chore(release): bump version to 4.2.5

Major type safety improvements throughout the codebase:

- Updated DEFAULT_CONFIG version to 4.2
- Replaced 'any' with proper types in systemd.ts:
  * displaySingleUpsStatus now uses IUpsConfig and NupstSnmp types
  * Fixed legacy config handling to use proper IUpsConfig format
  * Removed inline 'any' type annotations

- Replaced 'any' with proper types in daemon.ts:
  * emergencyUps now properly typed as { ups: IUpsConfig, status: ISnmpUpsStatus }
  * Exported IUpsStatus interface for reuse
  * Added ISnmpUpsStatus import to disambiguate from daemon's IUpsStatus

- Replaced 'any' with Record<string, unknown> in migration system:
  * Updated BaseMigration abstract class signatures
  * Updated MigrationRunner.run() signature
  * Updated migration-v4.0-to-v4.1.ts to use proper types
  * Migrations use Record<string, unknown> because they deal with
    unknown config schemas that are being upgraded

Benefits:
- TypeScript now catches type errors at compile time
- Would have caught the ups.thresholds bug earlier
- Better IDE autocomplete and type checking
- More maintainable and self-documenting code

deno.json

@@ -1,6 +1,6 @@
 {
   "name": "@serve.zone/nupst",
-  "version": "4.0.1",
+  "version": "4.2.5",
   "exports": "./mod.ts",
   "tasks": {
     "dev": "deno run --allow-all mod.ts",

example-action.sh

@@ -0,0 +1,122 @@
+#!/bin/bash
+# NUPST Action Script Example
+# Copy this to /etc/nupst/ and customize for your needs
+#
+# This script is called by NUPST when power events or threshold violations occur.
+# It receives UPS state information via environment variables and command-line arguments.
+
+# ==============================================================================
+# ARGUMENTS (positional parameters)
+# ==============================================================================
+# $1 = Power Status (online|onBattery|unknown)
+# $2 = Battery Capacity (percentage, 0-100)
+# $3 = Battery Runtime (estimated minutes remaining)
+
+POWER_STATUS=$1
+BATTERY_CAPACITY=$2
+BATTERY_RUNTIME=$3
+
+# ==============================================================================
+# ENVIRONMENT VARIABLES
+# ==============================================================================
+# NUPST_UPS_ID               - Unique UPS identifier
+# NUPST_UPS_NAME             - Human-readable UPS name
+# NUPST_POWER_STATUS         - Current power status
+# NUPST_BATTERY_CAPACITY     - Battery percentage (0-100)
+# NUPST_BATTERY_RUNTIME      - Estimated runtime in minutes
+# NUPST_THRESHOLDS_EXCEEDED  - "true" if below configured thresholds
+# NUPST_TRIGGER_REASON       - "powerStatusChange" or "thresholdViolation"
+# NUPST_BATTERY_THRESHOLD    - Configured battery threshold percentage
+# NUPST_RUNTIME_THRESHOLD    - Configured runtime threshold in minutes
+# NUPST_TIMESTAMP            - Unix timestamp (milliseconds since epoch)
+
+# ==============================================================================
+# EXAMPLE: Log the event
+# ==============================================================================
+LOG_FILE="/var/log/nupst-actions.log"
+
+echo "========================================" >> "$LOG_FILE"
+echo "NUPST Action Triggered: $(date)" >> "$LOG_FILE"
+echo "----------------------------------------" >> "$LOG_FILE"
+echo "UPS: $NUPST_UPS_NAME ($NUPST_UPS_ID)" >> "$LOG_FILE"
+echo "Power Status: $POWER_STATUS" >> "$LOG_FILE"
+echo "Battery: $BATTERY_CAPACITY%" >> "$LOG_FILE"
+echo "Runtime: $BATTERY_RUNTIME minutes" >> "$LOG_FILE"
+echo "Trigger Reason: $NUPST_TRIGGER_REASON" >> "$LOG_FILE"
+echo "Thresholds Exceeded: $NUPST_THRESHOLDS_EXCEEDED" >> "$LOG_FILE"
+echo "========================================" >> "$LOG_FILE"
+
+# ==============================================================================
+# EXAMPLE: Send email notification
+# ==============================================================================
+# if [ "$NUPST_TRIGGER_REASON" = "thresholdViolation" ]; then
+#   echo "ALERT: UPS $NUPST_UPS_NAME battery critical!" | \
+#     mail -s "UPS Battery Critical" admin@example.com
+# fi
+
+# ==============================================================================
+# EXAMPLE: Gracefully shutdown virtual machines
+# ==============================================================================
+# if [ "$NUPST_POWER_STATUS" = "onBattery" ] && [ "$NUPST_THRESHOLDS_EXCEEDED" = "true" ]; then
+#   echo "Shutting down VMs..." >> "$LOG_FILE"
+#   # virsh shutdown vm1
+#   # virsh shutdown vm2
+#   # Wait for VMs to shutdown
+#   # sleep 120
+# fi
+
+# ==============================================================================
+# EXAMPLE: Call external API/service
+# ==============================================================================
+# curl -X POST https://monitoring.example.com/ups-alert \
+#   -H "Content-Type: application/json" \
+#   -d "{
+#     \"upsId\": \"$NUPST_UPS_ID\",
+#     \"upsName\": \"$NUPST_UPS_NAME\",
+#     \"powerStatus\": \"$POWER_STATUS\",
+#     \"batteryCapacity\": $BATTERY_CAPACITY,
+#     \"batteryRuntime\": $BATTERY_RUNTIME,
+#     \"triggerReason\": \"$NUPST_TRIGGER_REASON\"
+#   }"
+
+# ==============================================================================
+# EXAMPLE: Remote shutdown via SSH with password
+# ==============================================================================
+# You can implement custom shutdown logic for remote systems
+# that require password authentication or webhooks
+#
+# if [ "$NUPST_THRESHOLDS_EXCEEDED" = "true" ]; then
+#   # Call a webhook with a secret password/token
+#   curl -X POST "https://remote-server.local/shutdown?token=YOUR_SECRET_TOKEN"
+#
+#   # Or use SSH with password (requires sshpass)
+#   # sshpass -p 'your-password' ssh user@remote-server 'sudo shutdown -h +5'
+# fi
+
+# ==============================================================================
+# EXAMPLE: Conditional logic based on battery level
+# ==============================================================================
+# if [ "$BATTERY_CAPACITY" -lt 20 ]; then
+#   echo "Battery critically low! Immediate action needed." >> "$LOG_FILE"
+# elif [ "$BATTERY_CAPACITY" -lt 50 ]; then
+#   echo "Battery low. Preparing for shutdown." >> "$LOG_FILE"
+# else
+#   echo "Battery acceptable. Monitoring." >> "$LOG_FILE"
+# fi
+
+# ==============================================================================
+# EXAMPLE: Different actions for different trigger reasons
+# ==============================================================================
+# case "$NUPST_TRIGGER_REASON" in
+#   powerStatusChange)
+#     echo "Power status changed to: $POWER_STATUS" >> "$LOG_FILE"
+#     # Send notification but don't take drastic action yet
+#     ;;
+#   thresholdViolation)
+#     echo "Thresholds violated! Taking emergency action." >> "$LOG_FILE"
+#     # Initiate graceful shutdowns, save data, etc.
+#     ;;
+# esac
+
+# Exit with success
+exit 0

