fix(update): rewrite nupst update for v4 (download install script instead of git pull)

The update command was still using v3 logic (git pull, setup.sh) which
doesn't work for v4 binary distribution.

Now it simply:
1. Downloads install.sh from main branch
2. Runs it (handles download, stop, replace, restart automatically)

This is much simpler and matches how v4 is distributed. No more git,
no more setup.sh, just download the latest binary.

deno.json

@@ -1,6 +1,6 @@
 {
   "name": "@serve.zone/nupst",
-  "version": "4.0.1",
+  "version": "4.0.7",
   "exports": "./mod.ts",
   "tasks": {
     "dev": "deno run --allow-all mod.ts",

install.sh

@@ -10,15 +10,7 @@
 #   With version specification:
 #     curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- --version v4.0.0
 #
-#   Non-interactive mode (auto-confirm):
-#     curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y
-#
-#   Downloaded script:
-#     curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh -o nupst-install.sh
-#     sudo bash nupst-install.sh
-#
 # Options:
-#   -y, --yes              Automatically answer yes to all prompts
 #   -h, --help             Show this help message
 #   --version VERSION      Install specific version (e.g., v4.0.0)
 #   --install-dir DIR      Installation directory (default: /opt/nupst)
@@ -26,7 +18,6 @@
 set -e
 
 # Default values
-AUTO_YES=0
 SHOW_HELP=0
 SPECIFIED_VERSION=""
 INSTALL_DIR="/opt/nupst"
@@ -36,10 +27,6 @@ GITEA_REPO="serve.zone/nupst"
 # Parse command line arguments
 while [[ $# -gt 0 ]]; do
   case $1 in
-    -y|--yes)
-      AUTO_YES=1
-      shift
-      ;;
     -h|--help)
       SHOW_HELP=1
       shift
@@ -67,7 +54,6 @@ if [ $SHOW_HELP -eq 1 ]; then
   echo "Usage: $0 [options]"
   echo ""
   echo "Options:"
-  echo "  -y, --yes              Automatically answer yes to all prompts"
   echo "  -h, --help             Show this help message"
   echo "  --version VERSION      Install specific version (e.g., v4.0.0)"
   echo "  --install-dir DIR      Installation directory (default: /opt/nupst)"
@@ -78,9 +64,6 @@ if [ $SHOW_HELP -eq 1 ]; then
   echo ""
   echo "  # Install specific version"
   echo "  curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- --version v4.0.0"
-  echo ""
-  echo "  # Non-interactive installation"
-  echo "  curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y"
   exit 0
 fi
 
@@ -90,32 +73,6 @@ if [ "$EUID" -ne 0 ]; then
   exit 1
 fi
 
-# Detect if script is being piped or run directly
-INTERACTIVE=1
-if [ ! -t 0 ] || [ ! -t 1 ]; then
-  # Either stdin or stdout is not a terminal
-  if [ $AUTO_YES -ne 1 ]; then
-    echo "Script detected it's running in a non-interactive environment without -y flag."
-    echo "Attempting to find a controlling terminal for interactive prompts..."
-    # Try to use a controlling terminal for user input
-    exec < /dev/tty 2>/dev/null || INTERACTIVE=0
-
-    if [ $INTERACTIVE -eq 0 ]; then
-      echo "ERROR: No controlling terminal available for interactive prompts."
-      echo ""
-      echo "For interactive installation (RECOMMENDED):"
-      echo "  curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh -o nupst-install.sh"
-      echo "  sudo bash nupst-install.sh"
-      echo ""
-      echo "For non-interactive installation with auto-confirm:"
-      echo "  curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y"
-      exit 1
-    else
-      echo "Interactive terminal found, continuing with prompts..."
-    fi
-  fi
-fi
-
 # Helper function to detect OS and architecture
 detect_platform() {
   local os=$(uname -s)
@@ -225,22 +182,6 @@ if [ -d "$INSTALL_DIR" ]; then
     echo ""
   fi
 
-  if [ $AUTO_YES -eq 0 ] && [ $INTERACTIVE -eq 1 ]; then
-    if [ $OLD_NODE_INSTALL -eq 1 ]; then
-      echo "This will replace your Node.js installation with a pre-compiled binary."
-      echo "Your configuration in /etc/nupst/config.json will be preserved."
-      echo ""
-    fi
-    echo "Installation directory already exists: $INSTALL_DIR"
-    echo "Do you want to update/reinstall? (Y/n): "
-    read -r update_confirm
-
-    if [[ "$update_confirm" =~ ^[Nn]$ ]]; then
-      echo "Installation cancelled."
-      exit 0
-    fi
-  fi
-
   echo "Updating existing installation at $INSTALL_DIR..."
 
   # Check if service exists (enabled or running) and stop it if active
@@ -269,17 +210,6 @@ if [ -d "$INSTALL_DIR" ]; then
     echo "Old installation files removed."
   fi
 else
-  if [ $AUTO_YES -eq 0 ] && [ $INTERACTIVE -eq 1 ]; then
-    echo "NUPST will be installed to: $INSTALL_DIR"
-    echo "Continue? (Y/n): "
-    read -r install_confirm
-
-    if [[ "$install_confirm" =~ ^[Nn]$ ]]; then
-      echo "Installation cancelled."
-      exit 0
-    fi
-  fi
-
   echo "Creating installation directory: $INSTALL_DIR"
   mkdir -p "$INSTALL_DIR"
 fi
@@ -325,22 +255,8 @@ else
 fi
 
 # Create symlink for global access
-if [ $AUTO_YES -eq 0 ] && [ $INTERACTIVE -eq 1 ]; then
+ln -sf "$BINARY_PATH" "$BIN_DIR/nupst"
-  echo "Create symlink in $BIN_DIR for global access? (Y/n): "
+echo "Symlink created: $BIN_DIR/nupst -> $BINARY_PATH"
-  read -r symlink_confirm
-
-  if [[ ! "$symlink_confirm" =~ ^[Nn]$ ]]; then
-    ln -sf "$BINARY_PATH" "$BIN_DIR/nupst"
-    echo "Symlink created: $BIN_DIR/nupst -> $BINARY_PATH"
-  else
-    echo "Symlink creation skipped."
-    echo "To use NUPST, run: $BINARY_PATH"
-    echo "Or manually create symlink: sudo ln -sf $BINARY_PATH $BIN_DIR/nupst"
-  fi
-else
-  ln -sf "$BINARY_PATH" "$BIN_DIR/nupst"
-  echo "Symlink created: $BIN_DIR/nupst -> $BINARY_PATH"
-fi
 
 echo ""
 

readme.md

@@ -29,15 +29,8 @@ dependencies.
 The easiest way to install NUPST is using the automated installer:
 
 ```bash
-# Download and run installer (most reliable)
+# One-line installation
-curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh -o nupst-install.sh
+curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash
-sudo bash nupst-install.sh
-rm nupst-install.sh
-```
-
-```bash
-# One-line installation (non-interactive with auto-confirm)
-curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y
 ```
 
 The installer will:
@@ -76,7 +69,6 @@ sudo mv nupst /usr/local/bin/nupst
 The installer script (`install.sh`) supports the following options:
 
 ```
--y, --yes                Automatically answer yes to all prompts
 -h, --help               Show help message
 --version VERSION        Install specific version (e.g., --version v4.0.0)
 --install-dir DIR        Custom installation directory (default: /opt/nupst)
@@ -373,7 +365,7 @@ sudo nupst service disable
 Re-run the installer to update to the latest version:
 
 ```bash
-curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y
+curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash
 ```
 
 The installer will:
@@ -461,7 +453,7 @@ The installer script automatically handles the entire migration while preserving
 
 ```bash
 # Run the installer (handles stop/update/restart automatically)
-curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y
+curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash
 
