function _filterMessage(msgObj, state) {
+ if (msgObj.uuid === state.uuid) return false;
+ if (state.eMIs.has(msgObj.id)) return false;
+ if (msgObj.data.time < state.messagesCallbackTime) return false;
+ return true;
+}
+function readNewMessages(state) {
+ if (state.closed) return PROMISE_RESOLVED_VOID;
+ if (!state.messagesCallback) return PROMISE_RESOLVED_VOID;
+ return getMessagesHigherThan(state.db, state.lastCursorId).then(function(newerMessages) {
+ var useMessages = newerMessages.filter(function(msgObj) {
+ return !!msgObj;
+ }).map(function(msgObj) {
+ if (msgObj.id > state.lastCursorId) {
+ state.lastCursorId = msgObj.id;
+ }
+ return msgObj;
+ }).filter(function(msgObj) {
+ return _filterMessage(msgObj, state);
+ }).sort(function(msgObjA, msgObjB) {
+ return msgObjA.time - msgObjB.time;
+ });
+ useMessages.forEach(function(msgObj) {
+ if (state.messagesCallback) {
+ state.eMIs.add(msgObj.id);
+ state.messagesCallback(msgObj.data);
+ }
+ });
+ return PROMISE_RESOLVED_VOID;
+ });
+}
+function close2(channelState) {
+ channelState.closed = true;
+ channelState.db.close();
+}
+function postMessage2(channelState, messageJson) {
+ channelState.writeBlockPromise = channelState.writeBlockPromise.then(function() {
+ return writeMessage(channelState.db, channelState.uuid, messageJson);
+ }).then(function() {
+ if (randomInt(0, 10) === 0) {
+ cleanOldMessages(channelState);
+ }
+ });
+ return channelState.writeBlockPromise;
+}
+function onMessage2(channelState, fn, time) {
+ channelState.messagesCallbackTime = time;
+ channelState.messagesCallback = fn;
+ readNewMessages(channelState);
+}
+function canBeUsed2() {
+ return !!getIdb();
+}
+function averageResponseTime2(options) {
+ return options.idb.fallbackInterval * 2;
+}
+var microSeconds3, DB_PREFIX, OBJECT_STORE_ID, TRANSACTION_SETTINGS, type2, IndexedDBMethod;
+var init_indexed_db = __esm({
+ "node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/methods/indexed-db.js"() {
+ init_util();
+ init_src();
+ init_options();
+ microSeconds3 = microSeconds;
+ DB_PREFIX = "pubkey.broadcast-channel-0-";
+ OBJECT_STORE_ID = "messages";
+ TRANSACTION_SETTINGS = {
+ durability: "relaxed"
+ };
+ type2 = "idb";
+ IndexedDBMethod = {
+ create: create2,
+ close: close2,
+ onMessage: onMessage2,
+ postMessage: postMessage2,
+ canBeUsed: canBeUsed2,
+ type: type2,
+ averageResponseTime: averageResponseTime2,
+ microSeconds: microSeconds3
+ };
+ }
+});
+
+// node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/methods/localstorage.js
+function getLocalStorage() {
+ var localStorage2;
+ if (typeof window === "undefined") return null;
+ try {
+ localStorage2 = window.localStorage;
+ localStorage2 = window["ie8-eventlistener/storage"] || window.localStorage;
+ } catch (e11) {
+ }
+ return localStorage2;
+}
+function storageKey(channelName) {
+ return KEY_PREFIX + channelName;
+}
+function postMessage3(channelState, messageJson) {
+ return new Promise(function(res) {
+ sleep().then(function() {
+ var key2 = storageKey(channelState.channelName);
+ var writeObj = {
+ token: randomToken(),
+ time: Date.now(),
+ data: messageJson,
+ uuid: channelState.uuid
+ };
+ var value2 = JSON.stringify(writeObj);
+ getLocalStorage().setItem(key2, value2);
+ var ev = document.createEvent("Event");
+ ev.initEvent("storage", true, true);
+ ev.key = key2;
+ ev.newValue = value2;
+ window.dispatchEvent(ev);
+ res();
+ });
+ });
+}
+function addStorageEventListener(channelName, fn) {
+ var key2 = storageKey(channelName);
+ var listener2 = function listener3(ev) {
+ if (ev.key === key2) {
+ fn(JSON.parse(ev.newValue));
+ }
+ };
+ window.addEventListener("storage", listener2);
+ return listener2;
+}
+function removeStorageEventListener(listener2) {
+ window.removeEventListener("storage", listener2);
+}
+function create3(channelName, options) {
+ options = fillOptionsWithDefaults(options);
+ if (!canBeUsed3()) {
+ throw new Error("BroadcastChannel: localstorage cannot be used");
+ }
+ var uuid = randomToken();
+ var eMIs = new ObliviousSet(options.localstorage.removeTimeout);
+ var state = {
+ channelName,
+ uuid,
+ eMIs
+ // emittedMessagesIds
+ };
+ state.listener = addStorageEventListener(channelName, function(msgObj) {
+ if (!state.messagesCallback) return;
+ if (msgObj.uuid === uuid) return;
+ if (!msgObj.token || eMIs.has(msgObj.token)) return;
+ if (msgObj.data.time && msgObj.data.time < state.messagesCallbackTime) return;
+ eMIs.add(msgObj.token);
+ state.messagesCallback(msgObj.data);
+ });
+ return state;
+}
+function close3(channelState) {
+ removeStorageEventListener(channelState.listener);
+}
+function onMessage3(channelState, fn, time) {
+ channelState.messagesCallbackTime = time;
+ channelState.messagesCallback = fn;
+}
+function canBeUsed3() {
+ var ls = getLocalStorage();
+ if (!ls) return false;
+ try {
+ var key2 = "__broadcastchannel_check";
+ ls.setItem(key2, "works");
+ ls.removeItem(key2);
+ } catch (e11) {
+ return false;
+ }
+ return true;
+}
+function averageResponseTime3() {
+ var defaultTime = 120;
+ var userAgent2 = navigator.userAgent.toLowerCase();
+ if (userAgent2.includes("safari") && !userAgent2.includes("chrome")) {
+ return defaultTime * 2;
+ }
+ return defaultTime;
+}
+var microSeconds4, KEY_PREFIX, type3, LocalstorageMethod;
+var init_localstorage = __esm({
+ "node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/methods/localstorage.js"() {
+ init_src();
+ init_options();
+ init_util();
+ microSeconds4 = microSeconds;
+ KEY_PREFIX = "pubkey.broadcastChannel-";
+ type3 = "localstorage";
+ LocalstorageMethod = {
+ create: create3,
+ close: close3,
+ onMessage: onMessage3,
+ postMessage: postMessage3,
+ canBeUsed: canBeUsed3,
+ type: type3,
+ averageResponseTime: averageResponseTime3,
+ microSeconds: microSeconds4
+ };
+ }
+});
+
+// node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/methods/simulate.js
+function create4(channelName) {
+ var state = {
+ time: microSeconds5(),
+ name: channelName,
+ messagesCallback: null
+ };
+ SIMULATE_CHANNELS.add(state);
+ return state;
+}
+function close4(channelState) {
+ SIMULATE_CHANNELS["delete"](channelState);
+}
+function postMessage4(channelState, messageJson) {
+ return new Promise(function(res) {
+ return setTimeout(function() {
+ var channelArray = Array.from(SIMULATE_CHANNELS);
+ channelArray.forEach(function(channel) {
+ if (channel.name === channelState.name && // has same name
+ channel !== channelState && // not own channel
+ !!channel.messagesCallback && // has subscribers
+ channel.time < messageJson.time) {
+ channel.messagesCallback(messageJson);
+ }
+ });
+ res();
+ }, SIMULATE_DELAY_TIME);
+ });
+}
+function onMessage4(channelState, fn) {
+ channelState.messagesCallback = fn;
+}
+function canBeUsed4() {
+ return true;
+}
+function averageResponseTime4() {
+ return SIMULATE_DELAY_TIME;
+}
+var microSeconds5, type4, SIMULATE_CHANNELS, SIMULATE_DELAY_TIME, SimulateMethod;
+var init_simulate = __esm({
+ "node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/methods/simulate.js"() {
+ init_util();
+ microSeconds5 = microSeconds;
+ type4 = "simulate";
+ SIMULATE_CHANNELS = /* @__PURE__ */ new Set();
+ SIMULATE_DELAY_TIME = 5;
+ SimulateMethod = {
+ create: create4,
+ close: close4,
+ onMessage: onMessage4,
+ postMessage: postMessage4,
+ canBeUsed: canBeUsed4,
+ type: type4,
+ averageResponseTime: averageResponseTime4,
+ microSeconds: microSeconds5
+ };
+ }
+});
+
+// node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/method-chooser.js
+function chooseMethod(options) {
+ var chooseMethods = [].concat(options.methods, METHODS).filter(Boolean);
+ if (options.type) {
+ if (options.type === "simulate") {
+ return SimulateMethod;
+ }
+ var ret = chooseMethods.find(function(m6) {
+ return m6.type === options.type;
+ });
+ if (!ret) throw new Error("method-type " + options.type + " not found");
+ else return ret;
+ }
+ if (!options.webWorkerSupport) {
+ chooseMethods = chooseMethods.filter(function(m6) {
+ return m6.type !== "idb";
+ });
+ }
+ var useMethod = chooseMethods.find(function(method) {
+ return method.canBeUsed();
+ });
+ if (!useMethod) {
+ throw new Error("No usable method found in " + JSON.stringify(METHODS.map(function(m6) {
+ return m6.type;
+ })));
+ } else {
+ return useMethod;
+ }
+}
+var METHODS;
+var init_method_chooser = __esm({
+ "node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/method-chooser.js"() {
+ init_native();
+ init_indexed_db();
+ init_localstorage();
+ init_simulate();
+ METHODS = [
+ NativeMethod,
+ // fastest
+ IndexedDBMethod,
+ LocalstorageMethod
+ ];
+ }
+});
+
+// node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/broadcast-channel.js
+function clearNodeFolder(options) {
+ options = fillOptionsWithDefaults(options);
+ var method = chooseMethod(options);
+ if (method.type === "node") {
+ return method.clearNodeFolder().then(function() {
+ return true;
+ });
+ } else {
+ return PROMISE_RESOLVED_FALSE;
+ }
+}
+function enforceOptions(options) {
+ ENFORCED_OPTIONS = options;
+}
+function _post(broadcastChannel, type5, msg) {
+ var time = broadcastChannel.method.microSeconds();
+ var msgObj = {
+ time,
+ type: type5,
+ data: msg
+ };
+ var awaitPrepare = broadcastChannel._prepP ? broadcastChannel._prepP : PROMISE_RESOLVED_VOID;
+ return awaitPrepare.then(function() {
+ var sendPromise = broadcastChannel.method.postMessage(broadcastChannel._state, msgObj);
+ broadcastChannel._uMP.add(sendPromise);
+ sendPromise["catch"]().then(function() {
+ return broadcastChannel._uMP["delete"](sendPromise);
+ });
+ return sendPromise;
+ });
+}
+function _prepareChannel(channel) {
+ var maybePromise = channel.method.create(channel.name, channel.options);
+ if (isPromise2(maybePromise)) {
+ channel._prepP = maybePromise;
+ maybePromise.then(function(s10) {
+ channel._state = s10;
+ });
+ } else {
+ channel._state = maybePromise;
+ }
+}
+function _hasMessageListeners(channel) {
+ if (channel._addEL.message.length > 0) return true;
+ if (channel._addEL.internal.length > 0) return true;
+ return false;
+}
+function _addListenerObject(channel, type5, obj) {
+ channel._addEL[type5].push(obj);
+ _startListening(channel);
+}
+function _removeListenerObject(channel, type5, obj) {
+ channel._addEL[type5] = channel._addEL[type5].filter(function(o13) {
+ return o13 !== obj;
+ });
+ _stopListening(channel);
+}
+function _startListening(channel) {
+ if (!channel._iL && _hasMessageListeners(channel)) {
+ var listenerFn = function listenerFn2(msgObj) {
+ channel._addEL[msgObj.type].forEach(function(listenerObject) {
+ if (msgObj.time >= listenerObject.time) {
+ listenerObject.fn(msgObj.data);
+ }
+ });
+ };
+ var time = channel.method.microSeconds();
+ if (channel._prepP) {
+ channel._prepP.then(function() {
+ channel._iL = true;
+ channel.method.onMessage(channel._state, listenerFn, time);
+ });
+ } else {
+ channel._iL = true;
+ channel.method.onMessage(channel._state, listenerFn, time);
+ }
+ }
+}
+function _stopListening(channel) {
+ if (channel._iL && !_hasMessageListeners(channel)) {
+ channel._iL = false;
+ var time = channel.method.microSeconds();
+ channel.method.onMessage(channel._state, null, time);
+ }
+}
+var OPEN_BROADCAST_CHANNELS, lastId, BroadcastChannel2, ENFORCED_OPTIONS;
+var init_broadcast_channel = __esm({
+ "node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/broadcast-channel.js"() {
+ init_util();
+ init_method_chooser();
+ init_options();
+ OPEN_BROADCAST_CHANNELS = /* @__PURE__ */ new Set();
+ lastId = 0;
+ BroadcastChannel2 = function BroadcastChannel3(name, options) {
+ this.id = lastId++;
+ OPEN_BROADCAST_CHANNELS.add(this);
+ this.name = name;
+ if (ENFORCED_OPTIONS) {
+ options = ENFORCED_OPTIONS;
+ }
+ this.options = fillOptionsWithDefaults(options);
+ this.method = chooseMethod(this.options);
+ this._iL = false;
+ this._onML = null;
+ this._addEL = {
+ message: [],
+ internal: []
+ };
+ this._uMP = /* @__PURE__ */ new Set();
+ this._befC = [];
+ this._prepP = null;
+ _prepareChannel(this);
+ };
+ BroadcastChannel2._pubkey = true;
+ BroadcastChannel2.prototype = {
+ postMessage: function postMessage5(msg) {
+ if (this.closed) {
+ throw new Error("BroadcastChannel.postMessage(): Cannot post message after channel has closed " + /**
+ * In the past when this error appeared, it was really hard to debug.
+ * So now we log the msg together with the error so it at least
+ * gives some clue about where in your application this happens.
+ */
+ JSON.stringify(msg));
+ }
+ return _post(this, "message", msg);
+ },
+ postInternal: function postInternal(msg) {
+ return _post(this, "internal", msg);
+ },
+ set onmessage(fn) {
+ var time = this.method.microSeconds();
+ var listenObj = {
+ time,
+ fn
+ };
+ _removeListenerObject(this, "message", this._onML);
+ if (fn && typeof fn === "function") {
+ this._onML = listenObj;
+ _addListenerObject(this, "message", listenObj);
+ } else {
+ this._onML = null;
+ }
+ },
+ addEventListener: function addEventListener(type5, fn) {
+ var time = this.method.microSeconds();
+ var listenObj = {
+ time,
+ fn
+ };
+ _addListenerObject(this, type5, listenObj);
+ },
+ removeEventListener: function removeEventListener(type5, fn) {
+ var obj = this._addEL[type5].find(function(obj2) {
+ return obj2.fn === fn;
+ });
+ _removeListenerObject(this, type5, obj);
+ },
+ close: function close5() {
+ var _this = this;
+ if (this.closed) {
+ return;
+ }
+ OPEN_BROADCAST_CHANNELS["delete"](this);
+ this.closed = true;
+ var awaitPrepare = this._prepP ? this._prepP : PROMISE_RESOLVED_VOID;
+ this._onML = null;
+ this._addEL.message = [];
+ return awaitPrepare.then(function() {
+ return Promise.all(Array.from(_this._uMP));
+ }).then(function() {
+ return Promise.all(_this._befC.map(function(fn) {
+ return fn();
+ }));
+ }).then(function() {
+ return _this.method.close(_this._state);
+ });
+ },
+ get type() {
+ return this.method.type;
+ },
+ get isClosed() {
+ return this.closed;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/unload@2.4.1/node_modules/unload/dist/es/browser.js
+function addBrowser(fn) {
+ if (typeof WorkerGlobalScope === "function" && self instanceof WorkerGlobalScope) {
+ var oldClose = self.close.bind(self);
+ self.close = function() {
+ fn();
+ return oldClose();
+ };
+ } else {
+ if (typeof window.addEventListener !== "function") {
+ return;
+ }
+ window.addEventListener("beforeunload", function() {
+ fn();
+ }, true);
+ window.addEventListener("unload", function() {
+ fn();
+ }, true);
+ }
+}
+var init_browser = __esm({
+ "node_modules/.pnpm/unload@2.4.1/node_modules/unload/dist/es/browser.js"() {
+ }
+});
+
+// node_modules/.pnpm/unload@2.4.1/node_modules/unload/dist/es/node.js
+function addNode(fn) {
+ process.on("exit", function() {
+ return fn();
+ });
+ process.on("beforeExit", function() {
+ return fn().then(function() {
+ return process.exit();
+ });
+ });
+ process.on("SIGINT", function() {
+ return fn().then(function() {
+ return process.exit();
+ });
+ });
+ process.on("uncaughtException", function(err) {
+ return fn().then(function() {
+ console.trace(err);
+ process.exit(101);
+ });
+ });
+}
+var init_node = __esm({
+ "node_modules/.pnpm/unload@2.4.1/node_modules/unload/dist/es/node.js"() {
+ }
+});
+
+// node_modules/.pnpm/unload@2.4.1/node_modules/unload/dist/es/index.js
+function startListening() {
+ if (startedListening) {
+ return;
+ }
+ startedListening = true;
+ USE_METHOD(runAll);
+}
+function add2(fn) {
+ startListening();
+ if (typeof fn !== "function") {
+ throw new Error("Listener is no function");
+ }
+ LISTENERS.add(fn);
+ var addReturn = {
+ remove: function remove2() {
+ return LISTENERS["delete"](fn);
+ },
+ run: function run() {
+ LISTENERS["delete"](fn);
+ return fn();
+ }
+ };
+ return addReturn;
+}
+function runAll() {
+ var promises = [];
+ LISTENERS.forEach(function(fn) {
+ promises.push(fn());
+ LISTENERS["delete"](fn);
+ });
+ return Promise.all(promises);
+}
+function removeAll() {
+ LISTENERS.clear();
+}
+function getSize() {
+ return LISTENERS.size;
+}
+var isNode, USE_METHOD, LISTENERS, startedListening;
+var init_es = __esm({
+ "node_modules/.pnpm/unload@2.4.1/node_modules/unload/dist/es/index.js"() {
+ init_browser();
+ init_node();
+ isNode = Object.prototype.toString.call(typeof process !== "undefined" ? process : 0) === "[object process]";
+ USE_METHOD = isNode ? addNode : addBrowser;
+ LISTENERS = /* @__PURE__ */ new Set();
+ startedListening = false;
+ }
+});
+
+// node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/leader-election-util.js
+function sendLeaderMessage(leaderElector, action) {
+ var msgJson = {
+ context: "leader",
+ action,
+ token: leaderElector.token
+ };
+ return leaderElector.broadcastChannel.postInternal(msgJson);
+}
+function beLeader(leaderElector) {
+ leaderElector.isLeader = true;
+ leaderElector._hasLeader = true;
+ var unloadFn = add2(function() {
+ return leaderElector.die();
+ });
+ leaderElector._unl.push(unloadFn);
+ var isLeaderListener = function isLeaderListener2(msg) {
+ if (msg.context === "leader" && msg.action === "apply") {
+ sendLeaderMessage(leaderElector, "tell");
+ }
+ if (msg.context === "leader" && msg.action === "tell" && !leaderElector._dpLC) {
+ leaderElector._dpLC = true;
+ leaderElector._dpL();
+ sendLeaderMessage(leaderElector, "tell");
+ }
+ };
+ leaderElector.broadcastChannel.addEventListener("internal", isLeaderListener);
+ leaderElector._lstns.push(isLeaderListener);
+ return sendLeaderMessage(leaderElector, "tell");
+}
+var init_leader_election_util = __esm({
+ "node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/leader-election-util.js"() {
+ init_es();
+ }
+});
+
+// node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/leader-election-web-lock.js
+var LeaderElectionWebLock, LEADER_DIE_ABORT_SIGNAL_MESSAGE;
+var init_leader_election_web_lock = __esm({
+ "node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/leader-election-web-lock.js"() {
+ init_util();
+ init_leader_election_util();
+ LeaderElectionWebLock = function LeaderElectionWebLock2(broadcastChannel, options) {
+ var _this = this;
+ this.broadcastChannel = broadcastChannel;
+ broadcastChannel._befC.push(function() {
+ return _this.die();
+ });
+ this._options = options;
+ this.isLeader = false;
+ this.isDead = false;
+ this.token = randomToken();
+ this._lstns = [];
+ this._unl = [];
+ this._dpL = function() {
+ };
+ this._dpLC = false;
+ this._wKMC = {};
+ this.lN = "pubkey-bc||" + broadcastChannel.method.type + "||" + broadcastChannel.name;
+ };
+ LEADER_DIE_ABORT_SIGNAL_MESSAGE = "LeaderElectionWebLock.die() called";
+ LeaderElectionWebLock.prototype = {
+ hasLeader: function hasLeader() {
+ var _this2 = this;
+ return navigator.locks.query().then(function(locks) {
+ var relevantLocks = locks.held ? locks.held.filter(function(lock) {
+ return lock.name === _this2.lN;
+ }) : [];
+ if (relevantLocks && relevantLocks.length > 0) {
+ return true;
+ } else {
+ return false;
+ }
+ });
+ },
+ awaitLeadership: function awaitLeadership() {
+ var _this3 = this;
+ if (!this._wLMP) {
+ this._wKMC.c = new AbortController();
+ var returnPromise = new Promise(function(res, rej) {
+ _this3._wKMC.res = res;
+ _this3._wKMC.rej = rej;
+ });
+ this._wLMP = new Promise(function(res, reject) {
+ navigator.locks.request(_this3.lN, {
+ signal: _this3._wKMC.c.signal
+ }, function() {
+ _this3._wKMC.c = void 0;
+ beLeader(_this3);
+ res();
+ return returnPromise;
+ })["catch"](function(err) {
+ if (err.message && err.message === LEADER_DIE_ABORT_SIGNAL_MESSAGE) {
+ } else {
+ if (_this3._wKMC.rej) {
+ _this3._wKMC.rej(err);
+ }
+ reject(err);
+ }
+ });
+ });
+ }
+ return this._wLMP;
+ },
+ set onduplicate(_fn) {
+ },
+ die: function die() {
+ var _this4 = this;
+ this._lstns.forEach(function(listener2) {
+ return _this4.broadcastChannel.removeEventListener("internal", listener2);
+ });
+ this._lstns = [];
+ this._unl.forEach(function(uFn) {
+ return uFn.remove();
+ });
+ this._unl = [];
+ if (this.isLeader) {
+ this.isLeader = false;
+ }
+ this.isDead = true;
+ if (this._wKMC.res) {
+ this._wKMC.res();
+ }
+ if (this._wKMC.c) {
+ this._wKMC.c.abort(new Error(LEADER_DIE_ABORT_SIGNAL_MESSAGE));
+ }
+ return sendLeaderMessage(this, "death");
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/leader-election.js
+function _awaitLeadershipOnce(leaderElector) {
+ if (leaderElector.isLeader) {
+ return PROMISE_RESOLVED_VOID;
+ }
+ return new Promise(function(res) {
+ var resolved2 = false;
+ function finish() {
+ if (resolved2) {
+ return;
+ }
+ resolved2 = true;
+ leaderElector.broadcastChannel.removeEventListener("internal", whenDeathListener);
+ res(true);
+ }
+ leaderElector.applyOnce().then(function() {
+ if (leaderElector.isLeader) {
+ finish();
+ }
+ });
+ var _tryOnFallBack = function tryOnFallBack() {
+ return sleep(leaderElector._options.fallbackInterval).then(function() {
+ if (leaderElector.isDead || resolved2) {
+ return;
+ }
+ if (leaderElector.isLeader) {
+ finish();
+ } else {
+ return leaderElector.applyOnce(true).then(function() {
+ if (leaderElector.isLeader) {
+ finish();
+ } else {
+ _tryOnFallBack();
+ }
+ });
+ }
+ });
+ };
+ _tryOnFallBack();
+ var whenDeathListener = function whenDeathListener2(msg) {
+ if (msg.context === "leader" && msg.action === "death") {
+ leaderElector._hasLeader = false;
+ leaderElector.applyOnce().then(function() {
+ if (leaderElector.isLeader) {
+ finish();
+ }
+ });
+ }
+ };
+ leaderElector.broadcastChannel.addEventListener("internal", whenDeathListener);
+ leaderElector._lstns.push(whenDeathListener);
+ });
+}
+function fillOptionsWithDefaults2(options, channel) {
+ if (!options) options = {};
+ options = JSON.parse(JSON.stringify(options));
+ if (!options.fallbackInterval) {
+ options.fallbackInterval = 3e3;
+ }
+ if (!options.responseTime) {
+ options.responseTime = channel.method.averageResponseTime(channel.options);
+ }
+ return options;
+}
+function createLeaderElection(channel, options) {
+ if (channel._leaderElector) {
+ throw new Error("BroadcastChannel already has a leader-elector");
+ }
+ options = fillOptionsWithDefaults2(options, channel);
+ var elector = supportsWebLockAPI() ? new LeaderElectionWebLock(channel, options) : new LeaderElection(channel, options);
+ channel._befC.push(function() {
+ return elector.die();
+ });
+ channel._leaderElector = elector;
+ return elector;
+}
+var LeaderElection;
+var init_leader_election = __esm({
+ "node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/leader-election.js"() {
+ init_util();
+ init_leader_election_util();
+ init_leader_election_web_lock();
+ LeaderElection = function LeaderElection2(broadcastChannel, options) {
+ var _this = this;
+ this.broadcastChannel = broadcastChannel;
+ this._options = options;
+ this.isLeader = false;
+ this._hasLeader = false;
+ this.isDead = false;
+ this.token = randomToken();
+ this._aplQ = PROMISE_RESOLVED_VOID;
+ this._aplQC = 0;
+ this._unl = [];
+ this._lstns = [];
+ this._dpL = function() {
+ };
+ this._dpLC = false;
+ var hasLeaderListener = function hasLeaderListener2(msg) {
+ if (msg.context === "leader") {
+ if (msg.action === "death") {
+ _this._hasLeader = false;
+ }
+ if (msg.action === "tell") {
+ _this._hasLeader = true;
+ }
+ }
+ };
+ this.broadcastChannel.addEventListener("internal", hasLeaderListener);
+ this._lstns.push(hasLeaderListener);
+ };
+ LeaderElection.prototype = {
+ hasLeader: function hasLeader2() {
+ return Promise.resolve(this._hasLeader);
+ },
+ /**
+ * Returns true if the instance is leader,
+ * false if not.
+ * @async
+ */
+ applyOnce: function applyOnce(isFromFallbackInterval) {
+ var _this2 = this;
+ if (this.isLeader) {
+ return sleep(0, true);
+ }
+ if (this.isDead) {
+ return sleep(0, false);
+ }
+ if (this._aplQC > 1) {
+ return this._aplQ;
+ }
+ var applyRun = function applyRun2() {
+ if (_this2.isLeader) {
+ return PROMISE_RESOLVED_TRUE;
+ }
+ var stopCriteria = false;
+ var stopCriteriaPromiseResolve;
+ var stopCriteriaPromise = new Promise(function(res) {
+ stopCriteriaPromiseResolve = function stopCriteriaPromiseResolve2() {
+ stopCriteria = true;
+ res();
+ };
+ });
+ var handleMessage = function handleMessage2(msg) {
+ if (msg.context === "leader" && msg.token != _this2.token) {
+ if (msg.action === "apply") {
+ if (msg.token > _this2.token) {
+ stopCriteriaPromiseResolve();
+ }
+ }
+ if (msg.action === "tell") {
+ stopCriteriaPromiseResolve();
+ _this2._hasLeader = true;
+ }
+ }
+ };
+ _this2.broadcastChannel.addEventListener("internal", handleMessage);
+ var waitForAnswerTime = isFromFallbackInterval ? _this2._options.responseTime * 4 : _this2._options.responseTime;
+ return sendLeaderMessage(_this2, "apply").then(function() {
+ return Promise.race([sleep(waitForAnswerTime), stopCriteriaPromise.then(function() {
+ return Promise.reject(new Error());
+ })]);
+ }).then(function() {
+ return sendLeaderMessage(_this2, "apply");
+ }).then(function() {
+ return Promise.race([sleep(waitForAnswerTime), stopCriteriaPromise.then(function() {
+ return Promise.reject(new Error());
+ })]);
+ })["catch"](function() {
+ }).then(function() {
+ _this2.broadcastChannel.removeEventListener("internal", handleMessage);
+ if (!stopCriteria) {
+ return beLeader(_this2).then(function() {
+ return true;
+ });
+ } else {
+ return false;
+ }
+ });
+ };
+ this._aplQC = this._aplQC + 1;
+ this._aplQ = this._aplQ.then(function() {
+ return applyRun();
+ }).then(function() {
+ _this2._aplQC = _this2._aplQC - 1;
+ });
+ return this._aplQ.then(function() {
+ return _this2.isLeader;
+ });
+ },
+ awaitLeadership: function awaitLeadership2() {
+ if (
+ /* _awaitLeadershipPromise */
+ !this._aLP
+ ) {
+ this._aLP = _awaitLeadershipOnce(this);
+ }
+ return this._aLP;
+ },
+ set onduplicate(fn) {
+ this._dpL = fn;
+ },
+ die: function die2() {
+ var _this3 = this;
+ this._lstns.forEach(function(listener2) {
+ return _this3.broadcastChannel.removeEventListener("internal", listener2);
+ });
+ this._lstns = [];
+ this._unl.forEach(function(uFn) {
+ return uFn.remove();
+ });
+ this._unl = [];
+ if (this.isLeader) {
+ this._hasLeader = false;
+ this.isLeader = false;
+ }
+ this.isDead = true;
+ return sendLeaderMessage(this, "death");
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/index.js
+var init_esbrowser = __esm({
+ "node_modules/.pnpm/broadcast-channel@7.3.0/node_modules/broadcast-channel/dist/esbrowser/index.js"() {
+ init_broadcast_channel();
+ init_leader_election();
+ init_leader_election_util();
+ }
+});
+
+// node_modules/.pnpm/@design.estate+dees-comms@1.0.30/node_modules/@design.estate/dees-comms/dist_ts/dees-comms.plugins.js
+var init_dees_comms_plugins = __esm({
+ "node_modules/.pnpm/@design.estate+dees-comms@1.0.30/node_modules/@design.estate/dees-comms/dist_ts/dees-comms.plugins.js"() {
+ init_dist_ts3();
+ init_dist_ts4();
+ init_dist_ts15();
+ init_esbrowser();
+ }
+});
+
+// node_modules/.pnpm/@design.estate+dees-comms@1.0.30/node_modules/@design.estate/dees-comms/dist_ts/dees-comms.classes.deescomms.js
+var BroadcastChannel4, DeesComms;
+var init_dees_comms_classes_deescomms = __esm({
+ "node_modules/.pnpm/@design.estate+dees-comms@1.0.30/node_modules/@design.estate/dees-comms/dist_ts/dees-comms.classes.deescomms.js"() {
+ init_dees_comms_plugins();
+ BroadcastChannel4 = globalThis.BroadcastChannel;
+ if (!BroadcastChannel4) {
+ BroadcastChannel4 = BroadcastChannel2;
+ }
+ DeesComms = class {
+ // receiving messages
+ constructor() {
+ this.broadcastChannel = new BroadcastChannel4("dees-comms");
+ this.typedrouter = new dist_ts_exports15.TypedRouter();
+ this.typedtarget = new dist_ts_exports15.TypedTarget({
+ postMethodWithTypedRouter: async (messageArg) => {
+ this.postMessage(messageArg);
+ },
+ typedRouterRef: this.typedrouter
+ });
+ this.broadcastChannel.onmessage = async (eventArg) => {
+ const message2 = eventArg.method ? eventArg : eventArg.data;
+ console.log(JSON.stringify(message2));
+ const response = await this.typedrouter.routeAndAddResponse(message2, { skipHooks: true });
+ if (response && !response.error) {
+ this.postMessage(response);
+ } else {
+ }
+ };
+ }
+ /**
+ * creates a typedrequest with this classes postMessage as postMethod
+ */
+ createTypedRequest(methodName) {
+ const typedrequest = new dist_ts_exports15.TypedRequest(this.typedtarget, methodName);
+ return typedrequest;
+ }
+ /**
+ * posts a typedrequestmessage
+ */
+ async postMessage(messageArg) {
+ this.broadcastChannel.postMessage(messageArg);
+ }
+ /**
+ * subscribe to messages
+ */
+ async createTypedHandler(methodArg, handlerFunction) {
+ this.typedrouter.addTypedHandler(new dist_ts_exports15.TypedHandler(methodArg, handlerFunction));
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/@design.estate+dees-comms@1.0.30/node_modules/@design.estate/dees-comms/dist_ts/index.js
+var dist_ts_exports16 = {};
+__export(dist_ts_exports16, {
+ DeesComms: () => DeesComms
+});
+var init_dist_ts16 = __esm({
+ "node_modules/.pnpm/@design.estate+dees-comms@1.0.30/node_modules/@design.estate/dees-comms/dist_ts/index.js"() {
+ init_dees_comms_classes_deescomms();
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/common.js
+var require_common = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/common.js"(exports, module) {
+ "use strict";
+ function isNothing(subject) {
+ return typeof subject === "undefined" || subject === null;
+ }
+ function isObject4(subject) {
+ return typeof subject === "object" && subject !== null;
+ }
+ function toArray3(sequence) {
+ if (Array.isArray(sequence)) return sequence;
+ else if (isNothing(sequence)) return [];
+ return [sequence];
+ }
+ function extend3(target, source) {
+ var index2, length, key2, sourceKeys;
+ if (source) {
+ sourceKeys = Object.keys(source);
+ for (index2 = 0, length = sourceKeys.length; index2 < length; index2 += 1) {
+ key2 = sourceKeys[index2];
+ target[key2] = source[key2];
+ }
+ }
+ return target;
+ }
+ function repeat3(string3, count2) {
+ var result = "", cycle;
+ for (cycle = 0; cycle < count2; cycle += 1) {
+ result += string3;
+ }
+ return result;
+ }
+ function isNegativeZero(number2) {
+ return number2 === 0 && Number.NEGATIVE_INFINITY === 1 / number2;
+ }
+ module.exports.isNothing = isNothing;
+ module.exports.isObject = isObject4;
+ module.exports.toArray = toArray3;
+ module.exports.repeat = repeat3;
+ module.exports.isNegativeZero = isNegativeZero;
+ module.exports.extend = extend3;
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/exception.js
+var require_exception = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/exception.js"(exports, module) {
+ "use strict";
+ function YAMLException(reason, mark2) {
+ Error.call(this);
+ this.name = "YAMLException";
+ this.reason = reason;
+ this.mark = mark2;
+ this.message = (this.reason || "(unknown reason)") + (this.mark ? " " + this.mark.toString() : "");
+ if (Error.captureStackTrace) {
+ Error.captureStackTrace(this, this.constructor);
+ } else {
+ this.stack = new Error().stack || "";
+ }
+ }
+ YAMLException.prototype = Object.create(Error.prototype);
+ YAMLException.prototype.constructor = YAMLException;
+ YAMLException.prototype.toString = function toString3(compact) {
+ var result = this.name + ": ";
+ result += this.reason || "(unknown reason)";
+ if (!compact && this.mark) {
+ result += " " + this.mark.toString();
+ }
+ return result;
+ };
+ module.exports = YAMLException;
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/mark.js
+var require_mark = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/mark.js"(exports, module) {
+ "use strict";
+ var common = require_common();
+ function Mark(name, buffer2, position3, line, column) {
+ this.name = name;
+ this.buffer = buffer2;
+ this.position = position3;
+ this.line = line;
+ this.column = column;
+ }
+ Mark.prototype.getSnippet = function getSnippet(indent3, maxLength) {
+ var head2, start, tail, end3, snippet;
+ if (!this.buffer) return null;
+ indent3 = indent3 || 4;
+ maxLength = maxLength || 75;
+ head2 = "";
+ start = this.position;
+ while (start > 0 && "\0\r\n\x85\u2028\u2029".indexOf(this.buffer.charAt(start - 1)) === -1) {
+ start -= 1;
+ if (this.position - start > maxLength / 2 - 1) {
+ head2 = " ... ";
+ start += 5;
+ break;
+ }
+ }
+ tail = "";
+ end3 = this.position;
+ while (end3 < this.buffer.length && "\0\r\n\x85\u2028\u2029".indexOf(this.buffer.charAt(end3)) === -1) {
+ end3 += 1;
+ if (end3 - this.position > maxLength / 2 - 1) {
+ tail = " ... ";
+ end3 -= 5;
+ break;
+ }
+ }
+ snippet = this.buffer.slice(start, end3);
+ return common.repeat(" ", indent3) + head2 + snippet + tail + "\n" + common.repeat(" ", indent3 + this.position - start + head2.length) + "^";
+ };
+ Mark.prototype.toString = function toString3(compact) {
+ var snippet, where = "";
+ if (this.name) {
+ where += 'in "' + this.name + '" ';
+ }
+ where += "at line " + (this.line + 1) + ", column " + (this.column + 1);
+ if (!compact) {
+ snippet = this.getSnippet();
+ if (snippet) {
+ where += ":\n" + snippet;
+ }
+ }
+ return where;
+ };
+ module.exports = Mark;
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type.js
+var require_type = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type.js"(exports, module) {
+ "use strict";
+ var YAMLException = require_exception();
+ var TYPE_CONSTRUCTOR_OPTIONS = [
+ "kind",
+ "resolve",
+ "construct",
+ "instanceOf",
+ "predicate",
+ "represent",
+ "defaultStyle",
+ "styleAliases"
+ ];
+ var YAML_NODE_KINDS = [
+ "scalar",
+ "sequence",
+ "mapping"
+ ];
+ function compileStyleAliases(map7) {
+ var result = {};
+ if (map7 !== null) {
+ Object.keys(map7).forEach(function(style) {
+ map7[style].forEach(function(alias) {
+ result[String(alias)] = style;
+ });
+ });
+ }
+ return result;
+ }
+ function Type(tag, options) {
+ options = options || {};
+ Object.keys(options).forEach(function(name) {
+ if (TYPE_CONSTRUCTOR_OPTIONS.indexOf(name) === -1) {
+ throw new YAMLException('Unknown option "' + name + '" is met in definition of "' + tag + '" YAML type.');
+ }
+ });
+ this.tag = tag;
+ this.kind = options["kind"] || null;
+ this.resolve = options["resolve"] || function() {
+ return true;
+ };
+ this.construct = options["construct"] || function(data8) {
+ return data8;
+ };
+ this.instanceOf = options["instanceOf"] || null;
+ this.predicate = options["predicate"] || null;
+ this.represent = options["represent"] || null;
+ this.defaultStyle = options["defaultStyle"] || null;
+ this.styleAliases = compileStyleAliases(options["styleAliases"] || null);
+ if (YAML_NODE_KINDS.indexOf(this.kind) === -1) {
+ throw new YAMLException('Unknown kind "' + this.kind + '" is specified for "' + tag + '" YAML type.');
+ }
+ }
+ module.exports = Type;
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/schema.js
+var require_schema = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/schema.js"(exports, module) {
+ "use strict";
+ var common = require_common();
+ var YAMLException = require_exception();
+ var Type = require_type();
+ function compileList(schema, name, result) {
+ var exclude = [];
+ schema.include.forEach(function(includedSchema) {
+ result = compileList(includedSchema, name, result);
+ });
+ schema[name].forEach(function(currentType) {
+ result.forEach(function(previousType, previousIndex) {
+ if (previousType.tag === currentType.tag && previousType.kind === currentType.kind) {
+ exclude.push(previousIndex);
+ }
+ });
+ result.push(currentType);
+ });
+ return result.filter(function(type5, index2) {
+ return exclude.indexOf(index2) === -1;
+ });
+ }
+ function compileMap() {
+ var result = {
+ scalar: {},
+ sequence: {},
+ mapping: {},
+ fallback: {}
+ }, index2, length;
+ function collectType(type5) {
+ result[type5.kind][type5.tag] = result["fallback"][type5.tag] = type5;
+ }
+ for (index2 = 0, length = arguments.length; index2 < length; index2 += 1) {
+ arguments[index2].forEach(collectType);
+ }
+ return result;
+ }
+ function Schema2(definition3) {
+ this.include = definition3.include || [];
+ this.implicit = definition3.implicit || [];
+ this.explicit = definition3.explicit || [];
+ this.implicit.forEach(function(type5) {
+ if (type5.loadKind && type5.loadKind !== "scalar") {
+ throw new YAMLException("There is a non-scalar type in the implicit list of a schema. Implicit resolving of such types is not supported.");
+ }
+ });
+ this.compiledImplicit = compileList(this, "implicit", []);
+ this.compiledExplicit = compileList(this, "explicit", []);
+ this.compiledTypeMap = compileMap(this.compiledImplicit, this.compiledExplicit);
+ }
+ Schema2.DEFAULT = null;
+ Schema2.create = function createSchema() {
+ var schemas, types;
+ switch (arguments.length) {
+ case 1:
+ schemas = Schema2.DEFAULT;
+ types = arguments[0];
+ break;
+ case 2:
+ schemas = arguments[0];
+ types = arguments[1];
+ break;
+ default:
+ throw new YAMLException("Wrong number of arguments for Schema.create function");
+ }
+ schemas = common.toArray(schemas);
+ types = common.toArray(types);
+ if (!schemas.every(function(schema) {
+ return schema instanceof Schema2;
+ })) {
+ throw new YAMLException("Specified list of super schemas (or a single Schema object) contains a non-Schema object.");
+ }
+ if (!types.every(function(type5) {
+ return type5 instanceof Type;
+ })) {
+ throw new YAMLException("Specified list of YAML types (or a single Type object) contains a non-Type object.");
+ }
+ return new Schema2({
+ include: schemas,
+ explicit: types
+ });
+ };
+ module.exports = Schema2;
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/str.js
+var require_str = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/str.js"(exports, module) {
+ "use strict";
+ var Type = require_type();
+ module.exports = new Type("tag:yaml.org,2002:str", {
+ kind: "scalar",
+ construct: function(data8) {
+ return data8 !== null ? data8 : "";
+ }
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/seq.js
+var require_seq = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/seq.js"(exports, module) {
+ "use strict";
+ var Type = require_type();
+ module.exports = new Type("tag:yaml.org,2002:seq", {
+ kind: "sequence",
+ construct: function(data8) {
+ return data8 !== null ? data8 : [];
+ }
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/map.js
+var require_map = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/map.js"(exports, module) {
+ "use strict";
+ var Type = require_type();
+ module.exports = new Type("tag:yaml.org,2002:map", {
+ kind: "mapping",
+ construct: function(data8) {
+ return data8 !== null ? data8 : {};
+ }
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/schema/failsafe.js
+var require_failsafe = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/schema/failsafe.js"(exports, module) {
+ "use strict";
+ var Schema2 = require_schema();
+ module.exports = new Schema2({
+ explicit: [
+ require_str(),
+ require_seq(),
+ require_map()
+ ]
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/null.js
+var require_null = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/null.js"(exports, module) {
+ "use strict";
+ var Type = require_type();
+ function resolveYamlNull(data8) {
+ if (data8 === null) return true;
+ var max3 = data8.length;
+ return max3 === 1 && data8 === "~" || max3 === 4 && (data8 === "null" || data8 === "Null" || data8 === "NULL");
+ }
+ function constructYamlNull() {
+ return null;
+ }
+ function isNull(object) {
+ return object === null;
+ }
+ module.exports = new Type("tag:yaml.org,2002:null", {
+ kind: "scalar",
+ resolve: resolveYamlNull,
+ construct: constructYamlNull,
+ predicate: isNull,
+ represent: {
+ canonical: function() {
+ return "~";
+ },
+ lowercase: function() {
+ return "null";
+ },
+ uppercase: function() {
+ return "NULL";
+ },
+ camelcase: function() {
+ return "Null";
+ }
+ },
+ defaultStyle: "lowercase"
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/bool.js
+var require_bool = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/bool.js"(exports, module) {
+ "use strict";
+ var Type = require_type();
+ function resolveYamlBoolean(data8) {
+ if (data8 === null) return false;
+ var max3 = data8.length;
+ return max3 === 4 && (data8 === "true" || data8 === "True" || data8 === "TRUE") || max3 === 5 && (data8 === "false" || data8 === "False" || data8 === "FALSE");
+ }
+ function constructYamlBoolean(data8) {
+ return data8 === "true" || data8 === "True" || data8 === "TRUE";
+ }
+ function isBoolean(object) {
+ return Object.prototype.toString.call(object) === "[object Boolean]";
+ }
+ module.exports = new Type("tag:yaml.org,2002:bool", {
+ kind: "scalar",
+ resolve: resolveYamlBoolean,
+ construct: constructYamlBoolean,
+ predicate: isBoolean,
+ represent: {
+ lowercase: function(object) {
+ return object ? "true" : "false";
+ },
+ uppercase: function(object) {
+ return object ? "TRUE" : "FALSE";
+ },
+ camelcase: function(object) {
+ return object ? "True" : "False";
+ }
+ },
+ defaultStyle: "lowercase"
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/int.js
+var require_int = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/int.js"(exports, module) {
+ "use strict";
+ var common = require_common();
+ var Type = require_type();
+ function isHexCode(c11) {
+ return 48 <= c11 && c11 <= 57 || 65 <= c11 && c11 <= 70 || 97 <= c11 && c11 <= 102;
+ }
+ function isOctCode(c11) {
+ return 48 <= c11 && c11 <= 55;
+ }
+ function isDecCode(c11) {
+ return 48 <= c11 && c11 <= 57;
+ }
+ function resolveYamlInteger(data8) {
+ if (data8 === null) return false;
+ var max3 = data8.length, index2 = 0, hasDigits = false, ch;
+ if (!max3) return false;
+ ch = data8[index2];
+ if (ch === "-" || ch === "+") {
+ ch = data8[++index2];
+ }
+ if (ch === "0") {
+ if (index2 + 1 === max3) return true;
+ ch = data8[++index2];
+ if (ch === "b") {
+ index2++;
+ for (; index2 < max3; index2++) {
+ ch = data8[index2];
+ if (ch === "_") continue;
+ if (ch !== "0" && ch !== "1") return false;
+ hasDigits = true;
+ }
+ return hasDigits && ch !== "_";
+ }
+ if (ch === "x") {
+ index2++;
+ for (; index2 < max3; index2++) {
+ ch = data8[index2];
+ if (ch === "_") continue;
+ if (!isHexCode(data8.charCodeAt(index2))) return false;
+ hasDigits = true;
+ }
+ return hasDigits && ch !== "_";
+ }
+ for (; index2 < max3; index2++) {
+ ch = data8[index2];
+ if (ch === "_") continue;
+ if (!isOctCode(data8.charCodeAt(index2))) return false;
+ hasDigits = true;
+ }
+ return hasDigits && ch !== "_";
+ }
+ if (ch === "_") return false;
+ for (; index2 < max3; index2++) {
+ ch = data8[index2];
+ if (ch === "_") continue;
+ if (ch === ":") break;
+ if (!isDecCode(data8.charCodeAt(index2))) {
+ return false;
+ }
+ hasDigits = true;
+ }
+ if (!hasDigits || ch === "_") return false;
+ if (ch !== ":") return true;
+ return /^(:[0-5]?[0-9])+$/.test(data8.slice(index2));
+ }
+ function constructYamlInteger(data8) {
+ var value2 = data8, sign = 1, ch, base, digits = [];
+ if (value2.indexOf("_") !== -1) {
+ value2 = value2.replace(/_/g, "");
+ }
+ ch = value2[0];
+ if (ch === "-" || ch === "+") {
+ if (ch === "-") sign = -1;
+ value2 = value2.slice(1);
+ ch = value2[0];
+ }
+ if (value2 === "0") return 0;
+ if (ch === "0") {
+ if (value2[1] === "b") return sign * parseInt(value2.slice(2), 2);
+ if (value2[1] === "x") return sign * parseInt(value2, 16);
+ return sign * parseInt(value2, 8);
+ }
+ if (value2.indexOf(":") !== -1) {
+ value2.split(":").forEach(function(v5) {
+ digits.unshift(parseInt(v5, 10));
+ });
+ value2 = 0;
+ base = 1;
+ digits.forEach(function(d5) {
+ value2 += d5 * base;
+ base *= 60;
+ });
+ return sign * value2;
+ }
+ return sign * parseInt(value2, 10);
+ }
+ function isInteger(object) {
+ return Object.prototype.toString.call(object) === "[object Number]" && (object % 1 === 0 && !common.isNegativeZero(object));
+ }
+ module.exports = new Type("tag:yaml.org,2002:int", {
+ kind: "scalar",
+ resolve: resolveYamlInteger,
+ construct: constructYamlInteger,
+ predicate: isInteger,
+ represent: {
+ binary: function(obj) {
+ return obj >= 0 ? "0b" + obj.toString(2) : "-0b" + obj.toString(2).slice(1);
+ },
+ octal: function(obj) {
+ return obj >= 0 ? "0" + obj.toString(8) : "-0" + obj.toString(8).slice(1);
+ },
+ decimal: function(obj) {
+ return obj.toString(10);
+ },
+ /* eslint-disable max-len */
+ hexadecimal: function(obj) {
+ return obj >= 0 ? "0x" + obj.toString(16).toUpperCase() : "-0x" + obj.toString(16).toUpperCase().slice(1);
+ }
+ },
+ defaultStyle: "decimal",
+ styleAliases: {
+ binary: [2, "bin"],
+ octal: [8, "oct"],
+ decimal: [10, "dec"],
+ hexadecimal: [16, "hex"]
+ }
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/float.js
+var require_float = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/float.js"(exports, module) {
+ "use strict";
+ var common = require_common();
+ var Type = require_type();
+ var YAML_FLOAT_PATTERN = new RegExp(
+ // 2.5e4, 2.5 and integers
+ "^(?:[-+]?(?:0|[1-9][0-9_]*)(?:\\.[0-9_]*)?(?:[eE][-+]?[0-9]+)?|\\.[0-9_]+(?:[eE][-+]?[0-9]+)?|[-+]?[0-9][0-9_]*(?::[0-5]?[0-9])+\\.[0-9_]*|[-+]?\\.(?:inf|Inf|INF)|\\.(?:nan|NaN|NAN))$"
+ );
+ function resolveYamlFloat(data8) {
+ if (data8 === null) return false;
+ if (!YAML_FLOAT_PATTERN.test(data8) || // Quick hack to not allow integers end with `_`
+ // Probably should update regexp & check speed
+ data8[data8.length - 1] === "_") {
+ return false;
+ }
+ return true;
+ }
+ function constructYamlFloat(data8) {
+ var value2, sign, base, digits;
+ value2 = data8.replace(/_/g, "").toLowerCase();
+ sign = value2[0] === "-" ? -1 : 1;
+ digits = [];
+ if ("+-".indexOf(value2[0]) >= 0) {
+ value2 = value2.slice(1);
+ }
+ if (value2 === ".inf") {
+ return sign === 1 ? Number.POSITIVE_INFINITY : Number.NEGATIVE_INFINITY;
+ } else if (value2 === ".nan") {
+ return NaN;
+ } else if (value2.indexOf(":") >= 0) {
+ value2.split(":").forEach(function(v5) {
+ digits.unshift(parseFloat(v5, 10));
+ });
+ value2 = 0;
+ base = 1;
+ digits.forEach(function(d5) {
+ value2 += d5 * base;
+ base *= 60;
+ });
+ return sign * value2;
+ }
+ return sign * parseFloat(value2, 10);
+ }
+ var SCIENTIFIC_WITHOUT_DOT = /^[-+]?[0-9]+e/;
+ function representYamlFloat(object, style) {
+ var res;
+ if (isNaN(object)) {
+ switch (style) {
+ case "lowercase":
+ return ".nan";
+ case "uppercase":
+ return ".NAN";
+ case "camelcase":
+ return ".NaN";
+ }
+ } else if (Number.POSITIVE_INFINITY === object) {
+ switch (style) {
+ case "lowercase":
+ return ".inf";
+ case "uppercase":
+ return ".INF";
+ case "camelcase":
+ return ".Inf";
+ }
+ } else if (Number.NEGATIVE_INFINITY === object) {
+ switch (style) {
+ case "lowercase":
+ return "-.inf";
+ case "uppercase":
+ return "-.INF";
+ case "camelcase":
+ return "-.Inf";
+ }
+ } else if (common.isNegativeZero(object)) {
+ return "-0.0";
+ }
+ res = object.toString(10);
+ return SCIENTIFIC_WITHOUT_DOT.test(res) ? res.replace("e", ".e") : res;
+ }
+ function isFloat(object) {
+ return Object.prototype.toString.call(object) === "[object Number]" && (object % 1 !== 0 || common.isNegativeZero(object));
+ }
+ module.exports = new Type("tag:yaml.org,2002:float", {
+ kind: "scalar",
+ resolve: resolveYamlFloat,
+ construct: constructYamlFloat,
+ predicate: isFloat,
+ represent: representYamlFloat,
+ defaultStyle: "lowercase"
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/schema/json.js
+var require_json = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/schema/json.js"(exports, module) {
+ "use strict";
+ var Schema2 = require_schema();
+ module.exports = new Schema2({
+ include: [
+ require_failsafe()
+ ],
+ implicit: [
+ require_null(),
+ require_bool(),
+ require_int(),
+ require_float()
+ ]
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/schema/core.js
+var require_core = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/schema/core.js"(exports, module) {
+ "use strict";
+ var Schema2 = require_schema();
+ module.exports = new Schema2({
+ include: [
+ require_json()
+ ]
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/timestamp.js
+var require_timestamp = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/timestamp.js"(exports, module) {
+ "use strict";
+ var Type = require_type();
+ var YAML_DATE_REGEXP = new RegExp(
+ "^([0-9][0-9][0-9][0-9])-([0-9][0-9])-([0-9][0-9])$"
+ );
+ var YAML_TIMESTAMP_REGEXP = new RegExp(
+ "^([0-9][0-9][0-9][0-9])-([0-9][0-9]?)-([0-9][0-9]?)(?:[Tt]|[ \\t]+)([0-9][0-9]?):([0-9][0-9]):([0-9][0-9])(?:\\.([0-9]*))?(?:[ \\t]*(Z|([-+])([0-9][0-9]?)(?::([0-9][0-9]))?))?$"
+ );
+ function resolveYamlTimestamp(data8) {
+ if (data8 === null) return false;
+ if (YAML_DATE_REGEXP.exec(data8) !== null) return true;
+ if (YAML_TIMESTAMP_REGEXP.exec(data8) !== null) return true;
+ return false;
+ }
+ function constructYamlTimestamp(data8) {
+ var match2, year, month, day, hour, minute, second, fraction = 0, delta = null, tz_hour, tz_minute, date;
+ match2 = YAML_DATE_REGEXP.exec(data8);
+ if (match2 === null) match2 = YAML_TIMESTAMP_REGEXP.exec(data8);
+ if (match2 === null) throw new Error("Date resolve error");
+ year = +match2[1];
+ month = +match2[2] - 1;
+ day = +match2[3];
+ if (!match2[4]) {
+ return new Date(Date.UTC(year, month, day));
+ }
+ hour = +match2[4];
+ minute = +match2[5];
+ second = +match2[6];
+ if (match2[7]) {
+ fraction = match2[7].slice(0, 3);
+ while (fraction.length < 3) {
+ fraction += "0";
+ }
+ fraction = +fraction;
+ }
+ if (match2[9]) {
+ tz_hour = +match2[10];
+ tz_minute = +(match2[11] || 0);
+ delta = (tz_hour * 60 + tz_minute) * 6e4;
+ if (match2[9] === "-") delta = -delta;
+ }
+ date = new Date(Date.UTC(year, month, day, hour, minute, second, fraction));
+ if (delta) date.setTime(date.getTime() - delta);
+ return date;
+ }
+ function representYamlTimestamp(object) {
+ return object.toISOString();
+ }
+ module.exports = new Type("tag:yaml.org,2002:timestamp", {
+ kind: "scalar",
+ resolve: resolveYamlTimestamp,
+ construct: constructYamlTimestamp,
+ instanceOf: Date,
+ represent: representYamlTimestamp
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/merge.js
+var require_merge = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/merge.js"(exports, module) {
+ "use strict";
+ var Type = require_type();
+ function resolveYamlMerge(data8) {
+ return data8 === "<<" || data8 === null;
+ }
+ module.exports = new Type("tag:yaml.org,2002:merge", {
+ kind: "scalar",
+ resolve: resolveYamlMerge
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/binary.js
+var require_binary = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/binary.js"(exports, module) {
+ "use strict";
+ var NodeBuffer;
+ try {
+ _require = __require;
+ NodeBuffer = _require("buffer").Buffer;
+ } catch (__) {
+ }
+ var Type = require_type();
+ var BASE64_MAP = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=\n\r";
+ function resolveYamlBinary(data8) {
+ if (data8 === null) return false;
+ var code4, idx, bitlen = 0, max3 = data8.length, map7 = BASE64_MAP;
+ for (idx = 0; idx < max3; idx++) {
+ code4 = map7.indexOf(data8.charAt(idx));
+ if (code4 > 64) continue;
+ if (code4 < 0) return false;
+ bitlen += 6;
+ }
+ return bitlen % 8 === 0;
+ }
+ function constructYamlBinary(data8) {
+ var idx, tailbits, input = data8.replace(/[\r\n=]/g, ""), max3 = input.length, map7 = BASE64_MAP, bits = 0, result = [];
+ for (idx = 0; idx < max3; idx++) {
+ if (idx % 4 === 0 && idx) {
+ result.push(bits >> 16 & 255);
+ result.push(bits >> 8 & 255);
+ result.push(bits & 255);
+ }
+ bits = bits << 6 | map7.indexOf(input.charAt(idx));
+ }
+ tailbits = max3 % 4 * 6;
+ if (tailbits === 0) {
+ result.push(bits >> 16 & 255);
+ result.push(bits >> 8 & 255);
+ result.push(bits & 255);
+ } else if (tailbits === 18) {
+ result.push(bits >> 10 & 255);
+ result.push(bits >> 2 & 255);
+ } else if (tailbits === 12) {
+ result.push(bits >> 4 & 255);
+ }
+ if (NodeBuffer) {
+ return NodeBuffer.from ? NodeBuffer.from(result) : new NodeBuffer(result);
+ }
+ return result;
+ }
+ function representYamlBinary(object) {
+ var result = "", bits = 0, idx, tail, max3 = object.length, map7 = BASE64_MAP;
+ for (idx = 0; idx < max3; idx++) {
+ if (idx % 3 === 0 && idx) {
+ result += map7[bits >> 18 & 63];
+ result += map7[bits >> 12 & 63];
+ result += map7[bits >> 6 & 63];
+ result += map7[bits & 63];
+ }
+ bits = (bits << 8) + object[idx];
+ }
+ tail = max3 % 3;
+ if (tail === 0) {
+ result += map7[bits >> 18 & 63];
+ result += map7[bits >> 12 & 63];
+ result += map7[bits >> 6 & 63];
+ result += map7[bits & 63];
+ } else if (tail === 2) {
+ result += map7[bits >> 10 & 63];
+ result += map7[bits >> 4 & 63];
+ result += map7[bits << 2 & 63];
+ result += map7[64];
+ } else if (tail === 1) {
+ result += map7[bits >> 2 & 63];
+ result += map7[bits << 4 & 63];
+ result += map7[64];
+ result += map7[64];
+ }
+ return result;
+ }
+ function isBinary(object) {
+ return NodeBuffer && NodeBuffer.isBuffer(object);
+ }
+ module.exports = new Type("tag:yaml.org,2002:binary", {
+ kind: "scalar",
+ resolve: resolveYamlBinary,
+ construct: constructYamlBinary,
+ predicate: isBinary,
+ represent: representYamlBinary
+ });
+ var _require;
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/omap.js
+var require_omap = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/omap.js"(exports, module) {
+ "use strict";
+ var Type = require_type();
+ var _hasOwnProperty = Object.prototype.hasOwnProperty;
+ var _toString = Object.prototype.toString;
+ function resolveYamlOmap(data8) {
+ if (data8 === null) return true;
+ var objectKeys = [], index2, length, pair, pairKey, pairHasKey, object = data8;
+ for (index2 = 0, length = object.length; index2 < length; index2 += 1) {
+ pair = object[index2];
+ pairHasKey = false;
+ if (_toString.call(pair) !== "[object Object]") return false;
+ for (pairKey in pair) {
+ if (_hasOwnProperty.call(pair, pairKey)) {
+ if (!pairHasKey) pairHasKey = true;
+ else return false;
+ }
+ }
+ if (!pairHasKey) return false;
+ if (objectKeys.indexOf(pairKey) === -1) objectKeys.push(pairKey);
+ else return false;
+ }
+ return true;
+ }
+ function constructYamlOmap(data8) {
+ return data8 !== null ? data8 : [];
+ }
+ module.exports = new Type("tag:yaml.org,2002:omap", {
+ kind: "sequence",
+ resolve: resolveYamlOmap,
+ construct: constructYamlOmap
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/pairs.js
+var require_pairs = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/pairs.js"(exports, module) {
+ "use strict";
+ var Type = require_type();
+ var _toString = Object.prototype.toString;
+ function resolveYamlPairs(data8) {
+ if (data8 === null) return true;
+ var index2, length, pair, keys2, result, object = data8;
+ result = new Array(object.length);
+ for (index2 = 0, length = object.length; index2 < length; index2 += 1) {
+ pair = object[index2];
+ if (_toString.call(pair) !== "[object Object]") return false;
+ keys2 = Object.keys(pair);
+ if (keys2.length !== 1) return false;
+ result[index2] = [keys2[0], pair[keys2[0]]];
+ }
+ return true;
+ }
+ function constructYamlPairs(data8) {
+ if (data8 === null) return [];
+ var index2, length, pair, keys2, result, object = data8;
+ result = new Array(object.length);
+ for (index2 = 0, length = object.length; index2 < length; index2 += 1) {
+ pair = object[index2];
+ keys2 = Object.keys(pair);
+ result[index2] = [keys2[0], pair[keys2[0]]];
+ }
+ return result;
+ }
+ module.exports = new Type("tag:yaml.org,2002:pairs", {
+ kind: "sequence",
+ resolve: resolveYamlPairs,
+ construct: constructYamlPairs
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/set.js
+var require_set = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/set.js"(exports, module) {
+ "use strict";
+ var Type = require_type();
+ var _hasOwnProperty = Object.prototype.hasOwnProperty;
+ function resolveYamlSet(data8) {
+ if (data8 === null) return true;
+ var key2, object = data8;
+ for (key2 in object) {
+ if (_hasOwnProperty.call(object, key2)) {
+ if (object[key2] !== null) return false;
+ }
+ }
+ return true;
+ }
+ function constructYamlSet(data8) {
+ return data8 !== null ? data8 : {};
+ }
+ module.exports = new Type("tag:yaml.org,2002:set", {
+ kind: "mapping",
+ resolve: resolveYamlSet,
+ construct: constructYamlSet
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/schema/default_safe.js
+var require_default_safe = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/schema/default_safe.js"(exports, module) {
+ "use strict";
+ var Schema2 = require_schema();
+ module.exports = new Schema2({
+ include: [
+ require_core()
+ ],
+ implicit: [
+ require_timestamp(),
+ require_merge()
+ ],
+ explicit: [
+ require_binary(),
+ require_omap(),
+ require_pairs(),
+ require_set()
+ ]
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/js/undefined.js
+var require_undefined = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/js/undefined.js"(exports, module) {
+ "use strict";
+ var Type = require_type();
+ function resolveJavascriptUndefined() {
+ return true;
+ }
+ function constructJavascriptUndefined() {
+ return void 0;
+ }
+ function representJavascriptUndefined() {
+ return "";
+ }
+ function isUndefined(object) {
+ return typeof object === "undefined";
+ }
+ module.exports = new Type("tag:yaml.org,2002:js/undefined", {
+ kind: "scalar",
+ resolve: resolveJavascriptUndefined,
+ construct: constructJavascriptUndefined,
+ predicate: isUndefined,
+ represent: representJavascriptUndefined
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/js/regexp.js
+var require_regexp = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/js/regexp.js"(exports, module) {
+ "use strict";
+ var Type = require_type();
+ function resolveJavascriptRegExp(data8) {
+ if (data8 === null) return false;
+ if (data8.length === 0) return false;
+ var regexp = data8, tail = /\/([gim]*)$/.exec(data8), modifiers = "";
+ if (regexp[0] === "/") {
+ if (tail) modifiers = tail[1];
+ if (modifiers.length > 3) return false;
+ if (regexp[regexp.length - modifiers.length - 1] !== "/") return false;
+ }
+ return true;
+ }
+ function constructJavascriptRegExp(data8) {
+ var regexp = data8, tail = /\/([gim]*)$/.exec(data8), modifiers = "";
+ if (regexp[0] === "/") {
+ if (tail) modifiers = tail[1];
+ regexp = regexp.slice(1, regexp.length - modifiers.length - 1);
+ }
+ return new RegExp(regexp, modifiers);
+ }
+ function representJavascriptRegExp(object) {
+ var result = "/" + object.source + "/";
+ if (object.global) result += "g";
+ if (object.multiline) result += "m";
+ if (object.ignoreCase) result += "i";
+ return result;
+ }
+ function isRegExp(object) {
+ return Object.prototype.toString.call(object) === "[object RegExp]";
+ }
+ module.exports = new Type("tag:yaml.org,2002:js/regexp", {
+ kind: "scalar",
+ resolve: resolveJavascriptRegExp,
+ construct: constructJavascriptRegExp,
+ predicate: isRegExp,
+ represent: representJavascriptRegExp
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/js/function.js
+var require_function = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/type/js/function.js"(exports, module) {
+ "use strict";
+ var esprima;
+ try {
+ _require = __require;
+ esprima = _require("esprima");
+ } catch (_4) {
+ if (typeof window !== "undefined") esprima = window.esprima;
+ }
+ var Type = require_type();
+ function resolveJavascriptFunction(data8) {
+ if (data8 === null) return false;
+ try {
+ var source = "(" + data8 + ")", ast = esprima.parse(source, { range: true });
+ if (ast.type !== "Program" || ast.body.length !== 1 || ast.body[0].type !== "ExpressionStatement" || ast.body[0].expression.type !== "ArrowFunctionExpression" && ast.body[0].expression.type !== "FunctionExpression") {
+ return false;
+ }
+ return true;
+ } catch (err) {
+ return false;
+ }
+ }
+ function constructJavascriptFunction(data8) {
+ var source = "(" + data8 + ")", ast = esprima.parse(source, { range: true }), params2 = [], body3;
+ if (ast.type !== "Program" || ast.body.length !== 1 || ast.body[0].type !== "ExpressionStatement" || ast.body[0].expression.type !== "ArrowFunctionExpression" && ast.body[0].expression.type !== "FunctionExpression") {
+ throw new Error("Failed to resolve function");
+ }
+ ast.body[0].expression.params.forEach(function(param) {
+ params2.push(param.name);
+ });
+ body3 = ast.body[0].expression.body.range;
+ if (ast.body[0].expression.body.type === "BlockStatement") {
+ return new Function(params2, source.slice(body3[0] + 1, body3[1] - 1));
+ }
+ return new Function(params2, "return " + source.slice(body3[0], body3[1]));
+ }
+ function representJavascriptFunction(object) {
+ return object.toString();
+ }
+ function isFunction2(object) {
+ return Object.prototype.toString.call(object) === "[object Function]";
+ }
+ module.exports = new Type("tag:yaml.org,2002:js/function", {
+ kind: "scalar",
+ resolve: resolveJavascriptFunction,
+ construct: constructJavascriptFunction,
+ predicate: isFunction2,
+ represent: representJavascriptFunction
+ });
+ var _require;
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/schema/default_full.js
+var require_default_full = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/schema/default_full.js"(exports, module) {
+ "use strict";
+ var Schema2 = require_schema();
+ module.exports = Schema2.DEFAULT = new Schema2({
+ include: [
+ require_default_safe()
+ ],
+ explicit: [
+ require_undefined(),
+ require_regexp(),
+ require_function()
+ ]
+ });
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/loader.js
+var require_loader = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/loader.js"(exports, module) {
+ "use strict";
+ var common = require_common();
+ var YAMLException = require_exception();
+ var Mark = require_mark();
+ var DEFAULT_SAFE_SCHEMA = require_default_safe();
+ var DEFAULT_FULL_SCHEMA = require_default_full();
+ var _hasOwnProperty = Object.prototype.hasOwnProperty;
+ var CONTEXT_FLOW_IN = 1;
+ var CONTEXT_FLOW_OUT = 2;
+ var CONTEXT_BLOCK_IN = 3;
+ var CONTEXT_BLOCK_OUT = 4;
+ var CHOMPING_CLIP = 1;
+ var CHOMPING_STRIP = 2;
+ var CHOMPING_KEEP = 3;
+ var PATTERN_NON_PRINTABLE = /[\x00-\x08\x0B\x0C\x0E-\x1F\x7F-\x84\x86-\x9F\uFFFE\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]/;
+ var PATTERN_NON_ASCII_LINE_BREAKS = /[\x85\u2028\u2029]/;
+ var PATTERN_FLOW_INDICATORS = /[,\[\]\{\}]/;
+ var PATTERN_TAG_HANDLE = /^(?:!|!!|![a-z\-]+!)$/i;
+ var PATTERN_TAG_URI = /^(?:!|[^,\[\]\{\}])(?:%[0-9a-f]{2}|[0-9a-z\-#;\/\?:@&=\+\$,_\.!~\*'\(\)\[\]])*$/i;
+ function _class(obj) {
+ return Object.prototype.toString.call(obj);
+ }
+ function is_EOL(c11) {
+ return c11 === 10 || c11 === 13;
+ }
+ function is_WHITE_SPACE(c11) {
+ return c11 === 9 || c11 === 32;
+ }
+ function is_WS_OR_EOL(c11) {
+ return c11 === 9 || c11 === 32 || c11 === 10 || c11 === 13;
+ }
+ function is_FLOW_INDICATOR(c11) {
+ return c11 === 44 || c11 === 91 || c11 === 93 || c11 === 123 || c11 === 125;
+ }
+ function fromHexCode(c11) {
+ var lc;
+ if (48 <= c11 && c11 <= 57) {
+ return c11 - 48;
+ }
+ lc = c11 | 32;
+ if (97 <= lc && lc <= 102) {
+ return lc - 97 + 10;
+ }
+ return -1;
+ }
+ function escapedHexLen(c11) {
+ if (c11 === 120) {
+ return 2;
+ }
+ if (c11 === 117) {
+ return 4;
+ }
+ if (c11 === 85) {
+ return 8;
+ }
+ return 0;
+ }
+ function fromDecimalCode(c11) {
+ if (48 <= c11 && c11 <= 57) {
+ return c11 - 48;
+ }
+ return -1;
+ }
+ function simpleEscapeSequence(c11) {
+ return c11 === 48 ? "\0" : c11 === 97 ? "\x07" : c11 === 98 ? "\b" : c11 === 116 ? " " : c11 === 9 ? " " : c11 === 110 ? "\n" : c11 === 118 ? "\v" : c11 === 102 ? "\f" : c11 === 114 ? "\r" : c11 === 101 ? "\x1B" : c11 === 32 ? " " : c11 === 34 ? '"' : c11 === 47 ? "/" : c11 === 92 ? "\\" : c11 === 78 ? "\x85" : c11 === 95 ? "\xA0" : c11 === 76 ? "\u2028" : c11 === 80 ? "\u2029" : "";
+ }
+ function charFromCodepoint(c11) {
+ if (c11 <= 65535) {
+ return String.fromCharCode(c11);
+ }
+ return String.fromCharCode(
+ (c11 - 65536 >> 10) + 55296,
+ (c11 - 65536 & 1023) + 56320
+ );
+ }
+ function setProperty(object, key2, value2) {
+ if (key2 === "__proto__") {
+ Object.defineProperty(object, key2, {
+ configurable: true,
+ enumerable: true,
+ writable: true,
+ value: value2
+ });
+ } else {
+ object[key2] = value2;
+ }
+ }
+ var simpleEscapeCheck = new Array(256);
+ var simpleEscapeMap = new Array(256);
+ for (i11 = 0; i11 < 256; i11++) {
+ simpleEscapeCheck[i11] = simpleEscapeSequence(i11) ? 1 : 0;
+ simpleEscapeMap[i11] = simpleEscapeSequence(i11);
+ }
+ function State(input, options) {
+ this.input = input;
+ this.filename = options["filename"] || null;
+ this.schema = options["schema"] || DEFAULT_FULL_SCHEMA;
+ this.onWarning = options["onWarning"] || null;
+ this.legacy = options["legacy"] || false;
+ this.json = options["json"] || false;
+ this.listener = options["listener"] || null;
+ this.implicitTypes = this.schema.compiledImplicit;
+ this.typeMap = this.schema.compiledTypeMap;
+ this.length = input.length;
+ this.position = 0;
+ this.line = 0;
+ this.lineStart = 0;
+ this.lineIndent = 0;
+ this.documents = [];
+ }
+ function generateError(state, message2) {
+ return new YAMLException(
+ message2,
+ new Mark(state.filename, state.input, state.position, state.line, state.position - state.lineStart)
+ );
+ }
+ function throwError2(state, message2) {
+ throw generateError(state, message2);
+ }
+ function throwWarning(state, message2) {
+ if (state.onWarning) {
+ state.onWarning.call(null, generateError(state, message2));
+ }
+ }
+ var directiveHandlers = {
+ YAML: function handleYamlDirective(state, name, args) {
+ var match2, major, minor;
+ if (state.version !== null) {
+ throwError2(state, "duplication of %YAML directive");
+ }
+ if (args.length !== 1) {