install.sh

@@ -10,15 +10,7 @@
 #   With version specification:
 #     curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- --version v4.0.0
 #
-#   Non-interactive mode (auto-confirm):
-#     curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y
-#
-#   Downloaded script:
-#     curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh -o nupst-install.sh
-#     sudo bash nupst-install.sh
-#
 # Options:
-#   -y, --yes              Automatically answer yes to all prompts
 #   -h, --help             Show this help message
 #   --version VERSION      Install specific version (e.g., v4.0.0)
 #   --install-dir DIR      Installation directory (default: /opt/nupst)
@@ -26,7 +18,6 @@
 set -e
 
 # Default values
-AUTO_YES=0
 SHOW_HELP=0
 SPECIFIED_VERSION=""
 INSTALL_DIR="/opt/nupst"
@@ -36,10 +27,6 @@ GITEA_REPO="serve.zone/nupst"
 # Parse command line arguments
 while [[ $# -gt 0 ]]; do
   case $1 in
-    -y|--yes)
-      AUTO_YES=1
-      shift
-      ;;
     -h|--help)
       SHOW_HELP=1
       shift
@@ -67,7 +54,6 @@ if [ $SHOW_HELP -eq 1 ]; then
   echo "Usage: $0 [options]"
   echo ""
   echo "Options:"
-  echo "  -y, --yes              Automatically answer yes to all prompts"
   echo "  -h, --help             Show this help message"
   echo "  --version VERSION      Install specific version (e.g., v4.0.0)"
   echo "  --install-dir DIR      Installation directory (default: /opt/nupst)"
@@ -78,9 +64,6 @@ if [ $SHOW_HELP -eq 1 ]; then
   echo ""
   echo "  # Install specific version"
   echo "  curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- --version v4.0.0"
-  echo ""
-  echo "  # Non-interactive installation"
-  echo "  curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y"
   exit 0
 fi
 
@@ -90,32 +73,6 @@ if [ "$EUID" -ne 0 ]; then
   exit 1
 fi
 
-# Detect if script is being piped or run directly
-INTERACTIVE=1
-if [ ! -t 0 ] || [ ! -t 1 ]; then
-  # Either stdin or stdout is not a terminal
-  if [ $AUTO_YES -ne 1 ]; then
-    echo "Script detected it's running in a non-interactive environment without -y flag."
-    echo "Attempting to find a controlling terminal for interactive prompts..."
-    # Try to use a controlling terminal for user input
-    exec < /dev/tty 2>/dev/null || INTERACTIVE=0
-
-    if [ $INTERACTIVE -eq 0 ]; then
-      echo "ERROR: No controlling terminal available for interactive prompts."
-      echo ""
-      echo "For interactive installation (RECOMMENDED):"
-      echo "  curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh -o nupst-install.sh"
-      echo "  sudo bash nupst-install.sh"
-      echo ""
-      echo "For non-interactive installation with auto-confirm:"
-      echo "  curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y"
-      exit 1
-    else
-      echo "Interactive terminal found, continuing with prompts..."
-    fi
-  fi
-fi
-
 # Helper function to detect OS and architecture
 detect_platform() {
   local os=$(uname -s)
@@ -225,22 +182,6 @@ if [ -d "$INSTALL_DIR" ]; then
     echo ""
   fi
 
-  if [ $AUTO_YES -eq 0 ] && [ $INTERACTIVE -eq 1 ]; then
-    if [ $OLD_NODE_INSTALL -eq 1 ]; then
-      echo "This will replace your Node.js installation with a pre-compiled binary."
-      echo "Your configuration in /etc/nupst/config.json will be preserved."
-      echo ""
-    fi
-    echo "Installation directory already exists: $INSTALL_DIR"
-    echo "Do you want to update/reinstall? (Y/n): "
-    read -r update_confirm
-
-    if [[ "$update_confirm" =~ ^[Nn]$ ]]; then
-      echo "Installation cancelled."
-      exit 0
-    fi
-  fi
-
   echo "Updating existing installation at $INSTALL_DIR..."
 
   # Check if service exists (enabled or running) and stop it if active
@@ -269,17 +210,6 @@ if [ -d "$INSTALL_DIR" ]; then
     echo "Old installation files removed."
   fi
 else
-  if [ $AUTO_YES -eq 0 ] && [ $INTERACTIVE -eq 1 ]; then
-    echo "NUPST will be installed to: $INSTALL_DIR"
-    echo "Continue? (Y/n): "
-    read -r install_confirm
-
-    if [[ "$install_confirm" =~ ^[Nn]$ ]]; then
-      echo "Installation cancelled."
-      exit 0
-    fi
-  fi
-
   echo "Creating installation directory: $INSTALL_DIR"
   mkdir -p "$INSTALL_DIR"
 fi
@@ -325,22 +255,8 @@ else
 fi
 