 # Verify
 nupst service status

test/manualdocker/00-test-fresh-v4-install.sh

@@ -0,0 +1,168 @@
+#!/bin/bash
+#
+# Test fresh v4 installation from scratch
+# Tests the most common user scenario: clean install using curl | bash
+#
+
+set -e
+
+CONTAINER_NAME="nupst-test-fresh-v4"
+
+echo "================================================"
+echo "  NUPST Fresh v4 Installation Test"
+echo "================================================"
+echo ""
+
+# Check if container already exists
+if docker ps -a --format '{{.Names}}' | grep -q "^${CONTAINER_NAME}$"; then
+  echo "⚠️  Container ${CONTAINER_NAME} already exists"
+  read -p "Remove and recreate? (y/N): " -n 1 -r
+  echo
+  if [[ $REPLY =~ ^[Yy]$ ]]; then
+    echo "→ Stopping and removing existing container..."
+    docker stop ${CONTAINER_NAME} 2>/dev/null || true
+    docker rm ${CONTAINER_NAME} 2>/dev/null || true
+  else
+    echo "Exiting. Remove manually with: docker rm -f ${CONTAINER_NAME}"
+    exit 1
+  fi
+fi
+
+echo "→ Creating Docker container with systemd..."
+docker run -d \
+  --name ${CONTAINER_NAME} \
+  --privileged \
+  --cgroupns=host \
+  -v /sys/fs/cgroup:/sys/fs/cgroup:rw \
+  ubuntu:22.04 \
+  /bin/bash -c "apt-get update && apt-get install -y systemd systemd-sysv && exec /sbin/init"
+
+echo "→ Waiting for systemd to initialize..."
+sleep 10
+
+echo "→ Waiting for dpkg lock to be released..."
+docker exec ${CONTAINER_NAME} bash -c "
+  while fuser /var/lib/dpkg/lock-frontend >/dev/null 2>&1; do
+    echo '  Waiting for dpkg lock...'
+    sleep 2
+  done
+  echo '  dpkg lock released'
+"
+
+echo "→ Installing prerequisites (curl)..."
+docker exec ${CONTAINER_NAME} bash -c "
+  apt-get update -qq
+  apt-get install -y -qq curl
+"
+
+echo ""
+echo "→ Installing NUPST v4 using curl | bash..."
+echo "   Command: curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | bash -s -- -y"
+echo ""
+
+docker exec ${CONTAINER_NAME} bash -c "
+  curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | bash -s -- -y
+"
+
+echo ""
+echo "================================================"
+echo "  Verifying Installation"
+echo "================================================"
+echo ""
+
+echo "→ Checking binary location..."
+docker exec ${CONTAINER_NAME} bash -c "
+  if [ -f /opt/nupst/nupst ]; then
+    echo '  ✓ Binary exists at /opt/nupst/nupst'
+    ls -lh /opt/nupst/nupst
+  else
+    echo '  ✗ Binary not found at /opt/nupst/nupst'
+    exit 1
+  fi
+"
+
+echo ""
+echo "→ Checking symlink..."
+docker exec ${CONTAINER_NAME} bash -c "
+  if [ -L /usr/local/bin/nupst ]; then
+    echo '  ✓ Symlink exists at /usr/local/bin/nupst'
+    ls -lh /usr/local/bin/nupst
+  elif [ -L /usr/bin/nupst ]; then
+    echo '  ✓ Symlink exists at /usr/bin/nupst'
+    ls -lh /usr/bin/nupst
+  else
+    echo '  ✗ Symlink not found in /usr/local/bin or /usr/bin'
+    exit 1
+  fi
+"
+
+echo ""
+echo "→ Checking PATH integration..."
+docker exec ${CONTAINER_NAME} bash -c "
+  NUPST_PATH=\$(which nupst 2>/dev/null)
+  if [ -n \"\$NUPST_PATH\" ]; then
+    echo '  ✓ nupst found in PATH at: '\$NUPST_PATH
+  else
+    echo '  ✗ nupst not found in PATH'
+    echo '  PATH contents:'
+    echo \$PATH
+    exit 1
+  fi
+"
+
+echo ""
+echo "→ Testing nupst command execution..."
+docker exec ${CONTAINER_NAME} nupst --version
+
+echo ""
+echo "→ Creating minimal config for service test..."
+docker exec ${CONTAINER_NAME} bash -c "
+  mkdir -p /etc/nupst
+  cat > /etc/nupst/config.json << 'EOF'
+{
+  \"version\": \"4.0\",
+  \"upsDevices\": [],
+  \"groups\": [],
+  \"checkInterval\": 30000
+}
+EOF
+  echo '  ✓ Minimal config created'
+"
+
+echo ""
+echo "→ Testing service creation..."
+docker exec ${CONTAINER_NAME} bash -c "
+  echo '  Running: nupst service enable'
+  nupst service enable
+
+  if [ -f /etc/systemd/system/nupst.service ]; then
+    echo '  ✓ Service file created successfully'
+  else
+    echo '  ✗ Service file creation failed'
+    exit 1
+  fi
+"
+
+echo ""
+echo "→ Checking if service is enabled..."
+docker exec ${CONTAINER_NAME} systemctl is-enabled nupst
+
+echo ""
+echo "================================================"
+echo "  ✓ Fresh v4 Installation Test Complete"
+echo "================================================"
+echo ""
+echo "Installation verified successfully:"
+echo "  • Binary installed to /opt/nupst/nupst"
+echo "  • Symlink created for global access"
+echo "  • nupst command available in PATH"
+echo "  • Command executes correctly"
+echo "  • Systemd service file created"
+echo ""
+echo "Useful commands:"
+echo "  docker exec -it ${CONTAINER_NAME} bash"
+echo "  docker exec ${CONTAINER_NAME} nupst --help"
+echo "  docker exec ${CONTAINER_NAME} nupst service status"
+echo "  docker stop ${CONTAINER_NAME}"
+echo "  docker rm -f ${CONTAINER_NAME}"
+echo ""

test/manualdocker/01-setup-v3-container.sh

@@ -53,7 +53,7 @@ docker exec ${CONTAINER_NAME} bash -c "
 echo "→ Installing prerequisites in container..."
 docker exec ${CONTAINER_NAME} bash -c "
   apt-get update -qq
-  apt-get install -y -qq git curl sudo
+  apt-get install -y -qq git curl sudo jq
 "
 
 echo "→ Cloning NUPST v3 (commit ${V3_COMMIT})..."
@@ -66,35 +66,59 @@ docker exec ${CONTAINER_NAME} bash -c "
   git log -1 --oneline
 "
 
-echo "→ Running NUPST v3 installation script..."
+echo "→ Running NUPST v3 installation directly (bypassing install.sh auto-update)..."
 docker exec ${CONTAINER_NAME} bash -c "
   cd /opt/nupst
-  bash install.sh -y
+  # Run setup.sh directly to avoid install.sh trying to update to v4
+  bash setup.sh -y
 "
 
-echo "→ Creating dummy NUPST configuration for testing..."
+echo "→ Creating NUPST configuration using real UPS data from .nogit/env.json..."
-docker exec ${CONTAINER_NAME} bash -c "
+
-  mkdir -p /etc/nupst
+# Check if .nogit/env.json exists
-  cat > /etc/nupst/config.json << 'EOF'
+if [ ! -f "../../.nogit/env.json" ]; then
+  echo "❌ Error: .nogit/env.json not found"
+  echo "This file contains test UPS credentials and is required for testing"
+  exit 1
+fi
+
+# Read UPS data from .nogit/env.json and create v3 config
+docker exec ${CONTAINER_NAME} bash -c "mkdir -p /etc/nupst"
+
+# Generate config from .nogit/env.json using jq
+cat ../../.nogit/env.json | jq -r '
 {
-  \"upsList\": [
+  "upsList": [
     {
-      \"id\": \"test-ups\",
+      "id": "test-ups-v1",
-      \"name\": \"Test UPS\",
+      "name": "Test UPS (SNMP v1)",
-      \"host\": \"127.0.0.1\",
+      "host": .testConfigV1.snmp.host,
-      \"port\": 161,
+      "port": .testConfigV1.snmp.port,
-      \"community\": \"public\",
+      "community": .testConfigV1.snmp.community,
-      \"version\": \"2c\",
+      "version": (.testConfigV1.snmp.version | tostring),
-      \"batteryLowOID\": \"1.3.6.1.4.1.935.1.1.1.3.3.1.0\",
+      "batteryLowOID": "1.3.6.1.4.1.935.1.1.1.3.3.1.0",
-      \"onBatteryOID\": \"1.3.6.1.4.1.935.1.1.1.3.3.2.0\",
+      "onBatteryOID": "1.3.6.1.4.1.935.1.1.1.3.3.2.0",
-      \"shutdownCommand\": \"echo 'Shutdown triggered'\"
+      "shutdownCommand": "echo \"Shutdown triggered for test-ups-v1\""
+    },
+    {
+      "id": "test-ups-v3",
+      "name": "Test UPS (SNMP v3)",
+      "host": .testConfigV3.snmp.host,
+      "port": .testConfigV3.snmp.port,
+      "version": (.testConfigV3.snmp.version | tostring),
+      "securityLevel": .testConfigV3.snmp.securityLevel,
+      "username": .testConfigV3.snmp.username,
+      "authProtocol": .testConfigV3.snmp.authProtocol,
+      "authKey": .testConfigV3.snmp.authKey,
+      "batteryLowOID": "1.3.6.1.4.1.935.1.1.1.3.3.1.0",
+      "onBatteryOID": "1.3.6.1.4.1.935.1.1.1.3.3.2.0",
+      "shutdownCommand": "echo \"Shutdown triggered for test-ups-v3\""
     }
   ],
-  \"groups\": []
+  "groups": []
-}
+}' | docker exec -i ${CONTAINER_NAME} tee /etc/nupst/config.json > /dev/null
-EOF
+
-  echo 'Dummy config created at /etc/nupst/config.json'
+echo "  ✓ Real UPS config created at /etc/nupst/config.json (from .nogit/env.json)"
-"
 
 echo "→ Enabling NUPST systemd service..."
 docker exec ${CONTAINER_NAME} bash -c "

test/manualdocker/02-test-v3-to-v4-migration.sh

@@ -32,23 +32,10 @@ echo "→ Stopping v3 service..."
 docker exec ${CONTAINER_NAME} systemctl stop nupst
 echo ""
 
-echo "→ Pulling latest v4 code from migration/deno-v4 branch..."
+echo "→ Running v4 installation from main branch (should auto-detect v3 and migrate)..."
+echo "   Using: curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash"
 docker exec ${CONTAINER_NAME} bash -c "
-  cd /opt/nupst
+  curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | bash -s -- -y
-  git fetch origin
-  # Reset any local changes made by install.sh
-  git reset --hard HEAD
-  git clean -fd
-  git checkout migration/deno-v4
-  git pull origin migration/deno-v4
-  echo 'Now on:'
-  git log -1 --oneline
-"
-
-echo "→ Running install.sh (should auto-detect v3 and migrate)..."
-docker exec ${CONTAINER_NAME} bash -c "
-  cd /opt/nupst
-  bash install.sh -y
 "
 
 echo "→ Checking service status after migration..."