+ throwError2(state, "YAML directive accepts exactly one argument");
+ }
+ match2 = /^([0-9]+)\.([0-9]+)$/.exec(args[0]);
+ if (match2 === null) {
+ throwError2(state, "ill-formed argument of the YAML directive");
+ }
+ major = parseInt(match2[1], 10);
+ minor = parseInt(match2[2], 10);
+ if (major !== 1) {
+ throwError2(state, "unacceptable YAML version of the document");
+ }
+ state.version = args[0];
+ state.checkLineBreaks = minor < 2;
+ if (minor !== 1 && minor !== 2) {
+ throwWarning(state, "unsupported YAML version of the document");
+ }
+ },
+ TAG: function handleTagDirective(state, name, args) {
+ var handle3, prefix4;
+ if (args.length !== 2) {
+ throwError2(state, "TAG directive accepts exactly two arguments");
+ }
+ handle3 = args[0];
+ prefix4 = args[1];
+ if (!PATTERN_TAG_HANDLE.test(handle3)) {
+ throwError2(state, "ill-formed tag handle (first argument) of the TAG directive");
+ }
+ if (_hasOwnProperty.call(state.tagMap, handle3)) {
+ throwError2(state, 'there is a previously declared suffix for "' + handle3 + '" tag handle');
+ }
+ if (!PATTERN_TAG_URI.test(prefix4)) {
+ throwError2(state, "ill-formed tag prefix (second argument) of the TAG directive");
+ }
+ state.tagMap[handle3] = prefix4;
+ }
+ };
+ function captureSegment(state, start, end3, checkJson) {
+ var _position, _length, _character, _result;
+ if (start < end3) {
+ _result = state.input.slice(start, end3);
+ if (checkJson) {
+ for (_position = 0, _length = _result.length; _position < _length; _position += 1) {
+ _character = _result.charCodeAt(_position);
+ if (!(_character === 9 || 32 <= _character && _character <= 1114111)) {
+ throwError2(state, "expected valid JSON character");
+ }
+ }
+ } else if (PATTERN_NON_PRINTABLE.test(_result)) {
+ throwError2(state, "the stream contains non-printable characters");
+ }
+ state.result += _result;
+ }
+ }
+ function mergeMappings(state, destination, source, overridableKeys) {
+ var sourceKeys, key2, index2, quantity;
+ if (!common.isObject(source)) {
+ throwError2(state, "cannot merge mappings; the provided source object is unacceptable");
+ }
+ sourceKeys = Object.keys(source);
+ for (index2 = 0, quantity = sourceKeys.length; index2 < quantity; index2 += 1) {
+ key2 = sourceKeys[index2];
+ if (!_hasOwnProperty.call(destination, key2)) {
+ setProperty(destination, key2, source[key2]);
+ overridableKeys[key2] = true;
+ }
+ }
+ }
+ function storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, valueNode, startLine, startPos) {
+ var index2, quantity;
+ if (Array.isArray(keyNode)) {
+ keyNode = Array.prototype.slice.call(keyNode);
+ for (index2 = 0, quantity = keyNode.length; index2 < quantity; index2 += 1) {
+ if (Array.isArray(keyNode[index2])) {
+ throwError2(state, "nested arrays are not supported inside keys");
+ }
+ if (typeof keyNode === "object" && _class(keyNode[index2]) === "[object Object]") {
+ keyNode[index2] = "[object Object]";
+ }
+ }
+ }
+ if (typeof keyNode === "object" && _class(keyNode) === "[object Object]") {
+ keyNode = "[object Object]";
+ }
+ keyNode = String(keyNode);
+ if (_result === null) {
+ _result = {};
+ }
+ if (keyTag === "tag:yaml.org,2002:merge") {
+ if (Array.isArray(valueNode)) {
+ for (index2 = 0, quantity = valueNode.length; index2 < quantity; index2 += 1) {
+ mergeMappings(state, _result, valueNode[index2], overridableKeys);
+ }
+ } else {
+ mergeMappings(state, _result, valueNode, overridableKeys);
+ }
+ } else {
+ if (!state.json && !_hasOwnProperty.call(overridableKeys, keyNode) && _hasOwnProperty.call(_result, keyNode)) {
+ state.line = startLine || state.line;
+ state.position = startPos || state.position;
+ throwError2(state, "duplicated mapping key");
+ }
+ setProperty(_result, keyNode, valueNode);
+ delete overridableKeys[keyNode];
+ }
+ return _result;
+ }
+ function readLineBreak(state) {
+ var ch;
+ ch = state.input.charCodeAt(state.position);
+ if (ch === 10) {
+ state.position++;
+ } else if (ch === 13) {
+ state.position++;
+ if (state.input.charCodeAt(state.position) === 10) {
+ state.position++;
+ }
+ } else {
+ throwError2(state, "a line break is expected");
+ }
+ state.line += 1;
+ state.lineStart = state.position;
+ }
+ function skipSeparationSpace(state, allowComments, checkIndent) {
+ var lineBreaks = 0, ch = state.input.charCodeAt(state.position);
+ while (ch !== 0) {
+ while (is_WHITE_SPACE(ch)) {
+ ch = state.input.charCodeAt(++state.position);
+ }
+ if (allowComments && ch === 35) {
+ do {
+ ch = state.input.charCodeAt(++state.position);
+ } while (ch !== 10 && ch !== 13 && ch !== 0);
+ }
+ if (is_EOL(ch)) {
+ readLineBreak(state);
+ ch = state.input.charCodeAt(state.position);
+ lineBreaks++;
+ state.lineIndent = 0;
+ while (ch === 32) {
+ state.lineIndent++;
+ ch = state.input.charCodeAt(++state.position);
+ }
+ } else {
+ break;
+ }
+ }
+ if (checkIndent !== -1 && lineBreaks !== 0 && state.lineIndent < checkIndent) {
+ throwWarning(state, "deficient indentation");
+ }
+ return lineBreaks;
+ }
+ function testDocumentSeparator(state) {
+ var _position = state.position, ch;
+ ch = state.input.charCodeAt(_position);
+ if ((ch === 45 || ch === 46) && ch === state.input.charCodeAt(_position + 1) && ch === state.input.charCodeAt(_position + 2)) {
+ _position += 3;
+ ch = state.input.charCodeAt(_position);
+ if (ch === 0 || is_WS_OR_EOL(ch)) {
+ return true;
+ }
+ }
+ return false;
+ }
+ function writeFoldedLines(state, count2) {
+ if (count2 === 1) {
+ state.result += " ";
+ } else if (count2 > 1) {
+ state.result += common.repeat("\n", count2 - 1);
+ }
+ }
+ function readPlainScalar(state, nodeIndent, withinFlowCollection) {
+ var preceding, following, captureStart, captureEnd, hasPendingContent, _line, _lineStart, _lineIndent, _kind = state.kind, _result = state.result, ch;
+ ch = state.input.charCodeAt(state.position);
+ if (is_WS_OR_EOL(ch) || is_FLOW_INDICATOR(ch) || ch === 35 || ch === 38 || ch === 42 || ch === 33 || ch === 124 || ch === 62 || ch === 39 || ch === 34 || ch === 37 || ch === 64 || ch === 96) {
+ return false;
+ }
+ if (ch === 63 || ch === 45) {
+ following = state.input.charCodeAt(state.position + 1);
+ if (is_WS_OR_EOL(following) || withinFlowCollection && is_FLOW_INDICATOR(following)) {
+ return false;
+ }
+ }
+ state.kind = "scalar";
+ state.result = "";
+ captureStart = captureEnd = state.position;
+ hasPendingContent = false;
+ while (ch !== 0) {
+ if (ch === 58) {
+ following = state.input.charCodeAt(state.position + 1);
+ if (is_WS_OR_EOL(following) || withinFlowCollection && is_FLOW_INDICATOR(following)) {
+ break;
+ }
+ } else if (ch === 35) {
+ preceding = state.input.charCodeAt(state.position - 1);
+ if (is_WS_OR_EOL(preceding)) {
+ break;
+ }
+ } else if (state.position === state.lineStart && testDocumentSeparator(state) || withinFlowCollection && is_FLOW_INDICATOR(ch)) {
+ break;
+ } else if (is_EOL(ch)) {
+ _line = state.line;
+ _lineStart = state.lineStart;
+ _lineIndent = state.lineIndent;
+ skipSeparationSpace(state, false, -1);
+ if (state.lineIndent >= nodeIndent) {
+ hasPendingContent = true;
+ ch = state.input.charCodeAt(state.position);
+ continue;
+ } else {
+ state.position = captureEnd;
+ state.line = _line;
+ state.lineStart = _lineStart;
+ state.lineIndent = _lineIndent;
+ break;
+ }
+ }
+ if (hasPendingContent) {
+ captureSegment(state, captureStart, captureEnd, false);
+ writeFoldedLines(state, state.line - _line);
+ captureStart = captureEnd = state.position;
+ hasPendingContent = false;
+ }
+ if (!is_WHITE_SPACE(ch)) {
+ captureEnd = state.position + 1;
+ }
+ ch = state.input.charCodeAt(++state.position);
+ }
+ captureSegment(state, captureStart, captureEnd, false);
+ if (state.result) {
+ return true;
+ }
+ state.kind = _kind;
+ state.result = _result;
+ return false;
+ }
+ function readSingleQuotedScalar(state, nodeIndent) {
+ var ch, captureStart, captureEnd;
+ ch = state.input.charCodeAt(state.position);
+ if (ch !== 39) {
+ return false;
+ }
+ state.kind = "scalar";
+ state.result = "";
+ state.position++;
+ captureStart = captureEnd = state.position;
+ while ((ch = state.input.charCodeAt(state.position)) !== 0) {
+ if (ch === 39) {
+ captureSegment(state, captureStart, state.position, true);
+ ch = state.input.charCodeAt(++state.position);
+ if (ch === 39) {
+ captureStart = state.position;
+ state.position++;
+ captureEnd = state.position;
+ } else {
+ return true;
+ }
+ } else if (is_EOL(ch)) {
+ captureSegment(state, captureStart, captureEnd, true);
+ writeFoldedLines(state, skipSeparationSpace(state, false, nodeIndent));
+ captureStart = captureEnd = state.position;
+ } else if (state.position === state.lineStart && testDocumentSeparator(state)) {
+ throwError2(state, "unexpected end of the document within a single quoted scalar");
+ } else {
+ state.position++;
+ captureEnd = state.position;
+ }
+ }
+ throwError2(state, "unexpected end of the stream within a single quoted scalar");
+ }
+ function readDoubleQuotedScalar(state, nodeIndent) {
+ var captureStart, captureEnd, hexLength, hexResult, tmp, ch;
+ ch = state.input.charCodeAt(state.position);
+ if (ch !== 34) {
+ return false;
+ }
+ state.kind = "scalar";
+ state.result = "";
+ state.position++;
+ captureStart = captureEnd = state.position;
+ while ((ch = state.input.charCodeAt(state.position)) !== 0) {
+ if (ch === 34) {
+ captureSegment(state, captureStart, state.position, true);
+ state.position++;
+ return true;
+ } else if (ch === 92) {
+ captureSegment(state, captureStart, state.position, true);
+ ch = state.input.charCodeAt(++state.position);
+ if (is_EOL(ch)) {
+ skipSeparationSpace(state, false, nodeIndent);
+ } else if (ch < 256 && simpleEscapeCheck[ch]) {
+ state.result += simpleEscapeMap[ch];
+ state.position++;
+ } else if ((tmp = escapedHexLen(ch)) > 0) {
+ hexLength = tmp;
+ hexResult = 0;
+ for (; hexLength > 0; hexLength--) {
+ ch = state.input.charCodeAt(++state.position);
+ if ((tmp = fromHexCode(ch)) >= 0) {
+ hexResult = (hexResult << 4) + tmp;
+ } else {
+ throwError2(state, "expected hexadecimal character");
+ }
+ }
+ state.result += charFromCodepoint(hexResult);
+ state.position++;
+ } else {
+ throwError2(state, "unknown escape sequence");
+ }
+ captureStart = captureEnd = state.position;
+ } else if (is_EOL(ch)) {
+ captureSegment(state, captureStart, captureEnd, true);
+ writeFoldedLines(state, skipSeparationSpace(state, false, nodeIndent));
+ captureStart = captureEnd = state.position;
+ } else if (state.position === state.lineStart && testDocumentSeparator(state)) {
+ throwError2(state, "unexpected end of the document within a double quoted scalar");
+ } else {
+ state.position++;
+ captureEnd = state.position;
+ }
+ }
+ throwError2(state, "unexpected end of the stream within a double quoted scalar");
+ }
+ function readFlowCollection(state, nodeIndent) {
+ var readNext = true, _line, _tag = state.tag, _result, _anchor = state.anchor, following, terminator, isPair, isExplicitPair, isMapping, overridableKeys = {}, keyNode, keyTag, valueNode, ch;
+ ch = state.input.charCodeAt(state.position);
+ if (ch === 91) {
+ terminator = 93;
+ isMapping = false;
+ _result = [];
+ } else if (ch === 123) {
+ terminator = 125;
+ isMapping = true;
+ _result = {};
+ } else {
+ return false;
+ }
+ if (state.anchor !== null) {
+ state.anchorMap[state.anchor] = _result;
+ }
+ ch = state.input.charCodeAt(++state.position);
+ while (ch !== 0) {
+ skipSeparationSpace(state, true, nodeIndent);
+ ch = state.input.charCodeAt(state.position);
+ if (ch === terminator) {
+ state.position++;
+ state.tag = _tag;
+ state.anchor = _anchor;
+ state.kind = isMapping ? "mapping" : "sequence";
+ state.result = _result;
+ return true;
+ } else if (!readNext) {
+ throwError2(state, "missed comma between flow collection entries");
+ }
+ keyTag = keyNode = valueNode = null;
+ isPair = isExplicitPair = false;
+ if (ch === 63) {
+ following = state.input.charCodeAt(state.position + 1);
+ if (is_WS_OR_EOL(following)) {
+ isPair = isExplicitPair = true;
+ state.position++;
+ skipSeparationSpace(state, true, nodeIndent);
+ }
+ }
+ _line = state.line;
+ composeNode(state, nodeIndent, CONTEXT_FLOW_IN, false, true);
+ keyTag = state.tag;
+ keyNode = state.result;
+ skipSeparationSpace(state, true, nodeIndent);
+ ch = state.input.charCodeAt(state.position);
+ if ((isExplicitPair || state.line === _line) && ch === 58) {
+ isPair = true;
+ ch = state.input.charCodeAt(++state.position);
+ skipSeparationSpace(state, true, nodeIndent);
+ composeNode(state, nodeIndent, CONTEXT_FLOW_IN, false, true);
+ valueNode = state.result;
+ }
+ if (isMapping) {
+ storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, valueNode);
+ } else if (isPair) {
+ _result.push(storeMappingPair(state, null, overridableKeys, keyTag, keyNode, valueNode));
+ } else {
+ _result.push(keyNode);
+ }
+ skipSeparationSpace(state, true, nodeIndent);
+ ch = state.input.charCodeAt(state.position);
+ if (ch === 44) {
+ readNext = true;
+ ch = state.input.charCodeAt(++state.position);
+ } else {
+ readNext = false;
+ }
+ }
+ throwError2(state, "unexpected end of the stream within a flow collection");
+ }
+ function readBlockScalar(state, nodeIndent) {
+ var captureStart, folding, chomping = CHOMPING_CLIP, didReadContent = false, detectedIndent = false, textIndent = nodeIndent, emptyLines = 0, atMoreIndented = false, tmp, ch;
+ ch = state.input.charCodeAt(state.position);
+ if (ch === 124) {
+ folding = false;
+ } else if (ch === 62) {
+ folding = true;
+ } else {
+ return false;
+ }
+ state.kind = "scalar";
+ state.result = "";
+ while (ch !== 0) {
+ ch = state.input.charCodeAt(++state.position);
+ if (ch === 43 || ch === 45) {
+ if (CHOMPING_CLIP === chomping) {
+ chomping = ch === 43 ? CHOMPING_KEEP : CHOMPING_STRIP;
+ } else {
+ throwError2(state, "repeat of a chomping mode identifier");
+ }
+ } else if ((tmp = fromDecimalCode(ch)) >= 0) {
+ if (tmp === 0) {
+ throwError2(state, "bad explicit indentation width of a block scalar; it cannot be less than one");
+ } else if (!detectedIndent) {
+ textIndent = nodeIndent + tmp - 1;
+ detectedIndent = true;
+ } else {
+ throwError2(state, "repeat of an indentation width identifier");
+ }
+ } else {
+ break;
+ }
+ }
+ if (is_WHITE_SPACE(ch)) {
+ do {
+ ch = state.input.charCodeAt(++state.position);
+ } while (is_WHITE_SPACE(ch));
+ if (ch === 35) {
+ do {
+ ch = state.input.charCodeAt(++state.position);
+ } while (!is_EOL(ch) && ch !== 0);
+ }
+ }
+ while (ch !== 0) {
+ readLineBreak(state);
+ state.lineIndent = 0;
+ ch = state.input.charCodeAt(state.position);
+ while ((!detectedIndent || state.lineIndent < textIndent) && ch === 32) {
+ state.lineIndent++;
+ ch = state.input.charCodeAt(++state.position);
+ }
+ if (!detectedIndent && state.lineIndent > textIndent) {
+ textIndent = state.lineIndent;
+ }
+ if (is_EOL(ch)) {
+ emptyLines++;
+ continue;
+ }
+ if (state.lineIndent < textIndent) {
+ if (chomping === CHOMPING_KEEP) {
+ state.result += common.repeat("\n", didReadContent ? 1 + emptyLines : emptyLines);
+ } else if (chomping === CHOMPING_CLIP) {
+ if (didReadContent) {
+ state.result += "\n";
+ }
+ }
+ break;
+ }
+ if (folding) {
+ if (is_WHITE_SPACE(ch)) {
+ atMoreIndented = true;
+ state.result += common.repeat("\n", didReadContent ? 1 + emptyLines : emptyLines);
+ } else if (atMoreIndented) {
+ atMoreIndented = false;
+ state.result += common.repeat("\n", emptyLines + 1);
+ } else if (emptyLines === 0) {
+ if (didReadContent) {
+ state.result += " ";
+ }
+ } else {
+ state.result += common.repeat("\n", emptyLines);
+ }
+ } else {
+ state.result += common.repeat("\n", didReadContent ? 1 + emptyLines : emptyLines);
+ }
+ didReadContent = true;
+ detectedIndent = true;
+ emptyLines = 0;
+ captureStart = state.position;
+ while (!is_EOL(ch) && ch !== 0) {
+ ch = state.input.charCodeAt(++state.position);
+ }
+ captureSegment(state, captureStart, state.position, false);
+ }
+ return true;
+ }
+ function readBlockSequence(state, nodeIndent) {
+ var _line, _tag = state.tag, _anchor = state.anchor, _result = [], following, detected = false, ch;
+ if (state.anchor !== null) {
+ state.anchorMap[state.anchor] = _result;
+ }
+ ch = state.input.charCodeAt(state.position);
+ while (ch !== 0) {
+ if (ch !== 45) {
+ break;
+ }
+ following = state.input.charCodeAt(state.position + 1);
+ if (!is_WS_OR_EOL(following)) {
+ break;
+ }
+ detected = true;
+ state.position++;
+ if (skipSeparationSpace(state, true, -1)) {
+ if (state.lineIndent <= nodeIndent) {
+ _result.push(null);
+ ch = state.input.charCodeAt(state.position);
+ continue;
+ }
+ }
+ _line = state.line;
+ composeNode(state, nodeIndent, CONTEXT_BLOCK_IN, false, true);
+ _result.push(state.result);
+ skipSeparationSpace(state, true, -1);
+ ch = state.input.charCodeAt(state.position);
+ if ((state.line === _line || state.lineIndent > nodeIndent) && ch !== 0) {
+ throwError2(state, "bad indentation of a sequence entry");
+ } else if (state.lineIndent < nodeIndent) {
+ break;
+ }
+ }
+ if (detected) {
+ state.tag = _tag;
+ state.anchor = _anchor;
+ state.kind = "sequence";
+ state.result = _result;
+ return true;
+ }
+ return false;
+ }
+ function readBlockMapping(state, nodeIndent, flowIndent) {
+ var following, allowCompact, _line, _pos, _tag = state.tag, _anchor = state.anchor, _result = {}, overridableKeys = {}, keyTag = null, keyNode = null, valueNode = null, atExplicitKey = false, detected = false, ch;
+ if (state.anchor !== null) {
+ state.anchorMap[state.anchor] = _result;
+ }
+ ch = state.input.charCodeAt(state.position);
+ while (ch !== 0) {
+ following = state.input.charCodeAt(state.position + 1);
+ _line = state.line;
+ _pos = state.position;
+ if ((ch === 63 || ch === 58) && is_WS_OR_EOL(following)) {
+ if (ch === 63) {
+ if (atExplicitKey) {
+ storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, null);
+ keyTag = keyNode = valueNode = null;
+ }
+ detected = true;
+ atExplicitKey = true;
+ allowCompact = true;
+ } else if (atExplicitKey) {
+ atExplicitKey = false;
+ allowCompact = true;
+ } else {
+ throwError2(state, "incomplete explicit mapping pair; a key node is missed; or followed by a non-tabulated empty line");
+ }
+ state.position += 1;
+ ch = following;
+ } else if (composeNode(state, flowIndent, CONTEXT_FLOW_OUT, false, true)) {
+ if (state.line === _line) {
+ ch = state.input.charCodeAt(state.position);
+ while (is_WHITE_SPACE(ch)) {
+ ch = state.input.charCodeAt(++state.position);
+ }
+ if (ch === 58) {
+ ch = state.input.charCodeAt(++state.position);
+ if (!is_WS_OR_EOL(ch)) {
+ throwError2(state, "a whitespace character is expected after the key-value separator within a block mapping");
+ }
+ if (atExplicitKey) {
+ storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, null);
+ keyTag = keyNode = valueNode = null;
+ }
+ detected = true;
+ atExplicitKey = false;
+ allowCompact = false;
+ keyTag = state.tag;
+ keyNode = state.result;
+ } else if (detected) {
+ throwError2(state, "can not read an implicit mapping pair; a colon is missed");
+ } else {
+ state.tag = _tag;
+ state.anchor = _anchor;
+ return true;
+ }
+ } else if (detected) {
+ throwError2(state, "can not read a block mapping entry; a multiline key may not be an implicit key");
+ } else {
+ state.tag = _tag;
+ state.anchor = _anchor;
+ return true;
+ }
+ } else {
+ break;
+ }
+ if (state.line === _line || state.lineIndent > nodeIndent) {
+ if (composeNode(state, nodeIndent, CONTEXT_BLOCK_OUT, true, allowCompact)) {
+ if (atExplicitKey) {
+ keyNode = state.result;
+ } else {
+ valueNode = state.result;
+ }
+ }
+ if (!atExplicitKey) {
+ storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, valueNode, _line, _pos);
+ keyTag = keyNode = valueNode = null;
+ }
+ skipSeparationSpace(state, true, -1);
+ ch = state.input.charCodeAt(state.position);
+ }
+ if (state.lineIndent > nodeIndent && ch !== 0) {
+ throwError2(state, "bad indentation of a mapping entry");
+ } else if (state.lineIndent < nodeIndent) {
+ break;
+ }
+ }
+ if (atExplicitKey) {
+ storeMappingPair(state, _result, overridableKeys, keyTag, keyNode, null);
+ }
+ if (detected) {
+ state.tag = _tag;
+ state.anchor = _anchor;
+ state.kind = "mapping";
+ state.result = _result;
+ }
+ return detected;
+ }
+ function readTagProperty(state) {
+ var _position, isVerbatim = false, isNamed = false, tagHandle, tagName, ch;
+ ch = state.input.charCodeAt(state.position);
+ if (ch !== 33) return false;
+ if (state.tag !== null) {
+ throwError2(state, "duplication of a tag property");
+ }
+ ch = state.input.charCodeAt(++state.position);
+ if (ch === 60) {
+ isVerbatim = true;
+ ch = state.input.charCodeAt(++state.position);
+ } else if (ch === 33) {
+ isNamed = true;
+ tagHandle = "!!";
+ ch = state.input.charCodeAt(++state.position);
+ } else {
+ tagHandle = "!";
+ }
+ _position = state.position;
+ if (isVerbatim) {
+ do {
+ ch = state.input.charCodeAt(++state.position);
+ } while (ch !== 0 && ch !== 62);
+ if (state.position < state.length) {
+ tagName = state.input.slice(_position, state.position);
+ ch = state.input.charCodeAt(++state.position);
+ } else {
+ throwError2(state, "unexpected end of the stream within a verbatim tag");
+ }
+ } else {
+ while (ch !== 0 && !is_WS_OR_EOL(ch)) {
+ if (ch === 33) {
+ if (!isNamed) {
+ tagHandle = state.input.slice(_position - 1, state.position + 1);
+ if (!PATTERN_TAG_HANDLE.test(tagHandle)) {
+ throwError2(state, "named tag handle cannot contain such characters");
+ }
+ isNamed = true;
+ _position = state.position + 1;
+ } else {
+ throwError2(state, "tag suffix cannot contain exclamation marks");
+ }
+ }
+ ch = state.input.charCodeAt(++state.position);
+ }
+ tagName = state.input.slice(_position, state.position);
+ if (PATTERN_FLOW_INDICATORS.test(tagName)) {
+ throwError2(state, "tag suffix cannot contain flow indicator characters");
+ }
+ }
+ if (tagName && !PATTERN_TAG_URI.test(tagName)) {
+ throwError2(state, "tag name cannot contain such characters: " + tagName);
+ }
+ if (isVerbatim) {
+ state.tag = tagName;
+ } else if (_hasOwnProperty.call(state.tagMap, tagHandle)) {
+ state.tag = state.tagMap[tagHandle] + tagName;
+ } else if (tagHandle === "!") {
+ state.tag = "!" + tagName;
+ } else if (tagHandle === "!!") {
+ state.tag = "tag:yaml.org,2002:" + tagName;
+ } else {
+ throwError2(state, 'undeclared tag handle "' + tagHandle + '"');
+ }
+ return true;
+ }
+ function readAnchorProperty(state) {
+ var _position, ch;
+ ch = state.input.charCodeAt(state.position);
+ if (ch !== 38) return false;
+ if (state.anchor !== null) {
+ throwError2(state, "duplication of an anchor property");
+ }
+ ch = state.input.charCodeAt(++state.position);
+ _position = state.position;
+ while (ch !== 0 && !is_WS_OR_EOL(ch) && !is_FLOW_INDICATOR(ch)) {
+ ch = state.input.charCodeAt(++state.position);
+ }
+ if (state.position === _position) {
+ throwError2(state, "name of an anchor node must contain at least one character");
+ }
+ state.anchor = state.input.slice(_position, state.position);
+ return true;
+ }
+ function readAlias(state) {
+ var _position, alias, ch;
+ ch = state.input.charCodeAt(state.position);
+ if (ch !== 42) return false;
+ ch = state.input.charCodeAt(++state.position);
+ _position = state.position;
+ while (ch !== 0 && !is_WS_OR_EOL(ch) && !is_FLOW_INDICATOR(ch)) {
+ ch = state.input.charCodeAt(++state.position);
+ }
+ if (state.position === _position) {
+ throwError2(state, "name of an alias node must contain at least one character");
+ }
+ alias = state.input.slice(_position, state.position);
+ if (!_hasOwnProperty.call(state.anchorMap, alias)) {
+ throwError2(state, 'unidentified alias "' + alias + '"');
+ }
+ state.result = state.anchorMap[alias];
+ skipSeparationSpace(state, true, -1);
+ return true;
+ }
+ function composeNode(state, parentIndent, nodeContext, allowToSeek, allowCompact) {
+ var allowBlockStyles, allowBlockScalars, allowBlockCollections, indentStatus = 1, atNewLine = false, hasContent = false, typeIndex, typeQuantity, type5, flowIndent, blockIndent;
+ if (state.listener !== null) {
+ state.listener("open", state);
+ }
+ state.tag = null;
+ state.anchor = null;
+ state.kind = null;
+ state.result = null;
+ allowBlockStyles = allowBlockScalars = allowBlockCollections = CONTEXT_BLOCK_OUT === nodeContext || CONTEXT_BLOCK_IN === nodeContext;
+ if (allowToSeek) {
+ if (skipSeparationSpace(state, true, -1)) {
+ atNewLine = true;
+ if (state.lineIndent > parentIndent) {
+ indentStatus = 1;
+ } else if (state.lineIndent === parentIndent) {
+ indentStatus = 0;
+ } else if (state.lineIndent < parentIndent) {
+ indentStatus = -1;
+ }
+ }
+ }
+ if (indentStatus === 1) {
+ while (readTagProperty(state) || readAnchorProperty(state)) {
+ if (skipSeparationSpace(state, true, -1)) {
+ atNewLine = true;
+ allowBlockCollections = allowBlockStyles;
+ if (state.lineIndent > parentIndent) {
+ indentStatus = 1;
+ } else if (state.lineIndent === parentIndent) {
+ indentStatus = 0;
+ } else if (state.lineIndent < parentIndent) {
+ indentStatus = -1;
+ }
+ } else {
+ allowBlockCollections = false;
+ }
+ }
+ }
+ if (allowBlockCollections) {
+ allowBlockCollections = atNewLine || allowCompact;
+ }
+ if (indentStatus === 1 || CONTEXT_BLOCK_OUT === nodeContext) {
+ if (CONTEXT_FLOW_IN === nodeContext || CONTEXT_FLOW_OUT === nodeContext) {
+ flowIndent = parentIndent;
+ } else {
+ flowIndent = parentIndent + 1;
+ }
+ blockIndent = state.position - state.lineStart;
+ if (indentStatus === 1) {
+ if (allowBlockCollections && (readBlockSequence(state, blockIndent) || readBlockMapping(state, blockIndent, flowIndent)) || readFlowCollection(state, flowIndent)) {
+ hasContent = true;
+ } else {
+ if (allowBlockScalars && readBlockScalar(state, flowIndent) || readSingleQuotedScalar(state, flowIndent) || readDoubleQuotedScalar(state, flowIndent)) {
+ hasContent = true;
+ } else if (readAlias(state)) {
+ hasContent = true;
+ if (state.tag !== null || state.anchor !== null) {
+ throwError2(state, "alias node should not have any properties");
+ }
+ } else if (readPlainScalar(state, flowIndent, CONTEXT_FLOW_IN === nodeContext)) {
+ hasContent = true;
+ if (state.tag === null) {
+ state.tag = "?";
+ }
+ }
+ if (state.anchor !== null) {
+ state.anchorMap[state.anchor] = state.result;
+ }
+ }
+ } else if (indentStatus === 0) {
+ hasContent = allowBlockCollections && readBlockSequence(state, blockIndent);
+ }
+ }
+ if (state.tag !== null && state.tag !== "!") {
+ if (state.tag === "?") {
+ if (state.result !== null && state.kind !== "scalar") {
+ throwError2(state, 'unacceptable node kind for !> tag; it should be "scalar", not "' + state.kind + '"');
+ }
+ for (typeIndex = 0, typeQuantity = state.implicitTypes.length; typeIndex < typeQuantity; typeIndex += 1) {
+ type5 = state.implicitTypes[typeIndex];
+ if (type5.resolve(state.result)) {
+ state.result = type5.construct(state.result);
+ state.tag = type5.tag;
+ if (state.anchor !== null) {
+ state.anchorMap[state.anchor] = state.result;
+ }
+ break;
+ }
+ }
+ } else if (_hasOwnProperty.call(state.typeMap[state.kind || "fallback"], state.tag)) {
+ type5 = state.typeMap[state.kind || "fallback"][state.tag];
+ if (state.result !== null && type5.kind !== state.kind) {
+ throwError2(state, "unacceptable node kind for !<" + state.tag + '> tag; it should be "' + type5.kind + '", not "' + state.kind + '"');
+ }
+ if (!type5.resolve(state.result)) {
+ throwError2(state, "cannot resolve a node with !<" + state.tag + "> explicit tag");
+ } else {
+ state.result = type5.construct(state.result);
+ if (state.anchor !== null) {
+ state.anchorMap[state.anchor] = state.result;
+ }
+ }
+ } else {
+ throwError2(state, "unknown tag !<" + state.tag + ">");
+ }
+ }
+ if (state.listener !== null) {
+ state.listener("close", state);
+ }
+ return state.tag !== null || state.anchor !== null || hasContent;
+ }
+ function readDocument(state) {
+ var documentStart = state.position, _position, directiveName, directiveArgs, hasDirectives = false, ch;
+ state.version = null;
+ state.checkLineBreaks = state.legacy;
+ state.tagMap = {};
+ state.anchorMap = {};
+ while ((ch = state.input.charCodeAt(state.position)) !== 0) {
+ skipSeparationSpace(state, true, -1);
+ ch = state.input.charCodeAt(state.position);
+ if (state.lineIndent > 0 || ch !== 37) {
+ break;
+ }
+ hasDirectives = true;
+ ch = state.input.charCodeAt(++state.position);
+ _position = state.position;
+ while (ch !== 0 && !is_WS_OR_EOL(ch)) {
+ ch = state.input.charCodeAt(++state.position);
+ }
+ directiveName = state.input.slice(_position, state.position);
+ directiveArgs = [];
+ if (directiveName.length < 1) {
+ throwError2(state, "directive name must not be less than one character in length");
+ }
+ while (ch !== 0) {
+ while (is_WHITE_SPACE(ch)) {
+ ch = state.input.charCodeAt(++state.position);
+ }
+ if (ch === 35) {
+ do {
+ ch = state.input.charCodeAt(++state.position);
+ } while (ch !== 0 && !is_EOL(ch));
+ break;
+ }
+ if (is_EOL(ch)) break;
+ _position = state.position;
+ while (ch !== 0 && !is_WS_OR_EOL(ch)) {
+ ch = state.input.charCodeAt(++state.position);
+ }
+ directiveArgs.push(state.input.slice(_position, state.position));
+ }
+ if (ch !== 0) readLineBreak(state);
+ if (_hasOwnProperty.call(directiveHandlers, directiveName)) {
+ directiveHandlers[directiveName](state, directiveName, directiveArgs);
+ } else {
+ throwWarning(state, 'unknown document directive "' + directiveName + '"');
+ }
+ }
+ skipSeparationSpace(state, true, -1);
+ if (state.lineIndent === 0 && state.input.charCodeAt(state.position) === 45 && state.input.charCodeAt(state.position + 1) === 45 && state.input.charCodeAt(state.position + 2) === 45) {
+ state.position += 3;
+ skipSeparationSpace(state, true, -1);
+ } else if (hasDirectives) {
+ throwError2(state, "directives end mark is expected");
+ }
+ composeNode(state, state.lineIndent - 1, CONTEXT_BLOCK_OUT, false, true);
+ skipSeparationSpace(state, true, -1);
+ if (state.checkLineBreaks && PATTERN_NON_ASCII_LINE_BREAKS.test(state.input.slice(documentStart, state.position))) {
+ throwWarning(state, "non-ASCII line breaks are interpreted as content");
+ }
+ state.documents.push(state.result);
+ if (state.position === state.lineStart && testDocumentSeparator(state)) {
+ if (state.input.charCodeAt(state.position) === 46) {
+ state.position += 3;
+ skipSeparationSpace(state, true, -1);
+ }
+ return;
+ }
+ if (state.position < state.length - 1) {
+ throwError2(state, "end of the stream or a document separator is expected");
+ } else {
+ return;
+ }
+ }
+ function loadDocuments(input, options) {
+ input = String(input);
+ options = options || {};
+ if (input.length !== 0) {
+ if (input.charCodeAt(input.length - 1) !== 10 && input.charCodeAt(input.length - 1) !== 13) {
+ input += "\n";
+ }
+ if (input.charCodeAt(0) === 65279) {
+ input = input.slice(1);
+ }
+ }
+ var state = new State(input, options);
+ var nullpos = input.indexOf("\0");
+ if (nullpos !== -1) {
+ state.position = nullpos;
+ throwError2(state, "null byte is not allowed in input");
+ }
+ state.input += "\0";
+ while (state.input.charCodeAt(state.position) === 32) {
+ state.lineIndent += 1;
+ state.position += 1;
+ }
+ while (state.position < state.length - 1) {
+ readDocument(state);
+ }
+ return state.documents;
+ }
+ function loadAll(input, iterator2, options) {
+ if (iterator2 !== null && typeof iterator2 === "object" && typeof options === "undefined") {
+ options = iterator2;
+ iterator2 = null;
+ }
+ var documents = loadDocuments(input, options);
+ if (typeof iterator2 !== "function") {
+ return documents;
+ }
+ for (var index2 = 0, length = documents.length; index2 < length; index2 += 1) {
+ iterator2(documents[index2]);
+ }
+ }
+ function load(input, options) {
+ var documents = loadDocuments(input, options);
+ if (documents.length === 0) {
+ return void 0;
+ } else if (documents.length === 1) {
+ return documents[0];
+ }
+ throw new YAMLException("expected a single document in the stream, but found more");
+ }
+ function safeLoadAll(input, iterator2, options) {
+ if (typeof iterator2 === "object" && iterator2 !== null && typeof options === "undefined") {
+ options = iterator2;
+ iterator2 = null;
+ }
+ return loadAll(input, iterator2, common.extend({ schema: DEFAULT_SAFE_SCHEMA }, options));
+ }
+ function safeLoad(input, options) {
+ return load(input, common.extend({ schema: DEFAULT_SAFE_SCHEMA }, options));
+ }
+ module.exports.loadAll = loadAll;
+ module.exports.load = load;
+ module.exports.safeLoadAll = safeLoadAll;
+ module.exports.safeLoad = safeLoad;
+ var i11;
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/dumper.js
+var require_dumper = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml/dumper.js"(exports, module) {
+ "use strict";
+ var common = require_common();
+ var YAMLException = require_exception();
+ var DEFAULT_FULL_SCHEMA = require_default_full();
+ var DEFAULT_SAFE_SCHEMA = require_default_safe();
+ var _toString = Object.prototype.toString;
+ var _hasOwnProperty = Object.prototype.hasOwnProperty;
+ var CHAR_TAB = 9;
+ var CHAR_LINE_FEED = 10;
+ var CHAR_CARRIAGE_RETURN = 13;
+ var CHAR_SPACE = 32;
+ var CHAR_EXCLAMATION = 33;
+ var CHAR_DOUBLE_QUOTE = 34;
+ var CHAR_SHARP = 35;
+ var CHAR_PERCENT = 37;
+ var CHAR_AMPERSAND = 38;
+ var CHAR_SINGLE_QUOTE = 39;
+ var CHAR_ASTERISK = 42;
+ var CHAR_COMMA = 44;
+ var CHAR_MINUS = 45;
+ var CHAR_COLON = 58;
+ var CHAR_EQUALS = 61;
+ var CHAR_GREATER_THAN = 62;
+ var CHAR_QUESTION = 63;
+ var CHAR_COMMERCIAL_AT = 64;
+ var CHAR_LEFT_SQUARE_BRACKET = 91;
+ var CHAR_RIGHT_SQUARE_BRACKET = 93;
+ var CHAR_GRAVE_ACCENT = 96;
+ var CHAR_LEFT_CURLY_BRACKET = 123;
+ var CHAR_VERTICAL_LINE = 124;
+ var CHAR_RIGHT_CURLY_BRACKET = 125;
+ var ESCAPE_SEQUENCES = {};
+ ESCAPE_SEQUENCES[0] = "\\0";
+ ESCAPE_SEQUENCES[7] = "\\a";
+ ESCAPE_SEQUENCES[8] = "\\b";
+ ESCAPE_SEQUENCES[9] = "\\t";
+ ESCAPE_SEQUENCES[10] = "\\n";
+ ESCAPE_SEQUENCES[11] = "\\v";
+ ESCAPE_SEQUENCES[12] = "\\f";
+ ESCAPE_SEQUENCES[13] = "\\r";
+ ESCAPE_SEQUENCES[27] = "\\e";
+ ESCAPE_SEQUENCES[34] = '\\"';
+ ESCAPE_SEQUENCES[92] = "\\\\";
+ ESCAPE_SEQUENCES[133] = "\\N";
+ ESCAPE_SEQUENCES[160] = "\\_";
+ ESCAPE_SEQUENCES[8232] = "\\L";
+ ESCAPE_SEQUENCES[8233] = "\\P";
+ var DEPRECATED_BOOLEANS_SYNTAX = [
+ "y",
+ "Y",
+ "yes",
+ "Yes",
+ "YES",
+ "on",
+ "On",
+ "ON",
+ "n",
+ "N",
+ "no",
+ "No",
+ "NO",
+ "off",
+ "Off",
+ "OFF"
+ ];
+ function compileStyleMap(schema, map7) {
+ var result, keys2, index2, length, tag, style, type5;
+ if (map7 === null) return {};
+ result = {};
+ keys2 = Object.keys(map7);
+ for (index2 = 0, length = keys2.length; index2 < length; index2 += 1) {
+ tag = keys2[index2];
+ style = String(map7[tag]);
+ if (tag.slice(0, 2) === "!!") {
+ tag = "tag:yaml.org,2002:" + tag.slice(2);
+ }
+ type5 = schema.compiledTypeMap["fallback"][tag];
+ if (type5 && _hasOwnProperty.call(type5.styleAliases, style)) {
+ style = type5.styleAliases[style];
+ }
+ result[tag] = style;
+ }
+ return result;
+ }
+ function encodeHex(character) {
+ var string3, handle3, length;
+ string3 = character.toString(16).toUpperCase();
+ if (character <= 255) {
+ handle3 = "x";
+ length = 2;
+ } else if (character <= 65535) {
+ handle3 = "u";
+ length = 4;
+ } else if (character <= 4294967295) {
+ handle3 = "U";
+ length = 8;
+ } else {
+ throw new YAMLException("code point within a string may not be greater than 0xFFFFFFFF");
+ }
+ return "\\" + handle3 + common.repeat("0", length - string3.length) + string3;
+ }
+ function State(options) {
+ this.schema = options["schema"] || DEFAULT_FULL_SCHEMA;
+ this.indent = Math.max(1, options["indent"] || 2);
+ this.noArrayIndent = options["noArrayIndent"] || false;
+ this.skipInvalid = options["skipInvalid"] || false;
+ this.flowLevel = common.isNothing(options["flowLevel"]) ? -1 : options["flowLevel"];
+ this.styleMap = compileStyleMap(this.schema, options["styles"] || null);
+ this.sortKeys = options["sortKeys"] || false;
+ this.lineWidth = options["lineWidth"] || 80;
+ this.noRefs = options["noRefs"] || false;
+ this.noCompatMode = options["noCompatMode"] || false;
+ this.condenseFlow = options["condenseFlow"] || false;
+ this.implicitTypes = this.schema.compiledImplicit;
+ this.explicitTypes = this.schema.compiledExplicit;
+ this.tag = null;
+ this.result = "";
+ this.duplicates = [];
+ this.usedDuplicates = null;
+ }
+ function indentString(string3, spaces) {
+ var ind = common.repeat(" ", spaces), position3 = 0, next2 = -1, result = "", line, length = string3.length;
+ while (position3 < length) {
+ next2 = string3.indexOf("\n", position3);
+ if (next2 === -1) {
+ line = string3.slice(position3);
+ position3 = length;
+ } else {
+ line = string3.slice(position3, next2 + 1);
+ position3 = next2 + 1;
+ }
+ if (line.length && line !== "\n") result += ind;
+ result += line;
+ }
+ return result;
+ }
+ function generateNextLine(state, level) {
+ return "\n" + common.repeat(" ", state.indent * level);
+ }
+ function testImplicitResolving(state, str) {
+ var index2, length, type5;
+ for (index2 = 0, length = state.implicitTypes.length; index2 < length; index2 += 1) {
+ type5 = state.implicitTypes[index2];
+ if (type5.resolve(str)) {
+ return true;
+ }
+ }
+ return false;
+ }
+ function isWhitespace(c11) {
+ return c11 === CHAR_SPACE || c11 === CHAR_TAB;
+ }
+ function isPrintable(c11) {
+ return 32 <= c11 && c11 <= 126 || 161 <= c11 && c11 <= 55295 && c11 !== 8232 && c11 !== 8233 || 57344 <= c11 && c11 <= 65533 && c11 !== 65279 || 65536 <= c11 && c11 <= 1114111;
+ }
+ function isNsChar(c11) {
+ return isPrintable(c11) && !isWhitespace(c11) && c11 !== 65279 && c11 !== CHAR_CARRIAGE_RETURN && c11 !== CHAR_LINE_FEED;
+ }
+ function isPlainSafe(c11, prev) {
+ return isPrintable(c11) && c11 !== 65279 && c11 !== CHAR_COMMA && c11 !== CHAR_LEFT_SQUARE_BRACKET && c11 !== CHAR_RIGHT_SQUARE_BRACKET && c11 !== CHAR_LEFT_CURLY_BRACKET && c11 !== CHAR_RIGHT_CURLY_BRACKET && c11 !== CHAR_COLON && (c11 !== CHAR_SHARP || prev && isNsChar(prev));
+ }
+ function isPlainSafeFirst(c11) {
+ return isPrintable(c11) && c11 !== 65279 && !isWhitespace(c11) && c11 !== CHAR_MINUS && c11 !== CHAR_QUESTION && c11 !== CHAR_COLON && c11 !== CHAR_COMMA && c11 !== CHAR_LEFT_SQUARE_BRACKET && c11 !== CHAR_RIGHT_SQUARE_BRACKET && c11 !== CHAR_LEFT_CURLY_BRACKET && c11 !== CHAR_RIGHT_CURLY_BRACKET && c11 !== CHAR_SHARP && c11 !== CHAR_AMPERSAND && c11 !== CHAR_ASTERISK && c11 !== CHAR_EXCLAMATION && c11 !== CHAR_VERTICAL_LINE && c11 !== CHAR_EQUALS && c11 !== CHAR_GREATER_THAN && c11 !== CHAR_SINGLE_QUOTE && c11 !== CHAR_DOUBLE_QUOTE && c11 !== CHAR_PERCENT && c11 !== CHAR_COMMERCIAL_AT && c11 !== CHAR_GRAVE_ACCENT;
+ }
+ function needIndentIndicator(string3) {
+ var leadingSpaceRe = /^\n* /;
+ return leadingSpaceRe.test(string3);
+ }
+ var STYLE_PLAIN = 1, STYLE_SINGLE = 2, STYLE_LITERAL = 3, STYLE_FOLDED = 4, STYLE_DOUBLE = 5;
+ function chooseScalarStyle(string3, singleLineOnly, indentPerLevel, lineWidth, testAmbiguousType) {
+ var i11;
+ var char, prev_char;
+ var hasLineBreak = false;
+ var hasFoldableLine = false;
+ var shouldTrackWidth = lineWidth !== -1;
+ var previousLineBreak = -1;
+ var plain = isPlainSafeFirst(string3.charCodeAt(0)) && !isWhitespace(string3.charCodeAt(string3.length - 1));
+ if (singleLineOnly) {
+ for (i11 = 0; i11 < string3.length; i11++) {
+ char = string3.charCodeAt(i11);
+ if (!isPrintable(char)) {
+ return STYLE_DOUBLE;
+ }
+ prev_char = i11 > 0 ? string3.charCodeAt(i11 - 1) : null;
+ plain = plain && isPlainSafe(char, prev_char);
+ }
+ } else {
+ for (i11 = 0; i11 < string3.length; i11++) {
+ char = string3.charCodeAt(i11);
+ if (char === CHAR_LINE_FEED) {
+ hasLineBreak = true;
+ if (shouldTrackWidth) {
+ hasFoldableLine = hasFoldableLine || // Foldable line = too long, and not more-indented.
+ i11 - previousLineBreak - 1 > lineWidth && string3[previousLineBreak + 1] !== " ";
+ previousLineBreak = i11;
+ }
+ } else if (!isPrintable(char)) {
+ return STYLE_DOUBLE;
+ }
+ prev_char = i11 > 0 ? string3.charCodeAt(i11 - 1) : null;
+ plain = plain && isPlainSafe(char, prev_char);
+ }
+ hasFoldableLine = hasFoldableLine || shouldTrackWidth && (i11 - previousLineBreak - 1 > lineWidth && string3[previousLineBreak + 1] !== " ");
+ }
+ if (!hasLineBreak && !hasFoldableLine) {
+ return plain && !testAmbiguousType(string3) ? STYLE_PLAIN : STYLE_SINGLE;
+ }
+ if (indentPerLevel > 9 && needIndentIndicator(string3)) {
+ return STYLE_DOUBLE;
+ }
+ return hasFoldableLine ? STYLE_FOLDED : STYLE_LITERAL;
+ }
+ function writeScalar(state, string3, level, iskey) {
+ state.dump = (function() {
+ if (string3.length === 0) {
+ return "''";
+ }
+ if (!state.noCompatMode && DEPRECATED_BOOLEANS_SYNTAX.indexOf(string3) !== -1) {
+ return "'" + string3 + "'";
+ }
+ var indent3 = state.indent * Math.max(1, level);
+ var lineWidth = state.lineWidth === -1 ? -1 : Math.max(Math.min(state.lineWidth, 40), state.lineWidth - indent3);
+ var singleLineOnly = iskey || state.flowLevel > -1 && level >= state.flowLevel;
+ function testAmbiguity(string4) {
+ return testImplicitResolving(state, string4);
+ }
+ switch (chooseScalarStyle(string3, singleLineOnly, state.indent, lineWidth, testAmbiguity)) {
+ case STYLE_PLAIN:
+ return string3;
+ case STYLE_SINGLE:
+ return "'" + string3.replace(/'/g, "''") + "'";
+ case STYLE_LITERAL:
+ return "|" + blockHeader(string3, state.indent) + dropEndingNewline(indentString(string3, indent3));
+ case STYLE_FOLDED:
+ return ">" + blockHeader(string3, state.indent) + dropEndingNewline(indentString(foldString(string3, lineWidth), indent3));
+ case STYLE_DOUBLE:
+ return '"' + escapeString(string3, lineWidth) + '"';
+ default:
+ throw new YAMLException("impossible error: invalid scalar style");
+ }
+ })();
+ }
+ function blockHeader(string3, indentPerLevel) {
+ var indentIndicator = needIndentIndicator(string3) ? String(indentPerLevel) : "";
+ var clip = string3[string3.length - 1] === "\n";
+ var keep = clip && (string3[string3.length - 2] === "\n" || string3 === "\n");
+ var chomp = keep ? "+" : clip ? "" : "-";
+ return indentIndicator + chomp + "\n";
+ }
+ function dropEndingNewline(string3) {
+ return string3[string3.length - 1] === "\n" ? string3.slice(0, -1) : string3;
+ }
+ function foldString(string3, width) {
+ var lineRe = /(\n+)([^\n]*)/g;
+ var result = (function() {
+ var nextLF = string3.indexOf("\n");
+ nextLF = nextLF !== -1 ? nextLF : string3.length;
+ lineRe.lastIndex = nextLF;
+ return foldLine(string3.slice(0, nextLF), width);
+ })();
+ var prevMoreIndented = string3[0] === "\n" || string3[0] === " ";
+ var moreIndented;
+ var match2;
+ while (match2 = lineRe.exec(string3)) {
+ var prefix4 = match2[1], line = match2[2];
+ moreIndented = line[0] === " ";
+ result += prefix4 + (!prevMoreIndented && !moreIndented && line !== "" ? "\n" : "") + foldLine(line, width);
+ prevMoreIndented = moreIndented;
+ }
+ return result;
+ }
+ function foldLine(line, width) {
+ if (line === "" || line[0] === " ") return line;
+ var breakRe = / [^ ]/g;
+ var match2;
+ var start = 0, end3, curr = 0, next2 = 0;
+ var result = "";
+ while (match2 = breakRe.exec(line)) {
+ next2 = match2.index;
+ if (next2 - start > width) {
+ end3 = curr > start ? curr : next2;
+ result += "\n" + line.slice(start, end3);
+ start = end3 + 1;
+ }
+ curr = next2;
+ }
+ result += "\n";
+ if (line.length - start > width && curr > start) {
+ result += line.slice(start, curr) + "\n" + line.slice(curr + 1);
+ } else {
+ result += line.slice(start);
+ }
+ return result.slice(1);
+ }
+ function escapeString(string3) {
+ var result = "";
+ var char, nextChar;
+ var escapeSeq;
+ for (var i11 = 0; i11 < string3.length; i11++) {
+ char = string3.charCodeAt(i11);
+ if (char >= 55296 && char <= 56319) {
+ nextChar = string3.charCodeAt(i11 + 1);
+ if (nextChar >= 56320 && nextChar <= 57343) {
+ result += encodeHex((char - 55296) * 1024 + nextChar - 56320 + 65536);
+ i11++;
+ continue;
+ }
+ }
+ escapeSeq = ESCAPE_SEQUENCES[char];
+ result += !escapeSeq && isPrintable(char) ? string3[i11] : escapeSeq || encodeHex(char);
+ }
+ return result;
+ }
+ function writeFlowSequence(state, level, object) {
+ var _result = "", _tag = state.tag, index2, length;
+ for (index2 = 0, length = object.length; index2 < length; index2 += 1) {
+ if (writeNode(state, level, object[index2], false, false)) {
+ if (index2 !== 0) _result += "," + (!state.condenseFlow ? " " : "");
+ _result += state.dump;
+ }
+ }
+ state.tag = _tag;
+ state.dump = "[" + _result + "]";
+ }
+ function writeBlockSequence(state, level, object, compact) {
+ var _result = "", _tag = state.tag, index2, length;
+ for (index2 = 0, length = object.length; index2 < length; index2 += 1) {
+ if (writeNode(state, level + 1, object[index2], true, true)) {
+ if (!compact || index2 !== 0) {
+ _result += generateNextLine(state, level);
+ }
+ if (state.dump && CHAR_LINE_FEED === state.dump.charCodeAt(0)) {
+ _result += "-";
+ } else {
+ _result += "- ";
+ }
+ _result += state.dump;
+ }
+ }
+ state.tag = _tag;
+ state.dump = _result || "[]";
+ }
+ function writeFlowMapping(state, level, object) {
+ var _result = "", _tag = state.tag, objectKeyList = Object.keys(object), index2, length, objectKey, objectValue, pairBuffer;
+ for (index2 = 0, length = objectKeyList.length; index2 < length; index2 += 1) {
+ pairBuffer = "";
+ if (index2 !== 0) pairBuffer += ", ";
+ if (state.condenseFlow) pairBuffer += '"';
+ objectKey = objectKeyList[index2];
+ objectValue = object[objectKey];
+ if (!writeNode(state, level, objectKey, false, false)) {
+ continue;
+ }
+ if (state.dump.length > 1024) pairBuffer += "? ";
+ pairBuffer += state.dump + (state.condenseFlow ? '"' : "") + ":" + (state.condenseFlow ? "" : " ");
+ if (!writeNode(state, level, objectValue, false, false)) {
+ continue;
+ }
+ pairBuffer += state.dump;
+ _result += pairBuffer;
+ }
+ state.tag = _tag;
+ state.dump = "{" + _result + "}";
+ }
+ function writeBlockMapping(state, level, object, compact) {
+ var _result = "", _tag = state.tag, objectKeyList = Object.keys(object), index2, length, objectKey, objectValue, explicitPair, pairBuffer;
+ if (state.sortKeys === true) {
+ objectKeyList.sort();
+ } else if (typeof state.sortKeys === "function") {
+ objectKeyList.sort(state.sortKeys);
+ } else if (state.sortKeys) {
+ throw new YAMLException("sortKeys must be a boolean or a function");
+ }
+ for (index2 = 0, length = objectKeyList.length; index2 < length; index2 += 1) {
+ pairBuffer = "";
+ if (!compact || index2 !== 0) {
+ pairBuffer += generateNextLine(state, level);
+ }
+ objectKey = objectKeyList[index2];
+ objectValue = object[objectKey];
+ if (!writeNode(state, level + 1, objectKey, true, true, true)) {
+ continue;
+ }
+ explicitPair = state.tag !== null && state.tag !== "?" || state.dump && state.dump.length > 1024;
+ if (explicitPair) {
+ if (state.dump && CHAR_LINE_FEED === state.dump.charCodeAt(0)) {
+ pairBuffer += "?";
+ } else {
+ pairBuffer += "? ";
+ }
+ }
+ pairBuffer += state.dump;
+ if (explicitPair) {
+ pairBuffer += generateNextLine(state, level);
+ }
+ if (!writeNode(state, level + 1, objectValue, true, explicitPair)) {
+ continue;
+ }
+ if (state.dump && CHAR_LINE_FEED === state.dump.charCodeAt(0)) {
+ pairBuffer += ":";
+ } else {
+ pairBuffer += ": ";
+ }
+ pairBuffer += state.dump;
+ _result += pairBuffer;
+ }
+ state.tag = _tag;
+ state.dump = _result || "{}";
+ }
+ function detectType(state, object, explicit) {
+ var _result, typeList, index2, length, type5, style;
+ typeList = explicit ? state.explicitTypes : state.implicitTypes;
+ for (index2 = 0, length = typeList.length; index2 < length; index2 += 1) {
+ type5 = typeList[index2];
+ if ((type5.instanceOf || type5.predicate) && (!type5.instanceOf || typeof object === "object" && object instanceof type5.instanceOf) && (!type5.predicate || type5.predicate(object))) {
+ state.tag = explicit ? type5.tag : "?";
+ if (type5.represent) {
+ style = state.styleMap[type5.tag] || type5.defaultStyle;
+ if (_toString.call(type5.represent) === "[object Function]") {
+ _result = type5.represent(object, style);
+ } else if (_hasOwnProperty.call(type5.represent, style)) {
+ _result = type5.represent[style](object, style);
+ } else {
+ throw new YAMLException("!<" + type5.tag + '> tag resolver accepts not "' + style + '" style');
+ }
+ state.dump = _result;
+ }
+ return true;
+ }
+ }
+ return false;
+ }
+ function writeNode(state, level, object, block, compact, iskey) {
+ state.tag = null;
+ state.dump = object;
+ if (!detectType(state, object, false)) {
+ detectType(state, object, true);
+ }
+ var type5 = _toString.call(state.dump);
+ if (block) {
+ block = state.flowLevel < 0 || state.flowLevel > level;
+ }
+ var objectOrArray = type5 === "[object Object]" || type5 === "[object Array]", duplicateIndex, duplicate;
+ if (objectOrArray) {
+ duplicateIndex = state.duplicates.indexOf(object);
+ duplicate = duplicateIndex !== -1;
+ }
+ if (state.tag !== null && state.tag !== "?" || duplicate || state.indent !== 2 && level > 0) {
+ compact = false;
+ }
+ if (duplicate && state.usedDuplicates[duplicateIndex]) {
+ state.dump = "*ref_" + duplicateIndex;
+ } else {
+ if (objectOrArray && duplicate && !state.usedDuplicates[duplicateIndex]) {
+ state.usedDuplicates[duplicateIndex] = true;
+ }
+ if (type5 === "[object Object]") {
+ if (block && Object.keys(state.dump).length !== 0) {
+ writeBlockMapping(state, level, state.dump, compact);
+ if (duplicate) {
+ state.dump = "&ref_" + duplicateIndex + state.dump;
+ }
+ } else {
+ writeFlowMapping(state, level, state.dump);
+ if (duplicate) {
+ state.dump = "&ref_" + duplicateIndex + " " + state.dump;
+ }
+ }
+ } else if (type5 === "[object Array]") {
+ var arrayLevel = state.noArrayIndent && level > 0 ? level - 1 : level;
+ if (block && state.dump.length !== 0) {
+ writeBlockSequence(state, arrayLevel, state.dump, compact);
+ if (duplicate) {
+ state.dump = "&ref_" + duplicateIndex + state.dump;
+ }
+ } else {
+ writeFlowSequence(state, arrayLevel, state.dump);
+ if (duplicate) {
+ state.dump = "&ref_" + duplicateIndex + " " + state.dump;
+ }
+ }
+ } else if (type5 === "[object String]") {
+ if (state.tag !== "?") {
+ writeScalar(state, state.dump, level, iskey);
+ }
+ } else {
+ if (state.skipInvalid) return false;
+ throw new YAMLException("unacceptable kind of an object to dump " + type5);
+ }
+ if (state.tag !== null && state.tag !== "?") {
+ state.dump = "!<" + state.tag + "> " + state.dump;
+ }
+ }
+ return true;
+ }
+ function getDuplicateReferences(object, state) {
+ var objects = [], duplicatesIndexes = [], index2, length;
+ inspectNode(object, objects, duplicatesIndexes);
+ for (index2 = 0, length = duplicatesIndexes.length; index2 < length; index2 += 1) {
+ state.duplicates.push(objects[duplicatesIndexes[index2]]);
+ }
+ state.usedDuplicates = new Array(length);
+ }
+ function inspectNode(object, objects, duplicatesIndexes) {
+ var objectKeyList, index2, length;
+ if (object !== null && typeof object === "object") {
+ index2 = objects.indexOf(object);
+ if (index2 !== -1) {
+ if (duplicatesIndexes.indexOf(index2) === -1) {
+ duplicatesIndexes.push(index2);
+ }
+ } else {
+ objects.push(object);
+ if (Array.isArray(object)) {
+ for (index2 = 0, length = object.length; index2 < length; index2 += 1) {
+ inspectNode(object[index2], objects, duplicatesIndexes);
+ }
+ } else {
+ objectKeyList = Object.keys(object);
+ for (index2 = 0, length = objectKeyList.length; index2 < length; index2 += 1) {
+ inspectNode(object[objectKeyList[index2]], objects, duplicatesIndexes);
+ }
+ }
+ }
+ }
+ }
+ function dump(input, options) {
+ options = options || {};
+ var state = new State(options);
+ if (!state.noRefs) getDuplicateReferences(input, state);
+ if (writeNode(state, 0, input, true, true)) return state.dump + "\n";
+ return "";
+ }
+ function safeDump(input, options) {
+ return dump(input, common.extend({ schema: DEFAULT_SAFE_SCHEMA }, options));
+ }
+ module.exports.dump = dump;
+ module.exports.safeDump = safeDump;
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml.js
+var require_js_yaml = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/lib/js-yaml.js"(exports, module) {
+ "use strict";
+ var loader = require_loader();
+ var dumper = require_dumper();
+ function deprecated(name) {
+ return function() {
+ throw new Error("Function " + name + " is deprecated and cannot be used.");
+ };
+ }
+ module.exports.Type = require_type();
+ module.exports.Schema = require_schema();
+ module.exports.FAILSAFE_SCHEMA = require_failsafe();
+ module.exports.JSON_SCHEMA = require_json();
+ module.exports.CORE_SCHEMA = require_core();
+ module.exports.DEFAULT_SAFE_SCHEMA = require_default_safe();
+ module.exports.DEFAULT_FULL_SCHEMA = require_default_full();
+ module.exports.load = loader.load;
+ module.exports.loadAll = loader.loadAll;
+ module.exports.safeLoad = loader.safeLoad;
+ module.exports.safeLoadAll = loader.safeLoadAll;
+ module.exports.dump = dumper.dump;
+ module.exports.safeDump = dumper.safeDump;
+ module.exports.YAMLException = require_exception();
+ module.exports.MINIMAL_SCHEMA = require_failsafe();
+ module.exports.SAFE_SCHEMA = require_default_safe();
+ module.exports.DEFAULT_SCHEMA = require_default_full();
+ module.exports.scan = deprecated("scan");
+ module.exports.parse = deprecated("parse");
+ module.exports.compose = deprecated("compose");
+ module.exports.addConstructor = deprecated("addConstructor");
+ }
+});
+
+// node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/index.js
+var require_js_yaml2 = __commonJS({
+ "node_modules/.pnpm/js-yaml@3.14.2/node_modules/js-yaml/index.js"(exports, module) {
+ "use strict";
+ var yaml = require_js_yaml();
+ module.exports = yaml;
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartyaml@2.0.5/node_modules/@push.rocks/smartyaml/dist_ts/smartyaml.plugins.js
+var require_smartyaml_plugins = __commonJS({
+ "node_modules/.pnpm/@push.rocks+smartyaml@2.0.5/node_modules/@push.rocks/smartyaml/dist_ts/smartyaml.plugins.js"(exports) {
+ "use strict";
+ var __createBinding2 = exports && exports.__createBinding || (Object.create ? (function(o13, m6, k4, k22) {
+ if (k22 === void 0) k22 = k4;
+ Object.defineProperty(o13, k22, { enumerable: true, get: function() {
+ return m6[k4];
+ } });
+ }) : (function(o13, m6, k4, k22) {
+ if (k22 === void 0) k22 = k4;
+ o13[k22] = m6[k4];
+ }));
+ var __setModuleDefault2 = exports && exports.__setModuleDefault || (Object.create ? (function(o13, v5) {
+ Object.defineProperty(o13, "default", { enumerable: true, value: v5 });
+ }) : function(o13, v5) {
+ o13["default"] = v5;
+ });
+ var __importStar2 = exports && exports.__importStar || function(mod) {
+ if (mod && mod.__esModule) return mod;
+ var result = {};
+ if (mod != null) {
+ for (var k4 in mod) if (k4 !== "default" && Object.hasOwnProperty.call(mod, k4)) __createBinding2(result, mod, k4);
+ }
+ __setModuleDefault2(result, mod);
+ return result;
+ };
+ Object.defineProperty(exports, "__esModule", { value: true });
+ exports.jsYaml = void 0;
+ var jsYaml = __importStar2(require_js_yaml2());
+ exports.jsYaml = jsYaml;
+ }
+});
+
+// node_modules/.pnpm/@push.rocks+smartyaml@2.0.5/node_modules/@push.rocks/smartyaml/dist_ts/index.js
+var require_dist_ts2 = __commonJS({
+ "node_modules/.pnpm/@push.rocks+smartyaml@2.0.5/node_modules/@push.rocks/smartyaml/dist_ts/index.js"(exports) {
+ "use strict";
+ var __createBinding2 = exports && exports.__createBinding || (Object.create ? (function(o13, m6, k4, k22) {
+ if (k22 === void 0) k22 = k4;
+ Object.defineProperty(o13, k22, { enumerable: true, get: function() {
+ return m6[k4];
+ } });
+ }) : (function(o13, m6, k4, k22) {
+ if (k22 === void 0) k22 = k4;
+ o13[k22] = m6[k4];
+ }));
+ var __setModuleDefault2 = exports && exports.__setModuleDefault || (Object.create ? (function(o13, v5) {
+ Object.defineProperty(o13, "default", { enumerable: true, value: v5 });
+ }) : function(o13, v5) {
+ o13["default"] = v5;
+ });
+ var __importStar2 = exports && exports.__importStar || function(mod) {
+ if (mod && mod.__esModule) return mod;
+ var result = {};
+ if (mod != null) {
+ for (var k4 in mod) if (k4 !== "default" && Object.hasOwnProperty.call(mod, k4)) __createBinding2(result, mod, k4);
+ }
+ __setModuleDefault2(result, mod);
+ return result;
+ };
+ Object.defineProperty(exports, "__esModule", { value: true });
+ exports.objectToYamlString = exports.yamlStringToObject = void 0;
+ var plugins13 = __importStar2(require_smartyaml_plugins());
+ exports.yamlStringToObject = async (yamlStringArg, optionsArg = {}) => {
+ return plugins13.jsYaml.safeLoad(yamlStringArg);
+ };
+ exports.objectToYamlString = async (objectArg, optionsArg = {}) => {
+ return plugins13.jsYaml.safeDump(objectArg);
+ };
+ }
+});
+
+// node_modules/.pnpm/bail@2.0.2/node_modules/bail/index.js
+function bail(error) {
+ if (error) {
+ throw error;
+ }
+}
+var init_bail = __esm({
+ "node_modules/.pnpm/bail@2.0.2/node_modules/bail/index.js"() {
+ }
+});
+
+// node_modules/.pnpm/extend@3.0.2/node_modules/extend/index.js
+var require_extend = __commonJS({
+ "node_modules/.pnpm/extend@3.0.2/node_modules/extend/index.js"(exports, module) {
+ "use strict";
+ var hasOwn = Object.prototype.hasOwnProperty;
+ var toStr = Object.prototype.toString;
+ var defineProperty = Object.defineProperty;
+ var gOPD = Object.getOwnPropertyDescriptor;
+ var isArray4 = function isArray5(arr) {
+ if (typeof Array.isArray === "function") {
+ return Array.isArray(arr);
+ }
+ return toStr.call(arr) === "[object Array]";
+ };
+ var isPlainObject2 = function isPlainObject3(obj) {
+ if (!obj || toStr.call(obj) !== "[object Object]") {
+ return false;
+ }
+ var hasOwnConstructor = hasOwn.call(obj, "constructor");
+ var hasIsPrototypeOf = obj.constructor && obj.constructor.prototype && hasOwn.call(obj.constructor.prototype, "isPrototypeOf");
+ if (obj.constructor && !hasOwnConstructor && !hasIsPrototypeOf) {
+ return false;
+ }
+ var key2;
+ for (key2 in obj) {
+ }
+ return typeof key2 === "undefined" || hasOwn.call(obj, key2);
+ };
+ var setProperty = function setProperty2(target, options) {
+ if (defineProperty && options.name === "__proto__") {
+ defineProperty(target, options.name, {
+ enumerable: true,
+ configurable: true,
+ value: options.newValue,
+ writable: true
+ });
+ } else {
+ target[options.name] = options.newValue;
+ }
+ };
+ var getProperty = function getProperty2(obj, name) {
+ if (name === "__proto__") {
+ if (!hasOwn.call(obj, name)) {
+ return void 0;
+ } else if (gOPD) {
+ return gOPD(obj, name).value;
+ }
+ }
+ return obj[name];
+ };
+ module.exports = function extend3() {
+ var options, name, src, copy, copyIsArray, clone;
+ var target = arguments[0];
+ var i11 = 1;
+ var length = arguments.length;
+ var deep = false;
+ if (typeof target === "boolean") {
+ deep = target;
+ target = arguments[1] || {};
+ i11 = 2;
+ }
+ if (target == null || typeof target !== "object" && typeof target !== "function") {
+ target = {};
+ }
+ for (; i11 < length; ++i11) {
+ options = arguments[i11];
+ if (options != null) {
+ for (name in options) {
+ src = getProperty(target, name);
+ copy = getProperty(options, name);
+ if (target !== copy) {
+ if (deep && copy && (isPlainObject2(copy) || (copyIsArray = isArray4(copy)))) {
+ if (copyIsArray) {
+ copyIsArray = false;
+ clone = src && isArray4(src) ? src : [];
+ } else {
+ clone = src && isPlainObject2(src) ? src : {};
+ }
+ setProperty(target, { name, newValue: extend3(deep, clone, copy) });
+ } else if (typeof copy !== "undefined") {
+ setProperty(target, { name, newValue: copy });
+ }
+ }
+ }
+ }
+ }
+ return target;
+ };
+ }
+});
+
+// node_modules/.pnpm/devlop@1.1.0/node_modules/devlop/lib/default.js
+function deprecate(fn) {
+ return fn;
+}
+function equal() {
+}
+function ok() {
+}
+function unreachable() {
+}
+var init_default = __esm({
+ "node_modules/.pnpm/devlop@1.1.0/node_modules/devlop/lib/default.js"() {
+ }
+});
+
+// node_modules/.pnpm/is-plain-obj@4.1.0/node_modules/is-plain-obj/index.js
+function isPlainObject(value2) {
+ if (typeof value2 !== "object" || value2 === null) {
+ return false;
+ }
+ const prototype = Object.getPrototypeOf(value2);
+ return (prototype === null || prototype === Object.prototype || Object.getPrototypeOf(prototype) === null) && !(Symbol.toStringTag in value2) && !(Symbol.iterator in value2);
+}
+var init_is_plain_obj = __esm({
+ "node_modules/.pnpm/is-plain-obj@4.1.0/node_modules/is-plain-obj/index.js"() {
+ }
+});
+
+// node_modules/.pnpm/trough@2.2.0/node_modules/trough/lib/index.js
+function trough() {
+ const fns = [];
+ const pipeline = { run, use };
+ return pipeline;
+ function run(...values) {
+ let middlewareIndex = -1;
+ const callback = values.pop();
+ if (typeof callback !== "function") {
+ throw new TypeError("Expected function as last argument, not " + callback);
+ }
+ next2(null, ...values);
+ function next2(error, ...output) {
+ const fn = fns[++middlewareIndex];
+ let index2 = -1;
+ if (error) {
+ callback(error);
+ return;
+ }
+ while (++index2 < values.length) {
+ if (output[index2] === null || output[index2] === void 0) {
+ output[index2] = values[index2];
+ }
+ }
+ values = output;
+ if (fn) {
+ wrap2(fn, next2)(...output);
+ } else {
+ callback(null, ...output);
+ }
+ }
+ }
+ function use(middelware) {
+ if (typeof middelware !== "function") {
+ throw new TypeError(
+ "Expected `middelware` to be a function, not " + middelware
+ );
+ }
+ fns.push(middelware);
+ return pipeline;
+ }
+}
+function wrap2(middleware, callback) {
+ let called;
+ return wrapped;
+ function wrapped(...parameters) {
+ const fnExpectsCallback = middleware.length > parameters.length;
+ let result;
+ if (fnExpectsCallback) {
+ parameters.push(done);
+ }
+ try {
+ result = middleware.apply(this, parameters);
+ } catch (error) {
+ const exception = (
+ /** @type {Error} */
+ error
+ );
+ if (fnExpectsCallback && called) {
+ throw exception;
+ }
+ return done(exception);
+ }
+ if (!fnExpectsCallback) {
+ if (result && result.then && typeof result.then === "function") {
+ result.then(then, done);
+ } else if (result instanceof Error) {
+ done(result);
+ } else {
+ then(result);
+ }
+ }
+ }
+ function done(error, ...output) {
+ if (!called) {
+ called = true;
+ callback(error, ...output);
+ }
+ }
+ function then(value2) {
+ done(null, value2);
+ }
+}
+var init_lib = __esm({
+ "node_modules/.pnpm/trough@2.2.0/node_modules/trough/lib/index.js"() {
+ }
+});
+
+// node_modules/.pnpm/trough@2.2.0/node_modules/trough/index.js
+var init_trough = __esm({
+ "node_modules/.pnpm/trough@2.2.0/node_modules/trough/index.js"() {
+ init_lib();
+ }
+});
+
+// node_modules/.pnpm/unist-util-stringify-position@4.0.0/node_modules/unist-util-stringify-position/lib/index.js
+function stringifyPosition(value2) {
+ if (!value2 || typeof value2 !== "object") {
+ return "";
+ }
+ if ("position" in value2 || "type" in value2) {
+ return position(value2.position);
+ }
+ if ("start" in value2 || "end" in value2) {
+ return position(value2);
+ }
+ if ("line" in value2 || "column" in value2) {
+ return point(value2);
+ }
+ return "";
+}
+function point(point4) {
+ return index(point4 && point4.line) + ":" + index(point4 && point4.column);
+}
+function position(pos) {
+ return point(pos && pos.start) + "-" + point(pos && pos.end);
+}
+function index(value2) {
+ return value2 && typeof value2 === "number" ? value2 : 1;
+}
+var init_lib2 = __esm({
+ "node_modules/.pnpm/unist-util-stringify-position@4.0.0/node_modules/unist-util-stringify-position/lib/index.js"() {
+ }
+});
+
+// node_modules/.pnpm/unist-util-stringify-position@4.0.0/node_modules/unist-util-stringify-position/index.js
+var init_unist_util_stringify_position = __esm({
+ "node_modules/.pnpm/unist-util-stringify-position@4.0.0/node_modules/unist-util-stringify-position/index.js"() {
+ init_lib2();
+ }
+});
+
+// node_modules/.pnpm/vfile-message@4.0.3/node_modules/vfile-message/lib/index.js
+var VFileMessage;
+var init_lib3 = __esm({
+ "node_modules/.pnpm/vfile-message@4.0.3/node_modules/vfile-message/lib/index.js"() {
+ init_unist_util_stringify_position();
+ VFileMessage = class extends Error {
+ /**
+ * Create a message for `reason`.
+ *
+ * > 🪦 **Note**: also has obsolete signatures.
+ *
+ * @overload
+ * @param {string} reason
+ * @param {Options | null | undefined} [options]
+ * @returns
+ *
+ * @overload
+ * @param {string} reason
+ * @param {Node | NodeLike | null | undefined} parent
+ * @param {string | null | undefined} [origin]
+ * @returns
+ *
+ * @overload
+ * @param {string} reason
+ * @param {Point | Position | null | undefined} place
+ * @param {string | null | undefined} [origin]
+ * @returns
+ *
+ * @overload
+ * @param {string} reason
+ * @param {string | null | undefined} [origin]
+ * @returns
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {Node | NodeLike | null | undefined} parent
+ * @param {string | null | undefined} [origin]
+ * @returns
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {Point | Position | null | undefined} place
+ * @param {string | null | undefined} [origin]
+ * @returns
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {string | null | undefined} [origin]
+ * @returns
+ *
+ * @param {Error | VFileMessage | string} causeOrReason
+ * Reason for message, should use markdown.
+ * @param {Node | NodeLike | Options | Point | Position | string | null | undefined} [optionsOrParentOrPlace]
+ * Configuration (optional).
+ * @param {string | null | undefined} [origin]
+ * Place in code where the message originates (example:
+ * `'my-package:my-rule'` or `'my-rule'`).
+ * @returns
+ * Instance of `VFileMessage`.
