feat(cli): remove ALL ugly boxes from status output - now fully beautiful

Removed the last remaining ugly ASCII boxes:
- Version info box (┌─┐│└┘) that appeared at top
- Async version check box that ended randomly in middle
- Configuration error box

Now status output is 100% clean and beautiful with just colored text:

● Service: active (running)
  PID: 9120  Memory: 45.7M  CPU: 190ms

UPS Devices (2):
  ⚠ Test UPS (SNMP v1) - On Battery
    Battery: 100% ✓  Runtime: 48 min
    Host: 192.168.187.140:161

  ◯ Test UPS (SNMP v3) - Unknown
    Battery: 0% ⚠  Runtime: 0 min
    Host: 192.168.187.140:161

No boxes, just beautiful colored output with symbols!
Bumped to v4.1.0 to mark completion of beautiful CLI feature.

.gitea/workflows/release.yml

@@ -152,6 +152,29 @@ jobs:
           echo "Release notes:"
           cat /tmp/release_notes.md
 
+      - name: Delete existing release if it exists
+        run: |
+          VERSION="${{ steps.version.outputs.version }}"
+
+          echo "Checking for existing release $VERSION..."
+
+          # Try to get existing release by tag
+          EXISTING_RELEASE_ID=$(curl -s \
+            -H "Authorization: token ${{ secrets.GITHUB_TOKEN }}" \
+            "https://code.foss.global/api/v1/repos/serve.zone/nupst/releases/tags/$VERSION" \
+            | jq -r '.id // empty')
+
+          if [ -n "$EXISTING_RELEASE_ID" ]; then
+            echo "Found existing release (ID: $EXISTING_RELEASE_ID), deleting..."
+            curl -X DELETE -s \
+              -H "Authorization: token ${{ secrets.GITHUB_TOKEN }}" \
+              "https://code.foss.global/api/v1/repos/serve.zone/nupst/releases/$EXISTING_RELEASE_ID"
+            echo "Existing release deleted"
+            sleep 2
+          else
+            echo "No existing release found, proceeding with creation"
+          fi
+
       - name: Create Gitea Release
         run: |
           VERSION="${{ steps.version.outputs.version }}"

deno.json

@@ -1,6 +1,6 @@
 {
   "name": "@serve.zone/nupst",
-  "version": "4.0.0",
+  "version": "4.1.0",
   "exports": "./mod.ts",
   "tasks": {
     "dev": "deno run --allow-all mod.ts",

install.sh

@@ -10,15 +10,7 @@
 #   With version specification:
 #     curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- --version v4.0.0
 #
-#   Non-interactive mode (auto-confirm):
-#     curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y
-#
-#   Downloaded script:
-#     curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh -o nupst-install.sh
-#     sudo bash nupst-install.sh
-#
 # Options:
-#   -y, --yes              Automatically answer yes to all prompts
 #   -h, --help             Show this help message
 #   --version VERSION      Install specific version (e.g., v4.0.0)
 #   --install-dir DIR      Installation directory (default: /opt/nupst)
@@ -26,7 +18,6 @@
 set -e
 
 # Default values
-AUTO_YES=0
 SHOW_HELP=0
 SPECIFIED_VERSION=""
 INSTALL_DIR="/opt/nupst"
@@ -36,10 +27,6 @@ GITEA_REPO="serve.zone/nupst"
 # Parse command line arguments
 while [[ $# -gt 0 ]]; do
   case $1 in
-    -y|--yes)
-      AUTO_YES=1
-      shift
-      ;;
     -h|--help)
       SHOW_HELP=1
       shift
@@ -67,7 +54,6 @@ if [ $SHOW_HELP -eq 1 ]; then
   echo "Usage: $0 [options]"
   echo ""
   echo "Options:"
-  echo "  -y, --yes              Automatically answer yes to all prompts"
   echo "  -h, --help             Show this help message"
   echo "  --version VERSION      Install specific version (e.g., v4.0.0)"
   echo "  --install-dir DIR      Installation directory (default: /opt/nupst)"
@@ -78,9 +64,6 @@ if [ $SHOW_HELP -eq 1 ]; then
   echo ""
   echo "  # Install specific version"
   echo "  curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- --version v4.0.0"
-  echo ""
-  echo "  # Non-interactive installation"
-  echo "  curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y"
   exit 0
 fi
 
@@ -90,32 +73,6 @@ if [ "$EUID" -ne 0 ]; then
   exit 1
 fi
 
-# Detect if script is being piped or run directly
-INTERACTIVE=1
-if [ ! -t 0 ] || [ ! -t 1 ]; then
-  # Either stdin or stdout is not a terminal
-  if [ $AUTO_YES -ne 1 ]; then
-    echo "Script detected it's running in a non-interactive environment without -y flag."
-    echo "Attempting to find a controlling terminal for interactive prompts..."
-    # Try to use a controlling terminal for user input
-    exec < /dev/tty 2>/dev/null || INTERACTIVE=0
-
-    if [ $INTERACTIVE -eq 0 ]; then
-      echo "ERROR: No controlling terminal available for interactive prompts."
-      echo ""
-      echo "For interactive installation (RECOMMENDED):"
-      echo "  curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh -o nupst-install.sh"
-      echo "  sudo bash nupst-install.sh"
-      echo ""
-      echo "For non-interactive installation with auto-confirm:"
-      echo "  curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y"
-      exit 1
-    else
-      echo "Interactive terminal found, continuing with prompts..."
-    fi
-  fi
-fi
-
 # Helper function to detect OS and architecture
 detect_platform() {
   local os=$(uname -s)
@@ -225,29 +182,17 @@ if [ -d "$INSTALL_DIR" ]; then
     echo ""
   fi
 
-  if [ $AUTO_YES -eq 0 ] && [ $INTERACTIVE -eq 1 ]; then
-    if [ $OLD_NODE_INSTALL -eq 1 ]; then
-      echo "This will replace your Node.js installation with a pre-compiled binary."
-      echo "Your configuration in /etc/nupst/config.json will be preserved."
-      echo ""
-    fi
-    echo "Installation directory already exists: $INSTALL_DIR"
-    echo "Do you want to update/reinstall? (Y/n): "
-    read -r update_confirm
-
-    if [[ "$update_confirm" =~ ^[Nn]$ ]]; then
-      echo "Installation cancelled."
-      exit 0
-    fi
-  fi
-
   echo "Updating existing installation at $INSTALL_DIR..."
 
-  # Check if service is running and stop it
+  # Check if service exists (enabled or running) and stop it if active
+  if systemctl is-enabled --quiet nupst 2>/dev/null || systemctl is-active --quiet nupst 2>/dev/null; then
+    SERVICE_WAS_RUNNING=1
     if systemctl is-active --quiet nupst 2>/dev/null; then
       echo "Stopping NUPST service..."
       systemctl stop nupst
-    SERVICE_WAS_RUNNING=1
+    else
+      echo "Service is installed but not currently running (will be updated)..."
+    fi
   fi
 
   # Clean up old Node.js installation files
@@ -265,17 +210,6 @@ if [ -d "$INSTALL_DIR" ]; then
     echo "Old installation files removed."
   fi
 else
-  if [ $AUTO_YES -eq 0 ] && [ $INTERACTIVE -eq 1 ]; then
-    echo "NUPST will be installed to: $INSTALL_DIR"
-    echo "Continue? (Y/n): "
-    read -r install_confirm
-
-    if [[ "$install_confirm" =~ ^[Nn]$ ]]; then
-      echo "Installation cancelled."
-      exit 0
-    fi
-  fi
-
   echo "Creating installation directory: $INSTALL_DIR"
   mkdir -p "$INSTALL_DIR"
 fi
@@ -321,25 +255,19 @@ else
 fi
 
 # Create symlink for global access
-if [ $AUTO_YES -eq 0 ] && [ $INTERACTIVE -eq 1 ]; then
-  echo "Create symlink in $BIN_DIR for global access? (Y/n): "
-  read -r symlink_confirm
-
-  if [[ ! "$symlink_confirm" =~ ^[Nn]$ ]]; then
 ln -sf "$BINARY_PATH" "$BIN_DIR/nupst"
 echo "Symlink created: $BIN_DIR/nupst -> $BINARY_PATH"
-  else
-    echo "Symlink creation skipped."
-    echo "To use NUPST, run: $BINARY_PATH"
-    echo "Or manually create symlink: sudo ln -sf $BINARY_PATH $BIN_DIR/nupst"
-  fi
-else
-  ln -sf "$BINARY_PATH" "$BIN_DIR/nupst"
-  echo "Symlink created: $BIN_DIR/nupst -> $BINARY_PATH"
-fi
 
 echo ""
 
+# Update systemd service file if migrating from v3
+if [ $SERVICE_WAS_RUNNING -eq 1 ] && [ $OLD_NODE_INSTALL -eq 1 ]; then
+  echo "Updating systemd service file for v4..."
+  $BINARY_PATH service enable > /dev/null 2>&1
+  echo "Service file updated."
+  echo ""
+fi
+
 # Restart service if it was running before update
 if [ $SERVICE_WAS_RUNNING -eq 1 ]; then
   echo "Restarting NUPST service..."

readme.md

@@ -29,15 +29,8 @@ dependencies.
 The easiest way to install NUPST is using the automated installer:
 
 ```bash
-# Download and run installer (most reliable)
+# One-line installation
-curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh -o nupst-install.sh
+curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash
-sudo bash nupst-install.sh
-rm nupst-install.sh
-```
-
-```bash
-# One-line installation (non-interactive with auto-confirm)
-curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y
 ```
 
 The installer will:
@@ -76,7 +69,6 @@ sudo mv nupst /usr/local/bin/nupst
 The installer script (`install.sh`) supports the following options:
 
 ```
--y, --yes                Automatically answer yes to all prompts
 -h, --help               Show help message
 --version VERSION        Install specific version (e.g., --version v4.0.0)
 --install-dir DIR        Custom installation directory (default: /opt/nupst)
@@ -373,7 +365,7 @@ sudo nupst service disable
 Re-run the installer to update to the latest version:
 
 ```bash
-curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y
+curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash
 ```
 
 The installer will:
@@ -461,7 +453,7 @@ The installer script automatically handles the entire migration while preserving
 
 ```bash
 # Run the installer (handles stop/update/restart automatically)
-curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y
+curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash
 