 # Create symlink for global access
-if [ $AUTO_YES -eq 0 ] && [ $INTERACTIVE -eq 1 ]; then
+ln -sf "$BINARY_PATH" "$BIN_DIR/nupst"
-  echo "Create symlink in $BIN_DIR for global access? (Y/n): "
+echo "Symlink created: $BIN_DIR/nupst -> $BINARY_PATH"
-  read -r symlink_confirm
-
-  if [[ ! "$symlink_confirm" =~ ^[Nn]$ ]]; then
-    ln -sf "$BINARY_PATH" "$BIN_DIR/nupst"
-    echo "Symlink created: $BIN_DIR/nupst -> $BINARY_PATH"
-  else
-    echo "Symlink creation skipped."
-    echo "To use NUPST, run: $BINARY_PATH"
-    echo "Or manually create symlink: sudo ln -sf $BINARY_PATH $BIN_DIR/nupst"
-  fi
-else
-  ln -sf "$BINARY_PATH" "$BIN_DIR/nupst"
-  echo "Symlink created: $BIN_DIR/nupst -> $BINARY_PATH"
-fi
 
 echo ""
 

readme.md

@@ -29,15 +29,8 @@ dependencies.
 The easiest way to install NUPST is using the automated installer:
 
 ```bash
-# Download and run installer (most reliable)
+# One-line installation
-curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh -o nupst-install.sh
+curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash
-sudo bash nupst-install.sh
-rm nupst-install.sh
-```
-
-```bash
-# One-line installation (non-interactive with auto-confirm)
-curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y
 ```
 
 The installer will:
@@ -76,7 +69,6 @@ sudo mv nupst /usr/local/bin/nupst
 The installer script (`install.sh`) supports the following options:
 
 ```
--y, --yes                Automatically answer yes to all prompts
 -h, --help               Show help message
 --version VERSION        Install specific version (e.g., --version v4.0.0)
 --install-dir DIR        Custom installation directory (default: /opt/nupst)
@@ -373,7 +365,7 @@ sudo nupst service disable
 Re-run the installer to update to the latest version:
 
 ```bash
-curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y
+curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash
 ```
 
 The installer will:
@@ -461,7 +453,7 @@ The installer script automatically handles the entire migration while preserving
 
 ```bash
 # Run the installer (handles stop/update/restart automatically)
-curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y
+curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash
 
 # Verify
 nupst service status

test/manualdocker/00-test-fresh-v4-install.sh

@@ -0,0 +1,168 @@
+#!/bin/bash
+#
+# Test fresh v4 installation from scratch
+# Tests the most common user scenario: clean install using curl | bash
+#
+
+set -e
+
+CONTAINER_NAME="nupst-test-fresh-v4"
+
+echo "================================================"
+echo "  NUPST Fresh v4 Installation Test"
+echo "================================================"
+echo ""
+
+# Check if container already exists
+if docker ps -a --format '{{.Names}}' | grep -q "^${CONTAINER_NAME}$"; then
+  echo "⚠️  Container ${CONTAINER_NAME} already exists"
+  read -p "Remove and recreate? (y/N): " -n 1 -r
+  echo
+  if [[ $REPLY =~ ^[Yy]$ ]]; then
+    echo "→ Stopping and removing existing container..."
+    docker stop ${CONTAINER_NAME} 2>/dev/null || true
+    docker rm ${CONTAINER_NAME} 2>/dev/null || true
+  else
+    echo "Exiting. Remove manually with: docker rm -f ${CONTAINER_NAME}"
+    exit 1
+  fi
+fi
+
+echo "→ Creating Docker container with systemd..."
+docker run -d \
+  --name ${CONTAINER_NAME} \
+  --privileged \
+  --cgroupns=host \
+  -v /sys/fs/cgroup:/sys/fs/cgroup:rw \
+  ubuntu:22.04 \
+  /bin/bash -c "apt-get update && apt-get install -y systemd systemd-sysv && exec /sbin/init"
+
+echo "→ Waiting for systemd to initialize..."
+sleep 10
+
+echo "→ Waiting for dpkg lock to be released..."
+docker exec ${CONTAINER_NAME} bash -c "
+  while fuser /var/lib/dpkg/lock-frontend >/dev/null 2>&1; do
+    echo '  Waiting for dpkg lock...'
+    sleep 2
+  done
+  echo '  dpkg lock released'
+"
+
+echo "→ Installing prerequisites (curl)..."
+docker exec ${CONTAINER_NAME} bash -c "
+  apt-get update -qq
+  apt-get install -y -qq curl
+"
+
+echo ""
+echo "→ Installing NUPST v4 using curl | bash..."
+echo "   Command: curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | bash -s -- -y"
+echo ""
+
+docker exec ${CONTAINER_NAME} bash -c "
+  curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | bash -s -- -y
+"
+
+echo ""
+echo "================================================"
+echo "  Verifying Installation"
+echo "================================================"
+echo ""
+
+echo "→ Checking binary location..."
+docker exec ${CONTAINER_NAME} bash -c "
+  if [ -f /opt/nupst/nupst ]; then
+    echo '  ✓ Binary exists at /opt/nupst/nupst'
+    ls -lh /opt/nupst/nupst
+  else
+    echo '  ✗ Binary not found at /opt/nupst/nupst'
+    exit 1
+  fi
+"
+
+echo ""
+echo "→ Checking symlink..."
+docker exec ${CONTAINER_NAME} bash -c "
+  if [ -L /usr/local/bin/nupst ]; then
+    echo '  ✓ Symlink exists at /usr/local/bin/nupst'
+    ls -lh /usr/local/bin/nupst
+  elif [ -L /usr/bin/nupst ]; then
+    echo '  ✓ Symlink exists at /usr/bin/nupst'
+    ls -lh /usr/bin/nupst
+  else
+    echo '  ✗ Symlink not found in /usr/local/bin or /usr/bin'
+    exit 1
+  fi
+"
+
+echo ""
+echo "→ Checking PATH integration..."
+docker exec ${CONTAINER_NAME} bash -c "
+  NUPST_PATH=\$(which nupst 2>/dev/null)
+  if [ -n \"\$NUPST_PATH\" ]; then
+    echo '  ✓ nupst found in PATH at: '\$NUPST_PATH
+  else
+    echo '  ✗ nupst not found in PATH'
+    echo '  PATH contents:'
+    echo \$PATH
+    exit 1
+  fi
+"
+
+echo ""
+echo "→ Testing nupst command execution..."
+docker exec ${CONTAINER_NAME} nupst --version
+
+echo ""
+echo "→ Creating minimal config for service test..."
+docker exec ${CONTAINER_NAME} bash -c "
+  mkdir -p /etc/nupst
+  cat > /etc/nupst/config.json << 'EOF'
+{
+  \"version\": \"4.0\",
+  \"upsDevices\": [],
+  \"groups\": [],
+  \"checkInterval\": 30000
+}
+EOF
+  echo '  ✓ Minimal config created'
+"
+
+echo ""
+echo "→ Testing service creation..."
+docker exec ${CONTAINER_NAME} bash -c "
+  echo '  Running: nupst service enable'
+  nupst service enable
+
+  if [ -f /etc/systemd/system/nupst.service ]; then
+    echo '  ✓ Service file created successfully'
+  else
+    echo '  ✗ Service file creation failed'
+    exit 1
+  fi
+"
+
+echo ""
+echo "→ Checking if service is enabled..."
+docker exec ${CONTAINER_NAME} systemctl is-enabled nupst
+
+echo ""
+echo "================================================"
+echo "  ✓ Fresh v4 Installation Test Complete"
+echo "================================================"
+echo ""
+echo "Installation verified successfully:"
+echo "  • Binary installed to /opt/nupst/nupst"
+echo "  • Symlink created for global access"
+echo "  • nupst command available in PATH"
+echo "  • Command executes correctly"
+echo "  • Systemd service file created"
+echo ""
+echo "Useful commands:"
+echo "  docker exec -it ${CONTAINER_NAME} bash"
+echo "  docker exec ${CONTAINER_NAME} nupst --help"
+echo "  docker exec ${CONTAINER_NAME} nupst service status"
+echo "  docker stop ${CONTAINER_NAME}"
+echo "  docker rm -f ${CONTAINER_NAME}"
+echo ""