+ */
+ // eslint-disable-next-line complexity
+ constructor(causeOrReason, optionsOrParentOrPlace, origin) {
+ super();
+ if (typeof optionsOrParentOrPlace === "string") {
+ origin = optionsOrParentOrPlace;
+ optionsOrParentOrPlace = void 0;
+ }
+ let reason = "";
+ let options = {};
+ let legacyCause = false;
+ if (optionsOrParentOrPlace) {
+ if ("line" in optionsOrParentOrPlace && "column" in optionsOrParentOrPlace) {
+ options = { place: optionsOrParentOrPlace };
+ } else if ("start" in optionsOrParentOrPlace && "end" in optionsOrParentOrPlace) {
+ options = { place: optionsOrParentOrPlace };
+ } else if ("type" in optionsOrParentOrPlace) {
+ options = {
+ ancestors: [optionsOrParentOrPlace],
+ place: optionsOrParentOrPlace.position
+ };
+ } else {
+ options = { ...optionsOrParentOrPlace };
+ }
+ }
+ if (typeof causeOrReason === "string") {
+ reason = causeOrReason;
+ } else if (!options.cause && causeOrReason) {
+ legacyCause = true;
+ reason = causeOrReason.message;
+ options.cause = causeOrReason;
+ }
+ if (!options.ruleId && !options.source && typeof origin === "string") {
+ const index2 = origin.indexOf(":");
+ if (index2 === -1) {
+ options.ruleId = origin;
+ } else {
+ options.source = origin.slice(0, index2);
+ options.ruleId = origin.slice(index2 + 1);
+ }
+ }
+ if (!options.place && options.ancestors && options.ancestors) {
+ const parent = options.ancestors[options.ancestors.length - 1];
+ if (parent) {
+ options.place = parent.position;
+ }
+ }
+ const start = options.place && "start" in options.place ? options.place.start : options.place;
+ this.ancestors = options.ancestors || void 0;
+ this.cause = options.cause || void 0;
+ this.column = start ? start.column : void 0;
+ this.fatal = void 0;
+ this.file = "";
+ this.message = reason;
+ this.line = start ? start.line : void 0;
+ this.name = stringifyPosition(options.place) || "1:1";
+ this.place = options.place || void 0;
+ this.reason = this.message;
+ this.ruleId = options.ruleId || void 0;
+ this.source = options.source || void 0;
+ this.stack = legacyCause && options.cause && typeof options.cause.stack === "string" ? options.cause.stack : "";
+ this.actual = void 0;
+ this.expected = void 0;
+ this.note = void 0;
+ this.url = void 0;
+ }
+ };
+ VFileMessage.prototype.file = "";
+ VFileMessage.prototype.name = "";
+ VFileMessage.prototype.reason = "";
+ VFileMessage.prototype.message = "";
+ VFileMessage.prototype.stack = "";
+ VFileMessage.prototype.column = void 0;
+ VFileMessage.prototype.line = void 0;
+ VFileMessage.prototype.ancestors = void 0;
+ VFileMessage.prototype.cause = void 0;
+ VFileMessage.prototype.fatal = void 0;
+ VFileMessage.prototype.place = void 0;
+ VFileMessage.prototype.ruleId = void 0;
+ VFileMessage.prototype.source = void 0;
+ }
+});
+
+// node_modules/.pnpm/vfile-message@4.0.3/node_modules/vfile-message/index.js
+var init_vfile_message = __esm({
+ "node_modules/.pnpm/vfile-message@4.0.3/node_modules/vfile-message/index.js"() {
+ init_lib3();
+ }
+});
+
+// node_modules/.pnpm/vfile@6.0.3/node_modules/vfile/lib/minpath.browser.js
+function basename(path2, extname2) {
+ if (extname2 !== void 0 && typeof extname2 !== "string") {
+ throw new TypeError('"ext" argument must be a string');
+ }
+ assertPath(path2);
+ let start = 0;
+ let end3 = -1;
+ let index2 = path2.length;
+ let seenNonSlash;
+ if (extname2 === void 0 || extname2.length === 0 || extname2.length > path2.length) {
+ while (index2--) {
+ if (path2.codePointAt(index2) === 47) {
+ if (seenNonSlash) {
+ start = index2 + 1;
+ break;
+ }
+ } else if (end3 < 0) {
+ seenNonSlash = true;
+ end3 = index2 + 1;
+ }
+ }
+ return end3 < 0 ? "" : path2.slice(start, end3);
+ }
+ if (extname2 === path2) {
+ return "";
+ }
+ let firstNonSlashEnd = -1;
+ let extnameIndex = extname2.length - 1;
+ while (index2--) {
+ if (path2.codePointAt(index2) === 47) {
+ if (seenNonSlash) {
+ start = index2 + 1;
+ break;
+ }
+ } else {
+ if (firstNonSlashEnd < 0) {
+ seenNonSlash = true;
+ firstNonSlashEnd = index2 + 1;
+ }
+ if (extnameIndex > -1) {
+ if (path2.codePointAt(index2) === extname2.codePointAt(extnameIndex--)) {
+ if (extnameIndex < 0) {
+ end3 = index2;
+ }
+ } else {
+ extnameIndex = -1;
+ end3 = firstNonSlashEnd;
+ }
+ }
+ }
+ }
+ if (start === end3) {
+ end3 = firstNonSlashEnd;
+ } else if (end3 < 0) {
+ end3 = path2.length;
+ }
+ return path2.slice(start, end3);
+}
+function dirname(path2) {
+ assertPath(path2);
+ if (path2.length === 0) {
+ return ".";
+ }
+ let end3 = -1;
+ let index2 = path2.length;
+ let unmatchedSlash;
+ while (--index2) {
+ if (path2.codePointAt(index2) === 47) {
+ if (unmatchedSlash) {
+ end3 = index2;
+ break;
+ }
+ } else if (!unmatchedSlash) {
+ unmatchedSlash = true;
+ }
+ }
+ return end3 < 0 ? path2.codePointAt(0) === 47 ? "/" : "." : end3 === 1 && path2.codePointAt(0) === 47 ? "//" : path2.slice(0, end3);
+}
+function extname(path2) {
+ assertPath(path2);
+ let index2 = path2.length;
+ let end3 = -1;
+ let startPart = 0;
+ let startDot = -1;
+ let preDotState = 0;
+ let unmatchedSlash;
+ while (index2--) {
+ const code4 = path2.codePointAt(index2);
+ if (code4 === 47) {
+ if (unmatchedSlash) {
+ startPart = index2 + 1;
+ break;
+ }
+ continue;
+ }
+ if (end3 < 0) {
+ unmatchedSlash = true;
+ end3 = index2 + 1;
+ }
+ if (code4 === 46) {
+ if (startDot < 0) {
+ startDot = index2;
+ } else if (preDotState !== 1) {
+ preDotState = 1;
+ }
+ } else if (startDot > -1) {
+ preDotState = -1;
+ }
+ }
+ if (startDot < 0 || end3 < 0 || // We saw a non-dot character immediately before the dot.
+ preDotState === 0 || // The (right-most) trimmed path component is exactly `..`.
+ preDotState === 1 && startDot === end3 - 1 && startDot === startPart + 1) {
+ return "";
+ }
+ return path2.slice(startDot, end3);
+}
+function join(...segments) {
+ let index2 = -1;
+ let joined;
+ while (++index2 < segments.length) {
+ assertPath(segments[index2]);
+ if (segments[index2]) {
+ joined = joined === void 0 ? segments[index2] : joined + "/" + segments[index2];
+ }
+ }
+ return joined === void 0 ? "." : normalize2(joined);
+}
+function normalize2(path2) {
+ assertPath(path2);
+ const absolute = path2.codePointAt(0) === 47;
+ let value2 = normalizeString(path2, !absolute);
+ if (value2.length === 0 && !absolute) {
+ value2 = ".";
+ }
+ if (value2.length > 0 && path2.codePointAt(path2.length - 1) === 47) {
+ value2 += "/";
+ }
+ return absolute ? "/" + value2 : value2;
+}
+function normalizeString(path2, allowAboveRoot) {
+ let result = "";
+ let lastSegmentLength = 0;
+ let lastSlash = -1;
+ let dots = 0;
+ let index2 = -1;
+ let code4;
+ let lastSlashIndex;
+ while (++index2 <= path2.length) {
+ if (index2 < path2.length) {
+ code4 = path2.codePointAt(index2);
+ } else if (code4 === 47) {
+ break;
+ } else {
+ code4 = 47;
+ }
+ if (code4 === 47) {
+ if (lastSlash === index2 - 1 || dots === 1) {
+ } else if (lastSlash !== index2 - 1 && dots === 2) {
+ if (result.length < 2 || lastSegmentLength !== 2 || result.codePointAt(result.length - 1) !== 46 || result.codePointAt(result.length - 2) !== 46) {
+ if (result.length > 2) {
+ lastSlashIndex = result.lastIndexOf("/");
+ if (lastSlashIndex !== result.length - 1) {
+ if (lastSlashIndex < 0) {
+ result = "";
+ lastSegmentLength = 0;
+ } else {
+ result = result.slice(0, lastSlashIndex);
+ lastSegmentLength = result.length - 1 - result.lastIndexOf("/");
+ }
+ lastSlash = index2;
+ dots = 0;
+ continue;
+ }
+ } else if (result.length > 0) {
+ result = "";
+ lastSegmentLength = 0;
+ lastSlash = index2;
+ dots = 0;
+ continue;
+ }
+ }
+ if (allowAboveRoot) {
+ result = result.length > 0 ? result + "/.." : "..";
+ lastSegmentLength = 2;
+ }
+ } else {
+ if (result.length > 0) {
+ result += "/" + path2.slice(lastSlash + 1, index2);
+ } else {
+ result = path2.slice(lastSlash + 1, index2);
+ }
+ lastSegmentLength = index2 - lastSlash - 1;
+ }
+ lastSlash = index2;
+ dots = 0;
+ } else if (code4 === 46 && dots > -1) {
+ dots++;
+ } else {
+ dots = -1;
+ }
+ }
+ return result;
+}
+function assertPath(path2) {
+ if (typeof path2 !== "string") {
+ throw new TypeError(
+ "Path must be a string. Received " + JSON.stringify(path2)
+ );
+ }
+}
+var minpath;
+var init_minpath_browser = __esm({
+ "node_modules/.pnpm/vfile@6.0.3/node_modules/vfile/lib/minpath.browser.js"() {
+ minpath = { basename, dirname, extname, join, sep: "/" };
+ }
+});
+
+// node_modules/.pnpm/vfile@6.0.3/node_modules/vfile/lib/minproc.browser.js
+function cwd() {
+ return "/";
+}
+var minproc;
+var init_minproc_browser = __esm({
+ "node_modules/.pnpm/vfile@6.0.3/node_modules/vfile/lib/minproc.browser.js"() {
+ minproc = { cwd };
+ }
+});
+
+// node_modules/.pnpm/vfile@6.0.3/node_modules/vfile/lib/minurl.shared.js
+function isUrl(fileUrlOrPath) {
+ return Boolean(
+ fileUrlOrPath !== null && typeof fileUrlOrPath === "object" && "href" in fileUrlOrPath && fileUrlOrPath.href && "protocol" in fileUrlOrPath && fileUrlOrPath.protocol && // @ts-expect-error: indexing is fine.
+ fileUrlOrPath.auth === void 0
+ );
+}
+var init_minurl_shared = __esm({
+ "node_modules/.pnpm/vfile@6.0.3/node_modules/vfile/lib/minurl.shared.js"() {
+ }
+});
+
+// node_modules/.pnpm/vfile@6.0.3/node_modules/vfile/lib/minurl.browser.js
+function urlToPath(path2) {
+ if (typeof path2 === "string") {
+ path2 = new URL(path2);
+ } else if (!isUrl(path2)) {
+ const error = new TypeError(
+ 'The "path" argument must be of type string or an instance of URL. Received `' + path2 + "`"
+ );
+ error.code = "ERR_INVALID_ARG_TYPE";
+ throw error;
+ }
+ if (path2.protocol !== "file:") {
+ const error = new TypeError("The URL must be of scheme file");
+ error.code = "ERR_INVALID_URL_SCHEME";
+ throw error;
+ }
+ return getPathFromURLPosix(path2);
+}
+function getPathFromURLPosix(url) {
+ if (url.hostname !== "") {
+ const error = new TypeError(
+ 'File URL host must be "localhost" or empty on darwin'
+ );
+ error.code = "ERR_INVALID_FILE_URL_HOST";
+ throw error;
+ }
+ const pathname = url.pathname;
+ let index2 = -1;
+ while (++index2 < pathname.length) {
+ if (pathname.codePointAt(index2) === 37 && pathname.codePointAt(index2 + 1) === 50) {
+ const third = pathname.codePointAt(index2 + 2);
+ if (third === 70 || third === 102) {
+ const error = new TypeError(
+ "File URL path must not include encoded / characters"
+ );
+ error.code = "ERR_INVALID_FILE_URL_PATH";
+ throw error;
+ }
+ }
+ }
+ return decodeURIComponent(pathname);
+}
+var init_minurl_browser = __esm({
+ "node_modules/.pnpm/vfile@6.0.3/node_modules/vfile/lib/minurl.browser.js"() {
+ init_minurl_shared();
+ init_minurl_shared();
+ }
+});
+
+// node_modules/.pnpm/vfile@6.0.3/node_modules/vfile/lib/index.js
+function assertPart(part, name) {
+ if (part && part.includes(minpath.sep)) {
+ throw new Error(
+ "`" + name + "` cannot be a path: did not expect `" + minpath.sep + "`"
+ );
+ }
+}
+function assertNonEmpty(part, name) {
+ if (!part) {
+ throw new Error("`" + name + "` cannot be empty");
+ }
+}
+function assertPath2(path2, name) {
+ if (!path2) {
+ throw new Error("Setting `" + name + "` requires `path` to be set too");
+ }
+}
+function isUint8Array3(value2) {
+ return Boolean(
+ value2 && typeof value2 === "object" && "byteLength" in value2 && "byteOffset" in value2
+ );
+}
+var order, VFile;
+var init_lib4 = __esm({
+ "node_modules/.pnpm/vfile@6.0.3/node_modules/vfile/lib/index.js"() {
+ init_vfile_message();
+ init_minpath_browser();
+ init_minproc_browser();
+ init_minurl_browser();
+ order = /** @type {const} */
+ [
+ "history",
+ "path",
+ "basename",
+ "stem",
+ "extname",
+ "dirname"
+ ];
+ VFile = class {
+ /**
+ * Create a new virtual file.
+ *
+ * `options` is treated as:
+ *
+ * * `string` or `Uint8Array` — `{value: options}`
+ * * `URL` — `{path: options}`
+ * * `VFile` — shallow copies its data over to the new file
+ * * `object` — all fields are shallow copied over to the new file
+ *
+ * Path related fields are set in the following order (least specific to
+ * most specific): `history`, `path`, `basename`, `stem`, `extname`,
+ * `dirname`.
+ *
+ * You cannot set `dirname` or `extname` without setting either `history`,
+ * `path`, `basename`, or `stem` too.
+ *
+ * @param {Compatible | null | undefined} [value]
+ * File value.
+ * @returns
+ * New instance.
+ */
+ constructor(value2) {
+ let options;
+ if (!value2) {
+ options = {};
+ } else if (isUrl(value2)) {
+ options = { path: value2 };
+ } else if (typeof value2 === "string" || isUint8Array3(value2)) {
+ options = { value: value2 };
+ } else {
+ options = value2;
+ }
+ this.cwd = "cwd" in options ? "" : minproc.cwd();
+ this.data = {};
+ this.history = [];
+ this.messages = [];
+ this.value;
+ this.map;
+ this.result;
+ this.stored;
+ let index2 = -1;
+ while (++index2 < order.length) {
+ const field2 = order[index2];
+ if (field2 in options && options[field2] !== void 0 && options[field2] !== null) {
+ this[field2] = field2 === "history" ? [...options[field2]] : options[field2];
+ }
+ }
+ let field;
+ for (field in options) {
+ if (!order.includes(field)) {
+ this[field] = options[field];
+ }
+ }
+ }
+ /**
+ * Get the basename (including extname) (example: `'index.min.js'`).
+ *
+ * @returns {string | undefined}
+ * Basename.
+ */
+ get basename() {
+ return typeof this.path === "string" ? minpath.basename(this.path) : void 0;
+ }
+ /**
+ * Set basename (including extname) (`'index.min.js'`).
+ *
+ * Cannot contain path separators (`'/'` on unix, macOS, and browsers, `'\'`
+ * on windows).
+ * Cannot be nullified (use `file.path = file.dirname` instead).
+ *
+ * @param {string} basename
+ * Basename.
+ * @returns {undefined}
+ * Nothing.
+ */
+ set basename(basename2) {
+ assertNonEmpty(basename2, "basename");
+ assertPart(basename2, "basename");
+ this.path = minpath.join(this.dirname || "", basename2);
+ }
+ /**
+ * Get the parent path (example: `'~'`).
+ *
+ * @returns {string | undefined}
+ * Dirname.
+ */
+ get dirname() {
+ return typeof this.path === "string" ? minpath.dirname(this.path) : void 0;
+ }
+ /**
+ * Set the parent path (example: `'~'`).
+ *
+ * Cannot be set if there’s no `path` yet.
+ *
+ * @param {string | undefined} dirname
+ * Dirname.
+ * @returns {undefined}
+ * Nothing.
+ */
+ set dirname(dirname2) {
+ assertPath2(this.basename, "dirname");
+ this.path = minpath.join(dirname2 || "", this.basename);
+ }
+ /**
+ * Get the extname (including dot) (example: `'.js'`).
+ *
+ * @returns {string | undefined}
+ * Extname.
+ */
+ get extname() {
+ return typeof this.path === "string" ? minpath.extname(this.path) : void 0;
+ }
+ /**
+ * Set the extname (including dot) (example: `'.js'`).
+ *
+ * Cannot contain path separators (`'/'` on unix, macOS, and browsers, `'\'`
+ * on windows).
+ * Cannot be set if there’s no `path` yet.
+ *
+ * @param {string | undefined} extname
+ * Extname.
+ * @returns {undefined}
+ * Nothing.
+ */
+ set extname(extname2) {
+ assertPart(extname2, "extname");
+ assertPath2(this.dirname, "extname");
+ if (extname2) {
+ if (extname2.codePointAt(0) !== 46) {
+ throw new Error("`extname` must start with `.`");
+ }
+ if (extname2.includes(".", 1)) {
+ throw new Error("`extname` cannot contain multiple dots");
+ }
+ }
+ this.path = minpath.join(this.dirname, this.stem + (extname2 || ""));
+ }
+ /**
+ * Get the full path (example: `'~/index.min.js'`).
+ *
+ * @returns {string}
+ * Path.
+ */
+ get path() {
+ return this.history[this.history.length - 1];
+ }
+ /**
+ * Set the full path (example: `'~/index.min.js'`).
+ *
+ * Cannot be nullified.
+ * You can set a file URL (a `URL` object with a `file:` protocol) which will
+ * be turned into a path with `url.fileURLToPath`.
+ *
+ * @param {URL | string} path
+ * Path.
+ * @returns {undefined}
+ * Nothing.
+ */
+ set path(path2) {
+ if (isUrl(path2)) {
+ path2 = urlToPath(path2);
+ }
+ assertNonEmpty(path2, "path");
+ if (this.path !== path2) {
+ this.history.push(path2);
+ }
+ }
+ /**
+ * Get the stem (basename w/o extname) (example: `'index.min'`).
+ *
+ * @returns {string | undefined}
+ * Stem.
+ */
+ get stem() {
+ return typeof this.path === "string" ? minpath.basename(this.path, this.extname) : void 0;
+ }
+ /**
+ * Set the stem (basename w/o extname) (example: `'index.min'`).
+ *
+ * Cannot contain path separators (`'/'` on unix, macOS, and browsers, `'\'`
+ * on windows).
+ * Cannot be nullified (use `file.path = file.dirname` instead).
+ *
+ * @param {string} stem
+ * Stem.
+ * @returns {undefined}
+ * Nothing.
+ */
+ set stem(stem) {
+ assertNonEmpty(stem, "stem");
+ assertPart(stem, "stem");
+ this.path = minpath.join(this.dirname || "", stem + (this.extname || ""));
+ }
+ // Normal prototypal methods.
+ /**
+ * Create a fatal message for `reason` associated with the file.
+ *
+ * The `fatal` field of the message is set to `true` (error; file not usable)
+ * and the `file` field is set to the current file path.
+ * The message is added to the `messages` field on `file`.
+ *
+ * > 🪦 **Note**: also has obsolete signatures.
+ *
+ * @overload
+ * @param {string} reason
+ * @param {MessageOptions | null | undefined} [options]
+ * @returns {never}
+ *
+ * @overload
+ * @param {string} reason
+ * @param {Node | NodeLike | null | undefined} parent
+ * @param {string | null | undefined} [origin]
+ * @returns {never}
+ *
+ * @overload
+ * @param {string} reason
+ * @param {Point | Position | null | undefined} place
+ * @param {string | null | undefined} [origin]
+ * @returns {never}
+ *
+ * @overload
+ * @param {string} reason
+ * @param {string | null | undefined} [origin]
+ * @returns {never}
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {Node | NodeLike | null | undefined} parent
+ * @param {string | null | undefined} [origin]
+ * @returns {never}
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {Point | Position | null | undefined} place
+ * @param {string | null | undefined} [origin]
+ * @returns {never}
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {string | null | undefined} [origin]
+ * @returns {never}
+ *
+ * @param {Error | VFileMessage | string} causeOrReason
+ * Reason for message, should use markdown.
+ * @param {Node | NodeLike | MessageOptions | Point | Position | string | null | undefined} [optionsOrParentOrPlace]
+ * Configuration (optional).
+ * @param {string | null | undefined} [origin]
+ * Place in code where the message originates (example:
+ * `'my-package:my-rule'` or `'my-rule'`).
+ * @returns {never}
+ * Never.
+ * @throws {VFileMessage}
+ * Message.
+ */
+ fail(causeOrReason, optionsOrParentOrPlace, origin) {
+ const message2 = this.message(causeOrReason, optionsOrParentOrPlace, origin);
+ message2.fatal = true;
+ throw message2;
+ }
+ /**
+ * Create an info message for `reason` associated with the file.
+ *
+ * The `fatal` field of the message is set to `undefined` (info; change
+ * likely not needed) and the `file` field is set to the current file path.
+ * The message is added to the `messages` field on `file`.
+ *
+ * > 🪦 **Note**: also has obsolete signatures.
+ *
+ * @overload
+ * @param {string} reason
+ * @param {MessageOptions | null | undefined} [options]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {string} reason
+ * @param {Node | NodeLike | null | undefined} parent
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {string} reason
+ * @param {Point | Position | null | undefined} place
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {string} reason
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {Node | NodeLike | null | undefined} parent
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {Point | Position | null | undefined} place
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @param {Error | VFileMessage | string} causeOrReason
+ * Reason for message, should use markdown.
+ * @param {Node | NodeLike | MessageOptions | Point | Position | string | null | undefined} [optionsOrParentOrPlace]
+ * Configuration (optional).
+ * @param {string | null | undefined} [origin]
+ * Place in code where the message originates (example:
+ * `'my-package:my-rule'` or `'my-rule'`).
+ * @returns {VFileMessage}
+ * Message.
+ */
+ info(causeOrReason, optionsOrParentOrPlace, origin) {
+ const message2 = this.message(causeOrReason, optionsOrParentOrPlace, origin);
+ message2.fatal = void 0;
+ return message2;
+ }
+ /**
+ * Create a message for `reason` associated with the file.
+ *
+ * The `fatal` field of the message is set to `false` (warning; change may be
+ * needed) and the `file` field is set to the current file path.
+ * The message is added to the `messages` field on `file`.
+ *
+ * > 🪦 **Note**: also has obsolete signatures.
+ *
+ * @overload
+ * @param {string} reason
+ * @param {MessageOptions | null | undefined} [options]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {string} reason
+ * @param {Node | NodeLike | null | undefined} parent
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {string} reason
+ * @param {Point | Position | null | undefined} place
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {string} reason
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {Node | NodeLike | null | undefined} parent
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {Point | Position | null | undefined} place
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @overload
+ * @param {Error | VFileMessage} cause
+ * @param {string | null | undefined} [origin]
+ * @returns {VFileMessage}
+ *
+ * @param {Error | VFileMessage | string} causeOrReason
+ * Reason for message, should use markdown.
+ * @param {Node | NodeLike | MessageOptions | Point | Position | string | null | undefined} [optionsOrParentOrPlace]
+ * Configuration (optional).
+ * @param {string | null | undefined} [origin]
+ * Place in code where the message originates (example:
+ * `'my-package:my-rule'` or `'my-rule'`).
+ * @returns {VFileMessage}
+ * Message.
+ */
+ message(causeOrReason, optionsOrParentOrPlace, origin) {
+ const message2 = new VFileMessage(
+ // @ts-expect-error: the overloads are fine.
+ causeOrReason,
+ optionsOrParentOrPlace,
+ origin
+ );
+ if (this.path) {
+ message2.name = this.path + ":" + message2.name;
+ message2.file = this.path;
+ }
+ message2.fatal = false;
+ this.messages.push(message2);
+ return message2;
+ }
+ /**
+ * Serialize the file.
+ *
+ * > **Note**: which encodings are supported depends on the engine.
+ * > For info on Node.js, see:
+ * > .
+ *
+ * @param {string | null | undefined} [encoding='utf8']
+ * Character encoding to understand `value` as when it’s a `Uint8Array`
+ * (default: `'utf-8'`).
+ * @returns {string}
+ * Serialized file.
+ */
+ toString(encoding) {
+ if (this.value === void 0) {
+ return "";
+ }
+ if (typeof this.value === "string") {
+ return this.value;
+ }
+ const decoder2 = new TextDecoder(encoding || void 0);
+ return decoder2.decode(this.value);
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/vfile@6.0.3/node_modules/vfile/index.js
+var init_vfile = __esm({
+ "node_modules/.pnpm/vfile@6.0.3/node_modules/vfile/index.js"() {
+ init_lib4();
+ }
+});
+
+// node_modules/.pnpm/unified@11.0.5/node_modules/unified/lib/callable-instance.js
+var CallableInstance;
+var init_callable_instance = __esm({
+ "node_modules/.pnpm/unified@11.0.5/node_modules/unified/lib/callable-instance.js"() {
+ CallableInstance = /**
+ * @type {new , Result>(property: string | symbol) => (...parameters: Parameters) => Result}
+ */
+ /** @type {unknown} */
+ /**
+ * @this {Function}
+ * @param {string | symbol} property
+ * @returns {(...parameters: Array) => unknown}
+ */
+ (function(property) {
+ const self2 = this;
+ const constr = self2.constructor;
+ const proto = (
+ /** @type {Record} */
+ // Prototypes do exist.
+ // type-coverage:ignore-next-line
+ constr.prototype
+ );
+ const value2 = proto[property];
+ const apply = function() {
+ return value2.apply(apply, arguments);
+ };
+ Object.setPrototypeOf(apply, proto);
+ return apply;
+ });
+ }
+});
+
+// node_modules/.pnpm/unified@11.0.5/node_modules/unified/lib/index.js
+function assertParser(name, value2) {
+ if (typeof value2 !== "function") {
+ throw new TypeError("Cannot `" + name + "` without `parser`");
+ }
+}
+function assertCompiler(name, value2) {
+ if (typeof value2 !== "function") {
+ throw new TypeError("Cannot `" + name + "` without `compiler`");
+ }
+}
+function assertUnfrozen(name, frozen) {
+ if (frozen) {
+ throw new Error(
+ "Cannot call `" + name + "` on a frozen processor.\nCreate a new processor first, by calling it: use `processor()` instead of `processor`."
+ );
+ }
+}
+function assertNode(node2) {
+ if (!isPlainObject(node2) || typeof node2.type !== "string") {
+ throw new TypeError("Expected node, got `" + node2 + "`");
+ }
+}
+function assertDone(name, asyncName, complete) {
+ if (!complete) {
+ throw new Error(
+ "`" + name + "` finished async. Use `" + asyncName + "` instead"
+ );
+ }
+}
+function vfile(value2) {
+ return looksLikeAVFile(value2) ? value2 : new VFile(value2);
+}
+function looksLikeAVFile(value2) {
+ return Boolean(
+ value2 && typeof value2 === "object" && "message" in value2 && "messages" in value2
+ );
+}
+function looksLikeAValue(value2) {
+ return typeof value2 === "string" || isUint8Array4(value2);
+}
+function isUint8Array4(value2) {
+ return Boolean(
+ value2 && typeof value2 === "object" && "byteLength" in value2 && "byteOffset" in value2
+ );
+}
+var import_extend, own, Processor, unified;
+var init_lib5 = __esm({
+ "node_modules/.pnpm/unified@11.0.5/node_modules/unified/lib/index.js"() {
+ init_bail();
+ import_extend = __toESM(require_extend(), 1);
+ init_default();
+ init_is_plain_obj();
+ init_trough();
+ init_vfile();
+ init_callable_instance();
+ own = {}.hasOwnProperty;
+ Processor = class _Processor extends CallableInstance {
+ /**
+ * Create a processor.
+ */
+ constructor() {
+ super("copy");
+ this.Compiler = void 0;
+ this.Parser = void 0;
+ this.attachers = [];
+ this.compiler = void 0;
+ this.freezeIndex = -1;
+ this.frozen = void 0;
+ this.namespace = {};
+ this.parser = void 0;
+ this.transformers = trough();
+ }
+ /**
+ * Copy a processor.
+ *
+ * @deprecated
+ * This is a private internal method and should not be used.
+ * @returns {Processor}
+ * New *unfrozen* processor ({@linkcode Processor}) that is
+ * configured to work the same as its ancestor.
+ * When the descendant processor is configured in the future it does not
+ * affect the ancestral processor.
+ */
+ copy() {
+ const destination = (
+ /** @type {Processor} */
+ new _Processor()
+ );
+ let index2 = -1;
+ while (++index2 < this.attachers.length) {
+ const attacher = this.attachers[index2];
+ destination.use(...attacher);
+ }
+ destination.data((0, import_extend.default)(true, {}, this.namespace));
+ return destination;
+ }
+ /**
+ * Configure the processor with info available to all plugins.
+ * Information is stored in an object.
+ *
+ * Typically, options can be given to a specific plugin, but sometimes it
+ * makes sense to have information shared with several plugins.
+ * For example, a list of HTML elements that are self-closing, which is
+ * needed during all phases.
+ *
+ * > **Note**: setting information cannot occur on *frozen* processors.
+ * > Call the processor first to create a new unfrozen processor.
+ *
+ * > **Note**: to register custom data in TypeScript, augment the
+ * > {@linkcode Data} interface.
+ *
+ * @example
+ * This example show how to get and set info:
+ *
+ * ```js
+ * import {unified} from 'unified'
+ *
+ * const processor = unified().data('alpha', 'bravo')
+ *
+ * processor.data('alpha') // => 'bravo'
+ *
+ * processor.data() // => {alpha: 'bravo'}
+ *
+ * processor.data({charlie: 'delta'})
+ *
+ * processor.data() // => {charlie: 'delta'}
+ * ```
+ *
+ * @template {keyof Data} Key
+ *
+ * @overload
+ * @returns {Data}
+ *
+ * @overload
+ * @param {Data} dataset
+ * @returns {Processor}
+ *
+ * @overload
+ * @param {Key} key
+ * @returns {Data[Key]}
+ *
+ * @overload
+ * @param {Key} key
+ * @param {Data[Key]} value
+ * @returns {Processor}
+ *
+ * @param {Data | Key} [key]
+ * Key to get or set, or entire dataset to set, or nothing to get the
+ * entire dataset (optional).
+ * @param {Data[Key]} [value]
+ * Value to set (optional).
+ * @returns {unknown}
+ * The current processor when setting, the value at `key` when getting, or
+ * the entire dataset when getting without key.
+ */
+ data(key2, value2) {
+ if (typeof key2 === "string") {
+ if (arguments.length === 2) {
+ assertUnfrozen("data", this.frozen);
+ this.namespace[key2] = value2;
+ return this;
+ }
+ return own.call(this.namespace, key2) && this.namespace[key2] || void 0;
+ }
+ if (key2) {
+ assertUnfrozen("data", this.frozen);
+ this.namespace = key2;
+ return this;
+ }
+ return this.namespace;
+ }
+ /**
+ * Freeze a processor.
+ *
+ * Frozen processors are meant to be extended and not to be configured
+ * directly.
+ *
+ * When a processor is frozen it cannot be unfrozen.
+ * New processors working the same way can be created by calling the
+ * processor.
+ *
+ * It’s possible to freeze processors explicitly by calling `.freeze()`.
+ * Processors freeze automatically when `.parse()`, `.run()`, `.runSync()`,
+ * `.stringify()`, `.process()`, or `.processSync()` are called.
+ *
+ * @returns {Processor}
+ * The current processor.
+ */
+ freeze() {
+ if (this.frozen) {
+ return this;
+ }
+ const self2 = (
+ /** @type {Processor} */
+ /** @type {unknown} */
+ this
+ );
+ while (++this.freezeIndex < this.attachers.length) {
+ const [attacher, ...options] = this.attachers[this.freezeIndex];
+ if (options[0] === false) {
+ continue;
+ }
+ if (options[0] === true) {
+ options[0] = void 0;
+ }
+ const transformer = attacher.call(self2, ...options);
+ if (typeof transformer === "function") {
+ this.transformers.use(transformer);
+ }
+ }
+ this.frozen = true;
+ this.freezeIndex = Number.POSITIVE_INFINITY;
+ return this;
+ }
+ /**
+ * Parse text to a syntax tree.
+ *
+ * > **Note**: `parse` freezes the processor if not already *frozen*.
+ *
+ * > **Note**: `parse` performs the parse phase, not the run phase or other
+ * > phases.
+ *
+ * @param {Compatible | undefined} [file]
+ * file to parse (optional); typically `string` or `VFile`; any value
+ * accepted as `x` in `new VFile(x)`.
+ * @returns {ParseTree extends undefined ? Node : ParseTree}
+ * Syntax tree representing `file`.
+ */
+ parse(file) {
+ this.freeze();
+ const realFile = vfile(file);
+ const parser = this.parser || this.Parser;
+ assertParser("parse", parser);
+ return parser(String(realFile), realFile);
+ }
+ /**
+ * Process the given file as configured on the processor.
+ *
+ * > **Note**: `process` freezes the processor if not already *frozen*.
+ *
+ * > **Note**: `process` performs the parse, run, and stringify phases.
+ *
+ * @overload
+ * @param {Compatible | undefined} file
+ * @param {ProcessCallback>} done
+ * @returns {undefined}
+ *
+ * @overload
+ * @param {Compatible | undefined} [file]
+ * @returns {Promise>}
+ *
+ * @param {Compatible | undefined} [file]
+ * File (optional); typically `string` or `VFile`]; any value accepted as
+ * `x` in `new VFile(x)`.
+ * @param {ProcessCallback> | undefined} [done]
+ * Callback (optional).
+ * @returns {Promise | undefined}
+ * Nothing if `done` is given.
+ * Otherwise a promise, rejected with a fatal error or resolved with the
+ * processed file.
+ *
+ * The parsed, transformed, and compiled value is available at
+ * `file.value` (see note).
+ *
+ * > **Note**: unified typically compiles by serializing: most
+ * > compilers return `string` (or `Uint8Array`).
+ * > Some compilers, such as the one configured with
+ * > [`rehype-react`][rehype-react], return other values (in this case, a
+ * > React tree).
+ * > If you’re using a compiler that doesn’t serialize, expect different
+ * > result values.
+ * >
+ * > To register custom results in TypeScript, add them to
+ * > {@linkcode CompileResultMap}.
+ *
+ * [rehype-react]: https://github.com/rehypejs/rehype-react
+ */
+ process(file, done) {
+ const self2 = this;
+ this.freeze();
+ assertParser("process", this.parser || this.Parser);
+ assertCompiler("process", this.compiler || this.Compiler);
+ return done ? executor(void 0, done) : new Promise(executor);
+ function executor(resolve2, reject) {
+ const realFile = vfile(file);
+ const parseTree = (
+ /** @type {HeadTree extends undefined ? Node : HeadTree} */
+ /** @type {unknown} */
+ self2.parse(realFile)
+ );
+ self2.run(parseTree, realFile, function(error, tree, file2) {
+ if (error || !tree || !file2) {
+ return realDone(error);
+ }
+ const compileTree = (
+ /** @type {CompileTree extends undefined ? Node : CompileTree} */
+ /** @type {unknown} */
+ tree
+ );
+ const compileResult = self2.stringify(compileTree, file2);
+ if (looksLikeAValue(compileResult)) {
+ file2.value = compileResult;
+ } else {
+ file2.result = compileResult;
+ }
+ realDone(
+ error,
+ /** @type {VFileWithOutput} */
+ file2
+ );
+ });
+ function realDone(error, file2) {
+ if (error || !file2) {
+ reject(error);
+ } else if (resolve2) {
+ resolve2(file2);
+ } else {
+ ok(done, "`done` is defined if `resolve` is not");
+ done(void 0, file2);
+ }
+ }
+ }
+ }
+ /**
+ * Process the given file as configured on the processor.
+ *
+ * An error is thrown if asynchronous transforms are configured.
+ *
+ * > **Note**: `processSync` freezes the processor if not already *frozen*.
+ *
+ * > **Note**: `processSync` performs the parse, run, and stringify phases.
+ *
+ * @param {Compatible | undefined} [file]
+ * File (optional); typically `string` or `VFile`; any value accepted as
+ * `x` in `new VFile(x)`.
+ * @returns {VFileWithOutput}
+ * The processed file.
+ *
+ * The parsed, transformed, and compiled value is available at
+ * `file.value` (see note).
+ *
+ * > **Note**: unified typically compiles by serializing: most
+ * > compilers return `string` (or `Uint8Array`).
+ * > Some compilers, such as the one configured with
+ * > [`rehype-react`][rehype-react], return other values (in this case, a
+ * > React tree).
+ * > If you’re using a compiler that doesn’t serialize, expect different
+ * > result values.
+ * >
+ * > To register custom results in TypeScript, add them to
+ * > {@linkcode CompileResultMap}.
+ *
+ * [rehype-react]: https://github.com/rehypejs/rehype-react
+ */
+ processSync(file) {
+ let complete = false;
+ let result;
+ this.freeze();
+ assertParser("processSync", this.parser || this.Parser);
+ assertCompiler("processSync", this.compiler || this.Compiler);
+ this.process(file, realDone);
+ assertDone("processSync", "process", complete);
+ ok(result, "we either bailed on an error or have a tree");
+ return result;
+ function realDone(error, file2) {
+ complete = true;
+ bail(error);
+ result = file2;
+ }
+ }
+ /**
+ * Run *transformers* on a syntax tree.
+ *
+ * > **Note**: `run` freezes the processor if not already *frozen*.
+ *
+ * > **Note**: `run` performs the run phase, not other phases.
+ *
+ * @overload
+ * @param {HeadTree extends undefined ? Node : HeadTree} tree
+ * @param {RunCallback} done
+ * @returns {undefined}
+ *
+ * @overload
+ * @param {HeadTree extends undefined ? Node : HeadTree} tree
+ * @param {Compatible | undefined} file
+ * @param {RunCallback} done
+ * @returns {undefined}
+ *
+ * @overload
+ * @param {HeadTree extends undefined ? Node : HeadTree} tree
+ * @param {Compatible | undefined} [file]
+ * @returns {Promise}
+ *
+ * @param {HeadTree extends undefined ? Node : HeadTree} tree
+ * Tree to transform and inspect.
+ * @param {(
+ * RunCallback |
+ * Compatible
+ * )} [file]
+ * File associated with `node` (optional); any value accepted as `x` in
+ * `new VFile(x)`.
+ * @param {RunCallback} [done]
+ * Callback (optional).
+ * @returns {Promise | undefined}
+ * Nothing if `done` is given.
+ * Otherwise, a promise rejected with a fatal error or resolved with the
+ * transformed tree.
+ */
+ run(tree, file, done) {
+ assertNode(tree);
+ this.freeze();
+ const transformers = this.transformers;
+ if (!done && typeof file === "function") {
+ done = file;
+ file = void 0;
+ }
+ return done ? executor(void 0, done) : new Promise(executor);
+ function executor(resolve2, reject) {
+ ok(
+ typeof file !== "function",
+ "`file` can\u2019t be a `done` anymore, we checked"
+ );
+ const realFile = vfile(file);
+ transformers.run(tree, realFile, realDone);
+ function realDone(error, outputTree, file2) {
+ const resultingTree = (
+ /** @type {TailTree extends undefined ? Node : TailTree} */
+ outputTree || tree
+ );
+ if (error) {
+ reject(error);
+ } else if (resolve2) {
+ resolve2(resultingTree);
+ } else {
+ ok(done, "`done` is defined if `resolve` is not");
+ done(void 0, resultingTree, file2);
+ }
+ }
+ }
+ }
+ /**
+ * Run *transformers* on a syntax tree.
+ *
+ * An error is thrown if asynchronous transforms are configured.
+ *
+ * > **Note**: `runSync` freezes the processor if not already *frozen*.
+ *
+ * > **Note**: `runSync` performs the run phase, not other phases.
+ *
+ * @param {HeadTree extends undefined ? Node : HeadTree} tree
+ * Tree to transform and inspect.
+ * @param {Compatible | undefined} [file]
+ * File associated with `node` (optional); any value accepted as `x` in
+ * `new VFile(x)`.
+ * @returns {TailTree extends undefined ? Node : TailTree}
+ * Transformed tree.
+ */
+ runSync(tree, file) {
+ let complete = false;
+ let result;
+ this.run(tree, file, realDone);
+ assertDone("runSync", "run", complete);
+ ok(result, "we either bailed on an error or have a tree");
+ return result;
+ function realDone(error, tree2) {
+ bail(error);
+ result = tree2;
+ complete = true;
+ }
+ }
+ /**
+ * Compile a syntax tree.
+ *
+ * > **Note**: `stringify` freezes the processor if not already *frozen*.
+ *
+ * > **Note**: `stringify` performs the stringify phase, not the run phase
+ * > or other phases.
+ *
+ * @param {CompileTree extends undefined ? Node : CompileTree} tree
+ * Tree to compile.
+ * @param {Compatible | undefined} [file]
+ * File associated with `node` (optional); any value accepted as `x` in
+ * `new VFile(x)`.
+ * @returns {CompileResult extends undefined ? Value : CompileResult}
+ * Textual representation of the tree (see note).
+ *
+ * > **Note**: unified typically compiles by serializing: most compilers
+ * > return `string` (or `Uint8Array`).
+ * > Some compilers, such as the one configured with
+ * > [`rehype-react`][rehype-react], return other values (in this case, a
+ * > React tree).
+ * > If you’re using a compiler that doesn’t serialize, expect different
+ * > result values.
+ * >
+ * > To register custom results in TypeScript, add them to
+ * > {@linkcode CompileResultMap}.
+ *
+ * [rehype-react]: https://github.com/rehypejs/rehype-react
+ */
+ stringify(tree, file) {
+ this.freeze();
+ const realFile = vfile(file);
+ const compiler2 = this.compiler || this.Compiler;
+ assertCompiler("stringify", compiler2);
+ assertNode(tree);
+ return compiler2(tree, realFile);
+ }
+ /**
+ * Configure the processor to use a plugin, a list of usable values, or a
+ * preset.
+ *
+ * If the processor is already using a plugin, the previous plugin
+ * configuration is changed based on the options that are passed in.
+ * In other words, the plugin is not added a second time.
+ *
+ * > **Note**: `use` cannot be called on *frozen* processors.
+ * > Call the processor first to create a new unfrozen processor.
+ *
+ * @example
+ * There are many ways to pass plugins to `.use()`.
+ * This example gives an overview:
+ *
+ * ```js
+ * import {unified} from 'unified'
+ *
+ * unified()
+ * // Plugin with options:
+ * .use(pluginA, {x: true, y: true})
+ * // Passing the same plugin again merges configuration (to `{x: true, y: false, z: true}`):
+ * .use(pluginA, {y: false, z: true})
+ * // Plugins:
+ * .use([pluginB, pluginC])
+ * // Two plugins, the second with options:
+ * .use([pluginD, [pluginE, {}]])
+ * // Preset with plugins and settings:
+ * .use({plugins: [pluginF, [pluginG, {}]], settings: {position: false}})
+ * // Settings only:
+ * .use({settings: {position: false}})
+ * ```
+ *
+ * @template {Array} [Parameters=[]]
+ * @template {Node | string | undefined} [Input=undefined]
+ * @template [Output=Input]
+ *
+ * @overload
+ * @param {Preset | null | undefined} [preset]
+ * @returns {Processor}
+ *
+ * @overload
+ * @param {PluggableList} list
+ * @returns {Processor}
+ *
+ * @overload
+ * @param {Plugin} plugin
+ * @param {...(Parameters | [boolean])} parameters
+ * @returns {UsePlugin}
+ *
+ * @param {PluggableList | Plugin | Preset | null | undefined} value
+ * Usable value.
+ * @param {...unknown} parameters
+ * Parameters, when a plugin is given as a usable value.
+ * @returns {Processor}
+ * Current processor.
+ */
+ use(value2, ...parameters) {
+ const attachers = this.attachers;
+ const namespace2 = this.namespace;
+ assertUnfrozen("use", this.frozen);
+ if (value2 === null || value2 === void 0) {
+ } else if (typeof value2 === "function") {
+ addPlugin(value2, parameters);
+ } else if (typeof value2 === "object") {
+ if (Array.isArray(value2)) {
+ addList(value2);
+ } else {
+ addPreset(value2);
+ }
+ } else {
+ throw new TypeError("Expected usable value, not `" + value2 + "`");
+ }
+ return this;
+ function add3(value3) {
+ if (typeof value3 === "function") {
+ addPlugin(value3, []);
+ } else if (typeof value3 === "object") {
+ if (Array.isArray(value3)) {
+ const [plugin, ...parameters2] = (
+ /** @type {PluginTuple>} */
+ value3
+ );
+ addPlugin(plugin, parameters2);
+ } else {
+ addPreset(value3);
+ }
+ } else {
+ throw new TypeError("Expected usable value, not `" + value3 + "`");
+ }
+ }
+ function addPreset(result) {
+ if (!("plugins" in result) && !("settings" in result)) {
+ throw new Error(
+ "Expected usable value but received an empty preset, which is probably a mistake: presets typically come with `plugins` and sometimes with `settings`, but this has neither"
+ );
+ }
+ addList(result.plugins);
+ if (result.settings) {
+ namespace2.settings = (0, import_extend.default)(true, namespace2.settings, result.settings);
+ }
+ }
+ function addList(plugins13) {
+ let index2 = -1;
+ if (plugins13 === null || plugins13 === void 0) {
+ } else if (Array.isArray(plugins13)) {
+ while (++index2 < plugins13.length) {
+ const thing = plugins13[index2];
+ add3(thing);
+ }
+ } else {
+ throw new TypeError("Expected a list of plugins, not `" + plugins13 + "`");
+ }
+ }
+ function addPlugin(plugin, parameters2) {
+ let index2 = -1;
+ let entryIndex = -1;
+ while (++index2 < attachers.length) {
+ if (attachers[index2][0] === plugin) {
+ entryIndex = index2;
+ break;
+ }
+ }
+ if (entryIndex === -1) {
+ attachers.push([plugin, ...parameters2]);
+ } else if (parameters2.length > 0) {
+ let [primary, ...rest] = parameters2;
+ const currentPrimary = attachers[entryIndex][1];
+ if (isPlainObject(currentPrimary) && isPlainObject(primary)) {
+ primary = (0, import_extend.default)(true, currentPrimary, primary);
+ }
+ attachers[entryIndex] = [plugin, primary, ...rest];
+ }
+ }
+ }
+ };
+ unified = new Processor().freeze();
+ }
+});
+
+// node_modules/.pnpm/unified@11.0.5/node_modules/unified/index.js
+var init_unified = __esm({
+ "node_modules/.pnpm/unified@11.0.5/node_modules/unified/index.js"() {
+ init_lib5();
+ }
+});
+
+// node_modules/.pnpm/ccount@2.0.1/node_modules/ccount/index.js
+function ccount(value2, character) {
+ const source = String(value2);
+ if (typeof character !== "string") {
+ throw new TypeError("Expected character");
+ }
+ let count2 = 0;
+ let index2 = source.indexOf(character);
+ while (index2 !== -1) {
+ count2++;
+ index2 = source.indexOf(character, index2 + character.length);
+ }
+ return count2;
+}
+var init_ccount = __esm({
+ "node_modules/.pnpm/ccount@2.0.1/node_modules/ccount/index.js"() {
+ }
+});
+
+// node_modules/.pnpm/micromark-util-character@2.1.1/node_modules/micromark-util-character/index.js
+function asciiControl(code4) {
+ return (
+ // Special whitespace codes (which have negative values), C0 and Control
+ // character DEL
+ code4 !== null && (code4 < 32 || code4 === 127)
+ );
+}
+function markdownLineEnding(code4) {
+ return code4 !== null && code4 < -2;
+}
+function markdownLineEndingOrSpace(code4) {
+ return code4 !== null && (code4 < 0 || code4 === 32);
+}
+function markdownSpace(code4) {
+ return code4 === -2 || code4 === -1 || code4 === 32;
+}
+function regexCheck(regex) {
+ return check;
+ function check(code4) {
+ return code4 !== null && code4 > -1 && regex.test(String.fromCharCode(code4));
+ }
+}
+var asciiAlpha, asciiAlphanumeric, asciiAtext, asciiDigit, asciiHexDigit, asciiPunctuation, unicodePunctuation, unicodeWhitespace;
+var init_micromark_util_character = __esm({
+ "node_modules/.pnpm/micromark-util-character@2.1.1/node_modules/micromark-util-character/index.js"() {
+ asciiAlpha = regexCheck(/[A-Za-z]/);
+ asciiAlphanumeric = regexCheck(/[\dA-Za-z]/);
+ asciiAtext = regexCheck(/[#-'*+\--9=?A-Z^-~]/);
+ asciiDigit = regexCheck(/\d/);
+ asciiHexDigit = regexCheck(/[\dA-Fa-f]/);
+ asciiPunctuation = regexCheck(/[!-/:-@[-`{-~]/);
+ unicodePunctuation = regexCheck(/\p{P}|\p{S}/u);
+ unicodeWhitespace = regexCheck(/\s/);
+ }
+});
+
+// node_modules/.pnpm/unist-util-is@6.0.1/node_modules/unist-util-is/lib/index.js
+function anyFactory(tests) {
+ const checks2 = [];
+ let index2 = -1;
+ while (++index2 < tests.length) {
+ checks2[index2] = convert(tests[index2]);
+ }
+ return castFactory(any);
+ function any(...parameters) {
+ let index3 = -1;
+ while (++index3 < checks2.length) {
+ if (checks2[index3].apply(this, parameters)) return true;
+ }
+ return false;
+ }
+}
+function propertiesFactory(check) {
+ const checkAsRecord = (
+ /** @type {Record} */
+ check
+ );
+ return castFactory(all3);
+ function all3(node2) {
+ const nodeAsRecord = (
+ /** @type {Record} */
+ /** @type {unknown} */
+ node2
+ );
+ let key2;
+ for (key2 in check) {
+ if (nodeAsRecord[key2] !== checkAsRecord[key2]) return false;
+ }
+ return true;
+ }
+}
+function typeFactory(check) {
+ return castFactory(type5);
+ function type5(node2) {
+ return node2 && node2.type === check;
+ }
+}
+function castFactory(testFunction) {
+ return check;
+ function check(value2, index2, parent) {
+ return Boolean(
+ looksLikeANode(value2) && testFunction.call(
+ this,
+ value2,
+ typeof index2 === "number" ? index2 : void 0,
+ parent || void 0
+ )
+ );
+ }
+}
+function ok2() {
+ return true;
+}
+function looksLikeANode(value2) {
+ return value2 !== null && typeof value2 === "object" && "type" in value2;
+}
+var is, convert;
+var init_lib6 = __esm({
+ "node_modules/.pnpm/unist-util-is@6.0.1/node_modules/unist-util-is/lib/index.js"() {
+ is = // Note: overloads in JSDoc can’t yet use different `@template`s.
+ /**
+ * @type {(
+ * (>(node: unknown, test: Condition, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node & {type: Condition[number]}) &
+ * (>(node: unknown, test: Condition, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node & {type: Condition[number]}) &
+ * ((node: unknown, test: Condition, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node & {type: Condition}) &
+ * ((node: unknown, test: Condition, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node & Condition) &
+ * ((node: unknown, test: Condition, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node & Predicate) &
+ * ((node?: null | undefined) => false) &
+ * ((node: unknown, test?: null | undefined, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node) &
+ * ((node: unknown, test?: Test, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => boolean)
+ * )}
+ */
+ /**
+ * @param {unknown} [node]
+ * @param {Test} [test]
+ * @param {number | null | undefined} [index]
+ * @param {Parent | null | undefined} [parent]
+ * @param {unknown} [context]
+ * @returns {boolean}
+ */
+ // eslint-disable-next-line max-params
+ (function(node2, test, index2, parent, context2) {
+ const check = convert(test);
+ if (index2 !== void 0 && index2 !== null && (typeof index2 !== "number" || index2 < 0 || index2 === Number.POSITIVE_INFINITY)) {
+ throw new Error("Expected positive finite index");
+ }
+ if (parent !== void 0 && parent !== null && (!is(parent) || !parent.children)) {
+ throw new Error("Expected parent node");
+ }
+ if ((parent === void 0 || parent === null) !== (index2 === void 0 || index2 === null)) {
+ throw new Error("Expected both parent and index");
+ }
+ return looksLikeANode(node2) ? check.call(context2, node2, index2, parent) : false;
+ });
+ convert = // Note: overloads in JSDoc can’t yet use different `@template`s.
+ /**
+ * @type {(
+ * ((test: Condition) => (node: unknown, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node & {type: Condition}) &
+ * ((test: Condition) => (node: unknown, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node & Condition) &
+ * ((test: Condition) => (node: unknown, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node & Predicate) &
+ * ((test?: null | undefined) => (node?: unknown, index?: number | null | undefined, parent?: Parent | null | undefined, context?: unknown) => node is Node) &
+ * ((test?: Test) => Check)
+ * )}
+ */
+ /**
+ * @param {Test} [test]
+ * @returns {Check}
+ */
+ (function(test) {
+ if (test === null || test === void 0) {
+ return ok2;
+ }
+ if (typeof test === "function") {
+ return castFactory(test);
+ }
+ if (typeof test === "object") {
+ return Array.isArray(test) ? anyFactory(test) : (
+ // Cast because `ReadonlyArray` goes into the above but `isArray`
+ // narrows to `Array`.
+ propertiesFactory(
+ /** @type {Props} */
+ test
+ )
+ );
+ }
+ if (typeof test === "string") {
+ return typeFactory(test);
+ }
+ throw new Error("Expected function, string, or object as test");
+ });
+ }
+});
+
+// node_modules/.pnpm/unist-util-is@6.0.1/node_modules/unist-util-is/index.js
+var init_unist_util_is = __esm({
+ "node_modules/.pnpm/unist-util-is@6.0.1/node_modules/unist-util-is/index.js"() {
+ init_lib6();
+ }
+});
+
+// node_modules/.pnpm/unist-util-visit-parents@6.0.2/node_modules/unist-util-visit-parents/lib/color.js
+function color(d5) {
+ return d5;
+}
+var init_color = __esm({
+ "node_modules/.pnpm/unist-util-visit-parents@6.0.2/node_modules/unist-util-visit-parents/lib/color.js"() {
+ }
+});
+
+// node_modules/.pnpm/unist-util-visit-parents@6.0.2/node_modules/unist-util-visit-parents/lib/index.js
+function visitParents(tree, test, visitor, reverse) {
+ let check;
+ if (typeof test === "function" && typeof visitor !== "function") {
+ reverse = visitor;
+ visitor = test;
+ } else {
+ check = test;
+ }
+ const is3 = convert(check);
+ const step = reverse ? -1 : 1;
+ factory(tree, void 0, [])();
+ function factory(node2, index2, parents) {
+ const value2 = (
+ /** @type {Record} */
+ node2 && typeof node2 === "object" ? node2 : {}
+ );
+ if (typeof value2.type === "string") {
+ const name = (
+ // `hast`
+ typeof value2.tagName === "string" ? value2.tagName : (
+ // `xast`
+ typeof value2.name === "string" ? value2.name : void 0
+ )
+ );
+ Object.defineProperty(visit2, "name", {
+ value: "node (" + color(node2.type + (name ? "<" + name + ">" : "")) + ")"
+ });
+ }
+ return visit2;
+ function visit2() {
+ let result = empty2;
+ let subresult;
+ let offset;
+ let grandparents;
+ if (!test || is3(node2, index2, parents[parents.length - 1] || void 0)) {
+ result = toResult(visitor(node2, parents));
+ if (result[0] === EXIT) {
+ return result;
+ }
+ }
+ if ("children" in node2 && node2.children) {
+ const nodeAsParent = (
+ /** @type {UnistParent} */
+ node2
+ );
+ if (nodeAsParent.children && result[0] !== SKIP) {
+ offset = (reverse ? nodeAsParent.children.length : -1) + step;
+ grandparents = parents.concat(nodeAsParent);
+ while (offset > -1 && offset < nodeAsParent.children.length) {
+ const child = nodeAsParent.children[offset];
+ subresult = factory(child, offset, grandparents)();
+ if (subresult[0] === EXIT) {
+ return subresult;
+ }
+ offset = typeof subresult[1] === "number" ? subresult[1] : offset + step;
+ }
+ }
+ }
+ return result;
+ }
+ }
+}
+function toResult(value2) {
+ if (Array.isArray(value2)) {
+ return value2;
+ }
+ if (typeof value2 === "number") {
+ return [CONTINUE, value2];
+ }
+ return value2 === null || value2 === void 0 ? empty2 : [value2];
+}
+var empty2, CONTINUE, EXIT, SKIP;
+var init_lib7 = __esm({
+ "node_modules/.pnpm/unist-util-visit-parents@6.0.2/node_modules/unist-util-visit-parents/lib/index.js"() {
+ init_unist_util_is();
+ init_color();
+ empty2 = [];
+ CONTINUE = true;
+ EXIT = false;
+ SKIP = "skip";
+ }
+});
+
+// node_modules/.pnpm/unist-util-visit-parents@6.0.2/node_modules/unist-util-visit-parents/index.js
+var init_unist_util_visit_parents = __esm({
+ "node_modules/.pnpm/unist-util-visit-parents@6.0.2/node_modules/unist-util-visit-parents/index.js"() {
+ init_lib7();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-find-and-replace@3.0.2/node_modules/mdast-util-find-and-replace/lib/index.js
+function findAndReplace(tree, list5, options) {
+ const settings = options || {};
+ const ignored = convert(settings.ignore || []);
+ const pairs2 = toPairs(list5);
+ let pairIndex = -1;
+ while (++pairIndex < pairs2.length) {
+ visitParents(tree, "text", visitor);
+ }
+ function visitor(node2, parents) {
+ let index2 = -1;
+ let grandparent;
+ while (++index2 < parents.length) {
+ const parent = parents[index2];
+ const siblings2 = grandparent ? grandparent.children : void 0;
+ if (ignored(
+ parent,
+ siblings2 ? siblings2.indexOf(parent) : void 0,
+ grandparent
+ )) {
+ return;
+ }
+ grandparent = parent;
+ }
+ if (grandparent) {
+ return handler2(node2, parents);
+ }
+ }
+ function handler2(node2, parents) {
+ const parent = parents[parents.length - 1];
+ const find3 = pairs2[pairIndex][0];
+ const replace5 = pairs2[pairIndex][1];
+ let start = 0;
+ const siblings2 = parent.children;
+ const index2 = siblings2.indexOf(node2);
+ let change = false;
+ let nodes = [];
+ find3.lastIndex = 0;
+ let match2 = find3.exec(node2.value);
+ while (match2) {
+ const position3 = match2.index;
+ const matchObject = {
+ index: match2.index,
+ input: match2.input,
+ stack: [...parents, node2]
+ };
+ let value2 = replace5(...match2, matchObject);
+ if (typeof value2 === "string") {
+ value2 = value2.length > 0 ? { type: "text", value: value2 } : void 0;
+ }
+ if (value2 === false) {
+ find3.lastIndex = position3 + 1;
+ } else {
+ if (start !== position3) {
+ nodes.push({
+ type: "text",
+ value: node2.value.slice(start, position3)
+ });
+ }
+ if (Array.isArray(value2)) {
+ nodes.push(...value2);
+ } else if (value2) {
+ nodes.push(value2);
+ }
+ start = position3 + match2[0].length;
+ change = true;
+ }
+ if (!find3.global) {
+ break;
+ }
+ match2 = find3.exec(node2.value);
+ }
+ if (change) {
+ if (start < node2.value.length) {
+ nodes.push({ type: "text", value: node2.value.slice(start) });
+ }
+ parent.children.splice(index2, 1, ...nodes);
+ } else {
+ nodes = [node2];
+ }
+ return index2 + nodes.length;
+ }
+}
+function toPairs(tupleOrList) {
+ const result = [];
+ if (!Array.isArray(tupleOrList)) {
+ throw new TypeError("Expected find and replace tuple or list of tuples");
+ }
+ const list5 = !tupleOrList[0] || Array.isArray(tupleOrList[0]) ? tupleOrList : [tupleOrList];
+ let index2 = -1;
+ while (++index2 < list5.length) {
+ const tuple = list5[index2];
+ result.push([toExpression(tuple[0]), toFunction(tuple[1])]);
+ }
+ return result;
+}
+function toExpression(find3) {
+ return typeof find3 === "string" ? new RegExp(escapeStringRegexp(find3), "g") : find3;
+}
+function toFunction(replace5) {
+ return typeof replace5 === "function" ? replace5 : function() {
+ return replace5;
+ };
+}
+var init_lib8 = __esm({
+ "node_modules/.pnpm/mdast-util-find-and-replace@3.0.2/node_modules/mdast-util-find-and-replace/lib/index.js"() {
+ init_escape_string_regexp();
+ init_unist_util_visit_parents();
+ init_unist_util_is();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-find-and-replace@3.0.2/node_modules/mdast-util-find-and-replace/index.js
+var init_mdast_util_find_and_replace = __esm({
+ "node_modules/.pnpm/mdast-util-find-and-replace@3.0.2/node_modules/mdast-util-find-and-replace/index.js"() {
+ init_lib8();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-gfm-autolink-literal@2.0.1/node_modules/mdast-util-gfm-autolink-literal/lib/index.js
+function gfmAutolinkLiteralFromMarkdown() {
+ return {
+ transforms: [transformGfmAutolinkLiterals],
+ enter: {
+ literalAutolink: enterLiteralAutolink,
+ literalAutolinkEmail: enterLiteralAutolinkValue,
+ literalAutolinkHttp: enterLiteralAutolinkValue,
+ literalAutolinkWww: enterLiteralAutolinkValue
+ },
+ exit: {
+ literalAutolink: exitLiteralAutolink,
+ literalAutolinkEmail: exitLiteralAutolinkEmail,
+ literalAutolinkHttp: exitLiteralAutolinkHttp,
+ literalAutolinkWww: exitLiteralAutolinkWww
+ }
+ };
+}
+function gfmAutolinkLiteralToMarkdown() {
+ return {
+ unsafe: [
+ {
+ character: "@",
+ before: "[+\\-.\\w]",
+ after: "[\\-.\\w]",
+ inConstruct,
+ notInConstruct
+ },
+ {
+ character: ".",
+ before: "[Ww]",
+ after: "[\\-.\\w]",
+ inConstruct,
+ notInConstruct
+ },
+ {
+ character: ":",
+ before: "[ps]",
+ after: "\\/",
+ inConstruct,
+ notInConstruct
+ }
+ ]
+ };
+}
+function enterLiteralAutolink(token) {
+ this.enter({ type: "link", title: null, url: "", children: [] }, token);
+}
+function enterLiteralAutolinkValue(token) {
+ this.config.enter.autolinkProtocol.call(this, token);
+}
+function exitLiteralAutolinkHttp(token) {
+ this.config.exit.autolinkProtocol.call(this, token);
+}
+function exitLiteralAutolinkWww(token) {
+ this.config.exit.data.call(this, token);
+ const node2 = this.stack[this.stack.length - 1];
+ ok(node2.type === "link");
+ node2.url = "http://" + this.sliceSerialize(token);
+}
+function exitLiteralAutolinkEmail(token) {
+ this.config.exit.autolinkEmail.call(this, token);
+}
+function exitLiteralAutolink(token) {
+ this.exit(token);
+}
+function transformGfmAutolinkLiterals(tree) {
+ findAndReplace(
+ tree,
+ [
+ [/(https?:\/\/|www(?=\.))([-.\w]+)([^ \t\r\n]*)/gi, findUrl],
+ [/(?<=^|\s|\p{P}|\p{S})([-.\w+]+)@([-\w]+(?:\.[-\w]+)+)/gu, findEmail]
+ ],
+ { ignore: ["link", "linkReference"] }
+ );
+}
+function findUrl(_4, protocol, domain2, path2, match2) {
+ let prefix4 = "";
+ if (!previous(match2)) {
+ return false;
+ }
+ if (/^w/i.test(protocol)) {
+ domain2 = protocol + domain2;
+ protocol = "";
+ prefix4 = "http://";
+ }
+ if (!isCorrectDomain(domain2)) {
+ return false;
+ }
+ const parts = splitUrl(domain2 + path2);
+ if (!parts[0]) return false;
+ const result = {
+ type: "link",
+ title: null,
+ url: prefix4 + protocol + parts[0],
+ children: [{ type: "text", value: protocol + parts[0] }]
+ };
+ if (parts[1]) {
+ return [result, { type: "text", value: parts[1] }];
+ }
+ return result;
+}
+function findEmail(_4, atext, label, match2) {
+ if (
+ // Not an expected previous character.
+ !previous(match2, true) || // Label ends in not allowed character.
+ /[-\d_]$/.test(label)
+ ) {
+ return false;
+ }
+ return {
+ type: "link",
+ title: null,
+ url: "mailto:" + atext + "@" + label,
+ children: [{ type: "text", value: atext + "@" + label }]
+ };
+}
+function isCorrectDomain(domain2) {
+ const parts = domain2.split(".");
+ if (parts.length < 2 || parts[parts.length - 1] && (/_/.test(parts[parts.length - 1]) || !/[a-zA-Z\d]/.test(parts[parts.length - 1])) || parts[parts.length - 2] && (/_/.test(parts[parts.length - 2]) || !/[a-zA-Z\d]/.test(parts[parts.length - 2]))) {
+ return false;
+ }
+ return true;
+}
+function splitUrl(url) {
+ const trailExec = /[!"&'),.:;<>?\]}]+$/.exec(url);
+ if (!trailExec) {
+ return [url, void 0];
+ }
+ url = url.slice(0, trailExec.index);
+ let trail2 = trailExec[0];
+ let closingParenIndex = trail2.indexOf(")");
+ const openingParens = ccount(url, "(");
+ let closingParens = ccount(url, ")");
+ while (closingParenIndex !== -1 && openingParens > closingParens) {
+ url += trail2.slice(0, closingParenIndex + 1);
+ trail2 = trail2.slice(closingParenIndex + 1);
+ closingParenIndex = trail2.indexOf(")");
+ closingParens++;
+ }
+ return [url, trail2];
+}
+function previous(match2, email) {
+ const code4 = match2.input.charCodeAt(match2.index - 1);
+ return (match2.index === 0 || unicodeWhitespace(code4) || unicodePunctuation(code4)) && // If it’s an email, the previous character should not be a slash.
+ (!email || code4 !== 47);
+}
+var inConstruct, notInConstruct;
+var init_lib9 = __esm({
+ "node_modules/.pnpm/mdast-util-gfm-autolink-literal@2.0.1/node_modules/mdast-util-gfm-autolink-literal/lib/index.js"() {
+ init_ccount();
+ init_default();
+ init_micromark_util_character();
+ init_mdast_util_find_and_replace();
+ inConstruct = "phrasing";
+ notInConstruct = ["autolink", "link", "image", "label"];
+ }
+});
+
+// node_modules/.pnpm/mdast-util-gfm-autolink-literal@2.0.1/node_modules/mdast-util-gfm-autolink-literal/index.js
+var init_mdast_util_gfm_autolink_literal = __esm({
+ "node_modules/.pnpm/mdast-util-gfm-autolink-literal@2.0.1/node_modules/mdast-util-gfm-autolink-literal/index.js"() {
+ init_lib9();
+ }
+});
+
+// node_modules/.pnpm/micromark-util-normalize-identifier@2.0.1/node_modules/micromark-util-normalize-identifier/index.js
+function normalizeIdentifier(value2) {
+ return value2.replace(/[\t\n\r ]+/g, " ").replace(/^ | $/g, "").toLowerCase().toUpperCase();
+}
+var init_micromark_util_normalize_identifier = __esm({
+ "node_modules/.pnpm/micromark-util-normalize-identifier@2.0.1/node_modules/micromark-util-normalize-identifier/index.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-gfm-footnote@2.1.0/node_modules/mdast-util-gfm-footnote/lib/index.js
+function enterFootnoteCallString() {
+ this.buffer();
+}
+function enterFootnoteCall(token) {
+ this.enter({ type: "footnoteReference", identifier: "", label: "" }, token);
+}
+function enterFootnoteDefinitionLabelString() {
+ this.buffer();
+}
+function enterFootnoteDefinition(token) {
+ this.enter(
+ { type: "footnoteDefinition", identifier: "", label: "", children: [] },
+ token
+ );
+}
+function exitFootnoteCallString(token) {
+ const label = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ ok(node2.type === "footnoteReference");
+ node2.identifier = normalizeIdentifier(
+ this.sliceSerialize(token)
+ ).toLowerCase();
+ node2.label = label;
+}
+function exitFootnoteCall(token) {
+ this.exit(token);
+}
+function exitFootnoteDefinitionLabelString(token) {
+ const label = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ ok(node2.type === "footnoteDefinition");
+ node2.identifier = normalizeIdentifier(
+ this.sliceSerialize(token)
+ ).toLowerCase();
+ node2.label = label;
+}
+function exitFootnoteDefinition(token) {
+ this.exit(token);
+}
+function footnoteReferencePeek() {
+ return "[";
+}
+function footnoteReference(node2, _4, state, info) {
+ const tracker = state.createTracker(info);
+ let value2 = tracker.move("[^");
+ const exit3 = state.enter("footnoteReference");
+ const subexit = state.enter("reference");
+ value2 += tracker.move(
+ state.safe(state.associationId(node2), { after: "]", before: value2 })
+ );
+ subexit();
+ exit3();
+ value2 += tracker.move("]");
+ return value2;
+}
+function gfmFootnoteFromMarkdown() {
+ return {
+ enter: {
+ gfmFootnoteCallString: enterFootnoteCallString,
+ gfmFootnoteCall: enterFootnoteCall,
+ gfmFootnoteDefinitionLabelString: enterFootnoteDefinitionLabelString,
+ gfmFootnoteDefinition: enterFootnoteDefinition
+ },
+ exit: {
+ gfmFootnoteCallString: exitFootnoteCallString,
+ gfmFootnoteCall: exitFootnoteCall,
+ gfmFootnoteDefinitionLabelString: exitFootnoteDefinitionLabelString,
+ gfmFootnoteDefinition: exitFootnoteDefinition
+ }
+ };
+}
+function gfmFootnoteToMarkdown(options) {
+ let firstLineBlank = false;
+ if (options && options.firstLineBlank) {
+ firstLineBlank = true;
+ }
+ return {
+ handlers: { footnoteDefinition, footnoteReference },
+ // This is on by default already.
+ unsafe: [{ character: "[", inConstruct: ["label", "phrasing", "reference"] }]
+ };
+ function footnoteDefinition(node2, _4, state, info) {
+ const tracker = state.createTracker(info);
+ let value2 = tracker.move("[^");
+ const exit3 = state.enter("footnoteDefinition");
+ const subexit = state.enter("label");
+ value2 += tracker.move(
+ state.safe(state.associationId(node2), { before: value2, after: "]" })
+ );
+ subexit();
+ value2 += tracker.move("]:");
+ if (node2.children && node2.children.length > 0) {
+ tracker.shift(4);
+ value2 += tracker.move(
+ (firstLineBlank ? "\n" : " ") + state.indentLines(
+ state.containerFlow(node2, tracker.current()),
+ firstLineBlank ? mapAll : mapExceptFirst
+ )
+ );
+ }
+ exit3();
+ return value2;
+ }
+}
+function mapExceptFirst(line, index2, blank) {
+ return index2 === 0 ? line : mapAll(line, index2, blank);
+}
+function mapAll(line, index2, blank) {
+ return (blank ? "" : " ") + line;
+}
+var init_lib10 = __esm({
+ "node_modules/.pnpm/mdast-util-gfm-footnote@2.1.0/node_modules/mdast-util-gfm-footnote/lib/index.js"() {
+ init_default();
+ init_micromark_util_normalize_identifier();
+ footnoteReference.peek = footnoteReferencePeek;
+ }
+});
+
+// node_modules/.pnpm/mdast-util-gfm-footnote@2.1.0/node_modules/mdast-util-gfm-footnote/index.js
+var init_mdast_util_gfm_footnote = __esm({
+ "node_modules/.pnpm/mdast-util-gfm-footnote@2.1.0/node_modules/mdast-util-gfm-footnote/index.js"() {
+ init_lib10();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-gfm-strikethrough@2.0.0/node_modules/mdast-util-gfm-strikethrough/lib/index.js
+function gfmStrikethroughFromMarkdown() {
+ return {
+ canContainEols: ["delete"],
+ enter: { strikethrough: enterStrikethrough },
+ exit: { strikethrough: exitStrikethrough }
+ };
+}
+function gfmStrikethroughToMarkdown() {
+ return {
+ unsafe: [
+ {
+ character: "~",
+ inConstruct: "phrasing",
+ notInConstruct: constructsWithoutStrikethrough
+ }
+ ],
+ handlers: { delete: handleDelete }
+ };
+}
+function enterStrikethrough(token) {
+ this.enter({ type: "delete", children: [] }, token);
+}
+function exitStrikethrough(token) {
+ this.exit(token);
+}
+function handleDelete(node2, _4, state, info) {
+ const tracker = state.createTracker(info);
+ const exit3 = state.enter("strikethrough");
+ let value2 = tracker.move("~~");
+ value2 += state.containerPhrasing(node2, {
+ ...tracker.current(),
+ before: value2,
+ after: "~"
+ });
+ value2 += tracker.move("~~");
+ exit3();
+ return value2;
+}
+function peekDelete() {
+ return "~";
+}
+var constructsWithoutStrikethrough;
+var init_lib11 = __esm({
+ "node_modules/.pnpm/mdast-util-gfm-strikethrough@2.0.0/node_modules/mdast-util-gfm-strikethrough/lib/index.js"() {
+ constructsWithoutStrikethrough = [
+ "autolink",
+ "destinationLiteral",
+ "destinationRaw",
+ "reference",
+ "titleQuote",
+ "titleApostrophe"
+ ];
+ handleDelete.peek = peekDelete;
+ }
+});
+
+// node_modules/.pnpm/mdast-util-gfm-strikethrough@2.0.0/node_modules/mdast-util-gfm-strikethrough/index.js
+var init_mdast_util_gfm_strikethrough = __esm({
+ "node_modules/.pnpm/mdast-util-gfm-strikethrough@2.0.0/node_modules/mdast-util-gfm-strikethrough/index.js"() {
+ init_lib11();
+ }
+});
+
+// node_modules/.pnpm/markdown-table@3.0.4/node_modules/markdown-table/index.js
+function defaultStringLength(value2) {
+ return value2.length;
+}
+function markdownTable(table2, options) {
+ const settings = options || {};
+ const align = (settings.align || []).concat();
+ const stringLength = settings.stringLength || defaultStringLength;
+ const alignments = [];
+ const cellMatrix = [];
+ const sizeMatrix = [];
+ const longestCellByColumn = [];
+ let mostCellsPerRow = 0;
+ let rowIndex = -1;
+ while (++rowIndex < table2.length) {
+ const row2 = [];
+ const sizes2 = [];
+ let columnIndex2 = -1;
+ if (table2[rowIndex].length > mostCellsPerRow) {
+ mostCellsPerRow = table2[rowIndex].length;
+ }
+ while (++columnIndex2 < table2[rowIndex].length) {
+ const cell2 = serialize(table2[rowIndex][columnIndex2]);
+ if (settings.alignDelimiters !== false) {
+ const size = stringLength(cell2);
+ sizes2[columnIndex2] = size;
+ if (longestCellByColumn[columnIndex2] === void 0 || size > longestCellByColumn[columnIndex2]) {
+ longestCellByColumn[columnIndex2] = size;
+ }
+ }
+ row2.push(cell2);
+ }
+ cellMatrix[rowIndex] = row2;
+ sizeMatrix[rowIndex] = sizes2;
+ }
+ let columnIndex = -1;
+ if (typeof align === "object" && "length" in align) {
+ while (++columnIndex < mostCellsPerRow) {
+ alignments[columnIndex] = toAlignment(align[columnIndex]);
+ }
+ } else {
+ const code4 = toAlignment(align);
+ while (++columnIndex < mostCellsPerRow) {
+ alignments[columnIndex] = code4;
+ }
+ }
+ columnIndex = -1;
+ const row = [];
+ const sizes = [];
+ while (++columnIndex < mostCellsPerRow) {
+ const code4 = alignments[columnIndex];
+ let before = "";
+ let after = "";
+ if (code4 === 99) {
+ before = ":";
+ after = ":";
+ } else if (code4 === 108) {
+ before = ":";
+ } else if (code4 === 114) {
+ after = ":";
+ }
+ let size = settings.alignDelimiters === false ? 1 : Math.max(
+ 1,
+ longestCellByColumn[columnIndex] - before.length - after.length
+ );
+ const cell2 = before + "-".repeat(size) + after;
+ if (settings.alignDelimiters !== false) {
+ size = before.length + size + after.length;
+ if (size > longestCellByColumn[columnIndex]) {
+ longestCellByColumn[columnIndex] = size;
+ }
+ sizes[columnIndex] = size;
+ }
+ row[columnIndex] = cell2;
+ }
+ cellMatrix.splice(1, 0, row);
+ sizeMatrix.splice(1, 0, sizes);
+ rowIndex = -1;
+ const lines = [];
+ while (++rowIndex < cellMatrix.length) {
+ const row2 = cellMatrix[rowIndex];
+ const sizes2 = sizeMatrix[rowIndex];
+ columnIndex = -1;
+ const line = [];
+ while (++columnIndex < mostCellsPerRow) {
+ const cell2 = row2[columnIndex] || "";
+ let before = "";
+ let after = "";
+ if (settings.alignDelimiters !== false) {
+ const size = longestCellByColumn[columnIndex] - (sizes2[columnIndex] || 0);
+ const code4 = alignments[columnIndex];
+ if (code4 === 114) {
+ before = " ".repeat(size);
+ } else if (code4 === 99) {
+ if (size % 2) {
+ before = " ".repeat(size / 2 + 0.5);
+ after = " ".repeat(size / 2 - 0.5);
+ } else {
+ before = " ".repeat(size / 2);
+ after = before;
+ }
+ } else {
+ after = " ".repeat(size);
+ }
+ }
+ if (settings.delimiterStart !== false && !columnIndex) {
+ line.push("|");
+ }
+ if (settings.padding !== false && // Don’t add the opening space if we’re not aligning and the cell is
+ // empty: there will be a closing space.