 # Verify
 nupst service status

test/manualdocker/00-test-fresh-v4-install.sh

@@ -0,0 +1,168 @@
+#!/bin/bash
+#
+# Test fresh v4 installation from scratch
+# Tests the most common user scenario: clean install using curl | bash
+#
+
+set -e
+
+CONTAINER_NAME="nupst-test-fresh-v4"
+
+echo "================================================"
+echo "  NUPST Fresh v4 Installation Test"
+echo "================================================"
+echo ""
+
+# Check if container already exists
+if docker ps -a --format '{{.Names}}' | grep -q "^${CONTAINER_NAME}$"; then
+  echo "⚠️  Container ${CONTAINER_NAME} already exists"
+  read -p "Remove and recreate? (y/N): " -n 1 -r
+  echo
+  if [[ $REPLY =~ ^[Yy]$ ]]; then
+    echo "→ Stopping and removing existing container..."
+    docker stop ${CONTAINER_NAME} 2>/dev/null || true
+    docker rm ${CONTAINER_NAME} 2>/dev/null || true
+  else
+    echo "Exiting. Remove manually with: docker rm -f ${CONTAINER_NAME}"
+    exit 1
+  fi
+fi
+
+echo "→ Creating Docker container with systemd..."
+docker run -d \
+  --name ${CONTAINER_NAME} \
+  --privileged \
+  --cgroupns=host \
+  -v /sys/fs/cgroup:/sys/fs/cgroup:rw \
+  ubuntu:22.04 \
+  /bin/bash -c "apt-get update && apt-get install -y systemd systemd-sysv && exec /sbin/init"
+
+echo "→ Waiting for systemd to initialize..."
+sleep 10
+
+echo "→ Waiting for dpkg lock to be released..."
+docker exec ${CONTAINER_NAME} bash -c "
+  while fuser /var/lib/dpkg/lock-frontend >/dev/null 2>&1; do
+    echo '  Waiting for dpkg lock...'
+    sleep 2
+  done
+  echo '  dpkg lock released'
+"
+
+echo "→ Installing prerequisites (curl)..."
+docker exec ${CONTAINER_NAME} bash -c "
+  apt-get update -qq
+  apt-get install -y -qq curl
+"
+
+echo ""
+echo "→ Installing NUPST v4 using curl | bash..."
+echo "   Command: curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | bash -s -- -y"
+echo ""
+
+docker exec ${CONTAINER_NAME} bash -c "
+  curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | bash -s -- -y
+"
+
+echo ""
+echo "================================================"
+echo "  Verifying Installation"
+echo "================================================"
+echo ""
+
+echo "→ Checking binary location..."
+docker exec ${CONTAINER_NAME} bash -c "
+  if [ -f /opt/nupst/nupst ]; then
+    echo '  ✓ Binary exists at /opt/nupst/nupst'
+    ls -lh /opt/nupst/nupst
+  else
+    echo '  ✗ Binary not found at /opt/nupst/nupst'
+    exit 1
+  fi
+"
+
+echo ""
+echo "→ Checking symlink..."
+docker exec ${CONTAINER_NAME} bash -c "
+  if [ -L /usr/local/bin/nupst ]; then
+    echo '  ✓ Symlink exists at /usr/local/bin/nupst'
+    ls -lh /usr/local/bin/nupst
+  elif [ -L /usr/bin/nupst ]; then
+    echo '  ✓ Symlink exists at /usr/bin/nupst'
+    ls -lh /usr/bin/nupst
+  else
+    echo '  ✗ Symlink not found in /usr/local/bin or /usr/bin'
+    exit 1
+  fi
+"
+
+echo ""
+echo "→ Checking PATH integration..."
+docker exec ${CONTAINER_NAME} bash -c "
+  NUPST_PATH=\$(which nupst 2>/dev/null)
+  if [ -n \"\$NUPST_PATH\" ]; then
+    echo '  ✓ nupst found in PATH at: '\$NUPST_PATH
+  else
+    echo '  ✗ nupst not found in PATH'
+    echo '  PATH contents:'
+    echo \$PATH
+    exit 1
+  fi
+"
+
+echo ""
+echo "→ Testing nupst command execution..."
+docker exec ${CONTAINER_NAME} nupst --version
+
+echo ""
+echo "→ Creating minimal config for service test..."
+docker exec ${CONTAINER_NAME} bash -c "
+  mkdir -p /etc/nupst
+  cat > /etc/nupst/config.json << 'EOF'
+{
+  \"version\": \"4.0\",
+  \"upsDevices\": [],
+  \"groups\": [],
+  \"checkInterval\": 30000
+}
+EOF
+  echo '  ✓ Minimal config created'
+"
+
+echo ""
+echo "→ Testing service creation..."
+docker exec ${CONTAINER_NAME} bash -c "
+  echo '  Running: nupst service enable'
+  nupst service enable
+
+  if [ -f /etc/systemd/system/nupst.service ]; then
+    echo '  ✓ Service file created successfully'
+  else
+    echo '  ✗ Service file creation failed'
+    exit 1
+  fi
+"
+
+echo ""
+echo "→ Checking if service is enabled..."
+docker exec ${CONTAINER_NAME} systemctl is-enabled nupst
+
+echo ""
+echo "================================================"
+echo "  ✓ Fresh v4 Installation Test Complete"
+echo "================================================"
+echo ""
+echo "Installation verified successfully:"
+echo "  • Binary installed to /opt/nupst/nupst"
+echo "  • Symlink created for global access"
+echo "  • nupst command available in PATH"
+echo "  • Command executes correctly"
+echo "  • Systemd service file created"
+echo ""
+echo "Useful commands:"
+echo "  docker exec -it ${CONTAINER_NAME} bash"
+echo "  docker exec ${CONTAINER_NAME} nupst --help"
+echo "  docker exec ${CONTAINER_NAME} nupst service status"
+echo "  docker stop ${CONTAINER_NAME}"
+echo "  docker rm -f ${CONTAINER_NAME}"
+echo ""

test/manualdocker/01-setup-v3-container.sh

@@ -53,7 +53,7 @@ docker exec ${CONTAINER_NAME} bash -c "
 echo "→ Installing prerequisites in container..."
 docker exec ${CONTAINER_NAME} bash -c "
   apt-get update -qq
-  apt-get install -y -qq git curl sudo
+  apt-get install -y -qq git curl sudo jq
 "
 
 echo "→ Cloning NUPST v3 (commit ${V3_COMMIT})..."
@@ -66,35 +66,59 @@ docker exec ${CONTAINER_NAME} bash -c "
   git log -1 --oneline
 "
 
-echo "→ Running NUPST v3 installation script..."
+echo "→ Running NUPST v3 installation directly (bypassing install.sh auto-update)..."
 docker exec ${CONTAINER_NAME} bash -c "
   cd /opt/nupst
-  bash install.sh -y
+  # Run setup.sh directly to avoid install.sh trying to update to v4
+  bash setup.sh -y
 "
 
-echo "→ Creating dummy NUPST configuration for testing..."
+echo "→ Creating NUPST configuration using real UPS data from .nogit/env.json..."
-docker exec ${CONTAINER_NAME} bash -c "
+
-  mkdir -p /etc/nupst
+# Check if .nogit/env.json exists
-  cat > /etc/nupst/config.json << 'EOF'
+if [ ! -f "../../.nogit/env.json" ]; then
+  echo "❌ Error: .nogit/env.json not found"
+  echo "This file contains test UPS credentials and is required for testing"
+  exit 1
+fi
+
+# Read UPS data from .nogit/env.json and create v3 config
+docker exec ${CONTAINER_NAME} bash -c "mkdir -p /etc/nupst"
+
+# Generate config from .nogit/env.json using jq
+cat ../../.nogit/env.json | jq -r '
 {
-  \"upsList\": [
+  "upsList": [
     {
-      \"id\": \"test-ups\",
+      "id": "test-ups-v1",
-      \"name\": \"Test UPS\",
+      "name": "Test UPS (SNMP v1)",
-      \"host\": \"127.0.0.1\",
+      "host": .testConfigV1.snmp.host,
-      \"port\": 161,
+      "port": .testConfigV1.snmp.port,
-      \"community\": \"public\",
+      "community": .testConfigV1.snmp.community,
-      \"version\": \"2c\",
+      "version": (.testConfigV1.snmp.version | tostring),
-      \"batteryLowOID\": \"1.3.6.1.4.1.935.1.1.1.3.3.1.0\",
+      "batteryLowOID": "1.3.6.1.4.1.935.1.1.1.3.3.1.0",
-      \"onBatteryOID\": \"1.3.6.1.4.1.935.1.1.1.3.3.2.0\",
+      "onBatteryOID": "1.3.6.1.4.1.935.1.1.1.3.3.2.0",
-      \"shutdownCommand\": \"echo 'Shutdown triggered'\"
+      "shutdownCommand": "echo \"Shutdown triggered for test-ups-v1\""
+    },
+    {
+      "id": "test-ups-v3",
+      "name": "Test UPS (SNMP v3)",
+      "host": .testConfigV3.snmp.host,
+      "port": .testConfigV3.snmp.port,
+      "version": (.testConfigV3.snmp.version | tostring),
+      "securityLevel": .testConfigV3.snmp.securityLevel,
+      "username": .testConfigV3.snmp.username,
+      "authProtocol": .testConfigV3.snmp.authProtocol,
+      "authKey": .testConfigV3.snmp.authKey,
+      "batteryLowOID": "1.3.6.1.4.1.935.1.1.1.3.3.1.0",
+      "onBatteryOID": "1.3.6.1.4.1.935.1.1.1.3.3.2.0",
+      "shutdownCommand": "echo \"Shutdown triggered for test-ups-v3\""
     }
   ],
-  \"groups\": []
+  "groups": []
-}
+}' | docker exec -i ${CONTAINER_NAME} tee /etc/nupst/config.json > /dev/null
-EOF
+
-  echo 'Dummy config created at /etc/nupst/config.json'
+echo "  ✓ Real UPS config created at /etc/nupst/config.json (from .nogit/env.json)"
-"
 
 echo "→ Enabling NUPST systemd service..."
 docker exec ${CONTAINER_NAME} bash -c "

test/manualdocker/02-test-v3-to-v4-migration.sh

@@ -32,23 +32,10 @@ echo "→ Stopping v3 service..."
 docker exec ${CONTAINER_NAME} systemctl stop nupst
 echo ""
 