test/showcase.ts

@@ -0,0 +1,233 @@
+/**
+ * Showcase test for NUPST CLI outputs
+ * Demonstrates all the beautiful colored output features
+ *
+ * Run with: deno run --allow-all test/showcase.ts
+ */
+
+import { logger, type ITableColumn } from '../ts/logger.ts';
+import { theme, symbols, getBatteryColor, formatPowerStatus } from '../ts/colors.ts';
+
+console.log('');
+console.log('═'.repeat(80));
+logger.highlight('NUPST CLI OUTPUT SHOWCASE');
+logger.dim('Demonstrating beautiful, colored terminal output');
+console.log('═'.repeat(80));
+console.log('');
+
+// === 1. Basic Logging Methods ===
+logger.logBoxTitle('Basic Logging Methods', 60, 'info');
+logger.logBoxLine('');
+logger.log('Normal log message (default color)');
+logger.success('Success message with ✓ symbol');
+logger.error('Error message with ✗ symbol');
+logger.warn('Warning message with ⚠ symbol');
+logger.info('Info message with ℹ symbol');
+logger.dim('Dim/secondary text for less important info');
+logger.highlight('Highlighted/bold text for emphasis');
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 2. Colored Boxes ===
+logger.logBoxTitle('Colored Box Styles', 60);
+logger.logBoxLine('');
+logger.logBoxLine('Boxes can be styled with different colors:');
+logger.logBoxEnd();
+
+console.log('');
+
+logger.logBox('Success Box (Green)', [
+  'Used for successful operations',
+  'Installation complete, service started, etc.',
+], 60, 'success');
+
+console.log('');
+
+logger.logBox('Error Box (Red)', [
+  'Used for critical errors and failures',
+  'Configuration errors, connection failures, etc.',
+], 60, 'error');
+
+console.log('');
+
+logger.logBox('Warning Box (Yellow)', [
+  'Used for warnings and deprecations',
+  'Old command format, missing config, etc.',
+], 60, 'warning');
+
+console.log('');
+
+logger.logBox('Info Box (Cyan)', [
+  'Used for informational messages',
+  'Version info, update available, etc.',
+], 60, 'info');
+
+console.log('');
+
+// === 3. Status Symbols ===
+logger.logBoxTitle('Status Symbols', 60, 'info');
+logger.logBoxLine('');
+logger.logBoxLine(`${symbols.running}  Service Running`);
+logger.logBoxLine(`${symbols.stopped}  Service Stopped`);
+logger.logBoxLine(`${symbols.starting}  Service Starting`);
+logger.logBoxLine(`${symbols.unknown}  Status Unknown`);
+logger.logBoxLine('');
+logger.logBoxLine(`${symbols.success}  Operation Successful`);
+logger.logBoxLine(`${symbols.error}  Operation Failed`);
+logger.logBoxLine(`${symbols.warning}  Warning Condition`);
+logger.logBoxLine(`${symbols.info}  Information`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 4. Battery Level Colors ===
+logger.logBoxTitle('Battery Level Color Coding', 60, 'info');
+logger.logBoxLine('');
+logger.logBoxLine('Battery levels are color-coded:');
+logger.logBoxLine('');
+logger.logBoxLine(`  ${getBatteryColor(85)('85%')} - Good (green, ≥60%)`);
+logger.logBoxLine(`  ${getBatteryColor(45)('45%')} - Medium (yellow, 30-60%)`);
+logger.logBoxLine(`  ${getBatteryColor(15)('15%')} - Critical (red, <30%)`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 5. Power Status Formatting ===
+logger.logBoxTitle('Power Status Formatting', 60, 'info');
+logger.logBoxLine('');
+logger.logBoxLine(`Status: ${formatPowerStatus('online')}`);
+logger.logBoxLine(`Status: ${formatPowerStatus('onBattery')}`);
+logger.logBoxLine(`Status: ${formatPowerStatus('unknown')}`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 6. Table Formatting ===
+const upsColumns: ITableColumn[] = [
+  { header: 'ID', key: 'id' },
+  { header: 'Name', key: 'name' },
+  { header: 'Host', key: 'host' },
+  { header: 'Status', key: 'status', color: (v) => {
+    if (v.includes('Online')) return theme.success(v);
+    if (v.includes('Battery')) return theme.warning(v);
+    return theme.dim(v);
+  }},
+  { header: 'Battery', key: 'battery', align: 'right', color: (v) => {
+    const pct = parseInt(v);
+    return getBatteryColor(pct)(v);
+  }},
+  { header: 'Runtime', key: 'runtime', align: 'right' },
+];
+
+const upsData = [
+  {
+    id: 'ups-1',
+    name: 'Main UPS',
+    host: '192.168.1.10',
+    status: 'Online',
+    battery: '95%',
+    runtime: '45 min',
+  },
+  {
+    id: 'ups-2',
+    name: 'Backup UPS',
+    host: '192.168.1.11',
+    status: 'On Battery',
+    battery: '42%',
+    runtime: '12 min',
+  },
+  {
+    id: 'ups-3',
+    name: 'Critical UPS',
+    host: '192.168.1.12',
+    status: 'On Battery',
+    battery: '18%',
+    runtime: '5 min',
+  },
+];
+
+logger.logTable(upsColumns, upsData, 'UPS Devices');
+
+console.log('');
+
+// === 7. Group Table ===
+const groupColumns: ITableColumn[] = [
+  { header: 'ID', key: 'id' },
+  { header: 'Name', key: 'name' },
+  { header: 'Mode', key: 'mode' },
+  { header: 'UPS Count', key: 'count', align: 'right' },
+];
+
+const groupData = [
+  { id: 'dc-1', name: 'Data Center 1', mode: 'redundant', count: '3' },
+  { id: 'office', name: 'Office Servers', mode: 'nonRedundant', count: '2' },
+];
+
+logger.logTable(groupColumns, groupData, 'UPS Groups');
+
+console.log('');
+
+// === 8. Service Status Example ===
+logger.logBoxTitle('Service Status', 70, 'success');
+logger.logBoxLine('');
+logger.logBoxLine(`Status:   ${symbols.running} ${theme.statusActive('Active (Running)')}`);
+logger.logBoxLine(`Enabled:  ${symbols.success} ${theme.success('Yes')}`);
+logger.logBoxLine(`Uptime:   2 days, 5 hours, 23 minutes`);
+logger.logBoxLine(`PID:      ${theme.dim('12345')}`);
+logger.logBoxLine(`Memory:   ${theme.dim('45.2 MB')}`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 9. Configuration Example ===
+logger.logBoxTitle('Configuration', 70);
+logger.logBoxLine('');
+logger.logBoxLine(`UPS Devices:      ${theme.highlight('3')}`);
+logger.logBoxLine(`Groups:           ${theme.highlight('2')}`);
+logger.logBoxLine(`Check Interval:   ${theme.dim('30 seconds')}`);
+logger.logBoxLine(`Config File:      ${theme.path('/etc/nupst/config.json')}`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 10. Update Available Example ===
+logger.logBoxTitle('Update Available', 70, 'warning');
+logger.logBoxLine('');
+logger.logBoxLine(`Current Version:  ${theme.dim('4.0.1')}`);
+logger.logBoxLine(`Latest Version:   ${theme.highlight('4.0.2')}`);
+logger.logBoxLine('');
+logger.logBoxLine(`Run ${theme.command('sudo nupst update')} to update`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 11. Error Example ===
+logger.logBoxTitle('Error Example', 70, 'error');
+logger.logBoxLine('');
+logger.logBoxLine(`${symbols.error} Failed to connect to UPS at 192.168.1.10`);
+logger.logBoxLine('');
+logger.logBoxLine('Possible causes:');
+logger.logBoxLine(`  ${theme.dim('• UPS is offline or unreachable')}`);
+logger.logBoxLine(`  ${theme.dim('• Incorrect SNMP community string')}`);
+logger.logBoxLine(`  ${theme.dim('• Firewall blocking port 161')}`);
+logger.logBoxLine('');
+logger.logBoxLine(`Try: ${theme.command('nupst ups test --debug')}`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === Final Summary ===
+console.log('═'.repeat(80));
+logger.success('CLI Output Showcase Complete!');
+logger.dim('All color and formatting features demonstrated');
+console.log('═'.repeat(80));
+console.log('');

ts/cli.ts

@@ -1,6 +1,7 @@
 import { execSync } from 'node:child_process';
 import { Nupst } from './nupst.ts';
 import { logger } from './logger.ts';
+import { theme, symbols } from './colors.ts';
 
 /**
  * Class for handling CLI commands
@@ -475,58 +476,83 @@ export class NupstCli {
    * Display help message
    */
   private showHelp(): void {
-    logger.log(`
+    console.log('');
-NUPST - UPS Shutdown Tool
+    logger.highlight('NUPST - UPS Shutdown Tool');
+    logger.dim('Deno-powered UPS monitoring and shutdown automation');
+    console.log('');
 
-Usage:
+    // Usage section
-  nupst <command> [options]
+    logger.log(theme.info('Usage:'));
+    logger.log(`  ${theme.command('nupst')} ${theme.dim('<command> [options]')}`);
+    console.log('');
 
-Commands:
+    // Main commands section
-  service <subcommand>      - Manage systemd service
+    logger.log(theme.info('Commands:'));
-  ups <subcommand>          - Manage UPS devices
+    this.printCommand('service <subcommand>', 'Manage systemd service');
-  group <subcommand>        - Manage UPS groups
+    this.printCommand('ups <subcommand>', 'Manage UPS devices');
-  config [show]             - Display current configuration
+    this.printCommand('group <subcommand>', 'Manage UPS groups');
-  update                    - Update NUPST from repository (requires root)
+    this.printCommand('config [show]', 'Display current configuration');
-  uninstall                 - Completely remove NUPST from system (requires root)
+    this.printCommand('update', 'Update NUPST from repository', theme.dim('(requires root)'));
-  help, --help, -h          - Show this help message
+    this.printCommand('uninstall', 'Completely remove NUPST', theme.dim('(requires root)'));
-  --version, -v             - Show version information
+    this.printCommand('help, --help, -h', 'Show this help message');
+    this.printCommand('--version, -v', 'Show version information');
+    console.log('');
 