+ !(settings.alignDelimiters === false && cell2 === "") && (settings.delimiterStart !== false || columnIndex)) {
+ line.push(" ");
+ }
+ if (settings.alignDelimiters !== false) {
+ line.push(before);
+ }
+ line.push(cell2);
+ if (settings.alignDelimiters !== false) {
+ line.push(after);
+ }
+ if (settings.padding !== false) {
+ line.push(" ");
+ }
+ if (settings.delimiterEnd !== false || columnIndex !== mostCellsPerRow - 1) {
+ line.push("|");
+ }
+ }
+ lines.push(
+ settings.delimiterEnd === false ? line.join("").replace(/ +$/, "") : line.join("")
+ );
+ }
+ return lines.join("\n");
+}
+function serialize(value2) {
+ return value2 === null || value2 === void 0 ? "" : String(value2);
+}
+function toAlignment(value2) {
+ const code4 = typeof value2 === "string" ? value2.codePointAt(0) : 0;
+ return code4 === 67 || code4 === 99 ? 99 : code4 === 76 || code4 === 108 ? 108 : code4 === 82 || code4 === 114 ? 114 : 0;
+}
+var init_markdown_table = __esm({
+ "node_modules/.pnpm/markdown-table@3.0.4/node_modules/markdown-table/index.js"() {
+ }
+});
+
+// node_modules/.pnpm/zwitch@2.0.4/node_modules/zwitch/index.js
+function zwitch(key2, options) {
+ const settings = options || {};
+ function one3(value2, ...parameters) {
+ let fn = one3.invalid;
+ const handlers2 = one3.handlers;
+ if (value2 && own2.call(value2, key2)) {
+ const id = String(value2[key2]);
+ fn = own2.call(handlers2, id) ? handlers2[id] : one3.unknown;
+ }
+ if (fn) {
+ return fn.call(this, value2, ...parameters);
+ }
+ }
+ one3.handlers = settings.handlers || {};
+ one3.invalid = settings.invalid;
+ one3.unknown = settings.unknown;
+ return one3;
+}
+var own2;
+var init_zwitch = __esm({
+ "node_modules/.pnpm/zwitch@2.0.4/node_modules/zwitch/index.js"() {
+ own2 = {}.hasOwnProperty;
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/configure.js
+function configure(base, extension2) {
+ let index2 = -1;
+ let key2;
+ if (extension2.extensions) {
+ while (++index2 < extension2.extensions.length) {
+ configure(base, extension2.extensions[index2]);
+ }
+ }
+ for (key2 in extension2) {
+ if (own3.call(extension2, key2)) {
+ switch (key2) {
+ case "extensions": {
+ break;
+ }
+ /* c8 ignore next 4 */
+ case "unsafe": {
+ list(base[key2], extension2[key2]);
+ break;
+ }
+ case "join": {
+ list(base[key2], extension2[key2]);
+ break;
+ }
+ case "handlers": {
+ map3(base[key2], extension2[key2]);
+ break;
+ }
+ default: {
+ base.options[key2] = extension2[key2];
+ }
+ }
+ }
+ }
+ return base;
+}
+function list(left, right) {
+ if (right) {
+ left.push(...right);
+ }
+}
+function map3(left, right) {
+ if (right) {
+ Object.assign(left, right);
+ }
+}
+var own3;
+var init_configure = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/configure.js"() {
+ own3 = {}.hasOwnProperty;
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/blockquote.js
+function blockquote(node2, _4, state, info) {
+ const exit3 = state.enter("blockquote");
+ const tracker = state.createTracker(info);
+ tracker.move("> ");
+ tracker.shift(2);
+ const value2 = state.indentLines(
+ state.containerFlow(node2, tracker.current()),
+ map4
+ );
+ exit3();
+ return value2;
+}
+function map4(line, _4, blank) {
+ return ">" + (blank ? "" : " ") + line;
+}
+var init_blockquote = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/blockquote.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/pattern-in-scope.js
+function patternInScope(stack, pattern) {
+ return listInScope(stack, pattern.inConstruct, true) && !listInScope(stack, pattern.notInConstruct, false);
+}
+function listInScope(stack, list5, none) {
+ if (typeof list5 === "string") {
+ list5 = [list5];
+ }
+ if (!list5 || list5.length === 0) {
+ return none;
+ }
+ let index2 = -1;
+ while (++index2 < list5.length) {
+ if (stack.includes(list5[index2])) {
+ return true;
+ }
+ }
+ return false;
+}
+var init_pattern_in_scope = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/pattern-in-scope.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/break.js
+function hardBreak(_4, _1, state, info) {
+ let index2 = -1;
+ while (++index2 < state.unsafe.length) {
+ if (state.unsafe[index2].character === "\n" && patternInScope(state.stack, state.unsafe[index2])) {
+ return /[ \t]/.test(info.before) ? "" : " ";
+ }
+ }
+ return "\\\n";
+}
+var init_break = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/break.js"() {
+ init_pattern_in_scope();
+ }
+});
+
+// node_modules/.pnpm/longest-streak@3.1.0/node_modules/longest-streak/index.js
+function longestStreak(value2, substring) {
+ const source = String(value2);
+ let index2 = source.indexOf(substring);
+ let expected = index2;
+ let count2 = 0;
+ let max3 = 0;
+ if (typeof substring !== "string") {
+ throw new TypeError("Expected substring");
+ }
+ while (index2 !== -1) {
+ if (index2 === expected) {
+ if (++count2 > max3) {
+ max3 = count2;
+ }
+ } else {
+ count2 = 1;
+ }
+ expected = index2 + substring.length;
+ index2 = source.indexOf(substring, expected);
+ }
+ return max3;
+}
+var init_longest_streak = __esm({
+ "node_modules/.pnpm/longest-streak@3.1.0/node_modules/longest-streak/index.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/format-code-as-indented.js
+function formatCodeAsIndented(node2, state) {
+ return Boolean(
+ state.options.fences === false && node2.value && // If there’s no info…
+ !node2.lang && // And there’s a non-whitespace character…
+ /[^ \r\n]/.test(node2.value) && // And the value doesn’t start or end in a blank…
+ !/^[\t ]*(?:[\r\n]|$)|(?:^|[\r\n])[\t ]*$/.test(node2.value)
+ );
+}
+var init_format_code_as_indented = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/format-code-as-indented.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-fence.js
+function checkFence(state) {
+ const marker = state.options.fence || "`";
+ if (marker !== "`" && marker !== "~") {
+ throw new Error(
+ "Cannot serialize code with `" + marker + "` for `options.fence`, expected `` ` `` or `~`"
+ );
+ }
+ return marker;
+}
+var init_check_fence = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-fence.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/code.js
+function code(node2, _4, state, info) {
+ const marker = checkFence(state);
+ const raw2 = node2.value || "";
+ const suffix = marker === "`" ? "GraveAccent" : "Tilde";
+ if (formatCodeAsIndented(node2, state)) {
+ const exit4 = state.enter("codeIndented");
+ const value3 = state.indentLines(raw2, map5);
+ exit4();
+ return value3;
+ }
+ const tracker = state.createTracker(info);
+ const sequence = marker.repeat(Math.max(longestStreak(raw2, marker) + 1, 3));
+ const exit3 = state.enter("codeFenced");
+ let value2 = tracker.move(sequence);
+ if (node2.lang) {
+ const subexit = state.enter(`codeFencedLang${suffix}`);
+ value2 += tracker.move(
+ state.safe(node2.lang, {
+ before: value2,
+ after: " ",
+ encode: ["`"],
+ ...tracker.current()
+ })
+ );
+ subexit();
+ }
+ if (node2.lang && node2.meta) {
+ const subexit = state.enter(`codeFencedMeta${suffix}`);
+ value2 += tracker.move(" ");
+ value2 += tracker.move(
+ state.safe(node2.meta, {
+ before: value2,
+ after: "\n",
+ encode: ["`"],
+ ...tracker.current()
+ })
+ );
+ subexit();
+ }
+ value2 += tracker.move("\n");
+ if (raw2) {
+ value2 += tracker.move(raw2 + "\n");
+ }
+ value2 += tracker.move(sequence);
+ exit3();
+ return value2;
+}
+function map5(line, _4, blank) {
+ return (blank ? "" : " ") + line;
+}
+var init_code = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/code.js"() {
+ init_longest_streak();
+ init_format_code_as_indented();
+ init_check_fence();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-quote.js
+function checkQuote(state) {
+ const marker = state.options.quote || '"';
+ if (marker !== '"' && marker !== "'") {
+ throw new Error(
+ "Cannot serialize title with `" + marker + "` for `options.quote`, expected `\"`, or `'`"
+ );
+ }
+ return marker;
+}
+var init_check_quote = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-quote.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/definition.js
+function definition(node2, _4, state, info) {
+ const quote = checkQuote(state);
+ const suffix = quote === '"' ? "Quote" : "Apostrophe";
+ const exit3 = state.enter("definition");
+ let subexit = state.enter("label");
+ const tracker = state.createTracker(info);
+ let value2 = tracker.move("[");
+ value2 += tracker.move(
+ state.safe(state.associationId(node2), {
+ before: value2,
+ after: "]",
+ ...tracker.current()
+ })
+ );
+ value2 += tracker.move("]: ");
+ subexit();
+ if (
+ // If there’s no url, or…
+ !node2.url || // If there are control characters or whitespace.
+ /[\0- \u007F]/.test(node2.url)
+ ) {
+ subexit = state.enter("destinationLiteral");
+ value2 += tracker.move("<");
+ value2 += tracker.move(
+ state.safe(node2.url, { before: value2, after: ">", ...tracker.current() })
+ );
+ value2 += tracker.move(">");
+ } else {
+ subexit = state.enter("destinationRaw");
+ value2 += tracker.move(
+ state.safe(node2.url, {
+ before: value2,
+ after: node2.title ? " " : "\n",
+ ...tracker.current()
+ })
+ );
+ }
+ subexit();
+ if (node2.title) {
+ subexit = state.enter(`title${suffix}`);
+ value2 += tracker.move(" " + quote);
+ value2 += tracker.move(
+ state.safe(node2.title, {
+ before: value2,
+ after: quote,
+ ...tracker.current()
+ })
+ );
+ value2 += tracker.move(quote);
+ subexit();
+ }
+ exit3();
+ return value2;
+}
+var init_definition = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/definition.js"() {
+ init_check_quote();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-emphasis.js
+function checkEmphasis(state) {
+ const marker = state.options.emphasis || "*";
+ if (marker !== "*" && marker !== "_") {
+ throw new Error(
+ "Cannot serialize emphasis with `" + marker + "` for `options.emphasis`, expected `*`, or `_`"
+ );
+ }
+ return marker;
+}
+var init_check_emphasis = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-emphasis.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/encode-character-reference.js
+function encodeCharacterReference(code4) {
+ return "" + code4.toString(16).toUpperCase() + ";";
+}
+var init_encode_character_reference = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/encode-character-reference.js"() {
+ }
+});
+
+// node_modules/.pnpm/micromark-util-classify-character@2.0.1/node_modules/micromark-util-classify-character/index.js
+function classifyCharacter(code4) {
+ if (code4 === null || markdownLineEndingOrSpace(code4) || unicodeWhitespace(code4)) {
+ return 1;
+ }
+ if (unicodePunctuation(code4)) {
+ return 2;
+ }
+}
+var init_micromark_util_classify_character = __esm({
+ "node_modules/.pnpm/micromark-util-classify-character@2.0.1/node_modules/micromark-util-classify-character/index.js"() {
+ init_micromark_util_character();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/encode-info.js
+function encodeInfo(outside, inside, marker) {
+ const outsideKind = classifyCharacter(outside);
+ const insideKind = classifyCharacter(inside);
+ if (outsideKind === void 0) {
+ return insideKind === void 0 ? (
+ // Letter inside:
+ // we have to encode *both* letters for `_` as it is looser.
+ // it already forms for `*` (and GFMs `~`).
+ marker === "_" ? { inside: true, outside: true } : { inside: false, outside: false }
+ ) : insideKind === 1 ? (
+ // Whitespace inside: encode both (letter, whitespace).
+ { inside: true, outside: true }
+ ) : (
+ // Punctuation inside: encode outer (letter)
+ { inside: false, outside: true }
+ );
+ }
+ if (outsideKind === 1) {
+ return insideKind === void 0 ? (
+ // Letter inside: already forms.
+ { inside: false, outside: false }
+ ) : insideKind === 1 ? (
+ // Whitespace inside: encode both (whitespace).
+ { inside: true, outside: true }
+ ) : (
+ // Punctuation inside: already forms.
+ { inside: false, outside: false }
+ );
+ }
+ return insideKind === void 0 ? (
+ // Letter inside: already forms.
+ { inside: false, outside: false }
+ ) : insideKind === 1 ? (
+ // Whitespace inside: encode inner (whitespace).
+ { inside: true, outside: false }
+ ) : (
+ // Punctuation inside: already forms.
+ { inside: false, outside: false }
+ );
+}
+var init_encode_info = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/encode-info.js"() {
+ init_micromark_util_classify_character();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/emphasis.js
+function emphasis(node2, _4, state, info) {
+ const marker = checkEmphasis(state);
+ const exit3 = state.enter("emphasis");
+ const tracker = state.createTracker(info);
+ const before = tracker.move(marker);
+ let between2 = tracker.move(
+ state.containerPhrasing(node2, {
+ after: marker,
+ before,
+ ...tracker.current()
+ })
+ );
+ const betweenHead = between2.charCodeAt(0);
+ const open = encodeInfo(
+ info.before.charCodeAt(info.before.length - 1),
+ betweenHead,
+ marker
+ );
+ if (open.inside) {
+ between2 = encodeCharacterReference(betweenHead) + between2.slice(1);
+ }
+ const betweenTail = between2.charCodeAt(between2.length - 1);
+ const close7 = encodeInfo(info.after.charCodeAt(0), betweenTail, marker);
+ if (close7.inside) {
+ between2 = between2.slice(0, -1) + encodeCharacterReference(betweenTail);
+ }
+ const after = tracker.move(marker);
+ exit3();
+ state.attentionEncodeSurroundingInfo = {
+ after: close7.outside,
+ before: open.outside
+ };
+ return before + between2 + after;
+}
+function emphasisPeek(_4, _1, state) {
+ return state.options.emphasis || "*";
+}
+var init_emphasis = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/emphasis.js"() {
+ init_check_emphasis();
+ init_encode_character_reference();
+ init_encode_info();
+ emphasis.peek = emphasisPeek;
+ }
+});
+
+// node_modules/.pnpm/unist-util-visit@5.1.0/node_modules/unist-util-visit/lib/index.js
+function visit(tree, testOrVisitor, visitorOrReverse, maybeReverse) {
+ let reverse;
+ let test;
+ let visitor;
+ if (typeof testOrVisitor === "function" && typeof visitorOrReverse !== "function") {
+ test = void 0;
+ visitor = testOrVisitor;
+ reverse = visitorOrReverse;
+ } else {
+ test = testOrVisitor;
+ visitor = visitorOrReverse;
+ reverse = maybeReverse;
+ }
+ visitParents(tree, test, overload, reverse);
+ function overload(node2, parents) {
+ const parent = parents[parents.length - 1];
+ const index2 = parent ? parent.children.indexOf(node2) : void 0;
+ return visitor(node2, index2, parent);
+ }
+}
+var init_lib12 = __esm({
+ "node_modules/.pnpm/unist-util-visit@5.1.0/node_modules/unist-util-visit/lib/index.js"() {
+ init_unist_util_visit_parents();
+ init_unist_util_visit_parents();
+ }
+});
+
+// node_modules/.pnpm/unist-util-visit@5.1.0/node_modules/unist-util-visit/index.js
+var init_unist_util_visit = __esm({
+ "node_modules/.pnpm/unist-util-visit@5.1.0/node_modules/unist-util-visit/index.js"() {
+ init_lib12();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-string@4.0.0/node_modules/mdast-util-to-string/lib/index.js
+function toString(value2, options) {
+ const settings = options || emptyOptions;
+ const includeImageAlt = typeof settings.includeImageAlt === "boolean" ? settings.includeImageAlt : true;
+ const includeHtml = typeof settings.includeHtml === "boolean" ? settings.includeHtml : true;
+ return one(value2, includeImageAlt, includeHtml);
+}
+function one(value2, includeImageAlt, includeHtml) {
+ if (node(value2)) {
+ if ("value" in value2) {
+ return value2.type === "html" && !includeHtml ? "" : value2.value;
+ }
+ if (includeImageAlt && "alt" in value2 && value2.alt) {
+ return value2.alt;
+ }
+ if ("children" in value2) {
+ return all(value2.children, includeImageAlt, includeHtml);
+ }
+ }
+ if (Array.isArray(value2)) {
+ return all(value2, includeImageAlt, includeHtml);
+ }
+ return "";
+}
+function all(values, includeImageAlt, includeHtml) {
+ const result = [];
+ let index2 = -1;
+ while (++index2 < values.length) {
+ result[index2] = one(values[index2], includeImageAlt, includeHtml);
+ }
+ return result.join("");
+}
+function node(value2) {
+ return Boolean(value2 && typeof value2 === "object");
+}
+var emptyOptions;
+var init_lib13 = __esm({
+ "node_modules/.pnpm/mdast-util-to-string@4.0.0/node_modules/mdast-util-to-string/lib/index.js"() {
+ emptyOptions = {};
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-string@4.0.0/node_modules/mdast-util-to-string/index.js
+var init_mdast_util_to_string = __esm({
+ "node_modules/.pnpm/mdast-util-to-string@4.0.0/node_modules/mdast-util-to-string/index.js"() {
+ init_lib13();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/format-heading-as-setext.js
+function formatHeadingAsSetext(node2, state) {
+ let literalWithBreak = false;
+ visit(node2, function(node3) {
+ if ("value" in node3 && /\r?\n|\r/.test(node3.value) || node3.type === "break") {
+ literalWithBreak = true;
+ return EXIT;
+ }
+ });
+ return Boolean(
+ (!node2.depth || node2.depth < 3) && toString(node2) && (state.options.setext || literalWithBreak)
+ );
+}
+var init_format_heading_as_setext = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/format-heading-as-setext.js"() {
+ init_unist_util_visit();
+ init_mdast_util_to_string();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/heading.js
+function heading(node2, _4, state, info) {
+ const rank = Math.max(Math.min(6, node2.depth || 1), 1);
+ const tracker = state.createTracker(info);
+ if (formatHeadingAsSetext(node2, state)) {
+ const exit4 = state.enter("headingSetext");
+ const subexit2 = state.enter("phrasing");
+ const value3 = state.containerPhrasing(node2, {
+ ...tracker.current(),
+ before: "\n",
+ after: "\n"
+ });
+ subexit2();
+ exit4();
+ return value3 + "\n" + (rank === 1 ? "=" : "-").repeat(
+ // The whole size…
+ value3.length - // Minus the position of the character after the last EOL (or
+ // 0 if there is none)…
+ (Math.max(value3.lastIndexOf("\r"), value3.lastIndexOf("\n")) + 1)
+ );
+ }
+ const sequence = "#".repeat(rank);
+ const exit3 = state.enter("headingAtx");
+ const subexit = state.enter("phrasing");
+ tracker.move(sequence + " ");
+ let value2 = state.containerPhrasing(node2, {
+ before: "# ",
+ after: "\n",
+ ...tracker.current()
+ });
+ if (/^[\t ]/.test(value2)) {
+ value2 = encodeCharacterReference(value2.charCodeAt(0)) + value2.slice(1);
+ }
+ value2 = value2 ? sequence + " " + value2 : sequence;
+ if (state.options.closeAtx) {
+ value2 += " " + sequence;
+ }
+ subexit();
+ exit3();
+ return value2;
+}
+var init_heading = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/heading.js"() {
+ init_encode_character_reference();
+ init_format_heading_as_setext();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/html.js
+function html(node2) {
+ return node2.value || "";
+}
+function htmlPeek() {
+ return "<";
+}
+var init_html = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/html.js"() {
+ html.peek = htmlPeek;
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/image.js
+function image(node2, _4, state, info) {
+ const quote = checkQuote(state);
+ const suffix = quote === '"' ? "Quote" : "Apostrophe";
+ const exit3 = state.enter("image");
+ let subexit = state.enter("label");
+ const tracker = state.createTracker(info);
+ let value2 = tracker.move("![");
+ value2 += tracker.move(
+ state.safe(node2.alt, { before: value2, after: "]", ...tracker.current() })
+ );
+ value2 += tracker.move("](");
+ subexit();
+ if (
+ // If there’s no url but there is a title…
+ !node2.url && node2.title || // If there are control characters or whitespace.
+ /[\0- \u007F]/.test(node2.url)
+ ) {
+ subexit = state.enter("destinationLiteral");
+ value2 += tracker.move("<");
+ value2 += tracker.move(
+ state.safe(node2.url, { before: value2, after: ">", ...tracker.current() })
+ );
+ value2 += tracker.move(">");
+ } else {
+ subexit = state.enter("destinationRaw");
+ value2 += tracker.move(
+ state.safe(node2.url, {
+ before: value2,
+ after: node2.title ? " " : ")",
+ ...tracker.current()
+ })
+ );
+ }
+ subexit();
+ if (node2.title) {
+ subexit = state.enter(`title${suffix}`);
+ value2 += tracker.move(" " + quote);
+ value2 += tracker.move(
+ state.safe(node2.title, {
+ before: value2,
+ after: quote,
+ ...tracker.current()
+ })
+ );
+ value2 += tracker.move(quote);
+ subexit();
+ }
+ value2 += tracker.move(")");
+ exit3();
+ return value2;
+}
+function imagePeek() {
+ return "!";
+}
+var init_image = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/image.js"() {
+ init_check_quote();
+ image.peek = imagePeek;
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/image-reference.js
+function imageReference(node2, _4, state, info) {
+ const type5 = node2.referenceType;
+ const exit3 = state.enter("imageReference");
+ let subexit = state.enter("label");
+ const tracker = state.createTracker(info);
+ let value2 = tracker.move("![");
+ const alt = state.safe(node2.alt, {
+ before: value2,
+ after: "]",
+ ...tracker.current()
+ });
+ value2 += tracker.move(alt + "][");
+ subexit();
+ const stack = state.stack;
+ state.stack = [];
+ subexit = state.enter("reference");
+ const reference = state.safe(state.associationId(node2), {
+ before: value2,
+ after: "]",
+ ...tracker.current()
+ });
+ subexit();
+ state.stack = stack;
+ exit3();
+ if (type5 === "full" || !alt || alt !== reference) {
+ value2 += tracker.move(reference + "]");
+ } else if (type5 === "shortcut") {
+ value2 = value2.slice(0, -1);
+ } else {
+ value2 += tracker.move("]");
+ }
+ return value2;
+}
+function imageReferencePeek() {
+ return "!";
+}
+var init_image_reference = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/image-reference.js"() {
+ imageReference.peek = imageReferencePeek;
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/inline-code.js
+function inlineCode(node2, _4, state) {
+ let value2 = node2.value || "";
+ let sequence = "`";
+ let index2 = -1;
+ while (new RegExp("(^|[^`])" + sequence + "([^`]|$)").test(value2)) {
+ sequence += "`";
+ }
+ if (/[^ \r\n]/.test(value2) && (/^[ \r\n]/.test(value2) && /[ \r\n]$/.test(value2) || /^`|`$/.test(value2))) {
+ value2 = " " + value2 + " ";
+ }
+ while (++index2 < state.unsafe.length) {
+ const pattern = state.unsafe[index2];
+ const expression = state.compilePattern(pattern);
+ let match2;
+ if (!pattern.atBreak) continue;
+ while (match2 = expression.exec(value2)) {
+ let position3 = match2.index;
+ if (value2.charCodeAt(position3) === 10 && value2.charCodeAt(position3 - 1) === 13) {
+ position3--;
+ }
+ value2 = value2.slice(0, position3) + " " + value2.slice(match2.index + 1);
+ }
+ }
+ return sequence + value2 + sequence;
+}
+function inlineCodePeek() {
+ return "`";
+}
+var init_inline_code = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/inline-code.js"() {
+ inlineCode.peek = inlineCodePeek;
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/format-link-as-autolink.js
+function formatLinkAsAutolink(node2, state) {
+ const raw2 = toString(node2);
+ return Boolean(
+ !state.options.resourceLink && // If there’s a url…
+ node2.url && // And there’s a no title…
+ !node2.title && // And the content of `node` is a single text node…
+ node2.children && node2.children.length === 1 && node2.children[0].type === "text" && // And if the url is the same as the content…
+ (raw2 === node2.url || "mailto:" + raw2 === node2.url) && // And that starts w/ a protocol…
+ /^[a-z][a-z+.-]+:/i.test(node2.url) && // And that doesn’t contain ASCII control codes (character escapes and
+ // references don’t work), space, or angle brackets…
+ !/[\0- <>\u007F]/.test(node2.url)
+ );
+}
+var init_format_link_as_autolink = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/format-link-as-autolink.js"() {
+ init_mdast_util_to_string();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/link.js
+function link(node2, _4, state, info) {
+ const quote = checkQuote(state);
+ const suffix = quote === '"' ? "Quote" : "Apostrophe";
+ const tracker = state.createTracker(info);
+ let exit3;
+ let subexit;
+ if (formatLinkAsAutolink(node2, state)) {
+ const stack = state.stack;
+ state.stack = [];
+ exit3 = state.enter("autolink");
+ let value3 = tracker.move("<");
+ value3 += tracker.move(
+ state.containerPhrasing(node2, {
+ before: value3,
+ after: ">",
+ ...tracker.current()
+ })
+ );
+ value3 += tracker.move(">");
+ exit3();
+ state.stack = stack;
+ return value3;
+ }
+ exit3 = state.enter("link");
+ subexit = state.enter("label");
+ let value2 = tracker.move("[");
+ value2 += tracker.move(
+ state.containerPhrasing(node2, {
+ before: value2,
+ after: "](",
+ ...tracker.current()
+ })
+ );
+ value2 += tracker.move("](");
+ subexit();
+ if (
+ // If there’s no url but there is a title…
+ !node2.url && node2.title || // If there are control characters or whitespace.
+ /[\0- \u007F]/.test(node2.url)
+ ) {
+ subexit = state.enter("destinationLiteral");
+ value2 += tracker.move("<");
+ value2 += tracker.move(
+ state.safe(node2.url, { before: value2, after: ">", ...tracker.current() })
+ );
+ value2 += tracker.move(">");
+ } else {
+ subexit = state.enter("destinationRaw");
+ value2 += tracker.move(
+ state.safe(node2.url, {
+ before: value2,
+ after: node2.title ? " " : ")",
+ ...tracker.current()
+ })
+ );
+ }
+ subexit();
+ if (node2.title) {
+ subexit = state.enter(`title${suffix}`);
+ value2 += tracker.move(" " + quote);
+ value2 += tracker.move(
+ state.safe(node2.title, {
+ before: value2,
+ after: quote,
+ ...tracker.current()
+ })
+ );
+ value2 += tracker.move(quote);
+ subexit();
+ }
+ value2 += tracker.move(")");
+ exit3();
+ return value2;
+}
+function linkPeek(node2, _4, state) {
+ return formatLinkAsAutolink(node2, state) ? "<" : "[";
+}
+var init_link = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/link.js"() {
+ init_check_quote();
+ init_format_link_as_autolink();
+ link.peek = linkPeek;
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/link-reference.js
+function linkReference(node2, _4, state, info) {
+ const type5 = node2.referenceType;
+ const exit3 = state.enter("linkReference");
+ let subexit = state.enter("label");
+ const tracker = state.createTracker(info);
+ let value2 = tracker.move("[");
+ const text9 = state.containerPhrasing(node2, {
+ before: value2,
+ after: "]",
+ ...tracker.current()
+ });
+ value2 += tracker.move(text9 + "][");
+ subexit();
+ const stack = state.stack;
+ state.stack = [];
+ subexit = state.enter("reference");
+ const reference = state.safe(state.associationId(node2), {
+ before: value2,
+ after: "]",
+ ...tracker.current()
+ });
+ subexit();
+ state.stack = stack;
+ exit3();
+ if (type5 === "full" || !text9 || text9 !== reference) {
+ value2 += tracker.move(reference + "]");
+ } else if (type5 === "shortcut") {
+ value2 = value2.slice(0, -1);
+ } else {
+ value2 += tracker.move("]");
+ }
+ return value2;
+}
+function linkReferencePeek() {
+ return "[";
+}
+var init_link_reference = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/link-reference.js"() {
+ linkReference.peek = linkReferencePeek;
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-bullet.js
+function checkBullet(state) {
+ const marker = state.options.bullet || "*";
+ if (marker !== "*" && marker !== "+" && marker !== "-") {
+ throw new Error(
+ "Cannot serialize items with `" + marker + "` for `options.bullet`, expected `*`, `+`, or `-`"
+ );
+ }
+ return marker;
+}
+var init_check_bullet = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-bullet.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-bullet-other.js
+function checkBulletOther(state) {
+ const bullet = checkBullet(state);
+ const bulletOther = state.options.bulletOther;
+ if (!bulletOther) {
+ return bullet === "*" ? "-" : "*";
+ }
+ if (bulletOther !== "*" && bulletOther !== "+" && bulletOther !== "-") {
+ throw new Error(
+ "Cannot serialize items with `" + bulletOther + "` for `options.bulletOther`, expected `*`, `+`, or `-`"
+ );
+ }
+ if (bulletOther === bullet) {
+ throw new Error(
+ "Expected `bullet` (`" + bullet + "`) and `bulletOther` (`" + bulletOther + "`) to be different"
+ );
+ }
+ return bulletOther;
+}
+var init_check_bullet_other = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-bullet-other.js"() {
+ init_check_bullet();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-bullet-ordered.js
+function checkBulletOrdered(state) {
+ const marker = state.options.bulletOrdered || ".";
+ if (marker !== "." && marker !== ")") {
+ throw new Error(
+ "Cannot serialize items with `" + marker + "` for `options.bulletOrdered`, expected `.` or `)`"
+ );
+ }
+ return marker;
+}
+var init_check_bullet_ordered = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-bullet-ordered.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-rule.js
+function checkRule(state) {
+ const marker = state.options.rule || "*";
+ if (marker !== "*" && marker !== "-" && marker !== "_") {
+ throw new Error(
+ "Cannot serialize rules with `" + marker + "` for `options.rule`, expected `*`, `-`, or `_`"
+ );
+ }
+ return marker;
+}
+var init_check_rule = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-rule.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/list.js
+function list2(node2, parent, state, info) {
+ const exit3 = state.enter("list");
+ const bulletCurrent = state.bulletCurrent;
+ let bullet = node2.ordered ? checkBulletOrdered(state) : checkBullet(state);
+ const bulletOther = node2.ordered ? bullet === "." ? ")" : "." : checkBulletOther(state);
+ let useDifferentMarker = parent && state.bulletLastUsed ? bullet === state.bulletLastUsed : false;
+ if (!node2.ordered) {
+ const firstListItem = node2.children ? node2.children[0] : void 0;
+ if (
+ // Bullet could be used as a thematic break marker:
+ (bullet === "*" || bullet === "-") && // Empty first list item:
+ firstListItem && (!firstListItem.children || !firstListItem.children[0]) && // Directly in two other list items:
+ state.stack[state.stack.length - 1] === "list" && state.stack[state.stack.length - 2] === "listItem" && state.stack[state.stack.length - 3] === "list" && state.stack[state.stack.length - 4] === "listItem" && // That are each the first child.
+ state.indexStack[state.indexStack.length - 1] === 0 && state.indexStack[state.indexStack.length - 2] === 0 && state.indexStack[state.indexStack.length - 3] === 0
+ ) {
+ useDifferentMarker = true;
+ }
+ if (checkRule(state) === bullet && firstListItem) {
+ let index2 = -1;
+ while (++index2 < node2.children.length) {
+ const item = node2.children[index2];
+ if (item && item.type === "listItem" && item.children && item.children[0] && item.children[0].type === "thematicBreak") {
+ useDifferentMarker = true;
+ break;
+ }
+ }
+ }
+ }
+ if (useDifferentMarker) {
+ bullet = bulletOther;
+ }
+ state.bulletCurrent = bullet;
+ const value2 = state.containerFlow(node2, info);
+ state.bulletLastUsed = bullet;
+ state.bulletCurrent = bulletCurrent;
+ exit3();
+ return value2;
+}
+var init_list = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/list.js"() {
+ init_check_bullet();
+ init_check_bullet_other();
+ init_check_bullet_ordered();
+ init_check_rule();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-list-item-indent.js
+function checkListItemIndent(state) {
+ const style = state.options.listItemIndent || "one";
+ if (style !== "tab" && style !== "one" && style !== "mixed") {
+ throw new Error(
+ "Cannot serialize items with `" + style + "` for `options.listItemIndent`, expected `tab`, `one`, or `mixed`"
+ );
+ }
+ return style;
+}
+var init_check_list_item_indent = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-list-item-indent.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/list-item.js
+function listItem(node2, parent, state, info) {
+ const listItemIndent = checkListItemIndent(state);
+ let bullet = state.bulletCurrent || checkBullet(state);
+ if (parent && parent.type === "list" && parent.ordered) {
+ bullet = (typeof parent.start === "number" && parent.start > -1 ? parent.start : 1) + (state.options.incrementListMarker === false ? 0 : parent.children.indexOf(node2)) + bullet;
+ }
+ let size = bullet.length + 1;
+ if (listItemIndent === "tab" || listItemIndent === "mixed" && (parent && parent.type === "list" && parent.spread || node2.spread)) {
+ size = Math.ceil(size / 4) * 4;
+ }
+ const tracker = state.createTracker(info);
+ tracker.move(bullet + " ".repeat(size - bullet.length));
+ tracker.shift(size);
+ const exit3 = state.enter("listItem");
+ const value2 = state.indentLines(
+ state.containerFlow(node2, tracker.current()),
+ map7
+ );
+ exit3();
+ return value2;
+ function map7(line, index2, blank) {
+ if (index2) {
+ return (blank ? "" : " ".repeat(size)) + line;
+ }
+ return (blank ? bullet : bullet + " ".repeat(size - bullet.length)) + line;
+ }
+}
+var init_list_item = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/list-item.js"() {
+ init_check_bullet();
+ init_check_list_item_indent();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/paragraph.js
+function paragraph(node2, _4, state, info) {
+ const exit3 = state.enter("paragraph");
+ const subexit = state.enter("phrasing");
+ const value2 = state.containerPhrasing(node2, info);
+ subexit();
+ exit3();
+ return value2;
+}
+var init_paragraph = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/paragraph.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-phrasing@4.1.0/node_modules/mdast-util-phrasing/lib/index.js
+var phrasing;
+var init_lib14 = __esm({
+ "node_modules/.pnpm/mdast-util-phrasing@4.1.0/node_modules/mdast-util-phrasing/lib/index.js"() {
+ init_unist_util_is();
+ phrasing = /** @type {(node?: unknown) => node is Exclude} */
+ convert([
+ "break",
+ "delete",
+ "emphasis",
+ // To do: next major: removed since footnotes were added to GFM.
+ "footnote",
+ "footnoteReference",
+ "image",
+ "imageReference",
+ "inlineCode",
+ // Enabled by `mdast-util-math`:
+ "inlineMath",
+ "link",
+ "linkReference",
+ // Enabled by `mdast-util-mdx`:
+ "mdxJsxTextElement",
+ // Enabled by `mdast-util-mdx`:
+ "mdxTextExpression",
+ "strong",
+ "text",
+ // Enabled by `mdast-util-directive`:
+ "textDirective"
+ ]);
+ }
+});
+
+// node_modules/.pnpm/mdast-util-phrasing@4.1.0/node_modules/mdast-util-phrasing/index.js
+var init_mdast_util_phrasing = __esm({
+ "node_modules/.pnpm/mdast-util-phrasing@4.1.0/node_modules/mdast-util-phrasing/index.js"() {
+ init_lib14();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/root.js
+function root(node2, _4, state, info) {
+ const hasPhrasing = node2.children.some(function(d5) {
+ return phrasing(d5);
+ });
+ const container = hasPhrasing ? state.containerPhrasing : state.containerFlow;
+ return container.call(state, node2, info);
+}
+var init_root = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/root.js"() {
+ init_mdast_util_phrasing();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-strong.js
+function checkStrong(state) {
+ const marker = state.options.strong || "*";
+ if (marker !== "*" && marker !== "_") {
+ throw new Error(
+ "Cannot serialize strong with `" + marker + "` for `options.strong`, expected `*`, or `_`"
+ );
+ }
+ return marker;
+}
+var init_check_strong = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-strong.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/strong.js
+function strong(node2, _4, state, info) {
+ const marker = checkStrong(state);
+ const exit3 = state.enter("strong");
+ const tracker = state.createTracker(info);
+ const before = tracker.move(marker + marker);
+ let between2 = tracker.move(
+ state.containerPhrasing(node2, {
+ after: marker,
+ before,
+ ...tracker.current()
+ })
+ );
+ const betweenHead = between2.charCodeAt(0);
+ const open = encodeInfo(
+ info.before.charCodeAt(info.before.length - 1),
+ betweenHead,
+ marker
+ );
+ if (open.inside) {
+ between2 = encodeCharacterReference(betweenHead) + between2.slice(1);
+ }
+ const betweenTail = between2.charCodeAt(between2.length - 1);
+ const close7 = encodeInfo(info.after.charCodeAt(0), betweenTail, marker);
+ if (close7.inside) {
+ between2 = between2.slice(0, -1) + encodeCharacterReference(betweenTail);
+ }
+ const after = tracker.move(marker + marker);
+ exit3();
+ state.attentionEncodeSurroundingInfo = {
+ after: close7.outside,
+ before: open.outside
+ };
+ return before + between2 + after;
+}
+function strongPeek(_4, _1, state) {
+ return state.options.strong || "*";
+}
+var init_strong = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/strong.js"() {
+ init_check_strong();
+ init_encode_character_reference();
+ init_encode_info();
+ strong.peek = strongPeek;
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/text.js
+function text(node2, _4, state, info) {
+ return state.safe(node2.value, info);
+}
+var init_text = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/text.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-rule-repetition.js
+function checkRuleRepetition(state) {
+ const repetition = state.options.ruleRepetition || 3;
+ if (repetition < 3) {
+ throw new Error(
+ "Cannot serialize rules with repetition `" + repetition + "` for `options.ruleRepetition`, expected `3` or more"
+ );
+ }
+ return repetition;
+}
+var init_check_rule_repetition = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/check-rule-repetition.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/thematic-break.js
+function thematicBreak(_4, _1, state) {
+ const value2 = (checkRule(state) + (state.options.ruleSpaces ? " " : "")).repeat(checkRuleRepetition(state));
+ return state.options.ruleSpaces ? value2.slice(0, -1) : value2;
+}
+var init_thematic_break = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/thematic-break.js"() {
+ init_check_rule_repetition();
+ init_check_rule();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/index.js
+var handle;
+var init_handle = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/handle/index.js"() {
+ init_blockquote();
+ init_break();
+ init_code();
+ init_definition();
+ init_emphasis();
+ init_heading();
+ init_html();
+ init_image();
+ init_image_reference();
+ init_inline_code();
+ init_link();
+ init_link_reference();
+ init_list();
+ init_list_item();
+ init_paragraph();
+ init_root();
+ init_strong();
+ init_text();
+ init_thematic_break();
+ handle = {
+ blockquote,
+ break: hardBreak,
+ code,
+ definition,
+ emphasis,
+ hardBreak,
+ heading,
+ html,
+ image,
+ imageReference,
+ inlineCode,
+ link,
+ linkReference,
+ list: list2,
+ listItem,
+ paragraph,
+ root,
+ strong,
+ text,
+ thematicBreak
+ };
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/join.js
+function joinDefaults(left, right, parent, state) {
+ if (right.type === "code" && formatCodeAsIndented(right, state) && (left.type === "list" || left.type === right.type && formatCodeAsIndented(left, state))) {
+ return false;
+ }
+ if ("spread" in parent && typeof parent.spread === "boolean") {
+ if (left.type === "paragraph" && // Two paragraphs.
+ (left.type === right.type || right.type === "definition" || // Paragraph followed by a setext heading.
+ right.type === "heading" && formatHeadingAsSetext(right, state))) {
+ return;
+ }
+ return parent.spread ? 1 : 0;
+ }
+}
+var join2;
+var init_join = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/join.js"() {
+ init_format_code_as_indented();
+ init_format_heading_as_setext();
+ join2 = [joinDefaults];
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/unsafe.js
+var fullPhrasingSpans, unsafe;
+var init_unsafe = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/unsafe.js"() {
+ fullPhrasingSpans = [
+ "autolink",
+ "destinationLiteral",
+ "destinationRaw",
+ "reference",
+ "titleQuote",
+ "titleApostrophe"
+ ];
+ unsafe = [
+ { character: " ", after: "[\\r\\n]", inConstruct: "phrasing" },
+ { character: " ", before: "[\\r\\n]", inConstruct: "phrasing" },
+ {
+ character: " ",
+ inConstruct: ["codeFencedLangGraveAccent", "codeFencedLangTilde"]
+ },
+ {
+ character: "\r",
+ inConstruct: [
+ "codeFencedLangGraveAccent",
+ "codeFencedLangTilde",
+ "codeFencedMetaGraveAccent",
+ "codeFencedMetaTilde",
+ "destinationLiteral",
+ "headingAtx"
+ ]
+ },
+ {
+ character: "\n",
+ inConstruct: [
+ "codeFencedLangGraveAccent",
+ "codeFencedLangTilde",
+ "codeFencedMetaGraveAccent",
+ "codeFencedMetaTilde",
+ "destinationLiteral",
+ "headingAtx"
+ ]
+ },
+ { character: " ", after: "[\\r\\n]", inConstruct: "phrasing" },
+ { character: " ", before: "[\\r\\n]", inConstruct: "phrasing" },
+ {
+ character: " ",
+ inConstruct: ["codeFencedLangGraveAccent", "codeFencedLangTilde"]
+ },
+ // An exclamation mark can start an image, if it is followed by a link or
+ // a link reference.
+ {
+ character: "!",
+ after: "\\[",
+ inConstruct: "phrasing",
+ notInConstruct: fullPhrasingSpans
+ },
+ // A quote can break out of a title.
+ { character: '"', inConstruct: "titleQuote" },
+ // A number sign could start an ATX heading if it starts a line.
+ { atBreak: true, character: "#" },
+ { character: "#", inConstruct: "headingAtx", after: "(?:[\r\n]|$)" },
+ // Dollar sign and percentage are not used in markdown.
+ // An ampersand could start a character reference.
+ { character: "&", after: "[#A-Za-z]", inConstruct: "phrasing" },
+ // An apostrophe can break out of a title.
+ { character: "'", inConstruct: "titleApostrophe" },
+ // A left paren could break out of a destination raw.
+ { character: "(", inConstruct: "destinationRaw" },
+ // A left paren followed by `]` could make something into a link or image.
+ {
+ before: "\\]",
+ character: "(",
+ inConstruct: "phrasing",
+ notInConstruct: fullPhrasingSpans
+ },
+ // A right paren could start a list item or break out of a destination
+ // raw.
+ { atBreak: true, before: "\\d+", character: ")" },
+ { character: ")", inConstruct: "destinationRaw" },
+ // An asterisk can start thematic breaks, list items, emphasis, strong.
+ { atBreak: true, character: "*", after: "(?:[ \r\n*])" },
+ { character: "*", inConstruct: "phrasing", notInConstruct: fullPhrasingSpans },
+ // A plus sign could start a list item.
+ { atBreak: true, character: "+", after: "(?:[ \r\n])" },
+ // A dash can start thematic breaks, list items, and setext heading
+ // underlines.
+ { atBreak: true, character: "-", after: "(?:[ \r\n-])" },
+ // A dot could start a list item.
+ { atBreak: true, before: "\\d+", character: ".", after: "(?:[ \r\n]|$)" },
+ // Slash, colon, and semicolon are not used in markdown for constructs.
+ // A less than can start html (flow or text) or an autolink.
+ // HTML could start with an exclamation mark (declaration, cdata, comment),
+ // slash (closing tag), question mark (instruction), or a letter (tag).
+ // An autolink also starts with a letter.
+ // Finally, it could break out of a destination literal.
+ { atBreak: true, character: "<", after: "[!/?A-Za-z]" },
+ {
+ character: "<",
+ after: "[!/?A-Za-z]",
+ inConstruct: "phrasing",
+ notInConstruct: fullPhrasingSpans
+ },
+ { character: "<", inConstruct: "destinationLiteral" },
+ // An equals to can start setext heading underlines.
+ { atBreak: true, character: "=" },
+ // A greater than can start block quotes and it can break out of a
+ // destination literal.
+ { atBreak: true, character: ">" },
+ { character: ">", inConstruct: "destinationLiteral" },
+ // Question mark and at sign are not used in markdown for constructs.
+ // A left bracket can start definitions, references, labels,
+ { atBreak: true, character: "[" },
+ { character: "[", inConstruct: "phrasing", notInConstruct: fullPhrasingSpans },
+ { character: "[", inConstruct: ["label", "reference"] },
+ // A backslash can start an escape (when followed by punctuation) or a
+ // hard break (when followed by an eol).
+ // Note: typical escapes are handled in `safe`!
+ { character: "\\", after: "[\\r\\n]", inConstruct: "phrasing" },
+ // A right bracket can exit labels.
+ { character: "]", inConstruct: ["label", "reference"] },
+ // Caret is not used in markdown for constructs.
+ // An underscore can start emphasis, strong, or a thematic break.
+ { atBreak: true, character: "_" },
+ { character: "_", inConstruct: "phrasing", notInConstruct: fullPhrasingSpans },
+ // A grave accent can start code (fenced or text), or it can break out of
+ // a grave accent code fence.
+ { atBreak: true, character: "`" },
+ {
+ character: "`",
+ inConstruct: ["codeFencedLangGraveAccent", "codeFencedMetaGraveAccent"]
+ },
+ { character: "`", inConstruct: "phrasing", notInConstruct: fullPhrasingSpans },
+ // Left brace, vertical bar, right brace are not used in markdown for
+ // constructs.
+ // A tilde can start code (fenced).
+ { atBreak: true, character: "~" }
+ ];
+ }
+});
+
+// node_modules/.pnpm/decode-named-character-reference@1.3.0/node_modules/decode-named-character-reference/index.dom.js
+function decodeNamedCharacterReference(value2) {
+ const characterReference2 = "&" + value2 + ";";
+ element.innerHTML = characterReference2;
+ const character = element.textContent;
+ if (character.charCodeAt(character.length - 1) === 59 && value2 !== "semi") {
+ return false;
+ }
+ return character === characterReference2 ? false : character;
+}
+var element;
+var init_index_dom = __esm({
+ "node_modules/.pnpm/decode-named-character-reference@1.3.0/node_modules/decode-named-character-reference/index.dom.js"() {
+ element = document.createElement("i");
+ }
+});
+
+// node_modules/.pnpm/micromark-util-decode-numeric-character-reference@2.0.2/node_modules/micromark-util-decode-numeric-character-reference/index.js
+function decodeNumericCharacterReference(value2, base) {
+ const code4 = Number.parseInt(value2, base);
+ if (
+ // C0 except for HT, LF, FF, CR, space.
+ code4 < 9 || code4 === 11 || code4 > 13 && code4 < 32 || // Control character (DEL) of C0, and C1 controls.
+ code4 > 126 && code4 < 160 || // Lone high surrogates and low surrogates.
+ code4 > 55295 && code4 < 57344 || // Noncharacters.
+ code4 > 64975 && code4 < 65008 || /* eslint-disable no-bitwise */
+ (code4 & 65535) === 65535 || (code4 & 65535) === 65534 || /* eslint-enable no-bitwise */
+ // Out of range
+ code4 > 1114111
+ ) {
+ return "\uFFFD";
+ }
+ return String.fromCodePoint(code4);
+}
+var init_micromark_util_decode_numeric_character_reference = __esm({
+ "node_modules/.pnpm/micromark-util-decode-numeric-character-reference@2.0.2/node_modules/micromark-util-decode-numeric-character-reference/index.js"() {
+ }
+});
+
+// node_modules/.pnpm/micromark-util-decode-string@2.0.1/node_modules/micromark-util-decode-string/index.js
+function decodeString(value2) {
+ return value2.replace(characterEscapeOrReference, decode);
+}
+function decode($0, $1, $22) {
+ if ($1) {
+ return $1;
+ }
+ const head2 = $22.charCodeAt(0);
+ if (head2 === 35) {
+ const head3 = $22.charCodeAt(1);
+ const hex2 = head3 === 120 || head3 === 88;
+ return decodeNumericCharacterReference($22.slice(hex2 ? 2 : 1), hex2 ? 16 : 10);
+ }
+ return decodeNamedCharacterReference($22) || $0;
+}
+var characterEscapeOrReference;
+var init_micromark_util_decode_string = __esm({
+ "node_modules/.pnpm/micromark-util-decode-string@2.0.1/node_modules/micromark-util-decode-string/index.js"() {
+ init_index_dom();
+ init_micromark_util_decode_numeric_character_reference();
+ characterEscapeOrReference = /\\([!-/:-@[-`{-~])|&(#(?:\d{1,7}|x[\da-f]{1,6})|[\da-z]{1,31});/gi;
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/association.js
+function association(node2) {
+ if (node2.label || !node2.identifier) {
+ return node2.label || "";
+ }
+ return decodeString(node2.identifier);
+}
+var init_association = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/association.js"() {
+ init_micromark_util_decode_string();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/compile-pattern.js
+function compilePattern(pattern) {
+ if (!pattern._compiled) {
+ const before = (pattern.atBreak ? "[\\r\\n][\\t ]*" : "") + (pattern.before ? "(?:" + pattern.before + ")" : "");
+ pattern._compiled = new RegExp(
+ (before ? "(" + before + ")" : "") + (/[|\\{}()[\]^$+*?.-]/.test(pattern.character) ? "\\" : "") + pattern.character + (pattern.after ? "(?:" + pattern.after + ")" : ""),
+ "g"
+ );
+ }
+ return pattern._compiled;
+}
+var init_compile_pattern = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/compile-pattern.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/container-phrasing.js
+function containerPhrasing(parent, state, info) {
+ const indexStack = state.indexStack;
+ const children2 = parent.children || [];
+ const results = [];
+ let index2 = -1;
+ let before = info.before;
+ let encodeAfter;
+ indexStack.push(-1);
+ let tracker = state.createTracker(info);
+ while (++index2 < children2.length) {
+ const child = children2[index2];
+ let after;
+ indexStack[indexStack.length - 1] = index2;
+ if (index2 + 1 < children2.length) {
+ let handle3 = state.handle.handlers[children2[index2 + 1].type];
+ if (handle3 && handle3.peek) handle3 = handle3.peek;
+ after = handle3 ? handle3(children2[index2 + 1], parent, state, {
+ before: "",
+ after: "",
+ ...tracker.current()
+ }).charAt(0) : "";
+ } else {
+ after = info.after;
+ }
+ if (results.length > 0 && (before === "\r" || before === "\n") && child.type === "html") {
+ results[results.length - 1] = results[results.length - 1].replace(
+ /(\r?\n|\r)$/,
+ " "
+ );
+ before = " ";
+ tracker = state.createTracker(info);
+ tracker.move(results.join(""));
+ }
+ let value2 = state.handle(child, parent, state, {
+ ...tracker.current(),
+ after,
+ before
+ });
+ if (encodeAfter && encodeAfter === value2.slice(0, 1)) {
+ value2 = encodeCharacterReference(encodeAfter.charCodeAt(0)) + value2.slice(1);
+ }
+ const encodingInfo = state.attentionEncodeSurroundingInfo;
+ state.attentionEncodeSurroundingInfo = void 0;
+ encodeAfter = void 0;
+ if (encodingInfo) {
+ if (results.length > 0 && encodingInfo.before && before === results[results.length - 1].slice(-1)) {
+ results[results.length - 1] = results[results.length - 1].slice(0, -1) + encodeCharacterReference(before.charCodeAt(0));
+ }
+ if (encodingInfo.after) encodeAfter = after;
+ }
+ tracker.move(value2);
+ results.push(value2);
+ before = value2.slice(-1);
+ }
+ indexStack.pop();
+ return results.join("");
+}
+var init_container_phrasing = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/container-phrasing.js"() {
+ init_encode_character_reference();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/container-flow.js
+function containerFlow(parent, state, info) {
+ const indexStack = state.indexStack;
+ const children2 = parent.children || [];
+ const tracker = state.createTracker(info);
+ const results = [];
+ let index2 = -1;
+ indexStack.push(-1);
+ while (++index2 < children2.length) {
+ const child = children2[index2];
+ indexStack[indexStack.length - 1] = index2;
+ results.push(
+ tracker.move(
+ state.handle(child, parent, state, {
+ before: "\n",
+ after: "\n",
+ ...tracker.current()
+ })
+ )
+ );
+ if (child.type !== "list") {
+ state.bulletLastUsed = void 0;
+ }
+ if (index2 < children2.length - 1) {
+ results.push(
+ tracker.move(between(child, children2[index2 + 1], parent, state))
+ );
+ }
+ }
+ indexStack.pop();
+ return results.join("");
+}
+function between(left, right, parent, state) {
+ let index2 = state.join.length;
+ while (index2--) {
+ const result = state.join[index2](left, right, parent, state);
+ if (result === true || result === 1) {
+ break;
+ }
+ if (typeof result === "number") {
+ return "\n".repeat(1 + result);
+ }
+ if (result === false) {
+ return "\n\n\n\n";
+ }
+ }
+ return "\n\n";
+}
+var init_container_flow = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/container-flow.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/indent-lines.js
+function indentLines(value2, map7) {
+ const result = [];
+ let start = 0;
+ let line = 0;
+ let match2;
+ while (match2 = eol.exec(value2)) {
+ one3(value2.slice(start, match2.index));
+ result.push(match2[0]);
+ start = match2.index + match2[0].length;
+ line++;
+ }
+ one3(value2.slice(start));
+ return result.join("");
+ function one3(value3) {
+ result.push(map7(value3, line, !value3));
+ }
+}
+var eol;
+var init_indent_lines = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/indent-lines.js"() {
+ eol = /\r?\n|\r/g;
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/safe.js
+function safe(state, input, config3) {
+ const value2 = (config3.before || "") + (input || "") + (config3.after || "");
+ const positions = [];
+ const result = [];
+ const infos = {};
+ let index2 = -1;
+ while (++index2 < state.unsafe.length) {
+ const pattern = state.unsafe[index2];
+ if (!patternInScope(state.stack, pattern)) {
+ continue;
+ }
+ const expression = state.compilePattern(pattern);
+ let match2;
+ while (match2 = expression.exec(value2)) {
+ const before = "before" in pattern || Boolean(pattern.atBreak);
+ const after = "after" in pattern;
+ const position3 = match2.index + (before ? match2[1].length : 0);
+ if (positions.includes(position3)) {
+ if (infos[position3].before && !before) {
+ infos[position3].before = false;
+ }
+ if (infos[position3].after && !after) {
+ infos[position3].after = false;
+ }
+ } else {
+ positions.push(position3);
+ infos[position3] = { before, after };
+ }
+ }
+ }
+ positions.sort(numerical);
+ let start = config3.before ? config3.before.length : 0;
+ const end3 = value2.length - (config3.after ? config3.after.length : 0);
+ index2 = -1;
+ while (++index2 < positions.length) {
+ const position3 = positions[index2];
+ if (position3 < start || position3 >= end3) {
+ continue;
+ }
+ if (position3 + 1 < end3 && positions[index2 + 1] === position3 + 1 && infos[position3].after && !infos[position3 + 1].before && !infos[position3 + 1].after || positions[index2 - 1] === position3 - 1 && infos[position3].before && !infos[position3 - 1].before && !infos[position3 - 1].after) {
+ continue;
+ }
+ if (start !== position3) {
+ result.push(escapeBackslashes(value2.slice(start, position3), "\\"));
+ }
+ start = position3;
+ if (/[!-/:-@[-`{-~]/.test(value2.charAt(position3)) && (!config3.encode || !config3.encode.includes(value2.charAt(position3)))) {
+ result.push("\\");
+ } else {
+ result.push(encodeCharacterReference(value2.charCodeAt(position3)));
+ start++;
+ }
+ }
+ result.push(escapeBackslashes(value2.slice(start, end3), config3.after));
+ return result.join("");
+}
+function numerical(a5, b5) {
+ return a5 - b5;
+}
+function escapeBackslashes(value2, after) {
+ const expression = /\\(?=[!-/:-@[-`{-~])/g;
+ const positions = [];
+ const results = [];
+ const whole = value2 + after;
+ let index2 = -1;
+ let start = 0;
+ let match2;
+ while (match2 = expression.exec(whole)) {
+ positions.push(match2.index);
+ }
+ while (++index2 < positions.length) {
+ if (start !== positions[index2]) {
+ results.push(value2.slice(start, positions[index2]));
+ }
+ results.push("\\");
+ start = positions[index2];
+ }
+ results.push(value2.slice(start));
+ return results.join("");
+}
+var init_safe = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/safe.js"() {
+ init_encode_character_reference();
+ init_pattern_in_scope();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/track.js
+function track(config3) {
+ const options = config3 || {};
+ const now2 = options.now || {};
+ let lineShift = options.lineShift || 0;
+ let line = now2.line || 1;
+ let column = now2.column || 1;
+ return { move, current, shift };
+ function current() {
+ return { now: { line, column }, lineShift };
+ }
+ function shift(value2) {
+ lineShift += value2;
+ }
+ function move(input) {
+ const value2 = input || "";
+ const chunks = value2.split(/\r?\n|\r/g);
+ const tail = chunks[chunks.length - 1];
+ line += chunks.length - 1;
+ column = chunks.length === 1 ? column + tail.length : 1 + tail.length + lineShift;
+ return value2;
+ }
+}
+var init_track = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/util/track.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/index.js
+function toMarkdown(tree, options) {
+ const settings = options || {};
+ const state = {
+ associationId: association,
+ containerPhrasing: containerPhrasingBound,
+ containerFlow: containerFlowBound,
+ createTracker: track,
+ compilePattern,
+ enter,
+ // @ts-expect-error: GFM / frontmatter are typed in `mdast` but not defined
+ // here.
+ handlers: { ...handle },
+ // @ts-expect-error: add `handle` in a second.
+ handle: void 0,
+ indentLines,
+ indexStack: [],
+ join: [...join2],
+ options: {},
+ safe: safeBound,
+ stack: [],
+ unsafe: [...unsafe]
+ };
+ configure(state, settings);
+ if (state.options.tightDefinitions) {
+ state.join.push(joinDefinition);
+ }
+ state.handle = zwitch("type", {
+ invalid,
+ unknown,
+ handlers: state.handlers
+ });
+ let result = state.handle(tree, void 0, state, {
+ before: "\n",
+ after: "\n",
+ now: { line: 1, column: 1 },
+ lineShift: 0
+ });
+ if (result && result.charCodeAt(result.length - 1) !== 10 && result.charCodeAt(result.length - 1) !== 13) {
+ result += "\n";
+ }
+ return result;
+ function enter(name) {
+ state.stack.push(name);
+ return exit3;
+ function exit3() {
+ state.stack.pop();
+ }
+ }
+}
+function invalid(value2) {
+ throw new Error("Cannot handle value `" + value2 + "`, expected node");
+}
+function unknown(value2) {
+ const node2 = (
+ /** @type {Nodes} */
+ value2
+ );
+ throw new Error("Cannot handle unknown node `" + node2.type + "`");
+}
+function joinDefinition(left, right) {
+ if (left.type === "definition" && left.type === right.type) {
+ return 0;
+ }
+}
+function containerPhrasingBound(parent, info) {
+ return containerPhrasing(parent, this, info);
+}
+function containerFlowBound(parent, info) {
+ return containerFlow(parent, this, info);
+}
+function safeBound(value2, config3) {
+ return safe(this, value2, config3);
+}
+var init_lib15 = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/lib/index.js"() {
+ init_zwitch();
+ init_configure();
+ init_handle();
+ init_join();
+ init_unsafe();
+ init_association();
+ init_compile_pattern();
+ init_container_phrasing();
+ init_container_flow();
+ init_indent_lines();
+ init_safe();
+ init_track();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/index.js
+var init_mdast_util_to_markdown = __esm({
+ "node_modules/.pnpm/mdast-util-to-markdown@2.1.2/node_modules/mdast-util-to-markdown/index.js"() {
+ init_lib15();
+ init_handle();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-gfm-table@2.0.0/node_modules/mdast-util-gfm-table/lib/index.js
+function gfmTableFromMarkdown() {
+ return {
+ enter: {
+ table: enterTable,
+ tableData: enterCell,
+ tableHeader: enterCell,
+ tableRow: enterRow
+ },
+ exit: {
+ codeText: exitCodeText,
+ table: exitTable,
+ tableData: exit,
+ tableHeader: exit,
+ tableRow: exit
+ }
+ };
+}
+function enterTable(token) {
+ const align = token._align;
+ ok(align, "expected `_align` on table");
+ this.enter(
+ {
+ type: "table",
+ align: align.map(function(d5) {
+ return d5 === "none" ? null : d5;
+ }),
+ children: []
+ },
+ token
+ );
+ this.data.inTable = true;
+}
+function exitTable(token) {
+ this.exit(token);
+ this.data.inTable = void 0;
+}
+function enterRow(token) {
+ this.enter({ type: "tableRow", children: [] }, token);
+}
+function exit(token) {
+ this.exit(token);
+}
+function enterCell(token) {
+ this.enter({ type: "tableCell", children: [] }, token);
+}
+function exitCodeText(token) {
+ let value2 = this.resume();
+ if (this.data.inTable) {
+ value2 = value2.replace(/\\([\\|])/g, replace);
+ }
+ const node2 = this.stack[this.stack.length - 1];
+ ok(node2.type === "inlineCode");
+ node2.value = value2;
+ this.exit(token);
+}
+function replace($0, $1) {
+ return $1 === "|" ? $1 : $0;
+}
+function gfmTableToMarkdown(options) {
+ const settings = options || {};
+ const padding = settings.tableCellPadding;
+ const alignDelimiters = settings.tablePipeAlign;
+ const stringLength = settings.stringLength;
+ const around = padding ? " " : "|";
+ return {
+ unsafe: [
+ { character: "\r", inConstruct: "tableCell" },
+ { character: "\n", inConstruct: "tableCell" },
+ // A pipe, when followed by a tab or space (padding), or a dash or colon
+ // (unpadded delimiter row), could result in a table.
+ { atBreak: true, character: "|", after: "[ :-]" },
+ // A pipe in a cell must be encoded.
+ { character: "|", inConstruct: "tableCell" },
+ // A colon must be followed by a dash, in which case it could start a
+ // delimiter row.
+ { atBreak: true, character: ":", after: "-" },
+ // A delimiter row can also start with a dash, when followed by more
+ // dashes, a colon, or a pipe.
+ // This is a stricter version than the built in check for lists, thematic
+ // breaks, and setex heading underlines though:
+ //
+ { atBreak: true, character: "-", after: "[:|-]" }
+ ],
+ handlers: {
+ inlineCode: inlineCodeWithTable,
+ table: handleTable,
+ tableCell: handleTableCell,
+ tableRow: handleTableRow
+ }
+ };
+ function handleTable(node2, _4, state, info) {
+ return serializeData(handleTableAsData(node2, state, info), node2.align);
+ }
+ function handleTableRow(node2, _4, state, info) {
+ const row = handleTableRowAsData(node2, state, info);
+ const value2 = serializeData([row]);
+ return value2.slice(0, value2.indexOf("\n"));
+ }
+ function handleTableCell(node2, _4, state, info) {
+ const exit3 = state.enter("tableCell");
+ const subexit = state.enter("phrasing");
+ const value2 = state.containerPhrasing(node2, {
+ ...info,
+ before: around,
+ after: around
+ });
+ subexit();
+ exit3();
+ return value2;
+ }
+ function serializeData(matrix, align) {
+ return markdownTable(matrix, {
+ align,
+ // @ts-expect-error: `markdown-table` types should support `null`.
+ alignDelimiters,
+ // @ts-expect-error: `markdown-table` types should support `null`.
+ padding,
+ // @ts-expect-error: `markdown-table` types should support `null`.
+ stringLength
+ });
+ }
+ function handleTableAsData(node2, state, info) {
+ const children2 = node2.children;
+ let index2 = -1;
+ const result = [];
+ const subexit = state.enter("table");
+ while (++index2 < children2.length) {
+ result[index2] = handleTableRowAsData(children2[index2], state, info);
+ }
+ subexit();
+ return result;
+ }
+ function handleTableRowAsData(node2, state, info) {
+ const children2 = node2.children;
+ let index2 = -1;
+ const result = [];
+ const subexit = state.enter("tableRow");
+ while (++index2 < children2.length) {
+ result[index2] = handleTableCell(children2[index2], node2, state, info);
+ }
+ subexit();
+ return result;
+ }
+ function inlineCodeWithTable(node2, parent, state) {
+ let value2 = handle.inlineCode(node2, parent, state);
+ if (state.stack.includes("tableCell")) {
+ value2 = value2.replace(/\|/g, "\\$&");
+ }
+ return value2;
+ }
+}
+var init_lib16 = __esm({
+ "node_modules/.pnpm/mdast-util-gfm-table@2.0.0/node_modules/mdast-util-gfm-table/lib/index.js"() {
+ init_default();
+ init_markdown_table();
+ init_mdast_util_to_markdown();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-gfm-table@2.0.0/node_modules/mdast-util-gfm-table/index.js
+var init_mdast_util_gfm_table = __esm({
+ "node_modules/.pnpm/mdast-util-gfm-table@2.0.0/node_modules/mdast-util-gfm-table/index.js"() {
+ init_lib16();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-gfm-task-list-item@2.0.0/node_modules/mdast-util-gfm-task-list-item/lib/index.js
+function gfmTaskListItemFromMarkdown() {
+ return {
+ exit: {
+ taskListCheckValueChecked: exitCheck,
+ taskListCheckValueUnchecked: exitCheck,
+ paragraph: exitParagraphWithTaskListItem
+ }
+ };
+}
+function gfmTaskListItemToMarkdown() {
+ return {
+ unsafe: [{ atBreak: true, character: "-", after: "[:|-]" }],
+ handlers: { listItem: listItemWithTaskListItem }
+ };
+}
+function exitCheck(token) {
+ const node2 = this.stack[this.stack.length - 2];
+ ok(node2.type === "listItem");
+ node2.checked = token.type === "taskListCheckValueChecked";
+}
+function exitParagraphWithTaskListItem(token) {
+ const parent = this.stack[this.stack.length - 2];
+ if (parent && parent.type === "listItem" && typeof parent.checked === "boolean") {
+ const node2 = this.stack[this.stack.length - 1];
+ ok(node2.type === "paragraph");
+ const head2 = node2.children[0];
+ if (head2 && head2.type === "text") {
+ const siblings2 = parent.children;
+ let index2 = -1;
+ let firstParaghraph;
+ while (++index2 < siblings2.length) {
+ const sibling = siblings2[index2];
+ if (sibling.type === "paragraph") {
+ firstParaghraph = sibling;
+ break;
+ }
+ }
+ if (firstParaghraph === node2) {
+ head2.value = head2.value.slice(1);
+ if (head2.value.length === 0) {
+ node2.children.shift();
+ } else if (node2.position && head2.position && typeof head2.position.start.offset === "number") {
+ head2.position.start.column++;
+ head2.position.start.offset++;
+ node2.position.start = Object.assign({}, head2.position.start);
+ }
+ }
+ }
+ }
+ this.exit(token);
+}
+function listItemWithTaskListItem(node2, parent, state, info) {
+ const head2 = node2.children[0];
+ const checkable = typeof node2.checked === "boolean" && head2 && head2.type === "paragraph";
+ const checkbox = "[" + (node2.checked ? "x" : " ") + "] ";
+ const tracker = state.createTracker(info);
+ if (checkable) {
+ tracker.move(checkbox);
+ }
+ let value2 = handle.listItem(node2, parent, state, {
+ ...info,
+ ...tracker.current()
+ });
+ if (checkable) {
+ value2 = value2.replace(/^(?:[*+-]|\d+\.)([\r\n]| {1,3})/, check);
+ }
+ return value2;
+ function check($0) {
+ return $0 + checkbox;
+ }
+}
+var init_lib17 = __esm({
+ "node_modules/.pnpm/mdast-util-gfm-task-list-item@2.0.0/node_modules/mdast-util-gfm-task-list-item/lib/index.js"() {
+ init_default();
+ init_mdast_util_to_markdown();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-gfm-task-list-item@2.0.0/node_modules/mdast-util-gfm-task-list-item/index.js
+var init_mdast_util_gfm_task_list_item = __esm({
+ "node_modules/.pnpm/mdast-util-gfm-task-list-item@2.0.0/node_modules/mdast-util-gfm-task-list-item/index.js"() {
+ init_lib17();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-gfm@3.1.0/node_modules/mdast-util-gfm/lib/index.js
+function gfmFromMarkdown() {
+ return [
+ gfmAutolinkLiteralFromMarkdown(),
+ gfmFootnoteFromMarkdown(),
+ gfmStrikethroughFromMarkdown(),
+ gfmTableFromMarkdown(),
+ gfmTaskListItemFromMarkdown()
+ ];
+}
+function gfmToMarkdown(options) {
+ return {
+ extensions: [
+ gfmAutolinkLiteralToMarkdown(),
+ gfmFootnoteToMarkdown(options),
+ gfmStrikethroughToMarkdown(),
+ gfmTableToMarkdown(options),
+ gfmTaskListItemToMarkdown()
+ ]
+ };
+}
+var init_lib18 = __esm({
+ "node_modules/.pnpm/mdast-util-gfm@3.1.0/node_modules/mdast-util-gfm/lib/index.js"() {
+ init_mdast_util_gfm_autolink_literal();
+ init_mdast_util_gfm_footnote();
+ init_mdast_util_gfm_strikethrough();
+ init_mdast_util_gfm_table();
+ init_mdast_util_gfm_task_list_item();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-gfm@3.1.0/node_modules/mdast-util-gfm/index.js
+var init_mdast_util_gfm = __esm({
+ "node_modules/.pnpm/mdast-util-gfm@3.1.0/node_modules/mdast-util-gfm/index.js"() {
+ init_lib18();
+ }
+});
+
+// node_modules/.pnpm/micromark-util-chunked@2.0.1/node_modules/micromark-util-chunked/index.js
+function splice(list5, start, remove2, items) {
+ const end3 = list5.length;
+ let chunkStart = 0;
+ let parameters;
+ if (start < 0) {
+ start = -start > end3 ? 0 : end3 + start;
+ } else {
+ start = start > end3 ? end3 : start;
+ }
+ remove2 = remove2 > 0 ? remove2 : 0;
+ if (items.length < 1e4) {
+ parameters = Array.from(items);
+ parameters.unshift(start, remove2);
+ list5.splice(...parameters);
+ } else {
+ if (remove2) list5.splice(start, remove2);
+ while (chunkStart < items.length) {
+ parameters = items.slice(chunkStart, chunkStart + 1e4);
+ parameters.unshift(start, 0);
+ list5.splice(...parameters);
+ chunkStart += 1e4;
+ start += 1e4;
+ }
+ }
+}
+function push(list5, items) {
+ if (list5.length > 0) {
+ splice(list5, list5.length, 0, items);
+ return list5;
+ }
+ return items;
+}
+var init_micromark_util_chunked = __esm({
+ "node_modules/.pnpm/micromark-util-chunked@2.0.1/node_modules/micromark-util-chunked/index.js"() {
+ }
+});
+
+// node_modules/.pnpm/micromark-util-combine-extensions@2.0.1/node_modules/micromark-util-combine-extensions/index.js
+function combineExtensions(extensions) {
+ const all3 = {};
+ let index2 = -1;
+ while (++index2 < extensions.length) {
+ syntaxExtension(all3, extensions[index2]);
+ }
+ return all3;
+}
+function syntaxExtension(all3, extension2) {
+ let hook;
+ for (hook in extension2) {
+ const maybe = hasOwnProperty.call(all3, hook) ? all3[hook] : void 0;
+ const left = maybe || (all3[hook] = {});
+ const right = extension2[hook];
+ let code4;
+ if (right) {
+ for (code4 in right) {
+ if (!hasOwnProperty.call(left, code4)) left[code4] = [];
+ const value2 = right[code4];
+ constructs(
+ // @ts-expect-error Looks like a list.
+ left[code4],
+ Array.isArray(value2) ? value2 : value2 ? [value2] : []
+ );
+ }
+ }
+ }
+}
+function constructs(existing, list5) {
+ let index2 = -1;
+ const before = [];
+ while (++index2 < list5.length) {
+ ;
+ (list5[index2].add === "after" ? existing : before).push(list5[index2]);
+ }
+ splice(existing, 0, 0, before);
+}
+function combineHtmlExtensions(htmlExtensions) {
+ const handlers2 = {};
+ let index2 = -1;
+ while (++index2 < htmlExtensions.length) {
+ htmlExtension(handlers2, htmlExtensions[index2]);
+ }
+ return handlers2;
+}
+function htmlExtension(all3, extension2) {
+ let hook;
+ for (hook in extension2) {
+ const maybe = hasOwnProperty.call(all3, hook) ? all3[hook] : void 0;
+ const left = maybe || (all3[hook] = {});
+ const right = extension2[hook];
+ let type5;
+ if (right) {
+ for (type5 in right) {
+ left[type5] = right[type5];
+ }
+ }
+ }
+}
+var hasOwnProperty;
+var init_micromark_util_combine_extensions = __esm({
+ "node_modules/.pnpm/micromark-util-combine-extensions@2.0.1/node_modules/micromark-util-combine-extensions/index.js"() {
+ init_micromark_util_chunked();
+ hasOwnProperty = {}.hasOwnProperty;
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-autolink-literal@2.1.0/node_modules/micromark-extension-gfm-autolink-literal/lib/syntax.js
+function gfmAutolinkLiteral() {
+ return {
+ text: text2
+ };
+}
+function tokenizeEmailAutolink(effects, ok3, nok) {
+ const self2 = this;
+ let dot;
+ let data8;
+ return start;
+ function start(code4) {
+ if (!gfmAtext(code4) || !previousEmail.call(self2, self2.previous) || previousUnbalanced(self2.events)) {
+ return nok(code4);
+ }
+ effects.enter("literalAutolink");
+ effects.enter("literalAutolinkEmail");
+ return atext(code4);
+ }
+ function atext(code4) {
+ if (gfmAtext(code4)) {
+ effects.consume(code4);
+ return atext;
+ }
+ if (code4 === 64) {
+ effects.consume(code4);
+ return emailDomain;
+ }
+ return nok(code4);
+ }
+ function emailDomain(code4) {
+ if (code4 === 46) {
+ return effects.check(emailDomainDotTrail, emailDomainAfter, emailDomainDot)(code4);
+ }
+ if (code4 === 45 || code4 === 95 || asciiAlphanumeric(code4)) {
+ data8 = true;
+ effects.consume(code4);
+ return emailDomain;
+ }
+ return emailDomainAfter(code4);
+ }
+ function emailDomainDot(code4) {
+ effects.consume(code4);
+ dot = true;
+ return emailDomain;
+ }
+ function emailDomainAfter(code4) {
+ if (data8 && dot && asciiAlpha(self2.previous)) {
+ effects.exit("literalAutolinkEmail");
+ effects.exit("literalAutolink");
+ return ok3(code4);
+ }
+ return nok(code4);
+ }
+}
+function tokenizeWwwAutolink(effects, ok3, nok) {
+ const self2 = this;
+ return wwwStart;
+ function wwwStart(code4) {
+ if (code4 !== 87 && code4 !== 119 || !previousWww.call(self2, self2.previous) || previousUnbalanced(self2.events)) {
+ return nok(code4);
+ }
+ effects.enter("literalAutolink");
+ effects.enter("literalAutolinkWww");
+ return effects.check(wwwPrefix, effects.attempt(domain, effects.attempt(path, wwwAfter), nok), nok)(code4);
+ }
+ function wwwAfter(code4) {
+ effects.exit("literalAutolinkWww");
+ effects.exit("literalAutolink");
+ return ok3(code4);
+ }
+}
+function tokenizeProtocolAutolink(effects, ok3, nok) {
+ const self2 = this;
+ let buffer2 = "";
+ let seen = false;
+ return protocolStart;
+ function protocolStart(code4) {
+ if ((code4 === 72 || code4 === 104) && previousProtocol.call(self2, self2.previous) && !previousUnbalanced(self2.events)) {
+ effects.enter("literalAutolink");
+ effects.enter("literalAutolinkHttp");
+ buffer2 += String.fromCodePoint(code4);
+ effects.consume(code4);
+ return protocolPrefixInside;
+ }
+ return nok(code4);
+ }
+ function protocolPrefixInside(code4) {
+ if (asciiAlpha(code4) && buffer2.length < 5) {
+ buffer2 += String.fromCodePoint(code4);
+ effects.consume(code4);
+ return protocolPrefixInside;
+ }
+ if (code4 === 58) {
+ const protocol = buffer2.toLowerCase();
+ if (protocol === "http" || protocol === "https") {
+ effects.consume(code4);
+ return protocolSlashesInside;
+ }
+ }
+ return nok(code4);
+ }
+ function protocolSlashesInside(code4) {
+ if (code4 === 47) {
+ effects.consume(code4);
+ if (seen) {
+ return afterProtocol;
+ }
+ seen = true;
+ return protocolSlashesInside;
+ }
+ return nok(code4);
+ }
+ function afterProtocol(code4) {
+ return code4 === null || asciiControl(code4) || markdownLineEndingOrSpace(code4) || unicodeWhitespace(code4) || unicodePunctuation(code4) ? nok(code4) : effects.attempt(domain, effects.attempt(path, protocolAfter), nok)(code4);
+ }
+ function protocolAfter(code4) {
+ effects.exit("literalAutolinkHttp");
+ effects.exit("literalAutolink");
+ return ok3(code4);
+ }
+}
+function tokenizeWwwPrefix(effects, ok3, nok) {
+ let size = 0;
+ return wwwPrefixInside;
+ function wwwPrefixInside(code4) {
+ if ((code4 === 87 || code4 === 119) && size < 3) {
+ size++;
+ effects.consume(code4);
+ return wwwPrefixInside;
+ }
+ if (code4 === 46 && size === 3) {
+ effects.consume(code4);
+ return wwwPrefixAfter;
+ }
+ return nok(code4);
+ }
+ function wwwPrefixAfter(code4) {
+ return code4 === null ? nok(code4) : ok3(code4);
+ }
+}
+function tokenizeDomain(effects, ok3, nok) {
+ let underscoreInLastSegment;
+ let underscoreInLastLastSegment;
+ let seen;
+ return domainInside;
+ function domainInside(code4) {
+ if (code4 === 46 || code4 === 95) {
+ return effects.check(trail, domainAfter, domainAtPunctuation)(code4);
+ }
+ if (code4 === null || markdownLineEndingOrSpace(code4) || unicodeWhitespace(code4) || code4 !== 45 && unicodePunctuation(code4)) {
+ return domainAfter(code4);
+ }
+ seen = true;
+ effects.consume(code4);
+ return domainInside;
+ }
+ function domainAtPunctuation(code4) {
+ if (code4 === 95) {
+ underscoreInLastSegment = true;
+ } else {
+ underscoreInLastLastSegment = underscoreInLastSegment;
+ underscoreInLastSegment = void 0;
+ }
+ effects.consume(code4);
+ return domainInside;
+ }
+ function domainAfter(code4) {
+ if (underscoreInLastLastSegment || underscoreInLastSegment || !seen) {
+ return nok(code4);
+ }
+ return ok3(code4);
+ }
+}
+function tokenizePath(effects, ok3) {
+ let sizeOpen = 0;
+ let sizeClose = 0;
+ return pathInside;
+ function pathInside(code4) {
+ if (code4 === 40) {
+ sizeOpen++;
+ effects.consume(code4);
+ return pathInside;
+ }
+ if (code4 === 41 && sizeClose < sizeOpen) {
+ return pathAtPunctuation(code4);
+ }
+ if (code4 === 33 || code4 === 34 || code4 === 38 || code4 === 39 || code4 === 41 || code4 === 42 || code4 === 44 || code4 === 46 || code4 === 58 || code4 === 59 || code4 === 60 || code4 === 63 || code4 === 93 || code4 === 95 || code4 === 126) {
+ return effects.check(trail, ok3, pathAtPunctuation)(code4);
+ }
+ if (code4 === null || markdownLineEndingOrSpace(code4) || unicodeWhitespace(code4)) {
+ return ok3(code4);
+ }
+ effects.consume(code4);
+ return pathInside;
+ }
+ function pathAtPunctuation(code4) {
+ if (code4 === 41) {
+ sizeClose++;
+ }
+ effects.consume(code4);
+ return pathInside;
+ }
+}
+function tokenizeTrail(effects, ok3, nok) {
+ return trail2;
+ function trail2(code4) {
+ if (code4 === 33 || code4 === 34 || code4 === 39 || code4 === 41 || code4 === 42 || code4 === 44 || code4 === 46 || code4 === 58 || code4 === 59 || code4 === 63 || code4 === 95 || code4 === 126) {
+ effects.consume(code4);
+ return trail2;
+ }
+ if (code4 === 38) {
+ effects.consume(code4);
+ return trailCharacterReferenceStart;
+ }
+ if (code4 === 93) {
+ effects.consume(code4);
+ return trailBracketAfter;
+ }
+ if (
+ // `<` is an end.