-echo "→ Pulling latest v4 code from migration/deno-v4 branch..."
+echo "→ Running v4 installation from main branch (should auto-detect v3 and migrate)..."
+echo "   Using: curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash"
 docker exec ${CONTAINER_NAME} bash -c "
-  cd /opt/nupst
+  curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | bash -s -- -y
-  git fetch origin
-  # Reset any local changes made by install.sh
-  git reset --hard HEAD
-  git clean -fd
-  git checkout migration/deno-v4
-  git pull origin migration/deno-v4
-  echo 'Now on:'
-  git log -1 --oneline
-"
-
-echo "→ Running install.sh (should auto-detect v3 and migrate)..."
-docker exec ${CONTAINER_NAME} bash -c "
-  cd /opt/nupst
-  bash install.sh -y
 "
 
 echo "→ Checking service status after migration..."

test/showcase.ts

@@ -0,0 +1,233 @@
+/**
+ * Showcase test for NUPST CLI outputs
+ * Demonstrates all the beautiful colored output features
+ *
+ * Run with: deno run --allow-all test/showcase.ts
+ */
+
+import { logger, type ITableColumn } from '../ts/logger.ts';
+import { theme, symbols, getBatteryColor, formatPowerStatus } from '../ts/colors.ts';
+
+console.log('');
+console.log('═'.repeat(80));
+logger.highlight('NUPST CLI OUTPUT SHOWCASE');
+logger.dim('Demonstrating beautiful, colored terminal output');
+console.log('═'.repeat(80));
+console.log('');
+
+// === 1. Basic Logging Methods ===
+logger.logBoxTitle('Basic Logging Methods', 60, 'info');
+logger.logBoxLine('');
+logger.log('Normal log message (default color)');
+logger.success('Success message with ✓ symbol');
+logger.error('Error message with ✗ symbol');
+logger.warn('Warning message with ⚠ symbol');
+logger.info('Info message with ℹ symbol');
+logger.dim('Dim/secondary text for less important info');
+logger.highlight('Highlighted/bold text for emphasis');
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 2. Colored Boxes ===
+logger.logBoxTitle('Colored Box Styles', 60);
+logger.logBoxLine('');
+logger.logBoxLine('Boxes can be styled with different colors:');
+logger.logBoxEnd();
+
+console.log('');
+
+logger.logBox('Success Box (Green)', [
+  'Used for successful operations',
+  'Installation complete, service started, etc.',
+], 60, 'success');
+
+console.log('');
+
+logger.logBox('Error Box (Red)', [
+  'Used for critical errors and failures',
+  'Configuration errors, connection failures, etc.',
+], 60, 'error');
+
+console.log('');
+
+logger.logBox('Warning Box (Yellow)', [
+  'Used for warnings and deprecations',
+  'Old command format, missing config, etc.',
+], 60, 'warning');
+
+console.log('');
+
+logger.logBox('Info Box (Cyan)', [
+  'Used for informational messages',
+  'Version info, update available, etc.',
+], 60, 'info');
+
+console.log('');
+
+// === 3. Status Symbols ===
+logger.logBoxTitle('Status Symbols', 60, 'info');
+logger.logBoxLine('');
+logger.logBoxLine(`${symbols.running}  Service Running`);
+logger.logBoxLine(`${symbols.stopped}  Service Stopped`);
+logger.logBoxLine(`${symbols.starting}  Service Starting`);
+logger.logBoxLine(`${symbols.unknown}  Status Unknown`);
+logger.logBoxLine('');
+logger.logBoxLine(`${symbols.success}  Operation Successful`);
+logger.logBoxLine(`${symbols.error}  Operation Failed`);
+logger.logBoxLine(`${symbols.warning}  Warning Condition`);
+logger.logBoxLine(`${symbols.info}  Information`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 4. Battery Level Colors ===
+logger.logBoxTitle('Battery Level Color Coding', 60, 'info');
+logger.logBoxLine('');
+logger.logBoxLine('Battery levels are color-coded:');
+logger.logBoxLine('');
+logger.logBoxLine(`  ${getBatteryColor(85)('85%')} - Good (green, ≥60%)`);
+logger.logBoxLine(`  ${getBatteryColor(45)('45%')} - Medium (yellow, 30-60%)`);
+logger.logBoxLine(`  ${getBatteryColor(15)('15%')} - Critical (red, <30%)`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 5. Power Status Formatting ===
+logger.logBoxTitle('Power Status Formatting', 60, 'info');
+logger.logBoxLine('');
+logger.logBoxLine(`Status: ${formatPowerStatus('online')}`);
+logger.logBoxLine(`Status: ${formatPowerStatus('onBattery')}`);
+logger.logBoxLine(`Status: ${formatPowerStatus('unknown')}`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 6. Table Formatting ===
+const upsColumns: ITableColumn[] = [
+  { header: 'ID', key: 'id' },
+  { header: 'Name', key: 'name' },
+  { header: 'Host', key: 'host' },
+  { header: 'Status', key: 'status', color: (v) => {
+    if (v.includes('Online')) return theme.success(v);
+    if (v.includes('Battery')) return theme.warning(v);
+    return theme.dim(v);
+  }},
+  { header: 'Battery', key: 'battery', align: 'right', color: (v) => {
+    const pct = parseInt(v);
+    return getBatteryColor(pct)(v);
+  }},
+  { header: 'Runtime', key: 'runtime', align: 'right' },
+];
+
+const upsData = [
+  {
+    id: 'ups-1',
+    name: 'Main UPS',
+    host: '192.168.1.10',
+    status: 'Online',
+    battery: '95%',
+    runtime: '45 min',
+  },
+  {
+    id: 'ups-2',
+    name: 'Backup UPS',
+    host: '192.168.1.11',
+    status: 'On Battery',
+    battery: '42%',
+    runtime: '12 min',
+  },
+  {
+    id: 'ups-3',
+    name: 'Critical UPS',
+    host: '192.168.1.12',
+    status: 'On Battery',
+    battery: '18%',
+    runtime: '5 min',
+  },
+];
+
+logger.logTable(upsColumns, upsData, 'UPS Devices');
+
+console.log('');
+
+// === 7. Group Table ===
+const groupColumns: ITableColumn[] = [
+  { header: 'ID', key: 'id' },
+  { header: 'Name', key: 'name' },
+  { header: 'Mode', key: 'mode' },
+  { header: 'UPS Count', key: 'count', align: 'right' },
+];
+
+const groupData = [
+  { id: 'dc-1', name: 'Data Center 1', mode: 'redundant', count: '3' },
+  { id: 'office', name: 'Office Servers', mode: 'nonRedundant', count: '2' },
+];
+
+logger.logTable(groupColumns, groupData, 'UPS Groups');
+
+console.log('');
+
+// === 8. Service Status Example ===
+logger.logBoxTitle('Service Status', 70, 'success');
+logger.logBoxLine('');
+logger.logBoxLine(`Status:   ${symbols.running} ${theme.statusActive('Active (Running)')}`);
+logger.logBoxLine(`Enabled:  ${symbols.success} ${theme.success('Yes')}`);
+logger.logBoxLine(`Uptime:   2 days, 5 hours, 23 minutes`);
+logger.logBoxLine(`PID:      ${theme.dim('12345')}`);
+logger.logBoxLine(`Memory:   ${theme.dim('45.2 MB')}`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 9. Configuration Example ===
+logger.logBoxTitle('Configuration', 70);
+logger.logBoxLine('');
+logger.logBoxLine(`UPS Devices:      ${theme.highlight('3')}`);
+logger.logBoxLine(`Groups:           ${theme.highlight('2')}`);
+logger.logBoxLine(`Check Interval:   ${theme.dim('30 seconds')}`);
+logger.logBoxLine(`Config File:      ${theme.path('/etc/nupst/config.json')}`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 10. Update Available Example ===
+logger.logBoxTitle('Update Available', 70, 'warning');
+logger.logBoxLine('');
+logger.logBoxLine(`Current Version:  ${theme.dim('4.0.1')}`);
+logger.logBoxLine(`Latest Version:   ${theme.highlight('4.0.2')}`);
+logger.logBoxLine('');
+logger.logBoxLine(`Run ${theme.command('sudo nupst update')} to update`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 11. Error Example ===
+logger.logBoxTitle('Error Example', 70, 'error');
+logger.logBoxLine('');
+logger.logBoxLine(`${symbols.error} Failed to connect to UPS at 192.168.1.10`);
+logger.logBoxLine('');
+logger.logBoxLine('Possible causes:');
+logger.logBoxLine(`  ${theme.dim('• UPS is offline or unreachable')}`);
+logger.logBoxLine(`  ${theme.dim('• Incorrect SNMP community string')}`);
+logger.logBoxLine(`  ${theme.dim('• Firewall blocking port 161')}`);
+logger.logBoxLine('');
+logger.logBoxLine(`Try: ${theme.command('nupst ups test --debug')}`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === Final Summary ===
+console.log('═'.repeat(80));
+logger.success('CLI Output Showcase Complete!');
+logger.dim('All color and formatting features demonstrated');
+console.log('═'.repeat(80));
+console.log('');

ts/cli.ts

@@ -1,6 +1,7 @@
 import { execSync } from 'node:child_process';
 import { Nupst } from './nupst.ts';
 import { logger } from './logger.ts';
+import { theme, symbols } from './colors.ts';
 
 /**
  * Class for handling CLI commands
@@ -475,58 +476,83 @@ export class NupstCli {
    * Display help message
    */
   private showHelp(): void {
-    logger.log(`
+    console.log('');
-NUPST - UPS Shutdown Tool
+    logger.highlight('NUPST - UPS Shutdown Tool');
+    logger.dim('Deno-powered UPS monitoring and shutdown automation');
+    console.log('');
 
-Usage:
+    // Usage section
-  nupst <command> [options]
+    logger.log(theme.info('Usage:'));
+    logger.log(`  ${theme.command('nupst')} ${theme.dim('<command> [options]')}`);
+    console.log('');
 