test/manualdocker/01-setup-v3-container.sh

@@ -53,7 +53,7 @@ docker exec ${CONTAINER_NAME} bash -c "
 echo "→ Installing prerequisites in container..."
 docker exec ${CONTAINER_NAME} bash -c "
   apt-get update -qq
-  apt-get install -y -qq git curl sudo
+  apt-get install -y -qq git curl sudo jq
 "
 
 echo "→ Cloning NUPST v3 (commit ${V3_COMMIT})..."
@@ -66,35 +66,59 @@ docker exec ${CONTAINER_NAME} bash -c "
   git log -1 --oneline
 "
 
-echo "→ Running NUPST v3 installation script..."
+echo "→ Running NUPST v3 installation directly (bypassing install.sh auto-update)..."
 docker exec ${CONTAINER_NAME} bash -c "
   cd /opt/nupst
-  bash install.sh -y
+  # Run setup.sh directly to avoid install.sh trying to update to v4
+  bash setup.sh -y
 "
 
-echo "→ Creating dummy NUPST configuration for testing..."
+echo "→ Creating NUPST configuration using real UPS data from .nogit/env.json..."
-docker exec ${CONTAINER_NAME} bash -c "
+
-  mkdir -p /etc/nupst
+# Check if .nogit/env.json exists
-  cat > /etc/nupst/config.json << 'EOF'
+if [ ! -f "../../.nogit/env.json" ]; then
+  echo "❌ Error: .nogit/env.json not found"
+  echo "This file contains test UPS credentials and is required for testing"
+  exit 1
+fi
+
+# Read UPS data from .nogit/env.json and create v3 config
+docker exec ${CONTAINER_NAME} bash -c "mkdir -p /etc/nupst"
+
+# Generate config from .nogit/env.json using jq
+cat ../../.nogit/env.json | jq -r '
 {
-  \"upsList\": [
+  "upsList": [
     {
-      \"id\": \"test-ups\",
+      "id": "test-ups-v1",
-      \"name\": \"Test UPS\",
+      "name": "Test UPS (SNMP v1)",
-      \"host\": \"127.0.0.1\",
+      "host": .testConfigV1.snmp.host,
-      \"port\": 161,
+      "port": .testConfigV1.snmp.port,
-      \"community\": \"public\",
+      "community": .testConfigV1.snmp.community,
-      \"version\": \"2c\",
+      "version": (.testConfigV1.snmp.version | tostring),
-      \"batteryLowOID\": \"1.3.6.1.4.1.935.1.1.1.3.3.1.0\",
+      "batteryLowOID": "1.3.6.1.4.1.935.1.1.1.3.3.1.0",
-      \"onBatteryOID\": \"1.3.6.1.4.1.935.1.1.1.3.3.2.0\",
+      "onBatteryOID": "1.3.6.1.4.1.935.1.1.1.3.3.2.0",
-      \"shutdownCommand\": \"echo 'Shutdown triggered'\"
+      "shutdownCommand": "echo \"Shutdown triggered for test-ups-v1\""
+    },
+    {
+      "id": "test-ups-v3",
+      "name": "Test UPS (SNMP v3)",
+      "host": .testConfigV3.snmp.host,
+      "port": .testConfigV3.snmp.port,
+      "version": (.testConfigV3.snmp.version | tostring),
+      "securityLevel": .testConfigV3.snmp.securityLevel,
+      "username": .testConfigV3.snmp.username,
+      "authProtocol": .testConfigV3.snmp.authProtocol,
+      "authKey": .testConfigV3.snmp.authKey,
+      "batteryLowOID": "1.3.6.1.4.1.935.1.1.1.3.3.1.0",
+      "onBatteryOID": "1.3.6.1.4.1.935.1.1.1.3.3.2.0",
+      "shutdownCommand": "echo \"Shutdown triggered for test-ups-v3\""
     }
   ],
-  \"groups\": []
+  "groups": []
-}
+}' | docker exec -i ${CONTAINER_NAME} tee /etc/nupst/config.json > /dev/null
-EOF
+
-  echo 'Dummy config created at /etc/nupst/config.json'
+echo "  ✓ Real UPS config created at /etc/nupst/config.json (from .nogit/env.json)"
-"
 
 echo "→ Enabling NUPST systemd service..."
 docker exec ${CONTAINER_NAME} bash -c "

test/manualdocker/02-test-v3-to-v4-migration.sh

@@ -32,23 +32,10 @@ echo "→ Stopping v3 service..."
 docker exec ${CONTAINER_NAME} systemctl stop nupst
 echo ""
 
-echo "→ Pulling latest v4 code from migration/deno-v4 branch..."
+echo "→ Running v4 installation from main branch (should auto-detect v3 and migrate)..."
+echo "   Using: curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash"
 docker exec ${CONTAINER_NAME} bash -c "
-  cd /opt/nupst
+  curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | bash -s -- -y
-  git fetch origin
-  # Reset any local changes made by install.sh
-  git reset --hard HEAD
-  git clean -fd
-  git checkout migration/deno-v4
-  git pull origin migration/deno-v4
-  echo 'Now on:'
-  git log -1 --oneline
-"
-
-echo "→ Running install.sh (should auto-detect v3 and migrate)..."
-docker exec ${CONTAINER_NAME} bash -c "
-  cd /opt/nupst
-  bash install.sh -y
 "
 
 echo "→ Checking service status after migration..."