+ code4 === 60 || // So is whitespace.
+ code4 === null || markdownLineEndingOrSpace(code4) || unicodeWhitespace(code4)
+ ) {
+ return ok3(code4);
+ }
+ return nok(code4);
+ }
+ function trailBracketAfter(code4) {
+ if (code4 === null || code4 === 40 || code4 === 91 || markdownLineEndingOrSpace(code4) || unicodeWhitespace(code4)) {
+ return ok3(code4);
+ }
+ return trail2(code4);
+ }
+ function trailCharacterReferenceStart(code4) {
+ return asciiAlpha(code4) ? trailCharacterReferenceInside(code4) : nok(code4);
+ }
+ function trailCharacterReferenceInside(code4) {
+ if (code4 === 59) {
+ effects.consume(code4);
+ return trail2;
+ }
+ if (asciiAlpha(code4)) {
+ effects.consume(code4);
+ return trailCharacterReferenceInside;
+ }
+ return nok(code4);
+ }
+}
+function tokenizeEmailDomainDotTrail(effects, ok3, nok) {
+ return start;
+ function start(code4) {
+ effects.consume(code4);
+ return after;
+ }
+ function after(code4) {
+ return asciiAlphanumeric(code4) ? nok(code4) : ok3(code4);
+ }
+}
+function previousWww(code4) {
+ return code4 === null || code4 === 40 || code4 === 42 || code4 === 95 || code4 === 91 || code4 === 93 || code4 === 126 || markdownLineEndingOrSpace(code4);
+}
+function previousProtocol(code4) {
+ return !asciiAlpha(code4);
+}
+function previousEmail(code4) {
+ return !(code4 === 47 || gfmAtext(code4));
+}
+function gfmAtext(code4) {
+ return code4 === 43 || code4 === 45 || code4 === 46 || code4 === 95 || asciiAlphanumeric(code4);
+}
+function previousUnbalanced(events) {
+ let index2 = events.length;
+ let result = false;
+ while (index2--) {
+ const token = events[index2][1];
+ if ((token.type === "labelLink" || token.type === "labelImage") && !token._balanced) {
+ result = true;
+ break;
+ }
+ if (token._gfmAutolinkLiteralWalkedInto) {
+ result = false;
+ break;
+ }
+ }
+ if (events.length > 0 && !result) {
+ events[events.length - 1][1]._gfmAutolinkLiteralWalkedInto = true;
+ }
+ return result;
+}
+var wwwPrefix, domain, path, trail, emailDomainDotTrail, wwwAutolink, protocolAutolink, emailAutolink, text2, code2;
+var init_syntax = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-autolink-literal@2.1.0/node_modules/micromark-extension-gfm-autolink-literal/lib/syntax.js"() {
+ init_micromark_util_character();
+ wwwPrefix = {
+ tokenize: tokenizeWwwPrefix,
+ partial: true
+ };
+ domain = {
+ tokenize: tokenizeDomain,
+ partial: true
+ };
+ path = {
+ tokenize: tokenizePath,
+ partial: true
+ };
+ trail = {
+ tokenize: tokenizeTrail,
+ partial: true
+ };
+ emailDomainDotTrail = {
+ tokenize: tokenizeEmailDomainDotTrail,
+ partial: true
+ };
+ wwwAutolink = {
+ name: "wwwAutolink",
+ tokenize: tokenizeWwwAutolink,
+ previous: previousWww
+ };
+ protocolAutolink = {
+ name: "protocolAutolink",
+ tokenize: tokenizeProtocolAutolink,
+ previous: previousProtocol
+ };
+ emailAutolink = {
+ name: "emailAutolink",
+ tokenize: tokenizeEmailAutolink,
+ previous: previousEmail
+ };
+ text2 = {};
+ code2 = 48;
+ while (code2 < 123) {
+ text2[code2] = emailAutolink;
+ code2++;
+ if (code2 === 58) code2 = 65;
+ else if (code2 === 91) code2 = 97;
+ }
+ text2[43] = emailAutolink;
+ text2[45] = emailAutolink;
+ text2[46] = emailAutolink;
+ text2[95] = emailAutolink;
+ text2[72] = [emailAutolink, protocolAutolink];
+ text2[104] = [emailAutolink, protocolAutolink];
+ text2[87] = [emailAutolink, wwwAutolink];
+ text2[119] = [emailAutolink, wwwAutolink];
+ }
+});
+
+// node_modules/.pnpm/micromark-util-encode@2.0.1/node_modules/micromark-util-encode/index.js
+function encode(value2) {
+ return value2.replace(/["&<>]/g, replace5);
+ function replace5(value3) {
+ return "&" + characterReferences[
+ /** @type {keyof typeof characterReferences} */
+ value3
+ ] + ";";
+ }
+}
+var characterReferences;
+var init_micromark_util_encode = __esm({
+ "node_modules/.pnpm/micromark-util-encode@2.0.1/node_modules/micromark-util-encode/index.js"() {
+ characterReferences = { '"': "quot", "&": "amp", "<": "lt", ">": "gt" };
+ }
+});
+
+// node_modules/.pnpm/micromark-util-sanitize-uri@2.0.1/node_modules/micromark-util-sanitize-uri/index.js
+function sanitizeUri(url, protocol) {
+ const value2 = encode(normalizeUri(url || ""));
+ if (!protocol) {
+ return value2;
+ }
+ const colon = value2.indexOf(":");
+ const questionMark = value2.indexOf("?");
+ const numberSign = value2.indexOf("#");
+ const slash = value2.indexOf("/");
+ if (
+ // If there is no protocol, it’s relative.
+ colon < 0 || // If the first colon is after a `?`, `#`, or `/`, it’s not a protocol.
+ slash > -1 && colon > slash || questionMark > -1 && colon > questionMark || numberSign > -1 && colon > numberSign || // It is a protocol, it should be allowed.
+ protocol.test(value2.slice(0, colon))
+ ) {
+ return value2;
+ }
+ return "";
+}
+function normalizeUri(value2) {
+ const result = [];
+ let index2 = -1;
+ let start = 0;
+ let skip2 = 0;
+ while (++index2 < value2.length) {
+ const code4 = value2.charCodeAt(index2);
+ let replace5 = "";
+ if (code4 === 37 && asciiAlphanumeric(value2.charCodeAt(index2 + 1)) && asciiAlphanumeric(value2.charCodeAt(index2 + 2))) {
+ skip2 = 2;
+ } else if (code4 < 128) {
+ if (!/[!#$&-;=?-Z_a-z~]/.test(String.fromCharCode(code4))) {
+ replace5 = String.fromCharCode(code4);
+ }
+ } else if (code4 > 55295 && code4 < 57344) {
+ const next2 = value2.charCodeAt(index2 + 1);
+ if (code4 < 56320 && next2 > 56319 && next2 < 57344) {
+ replace5 = String.fromCharCode(code4, next2);
+ skip2 = 1;
+ } else {
+ replace5 = "\uFFFD";
+ }
+ } else {
+ replace5 = String.fromCharCode(code4);
+ }
+ if (replace5) {
+ result.push(value2.slice(start, index2), encodeURIComponent(replace5));
+ start = index2 + skip2 + 1;
+ replace5 = "";
+ }
+ if (skip2) {
+ index2 += skip2;
+ skip2 = 0;
+ }
+ }
+ return result.join("") + value2.slice(start);
+}
+var init_micromark_util_sanitize_uri = __esm({
+ "node_modules/.pnpm/micromark-util-sanitize-uri@2.0.1/node_modules/micromark-util-sanitize-uri/index.js"() {
+ init_micromark_util_character();
+ init_micromark_util_encode();
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-autolink-literal@2.1.0/node_modules/micromark-extension-gfm-autolink-literal/lib/html.js
+function gfmAutolinkLiteralHtml() {
+ return {
+ exit: {
+ literalAutolinkEmail,
+ literalAutolinkHttp,
+ literalAutolinkWww
+ }
+ };
+}
+function literalAutolinkWww(token) {
+ anchorFromToken.call(this, token, "http://");
+}
+function literalAutolinkEmail(token) {
+ anchorFromToken.call(this, token, "mailto:");
+}
+function literalAutolinkHttp(token) {
+ anchorFromToken.call(this, token);
+}
+function anchorFromToken(token, protocol) {
+ const url = this.sliceSerialize(token);
+ this.tag('');
+ this.raw(this.encode(url));
+ this.tag("");
+}
+var init_html2 = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-autolink-literal@2.1.0/node_modules/micromark-extension-gfm-autolink-literal/lib/html.js"() {
+ init_micromark_util_sanitize_uri();
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-autolink-literal@2.1.0/node_modules/micromark-extension-gfm-autolink-literal/index.js
+var init_micromark_extension_gfm_autolink_literal = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-autolink-literal@2.1.0/node_modules/micromark-extension-gfm-autolink-literal/index.js"() {
+ init_syntax();
+ init_html2();
+ }
+});
+
+// node_modules/.pnpm/micromark-util-resolve-all@2.0.1/node_modules/micromark-util-resolve-all/index.js
+function resolveAll(constructs2, events, context2) {
+ const called = [];
+ let index2 = -1;
+ while (++index2 < constructs2.length) {
+ const resolve2 = constructs2[index2].resolveAll;
+ if (resolve2 && !called.includes(resolve2)) {
+ events = resolve2(events, context2);
+ called.push(resolve2);
+ }
+ }
+ return events;
+}
+var init_micromark_util_resolve_all = __esm({
+ "node_modules/.pnpm/micromark-util-resolve-all@2.0.1/node_modules/micromark-util-resolve-all/index.js"() {
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/attention.js
+function resolveAllAttention(events, context2) {
+ let index2 = -1;
+ let open;
+ let group;
+ let text9;
+ let openingSequence;
+ let closingSequence;
+ let use;
+ let nextEvents;
+ let offset;
+ while (++index2 < events.length) {
+ if (events[index2][0] === "enter" && events[index2][1].type === "attentionSequence" && events[index2][1]._close) {
+ open = index2;
+ while (open--) {
+ if (events[open][0] === "exit" && events[open][1].type === "attentionSequence" && events[open][1]._open && // If the markers are the same:
+ context2.sliceSerialize(events[open][1]).charCodeAt(0) === context2.sliceSerialize(events[index2][1]).charCodeAt(0)) {
+ if ((events[open][1]._close || events[index2][1]._open) && (events[index2][1].end.offset - events[index2][1].start.offset) % 3 && !((events[open][1].end.offset - events[open][1].start.offset + events[index2][1].end.offset - events[index2][1].start.offset) % 3)) {
+ continue;
+ }
+ use = events[open][1].end.offset - events[open][1].start.offset > 1 && events[index2][1].end.offset - events[index2][1].start.offset > 1 ? 2 : 1;
+ const start = {
+ ...events[open][1].end
+ };
+ const end3 = {
+ ...events[index2][1].start
+ };
+ movePoint(start, -use);
+ movePoint(end3, use);
+ openingSequence = {
+ type: use > 1 ? "strongSequence" : "emphasisSequence",
+ start,
+ end: {
+ ...events[open][1].end
+ }
+ };
+ closingSequence = {
+ type: use > 1 ? "strongSequence" : "emphasisSequence",
+ start: {
+ ...events[index2][1].start
+ },
+ end: end3
+ };
+ text9 = {
+ type: use > 1 ? "strongText" : "emphasisText",
+ start: {
+ ...events[open][1].end
+ },
+ end: {
+ ...events[index2][1].start
+ }
+ };
+ group = {
+ type: use > 1 ? "strong" : "emphasis",
+ start: {
+ ...openingSequence.start
+ },
+ end: {
+ ...closingSequence.end
+ }
+ };
+ events[open][1].end = {
+ ...openingSequence.start
+ };
+ events[index2][1].start = {
+ ...closingSequence.end
+ };
+ nextEvents = [];
+ if (events[open][1].end.offset - events[open][1].start.offset) {
+ nextEvents = push(nextEvents, [["enter", events[open][1], context2], ["exit", events[open][1], context2]]);
+ }
+ nextEvents = push(nextEvents, [["enter", group, context2], ["enter", openingSequence, context2], ["exit", openingSequence, context2], ["enter", text9, context2]]);
+ nextEvents = push(nextEvents, resolveAll(context2.parser.constructs.insideSpan.null, events.slice(open + 1, index2), context2));
+ nextEvents = push(nextEvents, [["exit", text9, context2], ["enter", closingSequence, context2], ["exit", closingSequence, context2], ["exit", group, context2]]);
+ if (events[index2][1].end.offset - events[index2][1].start.offset) {
+ offset = 2;
+ nextEvents = push(nextEvents, [["enter", events[index2][1], context2], ["exit", events[index2][1], context2]]);
+ } else {
+ offset = 0;
+ }
+ splice(events, open - 1, index2 - open + 3, nextEvents);
+ index2 = open + nextEvents.length - offset - 2;
+ break;
+ }
+ }
+ }
+ }
+ index2 = -1;
+ while (++index2 < events.length) {
+ if (events[index2][1].type === "attentionSequence") {
+ events[index2][1].type = "data";
+ }
+ }
+ return events;
+}
+function tokenizeAttention(effects, ok3) {
+ const attentionMarkers2 = this.parser.constructs.attentionMarkers.null;
+ const previous3 = this.previous;
+ const before = classifyCharacter(previous3);
+ let marker;
+ return start;
+ function start(code4) {
+ marker = code4;
+ effects.enter("attentionSequence");
+ return inside(code4);
+ }
+ function inside(code4) {
+ if (code4 === marker) {
+ effects.consume(code4);
+ return inside;
+ }
+ const token = effects.exit("attentionSequence");
+ const after = classifyCharacter(code4);
+ const open = !after || after === 2 && before || attentionMarkers2.includes(code4);
+ const close7 = !before || before === 2 && after || attentionMarkers2.includes(previous3);
+ token._open = Boolean(marker === 42 ? open : open && (before || !close7));
+ token._close = Boolean(marker === 42 ? close7 : close7 && (after || !open));
+ return ok3(code4);
+ }
+}
+function movePoint(point4, offset) {
+ point4.column += offset;
+ point4.offset += offset;
+ point4._bufferIndex += offset;
+}
+var attention;
+var init_attention = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/attention.js"() {
+ init_micromark_util_chunked();
+ init_micromark_util_classify_character();
+ init_micromark_util_resolve_all();
+ attention = {
+ name: "attention",
+ resolveAll: resolveAllAttention,
+ tokenize: tokenizeAttention
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/autolink.js
+function tokenizeAutolink(effects, ok3, nok) {
+ let size = 0;
+ return start;
+ function start(code4) {
+ effects.enter("autolink");
+ effects.enter("autolinkMarker");
+ effects.consume(code4);
+ effects.exit("autolinkMarker");
+ effects.enter("autolinkProtocol");
+ return open;
+ }
+ function open(code4) {
+ if (asciiAlpha(code4)) {
+ effects.consume(code4);
+ return schemeOrEmailAtext;
+ }
+ if (code4 === 64) {
+ return nok(code4);
+ }
+ return emailAtext(code4);
+ }
+ function schemeOrEmailAtext(code4) {
+ if (code4 === 43 || code4 === 45 || code4 === 46 || asciiAlphanumeric(code4)) {
+ size = 1;
+ return schemeInsideOrEmailAtext(code4);
+ }
+ return emailAtext(code4);
+ }
+ function schemeInsideOrEmailAtext(code4) {
+ if (code4 === 58) {
+ effects.consume(code4);
+ size = 0;
+ return urlInside;
+ }
+ if ((code4 === 43 || code4 === 45 || code4 === 46 || asciiAlphanumeric(code4)) && size++ < 32) {
+ effects.consume(code4);
+ return schemeInsideOrEmailAtext;
+ }
+ size = 0;
+ return emailAtext(code4);
+ }
+ function urlInside(code4) {
+ if (code4 === 62) {
+ effects.exit("autolinkProtocol");
+ effects.enter("autolinkMarker");
+ effects.consume(code4);
+ effects.exit("autolinkMarker");
+ effects.exit("autolink");
+ return ok3;
+ }
+ if (code4 === null || code4 === 32 || code4 === 60 || asciiControl(code4)) {
+ return nok(code4);
+ }
+ effects.consume(code4);
+ return urlInside;
+ }
+ function emailAtext(code4) {
+ if (code4 === 64) {
+ effects.consume(code4);
+ return emailAtSignOrDot;
+ }
+ if (asciiAtext(code4)) {
+ effects.consume(code4);
+ return emailAtext;
+ }
+ return nok(code4);
+ }
+ function emailAtSignOrDot(code4) {
+ return asciiAlphanumeric(code4) ? emailLabel(code4) : nok(code4);
+ }
+ function emailLabel(code4) {
+ if (code4 === 46) {
+ effects.consume(code4);
+ size = 0;
+ return emailAtSignOrDot;
+ }
+ if (code4 === 62) {
+ effects.exit("autolinkProtocol").type = "autolinkEmail";
+ effects.enter("autolinkMarker");
+ effects.consume(code4);
+ effects.exit("autolinkMarker");
+ effects.exit("autolink");
+ return ok3;
+ }
+ return emailValue(code4);
+ }
+ function emailValue(code4) {
+ if ((code4 === 45 || asciiAlphanumeric(code4)) && size++ < 63) {
+ const next2 = code4 === 45 ? emailValue : emailLabel;
+ effects.consume(code4);
+ return next2;
+ }
+ return nok(code4);
+ }
+}
+var autolink;
+var init_autolink = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/autolink.js"() {
+ init_micromark_util_character();
+ autolink = {
+ name: "autolink",
+ tokenize: tokenizeAutolink
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-factory-space@2.0.1/node_modules/micromark-factory-space/index.js
+function factorySpace(effects, ok3, type5, max3) {
+ const limit = max3 ? max3 - 1 : Number.POSITIVE_INFINITY;
+ let size = 0;
+ return start;
+ function start(code4) {
+ if (markdownSpace(code4)) {
+ effects.enter(type5);
+ return prefix4(code4);
+ }
+ return ok3(code4);
+ }
+ function prefix4(code4) {
+ if (markdownSpace(code4) && size++ < limit) {
+ effects.consume(code4);
+ return prefix4;
+ }
+ effects.exit(type5);
+ return ok3(code4);
+ }
+}
+var init_micromark_factory_space = __esm({
+ "node_modules/.pnpm/micromark-factory-space@2.0.1/node_modules/micromark-factory-space/index.js"() {
+ init_micromark_util_character();
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/blank-line.js
+function tokenizeBlankLine(effects, ok3, nok) {
+ return start;
+ function start(code4) {
+ return markdownSpace(code4) ? factorySpace(effects, after, "linePrefix")(code4) : after(code4);
+ }
+ function after(code4) {
+ return code4 === null || markdownLineEnding(code4) ? ok3(code4) : nok(code4);
+ }
+}
+var blankLine;
+var init_blank_line = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/blank-line.js"() {
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ blankLine = {
+ partial: true,
+ tokenize: tokenizeBlankLine
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/block-quote.js
+function tokenizeBlockQuoteStart(effects, ok3, nok) {
+ const self2 = this;
+ return start;
+ function start(code4) {
+ if (code4 === 62) {
+ const state = self2.containerState;
+ if (!state.open) {
+ effects.enter("blockQuote", {
+ _container: true
+ });
+ state.open = true;
+ }
+ effects.enter("blockQuotePrefix");
+ effects.enter("blockQuoteMarker");
+ effects.consume(code4);
+ effects.exit("blockQuoteMarker");
+ return after;
+ }
+ return nok(code4);
+ }
+ function after(code4) {
+ if (markdownSpace(code4)) {
+ effects.enter("blockQuotePrefixWhitespace");
+ effects.consume(code4);
+ effects.exit("blockQuotePrefixWhitespace");
+ effects.exit("blockQuotePrefix");
+ return ok3;
+ }
+ effects.exit("blockQuotePrefix");
+ return ok3(code4);
+ }
+}
+function tokenizeBlockQuoteContinuation(effects, ok3, nok) {
+ const self2 = this;
+ return contStart;
+ function contStart(code4) {
+ if (markdownSpace(code4)) {
+ return factorySpace(effects, contBefore, "linePrefix", self2.parser.constructs.disable.null.includes("codeIndented") ? void 0 : 4)(code4);
+ }
+ return contBefore(code4);
+ }
+ function contBefore(code4) {
+ return effects.attempt(blockQuote, ok3, nok)(code4);
+ }
+}
+function exit2(effects) {
+ effects.exit("blockQuote");
+}
+var blockQuote;
+var init_block_quote = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/block-quote.js"() {
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ blockQuote = {
+ continuation: {
+ tokenize: tokenizeBlockQuoteContinuation
+ },
+ exit: exit2,
+ name: "blockQuote",
+ tokenize: tokenizeBlockQuoteStart
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/character-escape.js
+function tokenizeCharacterEscape(effects, ok3, nok) {
+ return start;
+ function start(code4) {
+ effects.enter("characterEscape");
+ effects.enter("escapeMarker");
+ effects.consume(code4);
+ effects.exit("escapeMarker");
+ return inside;
+ }
+ function inside(code4) {
+ if (asciiPunctuation(code4)) {
+ effects.enter("characterEscapeValue");
+ effects.consume(code4);
+ effects.exit("characterEscapeValue");
+ effects.exit("characterEscape");
+ return ok3;
+ }
+ return nok(code4);
+ }
+}
+var characterEscape;
+var init_character_escape = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/character-escape.js"() {
+ init_micromark_util_character();
+ characterEscape = {
+ name: "characterEscape",
+ tokenize: tokenizeCharacterEscape
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/character-reference.js
+function tokenizeCharacterReference(effects, ok3, nok) {
+ const self2 = this;
+ let size = 0;
+ let max3;
+ let test;
+ return start;
+ function start(code4) {
+ effects.enter("characterReference");
+ effects.enter("characterReferenceMarker");
+ effects.consume(code4);
+ effects.exit("characterReferenceMarker");
+ return open;
+ }
+ function open(code4) {
+ if (code4 === 35) {
+ effects.enter("characterReferenceMarkerNumeric");
+ effects.consume(code4);
+ effects.exit("characterReferenceMarkerNumeric");
+ return numeric;
+ }
+ effects.enter("characterReferenceValue");
+ max3 = 31;
+ test = asciiAlphanumeric;
+ return value2(code4);
+ }
+ function numeric(code4) {
+ if (code4 === 88 || code4 === 120) {
+ effects.enter("characterReferenceMarkerHexadecimal");
+ effects.consume(code4);
+ effects.exit("characterReferenceMarkerHexadecimal");
+ effects.enter("characterReferenceValue");
+ max3 = 6;
+ test = asciiHexDigit;
+ return value2;
+ }
+ effects.enter("characterReferenceValue");
+ max3 = 7;
+ test = asciiDigit;
+ return value2(code4);
+ }
+ function value2(code4) {
+ if (code4 === 59 && size) {
+ const token = effects.exit("characterReferenceValue");
+ if (test === asciiAlphanumeric && !decodeNamedCharacterReference(self2.sliceSerialize(token))) {
+ return nok(code4);
+ }
+ effects.enter("characterReferenceMarker");
+ effects.consume(code4);
+ effects.exit("characterReferenceMarker");
+ effects.exit("characterReference");
+ return ok3;
+ }
+ if (test(code4) && size++ < max3) {
+ effects.consume(code4);
+ return value2;
+ }
+ return nok(code4);
+ }
+}
+var characterReference;
+var init_character_reference = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/character-reference.js"() {
+ init_index_dom();
+ init_micromark_util_character();
+ characterReference = {
+ name: "characterReference",
+ tokenize: tokenizeCharacterReference
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/code-fenced.js
+function tokenizeCodeFenced(effects, ok3, nok) {
+ const self2 = this;
+ const closeStart = {
+ partial: true,
+ tokenize: tokenizeCloseStart
+ };
+ let initialPrefix = 0;
+ let sizeOpen = 0;
+ let marker;
+ return start;
+ function start(code4) {
+ return beforeSequenceOpen(code4);
+ }
+ function beforeSequenceOpen(code4) {
+ const tail = self2.events[self2.events.length - 1];
+ initialPrefix = tail && tail[1].type === "linePrefix" ? tail[2].sliceSerialize(tail[1], true).length : 0;
+ marker = code4;
+ effects.enter("codeFenced");
+ effects.enter("codeFencedFence");
+ effects.enter("codeFencedFenceSequence");
+ return sequenceOpen(code4);
+ }
+ function sequenceOpen(code4) {
+ if (code4 === marker) {
+ sizeOpen++;
+ effects.consume(code4);
+ return sequenceOpen;
+ }
+ if (sizeOpen < 3) {
+ return nok(code4);
+ }
+ effects.exit("codeFencedFenceSequence");
+ return markdownSpace(code4) ? factorySpace(effects, infoBefore, "whitespace")(code4) : infoBefore(code4);
+ }
+ function infoBefore(code4) {
+ if (code4 === null || markdownLineEnding(code4)) {
+ effects.exit("codeFencedFence");
+ return self2.interrupt ? ok3(code4) : effects.check(nonLazyContinuation, atNonLazyBreak, after)(code4);
+ }
+ effects.enter("codeFencedFenceInfo");
+ effects.enter("chunkString", {
+ contentType: "string"
+ });
+ return info(code4);
+ }
+ function info(code4) {
+ if (code4 === null || markdownLineEnding(code4)) {
+ effects.exit("chunkString");
+ effects.exit("codeFencedFenceInfo");
+ return infoBefore(code4);
+ }
+ if (markdownSpace(code4)) {
+ effects.exit("chunkString");
+ effects.exit("codeFencedFenceInfo");
+ return factorySpace(effects, metaBefore, "whitespace")(code4);
+ }
+ if (code4 === 96 && code4 === marker) {
+ return nok(code4);
+ }
+ effects.consume(code4);
+ return info;
+ }
+ function metaBefore(code4) {
+ if (code4 === null || markdownLineEnding(code4)) {
+ return infoBefore(code4);
+ }
+ effects.enter("codeFencedFenceMeta");
+ effects.enter("chunkString", {
+ contentType: "string"
+ });
+ return meta(code4);
+ }
+ function meta(code4) {
+ if (code4 === null || markdownLineEnding(code4)) {
+ effects.exit("chunkString");
+ effects.exit("codeFencedFenceMeta");
+ return infoBefore(code4);
+ }
+ if (code4 === 96 && code4 === marker) {
+ return nok(code4);
+ }
+ effects.consume(code4);
+ return meta;
+ }
+ function atNonLazyBreak(code4) {
+ return effects.attempt(closeStart, after, contentBefore)(code4);
+ }
+ function contentBefore(code4) {
+ effects.enter("lineEnding");
+ effects.consume(code4);
+ effects.exit("lineEnding");
+ return contentStart;
+ }
+ function contentStart(code4) {
+ return initialPrefix > 0 && markdownSpace(code4) ? factorySpace(effects, beforeContentChunk, "linePrefix", initialPrefix + 1)(code4) : beforeContentChunk(code4);
+ }
+ function beforeContentChunk(code4) {
+ if (code4 === null || markdownLineEnding(code4)) {
+ return effects.check(nonLazyContinuation, atNonLazyBreak, after)(code4);
+ }
+ effects.enter("codeFlowValue");
+ return contentChunk(code4);
+ }
+ function contentChunk(code4) {
+ if (code4 === null || markdownLineEnding(code4)) {
+ effects.exit("codeFlowValue");
+ return beforeContentChunk(code4);
+ }
+ effects.consume(code4);
+ return contentChunk;
+ }
+ function after(code4) {
+ effects.exit("codeFenced");
+ return ok3(code4);
+ }
+ function tokenizeCloseStart(effects2, ok4, nok2) {
+ let size = 0;
+ return startBefore;
+ function startBefore(code4) {
+ effects2.enter("lineEnding");
+ effects2.consume(code4);
+ effects2.exit("lineEnding");
+ return start2;
+ }
+ function start2(code4) {
+ effects2.enter("codeFencedFence");
+ return markdownSpace(code4) ? factorySpace(effects2, beforeSequenceClose, "linePrefix", self2.parser.constructs.disable.null.includes("codeIndented") ? void 0 : 4)(code4) : beforeSequenceClose(code4);
+ }
+ function beforeSequenceClose(code4) {
+ if (code4 === marker) {
+ effects2.enter("codeFencedFenceSequence");
+ return sequenceClose(code4);
+ }
+ return nok2(code4);
+ }
+ function sequenceClose(code4) {
+ if (code4 === marker) {
+ size++;
+ effects2.consume(code4);
+ return sequenceClose;
+ }
+ if (size >= sizeOpen) {
+ effects2.exit("codeFencedFenceSequence");
+ return markdownSpace(code4) ? factorySpace(effects2, sequenceCloseAfter, "whitespace")(code4) : sequenceCloseAfter(code4);
+ }
+ return nok2(code4);
+ }
+ function sequenceCloseAfter(code4) {
+ if (code4 === null || markdownLineEnding(code4)) {
+ effects2.exit("codeFencedFence");
+ return ok4(code4);
+ }
+ return nok2(code4);
+ }
+ }
+}
+function tokenizeNonLazyContinuation(effects, ok3, nok) {
+ const self2 = this;
+ return start;
+ function start(code4) {
+ if (code4 === null) {
+ return nok(code4);
+ }
+ effects.enter("lineEnding");
+ effects.consume(code4);
+ effects.exit("lineEnding");
+ return lineStart;
+ }
+ function lineStart(code4) {
+ return self2.parser.lazy[self2.now().line] ? nok(code4) : ok3(code4);
+ }
+}
+var nonLazyContinuation, codeFenced;
+var init_code_fenced = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/code-fenced.js"() {
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ nonLazyContinuation = {
+ partial: true,
+ tokenize: tokenizeNonLazyContinuation
+ };
+ codeFenced = {
+ concrete: true,
+ name: "codeFenced",
+ tokenize: tokenizeCodeFenced
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/code-indented.js
+function tokenizeCodeIndented(effects, ok3, nok) {
+ const self2 = this;
+ return start;
+ function start(code4) {
+ effects.enter("codeIndented");
+ return factorySpace(effects, afterPrefix, "linePrefix", 4 + 1)(code4);
+ }
+ function afterPrefix(code4) {
+ const tail = self2.events[self2.events.length - 1];
+ return tail && tail[1].type === "linePrefix" && tail[2].sliceSerialize(tail[1], true).length >= 4 ? atBreak(code4) : nok(code4);
+ }
+ function atBreak(code4) {
+ if (code4 === null) {
+ return after(code4);
+ }
+ if (markdownLineEnding(code4)) {
+ return effects.attempt(furtherStart, atBreak, after)(code4);
+ }
+ effects.enter("codeFlowValue");
+ return inside(code4);
+ }
+ function inside(code4) {
+ if (code4 === null || markdownLineEnding(code4)) {
+ effects.exit("codeFlowValue");
+ return atBreak(code4);
+ }
+ effects.consume(code4);
+ return inside;
+ }
+ function after(code4) {
+ effects.exit("codeIndented");
+ return ok3(code4);
+ }
+}
+function tokenizeFurtherStart(effects, ok3, nok) {
+ const self2 = this;
+ return furtherStart2;
+ function furtherStart2(code4) {
+ if (self2.parser.lazy[self2.now().line]) {
+ return nok(code4);
+ }
+ if (markdownLineEnding(code4)) {
+ effects.enter("lineEnding");
+ effects.consume(code4);
+ effects.exit("lineEnding");
+ return furtherStart2;
+ }
+ return factorySpace(effects, afterPrefix, "linePrefix", 4 + 1)(code4);
+ }
+ function afterPrefix(code4) {
+ const tail = self2.events[self2.events.length - 1];
+ return tail && tail[1].type === "linePrefix" && tail[2].sliceSerialize(tail[1], true).length >= 4 ? ok3(code4) : markdownLineEnding(code4) ? furtherStart2(code4) : nok(code4);
+ }
+}
+var codeIndented, furtherStart;
+var init_code_indented = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/code-indented.js"() {
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ codeIndented = {
+ name: "codeIndented",
+ tokenize: tokenizeCodeIndented
+ };
+ furtherStart = {
+ partial: true,
+ tokenize: tokenizeFurtherStart
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/code-text.js
+function resolveCodeText(events) {
+ let tailExitIndex = events.length - 4;
+ let headEnterIndex = 3;
+ let index2;
+ let enter;
+ if ((events[headEnterIndex][1].type === "lineEnding" || events[headEnterIndex][1].type === "space") && (events[tailExitIndex][1].type === "lineEnding" || events[tailExitIndex][1].type === "space")) {
+ index2 = headEnterIndex;
+ while (++index2 < tailExitIndex) {
+ if (events[index2][1].type === "codeTextData") {
+ events[headEnterIndex][1].type = "codeTextPadding";
+ events[tailExitIndex][1].type = "codeTextPadding";
+ headEnterIndex += 2;
+ tailExitIndex -= 2;
+ break;
+ }
+ }
+ }
+ index2 = headEnterIndex - 1;
+ tailExitIndex++;
+ while (++index2 <= tailExitIndex) {
+ if (enter === void 0) {
+ if (index2 !== tailExitIndex && events[index2][1].type !== "lineEnding") {
+ enter = index2;
+ }
+ } else if (index2 === tailExitIndex || events[index2][1].type === "lineEnding") {
+ events[enter][1].type = "codeTextData";
+ if (index2 !== enter + 2) {
+ events[enter][1].end = events[index2 - 1][1].end;
+ events.splice(enter + 2, index2 - enter - 2);
+ tailExitIndex -= index2 - enter - 2;
+ index2 = enter + 2;
+ }
+ enter = void 0;
+ }
+ }
+ return events;
+}
+function previous2(code4) {
+ return code4 !== 96 || this.events[this.events.length - 1][1].type === "characterEscape";
+}
+function tokenizeCodeText(effects, ok3, nok) {
+ const self2 = this;
+ let sizeOpen = 0;
+ let size;
+ let token;
+ return start;
+ function start(code4) {
+ effects.enter("codeText");
+ effects.enter("codeTextSequence");
+ return sequenceOpen(code4);
+ }
+ function sequenceOpen(code4) {
+ if (code4 === 96) {
+ effects.consume(code4);
+ sizeOpen++;
+ return sequenceOpen;
+ }
+ effects.exit("codeTextSequence");
+ return between2(code4);
+ }
+ function between2(code4) {
+ if (code4 === null) {
+ return nok(code4);
+ }
+ if (code4 === 32) {
+ effects.enter("space");
+ effects.consume(code4);
+ effects.exit("space");
+ return between2;
+ }
+ if (code4 === 96) {
+ token = effects.enter("codeTextSequence");
+ size = 0;
+ return sequenceClose(code4);
+ }
+ if (markdownLineEnding(code4)) {
+ effects.enter("lineEnding");
+ effects.consume(code4);
+ effects.exit("lineEnding");
+ return between2;
+ }
+ effects.enter("codeTextData");
+ return data8(code4);
+ }
+ function data8(code4) {
+ if (code4 === null || code4 === 32 || code4 === 96 || markdownLineEnding(code4)) {
+ effects.exit("codeTextData");
+ return between2(code4);
+ }
+ effects.consume(code4);
+ return data8;
+ }
+ function sequenceClose(code4) {
+ if (code4 === 96) {
+ effects.consume(code4);
+ size++;
+ return sequenceClose;
+ }
+ if (size === sizeOpen) {
+ effects.exit("codeTextSequence");
+ effects.exit("codeText");
+ return ok3(code4);
+ }
+ token.type = "codeTextData";
+ return data8(code4);
+ }
+}
+var codeText;
+var init_code_text = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/code-text.js"() {
+ init_micromark_util_character();
+ codeText = {
+ name: "codeText",
+ previous: previous2,
+ resolve: resolveCodeText,
+ tokenize: tokenizeCodeText
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-util-subtokenize@2.1.0/node_modules/micromark-util-subtokenize/lib/splice-buffer.js
+function chunkedPush(list5, right) {
+ let chunkStart = 0;
+ if (right.length < 1e4) {
+ list5.push(...right);
+ } else {
+ while (chunkStart < right.length) {
+ list5.push(...right.slice(chunkStart, chunkStart + 1e4));
+ chunkStart += 1e4;
+ }
+ }
+}
+var SpliceBuffer;
+var init_splice_buffer = __esm({
+ "node_modules/.pnpm/micromark-util-subtokenize@2.1.0/node_modules/micromark-util-subtokenize/lib/splice-buffer.js"() {
+ SpliceBuffer = class {
+ /**
+ * @param {ReadonlyArray | null | undefined} [initial]
+ * Initial items (optional).
+ * @returns
+ * Splice buffer.
+ */
+ constructor(initial2) {
+ this.left = initial2 ? [...initial2] : [];
+ this.right = [];
+ }
+ /**
+ * Array access;
+ * does not move the cursor.
+ *
+ * @param {number} index
+ * Index.
+ * @return {T}
+ * Item.
+ */
+ get(index2) {
+ if (index2 < 0 || index2 >= this.left.length + this.right.length) {
+ throw new RangeError("Cannot access index `" + index2 + "` in a splice buffer of size `" + (this.left.length + this.right.length) + "`");
+ }
+ if (index2 < this.left.length) return this.left[index2];
+ return this.right[this.right.length - index2 + this.left.length - 1];
+ }
+ /**
+ * The length of the splice buffer, one greater than the largest index in the
+ * array.
+ */
+ get length() {
+ return this.left.length + this.right.length;
+ }
+ /**
+ * Remove and return `list[0]`;
+ * moves the cursor to `0`.
+ *
+ * @returns {T | undefined}
+ * Item, optional.
+ */
+ shift() {
+ this.setCursor(0);
+ return this.right.pop();
+ }
+ /**
+ * Slice the buffer to get an array;
+ * does not move the cursor.
+ *
+ * @param {number} start
+ * Start.
+ * @param {number | null | undefined} [end]
+ * End (optional).
+ * @returns {Array}
+ * Array of items.
+ */
+ slice(start, end3) {
+ const stop = end3 === null || end3 === void 0 ? Number.POSITIVE_INFINITY : end3;
+ if (stop < this.left.length) {
+ return this.left.slice(start, stop);
+ }
+ if (start > this.left.length) {
+ return this.right.slice(this.right.length - stop + this.left.length, this.right.length - start + this.left.length).reverse();
+ }
+ return this.left.slice(start).concat(this.right.slice(this.right.length - stop + this.left.length).reverse());
+ }
+ /**
+ * Mimics the behavior of Array.prototype.splice() except for the change of
+ * interface necessary to avoid segfaults when patching in very large arrays.
+ *
+ * This operation moves cursor is moved to `start` and results in the cursor
+ * placed after any inserted items.
+ *
+ * @param {number} start
+ * Start;
+ * zero-based index at which to start changing the array;
+ * negative numbers count backwards from the end of the array and values
+ * that are out-of bounds are clamped to the appropriate end of the array.
+ * @param {number | null | undefined} [deleteCount=0]
+ * Delete count (default: `0`);
+ * maximum number of elements to delete, starting from start.
+ * @param {Array | null | undefined} [items=[]]
+ * Items to include in place of the deleted items (default: `[]`).
+ * @return {Array}
+ * Any removed items.
+ */
+ splice(start, deleteCount, items) {
+ const count2 = deleteCount || 0;
+ this.setCursor(Math.trunc(start));
+ const removed = this.right.splice(this.right.length - count2, Number.POSITIVE_INFINITY);
+ if (items) chunkedPush(this.left, items);
+ return removed.reverse();
+ }
+ /**
+ * Remove and return the highest-numbered item in the array, so
+ * `list[list.length - 1]`;
+ * Moves the cursor to `length`.
+ *
+ * @returns {T | undefined}
+ * Item, optional.
+ */
+ pop() {
+ this.setCursor(Number.POSITIVE_INFINITY);
+ return this.left.pop();
+ }
+ /**
+ * Inserts a single item to the high-numbered side of the array;
+ * moves the cursor to `length`.
+ *
+ * @param {T} item
+ * Item.
+ * @returns {undefined}
+ * Nothing.
+ */
+ push(item) {
+ this.setCursor(Number.POSITIVE_INFINITY);
+ this.left.push(item);
+ }
+ /**
+ * Inserts many items to the high-numbered side of the array.
+ * Moves the cursor to `length`.
+ *
+ * @param {Array} items
+ * Items.
+ * @returns {undefined}
+ * Nothing.
+ */
+ pushMany(items) {
+ this.setCursor(Number.POSITIVE_INFINITY);
+ chunkedPush(this.left, items);
+ }
+ /**
+ * Inserts a single item to the low-numbered side of the array;
+ * Moves the cursor to `0`.
+ *
+ * @param {T} item
+ * Item.
+ * @returns {undefined}
+ * Nothing.
+ */
+ unshift(item) {
+ this.setCursor(0);
+ this.right.push(item);
+ }
+ /**
+ * Inserts many items to the low-numbered side of the array;
+ * moves the cursor to `0`.
+ *
+ * @param {Array} items
+ * Items.
+ * @returns {undefined}
+ * Nothing.
+ */
+ unshiftMany(items) {
+ this.setCursor(0);
+ chunkedPush(this.right, items.reverse());
+ }
+ /**
+ * Move the cursor to a specific position in the array. Requires
+ * time proportional to the distance moved.
+ *
+ * If `n < 0`, the cursor will end up at the beginning.
+ * If `n > length`, the cursor will end up at the end.
+ *
+ * @param {number} n
+ * Position.
+ * @return {undefined}
+ * Nothing.
+ */
+ setCursor(n12) {
+ if (n12 === this.left.length || n12 > this.left.length && this.right.length === 0 || n12 < 0 && this.left.length === 0) return;
+ if (n12 < this.left.length) {
+ const removed = this.left.splice(n12, Number.POSITIVE_INFINITY);
+ chunkedPush(this.right, removed.reverse());
+ } else {
+ const removed = this.right.splice(this.left.length + this.right.length - n12, Number.POSITIVE_INFINITY);
+ chunkedPush(this.left, removed.reverse());
+ }
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-util-subtokenize@2.1.0/node_modules/micromark-util-subtokenize/index.js
+function subtokenize(eventsArray) {
+ const jumps = {};
+ let index2 = -1;
+ let event;
+ let lineIndex;
+ let otherIndex;
+ let otherEvent;
+ let parameters;
+ let subevents;
+ let more;
+ const events = new SpliceBuffer(eventsArray);
+ while (++index2 < events.length) {
+ while (index2 in jumps) {
+ index2 = jumps[index2];
+ }
+ event = events.get(index2);
+ if (index2 && event[1].type === "chunkFlow" && events.get(index2 - 1)[1].type === "listItemPrefix") {
+ subevents = event[1]._tokenizer.events;
+ otherIndex = 0;
+ if (otherIndex < subevents.length && subevents[otherIndex][1].type === "lineEndingBlank") {
+ otherIndex += 2;
+ }
+ if (otherIndex < subevents.length && subevents[otherIndex][1].type === "content") {
+ while (++otherIndex < subevents.length) {
+ if (subevents[otherIndex][1].type === "content") {
+ break;
+ }
+ if (subevents[otherIndex][1].type === "chunkText") {
+ subevents[otherIndex][1]._isInFirstContentOfListItem = true;
+ otherIndex++;
+ }
+ }
+ }
+ }
+ if (event[0] === "enter") {
+ if (event[1].contentType) {
+ Object.assign(jumps, subcontent(events, index2));
+ index2 = jumps[index2];
+ more = true;
+ }
+ } else if (event[1]._container) {
+ otherIndex = index2;
+ lineIndex = void 0;
+ while (otherIndex--) {
+ otherEvent = events.get(otherIndex);
+ if (otherEvent[1].type === "lineEnding" || otherEvent[1].type === "lineEndingBlank") {
+ if (otherEvent[0] === "enter") {
+ if (lineIndex) {
+ events.get(lineIndex)[1].type = "lineEndingBlank";
+ }
+ otherEvent[1].type = "lineEnding";
+ lineIndex = otherIndex;
+ }
+ } else if (otherEvent[1].type === "linePrefix" || otherEvent[1].type === "listItemIndent") {
+ } else {
+ break;
+ }
+ }
+ if (lineIndex) {
+ event[1].end = {
+ ...events.get(lineIndex)[1].start
+ };
+ parameters = events.slice(lineIndex, index2);
+ parameters.unshift(event);
+ events.splice(lineIndex, index2 - lineIndex + 1, parameters);
+ }
+ }
+ }
+ splice(eventsArray, 0, Number.POSITIVE_INFINITY, events.slice(0));
+ return !more;
+}
+function subcontent(events, eventIndex) {
+ const token = events.get(eventIndex)[1];
+ const context2 = events.get(eventIndex)[2];
+ let startPosition = eventIndex - 1;
+ const startPositions = [];
+ let tokenizer = token._tokenizer;
+ if (!tokenizer) {
+ tokenizer = context2.parser[token.contentType](token.start);
+ if (token._contentTypeTextTrailing) {
+ tokenizer._contentTypeTextTrailing = true;
+ }
+ }
+ const childEvents = tokenizer.events;
+ const jumps = [];
+ const gaps = {};
+ let stream;
+ let previous3;
+ let index2 = -1;
+ let current = token;
+ let adjust = 0;
+ let start = 0;
+ const breaks = [start];
+ while (current) {
+ while (events.get(++startPosition)[1] !== current) {
+ }
+ startPositions.push(startPosition);
+ if (!current._tokenizer) {
+ stream = context2.sliceStream(current);
+ if (!current.next) {
+ stream.push(null);
+ }
+ if (previous3) {
+ tokenizer.defineSkip(current.start);
+ }
+ if (current._isInFirstContentOfListItem) {
+ tokenizer._gfmTasklistFirstContentOfListItem = true;
+ }
+ tokenizer.write(stream);
+ if (current._isInFirstContentOfListItem) {
+ tokenizer._gfmTasklistFirstContentOfListItem = void 0;
+ }
+ }
+ previous3 = current;
+ current = current.next;
+ }
+ current = token;
+ while (++index2 < childEvents.length) {
+ if (
+ // Find a void token that includes a break.
+ childEvents[index2][0] === "exit" && childEvents[index2 - 1][0] === "enter" && childEvents[index2][1].type === childEvents[index2 - 1][1].type && childEvents[index2][1].start.line !== childEvents[index2][1].end.line
+ ) {
+ start = index2 + 1;
+ breaks.push(start);
+ current._tokenizer = void 0;
+ current.previous = void 0;
+ current = current.next;
+ }
+ }
+ tokenizer.events = [];
+ if (current) {
+ current._tokenizer = void 0;
+ current.previous = void 0;
+ } else {
+ breaks.pop();
+ }
+ index2 = breaks.length;
+ while (index2--) {
+ const slice = childEvents.slice(breaks[index2], breaks[index2 + 1]);
+ const start2 = startPositions.pop();
+ jumps.push([start2, start2 + slice.length - 1]);
+ events.splice(start2, 2, slice);
+ }
+ jumps.reverse();
+ index2 = -1;
+ while (++index2 < jumps.length) {
+ gaps[adjust + jumps[index2][0]] = adjust + jumps[index2][1];
+ adjust += jumps[index2][1] - jumps[index2][0] - 1;
+ }
+ return gaps;
+}
+var init_micromark_util_subtokenize = __esm({
+ "node_modules/.pnpm/micromark-util-subtokenize@2.1.0/node_modules/micromark-util-subtokenize/index.js"() {
+ init_micromark_util_chunked();
+ init_splice_buffer();
+ init_splice_buffer();
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/content.js
+function resolveContent(events) {
+ subtokenize(events);
+ return events;
+}
+function tokenizeContent(effects, ok3) {
+ let previous3;
+ return chunkStart;
+ function chunkStart(code4) {
+ effects.enter("content");
+ previous3 = effects.enter("chunkContent", {
+ contentType: "content"
+ });
+ return chunkInside(code4);
+ }
+ function chunkInside(code4) {
+ if (code4 === null) {
+ return contentEnd(code4);
+ }
+ if (markdownLineEnding(code4)) {
+ return effects.check(continuationConstruct, contentContinue, contentEnd)(code4);
+ }
+ effects.consume(code4);
+ return chunkInside;
+ }
+ function contentEnd(code4) {
+ effects.exit("chunkContent");
+ effects.exit("content");
+ return ok3(code4);
+ }
+ function contentContinue(code4) {
+ effects.consume(code4);
+ effects.exit("chunkContent");
+ previous3.next = effects.enter("chunkContent", {
+ contentType: "content",
+ previous: previous3
+ });
+ previous3 = previous3.next;
+ return chunkInside;
+ }
+}
+function tokenizeContinuation(effects, ok3, nok) {
+ const self2 = this;
+ return startLookahead;
+ function startLookahead(code4) {
+ effects.exit("chunkContent");
+ effects.enter("lineEnding");
+ effects.consume(code4);
+ effects.exit("lineEnding");
+ return factorySpace(effects, prefixed, "linePrefix");
+ }
+ function prefixed(code4) {
+ if (code4 === null || markdownLineEnding(code4)) {
+ return nok(code4);
+ }
+ const tail = self2.events[self2.events.length - 1];
+ if (!self2.parser.constructs.disable.null.includes("codeIndented") && tail && tail[1].type === "linePrefix" && tail[2].sliceSerialize(tail[1], true).length >= 4) {
+ return ok3(code4);
+ }
+ return effects.interrupt(self2.parser.constructs.flow, nok, ok3)(code4);
+ }
+}
+var content, continuationConstruct;
+var init_content = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/content.js"() {
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ init_micromark_util_subtokenize();
+ content = {
+ resolve: resolveContent,
+ tokenize: tokenizeContent
+ };
+ continuationConstruct = {
+ partial: true,
+ tokenize: tokenizeContinuation
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-factory-destination@2.0.1/node_modules/micromark-factory-destination/index.js
+function factoryDestination(effects, ok3, nok, type5, literalType, literalMarkerType, rawType, stringType, max3) {
+ const limit = max3 || Number.POSITIVE_INFINITY;
+ let balance = 0;
+ return start;
+ function start(code4) {
+ if (code4 === 60) {
+ effects.enter(type5);
+ effects.enter(literalType);
+ effects.enter(literalMarkerType);
+ effects.consume(code4);
+ effects.exit(literalMarkerType);
+ return enclosedBefore;
+ }
+ if (code4 === null || code4 === 32 || code4 === 41 || asciiControl(code4)) {
+ return nok(code4);
+ }
+ effects.enter(type5);
+ effects.enter(rawType);
+ effects.enter(stringType);
+ effects.enter("chunkString", {
+ contentType: "string"
+ });
+ return raw2(code4);
+ }
+ function enclosedBefore(code4) {
+ if (code4 === 62) {
+ effects.enter(literalMarkerType);
+ effects.consume(code4);
+ effects.exit(literalMarkerType);
+ effects.exit(literalType);
+ effects.exit(type5);
+ return ok3;
+ }
+ effects.enter(stringType);
+ effects.enter("chunkString", {
+ contentType: "string"
+ });
+ return enclosed(code4);
+ }
+ function enclosed(code4) {
+ if (code4 === 62) {
+ effects.exit("chunkString");
+ effects.exit(stringType);
+ return enclosedBefore(code4);
+ }
+ if (code4 === null || code4 === 60 || markdownLineEnding(code4)) {
+ return nok(code4);
+ }
+ effects.consume(code4);
+ return code4 === 92 ? enclosedEscape : enclosed;
+ }
+ function enclosedEscape(code4) {
+ if (code4 === 60 || code4 === 62 || code4 === 92) {
+ effects.consume(code4);
+ return enclosed;
+ }
+ return enclosed(code4);
+ }
+ function raw2(code4) {
+ if (!balance && (code4 === null || code4 === 41 || markdownLineEndingOrSpace(code4))) {
+ effects.exit("chunkString");
+ effects.exit(stringType);
+ effects.exit(rawType);
+ effects.exit(type5);
+ return ok3(code4);
+ }
+ if (balance < limit && code4 === 40) {
+ effects.consume(code4);
+ balance++;
+ return raw2;
+ }
+ if (code4 === 41) {
+ effects.consume(code4);
+ balance--;
+ return raw2;
+ }
+ if (code4 === null || code4 === 32 || code4 === 40 || asciiControl(code4)) {
+ return nok(code4);
+ }
+ effects.consume(code4);
+ return code4 === 92 ? rawEscape : raw2;
+ }
+ function rawEscape(code4) {
+ if (code4 === 40 || code4 === 41 || code4 === 92) {
+ effects.consume(code4);
+ return raw2;
+ }
+ return raw2(code4);
+ }
+}
+var init_micromark_factory_destination = __esm({
+ "node_modules/.pnpm/micromark-factory-destination@2.0.1/node_modules/micromark-factory-destination/index.js"() {
+ init_micromark_util_character();
+ }
+});
+
+// node_modules/.pnpm/micromark-factory-label@2.0.1/node_modules/micromark-factory-label/index.js
+function factoryLabel(effects, ok3, nok, type5, markerType, stringType) {
+ const self2 = this;
+ let size = 0;
+ let seen;
+ return start;
+ function start(code4) {
+ effects.enter(type5);
+ effects.enter(markerType);
+ effects.consume(code4);
+ effects.exit(markerType);
+ effects.enter(stringType);
+ return atBreak;
+ }
+ function atBreak(code4) {
+ if (size > 999 || code4 === null || code4 === 91 || code4 === 93 && !seen || // To do: remove in the future once we’ve switched from
+ // `micromark-extension-footnote` to `micromark-extension-gfm-footnote`,
+ // which doesn’t need this.
+ // Hidden footnotes hook.
+ /* c8 ignore next 3 */
+ code4 === 94 && !size && "_hiddenFootnoteSupport" in self2.parser.constructs) {
+ return nok(code4);
+ }
+ if (code4 === 93) {
+ effects.exit(stringType);
+ effects.enter(markerType);
+ effects.consume(code4);
+ effects.exit(markerType);
+ effects.exit(type5);
+ return ok3;
+ }
+ if (markdownLineEnding(code4)) {
+ effects.enter("lineEnding");
+ effects.consume(code4);
+ effects.exit("lineEnding");
+ return atBreak;
+ }
+ effects.enter("chunkString", {
+ contentType: "string"
+ });
+ return labelInside(code4);
+ }
+ function labelInside(code4) {
+ if (code4 === null || code4 === 91 || code4 === 93 || markdownLineEnding(code4) || size++ > 999) {
+ effects.exit("chunkString");
+ return atBreak(code4);
+ }
+ effects.consume(code4);
+ if (!seen) seen = !markdownSpace(code4);
+ return code4 === 92 ? labelEscape : labelInside;
+ }
+ function labelEscape(code4) {
+ if (code4 === 91 || code4 === 92 || code4 === 93) {
+ effects.consume(code4);
+ size++;
+ return labelInside;
+ }
+ return labelInside(code4);
+ }
+}
+var init_micromark_factory_label = __esm({
+ "node_modules/.pnpm/micromark-factory-label@2.0.1/node_modules/micromark-factory-label/index.js"() {
+ init_micromark_util_character();
+ }
+});
+
+// node_modules/.pnpm/micromark-factory-title@2.0.1/node_modules/micromark-factory-title/index.js
+function factoryTitle(effects, ok3, nok, type5, markerType, stringType) {
+ let marker;
+ return start;
+ function start(code4) {
+ if (code4 === 34 || code4 === 39 || code4 === 40) {
+ effects.enter(type5);
+ effects.enter(markerType);
+ effects.consume(code4);
+ effects.exit(markerType);
+ marker = code4 === 40 ? 41 : code4;
+ return begin3;
+ }
+ return nok(code4);
+ }
+ function begin3(code4) {
+ if (code4 === marker) {
+ effects.enter(markerType);
+ effects.consume(code4);
+ effects.exit(markerType);
+ effects.exit(type5);
+ return ok3;
+ }
+ effects.enter(stringType);
+ return atBreak(code4);
+ }
+ function atBreak(code4) {
+ if (code4 === marker) {
+ effects.exit(stringType);
+ return begin3(marker);
+ }
+ if (code4 === null) {
+ return nok(code4);
+ }
+ if (markdownLineEnding(code4)) {
+ effects.enter("lineEnding");
+ effects.consume(code4);
+ effects.exit("lineEnding");
+ return factorySpace(effects, atBreak, "linePrefix");
+ }
+ effects.enter("chunkString", {
+ contentType: "string"
+ });
+ return inside(code4);
+ }
+ function inside(code4) {
+ if (code4 === marker || code4 === null || markdownLineEnding(code4)) {
+ effects.exit("chunkString");
+ return atBreak(code4);
+ }
+ effects.consume(code4);
+ return code4 === 92 ? escape : inside;
+ }
+ function escape(code4) {
+ if (code4 === marker || code4 === 92) {
+ effects.consume(code4);
+ return inside;
+ }
+ return inside(code4);
+ }
+}
+var init_micromark_factory_title = __esm({
+ "node_modules/.pnpm/micromark-factory-title@2.0.1/node_modules/micromark-factory-title/index.js"() {
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ }
+});
+
+// node_modules/.pnpm/micromark-factory-whitespace@2.0.1/node_modules/micromark-factory-whitespace/index.js
+function factoryWhitespace(effects, ok3) {
+ let seen;
+ return start;
+ function start(code4) {
+ if (markdownLineEnding(code4)) {
+ effects.enter("lineEnding");
+ effects.consume(code4);
+ effects.exit("lineEnding");
+ seen = true;
+ return start;
+ }
+ if (markdownSpace(code4)) {
+ return factorySpace(effects, start, seen ? "linePrefix" : "lineSuffix")(code4);
+ }
+ return ok3(code4);
+ }
+}
+var init_micromark_factory_whitespace = __esm({
+ "node_modules/.pnpm/micromark-factory-whitespace@2.0.1/node_modules/micromark-factory-whitespace/index.js"() {
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/definition.js
+function tokenizeDefinition(effects, ok3, nok) {
+ const self2 = this;
+ let identifier;
+ return start;
+ function start(code4) {
+ effects.enter("definition");
+ return before(code4);
+ }
+ function before(code4) {
+ return factoryLabel.call(
+ self2,
+ effects,
+ labelAfter,
+ // Note: we don’t need to reset the way `markdown-rs` does.
+ nok,
+ "definitionLabel",
+ "definitionLabelMarker",
+ "definitionLabelString"
+ )(code4);
+ }
+ function labelAfter(code4) {
+ identifier = normalizeIdentifier(self2.sliceSerialize(self2.events[self2.events.length - 1][1]).slice(1, -1));
+ if (code4 === 58) {
+ effects.enter("definitionMarker");
+ effects.consume(code4);
+ effects.exit("definitionMarker");
+ return markerAfter;
+ }
+ return nok(code4);
+ }
+ function markerAfter(code4) {
+ return markdownLineEndingOrSpace(code4) ? factoryWhitespace(effects, destinationBefore)(code4) : destinationBefore(code4);
+ }
+ function destinationBefore(code4) {
+ return factoryDestination(
+ effects,
+ destinationAfter,
+ // Note: we don’t need to reset the way `markdown-rs` does.