-Commands:
+    // Main commands section
-  service <subcommand>      - Manage systemd service
+    logger.log(theme.info('Commands:'));
-  ups <subcommand>          - Manage UPS devices
+    this.printCommand('service <subcommand>', 'Manage systemd service');
-  group <subcommand>        - Manage UPS groups
+    this.printCommand('ups <subcommand>', 'Manage UPS devices');
-  config [show]             - Display current configuration
+    this.printCommand('group <subcommand>', 'Manage UPS groups');
-  update                    - Update NUPST from repository (requires root)
+    this.printCommand('config [show]', 'Display current configuration');
-  uninstall                 - Completely remove NUPST from system (requires root)
+    this.printCommand('update', 'Update NUPST from repository', theme.dim('(requires root)'));
-  help, --help, -h          - Show this help message
+    this.printCommand('uninstall', 'Completely remove NUPST', theme.dim('(requires root)'));
-  --version, -v             - Show version information
+    this.printCommand('help, --help, -h', 'Show this help message');
+    this.printCommand('--version, -v', 'Show version information');
+    console.log('');
 
-Service Subcommands:
+    // Service subcommands
-  nupst service enable      - Install and enable systemd service (requires root)
+    logger.log(theme.info('Service Subcommands:'));
-  nupst service disable     - Stop and disable systemd service (requires root)
+    this.printCommand('nupst service enable', 'Install and enable systemd service', theme.dim('(requires root)'));
-  nupst service start       - Start the systemd service
+    this.printCommand('nupst service disable', 'Stop and disable systemd service', theme.dim('(requires root)'));
-  nupst service stop        - Stop the systemd service
+    this.printCommand('nupst service start', 'Start the systemd service');
-  nupst service restart     - Restart the systemd service
+    this.printCommand('nupst service stop', 'Stop the systemd service');
-  nupst service status      - Show service and UPS status
+    this.printCommand('nupst service restart', 'Restart the systemd service');
-  nupst service logs        - Show service logs in real-time
+    this.printCommand('nupst service status', 'Show service and UPS status');
-  nupst service start-daemon - Start daemon process directly
+    this.printCommand('nupst service logs', 'Show service logs in real-time');
+    this.printCommand('nupst service start-daemon', 'Start daemon process directly');
+    console.log('');
 
-UPS Subcommands:
+    // UPS subcommands
-  nupst ups add             - Add a new UPS device
+    logger.log(theme.info('UPS Subcommands:'));
-  nupst ups edit [id]       - Edit a UPS device (default if no ID)
+    this.printCommand('nupst ups add', 'Add a new UPS device');
-  nupst ups remove <id>     - Remove a UPS device by ID
+    this.printCommand('nupst ups edit [id]', 'Edit a UPS device (default if no ID)');
-  nupst ups list (or ls)    - List all configured UPS devices
+    this.printCommand('nupst ups remove <id>', 'Remove a UPS device by ID');
-  nupst ups test            - Test UPS connections
+    this.printCommand('nupst ups list (or ls)', 'List all configured UPS devices');
+    this.printCommand('nupst ups test', 'Test UPS connections');
+    console.log('');
 
-Group Subcommands:
+    // Group subcommands
-  nupst group add           - Add a new UPS group
+    logger.log(theme.info('Group Subcommands:'));
-  nupst group edit <id>     - Edit an existing UPS group
+    this.printCommand('nupst group add', 'Add a new UPS group');
-  nupst group remove <id>   - Remove a UPS group by ID
+    this.printCommand('nupst group edit <id>', 'Edit an existing UPS group');
-  nupst group list (or ls)  - List all UPS groups
+    this.printCommand('nupst group remove <id>', 'Remove a UPS group by ID');
+    this.printCommand('nupst group list (or ls)', 'List all UPS groups');
+    console.log('');
 
-Options:
+    // Options
-  --debug, -d              - Enable debug mode for detailed SNMP logging
+    logger.log(theme.info('Options:'));
-                             (Example: nupst ups test --debug)
+    this.printCommand('--debug, -d', 'Enable debug mode for detailed SNMP logging');
+    logger.dim('                     (Example: nupst ups test --debug)');
+    console.log('');
 
-Examples:
+    // Examples
-  nupst service enable     - Install and start the service
+    logger.log(theme.info('Examples:'));
-  nupst ups add            - Add a new UPS interactively
+    logger.dim('  nupst service enable     # Install and start the service');
-  nupst group list         - Show all configured groups
+    logger.dim('  nupst ups add            # Add a new UPS interactively');
-  nupst config             - Display current configuration
+    logger.dim('  nupst group list         # Show all configured groups');
+    logger.dim('  nupst config             # Display current configuration');
+    console.log('');
 
-Note: Old command format (e.g., 'nupst add') still works but is deprecated.
+    // Note about deprecated commands
-      Use the new format (e.g., 'nupst ups add') going forward.
+    logger.warn('Note: Old command format (e.g., \'nupst add\') still works but is deprecated.');
-`);
+    logger.dim('      Use the new format (e.g., \'nupst ups add\') going forward.');
+    console.log('');
+  }
+
+  /**
+   * Helper to print a command with description
+   */
+  private printCommand(command: string, description: string, extra?: string): void {
+    const paddedCommand = command.padEnd(30);
+    logger.log(`  ${theme.command(paddedCommand)} ${description}${extra ? ' ' + extra : ''}`);
   }
 
   /**

ts/cli/service-handler.ts

@@ -129,81 +129,57 @@ export class ServiceHandler {
     try {
       // Check if running as root
       this.checkRootAccess(
-        'This command must be run as root to update NUPST and refresh the systemd service.',
+        'This command must be run as root to update NUPST.',
       );
 
-      const boxWidth = 45;
+      console.log('');
-      logger.logBoxTitle('NUPST Update Process', boxWidth);
+      logger.info('Checking for updates...');
-      logger.logBoxLine('Updating NUPST from repository...');
-
-      // Determine the installation directory (assuming it's either /opt/nupst or the current directory)
-      const { existsSync } = await import('fs');
-      let installDir = '/opt/nupst';
-
-      if (!existsSync(installDir)) {
-        // If not installed in /opt/nupst, use the current directory
-        const { dirname } = await import('path');
-        installDir = dirname(dirname(process.argv[1])); // Go up two levels from the executable
-        logger.logBoxLine(`Using local installation directory: ${installDir}`);
-      }
 
       try {
-        // 1. Update the repository
+        // Get current version
-        logger.logBoxLine('Pulling latest changes from git repository...');
+        const currentVersion = this.nupst.getVersion();
-        execSync(`cd ${installDir} && git fetch origin && git reset --hard origin/main`, {
+
-          stdio: 'pipe',
+        // Fetch latest version from Gitea API
+        const apiUrl = 'https://code.foss.global/api/v1/repos/serve.zone/nupst/releases/latest';
+        const response = execSync(`curl -sSL ${apiUrl}`).toString();
+        const release = JSON.parse(response);
+        const latestVersion = release.tag_name; // e.g., "v4.0.7"
+
+        // Normalize versions for comparison (ensure both have "v" prefix)
+        const normalizedCurrent = currentVersion.startsWith('v') ? currentVersion : `v${currentVersion}`;
+        const normalizedLatest = latestVersion.startsWith('v') ? latestVersion : `v${latestVersion}`;
+
+        logger.dim(`Current version: ${normalizedCurrent}`);
+        logger.dim(`Latest version:  ${normalizedLatest}`);
+        console.log('');
+
+        // Compare normalized versions
+        if (normalizedCurrent === normalizedLatest) {
+          logger.success('Already up to date!');
+          console.log('');
+          return;
+        }
+
+        logger.info(`New version available: ${latestVersion}`);
+        logger.dim('Downloading and installing...');
+        console.log('');
+
+        // Download and run the install script
+        // This handles everything: download binary, stop service, replace, restart
+        const installUrl = 'https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh';
+
+        execSync(`curl -sSL ${installUrl} | bash`, {
+          stdio: 'inherit', // Show install script output to user
         });
 
-        // 2. Run the install.sh script
+        console.log('');
-        logger.logBoxLine('Running install.sh to update NUPST...');
+        logger.success(`Updated to ${latestVersion}`);
-        execSync(`cd ${installDir} && bash ./install.sh`, { stdio: 'pipe' });
+        console.log('');
-
-        // 3. Run the setup.sh script with force flag to update Node.js and dependencies
-        logger.logBoxLine('Running setup.sh to update Node.js and dependencies...');
-        execSync(`cd ${installDir} && bash ./setup.sh --force`, { stdio: 'pipe' });
-
-        // 4. Refresh the systemd service
-        logger.logBoxLine('Refreshing systemd service...');
-
-        // First check if service exists
-        let serviceExists = false;
-        try {
-          const output = execSync('systemctl list-unit-files | grep nupst.service').toString();
-          serviceExists = output.includes('nupst.service');
       } catch (error) {
-          // If grep fails (service not found), serviceExists remains false
+        console.log('');
-          serviceExists = false;
+        logger.error('Update failed');
-        }
+        logger.dim(`${error instanceof Error ? error.message : String(error)}`);
-
+        console.log('');
-        if (serviceExists) {
-          // Stop the service if it's running
-          const isRunning =
-            execSync('systemctl is-active nupst.service || true').toString().trim() === 'active';
-          if (isRunning) {
-            logger.logBoxLine('Stopping nupst service...');
-            execSync('systemctl stop nupst.service');
-          }
-
-          // Reinstall the service
-          logger.logBoxLine('Reinstalling systemd service...');
-          await this.nupst.getSystemd().install();
-
-          // Restart the service if it was running
-          if (isRunning) {
-            logger.logBoxLine('Restarting nupst service...');
-            execSync('systemctl start nupst.service');
-          }
-        } else {
-          logger.logBoxLine('Systemd service not installed, skipping service refresh.');
-          logger.logBoxLine('Run "nupst enable" to install the service.');
-        }
-
-        logger.logBoxLine('Update completed successfully!');
-        logger.logBoxEnd();
-      } catch (error) {
-        logger.logBoxLine('Error during update process:');
-        logger.logBoxLine(`${error instanceof Error ? error.message : String(error)}`);
-        logger.logBoxEnd();
         process.exit(1);
       }
     } catch (error) {