test/test.showcase.ts

@@ -0,0 +1,233 @@
+/**
+ * Showcase test for NUPST CLI outputs
+ * Demonstrates all the beautiful colored output features
+ *
+ * Run with: deno run --allow-all test/showcase.ts
+ */
+
+import { logger, type ITableColumn } from '../ts/logger.ts';
+import { theme, symbols, getBatteryColor, formatPowerStatus } from '../ts/colors.ts';
+
+console.log('');
+console.log('═'.repeat(80));
+logger.highlight('NUPST CLI OUTPUT SHOWCASE');
+logger.dim('Demonstrating beautiful, colored terminal output');
+console.log('═'.repeat(80));
+console.log('');
+
+// === 1. Basic Logging Methods ===
+logger.logBoxTitle('Basic Logging Methods', 60, 'info');
+logger.logBoxLine('');
+logger.log('Normal log message (default color)');
+logger.success('Success message with ✓ symbol');
+logger.error('Error message with ✗ symbol');
+logger.warn('Warning message with ⚠ symbol');
+logger.info('Info message with ℹ symbol');
+logger.dim('Dim/secondary text for less important info');
+logger.highlight('Highlighted/bold text for emphasis');
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 2. Colored Boxes ===
+logger.logBoxTitle('Colored Box Styles', 60);
+logger.logBoxLine('');
+logger.logBoxLine('Boxes can be styled with different colors:');
+logger.logBoxEnd();
+
+console.log('');
+
+logger.logBox('Success Box (Green)', [
+  'Used for successful operations',
+  'Installation complete, service started, etc.',
+], 60, 'success');
+
+console.log('');
+
+logger.logBox('Error Box (Red)', [
+  'Used for critical errors and failures',
+  'Configuration errors, connection failures, etc.',
+], 60, 'error');
+
+console.log('');
+
+logger.logBox('Warning Box (Yellow)', [
+  'Used for warnings and deprecations',
+  'Old command format, missing config, etc.',
+], 60, 'warning');
+
+console.log('');
+
+logger.logBox('Info Box (Cyan)', [
+  'Used for informational messages',
+  'Version info, update available, etc.',
+], 60, 'info');
+
+console.log('');
+
+// === 3. Status Symbols ===
+logger.logBoxTitle('Status Symbols', 60, 'info');
+logger.logBoxLine('');
+logger.logBoxLine(`${symbols.running}  Service Running`);
+logger.logBoxLine(`${symbols.stopped}  Service Stopped`);
+logger.logBoxLine(`${symbols.starting}  Service Starting`);
+logger.logBoxLine(`${symbols.unknown}  Status Unknown`);
+logger.logBoxLine('');
+logger.logBoxLine(`${symbols.success}  Operation Successful`);
+logger.logBoxLine(`${symbols.error}  Operation Failed`);
+logger.logBoxLine(`${symbols.warning}  Warning Condition`);
+logger.logBoxLine(`${symbols.info}  Information`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 4. Battery Level Colors ===
+logger.logBoxTitle('Battery Level Color Coding', 60, 'info');
+logger.logBoxLine('');
+logger.logBoxLine('Battery levels are color-coded:');
+logger.logBoxLine('');
+logger.logBoxLine(`  ${getBatteryColor(85)('85%')} - Good (green, ≥60%)`);
+logger.logBoxLine(`  ${getBatteryColor(45)('45%')} - Medium (yellow, 30-60%)`);
+logger.logBoxLine(`  ${getBatteryColor(15)('15%')} - Critical (red, <30%)`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 5. Power Status Formatting ===
+logger.logBoxTitle('Power Status Formatting', 60, 'info');
+logger.logBoxLine('');
+logger.logBoxLine(`Status: ${formatPowerStatus('online')}`);
+logger.logBoxLine(`Status: ${formatPowerStatus('onBattery')}`);
+logger.logBoxLine(`Status: ${formatPowerStatus('unknown')}`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 6. Table Formatting ===
+const upsColumns: ITableColumn[] = [
+  { header: 'ID', key: 'id' },
+  { header: 'Name', key: 'name' },
+  { header: 'Host', key: 'host' },
+  { header: 'Status', key: 'status', color: (v) => {
+    if (v.includes('Online')) return theme.success(v);
+    if (v.includes('Battery')) return theme.warning(v);
+    return theme.dim(v);
+  }},
+  { header: 'Battery', key: 'battery', align: 'right', color: (v) => {
+    const pct = parseInt(v);
+    return getBatteryColor(pct)(v);
+  }},
+  { header: 'Runtime', key: 'runtime', align: 'right' },
+];
+
+const upsData = [
+  {
+    id: 'ups-1',
+    name: 'Main UPS',
+    host: '192.168.1.10',
+    status: 'Online',
+    battery: '95%',
+    runtime: '45 min',
+  },
+  {
+    id: 'ups-2',
+    name: 'Backup UPS',
+    host: '192.168.1.11',
+    status: 'On Battery',
+    battery: '42%',
+    runtime: '12 min',
+  },
+  {
+    id: 'ups-3',
+    name: 'Critical UPS',
+    host: '192.168.1.12',
+    status: 'On Battery',
+    battery: '18%',
+    runtime: '5 min',
+  },
+];
+
+logger.logTable(upsColumns, upsData, 'UPS Devices');
+
+console.log('');
+
+// === 7. Group Table ===
+const groupColumns: ITableColumn[] = [
+  { header: 'ID', key: 'id' },
+  { header: 'Name', key: 'name' },
+  { header: 'Mode', key: 'mode' },
+  { header: 'UPS Count', key: 'count', align: 'right' },
+];
+
+const groupData = [
+  { id: 'dc-1', name: 'Data Center 1', mode: 'redundant', count: '3' },
+  { id: 'office', name: 'Office Servers', mode: 'nonRedundant', count: '2' },
+];
+
+logger.logTable(groupColumns, groupData, 'UPS Groups');
+
+console.log('');
+
+// === 8. Service Status Example ===
+logger.logBoxTitle('Service Status', 70, 'success');
+logger.logBoxLine('');
+logger.logBoxLine(`Status:   ${symbols.running} ${theme.statusActive('Active (Running)')}`);
+logger.logBoxLine(`Enabled:  ${symbols.success} ${theme.success('Yes')}`);
+logger.logBoxLine(`Uptime:   2 days, 5 hours, 23 minutes`);
+logger.logBoxLine(`PID:      ${theme.dim('12345')}`);
+logger.logBoxLine(`Memory:   ${theme.dim('45.2 MB')}`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 9. Configuration Example ===
+logger.logBoxTitle('Configuration', 70);
+logger.logBoxLine('');
+logger.logBoxLine(`UPS Devices:      ${theme.highlight('3')}`);
+logger.logBoxLine(`Groups:           ${theme.highlight('2')}`);
+logger.logBoxLine(`Check Interval:   ${theme.dim('30 seconds')}`);
+logger.logBoxLine(`Config File:      ${theme.path('/etc/nupst/config.json')}`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 10. Update Available Example ===
+logger.logBoxTitle('Update Available', 70, 'warning');
+logger.logBoxLine('');
+logger.logBoxLine(`Current Version:  ${theme.dim('4.0.1')}`);
+logger.logBoxLine(`Latest Version:   ${theme.highlight('4.0.2')}`);
+logger.logBoxLine('');
+logger.logBoxLine(`Run ${theme.command('sudo nupst update')} to update`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === 11. Error Example ===
+logger.logBoxTitle('Error Example', 70, 'error');
+logger.logBoxLine('');
+logger.logBoxLine(`${symbols.error} Failed to connect to UPS at 192.168.1.10`);
+logger.logBoxLine('');
+logger.logBoxLine('Possible causes:');
+logger.logBoxLine(`  ${theme.dim('• UPS is offline or unreachable')}`);
+logger.logBoxLine(`  ${theme.dim('• Incorrect SNMP community string')}`);
+logger.logBoxLine(`  ${theme.dim('• Firewall blocking port 161')}`);
+logger.logBoxLine('');
+logger.logBoxLine(`Try: ${theme.command('nupst ups test --debug')}`);
+logger.logBoxLine('');
+logger.logBoxEnd();
+
+console.log('');
+
+// === Final Summary ===
+console.log('═'.repeat(80));
+logger.success('CLI Output Showcase Complete!');
+logger.dim('All color and formatting features demonstrated');
+console.log('═'.repeat(80));
+console.log('');