+ nok,
+ "definitionDestination",
+ "definitionDestinationLiteral",
+ "definitionDestinationLiteralMarker",
+ "definitionDestinationRaw",
+ "definitionDestinationString"
+ )(code4);
+ }
+ function destinationAfter(code4) {
+ return effects.attempt(titleBefore, after, after)(code4);
+ }
+ function after(code4) {
+ return markdownSpace(code4) ? factorySpace(effects, afterWhitespace, "whitespace")(code4) : afterWhitespace(code4);
+ }
+ function afterWhitespace(code4) {
+ if (code4 === null || markdownLineEnding(code4)) {
+ effects.exit("definition");
+ self2.parser.defined.push(identifier);
+ return ok3(code4);
+ }
+ return nok(code4);
+ }
+}
+function tokenizeTitleBefore(effects, ok3, nok) {
+ return titleBefore2;
+ function titleBefore2(code4) {
+ return markdownLineEndingOrSpace(code4) ? factoryWhitespace(effects, beforeMarker)(code4) : nok(code4);
+ }
+ function beforeMarker(code4) {
+ return factoryTitle(effects, titleAfter, nok, "definitionTitle", "definitionTitleMarker", "definitionTitleString")(code4);
+ }
+ function titleAfter(code4) {
+ return markdownSpace(code4) ? factorySpace(effects, titleAfterOptionalWhitespace, "whitespace")(code4) : titleAfterOptionalWhitespace(code4);
+ }
+ function titleAfterOptionalWhitespace(code4) {
+ return code4 === null || markdownLineEnding(code4) ? ok3(code4) : nok(code4);
+ }
+}
+var definition2, titleBefore;
+var init_definition2 = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/definition.js"() {
+ init_micromark_factory_destination();
+ init_micromark_factory_label();
+ init_micromark_factory_space();
+ init_micromark_factory_title();
+ init_micromark_factory_whitespace();
+ init_micromark_util_character();
+ init_micromark_util_normalize_identifier();
+ definition2 = {
+ name: "definition",
+ tokenize: tokenizeDefinition
+ };
+ titleBefore = {
+ partial: true,
+ tokenize: tokenizeTitleBefore
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/hard-break-escape.js
+function tokenizeHardBreakEscape(effects, ok3, nok) {
+ return start;
+ function start(code4) {
+ effects.enter("hardBreakEscape");
+ effects.consume(code4);
+ return after;
+ }
+ function after(code4) {
+ if (markdownLineEnding(code4)) {
+ effects.exit("hardBreakEscape");
+ return ok3(code4);
+ }
+ return nok(code4);
+ }
+}
+var hardBreakEscape;
+var init_hard_break_escape = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/hard-break-escape.js"() {
+ init_micromark_util_character();
+ hardBreakEscape = {
+ name: "hardBreakEscape",
+ tokenize: tokenizeHardBreakEscape
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/heading-atx.js
+function resolveHeadingAtx(events, context2) {
+ let contentEnd = events.length - 2;
+ let contentStart = 3;
+ let content3;
+ let text9;
+ if (events[contentStart][1].type === "whitespace") {
+ contentStart += 2;
+ }
+ if (contentEnd - 2 > contentStart && events[contentEnd][1].type === "whitespace") {
+ contentEnd -= 2;
+ }
+ if (events[contentEnd][1].type === "atxHeadingSequence" && (contentStart === contentEnd - 1 || contentEnd - 4 > contentStart && events[contentEnd - 2][1].type === "whitespace")) {
+ contentEnd -= contentStart + 1 === contentEnd ? 2 : 4;
+ }
+ if (contentEnd > contentStart) {
+ content3 = {
+ type: "atxHeadingText",
+ start: events[contentStart][1].start,
+ end: events[contentEnd][1].end
+ };
+ text9 = {
+ type: "chunkText",
+ start: events[contentStart][1].start,
+ end: events[contentEnd][1].end,
+ contentType: "text"
+ };
+ splice(events, contentStart, contentEnd - contentStart + 1, [["enter", content3, context2], ["enter", text9, context2], ["exit", text9, context2], ["exit", content3, context2]]);
+ }
+ return events;
+}
+function tokenizeHeadingAtx(effects, ok3, nok) {
+ let size = 0;
+ return start;
+ function start(code4) {
+ effects.enter("atxHeading");
+ return before(code4);
+ }
+ function before(code4) {
+ effects.enter("atxHeadingSequence");
+ return sequenceOpen(code4);
+ }
+ function sequenceOpen(code4) {
+ if (code4 === 35 && size++ < 6) {
+ effects.consume(code4);
+ return sequenceOpen;
+ }
+ if (code4 === null || markdownLineEndingOrSpace(code4)) {
+ effects.exit("atxHeadingSequence");
+ return atBreak(code4);
+ }
+ return nok(code4);
+ }
+ function atBreak(code4) {
+ if (code4 === 35) {
+ effects.enter("atxHeadingSequence");
+ return sequenceFurther(code4);
+ }
+ if (code4 === null || markdownLineEnding(code4)) {
+ effects.exit("atxHeading");
+ return ok3(code4);
+ }
+ if (markdownSpace(code4)) {
+ return factorySpace(effects, atBreak, "whitespace")(code4);
+ }
+ effects.enter("atxHeadingText");
+ return data8(code4);
+ }
+ function sequenceFurther(code4) {
+ if (code4 === 35) {
+ effects.consume(code4);
+ return sequenceFurther;
+ }
+ effects.exit("atxHeadingSequence");
+ return atBreak(code4);
+ }
+ function data8(code4) {
+ if (code4 === null || code4 === 35 || markdownLineEndingOrSpace(code4)) {
+ effects.exit("atxHeadingText");
+ return atBreak(code4);
+ }
+ effects.consume(code4);
+ return data8;
+ }
+}
+var headingAtx;
+var init_heading_atx = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/heading-atx.js"() {
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ init_micromark_util_chunked();
+ headingAtx = {
+ name: "headingAtx",
+ resolve: resolveHeadingAtx,
+ tokenize: tokenizeHeadingAtx
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-util-html-tag-name@2.0.1/node_modules/micromark-util-html-tag-name/index.js
+var htmlBlockNames, htmlRawNames;
+var init_micromark_util_html_tag_name = __esm({
+ "node_modules/.pnpm/micromark-util-html-tag-name@2.0.1/node_modules/micromark-util-html-tag-name/index.js"() {
+ htmlBlockNames = [
+ "address",
+ "article",
+ "aside",
+ "base",
+ "basefont",
+ "blockquote",
+ "body",
+ "caption",
+ "center",
+ "col",
+ "colgroup",
+ "dd",
+ "details",
+ "dialog",
+ "dir",
+ "div",
+ "dl",
+ "dt",
+ "fieldset",
+ "figcaption",
+ "figure",
+ "footer",
+ "form",
+ "frame",
+ "frameset",
+ "h1",
+ "h2",
+ "h3",
+ "h4",
+ "h5",
+ "h6",
+ "head",
+ "header",
+ "hr",
+ "html",
+ "iframe",
+ "legend",
+ "li",
+ "link",
+ "main",
+ "menu",
+ "menuitem",
+ "nav",
+ "noframes",
+ "ol",
+ "optgroup",
+ "option",
+ "p",
+ "param",
+ "search",
+ "section",
+ "summary",
+ "table",
+ "tbody",
+ "td",
+ "tfoot",
+ "th",
+ "thead",
+ "title",
+ "tr",
+ "track",
+ "ul"
+ ];
+ htmlRawNames = ["pre", "script", "style", "textarea"];
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/html-flow.js
+function resolveToHtmlFlow(events) {
+ let index2 = events.length;
+ while (index2--) {
+ if (events[index2][0] === "enter" && events[index2][1].type === "htmlFlow") {
+ break;
+ }
+ }
+ if (index2 > 1 && events[index2 - 2][1].type === "linePrefix") {
+ events[index2][1].start = events[index2 - 2][1].start;
+ events[index2 + 1][1].start = events[index2 - 2][1].start;
+ events.splice(index2 - 2, 2);
+ }
+ return events;
+}
+function tokenizeHtmlFlow(effects, ok3, nok) {
+ const self2 = this;
+ let marker;
+ let closingTag;
+ let buffer2;
+ let index2;
+ let markerB;
+ return start;
+ function start(code4) {
+ return before(code4);
+ }
+ function before(code4) {
+ effects.enter("htmlFlow");
+ effects.enter("htmlFlowData");
+ effects.consume(code4);
+ return open;
+ }
+ function open(code4) {
+ if (code4 === 33) {
+ effects.consume(code4);
+ return declarationOpen;
+ }
+ if (code4 === 47) {
+ effects.consume(code4);
+ closingTag = true;
+ return tagCloseStart;
+ }
+ if (code4 === 63) {
+ effects.consume(code4);
+ marker = 3;
+ return self2.interrupt ? ok3 : continuationDeclarationInside;
+ }
+ if (asciiAlpha(code4)) {
+ effects.consume(code4);
+ buffer2 = String.fromCharCode(code4);
+ return tagName;
+ }
+ return nok(code4);
+ }
+ function declarationOpen(code4) {
+ if (code4 === 45) {
+ effects.consume(code4);
+ marker = 2;
+ return commentOpenInside;
+ }
+ if (code4 === 91) {
+ effects.consume(code4);
+ marker = 5;
+ index2 = 0;
+ return cdataOpenInside;
+ }
+ if (asciiAlpha(code4)) {
+ effects.consume(code4);
+ marker = 4;
+ return self2.interrupt ? ok3 : continuationDeclarationInside;
+ }
+ return nok(code4);
+ }
+ function commentOpenInside(code4) {
+ if (code4 === 45) {
+ effects.consume(code4);
+ return self2.interrupt ? ok3 : continuationDeclarationInside;
+ }
+ return nok(code4);
+ }
+ function cdataOpenInside(code4) {
+ const value2 = "CDATA[";
+ if (code4 === value2.charCodeAt(index2++)) {
+ effects.consume(code4);
+ if (index2 === value2.length) {
+ return self2.interrupt ? ok3 : continuation;
+ }
+ return cdataOpenInside;
+ }
+ return nok(code4);
+ }
+ function tagCloseStart(code4) {
+ if (asciiAlpha(code4)) {
+ effects.consume(code4);
+ buffer2 = String.fromCharCode(code4);
+ return tagName;
+ }
+ return nok(code4);
+ }
+ function tagName(code4) {
+ if (code4 === null || code4 === 47 || code4 === 62 || markdownLineEndingOrSpace(code4)) {
+ const slash = code4 === 47;
+ const name = buffer2.toLowerCase();
+ if (!slash && !closingTag && htmlRawNames.includes(name)) {
+ marker = 1;
+ return self2.interrupt ? ok3(code4) : continuation(code4);
+ }
+ if (htmlBlockNames.includes(buffer2.toLowerCase())) {
+ marker = 6;
+ if (slash) {
+ effects.consume(code4);
+ return basicSelfClosing;
+ }
+ return self2.interrupt ? ok3(code4) : continuation(code4);
+ }
+ marker = 7;
+ return self2.interrupt && !self2.parser.lazy[self2.now().line] ? nok(code4) : closingTag ? completeClosingTagAfter(code4) : completeAttributeNameBefore(code4);
+ }
+ if (code4 === 45 || asciiAlphanumeric(code4)) {
+ effects.consume(code4);
+ buffer2 += String.fromCharCode(code4);
+ return tagName;
+ }
+ return nok(code4);
+ }
+ function basicSelfClosing(code4) {
+ if (code4 === 62) {
+ effects.consume(code4);
+ return self2.interrupt ? ok3 : continuation;
+ }
+ return nok(code4);
+ }
+ function completeClosingTagAfter(code4) {
+ if (markdownSpace(code4)) {
+ effects.consume(code4);
+ return completeClosingTagAfter;
+ }
+ return completeEnd(code4);
+ }
+ function completeAttributeNameBefore(code4) {
+ if (code4 === 47) {
+ effects.consume(code4);
+ return completeEnd;
+ }
+ if (code4 === 58 || code4 === 95 || asciiAlpha(code4)) {
+ effects.consume(code4);
+ return completeAttributeName;
+ }
+ if (markdownSpace(code4)) {
+ effects.consume(code4);
+ return completeAttributeNameBefore;
+ }
+ return completeEnd(code4);
+ }
+ function completeAttributeName(code4) {
+ if (code4 === 45 || code4 === 46 || code4 === 58 || code4 === 95 || asciiAlphanumeric(code4)) {
+ effects.consume(code4);
+ return completeAttributeName;
+ }
+ return completeAttributeNameAfter(code4);
+ }
+ function completeAttributeNameAfter(code4) {
+ if (code4 === 61) {
+ effects.consume(code4);
+ return completeAttributeValueBefore;
+ }
+ if (markdownSpace(code4)) {
+ effects.consume(code4);
+ return completeAttributeNameAfter;
+ }
+ return completeAttributeNameBefore(code4);
+ }
+ function completeAttributeValueBefore(code4) {
+ if (code4 === null || code4 === 60 || code4 === 61 || code4 === 62 || code4 === 96) {
+ return nok(code4);
+ }
+ if (code4 === 34 || code4 === 39) {
+ effects.consume(code4);
+ markerB = code4;
+ return completeAttributeValueQuoted;
+ }
+ if (markdownSpace(code4)) {
+ effects.consume(code4);
+ return completeAttributeValueBefore;
+ }
+ return completeAttributeValueUnquoted(code4);
+ }
+ function completeAttributeValueQuoted(code4) {
+ if (code4 === markerB) {
+ effects.consume(code4);
+ markerB = null;
+ return completeAttributeValueQuotedAfter;
+ }
+ if (code4 === null || markdownLineEnding(code4)) {
+ return nok(code4);
+ }
+ effects.consume(code4);
+ return completeAttributeValueQuoted;
+ }
+ function completeAttributeValueUnquoted(code4) {
+ if (code4 === null || code4 === 34 || code4 === 39 || code4 === 47 || code4 === 60 || code4 === 61 || code4 === 62 || code4 === 96 || markdownLineEndingOrSpace(code4)) {
+ return completeAttributeNameAfter(code4);
+ }
+ effects.consume(code4);
+ return completeAttributeValueUnquoted;
+ }
+ function completeAttributeValueQuotedAfter(code4) {
+ if (code4 === 47 || code4 === 62 || markdownSpace(code4)) {
+ return completeAttributeNameBefore(code4);
+ }
+ return nok(code4);
+ }
+ function completeEnd(code4) {
+ if (code4 === 62) {
+ effects.consume(code4);
+ return completeAfter;
+ }
+ return nok(code4);
+ }
+ function completeAfter(code4) {
+ if (code4 === null || markdownLineEnding(code4)) {
+ return continuation(code4);
+ }
+ if (markdownSpace(code4)) {
+ effects.consume(code4);
+ return completeAfter;
+ }
+ return nok(code4);
+ }
+ function continuation(code4) {
+ if (code4 === 45 && marker === 2) {
+ effects.consume(code4);
+ return continuationCommentInside;
+ }
+ if (code4 === 60 && marker === 1) {
+ effects.consume(code4);
+ return continuationRawTagOpen;
+ }
+ if (code4 === 62 && marker === 4) {
+ effects.consume(code4);
+ return continuationClose;
+ }
+ if (code4 === 63 && marker === 3) {
+ effects.consume(code4);
+ return continuationDeclarationInside;
+ }
+ if (code4 === 93 && marker === 5) {
+ effects.consume(code4);
+ return continuationCdataInside;
+ }
+ if (markdownLineEnding(code4) && (marker === 6 || marker === 7)) {
+ effects.exit("htmlFlowData");
+ return effects.check(blankLineBefore, continuationAfter, continuationStart)(code4);
+ }
+ if (code4 === null || markdownLineEnding(code4)) {
+ effects.exit("htmlFlowData");
+ return continuationStart(code4);
+ }
+ effects.consume(code4);
+ return continuation;
+ }
+ function continuationStart(code4) {
+ return effects.check(nonLazyContinuationStart, continuationStartNonLazy, continuationAfter)(code4);
+ }
+ function continuationStartNonLazy(code4) {
+ effects.enter("lineEnding");
+ effects.consume(code4);
+ effects.exit("lineEnding");
+ return continuationBefore;
+ }
+ function continuationBefore(code4) {
+ if (code4 === null || markdownLineEnding(code4)) {
+ return continuationStart(code4);
+ }
+ effects.enter("htmlFlowData");
+ return continuation(code4);
+ }
+ function continuationCommentInside(code4) {
+ if (code4 === 45) {
+ effects.consume(code4);
+ return continuationDeclarationInside;
+ }
+ return continuation(code4);
+ }
+ function continuationRawTagOpen(code4) {
+ if (code4 === 47) {
+ effects.consume(code4);
+ buffer2 = "";
+ return continuationRawEndTag;
+ }
+ return continuation(code4);
+ }
+ function continuationRawEndTag(code4) {
+ if (code4 === 62) {
+ const name = buffer2.toLowerCase();
+ if (htmlRawNames.includes(name)) {
+ effects.consume(code4);
+ return continuationClose;
+ }
+ return continuation(code4);
+ }
+ if (asciiAlpha(code4) && buffer2.length < 8) {
+ effects.consume(code4);
+ buffer2 += String.fromCharCode(code4);
+ return continuationRawEndTag;
+ }
+ return continuation(code4);
+ }
+ function continuationCdataInside(code4) {
+ if (code4 === 93) {
+ effects.consume(code4);
+ return continuationDeclarationInside;
+ }
+ return continuation(code4);
+ }
+ function continuationDeclarationInside(code4) {
+ if (code4 === 62) {
+ effects.consume(code4);
+ return continuationClose;
+ }
+ if (code4 === 45 && marker === 2) {
+ effects.consume(code4);
+ return continuationDeclarationInside;
+ }
+ return continuation(code4);
+ }
+ function continuationClose(code4) {
+ if (code4 === null || markdownLineEnding(code4)) {
+ effects.exit("htmlFlowData");
+ return continuationAfter(code4);
+ }
+ effects.consume(code4);
+ return continuationClose;
+ }
+ function continuationAfter(code4) {
+ effects.exit("htmlFlow");
+ return ok3(code4);
+ }
+}
+function tokenizeNonLazyContinuationStart(effects, ok3, nok) {
+ const self2 = this;
+ return start;
+ function start(code4) {
+ if (markdownLineEnding(code4)) {
+ effects.enter("lineEnding");
+ effects.consume(code4);
+ effects.exit("lineEnding");
+ return after;
+ }
+ return nok(code4);
+ }
+ function after(code4) {
+ return self2.parser.lazy[self2.now().line] ? nok(code4) : ok3(code4);
+ }
+}
+function tokenizeBlankLineBefore(effects, ok3, nok) {
+ return start;
+ function start(code4) {
+ effects.enter("lineEnding");
+ effects.consume(code4);
+ effects.exit("lineEnding");
+ return effects.attempt(blankLine, ok3, nok);
+ }
+}
+var htmlFlow, blankLineBefore, nonLazyContinuationStart;
+var init_html_flow = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/html-flow.js"() {
+ init_micromark_util_character();
+ init_micromark_util_html_tag_name();
+ init_blank_line();
+ htmlFlow = {
+ concrete: true,
+ name: "htmlFlow",
+ resolveTo: resolveToHtmlFlow,
+ tokenize: tokenizeHtmlFlow
+ };
+ blankLineBefore = {
+ partial: true,
+ tokenize: tokenizeBlankLineBefore
+ };
+ nonLazyContinuationStart = {
+ partial: true,
+ tokenize: tokenizeNonLazyContinuationStart
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/html-text.js
+function tokenizeHtmlText(effects, ok3, nok) {
+ const self2 = this;
+ let marker;
+ let index2;
+ let returnState;
+ return start;
+ function start(code4) {
+ effects.enter("htmlText");
+ effects.enter("htmlTextData");
+ effects.consume(code4);
+ return open;
+ }
+ function open(code4) {
+ if (code4 === 33) {
+ effects.consume(code4);
+ return declarationOpen;
+ }
+ if (code4 === 47) {
+ effects.consume(code4);
+ return tagCloseStart;
+ }
+ if (code4 === 63) {
+ effects.consume(code4);
+ return instruction;
+ }
+ if (asciiAlpha(code4)) {
+ effects.consume(code4);
+ return tagOpen;
+ }
+ return nok(code4);
+ }
+ function declarationOpen(code4) {
+ if (code4 === 45) {
+ effects.consume(code4);
+ return commentOpenInside;
+ }
+ if (code4 === 91) {
+ effects.consume(code4);
+ index2 = 0;
+ return cdataOpenInside;
+ }
+ if (asciiAlpha(code4)) {
+ effects.consume(code4);
+ return declaration;
+ }
+ return nok(code4);
+ }
+ function commentOpenInside(code4) {
+ if (code4 === 45) {
+ effects.consume(code4);
+ return commentEnd;
+ }
+ return nok(code4);
+ }
+ function comment3(code4) {
+ if (code4 === null) {
+ return nok(code4);
+ }
+ if (code4 === 45) {
+ effects.consume(code4);
+ return commentClose;
+ }
+ if (markdownLineEnding(code4)) {
+ returnState = comment3;
+ return lineEndingBefore(code4);
+ }
+ effects.consume(code4);
+ return comment3;
+ }
+ function commentClose(code4) {
+ if (code4 === 45) {
+ effects.consume(code4);
+ return commentEnd;
+ }
+ return comment3(code4);
+ }
+ function commentEnd(code4) {
+ return code4 === 62 ? end3(code4) : code4 === 45 ? commentClose(code4) : comment3(code4);
+ }
+ function cdataOpenInside(code4) {
+ const value2 = "CDATA[";
+ if (code4 === value2.charCodeAt(index2++)) {
+ effects.consume(code4);
+ return index2 === value2.length ? cdata : cdataOpenInside;
+ }
+ return nok(code4);
+ }
+ function cdata(code4) {
+ if (code4 === null) {
+ return nok(code4);
+ }
+ if (code4 === 93) {
+ effects.consume(code4);
+ return cdataClose;
+ }
+ if (markdownLineEnding(code4)) {
+ returnState = cdata;
+ return lineEndingBefore(code4);
+ }
+ effects.consume(code4);
+ return cdata;
+ }
+ function cdataClose(code4) {
+ if (code4 === 93) {
+ effects.consume(code4);
+ return cdataEnd;
+ }
+ return cdata(code4);
+ }
+ function cdataEnd(code4) {
+ if (code4 === 62) {
+ return end3(code4);
+ }
+ if (code4 === 93) {
+ effects.consume(code4);
+ return cdataEnd;
+ }
+ return cdata(code4);
+ }
+ function declaration(code4) {
+ if (code4 === null || code4 === 62) {
+ return end3(code4);
+ }
+ if (markdownLineEnding(code4)) {
+ returnState = declaration;
+ return lineEndingBefore(code4);
+ }
+ effects.consume(code4);
+ return declaration;
+ }
+ function instruction(code4) {
+ if (code4 === null) {
+ return nok(code4);
+ }
+ if (code4 === 63) {
+ effects.consume(code4);
+ return instructionClose;
+ }
+ if (markdownLineEnding(code4)) {
+ returnState = instruction;
+ return lineEndingBefore(code4);
+ }
+ effects.consume(code4);
+ return instruction;
+ }
+ function instructionClose(code4) {
+ return code4 === 62 ? end3(code4) : instruction(code4);
+ }
+ function tagCloseStart(code4) {
+ if (asciiAlpha(code4)) {
+ effects.consume(code4);
+ return tagClose;
+ }
+ return nok(code4);
+ }
+ function tagClose(code4) {
+ if (code4 === 45 || asciiAlphanumeric(code4)) {
+ effects.consume(code4);
+ return tagClose;
+ }
+ return tagCloseBetween(code4);
+ }
+ function tagCloseBetween(code4) {
+ if (markdownLineEnding(code4)) {
+ returnState = tagCloseBetween;
+ return lineEndingBefore(code4);
+ }
+ if (markdownSpace(code4)) {
+ effects.consume(code4);
+ return tagCloseBetween;
+ }
+ return end3(code4);
+ }
+ function tagOpen(code4) {
+ if (code4 === 45 || asciiAlphanumeric(code4)) {
+ effects.consume(code4);
+ return tagOpen;
+ }
+ if (code4 === 47 || code4 === 62 || markdownLineEndingOrSpace(code4)) {
+ return tagOpenBetween(code4);
+ }
+ return nok(code4);
+ }
+ function tagOpenBetween(code4) {
+ if (code4 === 47) {
+ effects.consume(code4);
+ return end3;
+ }
+ if (code4 === 58 || code4 === 95 || asciiAlpha(code4)) {
+ effects.consume(code4);
+ return tagOpenAttributeName;
+ }
+ if (markdownLineEnding(code4)) {
+ returnState = tagOpenBetween;
+ return lineEndingBefore(code4);
+ }
+ if (markdownSpace(code4)) {
+ effects.consume(code4);
+ return tagOpenBetween;
+ }
+ return end3(code4);
+ }
+ function tagOpenAttributeName(code4) {
+ if (code4 === 45 || code4 === 46 || code4 === 58 || code4 === 95 || asciiAlphanumeric(code4)) {
+ effects.consume(code4);
+ return tagOpenAttributeName;
+ }
+ return tagOpenAttributeNameAfter(code4);
+ }
+ function tagOpenAttributeNameAfter(code4) {
+ if (code4 === 61) {
+ effects.consume(code4);
+ return tagOpenAttributeValueBefore;
+ }
+ if (markdownLineEnding(code4)) {
+ returnState = tagOpenAttributeNameAfter;
+ return lineEndingBefore(code4);
+ }
+ if (markdownSpace(code4)) {
+ effects.consume(code4);
+ return tagOpenAttributeNameAfter;
+ }
+ return tagOpenBetween(code4);
+ }
+ function tagOpenAttributeValueBefore(code4) {
+ if (code4 === null || code4 === 60 || code4 === 61 || code4 === 62 || code4 === 96) {
+ return nok(code4);
+ }
+ if (code4 === 34 || code4 === 39) {
+ effects.consume(code4);
+ marker = code4;
+ return tagOpenAttributeValueQuoted;
+ }
+ if (markdownLineEnding(code4)) {
+ returnState = tagOpenAttributeValueBefore;
+ return lineEndingBefore(code4);
+ }
+ if (markdownSpace(code4)) {
+ effects.consume(code4);
+ return tagOpenAttributeValueBefore;
+ }
+ effects.consume(code4);
+ return tagOpenAttributeValueUnquoted;
+ }
+ function tagOpenAttributeValueQuoted(code4) {
+ if (code4 === marker) {
+ effects.consume(code4);
+ marker = void 0;
+ return tagOpenAttributeValueQuotedAfter;
+ }
+ if (code4 === null) {
+ return nok(code4);
+ }
+ if (markdownLineEnding(code4)) {
+ returnState = tagOpenAttributeValueQuoted;
+ return lineEndingBefore(code4);
+ }
+ effects.consume(code4);
+ return tagOpenAttributeValueQuoted;
+ }
+ function tagOpenAttributeValueUnquoted(code4) {
+ if (code4 === null || code4 === 34 || code4 === 39 || code4 === 60 || code4 === 61 || code4 === 96) {
+ return nok(code4);
+ }
+ if (code4 === 47 || code4 === 62 || markdownLineEndingOrSpace(code4)) {
+ return tagOpenBetween(code4);
+ }
+ effects.consume(code4);
+ return tagOpenAttributeValueUnquoted;
+ }
+ function tagOpenAttributeValueQuotedAfter(code4) {
+ if (code4 === 47 || code4 === 62 || markdownLineEndingOrSpace(code4)) {
+ return tagOpenBetween(code4);
+ }
+ return nok(code4);
+ }
+ function end3(code4) {
+ if (code4 === 62) {
+ effects.consume(code4);
+ effects.exit("htmlTextData");
+ effects.exit("htmlText");
+ return ok3;
+ }
+ return nok(code4);
+ }
+ function lineEndingBefore(code4) {
+ effects.exit("htmlTextData");
+ effects.enter("lineEnding");
+ effects.consume(code4);
+ effects.exit("lineEnding");
+ return lineEndingAfter;
+ }
+ function lineEndingAfter(code4) {
+ return markdownSpace(code4) ? factorySpace(effects, lineEndingAfterPrefix, "linePrefix", self2.parser.constructs.disable.null.includes("codeIndented") ? void 0 : 4)(code4) : lineEndingAfterPrefix(code4);
+ }
+ function lineEndingAfterPrefix(code4) {
+ effects.enter("htmlTextData");
+ return returnState(code4);
+ }
+}
+var htmlText;
+var init_html_text = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/html-text.js"() {
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ htmlText = {
+ name: "htmlText",
+ tokenize: tokenizeHtmlText
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/label-end.js
+function resolveAllLabelEnd(events) {
+ let index2 = -1;
+ const newEvents = [];
+ while (++index2 < events.length) {
+ const token = events[index2][1];
+ newEvents.push(events[index2]);
+ if (token.type === "labelImage" || token.type === "labelLink" || token.type === "labelEnd") {
+ const offset = token.type === "labelImage" ? 4 : 2;
+ token.type = "data";
+ index2 += offset;
+ }
+ }
+ if (events.length !== newEvents.length) {
+ splice(events, 0, events.length, newEvents);
+ }
+ return events;
+}
+function resolveToLabelEnd(events, context2) {
+ let index2 = events.length;
+ let offset = 0;
+ let token;
+ let open;
+ let close7;
+ let media;
+ while (index2--) {
+ token = events[index2][1];
+ if (open) {
+ if (token.type === "link" || token.type === "labelLink" && token._inactive) {
+ break;
+ }
+ if (events[index2][0] === "enter" && token.type === "labelLink") {
+ token._inactive = true;
+ }
+ } else if (close7) {
+ if (events[index2][0] === "enter" && (token.type === "labelImage" || token.type === "labelLink") && !token._balanced) {
+ open = index2;
+ if (token.type !== "labelLink") {
+ offset = 2;
+ break;
+ }
+ }
+ } else if (token.type === "labelEnd") {
+ close7 = index2;
+ }
+ }
+ const group = {
+ type: events[open][1].type === "labelLink" ? "link" : "image",
+ start: {
+ ...events[open][1].start
+ },
+ end: {
+ ...events[events.length - 1][1].end
+ }
+ };
+ const label = {
+ type: "label",
+ start: {
+ ...events[open][1].start
+ },
+ end: {
+ ...events[close7][1].end
+ }
+ };
+ const text9 = {
+ type: "labelText",
+ start: {
+ ...events[open + offset + 2][1].end
+ },
+ end: {
+ ...events[close7 - 2][1].start
+ }
+ };
+ media = [["enter", group, context2], ["enter", label, context2]];
+ media = push(media, events.slice(open + 1, open + offset + 3));
+ media = push(media, [["enter", text9, context2]]);
+ media = push(media, resolveAll(context2.parser.constructs.insideSpan.null, events.slice(open + offset + 4, close7 - 3), context2));
+ media = push(media, [["exit", text9, context2], events[close7 - 2], events[close7 - 1], ["exit", label, context2]]);
+ media = push(media, events.slice(close7 + 1));
+ media = push(media, [["exit", group, context2]]);
+ splice(events, open, events.length, media);
+ return events;
+}
+function tokenizeLabelEnd(effects, ok3, nok) {
+ const self2 = this;
+ let index2 = self2.events.length;
+ let labelStart;
+ let defined;
+ while (index2--) {
+ if ((self2.events[index2][1].type === "labelImage" || self2.events[index2][1].type === "labelLink") && !self2.events[index2][1]._balanced) {
+ labelStart = self2.events[index2][1];
+ break;
+ }
+ }
+ return start;
+ function start(code4) {
+ if (!labelStart) {
+ return nok(code4);
+ }
+ if (labelStart._inactive) {
+ return labelEndNok(code4);
+ }
+ defined = self2.parser.defined.includes(normalizeIdentifier(self2.sliceSerialize({
+ start: labelStart.end,
+ end: self2.now()
+ })));
+ effects.enter("labelEnd");
+ effects.enter("labelMarker");
+ effects.consume(code4);
+ effects.exit("labelMarker");
+ effects.exit("labelEnd");
+ return after;
+ }
+ function after(code4) {
+ if (code4 === 40) {
+ return effects.attempt(resourceConstruct, labelEndOk, defined ? labelEndOk : labelEndNok)(code4);
+ }
+ if (code4 === 91) {
+ return effects.attempt(referenceFullConstruct, labelEndOk, defined ? referenceNotFull : labelEndNok)(code4);
+ }
+ return defined ? labelEndOk(code4) : labelEndNok(code4);
+ }
+ function referenceNotFull(code4) {
+ return effects.attempt(referenceCollapsedConstruct, labelEndOk, labelEndNok)(code4);
+ }
+ function labelEndOk(code4) {
+ return ok3(code4);
+ }
+ function labelEndNok(code4) {
+ labelStart._balanced = true;
+ return nok(code4);
+ }
+}
+function tokenizeResource(effects, ok3, nok) {
+ return resourceStart;
+ function resourceStart(code4) {
+ effects.enter("resource");
+ effects.enter("resourceMarker");
+ effects.consume(code4);
+ effects.exit("resourceMarker");
+ return resourceBefore;
+ }
+ function resourceBefore(code4) {
+ return markdownLineEndingOrSpace(code4) ? factoryWhitespace(effects, resourceOpen)(code4) : resourceOpen(code4);
+ }
+ function resourceOpen(code4) {
+ if (code4 === 41) {
+ return resourceEnd(code4);
+ }
+ return factoryDestination(effects, resourceDestinationAfter, resourceDestinationMissing, "resourceDestination", "resourceDestinationLiteral", "resourceDestinationLiteralMarker", "resourceDestinationRaw", "resourceDestinationString", 32)(code4);
+ }
+ function resourceDestinationAfter(code4) {
+ return markdownLineEndingOrSpace(code4) ? factoryWhitespace(effects, resourceBetween)(code4) : resourceEnd(code4);
+ }
+ function resourceDestinationMissing(code4) {
+ return nok(code4);
+ }
+ function resourceBetween(code4) {
+ if (code4 === 34 || code4 === 39 || code4 === 40) {
+ return factoryTitle(effects, resourceTitleAfter, nok, "resourceTitle", "resourceTitleMarker", "resourceTitleString")(code4);
+ }
+ return resourceEnd(code4);
+ }
+ function resourceTitleAfter(code4) {
+ return markdownLineEndingOrSpace(code4) ? factoryWhitespace(effects, resourceEnd)(code4) : resourceEnd(code4);
+ }
+ function resourceEnd(code4) {
+ if (code4 === 41) {
+ effects.enter("resourceMarker");
+ effects.consume(code4);
+ effects.exit("resourceMarker");
+ effects.exit("resource");
+ return ok3;
+ }
+ return nok(code4);
+ }
+}
+function tokenizeReferenceFull(effects, ok3, nok) {
+ const self2 = this;
+ return referenceFull;
+ function referenceFull(code4) {
+ return factoryLabel.call(self2, effects, referenceFullAfter, referenceFullMissing, "reference", "referenceMarker", "referenceString")(code4);
+ }
+ function referenceFullAfter(code4) {
+ return self2.parser.defined.includes(normalizeIdentifier(self2.sliceSerialize(self2.events[self2.events.length - 1][1]).slice(1, -1))) ? ok3(code4) : nok(code4);
+ }
+ function referenceFullMissing(code4) {
+ return nok(code4);
+ }
+}
+function tokenizeReferenceCollapsed(effects, ok3, nok) {
+ return referenceCollapsedStart;
+ function referenceCollapsedStart(code4) {
+ effects.enter("reference");
+ effects.enter("referenceMarker");
+ effects.consume(code4);
+ effects.exit("referenceMarker");
+ return referenceCollapsedOpen;
+ }
+ function referenceCollapsedOpen(code4) {
+ if (code4 === 93) {
+ effects.enter("referenceMarker");
+ effects.consume(code4);
+ effects.exit("referenceMarker");
+ effects.exit("reference");
+ return ok3;
+ }
+ return nok(code4);
+ }
+}
+var labelEnd, resourceConstruct, referenceFullConstruct, referenceCollapsedConstruct;
+var init_label_end = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/label-end.js"() {
+ init_micromark_factory_destination();
+ init_micromark_factory_label();
+ init_micromark_factory_title();
+ init_micromark_factory_whitespace();
+ init_micromark_util_character();
+ init_micromark_util_chunked();
+ init_micromark_util_normalize_identifier();
+ init_micromark_util_resolve_all();
+ labelEnd = {
+ name: "labelEnd",
+ resolveAll: resolveAllLabelEnd,
+ resolveTo: resolveToLabelEnd,
+ tokenize: tokenizeLabelEnd
+ };
+ resourceConstruct = {
+ tokenize: tokenizeResource
+ };
+ referenceFullConstruct = {
+ tokenize: tokenizeReferenceFull
+ };
+ referenceCollapsedConstruct = {
+ tokenize: tokenizeReferenceCollapsed
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/label-start-image.js
+function tokenizeLabelStartImage(effects, ok3, nok) {
+ const self2 = this;
+ return start;
+ function start(code4) {
+ effects.enter("labelImage");
+ effects.enter("labelImageMarker");
+ effects.consume(code4);
+ effects.exit("labelImageMarker");
+ return open;
+ }
+ function open(code4) {
+ if (code4 === 91) {
+ effects.enter("labelMarker");
+ effects.consume(code4);
+ effects.exit("labelMarker");
+ effects.exit("labelImage");
+ return after;
+ }
+ return nok(code4);
+ }
+ function after(code4) {
+ return code4 === 94 && "_hiddenFootnoteSupport" in self2.parser.constructs ? nok(code4) : ok3(code4);
+ }
+}
+var labelStartImage;
+var init_label_start_image = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/label-start-image.js"() {
+ init_label_end();
+ labelStartImage = {
+ name: "labelStartImage",
+ resolveAll: labelEnd.resolveAll,
+ tokenize: tokenizeLabelStartImage
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/label-start-link.js
+function tokenizeLabelStartLink(effects, ok3, nok) {
+ const self2 = this;
+ return start;
+ function start(code4) {
+ effects.enter("labelLink");
+ effects.enter("labelMarker");
+ effects.consume(code4);
+ effects.exit("labelMarker");
+ effects.exit("labelLink");
+ return after;
+ }
+ function after(code4) {
+ return code4 === 94 && "_hiddenFootnoteSupport" in self2.parser.constructs ? nok(code4) : ok3(code4);
+ }
+}
+var labelStartLink;
+var init_label_start_link = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/label-start-link.js"() {
+ init_label_end();
+ labelStartLink = {
+ name: "labelStartLink",
+ resolveAll: labelEnd.resolveAll,
+ tokenize: tokenizeLabelStartLink
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/line-ending.js
+function tokenizeLineEnding(effects, ok3) {
+ return start;
+ function start(code4) {
+ effects.enter("lineEnding");
+ effects.consume(code4);
+ effects.exit("lineEnding");
+ return factorySpace(effects, ok3, "linePrefix");
+ }
+}
+var lineEnding;
+var init_line_ending = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/line-ending.js"() {
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ lineEnding = {
+ name: "lineEnding",
+ tokenize: tokenizeLineEnding
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/thematic-break.js
+function tokenizeThematicBreak(effects, ok3, nok) {
+ let size = 0;
+ let marker;
+ return start;
+ function start(code4) {
+ effects.enter("thematicBreak");
+ return before(code4);
+ }
+ function before(code4) {
+ marker = code4;
+ return atBreak(code4);
+ }
+ function atBreak(code4) {
+ if (code4 === marker) {
+ effects.enter("thematicBreakSequence");
+ return sequence(code4);
+ }
+ if (size >= 3 && (code4 === null || markdownLineEnding(code4))) {
+ effects.exit("thematicBreak");
+ return ok3(code4);
+ }
+ return nok(code4);
+ }
+ function sequence(code4) {
+ if (code4 === marker) {
+ effects.consume(code4);
+ size++;
+ return sequence;
+ }
+ effects.exit("thematicBreakSequence");
+ return markdownSpace(code4) ? factorySpace(effects, atBreak, "whitespace")(code4) : atBreak(code4);
+ }
+}
+var thematicBreak2;
+var init_thematic_break2 = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/thematic-break.js"() {
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ thematicBreak2 = {
+ name: "thematicBreak",
+ tokenize: tokenizeThematicBreak
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/list.js
+function tokenizeListStart(effects, ok3, nok) {
+ const self2 = this;
+ const tail = self2.events[self2.events.length - 1];
+ let initialSize = tail && tail[1].type === "linePrefix" ? tail[2].sliceSerialize(tail[1], true).length : 0;
+ let size = 0;
+ return start;
+ function start(code4) {
+ const kind = self2.containerState.type || (code4 === 42 || code4 === 43 || code4 === 45 ? "listUnordered" : "listOrdered");
+ if (kind === "listUnordered" ? !self2.containerState.marker || code4 === self2.containerState.marker : asciiDigit(code4)) {
+ if (!self2.containerState.type) {
+ self2.containerState.type = kind;
+ effects.enter(kind, {
+ _container: true
+ });
+ }
+ if (kind === "listUnordered") {
+ effects.enter("listItemPrefix");
+ return code4 === 42 || code4 === 45 ? effects.check(thematicBreak2, nok, atMarker)(code4) : atMarker(code4);
+ }
+ if (!self2.interrupt || code4 === 49) {
+ effects.enter("listItemPrefix");
+ effects.enter("listItemValue");
+ return inside(code4);
+ }
+ }
+ return nok(code4);
+ }
+ function inside(code4) {
+ if (asciiDigit(code4) && ++size < 10) {
+ effects.consume(code4);
+ return inside;
+ }
+ if ((!self2.interrupt || size < 2) && (self2.containerState.marker ? code4 === self2.containerState.marker : code4 === 41 || code4 === 46)) {
+ effects.exit("listItemValue");
+ return atMarker(code4);
+ }
+ return nok(code4);
+ }
+ function atMarker(code4) {
+ effects.enter("listItemMarker");
+ effects.consume(code4);
+ effects.exit("listItemMarker");
+ self2.containerState.marker = self2.containerState.marker || code4;
+ return effects.check(
+ blankLine,
+ // Can’t be empty when interrupting.
+ self2.interrupt ? nok : onBlank,
+ effects.attempt(listItemPrefixWhitespaceConstruct, endOfPrefix, otherPrefix)
+ );
+ }
+ function onBlank(code4) {
+ self2.containerState.initialBlankLine = true;
+ initialSize++;
+ return endOfPrefix(code4);
+ }
+ function otherPrefix(code4) {
+ if (markdownSpace(code4)) {
+ effects.enter("listItemPrefixWhitespace");
+ effects.consume(code4);
+ effects.exit("listItemPrefixWhitespace");
+ return endOfPrefix;
+ }
+ return nok(code4);
+ }
+ function endOfPrefix(code4) {
+ self2.containerState.size = initialSize + self2.sliceSerialize(effects.exit("listItemPrefix"), true).length;
+ return ok3(code4);
+ }
+}
+function tokenizeListContinuation(effects, ok3, nok) {
+ const self2 = this;
+ self2.containerState._closeFlow = void 0;
+ return effects.check(blankLine, onBlank, notBlank);
+ function onBlank(code4) {
+ self2.containerState.furtherBlankLines = self2.containerState.furtherBlankLines || self2.containerState.initialBlankLine;
+ return factorySpace(effects, ok3, "listItemIndent", self2.containerState.size + 1)(code4);
+ }
+ function notBlank(code4) {
+ if (self2.containerState.furtherBlankLines || !markdownSpace(code4)) {
+ self2.containerState.furtherBlankLines = void 0;
+ self2.containerState.initialBlankLine = void 0;
+ return notInCurrentItem(code4);
+ }
+ self2.containerState.furtherBlankLines = void 0;
+ self2.containerState.initialBlankLine = void 0;
+ return effects.attempt(indentConstruct, ok3, notInCurrentItem)(code4);
+ }
+ function notInCurrentItem(code4) {
+ self2.containerState._closeFlow = true;
+ self2.interrupt = void 0;
+ return factorySpace(effects, effects.attempt(list3, ok3, nok), "linePrefix", self2.parser.constructs.disable.null.includes("codeIndented") ? void 0 : 4)(code4);
+ }
+}
+function tokenizeIndent(effects, ok3, nok) {
+ const self2 = this;
+ return factorySpace(effects, afterPrefix, "listItemIndent", self2.containerState.size + 1);
+ function afterPrefix(code4) {
+ const tail = self2.events[self2.events.length - 1];
+ return tail && tail[1].type === "listItemIndent" && tail[2].sliceSerialize(tail[1], true).length === self2.containerState.size ? ok3(code4) : nok(code4);
+ }
+}
+function tokenizeListEnd(effects) {
+ effects.exit(this.containerState.type);
+}
+function tokenizeListItemPrefixWhitespace(effects, ok3, nok) {
+ const self2 = this;
+ return factorySpace(effects, afterPrefix, "listItemPrefixWhitespace", self2.parser.constructs.disable.null.includes("codeIndented") ? void 0 : 4 + 1);
+ function afterPrefix(code4) {
+ const tail = self2.events[self2.events.length - 1];
+ return !markdownSpace(code4) && tail && tail[1].type === "listItemPrefixWhitespace" ? ok3(code4) : nok(code4);
+ }
+}
+var list3, listItemPrefixWhitespaceConstruct, indentConstruct;
+var init_list2 = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/list.js"() {
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ init_blank_line();
+ init_thematic_break2();
+ list3 = {
+ continuation: {
+ tokenize: tokenizeListContinuation
+ },
+ exit: tokenizeListEnd,
+ name: "list",
+ tokenize: tokenizeListStart
+ };
+ listItemPrefixWhitespaceConstruct = {
+ partial: true,
+ tokenize: tokenizeListItemPrefixWhitespace
+ };
+ indentConstruct = {
+ partial: true,
+ tokenize: tokenizeIndent
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/setext-underline.js
+function resolveToSetextUnderline(events, context2) {
+ let index2 = events.length;
+ let content3;
+ let text9;
+ let definition3;
+ while (index2--) {
+ if (events[index2][0] === "enter") {
+ if (events[index2][1].type === "content") {
+ content3 = index2;
+ break;
+ }
+ if (events[index2][1].type === "paragraph") {
+ text9 = index2;
+ }
+ } else {
+ if (events[index2][1].type === "content") {
+ events.splice(index2, 1);
+ }
+ if (!definition3 && events[index2][1].type === "definition") {
+ definition3 = index2;
+ }
+ }
+ }
+ const heading3 = {
+ type: "setextHeading",
+ start: {
+ ...events[content3][1].start
+ },
+ end: {
+ ...events[events.length - 1][1].end
+ }
+ };
+ events[text9][1].type = "setextHeadingText";
+ if (definition3) {
+ events.splice(text9, 0, ["enter", heading3, context2]);
+ events.splice(definition3 + 1, 0, ["exit", events[content3][1], context2]);
+ events[content3][1].end = {
+ ...events[definition3][1].end
+ };
+ } else {
+ events[content3][1] = heading3;
+ }
+ events.push(["exit", heading3, context2]);
+ return events;
+}
+function tokenizeSetextUnderline(effects, ok3, nok) {
+ const self2 = this;
+ let marker;
+ return start;
+ function start(code4) {
+ let index2 = self2.events.length;
+ let paragraph3;
+ while (index2--) {
+ if (self2.events[index2][1].type !== "lineEnding" && self2.events[index2][1].type !== "linePrefix" && self2.events[index2][1].type !== "content") {
+ paragraph3 = self2.events[index2][1].type === "paragraph";
+ break;
+ }
+ }
+ if (!self2.parser.lazy[self2.now().line] && (self2.interrupt || paragraph3)) {
+ effects.enter("setextHeadingLine");
+ marker = code4;
+ return before(code4);
+ }
+ return nok(code4);
+ }
+ function before(code4) {
+ effects.enter("setextHeadingLineSequence");
+ return inside(code4);
+ }
+ function inside(code4) {
+ if (code4 === marker) {
+ effects.consume(code4);
+ return inside;
+ }
+ effects.exit("setextHeadingLineSequence");
+ return markdownSpace(code4) ? factorySpace(effects, after, "lineSuffix")(code4) : after(code4);
+ }
+ function after(code4) {
+ if (code4 === null || markdownLineEnding(code4)) {
+ effects.exit("setextHeadingLine");
+ return ok3(code4);
+ }
+ return nok(code4);
+ }
+}
+var setextUnderline;
+var init_setext_underline = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/lib/setext-underline.js"() {
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ setextUnderline = {
+ name: "setextUnderline",
+ resolveTo: resolveToSetextUnderline,
+ tokenize: tokenizeSetextUnderline
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/index.js
+var init_micromark_core_commonmark = __esm({
+ "node_modules/.pnpm/micromark-core-commonmark@2.0.3/node_modules/micromark-core-commonmark/index.js"() {
+ init_attention();
+ init_autolink();
+ init_blank_line();
+ init_block_quote();
+ init_character_escape();
+ init_character_reference();
+ init_code_fenced();
+ init_code_indented();
+ init_code_text();
+ init_content();
+ init_definition2();
+ init_hard_break_escape();
+ init_heading_atx();
+ init_html_flow();
+ init_html_text();
+ init_label_end();
+ init_label_start_image();
+ init_label_start_link();
+ init_line_ending();
+ init_list2();
+ init_setext_underline();
+ init_thematic_break2();
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-footnote@2.1.0/node_modules/micromark-extension-gfm-footnote/lib/syntax.js
+function gfmFootnote() {
+ return {
+ document: {
+ [91]: {
+ name: "gfmFootnoteDefinition",
+ tokenize: tokenizeDefinitionStart,
+ continuation: {
+ tokenize: tokenizeDefinitionContinuation
+ },
+ exit: gfmFootnoteDefinitionEnd
+ }
+ },
+ text: {
+ [91]: {
+ name: "gfmFootnoteCall",
+ tokenize: tokenizeGfmFootnoteCall
+ },
+ [93]: {
+ name: "gfmPotentialFootnoteCall",
+ add: "after",
+ tokenize: tokenizePotentialGfmFootnoteCall,
+ resolveTo: resolveToPotentialGfmFootnoteCall
+ }
+ }
+ };
+}
+function tokenizePotentialGfmFootnoteCall(effects, ok3, nok) {
+ const self2 = this;
+ let index2 = self2.events.length;
+ const defined = self2.parser.gfmFootnotes || (self2.parser.gfmFootnotes = []);
+ let labelStart;
+ while (index2--) {
+ const token = self2.events[index2][1];
+ if (token.type === "labelImage") {
+ labelStart = token;
+ break;
+ }
+ if (token.type === "gfmFootnoteCall" || token.type === "labelLink" || token.type === "label" || token.type === "image" || token.type === "link") {
+ break;
+ }
+ }
+ return start;
+ function start(code4) {
+ if (!labelStart || !labelStart._balanced) {
+ return nok(code4);
+ }
+ const id = normalizeIdentifier(self2.sliceSerialize({
+ start: labelStart.end,
+ end: self2.now()
+ }));
+ if (id.codePointAt(0) !== 94 || !defined.includes(id.slice(1))) {
+ return nok(code4);
+ }
+ effects.enter("gfmFootnoteCallLabelMarker");
+ effects.consume(code4);
+ effects.exit("gfmFootnoteCallLabelMarker");
+ return ok3(code4);
+ }
+}
+function resolveToPotentialGfmFootnoteCall(events, context2) {
+ let index2 = events.length;
+ let labelStart;
+ while (index2--) {
+ if (events[index2][1].type === "labelImage" && events[index2][0] === "enter") {
+ labelStart = events[index2][1];
+ break;
+ }
+ }
+ events[index2 + 1][1].type = "data";
+ events[index2 + 3][1].type = "gfmFootnoteCallLabelMarker";
+ const call = {
+ type: "gfmFootnoteCall",
+ start: Object.assign({}, events[index2 + 3][1].start),
+ end: Object.assign({}, events[events.length - 1][1].end)
+ };
+ const marker = {
+ type: "gfmFootnoteCallMarker",
+ start: Object.assign({}, events[index2 + 3][1].end),
+ end: Object.assign({}, events[index2 + 3][1].end)
+ };
+ marker.end.column++;
+ marker.end.offset++;
+ marker.end._bufferIndex++;
+ const string3 = {
+ type: "gfmFootnoteCallString",
+ start: Object.assign({}, marker.end),
+ end: Object.assign({}, events[events.length - 1][1].start)
+ };
+ const chunk = {
+ type: "chunkString",
+ contentType: "string",
+ start: Object.assign({}, string3.start),
+ end: Object.assign({}, string3.end)
+ };
+ const replacement = [
+ // Take the `labelImageMarker` (now `data`, the `!`)
+ events[index2 + 1],
+ events[index2 + 2],
+ ["enter", call, context2],
+ // The `[`
+ events[index2 + 3],
+ events[index2 + 4],
+ // The `^`.
+ ["enter", marker, context2],
+ ["exit", marker, context2],
+ // Everything in between.
+ ["enter", string3, context2],
+ ["enter", chunk, context2],
+ ["exit", chunk, context2],
+ ["exit", string3, context2],
+ // The ending (`]`, properly parsed and labelled).
+ events[events.length - 2],
+ events[events.length - 1],
+ ["exit", call, context2]
+ ];
+ events.splice(index2, events.length - index2 + 1, ...replacement);
+ return events;
+}
+function tokenizeGfmFootnoteCall(effects, ok3, nok) {
+ const self2 = this;
+ const defined = self2.parser.gfmFootnotes || (self2.parser.gfmFootnotes = []);
+ let size = 0;
+ let data8;
+ return start;
+ function start(code4) {
+ effects.enter("gfmFootnoteCall");
+ effects.enter("gfmFootnoteCallLabelMarker");
+ effects.consume(code4);
+ effects.exit("gfmFootnoteCallLabelMarker");
+ return callStart;
+ }
+ function callStart(code4) {
+ if (code4 !== 94) return nok(code4);
+ effects.enter("gfmFootnoteCallMarker");
+ effects.consume(code4);
+ effects.exit("gfmFootnoteCallMarker");
+ effects.enter("gfmFootnoteCallString");
+ effects.enter("chunkString").contentType = "string";
+ return callData;
+ }
+ function callData(code4) {
+ if (
+ // Too long.
+ size > 999 || // Closing brace with nothing.
+ code4 === 93 && !data8 || // Space or tab is not supported by GFM for some reason.
+ // `\n` and `[` not being supported makes sense.
+ code4 === null || code4 === 91 || markdownLineEndingOrSpace(code4)
+ ) {
+ return nok(code4);
+ }
+ if (code4 === 93) {
+ effects.exit("chunkString");
+ const token = effects.exit("gfmFootnoteCallString");
+ if (!defined.includes(normalizeIdentifier(self2.sliceSerialize(token)))) {
+ return nok(code4);
+ }
+ effects.enter("gfmFootnoteCallLabelMarker");
+ effects.consume(code4);
+ effects.exit("gfmFootnoteCallLabelMarker");
+ effects.exit("gfmFootnoteCall");
+ return ok3;
+ }
+ if (!markdownLineEndingOrSpace(code4)) {
+ data8 = true;
+ }
+ size++;
+ effects.consume(code4);
+ return code4 === 92 ? callEscape : callData;
+ }
+ function callEscape(code4) {
+ if (code4 === 91 || code4 === 92 || code4 === 93) {
+ effects.consume(code4);
+ size++;
+ return callData;
+ }
+ return callData(code4);
+ }
+}
+function tokenizeDefinitionStart(effects, ok3, nok) {
+ const self2 = this;
+ const defined = self2.parser.gfmFootnotes || (self2.parser.gfmFootnotes = []);
+ let identifier;
+ let size = 0;
+ let data8;
+ return start;
+ function start(code4) {
+ effects.enter("gfmFootnoteDefinition")._container = true;
+ effects.enter("gfmFootnoteDefinitionLabel");
+ effects.enter("gfmFootnoteDefinitionLabelMarker");
+ effects.consume(code4);
+ effects.exit("gfmFootnoteDefinitionLabelMarker");
+ return labelAtMarker;
+ }
+ function labelAtMarker(code4) {
+ if (code4 === 94) {
+ effects.enter("gfmFootnoteDefinitionMarker");
+ effects.consume(code4);
+ effects.exit("gfmFootnoteDefinitionMarker");
+ effects.enter("gfmFootnoteDefinitionLabelString");
+ effects.enter("chunkString").contentType = "string";
+ return labelInside;
+ }
+ return nok(code4);
+ }
+ function labelInside(code4) {
+ if (
+ // Too long.
+ size > 999 || // Closing brace with nothing.
+ code4 === 93 && !data8 || // Space or tab is not supported by GFM for some reason.
+ // `\n` and `[` not being supported makes sense.
+ code4 === null || code4 === 91 || markdownLineEndingOrSpace(code4)
+ ) {
+ return nok(code4);
+ }
+ if (code4 === 93) {
+ effects.exit("chunkString");
+ const token = effects.exit("gfmFootnoteDefinitionLabelString");
+ identifier = normalizeIdentifier(self2.sliceSerialize(token));
+ effects.enter("gfmFootnoteDefinitionLabelMarker");
+ effects.consume(code4);
+ effects.exit("gfmFootnoteDefinitionLabelMarker");
+ effects.exit("gfmFootnoteDefinitionLabel");
+ return labelAfter;
+ }
+ if (!markdownLineEndingOrSpace(code4)) {
+ data8 = true;
+ }
+ size++;
+ effects.consume(code4);
+ return code4 === 92 ? labelEscape : labelInside;
+ }
+ function labelEscape(code4) {
+ if (code4 === 91 || code4 === 92 || code4 === 93) {
+ effects.consume(code4);
+ size++;
+ return labelInside;
+ }
+ return labelInside(code4);
+ }
+ function labelAfter(code4) {
+ if (code4 === 58) {
+ effects.enter("definitionMarker");
+ effects.consume(code4);
+ effects.exit("definitionMarker");
+ if (!defined.includes(identifier)) {
+ defined.push(identifier);
+ }
+ return factorySpace(effects, whitespaceAfter, "gfmFootnoteDefinitionWhitespace");
+ }
+ return nok(code4);
+ }
+ function whitespaceAfter(code4) {
+ return ok3(code4);
+ }
+}
+function tokenizeDefinitionContinuation(effects, ok3, nok) {
+ return effects.check(blankLine, ok3, effects.attempt(indent2, ok3, nok));
+}
+function gfmFootnoteDefinitionEnd(effects) {
+ effects.exit("gfmFootnoteDefinition");
+}
+function tokenizeIndent2(effects, ok3, nok) {
+ const self2 = this;
+ return factorySpace(effects, afterPrefix, "gfmFootnoteDefinitionIndent", 4 + 1);
+ function afterPrefix(code4) {
+ const tail = self2.events[self2.events.length - 1];
+ return tail && tail[1].type === "gfmFootnoteDefinitionIndent" && tail[2].sliceSerialize(tail[1], true).length === 4 ? ok3(code4) : nok(code4);
+ }
+}
+var indent2;
+var init_syntax2 = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-footnote@2.1.0/node_modules/micromark-extension-gfm-footnote/lib/syntax.js"() {
+ init_micromark_core_commonmark();
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ init_micromark_util_normalize_identifier();
+ indent2 = {
+ tokenize: tokenizeIndent2,
+ partial: true
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-footnote@2.1.0/node_modules/micromark-extension-gfm-footnote/lib/html.js
+function defaultBackLabel(referenceIndex, rereferenceIndex) {
+ return "Back to reference " + (referenceIndex + 1) + (rereferenceIndex > 1 ? "-" + rereferenceIndex : "");
+}
+function gfmFootnoteHtml(options) {
+ const config3 = options || emptyOptions2;
+ const label = config3.label || "Footnotes";
+ const labelTagName = config3.labelTagName || "h2";
+ const labelAttributes = config3.labelAttributes === null || config3.labelAttributes === void 0 ? 'class="sr-only"' : config3.labelAttributes;
+ const backLabel = config3.backLabel || defaultBackLabel;
+ const clobberPrefix = config3.clobberPrefix === null || config3.clobberPrefix === void 0 ? "user-content-" : config3.clobberPrefix;
+ return {
+ enter: {
+ gfmFootnoteDefinition() {
+ const stack = this.getData("tightStack");
+ stack.push(false);
+ },
+ gfmFootnoteDefinitionLabelString() {
+ this.buffer();
+ },
+ gfmFootnoteCallString() {
+ this.buffer();
+ }
+ },
+ exit: {
+ gfmFootnoteDefinition() {
+ let definitions = this.getData("gfmFootnoteDefinitions");
+ const footnoteStack = this.getData("gfmFootnoteDefinitionStack");
+ const tightStack = this.getData("tightStack");
+ const current = footnoteStack.pop();
+ const value2 = this.resume();
+ if (!definitions) {
+ this.setData("gfmFootnoteDefinitions", definitions = {});
+ }
+ if (!own4.call(definitions, current)) definitions[current] = value2;
+ tightStack.pop();
+ this.setData("slurpOneLineEnding", true);
+ this.setData("lastWasTag");
+ },
+ gfmFootnoteDefinitionLabelString(token) {
+ let footnoteStack = this.getData("gfmFootnoteDefinitionStack");
+ if (!footnoteStack) {
+ this.setData("gfmFootnoteDefinitionStack", footnoteStack = []);
+ }
+ footnoteStack.push(normalizeIdentifier(this.sliceSerialize(token)));
+ this.resume();
+ this.buffer();
+ },
+ gfmFootnoteCallString(token) {
+ let calls = this.getData("gfmFootnoteCallOrder");
+ let counts = this.getData("gfmFootnoteCallCounts");
+ const id = normalizeIdentifier(this.sliceSerialize(token));
+ let counter2;
+ this.resume();
+ if (!calls) this.setData("gfmFootnoteCallOrder", calls = []);
+ if (!counts) this.setData("gfmFootnoteCallCounts", counts = {});
+ const index2 = calls.indexOf(id);
+ const safeId = sanitizeUri(id.toLowerCase());
+ if (index2 === -1) {
+ calls.push(id);
+ counts[id] = 1;
+ counter2 = calls.length;
+ } else {
+ counts[id]++;
+ counter2 = index2 + 1;
+ }
+ const reuseCounter = counts[id];
+ this.tag(' 1 ? "-" + reuseCounter : "") + '" data-footnote-ref="" aria-describedby="footnote-label">' + String(counter2) + "");
+ },
+ null() {
+ const calls = this.getData("gfmFootnoteCallOrder") || [];
+ const counts = this.getData("gfmFootnoteCallCounts") || {};
+ const definitions = this.getData("gfmFootnoteDefinitions") || {};
+ let index2 = -1;
+ if (calls.length > 0) {
+ this.lineEndingIfNeeded();
+ this.tag('");
+ }
+ }
+ }
+ };
+}
+var own4, emptyOptions2;
+var init_html3 = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-footnote@2.1.0/node_modules/micromark-extension-gfm-footnote/lib/html.js"() {
+ init_micromark_util_normalize_identifier();
+ init_micromark_util_sanitize_uri();
+ own4 = {}.hasOwnProperty;
+ emptyOptions2 = {};
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-footnote@2.1.0/node_modules/micromark-extension-gfm-footnote/index.js
+var init_micromark_extension_gfm_footnote = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-footnote@2.1.0/node_modules/micromark-extension-gfm-footnote/index.js"() {
+ init_syntax2();
+ init_html3();
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-strikethrough@2.1.0/node_modules/micromark-extension-gfm-strikethrough/lib/html.js
+function gfmStrikethroughHtml() {
+ return {
+ enter: {
+ strikethrough() {
+ this.tag("");
+ }
+ },
+ exit: {
+ strikethrough() {
+ this.tag("");
+ }
+ }
+ };
+}
+var init_html4 = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-strikethrough@2.1.0/node_modules/micromark-extension-gfm-strikethrough/lib/html.js"() {
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-strikethrough@2.1.0/node_modules/micromark-extension-gfm-strikethrough/lib/syntax.js
+function gfmStrikethrough(options) {
+ const options_ = options || {};
+ let single2 = options_.singleTilde;
+ const tokenizer = {
+ name: "strikethrough",
+ tokenize: tokenizeStrikethrough,
+ resolveAll: resolveAllStrikethrough
+ };
+ if (single2 === null || single2 === void 0) {
+ single2 = true;
+ }
+ return {
+ text: {
+ [126]: tokenizer
+ },
+ insideSpan: {
+ null: [tokenizer]
+ },
+ attentionMarkers: {
+ null: [126]
+ }
+ };
+ function resolveAllStrikethrough(events, context2) {
+ let index2 = -1;
+ while (++index2 < events.length) {
+ if (events[index2][0] === "enter" && events[index2][1].type === "strikethroughSequenceTemporary" && events[index2][1]._close) {
+ let open = index2;
+ while (open--) {
+ if (events[open][0] === "exit" && events[open][1].type === "strikethroughSequenceTemporary" && events[open][1]._open && // If the sizes are the same:
+ events[index2][1].end.offset - events[index2][1].start.offset === events[open][1].end.offset - events[open][1].start.offset) {
+ events[index2][1].type = "strikethroughSequence";
+ events[open][1].type = "strikethroughSequence";
+ const strikethrough3 = {
+ type: "strikethrough",
+ start: Object.assign({}, events[open][1].start),
+ end: Object.assign({}, events[index2][1].end)
+ };
+ const text9 = {
+ type: "strikethroughText",
+ start: Object.assign({}, events[open][1].end),
+ end: Object.assign({}, events[index2][1].start)
+ };
+ const nextEvents = [["enter", strikethrough3, context2], ["enter", events[open][1], context2], ["exit", events[open][1], context2], ["enter", text9, context2]];
+ const insideSpan2 = context2.parser.constructs.insideSpan.null;
+ if (insideSpan2) {
+ splice(nextEvents, nextEvents.length, 0, resolveAll(insideSpan2, events.slice(open + 1, index2), context2));
+ }
+ splice(nextEvents, nextEvents.length, 0, [["exit", text9, context2], ["enter", events[index2][1], context2], ["exit", events[index2][1], context2], ["exit", strikethrough3, context2]]);
+ splice(events, open - 1, index2 - open + 3, nextEvents);
+ index2 = open + nextEvents.length - 2;
+ break;
+ }
+ }
+ }
+ }
+ index2 = -1;
+ while (++index2 < events.length) {
+ if (events[index2][1].type === "strikethroughSequenceTemporary") {
+ events[index2][1].type = "data";
+ }
+ }
+ return events;
+ }
+ function tokenizeStrikethrough(effects, ok3, nok) {
+ const previous3 = this.previous;
+ const events = this.events;
+ let size = 0;
+ return start;
+ function start(code4) {
+ if (previous3 === 126 && events[events.length - 1][1].type !== "characterEscape") {
+ return nok(code4);
+ }
+ effects.enter("strikethroughSequenceTemporary");
+ return more(code4);
+ }
+ function more(code4) {
+ const before = classifyCharacter(previous3);
+ if (code4 === 126) {
+ if (size > 1) return nok(code4);
+ effects.consume(code4);
+ size++;
+ return more;
+ }
+ if (size < 2 && !single2) return nok(code4);
+ const token = effects.exit("strikethroughSequenceTemporary");
+ const after = classifyCharacter(code4);
+ token._open = !after || after === 2 && Boolean(before);
+ token._close = !before || before === 2 && Boolean(after);
+ return ok3(code4);
+ }
+ }
+}
+var init_syntax3 = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-strikethrough@2.1.0/node_modules/micromark-extension-gfm-strikethrough/lib/syntax.js"() {
+ init_micromark_util_chunked();
+ init_micromark_util_classify_character();
+ init_micromark_util_resolve_all();
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-strikethrough@2.1.0/node_modules/micromark-extension-gfm-strikethrough/index.js
+var init_micromark_extension_gfm_strikethrough = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-strikethrough@2.1.0/node_modules/micromark-extension-gfm-strikethrough/index.js"() {
+ init_html4();
+ init_syntax3();
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-table@2.1.1/node_modules/micromark-extension-gfm-table/lib/html.js
+function gfmTableHtml() {
+ return {
+ enter: {
+ table(token) {
+ const tableAlign = token._align;
+ this.lineEndingIfNeeded();
+ this.tag("");
+ this.setData("tableAlign", tableAlign);
+ },
+ tableBody() {
+ this.tag("");
+ },
+ tableData() {
+ const tableAlign = this.getData("tableAlign");
+ const tableColumn = this.getData("tableColumn");
+ const align = alignment[tableAlign[tableColumn]];
+ if (align === void 0) {
+ this.buffer();
+ } else {
+ this.lineEndingIfNeeded();
+ this.tag("");
+ }
+ },
+ tableHead() {
+ this.lineEndingIfNeeded();
+ this.tag("");
+ },
+ tableHeader() {
+ const tableAlign = this.getData("tableAlign");
+ const tableColumn = this.getData("tableColumn");
+ const align = alignment[tableAlign[tableColumn]];
+ this.lineEndingIfNeeded();
+ this.tag("| ");
+ },
+ tableRow() {
+ this.setData("tableColumn", 0);
+ this.lineEndingIfNeeded();
+ this.tag(" | ");
+ }
+ },
+ exit: {
+ // Overwrite the default code text data handler to unescape escaped pipes when
+ // they are in tables.
+ codeTextData(token) {
+ let value2 = this.sliceSerialize(token);
+ if (this.getData("tableAlign")) {
+ value2 = value2.replace(/\\([\\|])/g, replace2);
+ }
+ this.raw(this.encode(value2));
+ },
+ table() {
+ this.setData("tableAlign");
+ this.setData("slurpAllLineEndings");
+ this.lineEndingIfNeeded();
+ this.tag(" |
");
+ },
+ tableBody() {
+ this.lineEndingIfNeeded();
+ this.tag("");
+ },
+ tableData() {
+ const tableAlign = this.getData("tableAlign");
+ const tableColumn = this.getData("tableColumn");
+ if (tableColumn in tableAlign) {
+ this.tag("");
+ this.setData("tableColumn", tableColumn + 1);
+ } else {
+ this.resume();
+ }
+ },
+ tableHead() {
+ this.lineEndingIfNeeded();
+ this.tag("");
+ },
+ tableHeader() {
+ const tableColumn = this.getData("tableColumn");
+ this.tag("");
+ this.setData("tableColumn", tableColumn + 1);
+ },
+ tableRow() {
+ const tableAlign = this.getData("tableAlign");
+ let tableColumn = this.getData("tableColumn");
+ while (tableColumn < tableAlign.length) {
+ this.lineEndingIfNeeded();
+ this.tag(" | ");
+ tableColumn++;
+ }
+ this.setData("tableColumn", tableColumn);
+ this.lineEndingIfNeeded();
+ this.tag("");
+ }
+ }
+ };
+}
+function replace2($0, $1) {
+ return $1 === "|" ? $1 : $0;
+}
+var alignment;
+var init_html5 = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-table@2.1.1/node_modules/micromark-extension-gfm-table/lib/html.js"() {
+ alignment = {
+ none: "",
+ left: ' align="left"',
+ right: ' align="right"',
+ center: ' align="center"'
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-table@2.1.1/node_modules/micromark-extension-gfm-table/lib/edit-map.js
+function addImplementation(editMap, at, remove2, add3) {
+ let index2 = 0;
+ if (remove2 === 0 && add3.length === 0) {
+ return;
+ }
+ while (index2 < editMap.map.length) {
+ if (editMap.map[index2][0] === at) {
+ editMap.map[index2][1] += remove2;
+ editMap.map[index2][2].push(...add3);
+ return;
+ }
+ index2 += 1;
+ }
+ editMap.map.push([at, remove2, add3]);
+}
+var EditMap;
+var init_edit_map = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-table@2.1.1/node_modules/micromark-extension-gfm-table/lib/edit-map.js"() {
+ EditMap = class {
+ /**
+ * Create a new edit map.
+ */
+ constructor() {
+ this.map = [];
+ }
+ /**
+ * Create an edit: a remove and/or add at a certain place.
+ *
+ * @param {number} index
+ * @param {number} remove
+ * @param {Array} add
+ * @returns {undefined}
+ */
+ add(index2, remove2, add3) {
+ addImplementation(this, index2, remove2, add3);
+ }
+ // To do: add this when moving to `micromark`.
+ // /**
+ // * Create an edit: but insert `add` before existing additions.
+ // *
+ // * @param {number} index
+ // * @param {number} remove
+ // * @param {Array} add
+ // * @returns {undefined}
+ // */
+ // addBefore(index, remove, add) {
+ // addImplementation(this, index, remove, add, true)
+ // }
+ /**
+ * Done, change the events.
+ *
+ * @param {Array} events
+ * @returns {undefined}
+ */
+ consume(events) {
+ this.map.sort(function(a5, b5) {
+ return a5[0] - b5[0];
+ });
+ if (this.map.length === 0) {
+ return;
+ }
+ let index2 = this.map.length;
+ const vecs = [];
+ while (index2 > 0) {
+ index2 -= 1;
+ vecs.push(events.slice(this.map[index2][0] + this.map[index2][1]), this.map[index2][2]);
+ events.length = this.map[index2][0];
+ }
+ vecs.push(events.slice());
+ events.length = 0;
+ let slice = vecs.pop();
+ while (slice) {
+ for (const element4 of slice) {
+ events.push(element4);
+ }
+ slice = vecs.pop();
+ }
+ this.map.length = 0;
+ }
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-table@2.1.1/node_modules/micromark-extension-gfm-table/lib/infer.js
+function gfmTableAlign(events, index2) {
+ let inDelimiterRow = false;
+ const align = [];
+ while (index2 < events.length) {
+ const event = events[index2];
+ if (inDelimiterRow) {
+ if (event[0] === "enter") {
+ if (event[1].type === "tableContent") {
+ align.push(events[index2 + 1][1].type === "tableDelimiterMarker" ? "left" : "none");
+ }
+ } else if (event[1].type === "tableContent") {
+ if (events[index2 - 1][1].type === "tableDelimiterMarker") {
+ const alignIndex = align.length - 1;
+ align[alignIndex] = align[alignIndex] === "left" ? "center" : "right";
+ }
+ } else if (event[1].type === "tableDelimiterRow") {
+ break;
+ }
+ } else if (event[0] === "enter" && event[1].type === "tableDelimiterRow") {
+ inDelimiterRow = true;
+ }
+ index2 += 1;
+ }
+ return align;
+}
+var init_infer = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-table@2.1.1/node_modules/micromark-extension-gfm-table/lib/infer.js"() {
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-table@2.1.1/node_modules/micromark-extension-gfm-table/lib/syntax.js
+function gfmTable() {
+ return {
+ flow: {
+ null: {
+ name: "table",
+ tokenize: tokenizeTable,
+ resolveAll: resolveTable
+ }
+ }
+ };
+}
+function tokenizeTable(effects, ok3, nok) {
+ const self2 = this;
+ let size = 0;
+ let sizeB = 0;
+ let seen;
+ return start;
+ function start(code4) {
+ let index2 = self2.events.length - 1;
+ while (index2 > -1) {
+ const type5 = self2.events[index2][1].type;
+ if (type5 === "lineEnding" || // Note: markdown-rs uses `whitespace` instead of `linePrefix`
+ type5 === "linePrefix") index2--;
+ else break;
+ }
+ const tail = index2 > -1 ? self2.events[index2][1].type : null;
+ const next2 = tail === "tableHead" || tail === "tableRow" ? bodyRowStart : headRowBefore;
+ if (next2 === bodyRowStart && self2.parser.lazy[self2.now().line]) {
+ return nok(code4);
+ }
+ return next2(code4);
+ }
+ function headRowBefore(code4) {
+ effects.enter("tableHead");
+ effects.enter("tableRow");
+ return headRowStart(code4);
+ }
+ function headRowStart(code4) {
+ if (code4 === 124) {
+ return headRowBreak(code4);
+ }
+ seen = true;
+ sizeB += 1;
+ return headRowBreak(code4);
+ }
+ function headRowBreak(code4) {
+ if (code4 === null) {
+ return nok(code4);
+ }
+ if (markdownLineEnding(code4)) {
+ if (sizeB > 1) {
+ sizeB = 0;
+ self2.interrupt = true;
+ effects.exit("tableRow");
+ effects.enter("lineEnding");
+ effects.consume(code4);
+ effects.exit("lineEnding");
+ return headDelimiterStart;
+ }
+ return nok(code4);
+ }
+ if (markdownSpace(code4)) {
+ return factorySpace(effects, headRowBreak, "whitespace")(code4);
+ }
+ sizeB += 1;
+ if (seen) {
+ seen = false;
+ size += 1;
+ }
+ if (code4 === 124) {
+ effects.enter("tableCellDivider");
+ effects.consume(code4);
+ effects.exit("tableCellDivider");
+ seen = true;
+ return headRowBreak;
+ }
+ effects.enter("data");
+ return headRowData(code4);
+ }
+ function headRowData(code4) {
+ if (code4 === null || code4 === 124 || markdownLineEndingOrSpace(code4)) {
+ effects.exit("data");
+ return headRowBreak(code4);
+ }
+ effects.consume(code4);
+ return code4 === 92 ? headRowEscape : headRowData;
+ }
+ function headRowEscape(code4) {
+ if (code4 === 92 || code4 === 124) {
+ effects.consume(code4);
+ return headRowData;
+ }
+ return headRowData(code4);
+ }
+ function headDelimiterStart(code4) {
+ self2.interrupt = false;
+ if (self2.parser.lazy[self2.now().line]) {
+ return nok(code4);
+ }
+ effects.enter("tableDelimiterRow");
+ seen = false;
+ if (markdownSpace(code4)) {
+ return factorySpace(effects, headDelimiterBefore, "linePrefix", self2.parser.constructs.disable.null.includes("codeIndented") ? void 0 : 4)(code4);
+ }
+ return headDelimiterBefore(code4);
+ }
+ function headDelimiterBefore(code4) {
+ if (code4 === 45 || code4 === 58) {
+ return headDelimiterValueBefore(code4);
+ }
+ if (code4 === 124) {
+ seen = true;
+ effects.enter("tableCellDivider");
+ effects.consume(code4);
+ effects.exit("tableCellDivider");
+ return headDelimiterCellBefore;
+ }
+ return headDelimiterNok(code4);
+ }
+ function headDelimiterCellBefore(code4) {
+ if (markdownSpace(code4)) {
+ return factorySpace(effects, headDelimiterValueBefore, "whitespace")(code4);
+ }
+ return headDelimiterValueBefore(code4);
+ }
+ function headDelimiterValueBefore(code4) {
+ if (code4 === 58) {
+ sizeB += 1;
+ seen = true;
+ effects.enter("tableDelimiterMarker");
+ effects.consume(code4);
+ effects.exit("tableDelimiterMarker");
+ return headDelimiterLeftAlignmentAfter;
+ }
+ if (code4 === 45) {
+ sizeB += 1;
+ return headDelimiterLeftAlignmentAfter(code4);
+ }
+ if (code4 === null || markdownLineEnding(code4)) {
+ return headDelimiterCellAfter(code4);
+ }
+ return headDelimiterNok(code4);
+ }
+ function headDelimiterLeftAlignmentAfter(code4) {
+ if (code4 === 45) {
+ effects.enter("tableDelimiterFiller");
+ return headDelimiterFiller(code4);
+ }
+ return headDelimiterNok(code4);
+ }
+ function headDelimiterFiller(code4) {
+ if (code4 === 45) {
+ effects.consume(code4);
+ return headDelimiterFiller;
+ }
+ if (code4 === 58) {
+ seen = true;
+ effects.exit("tableDelimiterFiller");
+ effects.enter("tableDelimiterMarker");
+ effects.consume(code4);
+ effects.exit("tableDelimiterMarker");
+ return headDelimiterRightAlignmentAfter;
+ }
+ effects.exit("tableDelimiterFiller");
+ return headDelimiterRightAlignmentAfter(code4);
+ }
+ function headDelimiterRightAlignmentAfter(code4) {
+ if (markdownSpace(code4)) {
+ return factorySpace(effects, headDelimiterCellAfter, "whitespace")(code4);
+ }
+ return headDelimiterCellAfter(code4);
+ }
+ function headDelimiterCellAfter(code4) {
+ if (code4 === 124) {
+ return headDelimiterBefore(code4);
+ }
+ if (code4 === null || markdownLineEnding(code4)) {
+ if (!seen || size !== sizeB) {
+ return headDelimiterNok(code4);
+ }
+ effects.exit("tableDelimiterRow");
+ effects.exit("tableHead");
+ return ok3(code4);
+ }
+ return headDelimiterNok(code4);
+ }
+ function headDelimiterNok(code4) {
+ return nok(code4);
+ }
+ function bodyRowStart(code4) {
+ effects.enter("tableRow");
+ return bodyRowBreak(code4);
+ }
+ function bodyRowBreak(code4) {
+ if (code4 === 124) {
+ effects.enter("tableCellDivider");
+ effects.consume(code4);
+ effects.exit("tableCellDivider");
+ return bodyRowBreak;
+ }
+ if (code4 === null || markdownLineEnding(code4)) {
+ effects.exit("tableRow");
+ return ok3(code4);
+ }
+ if (markdownSpace(code4)) {
+ return factorySpace(effects, bodyRowBreak, "whitespace")(code4);
+ }
+ effects.enter("data");
+ return bodyRowData(code4);
+ }
+ function bodyRowData(code4) {
+ if (code4 === null || code4 === 124 || markdownLineEndingOrSpace(code4)) {
+ effects.exit("data");
+ return bodyRowBreak(code4);
+ }
+ effects.consume(code4);
+ return code4 === 92 ? bodyRowEscape : bodyRowData;
+ }
+ function bodyRowEscape(code4) {
+ if (code4 === 92 || code4 === 124) {
+ effects.consume(code4);
+ return bodyRowData;
+ }
+ return bodyRowData(code4);
+ }
+}
+function resolveTable(events, context2) {
+ let index2 = -1;
+ let inFirstCellAwaitingPipe = true;
+ let rowKind = 0;
+ let lastCell = [0, 0, 0, 0];
+ let cell2 = [0, 0, 0, 0];
+ let afterHeadAwaitingFirstBodyRow = false;
+ let lastTableEnd = 0;
+ let currentTable;
+ let currentBody;
+ let currentCell;
+ const map7 = new EditMap();
+ while (++index2 < events.length) {
+ const event = events[index2];
+ const token = event[1];
+ if (event[0] === "enter") {
+ if (token.type === "tableHead") {
+ afterHeadAwaitingFirstBodyRow = false;
+ if (lastTableEnd !== 0) {
+ flushTableEnd(map7, context2, lastTableEnd, currentTable, currentBody);
+ currentBody = void 0;
+ lastTableEnd = 0;
+ }
+ currentTable = {
+ type: "table",
+ start: Object.assign({}, token.start),
+ // Note: correct end is set later.
+ end: Object.assign({}, token.end)
+ };
+ map7.add(index2, 0, [["enter", currentTable, context2]]);
+ } else if (token.type === "tableRow" || token.type === "tableDelimiterRow") {
+ inFirstCellAwaitingPipe = true;
+ currentCell = void 0;
+ lastCell = [0, 0, 0, 0];
+ cell2 = [0, index2 + 1, 0, 0];
+ if (afterHeadAwaitingFirstBodyRow) {
+ afterHeadAwaitingFirstBodyRow = false;
+ currentBody = {
+ type: "tableBody",
+ start: Object.assign({}, token.start),
+ // Note: correct end is set later.
+ end: Object.assign({}, token.end)
+ };
+ map7.add(index2, 0, [["enter", currentBody, context2]]);
+ }
+ rowKind = token.type === "tableDelimiterRow" ? 2 : currentBody ? 3 : 1;
+ } else if (rowKind && (token.type === "data" || token.type === "tableDelimiterMarker" || token.type === "tableDelimiterFiller")) {
+ inFirstCellAwaitingPipe = false;
+ if (cell2[2] === 0) {
+ if (lastCell[1] !== 0) {
+ cell2[0] = cell2[1];
+ currentCell = flushCell(map7, context2, lastCell, rowKind, void 0, currentCell);
+ lastCell = [0, 0, 0, 0];
+ }
+ cell2[2] = index2;
+ }
+ } else if (token.type === "tableCellDivider") {
+ if (inFirstCellAwaitingPipe) {
+ inFirstCellAwaitingPipe = false;
+ } else {
+ if (lastCell[1] !== 0) {
+ cell2[0] = cell2[1];
+ currentCell = flushCell(map7, context2, lastCell, rowKind, void 0, currentCell);
+ }
+ lastCell = cell2;
+ cell2 = [lastCell[1], index2, 0, 0];
+ }
+ }
+ } else if (token.type === "tableHead") {
+ afterHeadAwaitingFirstBodyRow = true;
+ lastTableEnd = index2;
+ } else if (token.type === "tableRow" || token.type === "tableDelimiterRow") {
+ lastTableEnd = index2;
+ if (lastCell[1] !== 0) {
+ cell2[0] = cell2[1];
+ currentCell = flushCell(map7, context2, lastCell, rowKind, index2, currentCell);
+ } else if (cell2[1] !== 0) {
+ currentCell = flushCell(map7, context2, cell2, rowKind, index2, currentCell);
+ }
+ rowKind = 0;
+ } else if (rowKind && (token.type === "data" || token.type === "tableDelimiterMarker" || token.type === "tableDelimiterFiller")) {
+ cell2[3] = index2;
+ }
+ }
+ if (lastTableEnd !== 0) {
+ flushTableEnd(map7, context2, lastTableEnd, currentTable, currentBody);
+ }
+ map7.consume(context2.events);
+ index2 = -1;
+ while (++index2 < context2.events.length) {
+ const event = context2.events[index2];
+ if (event[0] === "enter" && event[1].type === "table") {
+ event[1]._align = gfmTableAlign(context2.events, index2);
+ }
+ }
+ return events;
+}
+function flushCell(map7, context2, range2, rowKind, rowEnd, previousCell) {
+ const groupName = rowKind === 1 ? "tableHeader" : rowKind === 2 ? "tableDelimiter" : "tableData";
+ const valueName = "tableContent";
+ if (range2[0] !== 0) {
+ previousCell.end = Object.assign({}, getPoint(context2.events, range2[0]));
+ map7.add(range2[0], 0, [["exit", previousCell, context2]]);
+ }
+ const now2 = getPoint(context2.events, range2[1]);
+ previousCell = {
+ type: groupName,
+ start: Object.assign({}, now2),
+ // Note: correct end is set later.
+ end: Object.assign({}, now2)
+ };
+ map7.add(range2[1], 0, [["enter", previousCell, context2]]);
+ if (range2[2] !== 0) {
+ const relatedStart = getPoint(context2.events, range2[2]);
+ const relatedEnd = getPoint(context2.events, range2[3]);
+ const valueToken = {
+ type: valueName,
+ start: Object.assign({}, relatedStart),
+ end: Object.assign({}, relatedEnd)
+ };
+ map7.add(range2[2], 0, [["enter", valueToken, context2]]);
+ if (rowKind !== 2) {
+ const start = context2.events[range2[2]];
+ const end3 = context2.events[range2[3]];
+ start[1].end = Object.assign({}, end3[1].end);
+ start[1].type = "chunkText";
+ start[1].contentType = "text";
+ if (range2[3] > range2[2] + 1) {
+ const a5 = range2[2] + 1;
+ const b5 = range2[3] - range2[2] - 1;
+ map7.add(a5, b5, []);
+ }
+ }
+ map7.add(range2[3] + 1, 0, [["exit", valueToken, context2]]);
+ }
+ if (rowEnd !== void 0) {
+ previousCell.end = Object.assign({}, getPoint(context2.events, rowEnd));
+ map7.add(rowEnd, 0, [["exit", previousCell, context2]]);
+ previousCell = void 0;
+ }
+ return previousCell;
+}
+function flushTableEnd(map7, context2, index2, table2, tableBody) {
+ const exits = [];
+ const related = getPoint(context2.events, index2);
+ if (tableBody) {
+ tableBody.end = Object.assign({}, related);
+ exits.push(["exit", tableBody, context2]);
+ }
+ table2.end = Object.assign({}, related);
+ exits.push(["exit", table2, context2]);
+ map7.add(index2 + 1, 0, exits);
+}
+function getPoint(events, index2) {
+ const event = events[index2];
+ const side = event[0] === "enter" ? "start" : "end";
+ return event[1][side];
+}
+var init_syntax4 = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-table@2.1.1/node_modules/micromark-extension-gfm-table/lib/syntax.js"() {
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ init_edit_map();
+ init_infer();
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-table@2.1.1/node_modules/micromark-extension-gfm-table/index.js
+var init_micromark_extension_gfm_table = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-table@2.1.1/node_modules/micromark-extension-gfm-table/index.js"() {
+ init_html5();
+ init_syntax4();
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-tagfilter@2.0.0/node_modules/micromark-extension-gfm-tagfilter/lib/index.js
+function gfmTagfilterHtml() {
+ return {
+ exit: {
+ htmlFlowData(token) {
+ exitHtmlData.call(this, token, reFlow);
+ },
+ htmlTextData(token) {
+ exitHtmlData.call(this, token, reText);
+ }
+ }
+ };
+}
+function exitHtmlData(token, filter2) {
+ let value2 = this.sliceSerialize(token);
+ if (this.options.allowDangerousHtml) {
+ value2 = value2.replace(filter2, "<$1$2");
+ }
+ this.raw(this.encode(value2));
+}
+var reFlow, reText;
+var init_lib19 = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-tagfilter@2.0.0/node_modules/micromark-extension-gfm-tagfilter/lib/index.js"() {
+ reFlow = /<(\/?)(iframe|noembed|noframes|plaintext|script|style|title|textarea|xmp)(?=[\t\n\f\r />])/gi;
+ reText = new RegExp("^" + reFlow.source, "i");
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-tagfilter@2.0.0/node_modules/micromark-extension-gfm-tagfilter/index.js
+var init_micromark_extension_gfm_tagfilter = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-tagfilter@2.0.0/node_modules/micromark-extension-gfm-tagfilter/index.js"() {
+ init_lib19();
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-task-list-item@2.1.0/node_modules/micromark-extension-gfm-task-list-item/lib/html.js
+function gfmTaskListItemHtml() {
+ return {
+ enter: {
+ taskListCheck() {
+ this.tag('");
+ },
+ taskListCheckValueChecked() {
+ this.tag('checked="" ');
+ }
+ }
+ };
+}
+var init_html6 = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-task-list-item@2.1.0/node_modules/micromark-extension-gfm-task-list-item/lib/html.js"() {
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-task-list-item@2.1.0/node_modules/micromark-extension-gfm-task-list-item/lib/syntax.js
+function gfmTaskListItem() {
+ return {
+ text: {
+ [91]: tasklistCheck
+ }
+ };
+}
+function tokenizeTasklistCheck(effects, ok3, nok) {
+ const self2 = this;
+ return open;
+ function open(code4) {
+ if (
+ // Exit if there’s stuff before.
+ self2.previous !== null || // Exit if not in the first content that is the first child of a list
+ // item.