-Service Subcommands:
+    // Service subcommands
-  nupst service enable      - Install and enable systemd service (requires root)
+    logger.log(theme.info('Service Subcommands:'));
-  nupst service disable     - Stop and disable systemd service (requires root)
+    this.printCommand('nupst service enable', 'Install and enable systemd service', theme.dim('(requires root)'));
-  nupst service start       - Start the systemd service
+    this.printCommand('nupst service disable', 'Stop and disable systemd service', theme.dim('(requires root)'));
-  nupst service stop        - Stop the systemd service
+    this.printCommand('nupst service start', 'Start the systemd service');
-  nupst service restart     - Restart the systemd service
+    this.printCommand('nupst service stop', 'Stop the systemd service');
-  nupst service status      - Show service and UPS status
+    this.printCommand('nupst service restart', 'Restart the systemd service');
-  nupst service logs        - Show service logs in real-time
+    this.printCommand('nupst service status', 'Show service and UPS status');
-  nupst service start-daemon - Start daemon process directly
+    this.printCommand('nupst service logs', 'Show service logs in real-time');
+    this.printCommand('nupst service start-daemon', 'Start daemon process directly');
+    console.log('');
 
-UPS Subcommands:
+    // UPS subcommands
-  nupst ups add             - Add a new UPS device
+    logger.log(theme.info('UPS Subcommands:'));
-  nupst ups edit [id]       - Edit a UPS device (default if no ID)
+    this.printCommand('nupst ups add', 'Add a new UPS device');
-  nupst ups remove <id>     - Remove a UPS device by ID
+    this.printCommand('nupst ups edit [id]', 'Edit a UPS device (default if no ID)');
-  nupst ups list (or ls)    - List all configured UPS devices
+    this.printCommand('nupst ups remove <id>', 'Remove a UPS device by ID');
-  nupst ups test            - Test UPS connections
+    this.printCommand('nupst ups list (or ls)', 'List all configured UPS devices');
+    this.printCommand('nupst ups test', 'Test UPS connections');
+    console.log('');
 
-Group Subcommands:
+    // Group subcommands
-  nupst group add           - Add a new UPS group
+    logger.log(theme.info('Group Subcommands:'));
-  nupst group edit <id>     - Edit an existing UPS group
+    this.printCommand('nupst group add', 'Add a new UPS group');
-  nupst group remove <id>   - Remove a UPS group by ID
+    this.printCommand('nupst group edit <id>', 'Edit an existing UPS group');
-  nupst group list (or ls)  - List all UPS groups
+    this.printCommand('nupst group remove <id>', 'Remove a UPS group by ID');
+    this.printCommand('nupst group list (or ls)', 'List all UPS groups');
+    console.log('');
 
-Options:
+    // Options
-  --debug, -d              - Enable debug mode for detailed SNMP logging
+    logger.log(theme.info('Options:'));
-                             (Example: nupst ups test --debug)
+    this.printCommand('--debug, -d', 'Enable debug mode for detailed SNMP logging');
+    logger.dim('                     (Example: nupst ups test --debug)');
+    console.log('');
 
-Examples:
+    // Examples
-  nupst service enable     - Install and start the service
+    logger.log(theme.info('Examples:'));
-  nupst ups add            - Add a new UPS interactively
+    logger.dim('  nupst service enable     # Install and start the service');
-  nupst group list         - Show all configured groups
+    logger.dim('  nupst ups add            # Add a new UPS interactively');
-  nupst config             - Display current configuration
+    logger.dim('  nupst group list         # Show all configured groups');
+    logger.dim('  nupst config             # Display current configuration');
+    console.log('');
 
-Note: Old command format (e.g., 'nupst add') still works but is deprecated.
+    // Note about deprecated commands
-      Use the new format (e.g., 'nupst ups add') going forward.
+    logger.warn('Note: Old command format (e.g., \'nupst add\') still works but is deprecated.');
-`);
+    logger.dim('      Use the new format (e.g., \'nupst ups add\') going forward.');
+    console.log('');
+  }
+
+  /**
+   * Helper to print a command with description
+   */
+  private printCommand(command: string, description: string, extra?: string): void {
+    const paddedCommand = command.padEnd(30);
+    logger.log(`  ${theme.command(paddedCommand)} ${description}${extra ? ' ' + extra : ''}`);
   }
 
   /**

ts/cli/service-handler.ts

@@ -129,81 +129,32 @@ export class ServiceHandler {
     try {
       // Check if running as root
       this.checkRootAccess(
-        'This command must be run as root to update NUPST and refresh the systemd service.',
+        'This command must be run as root to update NUPST.',
       );
 
-      const boxWidth = 45;
+      console.log('');
-      logger.logBoxTitle('NUPST Update Process', boxWidth);
+      logger.info('Updating NUPST to latest version...');
-      logger.logBoxLine('Updating NUPST from repository...');
+      console.log('');
-
-      // Determine the installation directory (assuming it's either /opt/nupst or the current directory)
-      const { existsSync } = await import('fs');
-      let installDir = '/opt/nupst';
-
-      if (!existsSync(installDir)) {
-        // If not installed in /opt/nupst, use the current directory
-        const { dirname } = await import('path');
-        installDir = dirname(dirname(process.argv[1])); // Go up two levels from the executable
-        logger.logBoxLine(`Using local installation directory: ${installDir}`);
-      }
 
       try {
-        // 1. Update the repository
+        // Download and run the install script
-        logger.logBoxLine('Pulling latest changes from git repository...');
+        // This handles everything: download binary, stop service, replace, restart
-        execSync(`cd ${installDir} && git fetch origin && git reset --hard origin/main`, {
+        const installUrl = 'https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh';
-          stdio: 'pipe',
+
+        logger.dim('Downloading install script...');
+        execSync(`curl -sSL ${installUrl} | bash`, {
+          stdio: 'inherit', // Show install script output to user
         });
 
-        // 2. Run the install.sh script
+        console.log('');
-        logger.logBoxLine('Running install.sh to update NUPST...');
+        logger.success('Update completed successfully!');
-        execSync(`cd ${installDir} && bash ./install.sh`, { stdio: 'pipe' });
+        logger.dim('Run "nupst service status" to verify the update.');
-
+        console.log('');
-        // 3. Run the setup.sh script with force flag to update Node.js and dependencies
-        logger.logBoxLine('Running setup.sh to update Node.js and dependencies...');
-        execSync(`cd ${installDir} && bash ./setup.sh --force`, { stdio: 'pipe' });
-
-        // 4. Refresh the systemd service
-        logger.logBoxLine('Refreshing systemd service...');
-
-        // First check if service exists
-        let serviceExists = false;
-        try {
-          const output = execSync('systemctl list-unit-files | grep nupst.service').toString();
-          serviceExists = output.includes('nupst.service');
       } catch (error) {
-          // If grep fails (service not found), serviceExists remains false
+        console.log('');
-          serviceExists = false;
+        logger.error('Update failed');
-        }
+        logger.dim(`${error instanceof Error ? error.message : String(error)}`);
-
+        console.log('');
-        if (serviceExists) {
-          // Stop the service if it's running
-          const isRunning =
-            execSync('systemctl is-active nupst.service || true').toString().trim() === 'active';
-          if (isRunning) {
-            logger.logBoxLine('Stopping nupst service...');
-            execSync('systemctl stop nupst.service');
-          }
-
-          // Reinstall the service
-          logger.logBoxLine('Reinstalling systemd service...');
-          await this.nupst.getSystemd().install();
-
-          // Restart the service if it was running
-          if (isRunning) {
-            logger.logBoxLine('Restarting nupst service...');
-            execSync('systemctl start nupst.service');
-          }
-        } else {
-          logger.logBoxLine('Systemd service not installed, skipping service refresh.');
-          logger.logBoxLine('Run "nupst enable" to install the service.');
-        }
-
-        logger.logBoxLine('Update completed successfully!');
-        logger.logBoxEnd();
-      } catch (error) {
-        logger.logBoxLine('Error during update process:');
-        logger.logBoxLine(`${error instanceof Error ? error.message : String(error)}`);
-        logger.logBoxEnd();
         process.exit(1);
       }
     } catch (error) {