ts/00_commitinfo_data.ts

@@ -6,5 +6,5 @@ import denoConfig from '../deno.json' with { type: 'json' };
 export const commitinfo = {
   name: denoConfig.name,
   version: denoConfig.version,
-  description: 'Deno-powered UPS monitoring tool for SNMP-enabled UPS devices',
+  description: 'Network UPS Shutdown Tool (https://nupst.serve.zone)',
 };

ts/actions/base-action.ts

@@ -0,0 +1,170 @@
+/**
+ * Base classes and interfaces for the NUPST action system
+ *
+ * Actions are triggered on:
+ * 1. Power status changes (online ↔ onBattery)
+ * 2. Threshold violations (battery/runtime cross below configured thresholds)
+ */
+
+export type TPowerStatus = 'online' | 'onBattery' | 'unknown';
+
+/**
+ * Context provided to actions when they execute
+ * Contains all relevant UPS state and trigger information
+ */
+export interface IActionContext {
+  // UPS identification
+  /** Unique ID of the UPS */
+  upsId: string;
+  /** Human-readable name of the UPS */
+  upsName: string;
+
+  // Current state
+  /** Current power status */
+  powerStatus: TPowerStatus;
+  /** Current battery capacity percentage (0-100) */
+  batteryCapacity: number;
+  /** Estimated battery runtime in minutes */
+  batteryRuntime: number;
+
+  // State tracking
+  /** Previous power status before this trigger */
+  previousPowerStatus: TPowerStatus;
+
+  // Metadata
+  /** Timestamp when this action was triggered (milliseconds since epoch) */
+  timestamp: number;
+  /** Reason this action was triggered */
+  triggerReason: 'powerStatusChange' | 'thresholdViolation';
+}
+
+/**
+ * Action trigger mode - determines when an action executes
+ */
+export type TActionTriggerMode =
+  | 'onlyPowerChanges' // Only on power status changes (online ↔ onBattery)
+  | 'onlyThresholds' // Only when action's thresholds are exceeded
+  | 'powerChangesAndThresholds' // On power changes OR threshold violations
+  | 'anyChange'; // On every UPS poll/check (every ~30s)
+
+/**
+ * Configuration for an action
+ */
+export interface IActionConfig {
+  /** Type of action to execute */
+  type: 'shutdown' | 'webhook' | 'script';
+
+  // Trigger configuration
+  /**
+   * When should this action be triggered?
+   * - onlyPowerChanges: Only on power status changes
+   * - onlyThresholds: Only when thresholds exceeded
+   * - powerChangesAndThresholds: On both (default)
+   * - anyChange: On every check
+   */
+  triggerMode?: TActionTriggerMode;
+
+  // Threshold configuration (applies to all action types)
+  /** Threshold settings for this action */
+  thresholds?: {
+    /** Battery percentage threshold (0-100) */
+    battery: number;
+    /** Runtime threshold in minutes */
+    runtime: number;
+  };
+
+  // Shutdown action configuration
+  /** Delay before shutdown in minutes (default: 5) */
+  shutdownDelay?: number;
+  /** Only execute shutdown on threshold violation, not power status changes */
+  onlyOnThresholdViolation?: boolean;
+
+  // Webhook action configuration
+  /** URL to call for webhook */
+  webhookUrl?: string;
+  /** HTTP method to use (default: POST) */
+  webhookMethod?: 'GET' | 'POST';
+  /** Timeout for webhook request in milliseconds (default: 10000) */
+  webhookTimeout?: number;
+  /** Only execute webhook on threshold violation */
+  webhookOnlyOnThresholdViolation?: boolean;
+
+  // Script action configuration
+  /** Path to script relative to /etc/nupst (e.g., "myaction.sh") */
+  scriptPath?: string;
+  /** Timeout for script execution in milliseconds (default: 60000) */
+  scriptTimeout?: number;
+  /** Only execute script on threshold violation */
+  scriptOnlyOnThresholdViolation?: boolean;
+}
+
+/**
+ * Abstract base class for all actions
+ * Each action type must extend this class and implement execute()
+ */
+export abstract class Action {
+  /** Type identifier for this action */
+  abstract readonly type: string;
+
+  /**
+   * Create a new action with the given configuration
+   * @param config Action configuration
+   */
+  constructor(protected config: IActionConfig) {}
+
+  /**
+   * Execute this action with the given context
+   * @param context Current UPS state and trigger information
+   */
+  abstract execute(context: IActionContext): Promise<void>;
+
+  /**
+   * Helper to check if this action should execute based on trigger mode
+   * @param context Action context with current UPS state
+   * @returns True if action should execute
+   */
+  protected shouldExecute(context: IActionContext): boolean {
+    const mode = this.config.triggerMode || 'powerChangesAndThresholds'; // Default
+
+    switch (mode) {
+      case 'onlyPowerChanges':
+        // Only execute on power status changes
+        return context.triggerReason === 'powerStatusChange';
+
+      case 'onlyThresholds':
+        // Only execute when this action's thresholds are exceeded
+        if (!this.config.thresholds) return false; // No thresholds = never execute
+        return this.areThresholdsExceeded(context.batteryCapacity, context.batteryRuntime);
+
+      case 'powerChangesAndThresholds':
+        // Execute on power changes OR when thresholds exceeded
+        if (context.triggerReason === 'powerStatusChange') return true;
+        if (!this.config.thresholds) return false;
+        return this.areThresholdsExceeded(context.batteryCapacity, context.batteryRuntime);
+
+      case 'anyChange':
+        // Execute on every trigger (power change or threshold check)
+        return true;
+
+      default:
+        return true;
+    }
+  }
+
+  /**
+   * Check if current battery/runtime exceeds this action's thresholds
+   * @param batteryCapacity Current battery percentage
+   * @param batteryRuntime Current runtime in minutes
+   * @returns True if thresholds are exceeded
+   */
+  protected areThresholdsExceeded(batteryCapacity: number, batteryRuntime: number): boolean {
+    if (!this.config.thresholds) {
+      return false; // No thresholds configured
+    }
+
+    return (
+      batteryCapacity < this.config.thresholds.battery ||
+      batteryRuntime < this.config.thresholds.runtime
+    );
+  }
+}