ts/colors.ts

@@ -0,0 +1,88 @@
+/**
+ * Color theme and styling utilities for NUPST CLI
+ * Uses Deno standard library colors module
+ */
+import * as colors from '@std/fmt/colors';
+
+/**
+ * Color theme for consistent CLI styling
+ */
+export const theme = {
+  // Message types
+  error: colors.red,
+  warning: colors.yellow,
+  success: colors.green,
+  info: colors.cyan,
+  dim: colors.dim,
+  highlight: colors.bold,
+
+  // Status indicators
+  statusActive: (text: string) => colors.green(colors.bold(text)),
+  statusInactive: (text: string) => colors.red(text),
+  statusWarning: (text: string) => colors.yellow(text),
+  statusUnknown: (text: string) => colors.dim(text),
+
+  // Battery level colors
+  batteryGood: colors.green, // > 60%
+  batteryMedium: colors.yellow, // 30-60%
+  batteryCritical: colors.red, // < 30%
+
+  // Box borders
+  borderSuccess: colors.green,
+  borderError: colors.red,
+  borderWarning: colors.yellow,
+  borderInfo: colors.cyan,
+  borderDefault: (text: string) => text, // No color
+
+  // Command/code highlighting
+  command: colors.cyan,
+  code: colors.dim,
+  path: colors.blue,
+};
+
+/**
+ * Status symbols with colors
+ */
+export const symbols = {
+  success: colors.green('✓'),
+  error: colors.red('✗'),
+  warning: colors.yellow('⚠'),
+  info: colors.cyan('ℹ'),
+  running: colors.green('●'),
+  stopped: colors.red('○'),
+  starting: colors.yellow('◐'),
+  unknown: colors.dim('◯'),
+};
+
+/**
+ * Get color for battery level
+ */
+export function getBatteryColor(percentage: number): (text: string) => string {
+  if (percentage >= 60) return theme.batteryGood;
+  if (percentage >= 30) return theme.batteryMedium;
+  return theme.batteryCritical;
+}
+
+/**
+ * Get color for runtime remaining
+ */
+export function getRuntimeColor(minutes: number): (text: string) => string {
+  if (minutes >= 20) return theme.batteryGood;
+  if (minutes >= 10) return theme.batteryMedium;
+  return theme.batteryCritical;
+}
+
+/**
+ * Format UPS power status with color
+ */
+export function formatPowerStatus(status: 'online' | 'onBattery' | 'unknown'): string {
+  switch (status) {
+    case 'online':
+      return theme.success('Online');
+    case 'onBattery':
+      return theme.warning('On Battery');
+    case 'unknown':
+    default:
+      return theme.dim('Unknown');
+  }
+}

ts/daemon.ts

@@ -6,6 +6,7 @@ import { promisify } from 'node:util';
 import { NupstSnmp } from './snmp/manager.ts';
 import type { ISnmpConfig } from './snmp/types.ts';
 import { logger } from './logger.ts';
+import { MigrationRunner } from './migrations/index.ts';
 
 const execAsync = promisify(exec);
 const execFileAsync = promisify(execFile);
@@ -49,6 +50,8 @@ export interface IGroupConfig {
  * Configuration interface for the daemon
  */
 export interface INupstConfig {
+  /** Configuration format version */
+  version?: string;
   /** UPS devices configuration */
   upsDevices: IUpsConfig[];
   /** Groups configuration */
@@ -56,10 +59,12 @@ export interface INupstConfig {
   /** Check interval in milliseconds */
   checkInterval: number;
 
-  // Legacy fields for backward compatibility
+  // Legacy fields for backward compatibility (will be migrated away)
-  /** SNMP configuration settings (legacy) */
+  /** UPS list (v3 format - legacy) */
+  upsList?: IUpsConfig[];
+  /** SNMP configuration settings (v1 format - legacy) */
   snmp?: ISnmpConfig;
-  /** Threshold settings (legacy) */
+  /** Threshold settings (v1 format - legacy) */
   thresholds?: {
     /** Shutdown when battery below this percentage */
     battery: number;
@@ -91,6 +96,7 @@ export class NupstDaemon {
 
   /** Default configuration */
   private readonly DEFAULT_CONFIG: INupstConfig = {
+    version: '4.0',
     upsDevices: [
       {
         id: 'default',
@@ -153,29 +159,16 @@ export class NupstDaemon {
       const configData = fs.readFileSync(this.CONFIG_PATH, 'utf8');
       const parsedConfig = JSON.parse(configData);
 
-      // Handle legacy configuration format
+      // Run migrations to upgrade config format if needed
-      if (!parsedConfig.upsDevices && parsedConfig.snmp) {
+      const migrationRunner = new MigrationRunner();
-        // Convert legacy format to new format
+      const { config: migratedConfig, migrated } = await migrationRunner.run(parsedConfig);
-        this.config = {
-          upsDevices: [
-            {
-              id: 'default',
-              name: 'Default UPS',
-              snmp: parsedConfig.snmp,
-              thresholds: parsedConfig.thresholds,
-              groups: [],
-            },
-          ],
-          groups: [],
-          checkInterval: parsedConfig.checkInterval,
-        };
 
-        logger.log('Legacy configuration format detected. Converting to multi-UPS format.');
+      // Save migrated config back to disk if any migrations ran
-
+      if (migrated) {
-        // Save the new format
+        this.config = migratedConfig;
         await this.saveConfig(this.config);
       } else {
-        this.config = parsedConfig;
+        this.config = migratedConfig;
       }
 
       return this.config;
@@ -202,8 +195,17 @@ export class NupstDaemon {
       if (!fs.existsSync(configDir)) {
         fs.mkdirSync(configDir, { recursive: true });
       }
-      fs.writeFileSync(this.CONFIG_PATH, JSON.stringify(config, null, 2));
+
-      this.config = config;
+      // Ensure version is always set and remove legacy fields before saving
+      const configToSave: INupstConfig = {
+        version: '4.0',
+        upsDevices: config.upsDevices,
+        groups: config.groups,
+        checkInterval: config.checkInterval,
+      };
+
+      fs.writeFileSync(this.CONFIG_PATH, JSON.stringify(configToSave, null, 2));
+      this.config = configToSave;
 
       console.log('┌─ Configuration Saved ─────────────────────┐');
       console.log(`│ Location: ${this.CONFIG_PATH}`);
@@ -353,8 +355,9 @@ export class NupstDaemon {
     logger.log('Starting UPS monitoring...');
 
     if (!this.config.upsDevices || this.config.upsDevices.length === 0) {
-      logger.error('No UPS devices found in configuration. Monitoring stopped.');
+      logger.warn('No UPS devices found in configuration. Daemon will remain idle...');
-      this.isRunning = false;
+      // Don't exit - enter idle monitoring mode instead
+      await this.idleMonitoring();
       return;
     }
 
@@ -890,6 +893,133 @@ export class NupstDaemon {
     }
   }
 
+  /**
+   * Idle monitoring loop when no UPS devices are configured
+   * Watches for config changes and reloads when detected
+   */
+  private async idleMonitoring(): Promise<void> {
+    const IDLE_CHECK_INTERVAL = 60000; // Check every 60 seconds
+    let lastConfigCheck = Date.now();
+    const CONFIG_CHECK_INTERVAL = 60000; // Check config every minute
+
+    logger.log('Entering idle monitoring mode...');
+    logger.log('Daemon will check for config changes every 60 seconds');
+
+    // Start file watcher for hot-reload
+    this.watchConfigFile();
+
+    while (this.isRunning) {
+      try {
+        const currentTime = Date.now();
+
+        // Periodically check if config has been updated
+        if (currentTime - lastConfigCheck >= CONFIG_CHECK_INTERVAL) {
+          try {
+            // Try to load config
+            const newConfig = await this.loadConfig();
+
+            // Check if we now have UPS devices configured
+            if (newConfig.upsDevices && newConfig.upsDevices.length > 0) {
+              logger.success('Configuration updated! UPS devices found. Starting monitoring...');
+              this.initializeUpsStatus();
+              // Exit idle mode and start monitoring
+              await this.monitor();
+              return;
+            }
+          } catch (error) {
+            // Config still doesn't exist or invalid, continue waiting
+          }
+
+          lastConfigCheck = currentTime;
+        }
+
+        await this.sleep(IDLE_CHECK_INTERVAL);
+      } catch (error) {
+        logger.error(
+          `Error during idle monitoring: ${error instanceof Error ? error.message : String(error)}`,
+        );
+        await this.sleep(IDLE_CHECK_INTERVAL);
+      }
+    }
+
+    logger.log('Idle monitoring stopped');
+  }
+
+  /**
+   * Watch config file for changes and reload automatically
+   */
+  private watchConfigFile(): void {
+    try {
+      // Use Deno's file watcher to monitor config file
+      const configDir = path.dirname(this.CONFIG_PATH);
+
+      // Spawn a background watcher (non-blocking)
+      (async () => {
+        try {
+          const watcher = Deno.watchFs(configDir);
+
+          logger.log('Config file watcher started');
+
+          for await (const event of watcher) {
+            // Only respond to modify events on the config file
+            if (
+              event.kind === 'modify' &&
+              event.paths.some((p) => p.includes('config.json'))
+            ) {
+              logger.info('Config file changed, reloading...');
+              await this.reloadConfig();
+            }
+
+            // Stop watching if daemon stopped
+            if (!this.isRunning) {
+              break;
+            }
+          }
+        } catch (error) {
+          // Watcher error - not critical, just log it
+          logger.dim(
+            `Config watcher stopped: ${error instanceof Error ? error.message : String(error)}`,
+          );
+        }
+      })();
+    } catch (error) {
+      // If we can't start the watcher, just log and continue
+      // The periodic check will still work
+      logger.dim('Could not start config file watcher, using periodic checks only');
+    }
+  }
+
+  /**
+   * Reload configuration and restart monitoring if needed
+   */
+  private async reloadConfig(): Promise<void> {
+    try {
+      const oldDeviceCount = this.config.upsDevices?.length || 0;
+
+      // Load the new configuration
+      await this.loadConfig();
+      const newDeviceCount = this.config.upsDevices?.length || 0;
+
+      if (newDeviceCount > 0 && oldDeviceCount === 0) {
+        logger.success(`Configuration reloaded! Found ${newDeviceCount} UPS device(s)`);
+        logger.info('Monitoring will start automatically...');
+      } else if (newDeviceCount !== oldDeviceCount) {
+        logger.success(
+          `Configuration reloaded! UPS devices: ${oldDeviceCount} → ${newDeviceCount}`,
+        );
+
+        // Reinitialize UPS status tracking
+        this.initializeUpsStatus();
+      } else {
+        logger.success('Configuration reloaded successfully');
+      }
+    } catch (error) {
+      logger.warn(
+        `Failed to reload config: ${error instanceof Error ? error.message : String(error)}`,
+      );
+    }
+  }
+
   /**
    * Sleep for the specified milliseconds
    */

ts/logger.ts

@@ -1,9 +1,38 @@
+import { theme, symbols } from './colors.ts';
+
+/**
+ * Table column alignment options
+ */
+export type TColumnAlign = 'left' | 'right' | 'center';
+
+/**
+ * Table column definition
+ */
+export interface ITableColumn {
+  /** Column header text */
+  header: string;
+  /** Column key in data object */
+  key: string;
+  /** Column alignment (default: left) */
+  align?: TColumnAlign;
+  /** Column width (auto-calculated if not specified) */
+  width?: number;
+  /** Color function to apply to cell values */
+  color?: (value: string) => string;
+}
+
+/**
+ * Box style types with colors
+ */
+export type TBoxStyle = 'default' | 'success' | 'error' | 'warning' | 'info';
+
 /**
  * A simple logger class that provides consistent formatting for log messages
  * including support for logboxes with title, lines, and closing
  */
 export class Logger {
   private currentBoxWidth: number | null = null;
+  private currentBoxStyle: TBoxStyle = 'default';
   private static instance: Logger;
 