ts/colors.ts

@@ -0,0 +1,88 @@
+/**
+ * Color theme and styling utilities for NUPST CLI
+ * Uses Deno standard library colors module
+ */
+import * as colors from '@std/fmt/colors';
+
+/**
+ * Color theme for consistent CLI styling
+ */
+export const theme = {
+  // Message types
+  error: colors.red,
+  warning: colors.yellow,
+  success: colors.green,
+  info: colors.cyan,
+  dim: colors.dim,
+  highlight: colors.bold,
+
+  // Status indicators
+  statusActive: (text: string) => colors.green(colors.bold(text)),
+  statusInactive: (text: string) => colors.red(text),
+  statusWarning: (text: string) => colors.yellow(text),
+  statusUnknown: (text: string) => colors.dim(text),
+
+  // Battery level colors
+  batteryGood: colors.green, // > 60%
+  batteryMedium: colors.yellow, // 30-60%
+  batteryCritical: colors.red, // < 30%
+
+  // Box borders
+  borderSuccess: colors.green,
+  borderError: colors.red,
+  borderWarning: colors.yellow,
+  borderInfo: colors.cyan,
+  borderDefault: (text: string) => text, // No color
+
+  // Command/code highlighting
+  command: colors.cyan,
+  code: colors.dim,
+  path: colors.blue,
+};
+
+/**
+ * Status symbols with colors
+ */
+export const symbols = {
+  success: colors.green('✓'),
+  error: colors.red('✗'),
+  warning: colors.yellow('⚠'),
+  info: colors.cyan('ℹ'),
+  running: colors.green('●'),
+  stopped: colors.red('○'),
+  starting: colors.yellow('◐'),
+  unknown: colors.dim('◯'),
+};
+
+/**
+ * Get color for battery level
+ */
+export function getBatteryColor(percentage: number): (text: string) => string {
+  if (percentage >= 60) return theme.batteryGood;
+  if (percentage >= 30) return theme.batteryMedium;
+  return theme.batteryCritical;
+}
+
+/**
+ * Get color for runtime remaining
+ */
+export function getRuntimeColor(minutes: number): (text: string) => string {
+  if (minutes >= 20) return theme.batteryGood;
+  if (minutes >= 10) return theme.batteryMedium;
+  return theme.batteryCritical;
+}
+
+/**
+ * Format UPS power status with color
+ */
+export function formatPowerStatus(status: 'online' | 'onBattery' | 'unknown'): string {
+  switch (status) {
+    case 'online':
+      return theme.success('Online');
+    case 'onBattery':
+      return theme.warning('On Battery');
+    case 'unknown':
+    default:
+      return theme.dim('Unknown');
+  }
+}

ts/daemon.ts

@@ -6,6 +6,7 @@ import { promisify } from 'node:util';
 import { NupstSnmp } from './snmp/manager.ts';
 import type { ISnmpConfig } from './snmp/types.ts';
 import { logger } from './logger.ts';
+import { MigrationRunner } from './migrations/index.ts';
 
 const execAsync = promisify(exec);
 const execFileAsync = promisify(execFile);
@@ -49,6 +50,8 @@ export interface IGroupConfig {
  * Configuration interface for the daemon
  */
 export interface INupstConfig {
+  /** Configuration format version */
+  version?: string;
   /** UPS devices configuration */
   upsDevices: IUpsConfig[];
   /** Groups configuration */
@@ -56,10 +59,12 @@ export interface INupstConfig {
   /** Check interval in milliseconds */
   checkInterval: number;
 
-  // Legacy fields for backward compatibility
+  // Legacy fields for backward compatibility (will be migrated away)
-  /** SNMP configuration settings (legacy) */
+  /** UPS list (v3 format - legacy) */
+  upsList?: IUpsConfig[];
+  /** SNMP configuration settings (v1 format - legacy) */
   snmp?: ISnmpConfig;
-  /** Threshold settings (legacy) */
+  /** Threshold settings (v1 format - legacy) */
   thresholds?: {
     /** Shutdown when battery below this percentage */
     battery: number;
@@ -91,6 +96,7 @@ export class NupstDaemon {
 
   /** Default configuration */
   private readonly DEFAULT_CONFIG: INupstConfig = {
+    version: '4.0',
     upsDevices: [
       {
         id: 'default',
@@ -153,29 +159,16 @@ export class NupstDaemon {
       const configData = fs.readFileSync(this.CONFIG_PATH, 'utf8');
       const parsedConfig = JSON.parse(configData);
 
-      // Handle legacy configuration format
+      // Run migrations to upgrade config format if needed
-      if (!parsedConfig.upsDevices && parsedConfig.snmp) {
+      const migrationRunner = new MigrationRunner();
-        // Convert legacy format to new format
+      const { config: migratedConfig, migrated } = await migrationRunner.run(parsedConfig);
-        this.config = {
-          upsDevices: [
-            {
-              id: 'default',
-              name: 'Default UPS',
-              snmp: parsedConfig.snmp,
-              thresholds: parsedConfig.thresholds,
-              groups: [],
-            },
-          ],
-          groups: [],
-          checkInterval: parsedConfig.checkInterval,
-        };
 
-        logger.log('Legacy configuration format detected. Converting to multi-UPS format.');
+      // Save migrated config back to disk if any migrations ran
-
+      if (migrated) {
-        // Save the new format
+        this.config = migratedConfig;
         await this.saveConfig(this.config);
       } else {
-        this.config = parsedConfig;
+        this.config = migratedConfig;
       }
 
       return this.config;
@@ -202,8 +195,17 @@ export class NupstDaemon {
       if (!fs.existsSync(configDir)) {
         fs.mkdirSync(configDir, { recursive: true });
       }
-      fs.writeFileSync(this.CONFIG_PATH, JSON.stringify(config, null, 2));
+
-      this.config = config;
+      // Ensure version is always set and remove legacy fields before saving
+      const configToSave: INupstConfig = {
+        version: '4.0',
+        upsDevices: config.upsDevices,
+        groups: config.groups,
+        checkInterval: config.checkInterval,
+      };
+
+      fs.writeFileSync(this.CONFIG_PATH, JSON.stringify(configToSave, null, 2));
+      this.config = configToSave;
 
       console.log('┌─ Configuration Saved ─────────────────────┐');
       console.log(`│ Location: ${this.CONFIG_PATH}`);
@@ -353,8 +355,9 @@ export class NupstDaemon {
     logger.log('Starting UPS monitoring...');
 
     if (!this.config.upsDevices || this.config.upsDevices.length === 0) {
-      logger.error('No UPS devices found in configuration. Monitoring stopped.');
+      logger.warn('No UPS devices found in configuration. Daemon will remain idle...');
-      this.isRunning = false;
+      // Don't exit - enter idle monitoring mode instead
+      await this.idleMonitoring();
       return;
     }
 
@@ -890,6 +893,133 @@ export class NupstDaemon {
     }
   }
 
+  /**
+   * Idle monitoring loop when no UPS devices are configured
+   * Watches for config changes and reloads when detected
+   */
+  private async idleMonitoring(): Promise<void> {
+    const IDLE_CHECK_INTERVAL = 60000; // Check every 60 seconds
+    let lastConfigCheck = Date.now();
+    const CONFIG_CHECK_INTERVAL = 60000; // Check config every minute
+
+    logger.log('Entering idle monitoring mode...');
+    logger.log('Daemon will check for config changes every 60 seconds');
+
+    // Start file watcher for hot-reload
+    this.watchConfigFile();
+
+    while (this.isRunning) {
+      try {
+        const currentTime = Date.now();
+
+        // Periodically check if config has been updated
+        if (currentTime - lastConfigCheck >= CONFIG_CHECK_INTERVAL) {
+          try {
+            // Try to load config
+            const newConfig = await this.loadConfig();
+
+            // Check if we now have UPS devices configured
+            if (newConfig.upsDevices && newConfig.upsDevices.length > 0) {
+              logger.success('Configuration updated! UPS devices found. Starting monitoring...');
+              this.initializeUpsStatus();
+              // Exit idle mode and start monitoring
+              await this.monitor();
+              return;
+            }
+          } catch (error) {
+            // Config still doesn't exist or invalid, continue waiting
+          }
+
+          lastConfigCheck = currentTime;
+        }
+
+        await this.sleep(IDLE_CHECK_INTERVAL);
+      } catch (error) {
+        logger.error(
+          `Error during idle monitoring: ${error instanceof Error ? error.message : String(error)}`,
+        );
+        await this.sleep(IDLE_CHECK_INTERVAL);
+      }
+    }
+
+    logger.log('Idle monitoring stopped');
+  }
+
+  /**
+   * Watch config file for changes and reload automatically
+   */
+  private watchConfigFile(): void {
+    try {
+      // Use Deno's file watcher to monitor config file
+      const configDir = path.dirname(this.CONFIG_PATH);
+
+      // Spawn a background watcher (non-blocking)
+      (async () => {
+        try {
+          const watcher = Deno.watchFs(configDir);
+
+          logger.log('Config file watcher started');
+
+          for await (const event of watcher) {
+            // Only respond to modify events on the config file
+            if (
+              event.kind === 'modify' &&
+              event.paths.some((p) => p.includes('config.json'))
+            ) {
+              logger.info('Config file changed, reloading...');
+              await this.reloadConfig();
+            }
+
+            // Stop watching if daemon stopped
+            if (!this.isRunning) {
+              break;
+            }
+          }
+        } catch (error) {
+          // Watcher error - not critical, just log it
+          logger.dim(
+            `Config watcher stopped: ${error instanceof Error ? error.message : String(error)}`,
+          );
+        }
+      })();
+    } catch (error) {
+      // If we can't start the watcher, just log and continue
+      // The periodic check will still work
+      logger.dim('Could not start config file watcher, using periodic checks only');
+    }
+  }
+
+  /**
+   * Reload configuration and restart monitoring if needed
+   */
+  private async reloadConfig(): Promise<void> {
+    try {
+      const oldDeviceCount = this.config.upsDevices?.length || 0;
+
+      // Load the new configuration
+      await this.loadConfig();
+      const newDeviceCount = this.config.upsDevices?.length || 0;
+
+      if (newDeviceCount > 0 && oldDeviceCount === 0) {
+        logger.success(`Configuration reloaded! Found ${newDeviceCount} UPS device(s)`);
+        logger.info('Monitoring will start automatically...');
+      } else if (newDeviceCount !== oldDeviceCount) {
+        logger.success(
+          `Configuration reloaded! UPS devices: ${oldDeviceCount} → ${newDeviceCount}`,
+        );
+
+        // Reinitialize UPS status tracking
+        this.initializeUpsStatus();
+      } else {
+        logger.success('Configuration reloaded successfully');
+      }
+    } catch (error) {
+      logger.warn(
+        `Failed to reload config: ${error instanceof Error ? error.message : String(error)}`,
+      );
+    }
+  }
+
   /**
    * Sleep for the specified milliseconds
    */

ts/logger.ts

@@ -1,9 +1,38 @@
+import { theme, symbols } from './colors.ts';
+
+/**
+ * Table column alignment options
+ */
+export type TColumnAlign = 'left' | 'right' | 'center';
+
+/**
+ * Table column definition
+ */
+export interface ITableColumn {
+  /** Column header text */
+  header: string;
+  /** Column key in data object */
+  key: string;
+  /** Column alignment (default: left) */
+  align?: TColumnAlign;
+  /** Column width (auto-calculated if not specified) */
+  width?: number;
+  /** Color function to apply to cell values */
+  color?: (value: string) => string;
+}
+
+/**
+ * Box style types with colors
+ */
+export type TBoxStyle = 'default' | 'success' | 'error' | 'warning' | 'info';
+
 /**
  * A simple logger class that provides consistent formatting for log messages
  * including support for logboxes with title, lines, and closing
  */
 export class Logger {
   private currentBoxWidth: number | null = null;
+  private currentBoxStyle: TBoxStyle = 'default';
   private static instance: Logger;
 