ts/actions/index.ts

@@ -0,0 +1,91 @@
+/**
+ * Action system exports and ActionManager
+ *
+ * This module provides the central coordination for the action system.
+ * The ActionManager is responsible for creating and executing actions.
+ */
+
+import { logger } from '../logger.ts';
+import type { Action, IActionConfig, IActionContext } from './base-action.ts';
+import { ShutdownAction } from './shutdown-action.ts';
+import { WebhookAction } from './webhook-action.ts';
+import { ScriptAction } from './script-action.ts';
+
+// Re-export types for convenience
+export type { IActionConfig, IActionContext, TPowerStatus } from './base-action.ts';
+export { Action } from './base-action.ts';
+export { ShutdownAction } from './shutdown-action.ts';
+export { WebhookAction } from './webhook-action.ts';
+export { ScriptAction } from './script-action.ts';
+
+/**
+ * ActionManager - Coordinates action creation and execution
+ *
+ * Provides factory methods for creating actions from configuration
+ * and orchestrates action execution with error handling.
+ */
+export class ActionManager {
+  /**
+   * Create an action instance from configuration
+   * @param config Action configuration
+   * @returns Instantiated action
+   * @throws Error if action type is unknown
+   */
+  static createAction(config: IActionConfig): Action {
+    switch (config.type) {
+      case 'shutdown':
+        return new ShutdownAction(config);
+      case 'webhook':
+        return new WebhookAction(config);
+      case 'script':
+        return new ScriptAction(config);
+      default:
+        throw new Error(`Unknown action type: ${(config as IActionConfig).type}`);
+    }
+  }
+
+  /**
+   * Execute a sequence of actions with the given context
+   * Each action runs sequentially, and failures are logged but don't stop the chain
+   * @param actions Array of action configurations to execute
+   * @param context Action context with UPS state
+   */
+  static async executeActions(
+    actions: IActionConfig[],
+    context: IActionContext,
+  ): Promise<void> {
+    if (!actions || actions.length === 0) {
+      return;
+    }
+
+    logger.log('');
+    logger.logBoxTitle(`Executing ${actions.length} Action(s)`, 60, 'info');
+    logger.logBoxLine(`Trigger: ${context.triggerReason}`);
+    logger.logBoxLine(`UPS: ${context.upsName} (${context.upsId})`);
+    logger.logBoxLine(`Power: ${context.powerStatus}`);
+    logger.logBoxLine(`Battery: ${context.batteryCapacity}% / ${context.batteryRuntime} min`);
+    logger.logBoxEnd();
+    logger.log('');
+
+    for (let i = 0; i < actions.length; i++) {
+      const actionConfig = actions[i];
+      try {
+        logger.info(`[${i + 1}/${actions.length}] ${actionConfig.type} action...`);
+
+        const action = this.createAction(actionConfig);
+        await action.execute(context);
+      } catch (error) {
+        logger.error(
+          `Action ${actionConfig.type} failed: ${
+            error instanceof Error ? error.message : String(error)
+          }`,
+        );
+        // Continue with next action despite failure
+      }
+    }
+
+    logger.log('');
+    logger.success('Action execution completed');
+    logger.log('');
+  }
+}