+ !self2._gfmTasklistFirstContentOfListItem
+ ) {
+ return nok(code4);
+ }
+ effects.enter("taskListCheck");
+ effects.enter("taskListCheckMarker");
+ effects.consume(code4);
+ effects.exit("taskListCheckMarker");
+ return inside;
+ }
+ function inside(code4) {
+ if (markdownLineEndingOrSpace(code4)) {
+ effects.enter("taskListCheckValueUnchecked");
+ effects.consume(code4);
+ effects.exit("taskListCheckValueUnchecked");
+ return close7;
+ }
+ if (code4 === 88 || code4 === 120) {
+ effects.enter("taskListCheckValueChecked");
+ effects.consume(code4);
+ effects.exit("taskListCheckValueChecked");
+ return close7;
+ }
+ return nok(code4);
+ }
+ function close7(code4) {
+ if (code4 === 93) {
+ effects.enter("taskListCheckMarker");
+ effects.consume(code4);
+ effects.exit("taskListCheckMarker");
+ effects.exit("taskListCheck");
+ return after;
+ }
+ return nok(code4);
+ }
+ function after(code4) {
+ if (markdownLineEnding(code4)) {
+ return ok3(code4);
+ }
+ if (markdownSpace(code4)) {
+ return effects.check({
+ tokenize: spaceThenNonSpace
+ }, ok3, nok)(code4);
+ }
+ return nok(code4);
+ }
+}
+function spaceThenNonSpace(effects, ok3, nok) {
+ return factorySpace(effects, after, "whitespace");
+ function after(code4) {
+ return code4 === null ? nok(code4) : ok3(code4);
+ }
+}
+var tasklistCheck;
+var init_syntax5 = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-task-list-item@2.1.0/node_modules/micromark-extension-gfm-task-list-item/lib/syntax.js"() {
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ tasklistCheck = {
+ name: "tasklistCheck",
+ tokenize: tokenizeTasklistCheck
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm-task-list-item@2.1.0/node_modules/micromark-extension-gfm-task-list-item/index.js
+var init_micromark_extension_gfm_task_list_item = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm-task-list-item@2.1.0/node_modules/micromark-extension-gfm-task-list-item/index.js"() {
+ init_html6();
+ init_syntax5();
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-gfm@3.0.0/node_modules/micromark-extension-gfm/index.js
+function gfm(options) {
+ return combineExtensions([
+ gfmAutolinkLiteral(),
+ gfmFootnote(),
+ gfmStrikethrough(options),
+ gfmTable(),
+ gfmTaskListItem()
+ ]);
+}
+function gfmHtml(options) {
+ return combineHtmlExtensions([
+ gfmAutolinkLiteralHtml(),
+ gfmFootnoteHtml(options),
+ gfmStrikethroughHtml(),
+ gfmTableHtml(),
+ gfmTagfilterHtml(),
+ gfmTaskListItemHtml()
+ ]);
+}
+var init_micromark_extension_gfm = __esm({
+ "node_modules/.pnpm/micromark-extension-gfm@3.0.0/node_modules/micromark-extension-gfm/index.js"() {
+ init_micromark_util_combine_extensions();
+ init_micromark_extension_gfm_autolink_literal();
+ init_micromark_extension_gfm_footnote();
+ init_micromark_extension_gfm_strikethrough();
+ init_micromark_extension_gfm_table();
+ init_micromark_extension_gfm_tagfilter();
+ init_micromark_extension_gfm_task_list_item();
+ }
+});
+
+// node_modules/.pnpm/remark-gfm@4.0.1/node_modules/remark-gfm/lib/index.js
+function remarkGfm(options) {
+ const self2 = (
+ /** @type {Processor} */
+ this
+ );
+ const settings = options || emptyOptions3;
+ const data8 = self2.data();
+ const micromarkExtensions = data8.micromarkExtensions || (data8.micromarkExtensions = []);
+ const fromMarkdownExtensions = data8.fromMarkdownExtensions || (data8.fromMarkdownExtensions = []);
+ const toMarkdownExtensions = data8.toMarkdownExtensions || (data8.toMarkdownExtensions = []);
+ micromarkExtensions.push(gfm(settings));
+ fromMarkdownExtensions.push(gfmFromMarkdown());
+ toMarkdownExtensions.push(gfmToMarkdown(settings));
+}
+var emptyOptions3;
+var init_lib20 = __esm({
+ "node_modules/.pnpm/remark-gfm@4.0.1/node_modules/remark-gfm/lib/index.js"() {
+ init_mdast_util_gfm();
+ init_micromark_extension_gfm();
+ emptyOptions3 = {};
+ }
+});
+
+// node_modules/.pnpm/remark-gfm@4.0.1/node_modules/remark-gfm/index.js
+var init_remark_gfm = __esm({
+ "node_modules/.pnpm/remark-gfm@4.0.1/node_modules/remark-gfm/index.js"() {
+ init_lib20();
+ }
+});
+
+// node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/compile.js
+function compile(options) {
+ const settings = options || {};
+ let tags = true;
+ const definitions = {};
+ const buffers = [[]];
+ const mediaStack = [];
+ const tightStack = [];
+ const defaultHandlers = {
+ enter: {
+ blockQuote: onenterblockquote,
+ codeFenced: onentercodefenced,
+ codeFencedFenceInfo: buffer2,
+ codeFencedFenceMeta: buffer2,
+ codeIndented: onentercodeindented,
+ codeText: onentercodetext,
+ content: onentercontent,
+ definition: onenterdefinition,
+ definitionDestinationString: onenterdefinitiondestinationstring,
+ definitionLabelString: buffer2,
+ definitionTitleString: buffer2,
+ emphasis: onenteremphasis,
+ htmlFlow: onenterhtmlflow,
+ htmlText: onenterhtml,
+ image: onenterimage,
+ label: buffer2,
+ link: onenterlink,
+ listItemMarker: onenterlistitemmarker,
+ listItemValue: onenterlistitemvalue,
+ listOrdered: onenterlistordered,
+ listUnordered: onenterlistunordered,
+ paragraph: onenterparagraph,
+ reference: buffer2,
+ resource: onenterresource,
+ resourceDestinationString: onenterresourcedestinationstring,
+ resourceTitleString: buffer2,
+ setextHeading: onentersetextheading,
+ strong: onenterstrong
+ },
+ exit: {
+ atxHeading: onexitatxheading,
+ atxHeadingSequence: onexitatxheadingsequence,
+ autolinkEmail: onexitautolinkemail,
+ autolinkProtocol: onexitautolinkprotocol,
+ blockQuote: onexitblockquote,
+ characterEscapeValue: onexitdata,
+ characterReferenceMarkerHexadecimal: onexitcharacterreferencemarker,
+ characterReferenceMarkerNumeric: onexitcharacterreferencemarker,
+ characterReferenceValue: onexitcharacterreferencevalue,
+ codeFenced: onexitflowcode,
+ codeFencedFence: onexitcodefencedfence,
+ codeFencedFenceInfo: onexitcodefencedfenceinfo,
+ codeFencedFenceMeta: onresumedrop,
+ codeFlowValue: onexitcodeflowvalue,
+ codeIndented: onexitflowcode,
+ codeText: onexitcodetext,
+ codeTextData: onexitdata,
+ data: onexitdata,
+ definition: onexitdefinition,
+ definitionDestinationString: onexitdefinitiondestinationstring,
+ definitionLabelString: onexitdefinitionlabelstring,
+ definitionTitleString: onexitdefinitiontitlestring,
+ emphasis: onexitemphasis,
+ hardBreakEscape: onexithardbreak,
+ hardBreakTrailing: onexithardbreak,
+ htmlFlow: onexithtml,
+ htmlFlowData: onexitdata,
+ htmlText: onexithtml,
+ htmlTextData: onexitdata,
+ image: onexitmedia,
+ label: onexitlabel,
+ labelText: onexitlabeltext,
+ lineEnding: onexitlineending,
+ link: onexitmedia,
+ listOrdered: onexitlistordered,
+ listUnordered: onexitlistunordered,
+ paragraph: onexitparagraph,
+ reference: onresumedrop,
+ referenceString: onexitreferencestring,
+ resource: onresumedrop,
+ resourceDestinationString: onexitresourcedestinationstring,
+ resourceTitleString: onexitresourcetitlestring,
+ setextHeading: onexitsetextheading,
+ setextHeadingLineSequence: onexitsetextheadinglinesequence,
+ setextHeadingText: onexitsetextheadingtext,
+ strong: onexitstrong,
+ thematicBreak: onexitthematicbreak
+ }
+ };
+ const handlers2 = (
+ /** @type {NormalizedHtmlExtension} */
+ combineHtmlExtensions([defaultHandlers, ...settings.htmlExtensions || []])
+ );
+ const data8 = {
+ definitions,
+ tightStack
+ };
+ const context2 = {
+ buffer: buffer2,
+ encode: encode2,
+ getData,
+ lineEndingIfNeeded,
+ options: settings,
+ raw: raw2,
+ resume,
+ setData,
+ tag
+ };
+ let lineEndingStyle = settings.defaultLineEnding;
+ return compile2;
+ function compile2(events) {
+ let index2 = -1;
+ let start = 0;
+ const listStack = [];
+ let head2 = [];
+ let body3 = [];
+ while (++index2 < events.length) {
+ if (!lineEndingStyle && (events[index2][1].type === "lineEnding" || events[index2][1].type === "lineEndingBlank")) {
+ lineEndingStyle = /** @type {LineEnding} */
+ events[index2][2].sliceSerialize(events[index2][1]);
+ }
+ if (events[index2][1].type === "listOrdered" || events[index2][1].type === "listUnordered") {
+ if (events[index2][0] === "enter") {
+ listStack.push(index2);
+ } else {
+ prepareList(events.slice(listStack.pop(), index2));
+ }
+ }
+ if (events[index2][1].type === "definition") {
+ if (events[index2][0] === "enter") {
+ body3 = push(body3, events.slice(start, index2));
+ start = index2;
+ } else {
+ head2 = push(head2, events.slice(start, index2 + 1));
+ start = index2 + 1;
+ }
+ }
+ }
+ head2 = push(head2, body3);
+ head2 = push(head2, events.slice(start));
+ index2 = -1;
+ const result = head2;
+ if (handlers2.enter.null) {
+ handlers2.enter.null.call(context2);
+ }
+ while (++index2 < events.length) {
+ const handles = handlers2[result[index2][0]];
+ const kind = result[index2][1].type;
+ const handle3 = handles[kind];
+ if (hasOwnProperty2.call(handles, kind) && handle3) {
+ handle3.call({
+ sliceSerialize: result[index2][2].sliceSerialize,
+ ...context2
+ }, result[index2][1]);
+ }
+ }
+ if (handlers2.exit.null) {
+ handlers2.exit.null.call(context2);
+ }
+ return buffers[0].join("");
+ }
+ function prepareList(slice) {
+ const length = slice.length;
+ let index2 = 0;
+ let containerBalance = 0;
+ let loose = false;
+ let atMarker;
+ while (++index2 < length) {
+ const event = slice[index2];
+ if (event[1]._container) {
+ atMarker = void 0;
+ if (event[0] === "enter") {
+ containerBalance++;
+ } else {
+ containerBalance--;
+ }
+ } else switch (event[1].type) {
+ case "listItemPrefix": {
+ if (event[0] === "exit") {
+ atMarker = true;
+ }
+ break;
+ }
+ case "linePrefix": {
+ break;
+ }
+ case "lineEndingBlank": {
+ if (event[0] === "enter" && !containerBalance) {
+ if (atMarker) {
+ atMarker = void 0;
+ } else {
+ loose = true;
+ }
+ }
+ break;
+ }
+ default: {
+ atMarker = void 0;
+ }
+ }
+ }
+ slice[0][1]._loose = loose;
+ }
+ function setData(key2, value2) {
+ data8[key2] = value2;
+ }
+ function getData(key2) {
+ return data8[key2];
+ }
+ function buffer2() {
+ buffers.push([]);
+ }
+ function resume() {
+ const buf = buffers.pop();
+ return buf.join("");
+ }
+ function tag(value2) {
+ if (!tags) return;
+ setData("lastWasTag", true);
+ buffers[buffers.length - 1].push(value2);
+ }
+ function raw2(value2) {
+ setData("lastWasTag");
+ buffers[buffers.length - 1].push(value2);
+ }
+ function lineEnding2() {
+ raw2(lineEndingStyle || "\n");
+ }
+ function lineEndingIfNeeded() {
+ const buffer3 = buffers[buffers.length - 1];
+ const slice = buffer3[buffer3.length - 1];
+ const previous3 = slice ? slice.charCodeAt(slice.length - 1) : null;
+ if (previous3 === 10 || previous3 === 13 || previous3 === null) {
+ return;
+ }
+ lineEnding2();
+ }
+ function encode2(value2) {
+ return getData("ignoreEncode") ? value2 : encode(value2);
+ }
+ function onresumedrop() {
+ resume();
+ }
+ function onenterlistordered(token) {
+ tightStack.push(!token._loose);
+ lineEndingIfNeeded();
+ tag("");
+ } else {
+ onexitlistitem();
+ }
+ lineEndingIfNeeded();
+ tag("- ");
+ setData("expectFirstItem");
+ setData("lastWasTag");
+ }
+ function onexitlistordered() {
+ onexitlistitem();
+ tightStack.pop();
+ lineEnding2();
+ tag("
");
+ }
+ function onexitlistunordered() {
+ onexitlistitem();
+ tightStack.pop();
+ lineEnding2();
+ tag("");
+ }
+ function onexitlistitem() {
+ if (getData("lastWasTag") && !getData("slurpAllLineEndings")) {
+ lineEndingIfNeeded();
+ }
+ tag("");
+ setData("slurpAllLineEndings");
+ }
+ function onenterblockquote() {
+ tightStack.push(false);
+ lineEndingIfNeeded();
+ tag("");
+ }
+ function onexitblockquote() {
+ tightStack.pop();
+ lineEndingIfNeeded();
+ tag("
");
+ setData("slurpAllLineEndings");
+ }
+ function onenterparagraph() {
+ if (!tightStack[tightStack.length - 1]) {
+ lineEndingIfNeeded();
+ tag("");
+ }
+ setData("slurpAllLineEndings");
+ }
+ function onexitparagraph() {
+ if (tightStack[tightStack.length - 1]) {
+ setData("slurpAllLineEndings", true);
+ } else {
+ tag("
");
+ }
+ }
+ function onentercodefenced() {
+ lineEndingIfNeeded();
+ tag("");
+ setData("slurpOneLineEnding", true);
+ }
+ setData("fencesCount", count2 + 1);
+ }
+ function onentercodeindented() {
+ lineEndingIfNeeded();
+ tag("");
+ }
+ function onexitflowcode() {
+ const count2 = getData("fencesCount");
+ if (count2 !== void 0 && count2 < 2 && data8.tightStack.length > 0 && !getData("lastWasTag")) {
+ lineEnding2();
+ }
+ if (getData("flowCodeSeenData")) {
+ lineEndingIfNeeded();
+ }
+ tag("
");
+ if (count2 !== void 0 && count2 < 2) lineEndingIfNeeded();
+ setData("flowCodeSeenData");
+ setData("fencesCount");
+ setData("slurpOneLineEnding");
+ }
+ function onenterimage() {
+ mediaStack.push({
+ image: true
+ });
+ tags = void 0;
+ }
+ function onenterlink() {
+ mediaStack.push({});
+ }
+ function onexitlabeltext(token) {
+ mediaStack[mediaStack.length - 1].labelId = this.sliceSerialize(token);
+ }
+ function onexitlabel() {
+ mediaStack[mediaStack.length - 1].label = resume();
+ }
+ function onexitreferencestring(token) {
+ mediaStack[mediaStack.length - 1].referenceId = this.sliceSerialize(token);
+ }
+ function onenterresource() {
+ buffer2();
+ mediaStack[mediaStack.length - 1].destination = "";
+ }
+ function onenterresourcedestinationstring() {
+ buffer2();
+ setData("ignoreEncode", true);
+ }
+ function onexitresourcedestinationstring() {
+ mediaStack[mediaStack.length - 1].destination = resume();
+ setData("ignoreEncode");
+ }
+ function onexitresourcetitlestring() {
+ mediaStack[mediaStack.length - 1].title = resume();
+ }
+ function onexitmedia() {
+ let index2 = mediaStack.length - 1;
+ const media = mediaStack[index2];
+ const id = media.referenceId || media.labelId;
+ const context3 = media.destination === void 0 ? definitions[normalizeIdentifier(id)] : media;
+ tags = true;
+ while (index2--) {
+ if (mediaStack[index2].image) {
+ tags = void 0;
+ break;
+ }
+ }
+ if (media.image) {
+ tag('
");
+ } else {
+ tag(">");
+ raw2(media.label);
+ tag("");
+ }
+ mediaStack.pop();
+ }
+ function onenterdefinition() {
+ buffer2();
+ mediaStack.push({});
+ }
+ function onexitdefinitionlabelstring(token) {
+ resume();
+ mediaStack[mediaStack.length - 1].labelId = this.sliceSerialize(token);
+ }
+ function onenterdefinitiondestinationstring() {
+ buffer2();
+ setData("ignoreEncode", true);
+ }
+ function onexitdefinitiondestinationstring() {
+ mediaStack[mediaStack.length - 1].destination = resume();
+ setData("ignoreEncode");
+ }
+ function onexitdefinitiontitlestring() {
+ mediaStack[mediaStack.length - 1].title = resume();
+ }
+ function onexitdefinition() {
+ const media = mediaStack[mediaStack.length - 1];
+ const id = normalizeIdentifier(media.labelId);
+ resume();
+ if (!hasOwnProperty2.call(definitions, id)) {
+ definitions[id] = mediaStack[mediaStack.length - 1];
+ }
+ mediaStack.pop();
+ }
+ function onentercontent() {
+ setData("slurpAllLineEndings", true);
+ }
+ function onexitatxheadingsequence(token) {
+ if (getData("headingRank")) return;
+ setData("headingRank", this.sliceSerialize(token).length);
+ lineEndingIfNeeded();
+ tag("");
+ }
+ function onentersetextheading() {
+ buffer2();
+ setData("slurpAllLineEndings");
+ }
+ function onexitsetextheadingtext() {
+ setData("slurpAllLineEndings", true);
+ }
+ function onexitatxheading() {
+ tag("");
+ setData("headingRank");
+ }
+ function onexitsetextheadinglinesequence(token) {
+ setData("headingRank", this.sliceSerialize(token).charCodeAt(0) === 61 ? 1 : 2);
+ }
+ function onexitsetextheading() {
+ const value2 = resume();
+ lineEndingIfNeeded();
+ tag("");
+ raw2(value2);
+ tag("");
+ setData("slurpAllLineEndings");
+ setData("headingRank");
+ }
+ function onexitdata(token) {
+ raw2(encode2(this.sliceSerialize(token)));
+ }
+ function onexitlineending(token) {
+ if (getData("slurpAllLineEndings")) {
+ return;
+ }
+ if (getData("slurpOneLineEnding")) {
+ setData("slurpOneLineEnding");
+ return;
+ }
+ if (getData("inCodeText")) {
+ raw2(" ");
+ return;
+ }
+ raw2(encode2(this.sliceSerialize(token)));
+ }
+ function onexitcodeflowvalue(token) {
+ raw2(encode2(this.sliceSerialize(token)));
+ setData("flowCodeSeenData", true);
+ }
+ function onexithardbreak() {
+ tag("
");
+ }
+ function onenterhtmlflow() {
+ lineEndingIfNeeded();
+ onenterhtml();
+ }
+ function onexithtml() {
+ setData("ignoreEncode");
+ }
+ function onenterhtml() {
+ if (settings.allowDangerousHtml) {
+ setData("ignoreEncode", true);
+ }
+ }
+ function onenteremphasis() {
+ tag("");
+ }
+ function onenterstrong() {
+ tag("");
+ }
+ function onentercodetext() {
+ setData("inCodeText", true);
+ tag("");
+ }
+ function onexitcodetext() {
+ setData("inCodeText");
+ tag("");
+ }
+ function onexitemphasis() {
+ tag("");
+ }
+ function onexitstrong() {
+ tag("");
+ }
+ function onexitthematicbreak() {
+ lineEndingIfNeeded();
+ tag("
");
+ }
+ function onexitcharacterreferencemarker(token) {
+ setData("characterReferenceType", token.type);
+ }
+ function onexitcharacterreferencevalue(token) {
+ const value2 = this.sliceSerialize(token);
+ const decoded = getData("characterReferenceType") ? decodeNumericCharacterReference(value2, getData("characterReferenceType") === "characterReferenceMarkerNumeric" ? 10 : 16) : decodeNamedCharacterReference(value2);
+ raw2(encode2(
+ /** @type {string} */
+ decoded
+ ));
+ setData("characterReferenceType");
+ }
+ function onexitautolinkprotocol(token) {
+ const uri = this.sliceSerialize(token);
+ tag('');
+ raw2(encode2(uri));
+ tag("");
+ }
+ function onexitautolinkemail(token) {
+ const uri = this.sliceSerialize(token);
+ tag('');
+ raw2(encode2(uri));
+ tag("");
+ }
+}
+var hasOwnProperty2, protocolHref, protocolSource;
+var init_compile = __esm({
+ "node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/compile.js"() {
+ init_index_dom();
+ init_micromark_util_chunked();
+ init_micromark_util_combine_extensions();
+ init_micromark_util_decode_numeric_character_reference();
+ init_micromark_util_encode();
+ init_micromark_util_normalize_identifier();
+ init_micromark_util_sanitize_uri();
+ hasOwnProperty2 = {}.hasOwnProperty;
+ protocolHref = /^(https?|ircs?|mailto|xmpp)$/i;
+ protocolSource = /^https?$/i;
+ }
+});
+
+// node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/initialize/content.js
+function initializeContent(effects) {
+ const contentStart = effects.attempt(this.parser.constructs.contentInitial, afterContentStartConstruct, paragraphInitial);
+ let previous3;
+ return contentStart;
+ function afterContentStartConstruct(code4) {
+ if (code4 === null) {
+ effects.consume(code4);
+ return;
+ }
+ effects.enter("lineEnding");
+ effects.consume(code4);
+ effects.exit("lineEnding");
+ return factorySpace(effects, contentStart, "linePrefix");
+ }
+ function paragraphInitial(code4) {
+ effects.enter("paragraph");
+ return lineStart(code4);
+ }
+ function lineStart(code4) {
+ const token = effects.enter("chunkText", {
+ contentType: "text",
+ previous: previous3
+ });
+ if (previous3) {
+ previous3.next = token;
+ }
+ previous3 = token;
+ return data8(code4);
+ }
+ function data8(code4) {
+ if (code4 === null) {
+ effects.exit("chunkText");
+ effects.exit("paragraph");
+ effects.consume(code4);
+ return;
+ }
+ if (markdownLineEnding(code4)) {
+ effects.consume(code4);
+ effects.exit("chunkText");
+ return lineStart;
+ }
+ effects.consume(code4);
+ return data8;
+ }
+}
+var content2;
+var init_content2 = __esm({
+ "node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/initialize/content.js"() {
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ content2 = {
+ tokenize: initializeContent
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/initialize/document.js
+function initializeDocument(effects) {
+ const self2 = this;
+ const stack = [];
+ let continued = 0;
+ let childFlow;
+ let childToken;
+ let lineStartOffset;
+ return start;
+ function start(code4) {
+ if (continued < stack.length) {
+ const item = stack[continued];
+ self2.containerState = item[1];
+ return effects.attempt(item[0].continuation, documentContinue, checkNewContainers)(code4);
+ }
+ return checkNewContainers(code4);
+ }
+ function documentContinue(code4) {
+ continued++;
+ if (self2.containerState._closeFlow) {
+ self2.containerState._closeFlow = void 0;
+ if (childFlow) {
+ closeFlow();
+ }
+ const indexBeforeExits = self2.events.length;
+ let indexBeforeFlow = indexBeforeExits;
+ let point4;
+ while (indexBeforeFlow--) {
+ if (self2.events[indexBeforeFlow][0] === "exit" && self2.events[indexBeforeFlow][1].type === "chunkFlow") {
+ point4 = self2.events[indexBeforeFlow][1].end;
+ break;
+ }
+ }
+ exitContainers(continued);
+ let index2 = indexBeforeExits;
+ while (index2 < self2.events.length) {
+ self2.events[index2][1].end = {
+ ...point4
+ };
+ index2++;
+ }
+ splice(self2.events, indexBeforeFlow + 1, 0, self2.events.slice(indexBeforeExits));
+ self2.events.length = index2;
+ return checkNewContainers(code4);
+ }
+ return start(code4);
+ }
+ function checkNewContainers(code4) {
+ if (continued === stack.length) {
+ if (!childFlow) {
+ return documentContinued(code4);
+ }
+ if (childFlow.currentConstruct && childFlow.currentConstruct.concrete) {
+ return flowStart(code4);
+ }
+ self2.interrupt = Boolean(childFlow.currentConstruct && !childFlow._gfmTableDynamicInterruptHack);
+ }
+ self2.containerState = {};
+ return effects.check(containerConstruct, thereIsANewContainer, thereIsNoNewContainer)(code4);
+ }
+ function thereIsANewContainer(code4) {
+ if (childFlow) closeFlow();
+ exitContainers(continued);
+ return documentContinued(code4);
+ }
+ function thereIsNoNewContainer(code4) {
+ self2.parser.lazy[self2.now().line] = continued !== stack.length;
+ lineStartOffset = self2.now().offset;
+ return flowStart(code4);
+ }
+ function documentContinued(code4) {
+ self2.containerState = {};
+ return effects.attempt(containerConstruct, containerContinue, flowStart)(code4);
+ }
+ function containerContinue(code4) {
+ continued++;
+ stack.push([self2.currentConstruct, self2.containerState]);
+ return documentContinued(code4);
+ }
+ function flowStart(code4) {
+ if (code4 === null) {
+ if (childFlow) closeFlow();
+ exitContainers(0);
+ effects.consume(code4);
+ return;
+ }
+ childFlow = childFlow || self2.parser.flow(self2.now());
+ effects.enter("chunkFlow", {
+ _tokenizer: childFlow,
+ contentType: "flow",
+ previous: childToken
+ });
+ return flowContinue(code4);
+ }
+ function flowContinue(code4) {
+ if (code4 === null) {
+ writeToChild(effects.exit("chunkFlow"), true);
+ exitContainers(0);
+ effects.consume(code4);
+ return;
+ }
+ if (markdownLineEnding(code4)) {
+ effects.consume(code4);
+ writeToChild(effects.exit("chunkFlow"));
+ continued = 0;
+ self2.interrupt = void 0;
+ return start;
+ }
+ effects.consume(code4);
+ return flowContinue;
+ }
+ function writeToChild(token, endOfFile) {
+ const stream = self2.sliceStream(token);
+ if (endOfFile) stream.push(null);
+ token.previous = childToken;
+ if (childToken) childToken.next = token;
+ childToken = token;
+ childFlow.defineSkip(token.start);
+ childFlow.write(stream);
+ if (self2.parser.lazy[token.start.line]) {
+ let index2 = childFlow.events.length;
+ while (index2--) {
+ if (
+ // The token starts before the line ending…
+ childFlow.events[index2][1].start.offset < lineStartOffset && // …and either is not ended yet…
+ (!childFlow.events[index2][1].end || // …or ends after it.
+ childFlow.events[index2][1].end.offset > lineStartOffset)
+ ) {
+ return;
+ }
+ }
+ const indexBeforeExits = self2.events.length;
+ let indexBeforeFlow = indexBeforeExits;
+ let seen;
+ let point4;
+ while (indexBeforeFlow--) {
+ if (self2.events[indexBeforeFlow][0] === "exit" && self2.events[indexBeforeFlow][1].type === "chunkFlow") {
+ if (seen) {
+ point4 = self2.events[indexBeforeFlow][1].end;
+ break;
+ }
+ seen = true;
+ }
+ }
+ exitContainers(continued);
+ index2 = indexBeforeExits;
+ while (index2 < self2.events.length) {
+ self2.events[index2][1].end = {
+ ...point4
+ };
+ index2++;
+ }
+ splice(self2.events, indexBeforeFlow + 1, 0, self2.events.slice(indexBeforeExits));
+ self2.events.length = index2;
+ }
+ }
+ function exitContainers(size) {
+ let index2 = stack.length;
+ while (index2-- > size) {
+ const entry = stack[index2];
+ self2.containerState = entry[1];
+ entry[0].exit.call(self2, effects);
+ }
+ stack.length = size;
+ }
+ function closeFlow() {
+ childFlow.write([null]);
+ childToken = void 0;
+ childFlow = void 0;
+ self2.containerState._closeFlow = void 0;
+ }
+}
+function tokenizeContainer(effects, ok3, nok) {
+ return factorySpace(effects, effects.attempt(this.parser.constructs.document, ok3, nok), "linePrefix", this.parser.constructs.disable.null.includes("codeIndented") ? void 0 : 4);
+}
+var document2, containerConstruct;
+var init_document = __esm({
+ "node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/initialize/document.js"() {
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ init_micromark_util_chunked();
+ document2 = {
+ tokenize: initializeDocument
+ };
+ containerConstruct = {
+ tokenize: tokenizeContainer
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/initialize/flow.js
+function initializeFlow(effects) {
+ const self2 = this;
+ const initial2 = effects.attempt(
+ // Try to parse a blank line.
+ blankLine,
+ atBlankEnding,
+ // Try to parse initial flow (essentially, only code).
+ effects.attempt(this.parser.constructs.flowInitial, afterConstruct, factorySpace(effects, effects.attempt(this.parser.constructs.flow, afterConstruct, effects.attempt(content, afterConstruct)), "linePrefix"))
+ );
+ return initial2;
+ function atBlankEnding(code4) {
+ if (code4 === null) {
+ effects.consume(code4);
+ return;
+ }
+ effects.enter("lineEndingBlank");
+ effects.consume(code4);
+ effects.exit("lineEndingBlank");
+ self2.currentConstruct = void 0;
+ return initial2;
+ }
+ function afterConstruct(code4) {
+ if (code4 === null) {
+ effects.consume(code4);
+ return;
+ }
+ effects.enter("lineEnding");
+ effects.consume(code4);
+ effects.exit("lineEnding");
+ self2.currentConstruct = void 0;
+ return initial2;
+ }
+}
+var flow;
+var init_flow = __esm({
+ "node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/initialize/flow.js"() {
+ init_micromark_core_commonmark();
+ init_micromark_factory_space();
+ init_micromark_util_character();
+ flow = {
+ tokenize: initializeFlow
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/initialize/text.js
+function initializeFactory(field) {
+ return {
+ resolveAll: createResolver(field === "text" ? resolveAllLineSuffixes : void 0),
+ tokenize: initializeText
+ };
+ function initializeText(effects) {
+ const self2 = this;
+ const constructs2 = this.parser.constructs[field];
+ const text9 = effects.attempt(constructs2, start, notText);
+ return start;
+ function start(code4) {
+ return atBreak(code4) ? text9(code4) : notText(code4);
+ }
+ function notText(code4) {
+ if (code4 === null) {
+ effects.consume(code4);
+ return;
+ }
+ effects.enter("data");
+ effects.consume(code4);
+ return data8;
+ }
+ function data8(code4) {
+ if (atBreak(code4)) {
+ effects.exit("data");
+ return text9(code4);
+ }
+ effects.consume(code4);
+ return data8;
+ }
+ function atBreak(code4) {
+ if (code4 === null) {
+ return true;
+ }
+ const list5 = constructs2[code4];
+ let index2 = -1;
+ if (list5) {
+ while (++index2 < list5.length) {
+ const item = list5[index2];
+ if (!item.previous || item.previous.call(self2, self2.previous)) {
+ return true;
+ }
+ }
+ }
+ return false;
+ }
+ }
+}
+function createResolver(extraResolver) {
+ return resolveAllText;
+ function resolveAllText(events, context2) {
+ let index2 = -1;
+ let enter;
+ while (++index2 <= events.length) {
+ if (enter === void 0) {
+ if (events[index2] && events[index2][1].type === "data") {
+ enter = index2;
+ index2++;
+ }
+ } else if (!events[index2] || events[index2][1].type !== "data") {
+ if (index2 !== enter + 2) {
+ events[enter][1].end = events[index2 - 1][1].end;
+ events.splice(enter + 2, index2 - enter - 2);
+ index2 = enter + 2;
+ }
+ enter = void 0;
+ }
+ }
+ return extraResolver ? extraResolver(events, context2) : events;
+ }
+}
+function resolveAllLineSuffixes(events, context2) {
+ let eventIndex = 0;
+ while (++eventIndex <= events.length) {
+ if ((eventIndex === events.length || events[eventIndex][1].type === "lineEnding") && events[eventIndex - 1][1].type === "data") {
+ const data8 = events[eventIndex - 1][1];
+ const chunks = context2.sliceStream(data8);
+ let index2 = chunks.length;
+ let bufferIndex = -1;
+ let size = 0;
+ let tabs;
+ while (index2--) {
+ const chunk = chunks[index2];
+ if (typeof chunk === "string") {
+ bufferIndex = chunk.length;
+ while (chunk.charCodeAt(bufferIndex - 1) === 32) {
+ size++;
+ bufferIndex--;
+ }
+ if (bufferIndex) break;
+ bufferIndex = -1;
+ } else if (chunk === -2) {
+ tabs = true;
+ size++;
+ } else if (chunk === -1) {
+ } else {
+ index2++;
+ break;
+ }
+ }
+ if (context2._contentTypeTextTrailing && eventIndex === events.length) {
+ size = 0;
+ }
+ if (size) {
+ const token = {
+ type: eventIndex === events.length || tabs || size < 2 ? "lineSuffix" : "hardBreakTrailing",
+ start: {
+ _bufferIndex: index2 ? bufferIndex : data8.start._bufferIndex + bufferIndex,
+ _index: data8.start._index + index2,
+ line: data8.end.line,
+ column: data8.end.column - size,
+ offset: data8.end.offset - size
+ },
+ end: {
+ ...data8.end
+ }
+ };
+ data8.end = {
+ ...token.start
+ };
+ if (data8.start.offset === data8.end.offset) {
+ Object.assign(data8, token);
+ } else {
+ events.splice(eventIndex, 0, ["enter", token, context2], ["exit", token, context2]);
+ eventIndex += 2;
+ }
+ }
+ eventIndex++;
+ }
+ }
+ return events;
+}
+var resolver, string, text3;
+var init_text2 = __esm({
+ "node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/initialize/text.js"() {
+ resolver = {
+ resolveAll: createResolver()
+ };
+ string = initializeFactory("string");
+ text3 = initializeFactory("text");
+ }
+});
+
+// node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/constructs.js
+var constructs_exports = {};
+__export(constructs_exports, {
+ attentionMarkers: () => attentionMarkers,
+ contentInitial: () => contentInitial,
+ disable: () => disable,
+ document: () => document3,
+ flow: () => flow2,
+ flowInitial: () => flowInitial,
+ insideSpan: () => insideSpan,
+ string: () => string2,
+ text: () => text4
+});
+var document3, contentInitial, flowInitial, flow2, string2, text4, insideSpan, attentionMarkers, disable;
+var init_constructs = __esm({
+ "node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/constructs.js"() {
+ init_micromark_core_commonmark();
+ init_text2();
+ document3 = {
+ [42]: list3,
+ [43]: list3,
+ [45]: list3,
+ [48]: list3,
+ [49]: list3,
+ [50]: list3,
+ [51]: list3,
+ [52]: list3,
+ [53]: list3,
+ [54]: list3,
+ [55]: list3,
+ [56]: list3,
+ [57]: list3,
+ [62]: blockQuote
+ };
+ contentInitial = {
+ [91]: definition2
+ };
+ flowInitial = {
+ [-2]: codeIndented,
+ [-1]: codeIndented,
+ [32]: codeIndented
+ };
+ flow2 = {
+ [35]: headingAtx,
+ [42]: thematicBreak2,
+ [45]: [setextUnderline, thematicBreak2],
+ [60]: htmlFlow,
+ [61]: setextUnderline,
+ [95]: thematicBreak2,
+ [96]: codeFenced,
+ [126]: codeFenced
+ };
+ string2 = {
+ [38]: characterReference,
+ [92]: characterEscape
+ };
+ text4 = {
+ [-5]: lineEnding,
+ [-4]: lineEnding,
+ [-3]: lineEnding,
+ [33]: labelStartImage,
+ [38]: characterReference,
+ [42]: attention,
+ [60]: [autolink, htmlText],
+ [91]: labelStartLink,
+ [92]: [hardBreakEscape, characterEscape],
+ [93]: labelEnd,
+ [95]: attention,
+ [96]: codeText
+ };
+ insideSpan = {
+ null: [attention, resolver]
+ };
+ attentionMarkers = {
+ null: [42, 95]
+ };
+ disable = {
+ null: []
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/create-tokenizer.js
+function createTokenizer(parser, initialize, from2) {
+ let point4 = {
+ _bufferIndex: -1,
+ _index: 0,
+ line: from2 && from2.line || 1,
+ column: from2 && from2.column || 1,
+ offset: from2 && from2.offset || 0
+ };
+ const columnStart = {};
+ const resolveAllConstructs = [];
+ let chunks = [];
+ let stack = [];
+ let consumed = true;
+ const effects = {
+ attempt: constructFactory(onsuccessfulconstruct),
+ check: constructFactory(onsuccessfulcheck),
+ consume,
+ enter,
+ exit: exit3,
+ interrupt: constructFactory(onsuccessfulcheck, {
+ interrupt: true
+ })
+ };
+ const context2 = {
+ code: null,
+ containerState: {},
+ defineSkip,
+ events: [],
+ now: now2,
+ parser,
+ previous: null,
+ sliceSerialize,
+ sliceStream,
+ write
+ };
+ let state = initialize.tokenize.call(context2, effects);
+ let expectedCode;
+ if (initialize.resolveAll) {
+ resolveAllConstructs.push(initialize);
+ }
+ return context2;
+ function write(slice) {
+ chunks = push(chunks, slice);
+ main();
+ if (chunks[chunks.length - 1] !== null) {
+ return [];
+ }
+ addResult(initialize, 0);
+ context2.events = resolveAll(resolveAllConstructs, context2.events, context2);
+ return context2.events;
+ }
+ function sliceSerialize(token, expandTabs) {
+ return serializeChunks(sliceStream(token), expandTabs);
+ }
+ function sliceStream(token) {
+ return sliceChunks(chunks, token);
+ }
+ function now2() {
+ const {
+ _bufferIndex,
+ _index,
+ line,
+ column,
+ offset
+ } = point4;
+ return {
+ _bufferIndex,
+ _index,
+ line,
+ column,
+ offset
+ };
+ }
+ function defineSkip(value2) {
+ columnStart[value2.line] = value2.column;
+ accountForPotentialSkip();
+ }
+ function main() {
+ let chunkIndex;
+ while (point4._index < chunks.length) {
+ const chunk = chunks[point4._index];
+ if (typeof chunk === "string") {
+ chunkIndex = point4._index;
+ if (point4._bufferIndex < 0) {
+ point4._bufferIndex = 0;
+ }
+ while (point4._index === chunkIndex && point4._bufferIndex < chunk.length) {
+ go(chunk.charCodeAt(point4._bufferIndex));
+ }
+ } else {
+ go(chunk);
+ }
+ }
+ }
+ function go(code4) {
+ consumed = void 0;
+ expectedCode = code4;
+ state = state(code4);
+ }
+ function consume(code4) {
+ if (markdownLineEnding(code4)) {
+ point4.line++;
+ point4.column = 1;
+ point4.offset += code4 === -3 ? 2 : 1;
+ accountForPotentialSkip();
+ } else if (code4 !== -1) {
+ point4.column++;
+ point4.offset++;
+ }
+ if (point4._bufferIndex < 0) {
+ point4._index++;
+ } else {
+ point4._bufferIndex++;
+ if (point4._bufferIndex === // Points w/ non-negative `_bufferIndex` reference
+ // strings.
+ /** @type {string} */
+ chunks[point4._index].length) {
+ point4._bufferIndex = -1;
+ point4._index++;
+ }
+ }
+ context2.previous = code4;
+ consumed = true;
+ }
+ function enter(type5, fields) {
+ const token = fields || {};
+ token.type = type5;
+ token.start = now2();
+ context2.events.push(["enter", token, context2]);
+ stack.push(token);
+ return token;
+ }
+ function exit3(type5) {
+ const token = stack.pop();
+ token.end = now2();
+ context2.events.push(["exit", token, context2]);
+ return token;
+ }
+ function onsuccessfulconstruct(construct, info) {
+ addResult(construct, info.from);
+ }
+ function onsuccessfulcheck(_4, info) {
+ info.restore();
+ }
+ function constructFactory(onreturn, fields) {
+ return hook;
+ function hook(constructs2, returnState, bogusState) {
+ let listOfConstructs;
+ let constructIndex;
+ let currentConstruct;
+ let info;
+ return Array.isArray(constructs2) ? (
+ /* c8 ignore next 1 */
+ handleListOfConstructs(constructs2)
+ ) : "tokenize" in constructs2 ? (
+ // Looks like a construct.
+ handleListOfConstructs([
+ /** @type {Construct} */
+ constructs2
+ ])
+ ) : handleMapOfConstructs(constructs2);
+ function handleMapOfConstructs(map7) {
+ return start;
+ function start(code4) {
+ const left = code4 !== null && map7[code4];
+ const all3 = code4 !== null && map7.null;
+ const list5 = [
+ // To do: add more extension tests.
+ /* c8 ignore next 2 */
+ ...Array.isArray(left) ? left : left ? [left] : [],
+ ...Array.isArray(all3) ? all3 : all3 ? [all3] : []
+ ];
+ return handleListOfConstructs(list5)(code4);
+ }
+ }
+ function handleListOfConstructs(list5) {
+ listOfConstructs = list5;
+ constructIndex = 0;
+ if (list5.length === 0) {
+ return bogusState;
+ }
+ return handleConstruct(list5[constructIndex]);
+ }
+ function handleConstruct(construct) {
+ return start;
+ function start(code4) {
+ info = store();
+ currentConstruct = construct;
+ if (!construct.partial) {
+ context2.currentConstruct = construct;
+ }
+ if (construct.name && context2.parser.constructs.disable.null.includes(construct.name)) {
+ return nok(code4);
+ }
+ return construct.tokenize.call(
+ // If we do have fields, create an object w/ `context` as its
+ // prototype.
+ // This allows a “live binding”, which is needed for `interrupt`.
+ fields ? Object.assign(Object.create(context2), fields) : context2,
+ effects,
+ ok3,
+ nok
+ )(code4);
+ }
+ }
+ function ok3(code4) {
+ consumed = true;
+ onreturn(currentConstruct, info);
+ return returnState;
+ }
+ function nok(code4) {
+ consumed = true;
+ info.restore();
+ if (++constructIndex < listOfConstructs.length) {
+ return handleConstruct(listOfConstructs[constructIndex]);
+ }
+ return bogusState;
+ }
+ }
+ }
+ function addResult(construct, from3) {
+ if (construct.resolveAll && !resolveAllConstructs.includes(construct)) {
+ resolveAllConstructs.push(construct);
+ }
+ if (construct.resolve) {
+ splice(context2.events, from3, context2.events.length - from3, construct.resolve(context2.events.slice(from3), context2));
+ }
+ if (construct.resolveTo) {
+ context2.events = construct.resolveTo(context2.events, context2);
+ }
+ }
+ function store() {
+ const startPoint = now2();
+ const startPrevious = context2.previous;
+ const startCurrentConstruct = context2.currentConstruct;
+ const startEventsIndex = context2.events.length;
+ const startStack = Array.from(stack);
+ return {
+ from: startEventsIndex,
+ restore
+ };
+ function restore() {
+ point4 = startPoint;
+ context2.previous = startPrevious;
+ context2.currentConstruct = startCurrentConstruct;
+ context2.events.length = startEventsIndex;
+ stack = startStack;
+ accountForPotentialSkip();
+ }
+ }
+ function accountForPotentialSkip() {
+ if (point4.line in columnStart && point4.column < 2) {
+ point4.column = columnStart[point4.line];
+ point4.offset += columnStart[point4.line] - 1;
+ }
+ }
+}
+function sliceChunks(chunks, token) {
+ const startIndex = token.start._index;
+ const startBufferIndex = token.start._bufferIndex;
+ const endIndex = token.end._index;
+ const endBufferIndex = token.end._bufferIndex;
+ let view;
+ if (startIndex === endIndex) {
+ view = [chunks[startIndex].slice(startBufferIndex, endBufferIndex)];
+ } else {
+ view = chunks.slice(startIndex, endIndex);
+ if (startBufferIndex > -1) {
+ const head2 = view[0];
+ if (typeof head2 === "string") {
+ view[0] = head2.slice(startBufferIndex);
+ } else {
+ view.shift();
+ }
+ }
+ if (endBufferIndex > 0) {
+ view.push(chunks[endIndex].slice(0, endBufferIndex));
+ }
+ }
+ return view;
+}
+function serializeChunks(chunks, expandTabs) {
+ let index2 = -1;
+ const result = [];
+ let atTab;
+ while (++index2 < chunks.length) {
+ const chunk = chunks[index2];
+ let value2;
+ if (typeof chunk === "string") {
+ value2 = chunk;
+ } else switch (chunk) {
+ case -5: {
+ value2 = "\r";
+ break;
+ }
+ case -4: {
+ value2 = "\n";
+ break;
+ }
+ case -3: {
+ value2 = "\r\n";
+ break;
+ }
+ case -2: {
+ value2 = expandTabs ? " " : " ";
+ break;
+ }
+ case -1: {
+ if (!expandTabs && atTab) continue;
+ value2 = " ";
+ break;
+ }
+ default: {
+ value2 = String.fromCharCode(chunk);
+ }
+ }
+ atTab = chunk === -2;
+ result.push(value2);
+ }
+ return result.join("");
+}
+var init_create_tokenizer = __esm({
+ "node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/create-tokenizer.js"() {
+ init_micromark_util_character();
+ init_micromark_util_chunked();
+ init_micromark_util_resolve_all();
+ }
+});
+
+// node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/parse.js
+function parse4(options) {
+ const settings = options || {};
+ const constructs2 = (
+ /** @type {FullNormalizedExtension} */
+ combineExtensions([constructs_exports, ...settings.extensions || []])
+ );
+ const parser = {
+ constructs: constructs2,
+ content: create7(content2),
+ defined: [],
+ document: create7(document2),
+ flow: create7(flow),
+ lazy: {},
+ string: create7(string),
+ text: create7(text3)
+ };
+ return parser;
+ function create7(initial2) {
+ return creator;
+ function creator(from2) {
+ return createTokenizer(parser, initial2, from2);
+ }
+ }
+}
+var init_parse2 = __esm({
+ "node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/parse.js"() {
+ init_micromark_util_combine_extensions();
+ init_content2();
+ init_document();
+ init_flow();
+ init_text2();
+ init_constructs();
+ init_create_tokenizer();
+ }
+});
+
+// node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/postprocess.js
+function postprocess(events) {
+ while (!subtokenize(events)) {
+ }
+ return events;
+}
+var init_postprocess = __esm({
+ "node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/postprocess.js"() {
+ init_micromark_util_subtokenize();
+ }
+});
+
+// node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/preprocess.js
+function preprocess() {
+ let column = 1;
+ let buffer2 = "";
+ let start = true;
+ let atCarriageReturn;
+ return preprocessor;
+ function preprocessor(value2, encoding, end3) {
+ const chunks = [];
+ let match2;
+ let next2;
+ let startPosition;
+ let endPosition;
+ let code4;
+ value2 = buffer2 + (typeof value2 === "string" ? value2.toString() : new TextDecoder(encoding || void 0).decode(value2));
+ startPosition = 0;
+ buffer2 = "";
+ if (start) {
+ if (value2.charCodeAt(0) === 65279) {
+ startPosition++;
+ }
+ start = void 0;
+ }
+ while (startPosition < value2.length) {
+ search.lastIndex = startPosition;
+ match2 = search.exec(value2);
+ endPosition = match2 && match2.index !== void 0 ? match2.index : value2.length;
+ code4 = value2.charCodeAt(endPosition);
+ if (!match2) {
+ buffer2 = value2.slice(startPosition);
+ break;
+ }
+ if (code4 === 10 && startPosition === endPosition && atCarriageReturn) {
+ chunks.push(-3);
+ atCarriageReturn = void 0;
+ } else {
+ if (atCarriageReturn) {
+ chunks.push(-5);
+ atCarriageReturn = void 0;
+ }
+ if (startPosition < endPosition) {
+ chunks.push(value2.slice(startPosition, endPosition));
+ column += endPosition - startPosition;
+ }
+ switch (code4) {
+ case 0: {
+ chunks.push(65533);
+ column++;
+ break;
+ }
+ case 9: {
+ next2 = Math.ceil(column / 4) * 4;
+ chunks.push(-2);
+ while (column++ < next2) chunks.push(-1);
+ break;
+ }
+ case 10: {
+ chunks.push(-4);
+ column = 1;
+ break;
+ }
+ default: {
+ atCarriageReturn = true;
+ column = 1;
+ }
+ }
+ }
+ startPosition = endPosition + 1;
+ }
+ if (end3) {
+ if (atCarriageReturn) chunks.push(-5);
+ if (buffer2) chunks.push(buffer2);
+ chunks.push(null);
+ }
+ return chunks;
+ }
+}
+var search;
+var init_preprocess = __esm({
+ "node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/lib/preprocess.js"() {
+ search = /[\0\t\n\r]/g;
+ }
+});
+
+// node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/index.js
+function micromark(value2, encoding, options) {
+ if (typeof encoding !== "string") {
+ options = encoding;
+ encoding = void 0;
+ }
+ return compile(options)(postprocess(parse4(options).document().write(preprocess()(value2, encoding, true))));
+}
+var init_micromark = __esm({
+ "node_modules/.pnpm/micromark@4.0.2/node_modules/micromark/index.js"() {
+ init_compile();
+ init_parse2();
+ init_postprocess();
+ init_preprocess();
+ init_compile();
+ init_parse2();
+ init_postprocess();
+ init_preprocess();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-from-markdown@2.0.3/node_modules/mdast-util-from-markdown/lib/index.js
+function fromMarkdown(value2, encoding, options) {
+ if (encoding && typeof encoding === "object") {
+ options = encoding;
+ encoding = void 0;
+ }
+ return compiler(options)(postprocess(parse4(options).document().write(preprocess()(value2, encoding, true))));
+}
+function compiler(options) {
+ const config3 = {
+ transforms: [],
+ canContainEols: ["emphasis", "fragment", "heading", "paragraph", "strong"],
+ enter: {
+ autolink: opener2(link3),
+ autolinkProtocol: onenterdata,
+ autolinkEmail: onenterdata,
+ atxHeading: opener2(heading3),
+ blockQuote: opener2(blockQuote2),
+ characterEscape: onenterdata,
+ characterReference: onenterdata,
+ codeFenced: opener2(codeFlow),
+ codeFencedFenceInfo: buffer2,
+ codeFencedFenceMeta: buffer2,
+ codeIndented: opener2(codeFlow, buffer2),
+ codeText: opener2(codeText2, buffer2),
+ codeTextData: onenterdata,
+ data: onenterdata,
+ codeFlowValue: onenterdata,
+ definition: opener2(definition3),
+ definitionDestinationString: buffer2,
+ definitionLabelString: buffer2,
+ definitionTitleString: buffer2,
+ emphasis: opener2(emphasis3),
+ hardBreakEscape: opener2(hardBreak3),
+ hardBreakTrailing: opener2(hardBreak3),
+ htmlFlow: opener2(html7, buffer2),
+ htmlFlowData: onenterdata,
+ htmlText: opener2(html7, buffer2),
+ htmlTextData: onenterdata,
+ image: opener2(image3),
+ label: buffer2,
+ link: opener2(link3),
+ listItem: opener2(listItem3),
+ listItemValue: onenterlistitemvalue,
+ listOrdered: opener2(list5, onenterlistordered),
+ listUnordered: opener2(list5),
+ paragraph: opener2(paragraph3),
+ reference: onenterreference,
+ referenceString: buffer2,
+ resourceDestinationString: buffer2,
+ resourceTitleString: buffer2,
+ setextHeading: opener2(heading3),
+ strong: opener2(strong3),
+ thematicBreak: opener2(thematicBreak4)
+ },
+ exit: {
+ atxHeading: closer(),
+ atxHeadingSequence: onexitatxheadingsequence,
+ autolink: closer(),
+ autolinkEmail: onexitautolinkemail,
+ autolinkProtocol: onexitautolinkprotocol,
+ blockQuote: closer(),
+ characterEscapeValue: onexitdata,
+ characterReferenceMarkerHexadecimal: onexitcharacterreferencemarker,
+ characterReferenceMarkerNumeric: onexitcharacterreferencemarker,
+ characterReferenceValue: onexitcharacterreferencevalue,
+ characterReference: onexitcharacterreference,
+ codeFenced: closer(onexitcodefenced),
+ codeFencedFence: onexitcodefencedfence,
+ codeFencedFenceInfo: onexitcodefencedfenceinfo,
+ codeFencedFenceMeta: onexitcodefencedfencemeta,
+ codeFlowValue: onexitdata,
+ codeIndented: closer(onexitcodeindented),
+ codeText: closer(onexitcodetext),
+ codeTextData: onexitdata,
+ data: onexitdata,
+ definition: closer(),
+ definitionDestinationString: onexitdefinitiondestinationstring,
+ definitionLabelString: onexitdefinitionlabelstring,
+ definitionTitleString: onexitdefinitiontitlestring,
+ emphasis: closer(),
+ hardBreakEscape: closer(onexithardbreak),
+ hardBreakTrailing: closer(onexithardbreak),
+ htmlFlow: closer(onexithtmlflow),
+ htmlFlowData: onexitdata,
+ htmlText: closer(onexithtmltext),
+ htmlTextData: onexitdata,
+ image: closer(onexitimage),
+ label: onexitlabel,
+ labelText: onexitlabeltext,
+ lineEnding: onexitlineending,
+ link: closer(onexitlink),
+ listItem: closer(),
+ listOrdered: closer(),
+ listUnordered: closer(),
+ paragraph: closer(),
+ referenceString: onexitreferencestring,
+ resourceDestinationString: onexitresourcedestinationstring,
+ resourceTitleString: onexitresourcetitlestring,
+ resource: onexitresource,
+ setextHeading: closer(onexitsetextheading),
+ setextHeadingLineSequence: onexitsetextheadinglinesequence,
+ setextHeadingText: onexitsetextheadingtext,
+ strong: closer(),
+ thematicBreak: closer()
+ }
+ };
+ configure2(config3, (options || {}).mdastExtensions || []);
+ const data8 = {};
+ return compile2;
+ function compile2(events) {
+ let tree = {
+ type: "root",
+ children: []
+ };
+ const context2 = {
+ stack: [tree],
+ tokenStack: [],
+ config: config3,
+ enter,
+ exit: exit3,
+ buffer: buffer2,
+ resume,
+ data: data8
+ };
+ const listStack = [];
+ let index2 = -1;
+ while (++index2 < events.length) {
+ if (events[index2][1].type === "listOrdered" || events[index2][1].type === "listUnordered") {
+ if (events[index2][0] === "enter") {
+ listStack.push(index2);
+ } else {
+ const tail = listStack.pop();
+ index2 = prepareList(events, tail, index2);
+ }
+ }
+ }
+ index2 = -1;
+ while (++index2 < events.length) {
+ const handler2 = config3[events[index2][0]];
+ if (own5.call(handler2, events[index2][1].type)) {
+ handler2[events[index2][1].type].call(Object.assign({
+ sliceSerialize: events[index2][2].sliceSerialize
+ }, context2), events[index2][1]);
+ }
+ }
+ if (context2.tokenStack.length > 0) {
+ const tail = context2.tokenStack[context2.tokenStack.length - 1];
+ const handler2 = tail[1] || defaultOnError;
+ handler2.call(context2, void 0, tail[0]);
+ }
+ tree.position = {
+ start: point2(events.length > 0 ? events[0][1].start : {
+ line: 1,
+ column: 1,
+ offset: 0
+ }),
+ end: point2(events.length > 0 ? events[events.length - 2][1].end : {
+ line: 1,
+ column: 1,
+ offset: 0
+ })
+ };
+ index2 = -1;
+ while (++index2 < config3.transforms.length) {
+ tree = config3.transforms[index2](tree) || tree;
+ }
+ return tree;
+ }
+ function prepareList(events, start, length) {
+ let index2 = start - 1;
+ let containerBalance = -1;
+ let listSpread = false;
+ let listItem4;
+ let lineIndex;
+ let firstBlankLineIndex;
+ let atMarker;
+ while (++index2 <= length) {
+ const event = events[index2];
+ switch (event[1].type) {
+ case "listUnordered":
+ case "listOrdered":
+ case "blockQuote": {
+ if (event[0] === "enter") {
+ containerBalance++;
+ } else {
+ containerBalance--;
+ }
+ atMarker = void 0;
+ break;
+ }
+ case "lineEndingBlank": {
+ if (event[0] === "enter") {
+ if (listItem4 && !atMarker && !containerBalance && !firstBlankLineIndex) {
+ firstBlankLineIndex = index2;
+ }
+ atMarker = void 0;
+ }
+ break;
+ }
+ case "linePrefix":
+ case "listItemValue":
+ case "listItemMarker":
+ case "listItemPrefix":
+ case "listItemPrefixWhitespace": {
+ break;
+ }
+ default: {
+ atMarker = void 0;
+ }
+ }
+ if (!containerBalance && event[0] === "enter" && event[1].type === "listItemPrefix" || containerBalance === -1 && event[0] === "exit" && (event[1].type === "listUnordered" || event[1].type === "listOrdered")) {
+ if (listItem4) {
+ let tailIndex = index2;
+ lineIndex = void 0;
+ while (tailIndex--) {
+ const tailEvent = events[tailIndex];
+ if (tailEvent[1].type === "lineEnding" || tailEvent[1].type === "lineEndingBlank") {
+ if (tailEvent[0] === "exit") continue;
+ if (lineIndex) {
+ events[lineIndex][1].type = "lineEndingBlank";
+ listSpread = true;
+ }
+ tailEvent[1].type = "lineEnding";
+ lineIndex = tailIndex;
+ } else if (tailEvent[1].type === "linePrefix" || tailEvent[1].type === "blockQuotePrefix" || tailEvent[1].type === "blockQuotePrefixWhitespace" || tailEvent[1].type === "blockQuoteMarker" || tailEvent[1].type === "listItemIndent") {
+ } else {
+ break;
+ }
+ }
+ if (firstBlankLineIndex && (!lineIndex || firstBlankLineIndex < lineIndex)) {
+ listItem4._spread = true;
+ }
+ listItem4.end = Object.assign({}, lineIndex ? events[lineIndex][1].start : event[1].end);
+ events.splice(lineIndex || index2, 0, ["exit", listItem4, event[2]]);
+ index2++;
+ length++;
+ }
+ if (event[1].type === "listItemPrefix") {
+ const item = {
+ type: "listItem",
+ _spread: false,
+ start: Object.assign({}, event[1].start),
+ // @ts-expect-error: we’ll add `end` in a second.
+ end: void 0
+ };
+ listItem4 = item;
+ events.splice(index2, 0, ["enter", item, event[2]]);
+ index2++;
+ length++;
+ firstBlankLineIndex = void 0;
+ atMarker = true;
+ }
+ }
+ }
+ events[start][1]._spread = listSpread;
+ return length;
+ }
+ function opener2(create7, and) {
+ return open;
+ function open(token) {
+ enter.call(this, create7(token), token);
+ if (and) and.call(this, token);
+ }
+ }
+ function buffer2() {
+ this.stack.push({
+ type: "fragment",
+ children: []
+ });
+ }
+ function enter(node2, token, errorHandler) {
+ const parent = this.stack[this.stack.length - 1];
+ const siblings2 = parent.children;
+ siblings2.push(node2);
+ this.stack.push(node2);
+ this.tokenStack.push([token, errorHandler || void 0]);
+ node2.position = {
+ start: point2(token.start),
+ // @ts-expect-error: `end` will be patched later.
+ end: void 0
+ };
+ }
+ function closer(and) {
+ return close7;
+ function close7(token) {
+ if (and) and.call(this, token);
+ exit3.call(this, token);
+ }
+ }
+ function exit3(token, onExitError) {
+ const node2 = this.stack.pop();
+ const open = this.tokenStack.pop();
+ if (!open) {
+ throw new Error("Cannot close `" + token.type + "` (" + stringifyPosition({
+ start: token.start,
+ end: token.end
+ }) + "): it\u2019s not open");
+ } else if (open[0].type !== token.type) {
+ if (onExitError) {
+ onExitError.call(this, token, open[0]);
+ } else {
+ const handler2 = open[1] || defaultOnError;
+ handler2.call(this, token, open[0]);
+ }
+ }
+ node2.position.end = point2(token.end);
+ }
+ function resume() {
+ return toString(this.stack.pop());
+ }
+ function onenterlistordered() {
+ this.data.expectingFirstListItemValue = true;
+ }
+ function onenterlistitemvalue(token) {
+ if (this.data.expectingFirstListItemValue) {
+ const ancestor = this.stack[this.stack.length - 2];
+ ancestor.start = Number.parseInt(this.sliceSerialize(token), 10);
+ this.data.expectingFirstListItemValue = void 0;
+ }
+ }
+ function onexitcodefencedfenceinfo() {
+ const data9 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.lang = data9;
+ }
+ function onexitcodefencedfencemeta() {
+ const data9 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.meta = data9;
+ }
+ function onexitcodefencedfence() {
+ if (this.data.flowCodeInside) return;
+ this.buffer();
+ this.data.flowCodeInside = true;
+ }
+ function onexitcodefenced() {
+ const data9 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.value = data9.replace(/^(\r?\n|\r)|(\r?\n|\r)$/g, "");
+ this.data.flowCodeInside = void 0;
+ }
+ function onexitcodeindented() {
+ const data9 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.value = data9.replace(/(\r?\n|\r)$/g, "");
+ }
+ function onexitdefinitionlabelstring(token) {
+ const label = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.label = label;
+ node2.identifier = normalizeIdentifier(this.sliceSerialize(token)).toLowerCase();
+ }
+ function onexitdefinitiontitlestring() {
+ const data9 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.title = data9;
+ }
+ function onexitdefinitiondestinationstring() {
+ const data9 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.url = data9;
+ }
+ function onexitatxheadingsequence(token) {
+ const node2 = this.stack[this.stack.length - 1];
+ if (!node2.depth) {
+ const depth = this.sliceSerialize(token).length;
+ node2.depth = depth;
+ }
+ }
+ function onexitsetextheadingtext() {
+ this.data.setextHeadingSlurpLineEnding = true;
+ }
+ function onexitsetextheadinglinesequence(token) {
+ const node2 = this.stack[this.stack.length - 1];
+ node2.depth = this.sliceSerialize(token).codePointAt(0) === 61 ? 1 : 2;
+ }
+ function onexitsetextheading() {
+ this.data.setextHeadingSlurpLineEnding = void 0;
+ }
+ function onenterdata(token) {
+ const node2 = this.stack[this.stack.length - 1];
+ const siblings2 = node2.children;
+ let tail = siblings2[siblings2.length - 1];
+ if (!tail || tail.type !== "text") {
+ tail = text9();
+ tail.position = {
+ start: point2(token.start),
+ // @ts-expect-error: we’ll add `end` later.
+ end: void 0
+ };
+ siblings2.push(tail);
+ }
+ this.stack.push(tail);
+ }
+ function onexitdata(token) {
+ const tail = this.stack.pop();
+ tail.value += this.sliceSerialize(token);
+ tail.position.end = point2(token.end);
+ }
+ function onexitlineending(token) {
+ const context2 = this.stack[this.stack.length - 1];
+ if (this.data.atHardBreak) {
+ const tail = context2.children[context2.children.length - 1];
+ tail.position.end = point2(token.end);
+ this.data.atHardBreak = void 0;
+ return;
+ }
+ if (!this.data.setextHeadingSlurpLineEnding && config3.canContainEols.includes(context2.type)) {
+ onenterdata.call(this, token);
+ onexitdata.call(this, token);
+ }
+ }
+ function onexithardbreak() {
+ this.data.atHardBreak = true;
+ }
+ function onexithtmlflow() {
+ const data9 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.value = data9;
+ }
+ function onexithtmltext() {
+ const data9 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.value = data9;
+ }
+ function onexitcodetext() {
+ const data9 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.value = data9;
+ }
+ function onexitlink() {
+ const node2 = this.stack[this.stack.length - 1];
+ if (this.data.inReference) {
+ const referenceType = this.data.referenceType || "shortcut";
+ node2.type += "Reference";
+ node2.referenceType = referenceType;
+ delete node2.url;
+ delete node2.title;
+ } else {
+ delete node2.identifier;
+ delete node2.label;
+ }
+ this.data.referenceType = void 0;
+ }
+ function onexitimage() {
+ const node2 = this.stack[this.stack.length - 1];
+ if (this.data.inReference) {
+ const referenceType = this.data.referenceType || "shortcut";
+ node2.type += "Reference";
+ node2.referenceType = referenceType;
+ delete node2.url;
+ delete node2.title;
+ } else {
+ delete node2.identifier;
+ delete node2.label;
+ }
+ this.data.referenceType = void 0;
+ }
+ function onexitlabeltext(token) {
+ const string3 = this.sliceSerialize(token);
+ const ancestor = this.stack[this.stack.length - 2];
+ ancestor.label = decodeString(string3);
+ ancestor.identifier = normalizeIdentifier(string3).toLowerCase();
+ }
+ function onexitlabel() {
+ const fragment = this.stack[this.stack.length - 1];
+ const value2 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ this.data.inReference = true;
+ if (node2.type === "link") {
+ const children2 = fragment.children;
+ node2.children = children2;
+ } else {
+ node2.alt = value2;
+ }
+ }
+ function onexitresourcedestinationstring() {
+ const data9 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.url = data9;
+ }
+ function onexitresourcetitlestring() {
+ const data9 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.title = data9;
+ }
+ function onexitresource() {
+ this.data.inReference = void 0;
+ }
+ function onenterreference() {
+ this.data.referenceType = "collapsed";
+ }
+ function onexitreferencestring(token) {
+ const label = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ node2.label = label;
+ node2.identifier = normalizeIdentifier(this.sliceSerialize(token)).toLowerCase();
+ this.data.referenceType = "full";
+ }
+ function onexitcharacterreferencemarker(token) {
+ this.data.characterReferenceType = token.type;
+ }
+ function onexitcharacterreferencevalue(token) {
+ const data9 = this.sliceSerialize(token);
+ const type5 = this.data.characterReferenceType;
+ let value2;
+ if (type5) {
+ value2 = decodeNumericCharacterReference(data9, type5 === "characterReferenceMarkerNumeric" ? 10 : 16);
+ this.data.characterReferenceType = void 0;
+ } else {
+ const result = decodeNamedCharacterReference(data9);
+ value2 = result;
+ }
+ const tail = this.stack[this.stack.length - 1];
+ tail.value += value2;
+ }
+ function onexitcharacterreference(token) {
+ const tail = this.stack.pop();
+ tail.position.end = point2(token.end);
+ }
+ function onexitautolinkprotocol(token) {
+ onexitdata.call(this, token);
+ const node2 = this.stack[this.stack.length - 1];
+ node2.url = this.sliceSerialize(token);
+ }
+ function onexitautolinkemail(token) {
+ onexitdata.call(this, token);
+ const node2 = this.stack[this.stack.length - 1];
+ node2.url = "mailto:" + this.sliceSerialize(token);
+ }
+ function blockQuote2() {
+ return {
+ type: "blockquote",
+ children: []
+ };
+ }
+ function codeFlow() {
+ return {
+ type: "code",
+ lang: null,
+ meta: null,
+ value: ""
+ };
+ }
+ function codeText2() {
+ return {
+ type: "inlineCode",
+ value: ""
+ };
+ }
+ function definition3() {
+ return {
+ type: "definition",
+ identifier: "",
+ label: null,
+ title: null,
+ url: ""
+ };
+ }
+ function emphasis3() {
+ return {
+ type: "emphasis",
+ children: []
+ };
+ }
+ function heading3() {
+ return {
+ type: "heading",
+ // @ts-expect-error `depth` will be set later.
+ depth: 0,
+ children: []
+ };
+ }
+ function hardBreak3() {
+ return {
+ type: "break"
+ };
+ }
+ function html7() {
+ return {
+ type: "html",
+ value: ""
+ };
+ }
+ function image3() {
+ return {
+ type: "image",
+ title: null,
+ url: "",
+ alt: null
+ };
+ }
+ function link3() {
+ return {
+ type: "link",
+ title: null,
+ url: "",
+ children: []
+ };
+ }
+ function list5(token) {
+ return {
+ type: "list",
+ ordered: token.type === "listOrdered",
+ start: null,
+ spread: token._spread,
+ children: []
+ };
+ }
+ function listItem3(token) {
+ return {
+ type: "listItem",
+ spread: token._spread,
+ checked: null,
+ children: []
+ };
+ }
+ function paragraph3() {
+ return {
+ type: "paragraph",
+ children: []
+ };
+ }
+ function strong3() {
+ return {
+ type: "strong",
+ children: []
+ };
+ }
+ function text9() {
+ return {
+ type: "text",
+ value: ""
+ };
+ }
+ function thematicBreak4() {
+ return {
+ type: "thematicBreak"
+ };
+ }
+}
+function point2(d5) {
+ return {
+ line: d5.line,
+ column: d5.column,
+ offset: d5.offset
+ };
+}
+function configure2(combined, extensions) {
+ let index2 = -1;
+ while (++index2 < extensions.length) {
+ const value2 = extensions[index2];
+ if (Array.isArray(value2)) {
+ configure2(combined, value2);
+ } else {
+ extension(combined, value2);
+ }
+ }
+}
+function extension(combined, extension2) {
+ let key2;
+ for (key2 in extension2) {
+ if (own5.call(extension2, key2)) {
+ switch (key2) {
+ case "canContainEols": {
+ const right = extension2[key2];
+ if (right) {
+ combined[key2].push(...right);
+ }
+ break;
+ }
+ case "transforms": {
+ const right = extension2[key2];
+ if (right) {
+ combined[key2].push(...right);
+ }
+ break;
+ }
+ case "enter":
+ case "exit": {
+ const right = extension2[key2];
+ if (right) {
+ Object.assign(combined[key2], right);
+ }
+ break;
+ }
+ }
+ }
+ }
+}
+function defaultOnError(left, right) {
+ if (left) {
+ throw new Error("Cannot close `" + left.type + "` (" + stringifyPosition({
+ start: left.start,
+ end: left.end
+ }) + "): a different token (`" + right.type + "`, " + stringifyPosition({
+ start: right.start,
+ end: right.end
+ }) + ") is open");
+ } else {
+ throw new Error("Cannot close document, a token (`" + right.type + "`, " + stringifyPosition({
+ start: right.start,
+ end: right.end
+ }) + ") is still open");
+ }
+}
+var own5;
+var init_lib21 = __esm({
+ "node_modules/.pnpm/mdast-util-from-markdown@2.0.3/node_modules/mdast-util-from-markdown/lib/index.js"() {
+ init_mdast_util_to_string();
+ init_micromark();
+ init_micromark_util_decode_numeric_character_reference();
+ init_micromark_util_decode_string();
+ init_micromark_util_normalize_identifier();
+ init_index_dom();
+ init_unist_util_stringify_position();
+ own5 = {}.hasOwnProperty;
+ }
+});
+
+// node_modules/.pnpm/mdast-util-from-markdown@2.0.3/node_modules/mdast-util-from-markdown/index.js
+var init_mdast_util_from_markdown = __esm({
+ "node_modules/.pnpm/mdast-util-from-markdown@2.0.3/node_modules/mdast-util-from-markdown/index.js"() {
+ init_lib21();
+ }
+});
+
+// node_modules/.pnpm/remark-parse@11.0.0/node_modules/remark-parse/lib/index.js
+function remarkParse(options) {
+ const self2 = this;
+ self2.parser = parser;
+ function parser(doc) {
+ return fromMarkdown(doc, {
+ ...self2.data("settings"),
+ ...options,
+ // Note: these options are not in the readme.
+ // The goal is for them to be set by plugins on `data` instead of being
+ // passed by users.
+ extensions: self2.data("micromarkExtensions") || [],
+ mdastExtensions: self2.data("fromMarkdownExtensions") || []
+ });
+ }
+}
+var init_lib22 = __esm({
+ "node_modules/.pnpm/remark-parse@11.0.0/node_modules/remark-parse/lib/index.js"() {
+ init_mdast_util_from_markdown();
+ }
+});
+
+// node_modules/.pnpm/remark-parse@11.0.0/node_modules/remark-parse/index.js
+var init_remark_parse = __esm({
+ "node_modules/.pnpm/remark-parse@11.0.0/node_modules/remark-parse/index.js"() {
+ init_lib22();
+ }
+});
+
+// node_modules/.pnpm/format@0.2.2/node_modules/format/format.js
+var require_format = __commonJS({
+ "node_modules/.pnpm/format@0.2.2/node_modules/format/format.js"(exports, module) {
+ ;
+ (function() {
+ var namespace2;
+ if (typeof module !== "undefined") {
+ namespace2 = module.exports = format2;
+ } else {
+ namespace2 = (function() {
+ return this || (1, eval)("this");
+ })();
+ }
+ namespace2.format = format2;
+ namespace2.vsprintf = vsprintf;
+ if (typeof console !== "undefined" && typeof console.log === "function") {
+ namespace2.printf = printf;
+ }
+ function printf() {
+ console.log(format2.apply(null, arguments));
+ }
+ function vsprintf(fmt, replacements) {
+ return format2.apply(null, [fmt].concat(replacements));
+ }
+ function format2(fmt) {
+ var argIndex = 1, args = [].slice.call(arguments), i11 = 0, n12 = fmt.length, result = "", c11, escaped = false, arg, tmp, leadingZero = false, precision, nextArg = function() {
+ return args[argIndex++];
+ }, slurpNumber = function() {
+ var digits = "";
+ while (/\d/.test(fmt[i11])) {
+ digits += fmt[i11++];
+ c11 = fmt[i11];
+ }
+ return digits.length > 0 ? parseInt(digits) : null;
+ };
+ for (; i11 < n12; ++i11) {
+ c11 = fmt[i11];
+ if (escaped) {
+ escaped = false;
+ if (c11 == ".") {
+ leadingZero = false;
+ c11 = fmt[++i11];
+ } else if (c11 == "0" && fmt[i11 + 1] == ".") {
+ leadingZero = true;
+ i11 += 2;
+ c11 = fmt[i11];
+ } else {
+ leadingZero = true;
+ }
+ precision = slurpNumber();
+ switch (c11) {
+ case "b":
+ result += parseInt(nextArg(), 10).toString(2);
+ break;
+ case "c":
+ arg = nextArg();
+ if (typeof arg === "string" || arg instanceof String)
+ result += arg;
+ else
+ result += String.fromCharCode(parseInt(arg, 10));
+ break;
+ case "d":
+ result += parseInt(nextArg(), 10);
+ break;
+ case "f":
+ tmp = String(parseFloat(nextArg()).toFixed(precision || 6));
+ result += leadingZero ? tmp : tmp.replace(/^0/, "");
+ break;
+ case "j":
+ result += JSON.stringify(nextArg());
+ break;
+ case "o":
+ result += "0" + parseInt(nextArg(), 10).toString(8);
+ break;
+ case "s":
+ result += nextArg();
+ break;
+ case "x":
+ result += "0x" + parseInt(nextArg(), 10).toString(16);
+ break;
+ case "X":
+ result += "0x" + parseInt(nextArg(), 10).toString(16).toUpperCase();
+ break;
+ default:
+ result += c11;
+ break;
+ }
+ } else if (c11 === "%") {
+ escaped = true;
+ } else {
+ result += c11;
+ }
+ }
+ return result;
+ }
+ })();
+ }
+});
+
+// node_modules/.pnpm/fault@2.0.1/node_modules/fault/index.js
+function create5(Constructor) {
+ FormattedError.displayName = Constructor.displayName || Constructor.name;
+ return FormattedError;
+ function FormattedError(format2, ...values) {
+ const reason = format2 ? (0, import_format2.default)(format2, ...values) : format2;
+ return new Constructor(reason);
+ }
+}
+var import_format2, fault;
+var init_fault = __esm({
+ "node_modules/.pnpm/fault@2.0.1/node_modules/fault/index.js"() {
+ import_format2 = __toESM(require_format(), 1);
+ fault = Object.assign(create5(Error), {
+ eval: create5(EvalError),
+ range: create5(RangeError),
+ reference: create5(ReferenceError),
+ syntax: create5(SyntaxError),
+ type: create5(TypeError),
+ uri: create5(URIError)
+ });
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-frontmatter@2.0.0/node_modules/micromark-extension-frontmatter/lib/to-matters.js
+function toMatters(options) {
+ const result = [];
+ let index2 = -1;
+ const presetsOrMatters = Array.isArray(options) ? options : options ? [options] : ["yaml"];
+ while (++index2 < presetsOrMatters.length) {
+ result[index2] = matter(presetsOrMatters[index2]);
+ }
+ return result;
+}
+function matter(option2) {
+ let result = option2;
+ if (typeof result === "string") {
+ if (!own6.call(markers, result)) {
+ throw fault("Missing matter definition for `%s`", result);
+ }
+ result = {
+ type: result,
+ marker: markers[result]
+ };
+ } else if (typeof result !== "object") {
+ throw fault("Expected matter to be an object, not `%j`", result);
+ }
+ if (!own6.call(result, "type")) {
+ throw fault("Missing `type` in matter `%j`", result);
+ }
+ if (!own6.call(result, "fence") && !own6.call(result, "marker")) {
+ throw fault("Missing `marker` or `fence` in matter `%j`", result);
+ }
+ return result;
+}
+var own6, markers;
+var init_to_matters = __esm({
+ "node_modules/.pnpm/micromark-extension-frontmatter@2.0.0/node_modules/micromark-extension-frontmatter/lib/to-matters.js"() {
+ init_fault();
+ own6 = {}.hasOwnProperty;
+ markers = {
+ yaml: "-",
+ toml: "+"
+ };
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-frontmatter@2.0.0/node_modules/micromark-extension-frontmatter/lib/syntax.js
+function frontmatter(options) {
+ const matters = toMatters(options);
+ const flow3 = {};
+ let index2 = -1;
+ while (++index2 < matters.length) {
+ const matter2 = matters[index2];
+ const code4 = fence(matter2, "open").charCodeAt(0);
+ const construct = createConstruct(matter2);
+ const existing = flow3[code4];
+ if (Array.isArray(existing)) {
+ existing.push(construct);
+ } else {
+ flow3[code4] = [construct];
+ }
+ }
+ return {
+ flow: flow3
+ };
+}
+function createConstruct(matter2) {
+ const anywhere = matter2.anywhere;
+ const frontmatterType = (
+ /** @type {TokenType} */
+ matter2.type
+ );
+ const fenceType = (
+ /** @type {TokenType} */
+ frontmatterType + "Fence"
+ );
+ const sequenceType = (
+ /** @type {TokenType} */
+ fenceType + "Sequence"
+ );
+ const valueType = (
+ /** @type {TokenType} */
+ frontmatterType + "Value"
+ );
+ const closingFenceConstruct = {
+ tokenize: tokenizeClosingFence,
+ partial: true
+ };
+ let buffer2;
+ let bufferIndex = 0;
+ return {
+ tokenize: tokenizeFrontmatter,
+ concrete: true
+ };
+ function tokenizeFrontmatter(effects, ok3, nok) {
+ const self2 = this;
+ return start;
+ function start(code4) {
+ const position3 = self2.now();
+ if (
+ // Indent not allowed.