   /** Default width to use when no width is specified */
@@ -36,36 +65,83 @@ export class Logger {
   }
 
   /**
-   * Log an error message
+   * Log an error message (red with ✗ symbol)
    * @param message Error message to log
    */
   public error(message: string): void {
-    console.error(message);
+    console.error(`${symbols.error} ${theme.error(message)}`);
   }
 
   /**
-   * Log a warning message with a warning emoji
+   * Log a warning message (yellow with ⚠ symbol)
    * @param message Warning message to log
    */
   public warn(message: string): void {
-    console.warn(`⚠️ ${message}`);
+    console.warn(`${symbols.warning} ${theme.warning(message)}`);
   }
 
   /**
-   * Log a success message with a checkmark
+   * Log a success message (green with ✓ symbol)
    * @param message Success message to log
    */
   public success(message: string): void {
-    console.log(`✓ ${message}`);
+    console.log(`${symbols.success} ${theme.success(message)}`);
+  }
+
+  /**
+   * Log an info message (cyan with ℹ symbol)
+   * @param message Info message to log
+   */
+  public info(message: string): void {
+    console.log(`${symbols.info} ${theme.info(message)}`);
+  }
+
+  /**
+   * Log a dim/secondary message
+   * @param message Message to log in dim style
+   */
+  public dim(message: string): void {
+    console.log(theme.dim(message));
+  }
+
+  /**
+   * Log a highlighted/bold message
+   * @param message Message to highlight
+   */
+  public highlight(message: string): void {
+    console.log(theme.highlight(message));
+  }
+
+  /**
+   * Get color function for box based on style
+   */
+  private getBoxColor(style: TBoxStyle): (text: string) => string {
+    switch (style) {
+      case 'success':
+        return theme.borderSuccess;
+      case 'error':
+        return theme.borderError;
+      case 'warning':
+        return theme.borderWarning;
+      case 'info':
+        return theme.borderInfo;
+      case 'default':
+      default:
+        return theme.borderDefault;
+    }
   }
 
   /**
    * Log a logbox title and set the current box width
    * @param title Title of the logbox
    * @param width Width of the logbox (including borders), defaults to DEFAULT_WIDTH
+   * @param style Box style for coloring (default, success, error, warning, info)
    */
-  public logBoxTitle(title: string, width?: number): void {
+  public logBoxTitle(title: string, width?: number, style?: TBoxStyle): void {
     this.currentBoxWidth = width || this.DEFAULT_WIDTH;
+    this.currentBoxStyle = style || 'default';
+
+    const colorFn = this.getBoxColor(this.currentBoxStyle);
 
     // Create the title line with appropriate padding
     const paddedTitle = ` ${title} `;
@@ -74,7 +150,7 @@ export class Logger {
     // Title line: ┌─ Title ───┐
     const titleLine = `┌─${paddedTitle}${'─'.repeat(Math.max(0, remainingSpace))}┐`;
 
-    console.log(titleLine);
+    console.log(colorFn(titleLine));
   }
 
   /**
@@ -89,17 +165,21 @@ export class Logger {
     }
 
     const boxWidth = width || this.currentBoxWidth || this.DEFAULT_WIDTH;
+    const colorFn = this.getBoxColor(this.currentBoxStyle);
 
-    // Calculate the available space for content
+    // Calculate the available space for content (use visible length)
     const availableSpace = boxWidth - 2; // Account for left and right borders
+    const visibleLen = this.visibleLength(content);
 
-    if (content.length <= availableSpace - 1) {
+    if (visibleLen <= availableSpace - 1) {
       // If content fits with at least one space for the right border stripe
-      const padding = availableSpace - content.length - 1;
+      const padding = availableSpace - visibleLen - 1;
-      console.log(`│ ${content}${' '.repeat(padding)}│`);
+      const line = `│ ${content}${' '.repeat(padding)}│`;
+      console.log(colorFn(line));
     } else {
       // Content is too long, let it flow out of boundaries.
-      console.log(`│ ${content}`);
+      const line = `│ ${content}`;
+      console.log(colorFn(line));
     }
   }
 
@@ -109,12 +189,15 @@ export class Logger {
    */
   public logBoxEnd(width?: number): void {
     const boxWidth = width || this.currentBoxWidth || this.DEFAULT_WIDTH;
+    const colorFn = this.getBoxColor(this.currentBoxStyle);
 
     // Create the bottom border: └────────┘
-    console.log(`└${'─'.repeat(boxWidth - 2)}┘`);
+    const bottomLine = `└${'─'.repeat(boxWidth - 2)}┘`;
+    console.log(colorFn(bottomLine));
 
-    // Reset the current box width
+    // Reset the current box width and style
     this.currentBoxWidth = null;
+    this.currentBoxStyle = 'default';
   }
 
   /**
@@ -122,9 +205,10 @@ export class Logger {
    * @param title Title of the logbox
    * @param lines Array of content lines
    * @param width Width of the logbox, defaults to DEFAULT_WIDTH
+   * @param style Box style for coloring
    */
-  public logBox(title: string, lines: string[], width?: number): void {
+  public logBox(title: string, lines: string[], width?: number, style?: TBoxStyle): void {
-    this.logBoxTitle(title, width || this.DEFAULT_WIDTH);
+    this.logBoxTitle(title, width || this.DEFAULT_WIDTH, style);
 
     for (const line of lines) {
       this.logBoxLine(line);
@@ -141,6 +225,108 @@ export class Logger {
   public logDivider(width?: number, character: string = '─'): void {
     console.log(character.repeat(width || this.DEFAULT_WIDTH));
   }
+
+  /**
+   * Strip ANSI color codes from string for accurate length calculation
+   */
+  private stripAnsi(text: string): string {
+    // Remove ANSI escape codes
+    return text.replace(/\x1b\[[0-9;]*m/g, '');
+  }
+
+  /**
+   * Get visible length of string (excluding ANSI codes)
+   */
+  private visibleLength(text: string): number {
+    return this.stripAnsi(text).length;
+  }
+
+  /**
+   * Align text within a column (handles ANSI color codes correctly)
+   */
+  private alignText(text: string, width: number, align: TColumnAlign = 'left'): string {
+    const visibleLen = this.visibleLength(text);
+
+    if (visibleLen >= width) {
+      // Text is too long, truncate the visible part
+      const stripped = this.stripAnsi(text);
+      return stripped.substring(0, width);
+    }
+
+    const padding = width - visibleLen;
+
+    switch (align) {
+      case 'right':
+        return ' '.repeat(padding) + text;
+      case 'center': {
+        const leftPad = Math.floor(padding / 2);
+        const rightPad = padding - leftPad;
+        return ' '.repeat(leftPad) + text + ' '.repeat(rightPad);
+      }
+      case 'left':
+      default:
+        return text + ' '.repeat(padding);
+    }
+  }
+
+  /**
+   * Log a formatted table
+   * @param columns Column definitions
+   * @param rows Array of data objects
+   * @param title Optional table title
+   */
+  public logTable(columns: ITableColumn[], rows: Record<string, string>[], title?: string): void {
+    if (rows.length === 0) {
+      this.dim('No data to display');
+      return;
+    }
+
+    // Calculate column widths
+    const columnWidths = columns.map((col) => {
+      if (col.width) return col.width;
+
+      // Auto-calculate width based on header and data (use visible length)
+      let maxWidth = this.visibleLength(col.header);
+      for (const row of rows) {
+        const value = String(row[col.key] || '');
+        maxWidth = Math.max(maxWidth, this.visibleLength(value));
+      }
+      return maxWidth;
+    });
+
+    // Calculate total table width
+    const totalWidth = columnWidths.reduce((sum, w) => sum + w, 0) + (columns.length * 3) + 1;
+
+    // Print title if provided
+    if (title) {
+      this.logBoxTitle(title, totalWidth);
+    } else {
+      // Print top border
+      console.log('┌' + columnWidths.map((w) => '─'.repeat(w + 2)).join('┬') + '┐');
+    }
+
+    // Print header row
+    const headerCells = columns.map((col, i) =>
+      theme.highlight(this.alignText(col.header, columnWidths[i], col.align))
+    );
+    console.log('│ ' + headerCells.join(' │ ') + ' │');
+
+    // Print separator
+    console.log('├' + columnWidths.map((w) => '─'.repeat(w + 2)).join('┼') + '┤');
+
+    // Print data rows
+    for (const row of rows) {
+      const cells = columns.map((col, i) => {
+        const value = String(row[col.key] || '');
+        const aligned = this.alignText(value, columnWidths[i], col.align);
+        return col.color ? col.color(aligned) : aligned;
+      });
+      console.log('│ ' + cells.join(' │ ') + ' │');
+    }
+
+    // Print bottom border
+    console.log('└' + columnWidths.map((w) => '─'.repeat(w + 2)).join('┴') + '┘');
+  }
 }
 