   /** Default width to use when no width is specified */
@@ -36,36 +65,83 @@ export class Logger {
   }
 
   /**
-   * Log an error message
+   * Log an error message (red with ✗ symbol)
    * @param message Error message to log
    */
   public error(message: string): void {
-    console.error(message);
+    console.error(`${symbols.error} ${theme.error(message)}`);
   }
 
   /**
-   * Log a warning message with a warning emoji
+   * Log a warning message (yellow with ⚠ symbol)
    * @param message Warning message to log
    */
   public warn(message: string): void {
-    console.warn(`⚠️ ${message}`);
+    console.warn(`${symbols.warning} ${theme.warning(message)}`);
   }
 
   /**
-   * Log a success message with a checkmark
+   * Log a success message (green with ✓ symbol)
    * @param message Success message to log
    */
   public success(message: string): void {
-    console.log(`✓ ${message}`);
+    console.log(`${symbols.success} ${theme.success(message)}`);
+  }
+
+  /**
+   * Log an info message (cyan with ℹ symbol)
+   * @param message Info message to log
+   */
+  public info(message: string): void {
+    console.log(`${symbols.info} ${theme.info(message)}`);
+  }
+
+  /**
+   * Log a dim/secondary message
+   * @param message Message to log in dim style
+   */
+  public dim(message: string): void {
+    console.log(theme.dim(message));
+  }
+
+  /**
+   * Log a highlighted/bold message
+   * @param message Message to highlight
+   */
+  public highlight(message: string): void {
+    console.log(theme.highlight(message));
+  }
+
+  /**
+   * Get color function for box based on style
+   */
+  private getBoxColor(style: TBoxStyle): (text: string) => string {
+    switch (style) {
+      case 'success':
+        return theme.borderSuccess;
+      case 'error':
+        return theme.borderError;
+      case 'warning':
+        return theme.borderWarning;
+      case 'info':
+        return theme.borderInfo;
+      case 'default':
+      default:
+        return theme.borderDefault;
+    }
   }
 
   /**
    * Log a logbox title and set the current box width
    * @param title Title of the logbox
    * @param width Width of the logbox (including borders), defaults to DEFAULT_WIDTH
+   * @param style Box style for coloring (default, success, error, warning, info)
    */
-  public logBoxTitle(title: string, width?: number): void {
+  public logBoxTitle(title: string, width?: number, style?: TBoxStyle): void {
     this.currentBoxWidth = width || this.DEFAULT_WIDTH;
+    this.currentBoxStyle = style || 'default';
+
+    const colorFn = this.getBoxColor(this.currentBoxStyle);
 
     // Create the title line with appropriate padding
     const paddedTitle = ` ${title} `;
@@ -74,7 +150,7 @@ export class Logger {
     // Title line: ┌─ Title ───┐
     const titleLine = `┌─${paddedTitle}${'─'.repeat(Math.max(0, remainingSpace))}┐`;
 
-    console.log(titleLine);
+    console.log(colorFn(titleLine));
   }
 
   /**
@@ -89,17 +165,21 @@ export class Logger {
     }
 
     const boxWidth = width || this.currentBoxWidth || this.DEFAULT_WIDTH;
+    const colorFn = this.getBoxColor(this.currentBoxStyle);
 
-    // Calculate the available space for content
+    // Calculate the available space for content (use visible length)
     const availableSpace = boxWidth - 2; // Account for left and right borders
+    const visibleLen = this.visibleLength(content);
 
-    if (content.length <= availableSpace - 1) {
+    if (visibleLen <= availableSpace - 1) {
       // If content fits with at least one space for the right border stripe
-      const padding = availableSpace - content.length - 1;
+      const padding = availableSpace - visibleLen - 1;
-      console.log(`│ ${content}${' '.repeat(padding)}│`);
+      const line = `│ ${content}${' '.repeat(padding)}│`;
+      console.log(colorFn(line));
     } else {
       // Content is too long, let it flow out of boundaries.
-      console.log(`│ ${content}`);
+      const line = `│ ${content}`;
+      console.log(colorFn(line));
     }
   }
 
@@ -109,12 +189,15 @@ export class Logger {
    */
   public logBoxEnd(width?: number): void {
     const boxWidth = width || this.currentBoxWidth || this.DEFAULT_WIDTH;
+    const colorFn = this.getBoxColor(this.currentBoxStyle);
 
     // Create the bottom border: └────────┘
-    console.log(`└${'─'.repeat(boxWidth - 2)}┘`);
+    const bottomLine = `└${'─'.repeat(boxWidth - 2)}┘`;
+    console.log(colorFn(bottomLine));
 
-    // Reset the current box width
+    // Reset the current box width and style
     this.currentBoxWidth = null;
+    this.currentBoxStyle = 'default';
   }
 
   /**
@@ -122,9 +205,10 @@ export class Logger {
    * @param title Title of the logbox
    * @param lines Array of content lines
    * @param width Width of the logbox, defaults to DEFAULT_WIDTH
+   * @param style Box style for coloring
    */
-  public logBox(title: string, lines: string[], width?: number): void {
+  public logBox(title: string, lines: string[], width?: number, style?: TBoxStyle): void {
-    this.logBoxTitle(title, width || this.DEFAULT_WIDTH);
+    this.logBoxTitle(title, width || this.DEFAULT_WIDTH, style);
 
     for (const line of lines) {
       this.logBoxLine(line);
@@ -141,6 +225,108 @@ export class Logger {
   public logDivider(width?: number, character: string = '─'): void {
     console.log(character.repeat(width || this.DEFAULT_WIDTH));
   }
+
+  /**
+   * Strip ANSI color codes from string for accurate length calculation
+   */
+  private stripAnsi(text: string): string {
+    // Remove ANSI escape codes
+    return text.replace(/\x1b\[[0-9;]*m/g, '');
+  }
+
+  /**
+   * Get visible length of string (excluding ANSI codes)
+   */
+  private visibleLength(text: string): number {
+    return this.stripAnsi(text).length;
+  }
+
+  /**
+   * Align text within a column (handles ANSI color codes correctly)
+   */
+  private alignText(text: string, width: number, align: TColumnAlign = 'left'): string {
+    const visibleLen = this.visibleLength(text);
+
+    if (visibleLen >= width) {
+      // Text is too long, truncate the visible part
+      const stripped = this.stripAnsi(text);
+      return stripped.substring(0, width);
+    }
+
+    const padding = width - visibleLen;
+
+    switch (align) {
+      case 'right':
+        return ' '.repeat(padding) + text;
+      case 'center': {
+        const leftPad = Math.floor(padding / 2);
+        const rightPad = padding - leftPad;
+        return ' '.repeat(leftPad) + text + ' '.repeat(rightPad);
+      }
+      case 'left':
+      default:
+        return text + ' '.repeat(padding);
+    }
+  }
+
+  /**
+   * Log a formatted table
+   * @param columns Column definitions
+   * @param rows Array of data objects
+   * @param title Optional table title
+   */
+  public logTable(columns: ITableColumn[], rows: Record<string, string>[], title?: string): void {
+    if (rows.length === 0) {
+      this.dim('No data to display');
+      return;
+    }
+
+    // Calculate column widths
+    const columnWidths = columns.map((col) => {
+      if (col.width) return col.width;
+
+      // Auto-calculate width based on header and data (use visible length)
+      let maxWidth = this.visibleLength(col.header);
+      for (const row of rows) {
+        const value = String(row[col.key] || '');
+        maxWidth = Math.max(maxWidth, this.visibleLength(value));
+      }
+      return maxWidth;
+    });
+
+    // Calculate total table width
+    const totalWidth = columnWidths.reduce((sum, w) => sum + w, 0) + (columns.length * 3) + 1;
+
+    // Print title if provided
+    if (title) {
+      this.logBoxTitle(title, totalWidth);
+    } else {
+      // Print top border
+      console.log('┌' + columnWidths.map((w) => '─'.repeat(w + 2)).join('┬') + '┐');
+    }
+
+    // Print header row
+    const headerCells = columns.map((col, i) =>
+      theme.highlight(this.alignText(col.header, columnWidths[i], col.align))
+    );
+    console.log('│ ' + headerCells.join(' │ ') + ' │');
+
+    // Print separator
+    console.log('├' + columnWidths.map((w) => '─'.repeat(w + 2)).join('┼') + '┤');
+
+    // Print data rows
+    for (const row of rows) {
+      const cells = columns.map((col, i) => {
+        const value = String(row[col.key] || '');
+        const aligned = this.alignText(value, columnWidths[i], col.align);
+        return col.color ? col.color(aligned) : aligned;
+      });
+      console.log('│ ' + cells.join(' │ ') + ' │');
+    }
+
+    // Print bottom border
+    console.log('└' + columnWidths.map((w) => '─'.repeat(w + 2)).join('┴') + '┘');
+  }
 }
 