+ position3.column === 1 && // Normally, only allowed in first line.
+ (position3.line === 1 || anywhere)
+ ) {
+ buffer2 = fence(matter2, "open");
+ bufferIndex = 0;
+ if (code4 === buffer2.charCodeAt(bufferIndex)) {
+ effects.enter(frontmatterType);
+ effects.enter(fenceType);
+ effects.enter(sequenceType);
+ return openSequence(code4);
+ }
+ }
+ return nok(code4);
+ }
+ function openSequence(code4) {
+ if (bufferIndex === buffer2.length) {
+ effects.exit(sequenceType);
+ if (markdownSpace(code4)) {
+ effects.enter("whitespace");
+ return openSequenceWhitespace(code4);
+ }
+ return openAfter(code4);
+ }
+ if (code4 === buffer2.charCodeAt(bufferIndex++)) {
+ effects.consume(code4);
+ return openSequence;
+ }
+ return nok(code4);
+ }
+ function openSequenceWhitespace(code4) {
+ if (markdownSpace(code4)) {
+ effects.consume(code4);
+ return openSequenceWhitespace;
+ }
+ effects.exit("whitespace");
+ return openAfter(code4);
+ }
+ function openAfter(code4) {
+ if (markdownLineEnding(code4)) {
+ effects.exit(fenceType);
+ effects.enter("lineEnding");
+ effects.consume(code4);
+ effects.exit("lineEnding");
+ buffer2 = fence(matter2, "close");
+ bufferIndex = 0;
+ return effects.attempt(closingFenceConstruct, after, contentStart);
+ }
+ return nok(code4);
+ }
+ function contentStart(code4) {
+ if (code4 === null || markdownLineEnding(code4)) {
+ return contentEnd(code4);
+ }
+ effects.enter(valueType);
+ return contentInside(code4);
+ }
+ function contentInside(code4) {
+ if (code4 === null || markdownLineEnding(code4)) {
+ effects.exit(valueType);
+ return contentEnd(code4);
+ }
+ effects.consume(code4);
+ return contentInside;
+ }
+ function contentEnd(code4) {
+ if (code4 === null) {
+ return nok(code4);
+ }
+ effects.enter("lineEnding");
+ effects.consume(code4);
+ effects.exit("lineEnding");
+ return effects.attempt(closingFenceConstruct, after, contentStart);
+ }
+ function after(code4) {
+ effects.exit(frontmatterType);
+ return ok3(code4);
+ }
+ }
+ function tokenizeClosingFence(effects, ok3, nok) {
+ let bufferIndex2 = 0;
+ return closeStart;
+ function closeStart(code4) {
+ if (code4 === buffer2.charCodeAt(bufferIndex2)) {
+ effects.enter(fenceType);
+ effects.enter(sequenceType);
+ return closeSequence(code4);
+ }
+ return nok(code4);
+ }
+ function closeSequence(code4) {
+ if (bufferIndex2 === buffer2.length) {
+ effects.exit(sequenceType);
+ if (markdownSpace(code4)) {
+ effects.enter("whitespace");
+ return closeSequenceWhitespace(code4);
+ }
+ return closeAfter(code4);
+ }
+ if (code4 === buffer2.charCodeAt(bufferIndex2++)) {
+ effects.consume(code4);
+ return closeSequence;
+ }
+ return nok(code4);
+ }
+ function closeSequenceWhitespace(code4) {
+ if (markdownSpace(code4)) {
+ effects.consume(code4);
+ return closeSequenceWhitespace;
+ }
+ effects.exit("whitespace");
+ return closeAfter(code4);
+ }
+ function closeAfter(code4) {
+ if (code4 === null || markdownLineEnding(code4)) {
+ effects.exit(fenceType);
+ return ok3(code4);
+ }
+ return nok(code4);
+ }
+ }
+}
+function fence(matter2, prop) {
+ return matter2.marker ? pick(matter2.marker, prop).repeat(3) : (
+ // @ts-expect-error: They’re mutually exclusive.
+ pick(matter2.fence, prop)
+ );
+}
+function pick(schema, prop) {
+ return typeof schema === "string" ? schema : schema[prop];
+}
+var init_syntax6 = __esm({
+ "node_modules/.pnpm/micromark-extension-frontmatter@2.0.0/node_modules/micromark-extension-frontmatter/lib/syntax.js"() {
+ init_micromark_util_character();
+ init_to_matters();
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-frontmatter@2.0.0/node_modules/micromark-extension-frontmatter/lib/html.js
+var init_html7 = __esm({
+ "node_modules/.pnpm/micromark-extension-frontmatter@2.0.0/node_modules/micromark-extension-frontmatter/lib/html.js"() {
+ }
+});
+
+// node_modules/.pnpm/micromark-extension-frontmatter@2.0.0/node_modules/micromark-extension-frontmatter/index.js
+var init_micromark_extension_frontmatter = __esm({
+ "node_modules/.pnpm/micromark-extension-frontmatter@2.0.0/node_modules/micromark-extension-frontmatter/index.js"() {
+ init_syntax6();
+ init_html7();
+ init_to_matters();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-frontmatter@2.0.1/node_modules/mdast-util-frontmatter/lib/index.js
+function frontmatterFromMarkdown(options) {
+ const matters = toMatters(options);
+ const enter = {};
+ const exit3 = {};
+ let index2 = -1;
+ while (++index2 < matters.length) {
+ const matter2 = matters[index2];
+ enter[matter2.type] = opener(matter2);
+ exit3[matter2.type] = close6;
+ exit3[matter2.type + "Value"] = value;
+ }
+ return { enter, exit: exit3 };
+}
+function opener(matter2) {
+ return open;
+ function open(token) {
+ this.enter({ type: matter2.type, value: "" }, token);
+ this.buffer();
+ }
+}
+function close6(token) {
+ const data8 = this.resume();
+ const node2 = this.stack[this.stack.length - 1];
+ ok("value" in node2);
+ this.exit(token);
+ node2.value = data8.replace(/^(\r?\n|\r)|(\r?\n|\r)$/g, "");
+}
+function value(token) {
+ this.config.enter.data.call(this, token);
+ this.config.exit.data.call(this, token);
+}
+function frontmatterToMarkdown(options) {
+ const unsafe2 = [];
+ const handlers2 = {};
+ const matters = toMatters(options);
+ let index2 = -1;
+ while (++index2 < matters.length) {
+ const matter2 = matters[index2];
+ handlers2[matter2.type] = handler(matter2);
+ const open = fence2(matter2, "open");
+ unsafe2.push({
+ atBreak: true,
+ character: open.charAt(0),
+ after: escapeStringRegexp(open.charAt(1))
+ });
+ }
+ return { unsafe: unsafe2, handlers: handlers2 };
+}
+function handler(matter2) {
+ const open = fence2(matter2, "open");
+ const close7 = fence2(matter2, "close");
+ return handle3;
+ function handle3(node2) {
+ return open + (node2.value ? "\n" + node2.value : "") + "\n" + close7;
+ }
+}
+function fence2(matter2, prop) {
+ return matter2.marker ? pick2(matter2.marker, prop).repeat(3) : (
+ // @ts-expect-error: They’re mutually exclusive.
+ pick2(matter2.fence, prop)
+ );
+}
+function pick2(schema, prop) {
+ return typeof schema === "string" ? schema : schema[prop];
+}
+var init_lib23 = __esm({
+ "node_modules/.pnpm/mdast-util-frontmatter@2.0.1/node_modules/mdast-util-frontmatter/lib/index.js"() {
+ init_default();
+ init_micromark_extension_frontmatter();
+ init_escape_string_regexp();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-frontmatter@2.0.1/node_modules/mdast-util-frontmatter/index.js
+var init_mdast_util_frontmatter = __esm({
+ "node_modules/.pnpm/mdast-util-frontmatter@2.0.1/node_modules/mdast-util-frontmatter/index.js"() {
+ init_lib23();
+ }
+});
+
+// node_modules/.pnpm/remark-frontmatter@5.0.0/node_modules/remark-frontmatter/lib/index.js
+function remarkFrontmatter(options) {
+ const self2 = (
+ /** @type {Processor} */
+ this
+ );
+ const settings = options || emptyOptions4;
+ const data8 = self2.data();
+ const micromarkExtensions = data8.micromarkExtensions || (data8.micromarkExtensions = []);
+ const fromMarkdownExtensions = data8.fromMarkdownExtensions || (data8.fromMarkdownExtensions = []);
+ const toMarkdownExtensions = data8.toMarkdownExtensions || (data8.toMarkdownExtensions = []);
+ micromarkExtensions.push(frontmatter(settings));
+ fromMarkdownExtensions.push(frontmatterFromMarkdown(settings));
+ toMarkdownExtensions.push(frontmatterToMarkdown(settings));
+}
+var emptyOptions4;
+var init_lib24 = __esm({
+ "node_modules/.pnpm/remark-frontmatter@5.0.0/node_modules/remark-frontmatter/lib/index.js"() {
+ init_mdast_util_frontmatter();
+ init_micromark_extension_frontmatter();
+ emptyOptions4 = "yaml";
+ }
+});
+
+// node_modules/.pnpm/remark-frontmatter@5.0.0/node_modules/remark-frontmatter/index.js
+var init_remark_frontmatter = __esm({
+ "node_modules/.pnpm/remark-frontmatter@5.0.0/node_modules/remark-frontmatter/index.js"() {
+ init_lib24();
+ }
+});
+
+// node_modules/.pnpm/@ungap+structured-clone@1.3.0/node_modules/@ungap/structured-clone/esm/types.js
+var VOID, PRIMITIVE, ARRAY, OBJECT, DATE, REGEXP, MAP, SET, ERROR, BIGINT;
+var init_types2 = __esm({
+ "node_modules/.pnpm/@ungap+structured-clone@1.3.0/node_modules/@ungap/structured-clone/esm/types.js"() {
+ VOID = -1;
+ PRIMITIVE = 0;
+ ARRAY = 1;
+ OBJECT = 2;
+ DATE = 3;
+ REGEXP = 4;
+ MAP = 5;
+ SET = 6;
+ ERROR = 7;
+ BIGINT = 8;
+ }
+});
+
+// node_modules/.pnpm/@ungap+structured-clone@1.3.0/node_modules/@ungap/structured-clone/esm/deserialize.js
+var env, deserializer, deserialize;
+var init_deserialize = __esm({
+ "node_modules/.pnpm/@ungap+structured-clone@1.3.0/node_modules/@ungap/structured-clone/esm/deserialize.js"() {
+ init_types2();
+ env = typeof self === "object" ? self : globalThis;
+ deserializer = ($4, _4) => {
+ const as = (out, index2) => {
+ $4.set(index2, out);
+ return out;
+ };
+ const unpair = (index2) => {
+ if ($4.has(index2))
+ return $4.get(index2);
+ const [type5, value2] = _4[index2];
+ switch (type5) {
+ case PRIMITIVE:
+ case VOID:
+ return as(value2, index2);
+ case ARRAY: {
+ const arr = as([], index2);
+ for (const index3 of value2)
+ arr.push(unpair(index3));
+ return arr;
+ }
+ case OBJECT: {
+ const object = as({}, index2);
+ for (const [key2, index3] of value2)
+ object[unpair(key2)] = unpair(index3);
+ return object;
+ }
+ case DATE:
+ return as(new Date(value2), index2);
+ case REGEXP: {
+ const { source, flags } = value2;
+ return as(new RegExp(source, flags), index2);
+ }
+ case MAP: {
+ const map7 = as(/* @__PURE__ */ new Map(), index2);
+ for (const [key2, index3] of value2)
+ map7.set(unpair(key2), unpair(index3));
+ return map7;
+ }
+ case SET: {
+ const set3 = as(/* @__PURE__ */ new Set(), index2);
+ for (const index3 of value2)
+ set3.add(unpair(index3));
+ return set3;
+ }
+ case ERROR: {
+ const { name, message: message2 } = value2;
+ return as(new env[name](message2), index2);
+ }
+ case BIGINT:
+ return as(BigInt(value2), index2);
+ case "BigInt":
+ return as(Object(BigInt(value2)), index2);
+ case "ArrayBuffer":
+ return as(new Uint8Array(value2).buffer, value2);
+ case "DataView": {
+ const { buffer: buffer2 } = new Uint8Array(value2);
+ return as(new DataView(buffer2), value2);
+ }
+ }
+ return as(new env[type5](value2), index2);
+ };
+ return unpair;
+ };
+ deserialize = (serialized) => deserializer(/* @__PURE__ */ new Map(), serialized)(0);
+ }
+});
+
+// node_modules/.pnpm/@ungap+structured-clone@1.3.0/node_modules/@ungap/structured-clone/esm/serialize.js
+var EMPTY2, toString2, keys, typeOf, shouldSkip, serializer, serialize2;
+var init_serialize = __esm({
+ "node_modules/.pnpm/@ungap+structured-clone@1.3.0/node_modules/@ungap/structured-clone/esm/serialize.js"() {
+ init_types2();
+ EMPTY2 = "";
+ ({ toString: toString2 } = {});
+ ({ keys } = Object);
+ typeOf = (value2) => {
+ const type5 = typeof value2;
+ if (type5 !== "object" || !value2)
+ return [PRIMITIVE, type5];
+ const asString = toString2.call(value2).slice(8, -1);
+ switch (asString) {
+ case "Array":
+ return [ARRAY, EMPTY2];
+ case "Object":
+ return [OBJECT, EMPTY2];
+ case "Date":
+ return [DATE, EMPTY2];
+ case "RegExp":
+ return [REGEXP, EMPTY2];
+ case "Map":
+ return [MAP, EMPTY2];
+ case "Set":
+ return [SET, EMPTY2];
+ case "DataView":
+ return [ARRAY, asString];
+ }
+ if (asString.includes("Array"))
+ return [ARRAY, asString];
+ if (asString.includes("Error"))
+ return [ERROR, asString];
+ return [OBJECT, asString];
+ };
+ shouldSkip = ([TYPE, type5]) => TYPE === PRIMITIVE && (type5 === "function" || type5 === "symbol");
+ serializer = (strict, json, $4, _4) => {
+ const as = (out, value2) => {
+ const index2 = _4.push(out) - 1;
+ $4.set(value2, index2);
+ return index2;
+ };
+ const pair = (value2) => {
+ if ($4.has(value2))
+ return $4.get(value2);
+ let [TYPE, type5] = typeOf(value2);
+ switch (TYPE) {
+ case PRIMITIVE: {
+ let entry = value2;
+ switch (type5) {
+ case "bigint":
+ TYPE = BIGINT;
+ entry = value2.toString();
+ break;
+ case "function":
+ case "symbol":
+ if (strict)
+ throw new TypeError("unable to serialize " + type5);
+ entry = null;
+ break;
+ case "undefined":
+ return as([VOID], value2);
+ }
+ return as([TYPE, entry], value2);
+ }
+ case ARRAY: {
+ if (type5) {
+ let spread = value2;
+ if (type5 === "DataView") {
+ spread = new Uint8Array(value2.buffer);
+ } else if (type5 === "ArrayBuffer") {
+ spread = new Uint8Array(value2);
+ }
+ return as([type5, [...spread]], value2);
+ }
+ const arr = [];
+ const index2 = as([TYPE, arr], value2);
+ for (const entry of value2)
+ arr.push(pair(entry));
+ return index2;
+ }
+ case OBJECT: {
+ if (type5) {
+ switch (type5) {
+ case "BigInt":
+ return as([type5, value2.toString()], value2);
+ case "Boolean":
+ case "Number":
+ case "String":
+ return as([type5, value2.valueOf()], value2);
+ }
+ }
+ if (json && "toJSON" in value2)
+ return pair(value2.toJSON());
+ const entries = [];
+ const index2 = as([TYPE, entries], value2);
+ for (const key2 of keys(value2)) {
+ if (strict || !shouldSkip(typeOf(value2[key2])))
+ entries.push([pair(key2), pair(value2[key2])]);
+ }
+ return index2;
+ }
+ case DATE:
+ return as([TYPE, value2.toISOString()], value2);
+ case REGEXP: {
+ const { source, flags } = value2;
+ return as([TYPE, { source, flags }], value2);
+ }
+ case MAP: {
+ const entries = [];
+ const index2 = as([TYPE, entries], value2);
+ for (const [key2, entry] of value2) {
+ if (strict || !(shouldSkip(typeOf(key2)) || shouldSkip(typeOf(entry))))
+ entries.push([pair(key2), pair(entry)]);
+ }
+ return index2;
+ }
+ case SET: {
+ const entries = [];
+ const index2 = as([TYPE, entries], value2);
+ for (const entry of value2) {
+ if (strict || !shouldSkip(typeOf(entry)))
+ entries.push(pair(entry));
+ }
+ return index2;
+ }
+ }
+ const { message: message2 } = value2;
+ return as([TYPE, { name: type5, message: message2 }], value2);
+ };
+ return pair;
+ };
+ serialize2 = (value2, { json, lossy } = {}) => {
+ const _4 = [];
+ return serializer(!(json || lossy), !!json, /* @__PURE__ */ new Map(), _4)(value2), _4;
+ };
+ }
+});
+
+// node_modules/.pnpm/@ungap+structured-clone@1.3.0/node_modules/@ungap/structured-clone/esm/index.js
+var esm_default;
+var init_esm = __esm({
+ "node_modules/.pnpm/@ungap+structured-clone@1.3.0/node_modules/@ungap/structured-clone/esm/index.js"() {
+ init_deserialize();
+ init_serialize();
+ esm_default = typeof structuredClone === "function" ? (
+ /* c8 ignore start */
+ (any, options) => options && ("json" in options || "lossy" in options) ? deserialize(serialize2(any, options)) : structuredClone(any)
+ ) : (any, options) => deserialize(serialize2(any, options));
+ }
+});
+
+// node_modules/.pnpm/unist-util-position@5.0.0/node_modules/unist-util-position/lib/index.js
+function point3(type5) {
+ return point4;
+ function point4(node2) {
+ const point5 = node2 && node2.position && node2.position[type5] || {};
+ if (typeof point5.line === "number" && point5.line > 0 && typeof point5.column === "number" && point5.column > 0) {
+ return {
+ line: point5.line,
+ column: point5.column,
+ offset: typeof point5.offset === "number" && point5.offset > -1 ? point5.offset : void 0
+ };
+ }
+ }
+}
+function position2(node2) {
+ const start = pointStart(node2);
+ const end3 = pointEnd(node2);
+ if (start && end3) {
+ return { start, end: end3 };
+ }
+}
+var pointEnd, pointStart;
+var init_lib25 = __esm({
+ "node_modules/.pnpm/unist-util-position@5.0.0/node_modules/unist-util-position/lib/index.js"() {
+ pointEnd = point3("end");
+ pointStart = point3("start");
+ }
+});
+
+// node_modules/.pnpm/unist-util-position@5.0.0/node_modules/unist-util-position/index.js
+var init_unist_util_position = __esm({
+ "node_modules/.pnpm/unist-util-position@5.0.0/node_modules/unist-util-position/index.js"() {
+ init_lib25();
+ }
+});
+
+// node_modules/.pnpm/hast-util-sanitize@5.0.2/node_modules/hast-util-sanitize/lib/schema.js
+var aria, defaultSchema;
+var init_schema = __esm({
+ "node_modules/.pnpm/hast-util-sanitize@5.0.2/node_modules/hast-util-sanitize/lib/schema.js"() {
+ aria = ["ariaDescribedBy", "ariaLabel", "ariaLabelledBy"];
+ defaultSchema = {
+ ancestors: {
+ tbody: ["table"],
+ td: ["table"],
+ th: ["table"],
+ thead: ["table"],
+ tfoot: ["table"],
+ tr: ["table"]
+ },
+ attributes: {
+ a: [
+ ...aria,
+ // Note: these 3 are used by GFM footnotes, they do work on all links.
+ "dataFootnoteBackref",
+ "dataFootnoteRef",
+ ["className", "data-footnote-backref"],
+ "href"
+ ],
+ blockquote: ["cite"],
+ // Note: this class is not normally allowed by GH, when manually writing
+ // `code` as HTML in markdown, they adds it some other way.
+ // We can’t do that, so we have to allow it.
+ code: [["className", /^language-./]],
+ del: ["cite"],
+ div: ["itemScope", "itemType"],
+ dl: [...aria],
+ // Note: this is used by GFM footnotes.
+ h2: [["className", "sr-only"]],
+ img: [...aria, "longDesc", "src"],
+ // Note: `input` is not normally allowed by GH, when manually writing
+ // it in markdown, they add it from tasklists some other way.
+ // We can’t do that, so we have to allow it.
+ input: [
+ ["disabled", true],
+ ["type", "checkbox"]
+ ],
+ ins: ["cite"],
+ // Note: this class is not normally allowed by GH, when manually writing
+ // `li` as HTML in markdown, they adds it some other way.
+ // We can’t do that, so we have to allow it.
+ li: [["className", "task-list-item"]],
+ // Note: this class is not normally allowed by GH, when manually writing
+ // `ol` as HTML in markdown, they adds it some other way.
+ // We can’t do that, so we have to allow it.
+ ol: [...aria, ["className", "contains-task-list"]],
+ q: ["cite"],
+ section: ["dataFootnotes", ["className", "footnotes"]],
+ source: ["srcSet"],
+ summary: [...aria],
+ table: [...aria],
+ // Note: this class is not normally allowed by GH, when manually writing
+ // `ol` as HTML in markdown, they adds it some other way.
+ // We can’t do that, so we have to allow it.
+ ul: [...aria, ["className", "contains-task-list"]],
+ "*": [
+ "abbr",
+ "accept",
+ "acceptCharset",
+ "accessKey",
+ "action",
+ "align",
+ "alt",
+ "axis",
+ "border",
+ "cellPadding",
+ "cellSpacing",
+ "char",
+ "charOff",
+ "charSet",
+ "checked",
+ "clear",
+ "colSpan",
+ "color",
+ "cols",
+ "compact",
+ "coords",
+ "dateTime",
+ "dir",
+ // Note: `disabled` is technically allowed on all elements by GH.
+ // But it is useless on everything except `input`.
+ // Because `input`s are normally not allowed, but we allow them for
+ // checkboxes due to tasklists, we allow `disabled` only there.
+ "encType",
+ "frame",
+ "hSpace",
+ "headers",
+ "height",
+ "hrefLang",
+ "htmlFor",
+ "id",
+ "isMap",
+ "itemProp",
+ "label",
+ "lang",
+ "maxLength",
+ "media",
+ "method",
+ "multiple",
+ "name",
+ "noHref",
+ "noShade",
+ "noWrap",
+ "open",
+ "prompt",
+ "readOnly",
+ "rev",
+ "rowSpan",
+ "rows",
+ "rules",
+ "scope",
+ "selected",
+ "shape",
+ "size",
+ "span",
+ "start",
+ "summary",
+ "tabIndex",
+ "title",
+ "useMap",
+ "vAlign",
+ "value",
+ "width"
+ ]
+ },
+ clobber: ["ariaDescribedBy", "ariaLabelledBy", "id", "name"],
+ clobberPrefix: "user-content-",
+ protocols: {
+ cite: ["http", "https"],
+ href: ["http", "https", "irc", "ircs", "mailto", "xmpp"],
+ longDesc: ["http", "https"],
+ src: ["http", "https"]
+ },
+ required: {
+ input: { disabled: true, type: "checkbox" }
+ },
+ strip: ["script"],
+ tagNames: [
+ "a",
+ "b",
+ "blockquote",
+ "br",
+ "code",
+ "dd",
+ "del",
+ "details",
+ "div",
+ "dl",
+ "dt",
+ "em",
+ "h1",
+ "h2",
+ "h3",
+ "h4",
+ "h5",
+ "h6",
+ "hr",
+ "i",
+ "img",
+ // Note: `input` is not normally allowed by GH, when manually writing
+ // it in markdown, they add it from tasklists some other way.
+ // We can’t do that, so we have to allow it.
+ "input",
+ "ins",
+ "kbd",
+ "li",
+ "ol",
+ "p",
+ "picture",
+ "pre",
+ "q",
+ "rp",
+ "rt",
+ "ruby",
+ "s",
+ "samp",
+ "section",
+ "source",
+ "span",
+ "strike",
+ "strong",
+ "sub",
+ "summary",
+ "sup",
+ "table",
+ "tbody",
+ "td",
+ "tfoot",
+ "th",
+ "thead",
+ "tr",
+ "tt",
+ "ul",
+ "var"
+ ]
+ };
+ }
+});
+
+// node_modules/.pnpm/hast-util-sanitize@5.0.2/node_modules/hast-util-sanitize/lib/index.js
+function sanitize(node2, options) {
+ let result = { type: "root", children: [] };
+ const state = {
+ schema: options ? { ...defaultSchema, ...options } : defaultSchema,
+ stack: []
+ };
+ const replace5 = transform(state, node2);
+ if (replace5) {
+ if (Array.isArray(replace5)) {
+ if (replace5.length === 1) {
+ result = replace5[0];
+ } else {
+ result.children = replace5;
+ }
+ } else {
+ result = replace5;
+ }
+ }
+ return result;
+}
+function transform(state, node2) {
+ if (node2 && typeof node2 === "object") {
+ const unsafe2 = (
+ /** @type {Record>} */
+ node2
+ );
+ const type5 = typeof unsafe2.type === "string" ? unsafe2.type : "";
+ switch (type5) {
+ case "comment": {
+ return comment(state, unsafe2);
+ }
+ case "doctype": {
+ return doctype(state, unsafe2);
+ }
+ case "element": {
+ return element2(state, unsafe2);
+ }
+ case "root": {
+ return root2(state, unsafe2);
+ }
+ case "text": {
+ return text5(state, unsafe2);
+ }
+ default:
+ }
+ }
+}
+function comment(state, unsafe2) {
+ if (state.schema.allowComments) {
+ const result = typeof unsafe2.value === "string" ? unsafe2.value : "";
+ const index2 = result.indexOf("-->");
+ const value2 = index2 < 0 ? result : result.slice(0, index2);
+ const node2 = { type: "comment", value: value2 };
+ patch(node2, unsafe2);
+ return node2;
+ }
+}
+function doctype(state, unsafe2) {
+ if (state.schema.allowDoctypes) {
+ const node2 = { type: "doctype" };
+ patch(node2, unsafe2);
+ return node2;
+ }
+}
+function element2(state, unsafe2) {
+ const name = typeof unsafe2.tagName === "string" ? unsafe2.tagName : "";
+ state.stack.push(name);
+ const content3 = (
+ /** @type {Array} */
+ children(state, unsafe2.children)
+ );
+ const properties_ = properties(state, unsafe2.properties);
+ state.stack.pop();
+ let safeElement = false;
+ if (name && name !== "*" && (!state.schema.tagNames || state.schema.tagNames.includes(name))) {
+ safeElement = true;
+ if (state.schema.ancestors && own7.call(state.schema.ancestors, name)) {
+ const ancestors = state.schema.ancestors[name];
+ let index2 = -1;
+ safeElement = false;
+ while (++index2 < ancestors.length) {
+ if (state.stack.includes(ancestors[index2])) {
+ safeElement = true;
+ }
+ }
+ }
+ }
+ if (!safeElement) {
+ return state.schema.strip && !state.schema.strip.includes(name) ? content3 : void 0;
+ }
+ const node2 = {
+ type: "element",
+ tagName: name,
+ properties: properties_,
+ children: content3
+ };
+ patch(node2, unsafe2);
+ return node2;
+}
+function root2(state, unsafe2) {
+ const content3 = (
+ /** @type {Array} */
+ children(state, unsafe2.children)
+ );
+ const node2 = { type: "root", children: content3 };
+ patch(node2, unsafe2);
+ return node2;
+}
+function text5(_4, unsafe2) {
+ const value2 = typeof unsafe2.value === "string" ? unsafe2.value : "";
+ const node2 = { type: "text", value: value2 };
+ patch(node2, unsafe2);
+ return node2;
+}
+function children(state, children2) {
+ const results = [];
+ if (Array.isArray(children2)) {
+ const childrenUnknown = (
+ /** @type {Array>} */
+ children2
+ );
+ let index2 = -1;
+ while (++index2 < childrenUnknown.length) {
+ const value2 = transform(state, childrenUnknown[index2]);
+ if (value2) {
+ if (Array.isArray(value2)) {
+ results.push(...value2);
+ } else {
+ results.push(value2);
+ }
+ }
+ }
+ }
+ return results;
+}
+function properties(state, properties2) {
+ const tagName = state.stack[state.stack.length - 1];
+ const attributes = state.schema.attributes;
+ const required = state.schema.required;
+ const specific = attributes && own7.call(attributes, tagName) ? attributes[tagName] : void 0;
+ const defaults = attributes && own7.call(attributes, "*") ? attributes["*"] : void 0;
+ const properties_ = (
+ /** @type {Readonly>>} */
+ properties2 && typeof properties2 === "object" ? properties2 : {}
+ );
+ const result = {};
+ let key2;
+ for (key2 in properties_) {
+ if (own7.call(properties_, key2)) {
+ const unsafe2 = properties_[key2];
+ let safe2 = propertyValue(
+ state,
+ findDefinition(specific, key2),
+ key2,
+ unsafe2
+ );
+ if (safe2 === null || safe2 === void 0) {
+ safe2 = propertyValue(state, findDefinition(defaults, key2), key2, unsafe2);
+ }
+ if (safe2 !== null && safe2 !== void 0) {
+ result[key2] = safe2;
+ }
+ }
+ }
+ if (required && own7.call(required, tagName)) {
+ const properties3 = required[tagName];
+ for (key2 in properties3) {
+ if (own7.call(properties3, key2) && !own7.call(result, key2)) {
+ result[key2] = properties3[key2];
+ }
+ }
+ }
+ return result;
+}
+function propertyValue(state, definition3, key2, value2) {
+ return definition3 ? Array.isArray(value2) ? propertyValueMany(state, definition3, key2, value2) : propertyValuePrimitive(state, definition3, key2, value2) : void 0;
+}
+function propertyValueMany(state, definition3, key2, values) {
+ let index2 = -1;
+ const result = [];
+ while (++index2 < values.length) {
+ const value2 = propertyValuePrimitive(state, definition3, key2, values[index2]);
+ if (typeof value2 === "number" || typeof value2 === "string") {
+ result.push(value2);
+ }
+ }
+ return result;
+}
+function propertyValuePrimitive(state, definition3, key2, value2) {
+ if (typeof value2 !== "boolean" && typeof value2 !== "number" && typeof value2 !== "string") {
+ return;
+ }
+ if (!safeProtocol(state, key2, value2)) {
+ return;
+ }
+ if (typeof definition3 === "object" && definition3.length > 1) {
+ let ok3 = false;
+ let index2 = 0;
+ while (++index2 < definition3.length) {
+ const allowed = definition3[index2];
+ if (allowed && typeof allowed === "object" && "flags" in allowed) {
+ if (allowed.test(String(value2))) {
+ ok3 = true;
+ break;
+ }
+ } else if (allowed === value2) {
+ ok3 = true;
+ break;
+ }
+ }
+ if (!ok3) return;
+ }
+ return state.schema.clobber && state.schema.clobberPrefix && state.schema.clobber.includes(key2) ? state.schema.clobberPrefix + value2 : value2;
+}
+function safeProtocol(state, key2, value2) {
+ const protocols = state.schema.protocols && own7.call(state.schema.protocols, key2) ? state.schema.protocols[key2] : void 0;
+ if (!protocols || protocols.length === 0) {
+ return true;
+ }
+ const url = String(value2);
+ const colon = url.indexOf(":");
+ const questionMark = url.indexOf("?");
+ const numberSign = url.indexOf("#");
+ const slash = url.indexOf("/");
+ if (colon < 0 || // If the first colon is after a `?`, `#`, or `/`, it’s not a protocol.
+ slash > -1 && colon > slash || questionMark > -1 && colon > questionMark || numberSign > -1 && colon > numberSign) {
+ return true;
+ }
+ let index2 = -1;
+ while (++index2 < protocols.length) {
+ const protocol = protocols[index2];
+ if (colon === protocol.length && url.slice(0, protocol.length) === protocol) {
+ return true;
+ }
+ }
+ return false;
+}
+function patch(node2, unsafe2) {
+ const cleanPosition = position2(
+ // @ts-expect-error: looks like a node.
+ unsafe2
+ );
+ if (unsafe2.data) {
+ node2.data = esm_default(unsafe2.data);
+ }
+ if (cleanPosition) node2.position = cleanPosition;
+}
+function findDefinition(definitions, key2) {
+ let dataDefault;
+ let index2 = -1;
+ if (definitions) {
+ while (++index2 < definitions.length) {
+ const entry = definitions[index2];
+ const name = typeof entry === "string" ? entry : entry[0];
+ if (name === key2) {
+ return entry;
+ }
+ if (name === "data*") dataDefault = entry;
+ }
+ }
+ if (key2.length > 4 && key2.slice(0, 4).toLowerCase() === "data") {
+ return dataDefault;
+ }
+}
+var own7;
+var init_lib26 = __esm({
+ "node_modules/.pnpm/hast-util-sanitize@5.0.2/node_modules/hast-util-sanitize/lib/index.js"() {
+ init_esm();
+ init_unist_util_position();
+ init_schema();
+ own7 = {}.hasOwnProperty;
+ }
+});
+
+// node_modules/.pnpm/hast-util-sanitize@5.0.2/node_modules/hast-util-sanitize/index.js
+var init_hast_util_sanitize = __esm({
+ "node_modules/.pnpm/hast-util-sanitize@5.0.2/node_modules/hast-util-sanitize/index.js"() {
+ init_lib26();
+ init_schema();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/blockquote.js
+function blockquote2(state, node2) {
+ const result = {
+ type: "element",
+ tagName: "blockquote",
+ properties: {},
+ children: state.wrap(state.all(node2), true)
+ };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+var init_blockquote2 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/blockquote.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/break.js
+function hardBreak2(state, node2) {
+ const result = { type: "element", tagName: "br", properties: {}, children: [] };
+ state.patch(node2, result);
+ return [state.applyData(node2, result), { type: "text", value: "\n" }];
+}
+var init_break2 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/break.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/code.js
+function code3(state, node2) {
+ const value2 = node2.value ? node2.value + "\n" : "";
+ const properties2 = {};
+ const language = node2.lang ? node2.lang.split(/\s+/) : [];
+ if (language.length > 0) {
+ properties2.className = ["language-" + language[0]];
+ }
+ let result = {
+ type: "element",
+ tagName: "code",
+ properties: properties2,
+ children: [{ type: "text", value: value2 }]
+ };
+ if (node2.meta) {
+ result.data = { meta: node2.meta };
+ }
+ state.patch(node2, result);
+ result = state.applyData(node2, result);
+ result = { type: "element", tagName: "pre", properties: {}, children: [result] };
+ state.patch(node2, result);
+ return result;
+}
+var init_code2 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/code.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/delete.js
+function strikethrough(state, node2) {
+ const result = {
+ type: "element",
+ tagName: "del",
+ properties: {},
+ children: state.all(node2)
+ };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+var init_delete = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/delete.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/emphasis.js
+function emphasis2(state, node2) {
+ const result = {
+ type: "element",
+ tagName: "em",
+ properties: {},
+ children: state.all(node2)
+ };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+var init_emphasis2 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/emphasis.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/footnote-reference.js
+function footnoteReference2(state, node2) {
+ const clobberPrefix = typeof state.options.clobberPrefix === "string" ? state.options.clobberPrefix : "user-content-";
+ const id = String(node2.identifier).toUpperCase();
+ const safeId = normalizeUri(id.toLowerCase());
+ const index2 = state.footnoteOrder.indexOf(id);
+ let counter2;
+ let reuseCounter = state.footnoteCounts.get(id);
+ if (reuseCounter === void 0) {
+ reuseCounter = 0;
+ state.footnoteOrder.push(id);
+ counter2 = state.footnoteOrder.length;
+ } else {
+ counter2 = index2 + 1;
+ }
+ reuseCounter += 1;
+ state.footnoteCounts.set(id, reuseCounter);
+ const link3 = {
+ type: "element",
+ tagName: "a",
+ properties: {
+ href: "#" + clobberPrefix + "fn-" + safeId,
+ id: clobberPrefix + "fnref-" + safeId + (reuseCounter > 1 ? "-" + reuseCounter : ""),
+ dataFootnoteRef: true,
+ ariaDescribedBy: ["footnote-label"]
+ },
+ children: [{ type: "text", value: String(counter2) }]
+ };
+ state.patch(node2, link3);
+ const sup = {
+ type: "element",
+ tagName: "sup",
+ properties: {},
+ children: [link3]
+ };
+ state.patch(node2, sup);
+ return state.applyData(node2, sup);
+}
+var init_footnote_reference = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/footnote-reference.js"() {
+ init_micromark_util_sanitize_uri();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/heading.js
+function heading2(state, node2) {
+ const result = {
+ type: "element",
+ tagName: "h" + node2.depth,
+ properties: {},
+ children: state.all(node2)
+ };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+var init_heading2 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/heading.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/html.js
+function html2(state, node2) {
+ if (state.options.allowDangerousHtml) {
+ const result = { type: "raw", value: node2.value };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+ }
+ return void 0;
+}
+var init_html8 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/html.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/revert.js
+function revert(state, node2) {
+ const subtype = node2.referenceType;
+ let suffix = "]";
+ if (subtype === "collapsed") {
+ suffix += "[]";
+ } else if (subtype === "full") {
+ suffix += "[" + (node2.label || node2.identifier) + "]";
+ }
+ if (node2.type === "imageReference") {
+ return [{ type: "text", value: "![" + node2.alt + suffix }];
+ }
+ const contents = state.all(node2);
+ const head2 = contents[0];
+ if (head2 && head2.type === "text") {
+ head2.value = "[" + head2.value;
+ } else {
+ contents.unshift({ type: "text", value: "[" });
+ }
+ const tail = contents[contents.length - 1];
+ if (tail && tail.type === "text") {
+ tail.value += suffix;
+ } else {
+ contents.push({ type: "text", value: suffix });
+ }
+ return contents;
+}
+var init_revert = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/revert.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/image-reference.js
+function imageReference2(state, node2) {
+ const id = String(node2.identifier).toUpperCase();
+ const definition3 = state.definitionById.get(id);
+ if (!definition3) {
+ return revert(state, node2);
+ }
+ const properties2 = { src: normalizeUri(definition3.url || ""), alt: node2.alt };
+ if (definition3.title !== null && definition3.title !== void 0) {
+ properties2.title = definition3.title;
+ }
+ const result = { type: "element", tagName: "img", properties: properties2, children: [] };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+var init_image_reference2 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/image-reference.js"() {
+ init_micromark_util_sanitize_uri();
+ init_revert();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/image.js
+function image2(state, node2) {
+ const properties2 = { src: normalizeUri(node2.url) };
+ if (node2.alt !== null && node2.alt !== void 0) {
+ properties2.alt = node2.alt;
+ }
+ if (node2.title !== null && node2.title !== void 0) {
+ properties2.title = node2.title;
+ }
+ const result = { type: "element", tagName: "img", properties: properties2, children: [] };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+var init_image2 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/image.js"() {
+ init_micromark_util_sanitize_uri();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/inline-code.js
+function inlineCode2(state, node2) {
+ const text9 = { type: "text", value: node2.value.replace(/\r?\n|\r/g, " ") };
+ state.patch(node2, text9);
+ const result = {
+ type: "element",
+ tagName: "code",
+ properties: {},
+ children: [text9]
+ };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+var init_inline_code2 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/inline-code.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/link-reference.js
+function linkReference2(state, node2) {
+ const id = String(node2.identifier).toUpperCase();
+ const definition3 = state.definitionById.get(id);
+ if (!definition3) {
+ return revert(state, node2);
+ }
+ const properties2 = { href: normalizeUri(definition3.url || "") };
+ if (definition3.title !== null && definition3.title !== void 0) {
+ properties2.title = definition3.title;
+ }
+ const result = {
+ type: "element",
+ tagName: "a",
+ properties: properties2,
+ children: state.all(node2)
+ };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+var init_link_reference2 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/link-reference.js"() {
+ init_micromark_util_sanitize_uri();
+ init_revert();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/link.js
+function link2(state, node2) {
+ const properties2 = { href: normalizeUri(node2.url) };
+ if (node2.title !== null && node2.title !== void 0) {
+ properties2.title = node2.title;
+ }
+ const result = {
+ type: "element",
+ tagName: "a",
+ properties: properties2,
+ children: state.all(node2)
+ };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+var init_link2 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/link.js"() {
+ init_micromark_util_sanitize_uri();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/list-item.js
+function listItem2(state, node2, parent) {
+ const results = state.all(node2);
+ const loose = parent ? listLoose(parent) : listItemLoose(node2);
+ const properties2 = {};
+ const children2 = [];
+ if (typeof node2.checked === "boolean") {
+ const head2 = results[0];
+ let paragraph3;
+ if (head2 && head2.type === "element" && head2.tagName === "p") {
+ paragraph3 = head2;
+ } else {
+ paragraph3 = { type: "element", tagName: "p", properties: {}, children: [] };
+ results.unshift(paragraph3);
+ }
+ if (paragraph3.children.length > 0) {
+ paragraph3.children.unshift({ type: "text", value: " " });
+ }
+ paragraph3.children.unshift({
+ type: "element",
+ tagName: "input",
+ properties: { type: "checkbox", checked: node2.checked, disabled: true },
+ children: []
+ });
+ properties2.className = ["task-list-item"];
+ }
+ let index2 = -1;
+ while (++index2 < results.length) {
+ const child = results[index2];
+ if (loose || index2 !== 0 || child.type !== "element" || child.tagName !== "p") {
+ children2.push({ type: "text", value: "\n" });
+ }
+ if (child.type === "element" && child.tagName === "p" && !loose) {
+ children2.push(...child.children);
+ } else {
+ children2.push(child);
+ }
+ }
+ const tail = results[results.length - 1];
+ if (tail && (loose || tail.type !== "element" || tail.tagName !== "p")) {
+ children2.push({ type: "text", value: "\n" });
+ }
+ const result = { type: "element", tagName: "li", properties: properties2, children: children2 };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+function listLoose(node2) {
+ let loose = false;
+ if (node2.type === "list") {
+ loose = node2.spread || false;
+ const children2 = node2.children;
+ let index2 = -1;
+ while (!loose && ++index2 < children2.length) {
+ loose = listItemLoose(children2[index2]);
+ }
+ }
+ return loose;
+}
+function listItemLoose(node2) {
+ const spread = node2.spread;
+ return spread === null || spread === void 0 ? node2.children.length > 1 : spread;
+}
+var init_list_item2 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/list-item.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/list.js
+function list4(state, node2) {
+ const properties2 = {};
+ const results = state.all(node2);
+ let index2 = -1;
+ if (typeof node2.start === "number" && node2.start !== 1) {
+ properties2.start = node2.start;
+ }
+ while (++index2 < results.length) {
+ const child = results[index2];
+ if (child.type === "element" && child.tagName === "li" && child.properties && Array.isArray(child.properties.className) && child.properties.className.includes("task-list-item")) {
+ properties2.className = ["contains-task-list"];
+ break;
+ }
+ }
+ const result = {
+ type: "element",
+ tagName: node2.ordered ? "ol" : "ul",
+ properties: properties2,
+ children: state.wrap(results, true)
+ };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+var init_list3 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/list.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/paragraph.js
+function paragraph2(state, node2) {
+ const result = {
+ type: "element",
+ tagName: "p",
+ properties: {},
+ children: state.all(node2)
+ };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+var init_paragraph2 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/paragraph.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/root.js
+function root3(state, node2) {
+ const result = { type: "root", children: state.wrap(state.all(node2)) };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+var init_root2 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/root.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/strong.js
+function strong2(state, node2) {
+ const result = {
+ type: "element",
+ tagName: "strong",
+ properties: {},
+ children: state.all(node2)
+ };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+var init_strong2 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/strong.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/table.js
+function table(state, node2) {
+ const rows = state.all(node2);
+ const firstRow = rows.shift();
+ const tableContent = [];
+ if (firstRow) {
+ const head2 = {
+ type: "element",
+ tagName: "thead",
+ properties: {},
+ children: state.wrap([firstRow], true)
+ };
+ state.patch(node2.children[0], head2);
+ tableContent.push(head2);
+ }
+ if (rows.length > 0) {
+ const body3 = {
+ type: "element",
+ tagName: "tbody",
+ properties: {},
+ children: state.wrap(rows, true)
+ };
+ const start = pointStart(node2.children[1]);
+ const end3 = pointEnd(node2.children[node2.children.length - 1]);
+ if (start && end3) body3.position = { start, end: end3 };
+ tableContent.push(body3);
+ }
+ const result = {
+ type: "element",
+ tagName: "table",
+ properties: {},
+ children: state.wrap(tableContent, true)
+ };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+var init_table = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/table.js"() {
+ init_unist_util_position();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/table-row.js
+function tableRow(state, node2, parent) {
+ const siblings2 = parent ? parent.children : void 0;
+ const rowIndex = siblings2 ? siblings2.indexOf(node2) : 1;
+ const tagName = rowIndex === 0 ? "th" : "td";
+ const align = parent && parent.type === "table" ? parent.align : void 0;
+ const length = align ? align.length : node2.children.length;
+ let cellIndex = -1;
+ const cells2 = [];
+ while (++cellIndex < length) {
+ const cell2 = node2.children[cellIndex];
+ const properties2 = {};
+ const alignValue = align ? align[cellIndex] : void 0;
+ if (alignValue) {
+ properties2.align = alignValue;
+ }
+ let result2 = { type: "element", tagName, properties: properties2, children: [] };
+ if (cell2) {
+ result2.children = state.all(cell2);
+ state.patch(cell2, result2);
+ result2 = state.applyData(cell2, result2);
+ }
+ cells2.push(result2);
+ }
+ const result = {
+ type: "element",
+ tagName: "tr",
+ properties: {},
+ children: state.wrap(cells2, true)
+ };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+var init_table_row = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/table-row.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/table-cell.js
+function tableCell(state, node2) {
+ const result = {
+ type: "element",
+ tagName: "td",
+ // Assume body cell.
+ properties: {},
+ children: state.all(node2)
+ };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+var init_table_cell = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/table-cell.js"() {
+ }
+});
+
+// node_modules/.pnpm/trim-lines@3.0.1/node_modules/trim-lines/index.js
+function trimLines(value2) {
+ const source = String(value2);
+ const search2 = /\r?\n|\r/g;
+ let match2 = search2.exec(source);
+ let last3 = 0;
+ const lines = [];
+ while (match2) {
+ lines.push(
+ trimLine(source.slice(last3, match2.index), last3 > 0, true),
+ match2[0]
+ );
+ last3 = match2.index + match2[0].length;
+ match2 = search2.exec(source);
+ }
+ lines.push(trimLine(source.slice(last3), last3 > 0, false));
+ return lines.join("");
+}
+function trimLine(value2, start, end3) {
+ let startIndex = 0;
+ let endIndex = value2.length;
+ if (start) {
+ let code4 = value2.codePointAt(startIndex);
+ while (code4 === tab || code4 === space) {
+ startIndex++;
+ code4 = value2.codePointAt(startIndex);
+ }
+ }
+ if (end3) {
+ let code4 = value2.codePointAt(endIndex - 1);
+ while (code4 === tab || code4 === space) {
+ endIndex--;
+ code4 = value2.codePointAt(endIndex - 1);
+ }
+ }
+ return endIndex > startIndex ? value2.slice(startIndex, endIndex) : "";
+}
+var tab, space;
+var init_trim_lines = __esm({
+ "node_modules/.pnpm/trim-lines@3.0.1/node_modules/trim-lines/index.js"() {
+ tab = 9;
+ space = 32;
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/text.js
+function text6(state, node2) {
+ const result = { type: "text", value: trimLines(String(node2.value)) };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+var init_text3 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/text.js"() {
+ init_trim_lines();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/thematic-break.js
+function thematicBreak3(state, node2) {
+ const result = {
+ type: "element",
+ tagName: "hr",
+ properties: {},
+ children: []
+ };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+var init_thematic_break3 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/thematic-break.js"() {
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/index.js
+function ignore() {
+ return void 0;
+}
+var handlers;
+var init_handlers = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/handlers/index.js"() {
+ init_blockquote2();
+ init_break2();
+ init_code2();
+ init_delete();
+ init_emphasis2();
+ init_footnote_reference();
+ init_heading2();
+ init_html8();
+ init_image_reference2();
+ init_image2();
+ init_inline_code2();
+ init_link_reference2();
+ init_link2();
+ init_list_item2();
+ init_list3();
+ init_paragraph2();
+ init_root2();
+ init_strong2();
+ init_table();
+ init_table_row();
+ init_table_cell();
+ init_text3();
+ init_thematic_break3();
+ handlers = {
+ blockquote: blockquote2,
+ break: hardBreak2,
+ code: code3,
+ delete: strikethrough,
+ emphasis: emphasis2,
+ footnoteReference: footnoteReference2,
+ heading: heading2,
+ html: html2,
+ imageReference: imageReference2,
+ image: image2,
+ inlineCode: inlineCode2,
+ linkReference: linkReference2,
+ link: link2,
+ listItem: listItem2,
+ list: list4,
+ paragraph: paragraph2,
+ // @ts-expect-error: root is different, but hard to type.
+ root: root3,
+ strong: strong2,
+ table,
+ tableCell,
+ tableRow,
+ text: text6,
+ thematicBreak: thematicBreak3,
+ toml: ignore,
+ yaml: ignore,
+ definition: ignore,
+ footnoteDefinition: ignore
+ };
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/footer.js
+function defaultFootnoteBackContent(_4, rereferenceIndex) {
+ const result = [{ type: "text", value: "\u21A9" }];
+ if (rereferenceIndex > 1) {
+ result.push({
+ type: "element",
+ tagName: "sup",
+ properties: {},
+ children: [{ type: "text", value: String(rereferenceIndex) }]
+ });
+ }
+ return result;
+}
+function defaultFootnoteBackLabel(referenceIndex, rereferenceIndex) {
+ return "Back to reference " + (referenceIndex + 1) + (rereferenceIndex > 1 ? "-" + rereferenceIndex : "");
+}
+function footer(state) {
+ const clobberPrefix = typeof state.options.clobberPrefix === "string" ? state.options.clobberPrefix : "user-content-";
+ const footnoteBackContent = state.options.footnoteBackContent || defaultFootnoteBackContent;
+ const footnoteBackLabel = state.options.footnoteBackLabel || defaultFootnoteBackLabel;
+ const footnoteLabel = state.options.footnoteLabel || "Footnotes";
+ const footnoteLabelTagName = state.options.footnoteLabelTagName || "h2";
+ const footnoteLabelProperties = state.options.footnoteLabelProperties || {
+ className: ["sr-only"]
+ };
+ const listItems = [];
+ let referenceIndex = -1;
+ while (++referenceIndex < state.footnoteOrder.length) {
+ const definition3 = state.footnoteById.get(
+ state.footnoteOrder[referenceIndex]
+ );
+ if (!definition3) {
+ continue;
+ }
+ const content3 = state.all(definition3);
+ const id = String(definition3.identifier).toUpperCase();
+ const safeId = normalizeUri(id.toLowerCase());
+ let rereferenceIndex = 0;
+ const backReferences = [];
+ const counts = state.footnoteCounts.get(id);
+ while (counts !== void 0 && ++rereferenceIndex <= counts) {
+ if (backReferences.length > 0) {
+ backReferences.push({ type: "text", value: " " });
+ }
+ let children2 = typeof footnoteBackContent === "string" ? footnoteBackContent : footnoteBackContent(referenceIndex, rereferenceIndex);
+ if (typeof children2 === "string") {
+ children2 = { type: "text", value: children2 };
+ }
+ backReferences.push({
+ type: "element",
+ tagName: "a",
+ properties: {
+ href: "#" + clobberPrefix + "fnref-" + safeId + (rereferenceIndex > 1 ? "-" + rereferenceIndex : ""),
+ dataFootnoteBackref: "",
+ ariaLabel: typeof footnoteBackLabel === "string" ? footnoteBackLabel : footnoteBackLabel(referenceIndex, rereferenceIndex),
+ className: ["data-footnote-backref"]
+ },
+ children: Array.isArray(children2) ? children2 : [children2]
+ });
+ }
+ const tail = content3[content3.length - 1];
+ if (tail && tail.type === "element" && tail.tagName === "p") {
+ const tailTail = tail.children[tail.children.length - 1];
+ if (tailTail && tailTail.type === "text") {
+ tailTail.value += " ";
+ } else {
+ tail.children.push({ type: "text", value: " " });
+ }
+ tail.children.push(...backReferences);
+ } else {
+ content3.push(...backReferences);
+ }
+ const listItem3 = {
+ type: "element",
+ tagName: "li",
+ properties: { id: clobberPrefix + "fn-" + safeId },
+ children: state.wrap(content3, true)
+ };
+ state.patch(definition3, listItem3);
+ listItems.push(listItem3);
+ }
+ if (listItems.length === 0) {
+ return;
+ }
+ return {
+ type: "element",
+ tagName: "section",
+ properties: { dataFootnotes: true, className: ["footnotes"] },
+ children: [
+ {
+ type: "element",
+ tagName: footnoteLabelTagName,
+ properties: {
+ ...esm_default(footnoteLabelProperties),
+ id: "footnote-label"
+ },
+ children: [{ type: "text", value: footnoteLabel }]
+ },
+ { type: "text", value: "\n" },
+ {
+ type: "element",
+ tagName: "ol",
+ properties: {},
+ children: state.wrap(listItems, true)
+ },
+ { type: "text", value: "\n" }
+ ]
+ };
+}
+var init_footer = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/footer.js"() {
+ init_esm();
+ init_micromark_util_sanitize_uri();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/state.js
+function createState(tree, options) {
+ const settings = options || emptyOptions5;
+ const definitionById = /* @__PURE__ */ new Map();
+ const footnoteById = /* @__PURE__ */ new Map();
+ const footnoteCounts = /* @__PURE__ */ new Map();
+ const handlers2 = { ...handlers, ...settings.handlers };
+ const state = {
+ all: all3,
+ applyData,
+ definitionById,
+ footnoteById,
+ footnoteCounts,
+ footnoteOrder: [],
+ handlers: handlers2,
+ one: one3,
+ options: settings,
+ patch: patch2,
+ wrap: wrap3
+ };
+ visit(tree, function(node2) {
+ if (node2.type === "definition" || node2.type === "footnoteDefinition") {
+ const map7 = node2.type === "definition" ? definitionById : footnoteById;
+ const id = String(node2.identifier).toUpperCase();
+ if (!map7.has(id)) {
+ map7.set(id, node2);
+ }
+ }
+ });
+ return state;
+ function one3(node2, parent) {
+ const type5 = node2.type;
+ const handle3 = state.handlers[type5];
+ if (own8.call(state.handlers, type5) && handle3) {
+ return handle3(state, node2, parent);
+ }
+ if (state.options.passThrough && state.options.passThrough.includes(type5)) {
+ if ("children" in node2) {
+ const { children: children2, ...shallow } = node2;
+ const result = esm_default(shallow);
+ result.children = state.all(node2);
+ return result;
+ }
+ return esm_default(node2);
+ }
+ const unknown3 = state.options.unknownHandler || defaultUnknownHandler;
+ return unknown3(state, node2, parent);
+ }
+ function all3(parent) {
+ const values = [];
+ if ("children" in parent) {
+ const nodes = parent.children;
+ let index2 = -1;
+ while (++index2 < nodes.length) {
+ const result = state.one(nodes[index2], parent);
+ if (result) {
+ if (index2 && nodes[index2 - 1].type === "break") {
+ if (!Array.isArray(result) && result.type === "text") {
+ result.value = trimMarkdownSpaceStart(result.value);
+ }
+ if (!Array.isArray(result) && result.type === "element") {
+ const head2 = result.children[0];
+ if (head2 && head2.type === "text") {
+ head2.value = trimMarkdownSpaceStart(head2.value);
+ }
+ }
+ }
+ if (Array.isArray(result)) {
+ values.push(...result);
+ } else {
+ values.push(result);
+ }
+ }
+ }
+ }
+ return values;
+ }
+}
+function patch2(from2, to) {
+ if (from2.position) to.position = position2(from2);
+}
+function applyData(from2, to) {
+ let result = to;
+ if (from2 && from2.data) {
+ const hName = from2.data.hName;
+ const hChildren = from2.data.hChildren;
+ const hProperties = from2.data.hProperties;
+ if (typeof hName === "string") {
+ if (result.type === "element") {
+ result.tagName = hName;
+ } else {
+ const children2 = "children" in result ? result.children : [result];
+ result = { type: "element", tagName: hName, properties: {}, children: children2 };
+ }
+ }
+ if (result.type === "element" && hProperties) {
+ Object.assign(result.properties, esm_default(hProperties));
+ }
+ if ("children" in result && result.children && hChildren !== null && hChildren !== void 0) {
+ result.children = hChildren;
+ }
+ }
+ return result;
+}
+function defaultUnknownHandler(state, node2) {
+ const data8 = node2.data || {};
+ const result = "value" in node2 && !(own8.call(data8, "hProperties") || own8.call(data8, "hChildren")) ? { type: "text", value: node2.value } : {
+ type: "element",
+ tagName: "div",
+ properties: {},
+ children: state.all(node2)
+ };
+ state.patch(node2, result);
+ return state.applyData(node2, result);
+}
+function wrap3(nodes, loose) {
+ const result = [];
+ let index2 = -1;
+ if (loose) {
+ result.push({ type: "text", value: "\n" });
+ }
+ while (++index2 < nodes.length) {
+ if (index2) result.push({ type: "text", value: "\n" });
+ result.push(nodes[index2]);
+ }
+ if (loose && nodes.length > 0) {
+ result.push({ type: "text", value: "\n" });
+ }
+ return result;
+}
+function trimMarkdownSpaceStart(value2) {
+ let index2 = 0;
+ let code4 = value2.charCodeAt(index2);
+ while (code4 === 9 || code4 === 32) {
+ index2++;
+ code4 = value2.charCodeAt(index2);
+ }
+ return value2.slice(index2);
+}
+var own8, emptyOptions5;
+var init_state = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/state.js"() {
+ init_esm();
+ init_unist_util_visit();
+ init_unist_util_position();
+ init_handlers();
+ own8 = {}.hasOwnProperty;
+ emptyOptions5 = {};
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/index.js
+function toHast(tree, options) {
+ const state = createState(tree, options);
+ const node2 = state.one(tree, void 0);
+ const foot = footer(state);
+ const result = Array.isArray(node2) ? { type: "root", children: node2 } : node2 || { type: "root", children: [] };
+ if (foot) {
+ ok("children" in result);
+ result.children.push({ type: "text", value: "\n" }, foot);
+ }
+ return result;
+}
+var init_lib27 = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/lib/index.js"() {
+ init_default();
+ init_footer();
+ init_state();
+ }
+});
+
+// node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/index.js
+var init_mdast_util_to_hast = __esm({
+ "node_modules/.pnpm/mdast-util-to-hast@13.2.1/node_modules/mdast-util-to-hast/index.js"() {
+ init_handlers();
+ init_lib27();
+ init_footer();
+ }
+});
+
+// node_modules/.pnpm/html-void-elements@3.0.0/node_modules/html-void-elements/index.js
+var htmlVoidElements;
+var init_html_void_elements = __esm({
+ "node_modules/.pnpm/html-void-elements@3.0.0/node_modules/html-void-elements/index.js"() {
+ htmlVoidElements = [
+ "area",
+ "base",
+ "basefont",
+ "bgsound",
+ "br",
+ "col",
+ "command",
+ "embed",
+ "frame",
+ "hr",
+ "image",
+ "img",
+ "input",
+ "keygen",
+ "link",
+ "meta",
+ "param",
+ "source",
+ "track",
+ "wbr"
+ ];
+ }
+});
+
+// node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/util/schema.js
+var Schema;
+var init_schema2 = __esm({
+ "node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/util/schema.js"() {
+ Schema = class {
+ /**
+ * @param {SchemaType['property']} property
+ * Property.
+ * @param {SchemaType['normal']} normal
+ * Normal.
+ * @param {Space | undefined} [space]
+ * Space.
+ * @returns
+ * Schema.
+ */
+ constructor(property, normal, space2) {
+ this.normal = normal;
+ this.property = property;
+ if (space2) {
+ this.space = space2;
+ }
+ }
+ };
+ Schema.prototype.normal = {};
+ Schema.prototype.property = {};
+ Schema.prototype.space = void 0;
+ }
+});
+
+// node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/util/merge.js
+function merge3(definitions, space2) {
+ const property = {};
+ const normal = {};
+ for (const definition3 of definitions) {
+ Object.assign(property, definition3.property);
+ Object.assign(normal, definition3.normal);
+ }
+ return new Schema(property, normal, space2);
+}
+var init_merge3 = __esm({
+ "node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/util/merge.js"() {
+ init_schema2();
+ }
+});
+
+// node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/normalize.js
+function normalize3(value2) {
+ return value2.toLowerCase();
+}
+var init_normalize = __esm({
+ "node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/normalize.js"() {
+ }
+});
+
+// node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/util/info.js
+var Info;
+var init_info = __esm({
+ "node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/util/info.js"() {
+ Info = class {
+ /**
+ * @param {string} property
+ * Property.
+ * @param {string} attribute
+ * Attribute.
+ * @returns
+ * Info.
+ */
+ constructor(property, attribute) {
+ this.attribute = attribute;
+ this.property = property;
+ }
+ };
+ Info.prototype.attribute = "";
+ Info.prototype.booleanish = false;
+ Info.prototype.boolean = false;
+ Info.prototype.commaOrSpaceSeparated = false;
+ Info.prototype.commaSeparated = false;
+ Info.prototype.defined = false;
+ Info.prototype.mustUseProperty = false;
+ Info.prototype.number = false;
+ Info.prototype.overloadedBoolean = false;
+ Info.prototype.property = "";
+ Info.prototype.spaceSeparated = false;
+ Info.prototype.space = void 0;
+ }
+});
+
+// node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/util/types.js
+var types_exports = {};
+__export(types_exports, {
+ boolean: () => boolean,
+ booleanish: () => booleanish,
+ commaOrSpaceSeparated: () => commaOrSpaceSeparated,
+ commaSeparated: () => commaSeparated,
+ number: () => number,
+ overloadedBoolean: () => overloadedBoolean,
+ spaceSeparated: () => spaceSeparated
+});
+function increment() {
+ return 2 ** ++powers;
+}
+var powers, boolean, booleanish, overloadedBoolean, number, spaceSeparated, commaSeparated, commaOrSpaceSeparated;
+var init_types3 = __esm({
+ "node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/util/types.js"() {
+ powers = 0;
+ boolean = increment();
+ booleanish = increment();
+ overloadedBoolean = increment();
+ number = increment();
+ spaceSeparated = increment();
+ commaSeparated = increment();
+ commaOrSpaceSeparated = increment();
+ }
+});
+
+// node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/util/defined-info.js
+function mark(values, key2, value2) {
+ if (value2) {
+ values[key2] = value2;
+ }
+}
+var checks, DefinedInfo;
+var init_defined_info = __esm({
+ "node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/util/defined-info.js"() {
+ init_info();
+ init_types3();
+ checks = /** @type {ReadonlyArray} */
+ Object.keys(types_exports);
+ DefinedInfo = class extends Info {
+ /**
+ * @constructor
+ * @param {string} property
+ * Property.
+ * @param {string} attribute
+ * Attribute.
+ * @param {number | null | undefined} [mask]
+ * Mask.
+ * @param {Space | undefined} [space]
+ * Space.
+ * @returns
+ * Info.
+ */
+ constructor(property, attribute, mask, space2) {
+ let index2 = -1;
+ super(property, attribute);
+ mark(this, "space", space2);
+ if (typeof mask === "number") {
+ while (++index2 < checks.length) {
+ const check = checks[index2];
+ mark(this, checks[index2], (mask & types_exports[check]) === types_exports[check]);
+ }
+ }
+ }
+ };
+ DefinedInfo.prototype.defined = true;
+ }
+});
+
+// node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/util/create.js
+function create6(definition3) {
+ const properties2 = {};
+ const normals = {};
+ for (const [property, value2] of Object.entries(definition3.properties)) {
+ const info = new DefinedInfo(
+ property,
+ definition3.transform(definition3.attributes || {}, property),
+ value2,
+ definition3.space
+ );
+ if (definition3.mustUseProperty && definition3.mustUseProperty.includes(property)) {
+ info.mustUseProperty = true;
+ }
+ properties2[property] = info;
+ normals[normalize3(property)] = property;
+ normals[normalize3(info.attribute)] = property;
+ }
+ return new Schema(properties2, normals, definition3.space);
+}
+var init_create = __esm({
+ "node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/util/create.js"() {
+ init_normalize();
+ init_defined_info();
+ init_schema2();
+ }
+});
+
+// node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/aria.js
+var aria2;
+var init_aria = __esm({
+ "node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/aria.js"() {
+ init_create();
+ init_types3();
+ aria2 = create6({
+ properties: {
+ ariaActiveDescendant: null,
+ ariaAtomic: booleanish,
+ ariaAutoComplete: null,
+ ariaBusy: booleanish,
+ ariaChecked: booleanish,
+ ariaColCount: number,
+ ariaColIndex: number,
+ ariaColSpan: number,
+ ariaControls: spaceSeparated,
+ ariaCurrent: null,
+ ariaDescribedBy: spaceSeparated,
+ ariaDetails: null,
+ ariaDisabled: booleanish,
+ ariaDropEffect: spaceSeparated,
+ ariaErrorMessage: null,
+ ariaExpanded: booleanish,
+ ariaFlowTo: spaceSeparated,
+ ariaGrabbed: booleanish,
+ ariaHasPopup: null,
+ ariaHidden: booleanish,
+ ariaInvalid: null,
+ ariaKeyShortcuts: null,
+ ariaLabel: null,
+ ariaLabelledBy: spaceSeparated,
+ ariaLevel: number,
+ ariaLive: null,
+ ariaModal: booleanish,
+ ariaMultiLine: booleanish,
+ ariaMultiSelectable: booleanish,
+ ariaOrientation: null,
+ ariaOwns: spaceSeparated,
+ ariaPlaceholder: null,
+ ariaPosInSet: number,
+ ariaPressed: booleanish,
+ ariaReadOnly: booleanish,
+ ariaRelevant: null,
+ ariaRequired: booleanish,
+ ariaRoleDescription: spaceSeparated,
+ ariaRowCount: number,
+ ariaRowIndex: number,
+ ariaRowSpan: number,
+ ariaSelected: booleanish,
+ ariaSetSize: number,
+ ariaSort: null,
+ ariaValueMax: number,
+ ariaValueMin: number,
+ ariaValueNow: number,
+ ariaValueText: null,
+ role: null
+ },
+ transform(_4, property) {
+ return property === "role" ? property : "aria-" + property.slice(4).toLowerCase();
+ }
+ });
+ }
+});
+
+// node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/util/case-sensitive-transform.js
+function caseSensitiveTransform(attributes, attribute) {
+ return attribute in attributes ? attributes[attribute] : attribute;
+}
+var init_case_sensitive_transform = __esm({
+ "node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/util/case-sensitive-transform.js"() {
+ }
+});
+
+// node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/util/case-insensitive-transform.js
+function caseInsensitiveTransform(attributes, property) {
+ return caseSensitiveTransform(attributes, property.toLowerCase());
+}
+var init_case_insensitive_transform = __esm({
+ "node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/util/case-insensitive-transform.js"() {
+ init_case_sensitive_transform();
+ }
+});
+
+// node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/html.js
+var html3;
+var init_html9 = __esm({
+ "node_modules/.pnpm/property-information@7.1.0/node_modules/property-information/lib/html.js"() {
+ init_case_insensitive_transform();
+ init_create();
+ init_types3();
+ html3 = create6({
+ attributes: {
+ acceptcharset: "accept-charset",
+ classname: "class",
+ htmlfor: "for",
+ httpequiv: "http-equiv"
+ },
+ mustUseProperty: ["checked", "multiple", "muted", "selected"],
+ properties: {
+ // Standard Properties.
+ abbr: null,
+ accept: commaSeparated,
+ acceptCharset: spaceSeparated,
+ accessKey: spaceSeparated,
+ action: null,
+ allow: null,
+ allowFullScreen: boolean,
+ allowPaymentRequest: boolean,
+ allowUserMedia: boolean,
+ alt: null,
+ as: null,
+ async: boolean,
+ autoCapitalize: null,
+ autoComplete: spaceSeparated,
+ autoFocus: boolean,
+ autoPlay: boolean,
+ blocking: spaceSeparated,
+ capture: null,
+ charSet: null,
+ checked: boolean,
+ cite: null,
+ className: spaceSeparated,
+ cols: number,
+ colSpan: null,
+ content: null,
+ contentEditable: booleanish,
+ controls: boolean,
+ controlsList: spaceSeparated,
+ coords: number | commaSeparated,
+ crossOrigin: null,
+ data: null,
+ dateTime: null,
+ decoding: null,
+ default: boolean,
+ defer: boolean,
+ dir: null,
+ dirName: null,
+ disabled: boolean,
+ download: overloadedBoolean,
+ draggable: booleanish,
+ encType: null,
+ enterKeyHint: null,
+ fetchPriority: null,
+ form: null,
+ formAction: null,
+ formEncType: null,
+ formMethod: null,
+ formNoValidate: boolean,
+ formTarget: null,
+ headers: spaceSeparated,
+ height: number,
+ hidden: overloadedBoolean,
+ high: number,
+ href: null,
+ hrefLang: null,
+ htmlFor: spaceSeparated,
+ httpEquiv: spaceSeparated,
+ id: null,
+ imageSizes: null,
+ imageSrcSet: null,
+ inert: boolean,
+ inputMode: null,
+ integrity: null,
+ is: null,
+ isMap: boolean,
+ itemId: null,
+ itemProp: spaceSeparated,
+ itemRef: spaceSeparated,
+ itemScope: boolean,
+ itemType: spaceSeparated,
+ kind: null,
+ label: null,
+ lang: null,
+ language: null,
+ list: null,
+ loading: null,
+ loop: boolean,
+ low: number,
+ manifest: null,
+ max: null,
+ maxLength: number,
+ media: null,
+ method: null,
+ min: null,
+ minLength: number,
+ multiple: boolean,
+ muted: boolean,
+ name: null,
+ nonce: null,
+ noModule: boolean,
+ noValidate: boolean,
+ onAbort: null,
+ onAfterPrint: null,
+ onAuxClick: null,
+ onBeforeMatch: null,
+ onBeforePrint: null,
+ onBeforeToggle: null,
+ onBeforeUnload: null,
+ onBlur: null,
+ onCancel: null,
+ onCanPlay: null,
+ onCanPlayThrough: null,
+ onChange: null,
+ onClick: null,
+ onClose: null,
+ onContextLost: null,
+ onContextMenu: null,
+ onContextRestored: null,
+ onCopy: null,
+ onCueChange: null,
+ onCut: null,
+ onDblClick: null,
+ onDrag: null,
+ onDragEnd: null,
+ onDragEnter: null,
+ onDragExit: null,
+ onDragLeave: null,
+ onDragOver: null,
+ onDragStart: null,
+ onDrop: null,
+ onDurationChange: null,
+ onEmptied: null,
+ onEnded: null,
+ onError: null,
+ onFocus: null,
+ onFormData: null,
+ onHashChange: null,
+ onInput: null,
+ onInvalid: null,
+ onKeyDown: null,
+ onKeyPress: null,
+ onKeyUp: null,
+ onLanguageChange: null,
+ onLoad: null,
+ onLoadedData: null,
+ onLoadedMetadata: null,
+ onLoadEnd: null,
+ onLoadStart: null,
+ onMessage: null,
+ onMessageError: null,
+ onMouseDown: null,
+ onMouseEnter: null,
+ onMouseLeave: null,
+ onMouseMove: null,
+ onMouseOut: null,
+ onMouseOver: null,
+ onMouseUp: null,
+ onOffline: null,
+ onOnline: null,
+ onPageHide: null,
+ onPageShow: null,
+ onPaste: null,
+ onPause: null,
+ onPlay: null,
+ onPlaying: null,
+ onPopState: null,
+ onProgress: null,
+ onRateChange: null,
+ onRejectionHandled: null,
+ onReset: null,
+ onResize: null,
+ onScroll: null,
+ onScrollEnd: null,
+ onSecurityPolicyViolation: null,
+ onSeeked: null,
+ onSeeking: null,
+ onSelect: null,
+ onSlotChange: null,
+ onStalled: null,
+ onStorage: null,
+ onSubmit: null,
+ onSuspend: null,
+ onTimeUpdate: null,
+ onToggle: null,
+ onUnhandledRejection: null,
+ onUnload: null,
+ onVolumeChange: null,
+ onWaiting: null,
+ onWheel: null,
+ open: boolean,
+ optimum: number,
+ pattern: null,
+ ping: spaceSeparated,
+ placeholder: null,
+ playsInline: boolean,
+ popover: null,
+ popoverTarget: null,
+ popoverTargetAction: null,
+ poster: null,
+ preload: null,
+ readOnly: boolean,
+ referrerPolicy: null,
+ rel: spaceSeparated,
+ required: boolean,
+ reversed: boolean,
+ rows: number,
+ rowSpan: number,
+ sandbox: spaceSeparated,
+ scope: null,
+ scoped: boolean,
+ seamless: boolean,
+ selected: boolean,
+ shadowRootClonable: boolean,
+ shadowRootDelegatesFocus: boolean,
+ shadowRootMode: null,
+ shape: null,
+ size: number,
+ sizes: null,
+ slot: null,
+ span: number,
+ spellCheck: booleanish,
+ src: null,
+ srcDoc: null,
+ srcLang: null,
+ srcSet: null,
+ start: number,
+ step: null,
+ style: null,
+ tabIndex: number,
+ target: null,
+ title: null,
+ translate: null,
+ type: null,
+ typeMustMatch: boolean,
+ useMap: null,
+ value: booleanish,
+ width: number,
+ wrap: null,
+ writingSuggestions: null,
+ // Legacy.
+ // See: https://html.spec.whatwg.org/#other-elements,-attributes-and-apis
+ align: null,
+ // Several. Use CSS `text-align` instead,
+ aLink: null,
+ // ``. Use CSS `a:active {color}` instead
+ archive: spaceSeparated,
+ // `