 // Export a singleton instance for easy use

ts/migrations/base-migration.ts

@@ -0,0 +1,54 @@
+/**
+ * Abstract base class for configuration migrations
+ *
+ * Each migration represents an upgrade from one config version to another.
+ * Migrations run in order based on the `order` field, allowing users to jump
+ * multiple versions (e.g., v1 → v4 runs migrations 2, 3, and 4).
+ */
+export abstract class BaseMigration {
+  /**
+   * Migration order number
+   * - Order 2: v1 → v2
+   * - Order 3: v2 → v3
+   * - Order 4: v3 → v4
+   * etc.
+   */
+  abstract readonly order: number;
+
+  /**
+   * Source version this migration upgrades from
+   * e.g., "1.x", "3.x"
+   */
+  abstract readonly fromVersion: string;
+
+  /**
+   * Target version this migration upgrades to
+   * e.g., "2.0", "4.0"
+   */
+  abstract readonly toVersion: string;
+
+  /**
+   * Check if this migration should run on the given config
+   *
+   * @param config - Raw configuration object to check
+   * @returns True if migration should run, false otherwise
+   */
+  abstract shouldRun(config: any): Promise<boolean>;
+
+  /**
+   * Perform the migration on the given config
+   *
+   * @param config - Raw configuration object to migrate
+   * @returns Migrated configuration object
+   */
+  abstract migrate(config: any): Promise<any>;
+
+  /**
+   * Get human-readable name for this migration
+   *
+   * @returns Migration name
+   */
+  getName(): string {
+    return `Migration ${this.fromVersion} → ${this.toVersion}`;
+  }
+}

ts/migrations/index.ts

@@ -0,0 +1,10 @@
+/**
+ * Configuration migrations module
+ *
+ * Exports the migration system for upgrading configs between versions.
+ */
+
+export { BaseMigration } from './base-migration.ts';
+export { MigrationRunner } from './migration-runner.ts';
+export { MigrationV1ToV2 } from './migration-v1-to-v2.ts';
+export { MigrationV3ToV4 } from './migration-v3-to-v4.ts';

ts/migrations/migration-runner.ts

@@ -0,0 +1,69 @@
+import { BaseMigration } from './base-migration.ts';
+import { MigrationV1ToV2 } from './migration-v1-to-v2.ts';
+import { MigrationV3ToV4 } from './migration-v3-to-v4.ts';
+import { logger } from '../logger.ts';
+
+/**
+ * Migration runner
+ *
+ * Discovers all available migrations, sorts them by order,
+ * and runs applicable migrations in sequence.
+ */
+export class MigrationRunner {
+  private migrations: BaseMigration[];
+
+  constructor() {
+    // Register all migrations here
+    this.migrations = [
+      new MigrationV1ToV2(),
+      new MigrationV3ToV4(),
+      // Add future migrations here (v4→v5, v5→v6, etc.)
+    ];
+
+    // Sort by order to ensure they run in sequence
+    this.migrations.sort((a, b) => a.order - b.order);
+  }
+
+  /**
+   * Run all applicable migrations on the config
+   *
+   * @param config - Raw configuration object to migrate
+   * @returns Migrated configuration and whether migrations ran
+   */
+  async run(config: any): Promise<{ config: any; migrated: boolean }> {
+    let currentConfig = config;
+    let anyMigrationsRan = false;
+
+    logger.dim('Checking for required config migrations...');
+
+    for (const migration of this.migrations) {
+      const shouldRun = await migration.shouldRun(currentConfig);
+
+      if (shouldRun) {
+        logger.info(`Running ${migration.getName()}...`);
+        currentConfig = await migration.migrate(currentConfig);
+        anyMigrationsRan = true;
+      }
+    }
+
+    if (anyMigrationsRan) {
+      logger.success('Configuration migrations complete');
+    } else {
+      logger.dim('No migrations needed');
+    }
+
+    return {
+      config: currentConfig,
+      migrated: anyMigrationsRan,
+    };
+  }
+
+  /**
+   * Get all registered migrations
+   *
+   * @returns Array of all migrations sorted by order
+   */
+  getMigrations(): BaseMigration[] {
+    return [...this.migrations];
+  }
+}

ts/migrations/migration-v1-to-v2.ts

@@ -0,0 +1,56 @@
+import { BaseMigration } from './base-migration.ts';
+import { logger } from '../logger.ts';
+
+/**
+ * Migration from v1 (single SNMP config) to v2 (upsDevices array)
+ *
+ * Detects old format:
+ * {
+ *   snmp: { ... },
+ *   thresholds: { ... },
+ *   checkInterval: 30000
+ * }
+ *
+ * Converts to:
+ * {
+ *   version: "2.0",
+ *   upsDevices: [{ id: "default", name: "Default UPS", snmp: ..., thresholds: ... }],
+ *   groups: [],
+ *   checkInterval: 30000
+ * }
+ */
+export class MigrationV1ToV2 extends BaseMigration {
+  readonly order = 2;
+  readonly fromVersion = '1.x';
+  readonly toVersion = '2.0';
+
+  async shouldRun(config: any): Promise<boolean> {
+    // V1 format has snmp field directly at root, no upsDevices or upsList
+    return !!config.snmp && !config.upsDevices && !config.upsList;
+  }
+
+  async migrate(config: any): Promise<any> {
+    logger.info(`${this.getName()}: Converting single SNMP config to multi-UPS format...`);
+
+    const migrated = {
+      version: this.toVersion,
+      upsDevices: [
+        {
+          id: 'default',
+          name: 'Default UPS',
+          snmp: config.snmp,
+          thresholds: config.thresholds || {
+            battery: 60,
+            runtime: 20,
+          },
+          groups: [],
+        },
+      ],
+      groups: [],
+      checkInterval: config.checkInterval || 30000,
+    };
+
+    logger.success(`${this.getName()}: Migration complete`);
+    return migrated;
+  }
+}

ts/migrations/migration-v3-to-v4.ts

@@ -0,0 +1,119 @@
+import { BaseMigration } from './base-migration.ts';
+import { logger } from '../logger.ts';
+
+/**
+ * Migration from v3 (upsList) to v4 (upsDevices)
+ *
+ * Transforms v3 format with flat SNMP config:
+ * {
+ *   upsList: [
+ *     {
+ *       id: "ups-1",
+ *       name: "UPS 1",
+ *       host: "192.168.1.1",
+ *       port: 161,
+ *       community: "public",
+ *       version: "1"  // string
+ *     }
+ *   ]
+ * }
+ *
+ * To v4 format with nested SNMP config:
+ * {
+ *   version: "4.0",
+ *   upsDevices: [
+ *     {
+ *       id: "ups-1",
+ *       name: "UPS 1",
+ *       snmp: {
+ *         host: "192.168.1.1",
+ *         port: 161,
+ *         community: "public",
+ *         version: 1,  // number
+ *         timeout: 5000
+ *       },
+ *       thresholds: { battery: 60, runtime: 20 },
+ *       groups: []
+ *     }
+ *   ]
+ * }
+ */
+export class MigrationV3ToV4 extends BaseMigration {
+  readonly order = 4;
+  readonly fromVersion = '3.x';
+  readonly toVersion = '4.0';
+
+  async shouldRun(config: any): Promise<boolean> {
+    // V3 format has upsList OR has upsDevices with flat structure (host at top level)
+    if (config.upsList && !config.upsDevices) {
+      return true; // Classic v3 with upsList
+    }
+
+    // Check if upsDevices exists but has flat structure (v3 format)
+    if (config.upsDevices && config.upsDevices.length > 0) {
+      const firstDevice = config.upsDevices[0];
+      // V3 has host at top level, v4 has it nested in snmp object
+      return !!firstDevice.host && !firstDevice.snmp;
+    }
+
+    return false;
+  }
+
+  async migrate(config: any): Promise<any> {
+    logger.info(`${this.getName()}: Migrating v3 config to v4 format...`);
+    logger.dim(`  - Restructuring UPS devices (flat → nested snmp config)`);
+
+    // Get devices from either upsList or upsDevices (for partially migrated configs)
+    const sourceDevices = config.upsList || config.upsDevices;
+
+    // Transform each UPS device from v3 flat structure to v4 nested structure
+    const transformedDevices = sourceDevices.map((device: any) => {
+      // Build SNMP config object
+      const snmpConfig: any = {
+        host: device.host,
+        port: device.port || 161,
+        version: typeof device.version === 'string' ? parseInt(device.version, 10) : device.version,
+        timeout: device.timeout || 5000,
+      };
+
+      // Add SNMPv1/v2c fields
+      if (device.community) {
+        snmpConfig.community = device.community;
+      }
+
+      // Add SNMPv3 fields
+      if (device.securityLevel) snmpConfig.securityLevel = device.securityLevel;
+      if (device.username) snmpConfig.username = device.username;
+      if (device.authProtocol) snmpConfig.authProtocol = device.authProtocol;
+      if (device.authKey) snmpConfig.authKey = device.authKey;
+      if (device.privProtocol) snmpConfig.privProtocol = device.privProtocol;
+      if (device.privKey) snmpConfig.privKey = device.privKey;
+
+      // Add UPS model if present
+      if (device.upsModel) snmpConfig.upsModel = device.upsModel;
+      if (device.customOIDs) snmpConfig.customOIDs = device.customOIDs;
+
+      // Return v4 format with nested structure
+      return {
+        id: device.id,
+        name: device.name,
+        snmp: snmpConfig,
+        thresholds: device.thresholds || {
+          battery: 60,
+          runtime: 20,
+        },
+        groups: device.groups || [],
+      };
+    });
+
+    const migrated = {
+      version: this.toVersion,
+      upsDevices: transformedDevices,
+      groups: config.groups || [],
+      checkInterval: config.checkInterval || 30000,
+    };
+
+    logger.success(`${this.getName()}: Migration complete (${transformedDevices.length} devices transformed)`);
+    return migrated;
+  }
+}

ts/systemd.ts

@@ -3,6 +3,7 @@ import { promises as fs } from 'node:fs';
 import { execSync } from 'node:child_process';
 import { NupstDaemon } from './daemon.ts';
 import { logger } from './logger.ts';
+import { theme, symbols, getBatteryColor, getRuntimeColor, formatPowerStatus } from './colors.ts';
 