 // Export a singleton instance for easy use

ts/migrations/base-migration.ts

@@ -0,0 +1,54 @@
+/**
+ * Abstract base class for configuration migrations
+ *
+ * Each migration represents an upgrade from one config version to another.
+ * Migrations run in order based on the `order` field, allowing users to jump
+ * multiple versions (e.g., v1 → v4 runs migrations 2, 3, and 4).
+ */
+export abstract class BaseMigration {
+  /**
+   * Migration order number
+   * - Order 2: v1 → v2
+   * - Order 3: v2 → v3
+   * - Order 4: v3 → v4
+   * etc.
+   */
+  abstract readonly order: number;
+
+  /**
+   * Source version this migration upgrades from
+   * e.g., "1.x", "3.x"
+   */
+  abstract readonly fromVersion: string;
+
+  /**
+   * Target version this migration upgrades to
+   * e.g., "2.0", "4.0"
+   */
+  abstract readonly toVersion: string;
+
+  /**
+   * Check if this migration should run on the given config
+   *
+   * @param config - Raw configuration object to check
+   * @returns True if migration should run, false otherwise
+   */
+  abstract shouldRun(config: any): Promise<boolean>;
+
+  /**
+   * Perform the migration on the given config
+   *
+   * @param config - Raw configuration object to migrate
+   * @returns Migrated configuration object
+   */
+  abstract migrate(config: any): Promise<any>;
+
+  /**
+   * Get human-readable name for this migration
+   *
+   * @returns Migration name
+   */
+  getName(): string {
+    return `Migration ${this.fromVersion} → ${this.toVersion}`;
+  }
+}

ts/migrations/index.ts

@@ -0,0 +1,10 @@
+/**
+ * Configuration migrations module
+ *
+ * Exports the migration system for upgrading configs between versions.
+ */
+
+export { BaseMigration } from './base-migration.ts';
+export { MigrationRunner } from './migration-runner.ts';
+export { MigrationV1ToV2 } from './migration-v1-to-v2.ts';
+export { MigrationV3ToV4 } from './migration-v3-to-v4.ts';

ts/migrations/migration-runner.ts

@@ -0,0 +1,69 @@
+import { BaseMigration } from './base-migration.ts';
+import { MigrationV1ToV2 } from './migration-v1-to-v2.ts';
+import { MigrationV3ToV4 } from './migration-v3-to-v4.ts';
+import { logger } from '../logger.ts';
+
+/**
+ * Migration runner
+ *
+ * Discovers all available migrations, sorts them by order,
+ * and runs applicable migrations in sequence.
+ */
+export class MigrationRunner {
+  private migrations: BaseMigration[];
+
+  constructor() {
+    // Register all migrations here
+    this.migrations = [
+      new MigrationV1ToV2(),
+      new MigrationV3ToV4(),
+      // Add future migrations here (v4→v5, v5→v6, etc.)
+    ];
+
+    // Sort by order to ensure they run in sequence
+    this.migrations.sort((a, b) => a.order - b.order);
+  }
+
+  /**
+   * Run all applicable migrations on the config
+   *
+   * @param config - Raw configuration object to migrate
+   * @returns Migrated configuration and whether migrations ran
+   */
+  async run(config: any): Promise<{ config: any; migrated: boolean }> {
+    let currentConfig = config;
+    let anyMigrationsRan = false;
+
+    logger.dim('Checking for required config migrations...');
+
+    for (const migration of this.migrations) {
+      const shouldRun = await migration.shouldRun(currentConfig);
+
+      if (shouldRun) {
+        logger.info(`Running ${migration.getName()}...`);
+        currentConfig = await migration.migrate(currentConfig);
+        anyMigrationsRan = true;
+      }
+    }
+
+    if (anyMigrationsRan) {
+      logger.success('Configuration migrations complete');
+    } else {
+      logger.dim('No migrations needed');
+    }
+
+    return {
+      config: currentConfig,
+      migrated: anyMigrationsRan,
+    };
+  }
+
+  /**
+   * Get all registered migrations
+   *
+   * @returns Array of all migrations sorted by order
+   */
+  getMigrations(): BaseMigration[] {
+    return [...this.migrations];
+  }
+}

ts/migrations/migration-v1-to-v2.ts

@@ -0,0 +1,56 @@
+import { BaseMigration } from './base-migration.ts';
+import { logger } from '../logger.ts';
+
+/**
+ * Migration from v1 (single SNMP config) to v2 (upsDevices array)
+ *
+ * Detects old format:
+ * {
+ *   snmp: { ... },
+ *   thresholds: { ... },
+ *   checkInterval: 30000
+ * }
+ *
+ * Converts to:
+ * {
+ *   version: "2.0",
+ *   upsDevices: [{ id: "default", name: "Default UPS", snmp: ..., thresholds: ... }],
+ *   groups: [],
+ *   checkInterval: 30000
+ * }
+ */
+export class MigrationV1ToV2 extends BaseMigration {
+  readonly order = 2;
+  readonly fromVersion = '1.x';
+  readonly toVersion = '2.0';
+
+  async shouldRun(config: any): Promise<boolean> {
+    // V1 format has snmp field directly at root, no upsDevices or upsList
+    return !!config.snmp && !config.upsDevices && !config.upsList;
+  }
+
+  async migrate(config: any): Promise<any> {
+    logger.info(`${this.getName()}: Converting single SNMP config to multi-UPS format...`);
+
+    const migrated = {
+      version: this.toVersion,
+      upsDevices: [
+        {
+          id: 'default',
+          name: 'Default UPS',
+          snmp: config.snmp,
+          thresholds: config.thresholds || {
+            battery: 60,
+            runtime: 20,
+          },
+          groups: [],
+        },
+      ],
+      groups: [],
+      checkInterval: config.checkInterval || 30000,
+    };
+
+    logger.success(`${this.getName()}: Migration complete`);
+    return migrated;
+  }
+}

ts/migrations/migration-v3-to-v4.ts

@@ -0,0 +1,119 @@
+import { BaseMigration } from './base-migration.ts';
+import { logger } from '../logger.ts';
+
+/**
+ * Migration from v3 (upsList) to v4 (upsDevices)
+ *
+ * Transforms v3 format with flat SNMP config:
+ * {
+ *   upsList: [
+ *     {
+ *       id: "ups-1",
+ *       name: "UPS 1",
+ *       host: "192.168.1.1",
+ *       port: 161,
+ *       community: "public",
+ *       version: "1"  // string
+ *     }
+ *   ]
+ * }
+ *
+ * To v4 format with nested SNMP config:
+ * {
+ *   version: "4.0",
+ *   upsDevices: [
+ *     {
+ *       id: "ups-1",
+ *       name: "UPS 1",
+ *       snmp: {
+ *         host: "192.168.1.1",
+ *         port: 161,
+ *         community: "public",
+ *         version: 1,  // number
+ *         timeout: 5000
+ *       },
+ *       thresholds: { battery: 60, runtime: 20 },
+ *       groups: []
+ *     }
+ *   ]
+ * }
+ */
+export class MigrationV3ToV4 extends BaseMigration {
+  readonly order = 4;
+  readonly fromVersion = '3.x';
+  readonly toVersion = '4.0';
+
+  async shouldRun(config: any): Promise<boolean> {
+    // V3 format has upsList OR has upsDevices with flat structure (host at top level)
+    if (config.upsList && !config.upsDevices) {
+      return true; // Classic v3 with upsList
+    }
+
+    // Check if upsDevices exists but has flat structure (v3 format)
+    if (config.upsDevices && config.upsDevices.length > 0) {
+      const firstDevice = config.upsDevices[0];
+      // V3 has host at top level, v4 has it nested in snmp object
+      return !!firstDevice.host && !firstDevice.snmp;
+    }
+
+    return false;
+  }
+
+  async migrate(config: any): Promise<any> {
+    logger.info(`${this.getName()}: Migrating v3 config to v4 format...`);
+    logger.dim(`  - Restructuring UPS devices (flat → nested snmp config)`);
+
+    // Get devices from either upsList or upsDevices (for partially migrated configs)
+    const sourceDevices = config.upsList || config.upsDevices;
+
+    // Transform each UPS device from v3 flat structure to v4 nested structure
+    const transformedDevices = sourceDevices.map((device: any) => {
+      // Build SNMP config object
+      const snmpConfig: any = {
+        host: device.host,
+        port: device.port || 161,
+        version: typeof device.version === 'string' ? parseInt(device.version, 10) : device.version,
+        timeout: device.timeout || 5000,
+      };
+
+      // Add SNMPv1/v2c fields
+      if (device.community) {
+        snmpConfig.community = device.community;
+      }
+
+      // Add SNMPv3 fields
+      if (device.securityLevel) snmpConfig.securityLevel = device.securityLevel;
+      if (device.username) snmpConfig.username = device.username;
+      if (device.authProtocol) snmpConfig.authProtocol = device.authProtocol;
+      if (device.authKey) snmpConfig.authKey = device.authKey;
+      if (device.privProtocol) snmpConfig.privProtocol = device.privProtocol;
+      if (device.privKey) snmpConfig.privKey = device.privKey;
+
+      // Add UPS model if present
+      if (device.upsModel) snmpConfig.upsModel = device.upsModel;
+      if (device.customOIDs) snmpConfig.customOIDs = device.customOIDs;
+
+      // Return v4 format with nested structure
+      return {
+        id: device.id,
+        name: device.name,
+        snmp: snmpConfig,
+        thresholds: device.thresholds || {
+          battery: 60,
+          runtime: 20,
+        },
+        groups: device.groups || [],
+      };
+    });
+
+    const migrated = {
+      version: this.toVersion,
+      upsDevices: transformedDevices,
+      groups: config.groups || [],
+      checkInterval: config.checkInterval || 30000,
+    };
+
+    logger.success(`${this.getName()}: Migration complete (${transformedDevices.length} devices transformed)`);
+    return migrated;
+  }
+}

ts/systemd.ts

@@ -3,6 +3,7 @@ import { promises as fs } from 'node:fs';
 import { execSync } from 'node:child_process';
 import { NupstDaemon } from './daemon.ts';
 import { logger } from './logger.ts';
+import { theme, symbols, getBatteryColor, getRuntimeColor, formatPowerStatus } from './colors.ts';
 
 /**
  * Class for managing systemd service
@@ -15,17 +16,17 @@ export class NupstSystemd {
 
   /** Template for the systemd service file */
   private readonly serviceTemplate = `[Unit]
-Description=Node.js UPS Shutdown Tool for Multiple UPS Devices
+Description=NUPST - Deno-powered UPS Monitoring Tool
 After=network.target
 