 /**
  * Class for managing systemd service
@@ -171,18 +172,50 @@ WantedBy=multi-user.target
   private displayServiceStatus(): void {
     try {
       const serviceStatus = execSync('systemctl status nupst.service').toString();
-      const boxWidth = 45;
+      const lines = serviceStatus.split('\n');
-      logger.logBoxTitle('Service Status', boxWidth);
+
-      // Process each line of the status output
+      // Parse key information from systemctl output
-      serviceStatus.split('\n').forEach((line) => {
+      let isActive = false;
-        logger.logBoxLine(line);
+      let pid = '';
-      });
+      let memory = '';
-      logger.logBoxEnd();
+      let cpu = '';
+
+      for (const line of lines) {
+        if (line.includes('Active:')) {
+          isActive = line.includes('active (running)');
+        } else if (line.includes('Main PID:')) {
+          const match = line.match(/Main PID:\s+(\d+)/);
+          if (match) pid = match[1];
+        } else if (line.includes('Memory:')) {
+          const match = line.match(/Memory:\s+([\d.]+[A-Z])/);
+          if (match) memory = match[1];
+        } else if (line.includes('CPU:')) {
+          const match = line.match(/CPU:\s+([\d.]+(?:ms|s))/);
+          if (match) cpu = match[1];
+        }
+      }
+
+      // Display beautiful status
+      console.log('');
+      if (isActive) {
+        console.log(`${symbols.running} ${theme.success('Service:')} ${theme.statusActive('active (running)')}`);
+      } else {
+        console.log(`${symbols.stopped} ${theme.dim('Service:')} ${theme.statusInactive('inactive')}`);
+      }
+
+      if (pid || memory || cpu) {
+        const details = [];
+        if (pid) details.push(`PID: ${theme.dim(pid)}`);
+        if (memory) details.push(`Memory: ${theme.dim(memory)}`);
+        if (cpu) details.push(`CPU: ${theme.dim(cpu)}`);
+        console.log(`  ${details.join('  ')}`);
+      }
+      console.log('');
+
     } catch (error) {
-      const boxWidth = 45;
+      console.log('');
-      logger.logBoxTitle('Service Status', boxWidth);
+      console.log(`${symbols.stopped} ${theme.dim('Service:')} ${theme.statusInactive('not installed')}`);
-      logger.logBoxLine('Service is not running');
+      console.log('');
-      logger.logBoxEnd();
     }
   }
 
@@ -199,7 +232,7 @@ WantedBy=multi-user.target
 
       // Check if we have the new multi-UPS config format
       if (config.upsDevices && Array.isArray(config.upsDevices) && config.upsDevices.length > 0) {
-        logger.log(`Found ${config.upsDevices.length} UPS device(s) in configuration`);
+        console.log(theme.info(`UPS Devices (${config.upsDevices.length}):`));
 
         // Show status for each UPS
         for (const ups of config.upsDevices) {
@@ -207,6 +240,7 @@ WantedBy=multi-user.target
         }
       } else if (config.snmp) {
         // Legacy single UPS configuration
+        console.log(theme.info('UPS Devices (1):'));
         const legacyUps = {
           id: 'default',
           name: 'Default UPS',
@@ -217,15 +251,16 @@ WantedBy=multi-user.target
 
         await this.displaySingleUpsStatus(legacyUps, snmp);
       } else {
-        logger.error('No UPS devices found in configuration');
+        console.log('');
+        console.log(`${symbols.warning} ${theme.warning('No UPS devices configured')}`);
+        console.log(`  ${theme.dim('Run')} ${theme.command('nupst ups add')} ${theme.dim('to add a device')}`);
+        console.log('');
       }
     } catch (error) {
-      const boxWidth = 45;
+      console.log('');
-      logger.logBoxTitle('UPS Status', boxWidth);
+      console.log(`${symbols.error} ${theme.error('Failed to retrieve UPS status')}`);
-      logger.logBoxLine(
+      console.log(`  ${theme.dim(error instanceof Error ? error.message : String(error))}`);
-        `Failed to retrieve UPS status: ${error instanceof Error ? error.message : String(error)}`,
+      console.log('');
-      );
-      logger.logBoxEnd();
     }
   }
 
@@ -235,24 +270,6 @@ WantedBy=multi-user.target
    * @param snmp SNMP manager
    */
   private async displaySingleUpsStatus(ups: any, snmp: any): Promise<void> {
-    const boxWidth = 45;
-    logger.logBoxTitle(`Connecting to UPS: ${ups.name}`, boxWidth);
-    logger.logBoxLine(`ID: ${ups.id}`);
-    logger.logBoxLine(`Host: ${ups.snmp.host}:${ups.snmp.port}`);
-    logger.logBoxLine(`UPS Model: ${ups.snmp.upsModel || 'cyberpower'}`);
-
-    if (ups.groups && ups.groups.length > 0) {
-      // Get group names if available
-      const config = this.daemon.getConfig();
-      const groupNames = ups.groups.map((groupId: string) => {
-        const group = config.groups?.find((g: { id: string }) => g.id === groupId);
-        return group ? group.name : groupId;
-      });
-      logger.logBoxLine(`Groups: ${groupNames.join(', ')}`);
-    }
-
-    logger.logBoxEnd();
-
     try {
       // Create a test config with a short timeout
       const testConfig = {
@@ -262,32 +279,43 @@ WantedBy=multi-user.target
 
       const status = await snmp.getUpsStatus(testConfig);
 
-      logger.logBoxTitle(`UPS Status: ${ups.name}`, boxWidth);
+      // Determine status symbol based on power status
-      logger.logBoxLine(`Power Status: ${status.powerStatus}`);
+      let statusSymbol = symbols.unknown;
-      logger.logBoxLine(`Battery Capacity: ${status.batteryCapacity}%`);
+      if (status.powerStatus === 'online') {
-      logger.logBoxLine(`Runtime Remaining: ${status.batteryRuntime} minutes`);
+        statusSymbol = symbols.running;
+      } else if (status.powerStatus === 'onBattery') {
+        statusSymbol = symbols.warning;
+      }
 
-      // Show threshold status
+      // Display UPS name and power status
-      logger.logBoxLine('');
+      console.log(`  ${statusSymbol} ${theme.highlight(ups.name)} - ${formatPowerStatus(status.powerStatus)}`);
-      logger.logBoxLine('Thresholds:');
+
-      logger.logBoxLine(
+      // Display battery with color coding
-        `  Battery: ${status.batteryCapacity}% / ${ups.thresholds.battery}% ${
+      const batteryColor = getBatteryColor(status.batteryCapacity);
-          status.batteryCapacity < ups.thresholds.battery ? '⚠️' : '✓'
+      const batterySymbol = status.batteryCapacity >= ups.thresholds.battery ? symbols.success : symbols.warning;
-        }`,
+      console.log(`    Battery: ${batteryColor(status.batteryCapacity + '%')} ${batterySymbol}  Runtime: ${getRuntimeColor(status.batteryRuntime)(status.batteryRuntime + ' min')}`);
-      );
+
-      logger.logBoxLine(
+      // Display host info
-        `  Runtime: ${status.batteryRuntime} min / ${ups.thresholds.runtime} min ${
+      console.log(`    ${theme.dim(`Host: ${ups.snmp.host}:${ups.snmp.port}`)}`);
-          status.batteryRuntime < ups.thresholds.runtime ? '⚠️' : '✓'
+
-        }`,
+      // Display groups if any
-      );
+      if (ups.groups && ups.groups.length > 0) {
+        const config = this.daemon.getConfig();
+        const groupNames = ups.groups.map((groupId: string) => {
+          const group = config.groups?.find((g: { id: string }) => g.id === groupId);
+          return group ? group.name : groupId;
+        });
+        console.log(`    ${theme.dim(`Groups: ${groupNames.join(', ')}`)}`);
+      }
+
+      console.log('');
 
-      logger.logBoxEnd();
     } catch (error) {
-      logger.logBoxTitle(`UPS Status: ${ups.name}`, boxWidth);
+      // Display error for this UPS
-      logger.logBoxLine(
+      console.log(`  ${symbols.error} ${theme.highlight(ups.name)} - ${theme.error('Connection failed')}`);
-        `Failed to retrieve UPS status: ${error instanceof Error ? error.message : String(error)}`,
+      console.log(`    ${theme.dim(error instanceof Error ? error.message : String(error))}`);
-      );
+      console.log(`    ${theme.dim(`Host: ${ups.snmp.host}:${ups.snmp.port}`)}`);
-      logger.logBoxEnd();
+      console.log('');
     }
   }