 [Service]
-ExecStart=/opt/nupst/bin/nupst daemon-start
+ExecStart=/usr/local/bin/nupst service start-daemon
 Restart=always
+RestartSec=10
 User=root
 Group=root
 Environment=PATH=/usr/bin:/usr/local/bin
-Environment=NODE_ENV=production
+WorkingDirectory=/opt/nupst
-WorkingDirectory=/tmp
 
 [Install]
 WantedBy=multi-user.target
@@ -49,11 +50,11 @@ WantedBy=multi-user.target
     try {
       await fs.access(configPath);
     } catch (error) {
-      const boxWidth = 50;
+      console.log('');
-      logger.logBoxTitle('Configuration Error', boxWidth);
+      console.log(`${symbols.error} ${theme.error('No configuration found')}`);
-      logger.logBoxLine(`No configuration file found at ${configPath}`);
+      console.log(`  ${theme.dim('Config file:')} ${configPath}`);
-      logger.logBoxLine("Please run 'nupst add' first to create a UPS configuration.");
+      console.log(`  ${theme.dim('Run')} ${theme.command('nupst ups add')} ${theme.dim('to create a configuration')}`);
-      logger.logBoxEnd();
+      console.log('');
       throw new Error('Configuration not found');
     }
   }
@@ -137,16 +138,12 @@ WantedBy=multi-user.target
     try {
       // Enable debug mode if requested
       if (debugMode) {
-        const boxWidth = 45;
+        console.log('');
-        logger.logBoxTitle('Debug Mode', boxWidth);
+        logger.info('Debug Mode: SNMP debugging enabled');
-        logger.logBoxLine('SNMP debugging enabled - detailed logs will be shown');
+        console.log('');
-        logger.logBoxEnd();
         this.daemon.getNupstSnmp().enableDebug();
       }
 
-      // Display version information
-      this.daemon.getNupstSnmp().getNupst().logVersionInfo();
-
       // Check if config exists first
       try {
         await this.checkConfigExists();
@@ -171,18 +168,50 @@ WantedBy=multi-user.target
   private displayServiceStatus(): void {
     try {
       const serviceStatus = execSync('systemctl status nupst.service').toString();
-      const boxWidth = 45;
+      const lines = serviceStatus.split('\n');
-      logger.logBoxTitle('Service Status', boxWidth);
+
-      // Process each line of the status output
+      // Parse key information from systemctl output
-      serviceStatus.split('\n').forEach((line) => {
+      let isActive = false;
-        logger.logBoxLine(line);
+      let pid = '';
-      });
+      let memory = '';
-      logger.logBoxEnd();
+      let cpu = '';
+
+      for (const line of lines) {
+        if (line.includes('Active:')) {
+          isActive = line.includes('active (running)');
+        } else if (line.includes('Main PID:')) {
+          const match = line.match(/Main PID:\s+(\d+)/);
+          if (match) pid = match[1];
+        } else if (line.includes('Memory:')) {
+          const match = line.match(/Memory:\s+([\d.]+[A-Z])/);
+          if (match) memory = match[1];
+        } else if (line.includes('CPU:')) {
+          const match = line.match(/CPU:\s+([\d.]+(?:ms|s))/);
+          if (match) cpu = match[1];
+        }
+      }
+
+      // Display beautiful status
+      console.log('');
+      if (isActive) {
+        console.log(`${symbols.running} ${theme.success('Service:')} ${theme.statusActive('active (running)')}`);
+      } else {
+        console.log(`${symbols.stopped} ${theme.dim('Service:')} ${theme.statusInactive('inactive')}`);
+      }
+
+      if (pid || memory || cpu) {
+        const details = [];
+        if (pid) details.push(`PID: ${theme.dim(pid)}`);
+        if (memory) details.push(`Memory: ${theme.dim(memory)}`);
+        if (cpu) details.push(`CPU: ${theme.dim(cpu)}`);
+        console.log(`  ${details.join('  ')}`);
+      }
+      console.log('');
+
     } catch (error) {
-      const boxWidth = 45;
+      console.log('');
-      logger.logBoxTitle('Service Status', boxWidth);
+      console.log(`${symbols.stopped} ${theme.dim('Service:')} ${theme.statusInactive('not installed')}`);
-      logger.logBoxLine('Service is not running');
+      console.log('');
-      logger.logBoxEnd();
     }
   }
 
@@ -199,7 +228,7 @@ WantedBy=multi-user.target
 
       // Check if we have the new multi-UPS config format
       if (config.upsDevices && Array.isArray(config.upsDevices) && config.upsDevices.length > 0) {
-        logger.log(`Found ${config.upsDevices.length} UPS device(s) in configuration`);
+        console.log(theme.info(`UPS Devices (${config.upsDevices.length}):`));
 
         // Show status for each UPS
         for (const ups of config.upsDevices) {
@@ -207,6 +236,7 @@ WantedBy=multi-user.target
         }
       } else if (config.snmp) {
         // Legacy single UPS configuration
+        console.log(theme.info('UPS Devices (1):'));
         const legacyUps = {
           id: 'default',
           name: 'Default UPS',
@@ -217,15 +247,16 @@ WantedBy=multi-user.target
 
         await this.displaySingleUpsStatus(legacyUps, snmp);
       } else {
-        logger.error('No UPS devices found in configuration');
+        console.log('');
+        console.log(`${symbols.warning} ${theme.warning('No UPS devices configured')}`);
+        console.log(`  ${theme.dim('Run')} ${theme.command('nupst ups add')} ${theme.dim('to add a device')}`);
+        console.log('');
       }
     } catch (error) {
-      const boxWidth = 45;
+      console.log('');
-      logger.logBoxTitle('UPS Status', boxWidth);
+      console.log(`${symbols.error} ${theme.error('Failed to retrieve UPS status')}`);
-      logger.logBoxLine(
+      console.log(`  ${theme.dim(error instanceof Error ? error.message : String(error))}`);
-        `Failed to retrieve UPS status: ${error instanceof Error ? error.message : String(error)}`,
+      console.log('');
-      );
-      logger.logBoxEnd();
     }
   }
 
@@ -235,24 +266,6 @@ WantedBy=multi-user.target
    * @param snmp SNMP manager
    */
   private async displaySingleUpsStatus(ups: any, snmp: any): Promise<void> {
-    const boxWidth = 45;
-    logger.logBoxTitle(`Connecting to UPS: ${ups.name}`, boxWidth);
-    logger.logBoxLine(`ID: ${ups.id}`);
-    logger.logBoxLine(`Host: ${ups.snmp.host}:${ups.snmp.port}`);
-    logger.logBoxLine(`UPS Model: ${ups.snmp.upsModel || 'cyberpower'}`);
-
-    if (ups.groups && ups.groups.length > 0) {
-      // Get group names if available
-      const config = this.daemon.getConfig();
-      const groupNames = ups.groups.map((groupId: string) => {
-        const group = config.groups?.find((g: { id: string }) => g.id === groupId);
-        return group ? group.name : groupId;
-      });
-      logger.logBoxLine(`Groups: ${groupNames.join(', ')}`);
-    }
-
-    logger.logBoxEnd();
-
     try {
       // Create a test config with a short timeout
       const testConfig = {
@@ -262,32 +275,43 @@ WantedBy=multi-user.target
 
       const status = await snmp.getUpsStatus(testConfig);
 
-      logger.logBoxTitle(`UPS Status: ${ups.name}`, boxWidth);
+      // Determine status symbol based on power status
-      logger.logBoxLine(`Power Status: ${status.powerStatus}`);
+      let statusSymbol = symbols.unknown;
-      logger.logBoxLine(`Battery Capacity: ${status.batteryCapacity}%`);
+      if (status.powerStatus === 'online') {
-      logger.logBoxLine(`Runtime Remaining: ${status.batteryRuntime} minutes`);
+        statusSymbol = symbols.running;
+      } else if (status.powerStatus === 'onBattery') {
+        statusSymbol = symbols.warning;
+      }
 
-      // Show threshold status
+      // Display UPS name and power status
-      logger.logBoxLine('');
+      console.log(`  ${statusSymbol} ${theme.highlight(ups.name)} - ${formatPowerStatus(status.powerStatus)}`);
-      logger.logBoxLine('Thresholds:');
+
-      logger.logBoxLine(
+      // Display battery with color coding
-        `  Battery: ${status.batteryCapacity}% / ${ups.thresholds.battery}% ${
+      const batteryColor = getBatteryColor(status.batteryCapacity);
-          status.batteryCapacity < ups.thresholds.battery ? '⚠️' : '✓'
+      const batterySymbol = status.batteryCapacity >= ups.thresholds.battery ? symbols.success : symbols.warning;
-        }`,
+      console.log(`    Battery: ${batteryColor(status.batteryCapacity + '%')} ${batterySymbol}  Runtime: ${getRuntimeColor(status.batteryRuntime)(status.batteryRuntime + ' min')}`);
-      );
+
-      logger.logBoxLine(
+      // Display host info
-        `  Runtime: ${status.batteryRuntime} min / ${ups.thresholds.runtime} min ${
+      console.log(`    ${theme.dim(`Host: ${ups.snmp.host}:${ups.snmp.port}`)}`);
-          status.batteryRuntime < ups.thresholds.runtime ? '⚠️' : '✓'
+
-        }`,
+      // Display groups if any
-      );
+      if (ups.groups && ups.groups.length > 0) {
+        const config = this.daemon.getConfig();
+        const groupNames = ups.groups.map((groupId: string) => {
+          const group = config.groups?.find((g: { id: string }) => g.id === groupId);
+          return group ? group.name : groupId;
+        });
+        console.log(`    ${theme.dim(`Groups: ${groupNames.join(', ')}`)}`);
+      }
+
+      console.log('');
 
-      logger.logBoxEnd();
     } catch (error) {
-      logger.logBoxTitle(`UPS Status: ${ups.name}`, boxWidth);
+      // Display error for this UPS
-      logger.logBoxLine(
+      console.log(`  ${symbols.error} ${theme.highlight(ups.name)} - ${theme.error('Connection failed')}`);
-        `Failed to retrieve UPS status: ${error instanceof Error ? error.message : String(error)}`,
+      console.log(`    ${theme.dim(error instanceof Error ? error.message : String(error))}`);
-      );
+      console.log(`    ${theme.dim(`Host: ${ups.snmp.host}:${ups.snmp.port}`)}`);
-      logger.logBoxEnd();
+      console.log('');
     }
   }