ts/actions/script-action.ts

@@ -0,0 +1,166 @@
+import * as path from 'node:path';
+import * as fs from 'node:fs';
+import { exec } from 'node:child_process';
+import { promisify } from 'node:util';
+import { Action, type IActionConfig, type IActionContext } from './base-action.ts';
+import { logger } from '../logger.ts';
+
+const execAsync = promisify(exec);
+
+/**
+ * ScriptAction - Executes a custom shell script from /etc/nupst/
+ *
+ * Runs user-provided scripts with UPS state passed as environment variables and arguments.
+ * Scripts must be .sh files located in /etc/nupst/ for security.
+ */
+export class ScriptAction extends Action {
+  readonly type = 'script';
+
+  private static readonly SCRIPT_DIR = '/etc/nupst';
+
+  /**
+   * Execute the script action
+   * @param context Action context with UPS state
+   */
+  async execute(context: IActionContext): Promise<void> {
+    // Check if we should execute based on trigger mode
+    if (!this.shouldExecute(context)) {
+      logger.info(`Script action skipped (trigger mode: ${this.config.triggerMode || 'powerChangesAndThresholds'})`);
+      return;
+    }
+
+    if (!this.config.scriptPath) {
+      logger.error('Script path not configured');
+      return;
+    }
+
+    // Validate and build script path
+    const scriptPath = this.validateAndBuildScriptPath(this.config.scriptPath);
+    if (!scriptPath) {
+      logger.error(`Invalid script path: ${this.config.scriptPath}`);
+      return;
+    }
+
+    // Check if script exists and is executable
+    if (!fs.existsSync(scriptPath)) {
+      logger.error(`Script not found: ${scriptPath}`);
+      return;
+    }
+
+    const timeout = this.config.scriptTimeout || 60000; // Default 60 seconds
+
+    logger.info(`Executing script: ${scriptPath}`);
+
+    try {
+      await this.executeScript(scriptPath, context, timeout);
+      logger.success('Script executed successfully');
+    } catch (error) {
+      logger.error(
+        `Script execution failed: ${error instanceof Error ? error.message : String(error)}`,
+      );
+      // Don't throw - script failures shouldn't stop other actions
+    }
+  }
+
+  /**
+   * Validate script path and build full path
+   * Ensures security by preventing path traversal and limiting to /etc/nupst
+   * @param scriptPath Relative script path from config
+   * @returns Full validated path or null if invalid
+   */
+  private validateAndBuildScriptPath(scriptPath: string): string | null {
+    // Remove any leading/trailing whitespace
+    scriptPath = scriptPath.trim();
+
+    // Reject paths with path traversal attempts
+    if (scriptPath.includes('..') || scriptPath.includes('/') || scriptPath.includes('\\')) {
+      logger.error('Script path must not contain directory separators or parent references');
+      return null;
+    }
+
+    // Require .sh extension
+    if (!scriptPath.endsWith('.sh')) {
+      logger.error('Script must have .sh extension');
+      return null;
+    }
+
+    // Build full path
+    return path.join(ScriptAction.SCRIPT_DIR, scriptPath);
+  }
+
+  /**
+   * Execute the script with UPS state as environment variables and arguments
+   * @param scriptPath Full path to the script
+   * @param context Action context
+   * @param timeout Execution timeout in milliseconds
+   */
+  private async executeScript(
+    scriptPath: string,
+    context: IActionContext,
+    timeout: number,
+  ): Promise<void> {
+    // Prepare environment variables
+    const env = {
+      ...process.env,
+      NUPST_UPS_ID: context.upsId,
+      NUPST_UPS_NAME: context.upsName,
+      NUPST_POWER_STATUS: context.powerStatus,
+      NUPST_BATTERY_CAPACITY: String(context.batteryCapacity),
+      NUPST_BATTERY_RUNTIME: String(context.batteryRuntime),
+      NUPST_TRIGGER_REASON: context.triggerReason,
+      NUPST_TIMESTAMP: String(context.timestamp),
+      // Include action's own thresholds if configured
+      NUPST_BATTERY_THRESHOLD: this.config.thresholds ? String(this.config.thresholds.battery) : '',
+      NUPST_RUNTIME_THRESHOLD: this.config.thresholds ? String(this.config.thresholds.runtime) : '',
+    };
+
+    // Build command with arguments
+    // Arguments: powerStatus batteryCapacity batteryRuntime
+    const args = [
+      context.powerStatus,
+      String(context.batteryCapacity),
+      String(context.batteryRuntime),
+    ].join(' ');
+
+    const command = `bash "${scriptPath}" ${args}`;
+
+    try {
+      const { stdout, stderr } = await execAsync(command, {
+        env,
+        cwd: ScriptAction.SCRIPT_DIR,
+        timeout,
+      });
+
+      // Log output
+      if (stdout) {
+        logger.log('Script stdout:');
+        logger.dim(stdout.trim());
+      }
+
+      if (stderr) {
+        logger.warn('Script stderr:');
+        logger.dim(stderr.trim());
+      }
+    } catch (error) {
+      // Check if it was a timeout
+      if (error instanceof Error && 'killed' in error && error.killed) {
+        throw new Error(`Script timed out after ${timeout}ms`);
+      }
+
+      // Include stdout/stderr in error if available
+      if (error && typeof error === 'object' && 'stdout' in error && 'stderr' in error) {
+        const execError = error as { stdout: string; stderr: string };
+        if (execError.stdout) {
+          logger.log('Script stdout:');
+          logger.dim(execError.stdout.trim());
+        }
+        if (execError.stderr) {
+          logger.warn('Script stderr:');
+          logger.dim(execError.stderr.trim());
+        }
+      }
+
+      throw error;
+    }
+  }
+}

ts/actions/shutdown-action.ts

@@ -0,0 +1,142 @@
+import * as fs from 'node:fs';
+import { execFile } from 'node:child_process';
+import { promisify } from 'node:util';
+import { Action, type IActionConfig, type IActionContext } from './base-action.ts';
+import { logger } from '../logger.ts';
+
+const execFileAsync = promisify(execFile);
+
+/**
+ * ShutdownAction - Initiates system shutdown
+ *
+ * This action triggers a system shutdown using the standard shutdown command.
+ * It includes a configurable delay to allow VMs and services to gracefully terminate.
+ */
+export class ShutdownAction extends Action {
+  readonly type = 'shutdown';
+
+  /**
+   * Execute the shutdown action
+   * @param context Action context with UPS state
+   */
+  async execute(context: IActionContext): Promise<void> {
+    // Check if we should execute based on trigger mode and thresholds
+    if (!this.shouldExecute(context)) {
+      logger.info(`Shutdown action skipped (trigger mode: ${this.config.triggerMode || 'powerChangesAndThresholds'})`);
+      return;
+    }
+
+    const shutdownDelay = this.config.shutdownDelay || 5; // Default 5 minutes
+
+    logger.log('');
+    logger.logBoxTitle('Initiating System Shutdown', 60, 'error');
+    logger.logBoxLine(`UPS: ${context.upsName} (${context.upsId})`);
+    logger.logBoxLine(`Power Status: ${context.powerStatus}`);
+    logger.logBoxLine(`Battery: ${context.batteryCapacity}%`);
+    logger.logBoxLine(`Runtime: ${context.batteryRuntime} minutes`);
+    logger.logBoxLine(`Trigger: ${context.triggerReason}`);
+    logger.logBoxLine(`Shutdown delay: ${shutdownDelay} minutes`);
+    logger.logBoxEnd();
+    logger.log('');
+
+    try {
+      await this.executeShutdownCommand(shutdownDelay);
+    } catch (error) {
+      logger.error(
+        `Shutdown command failed: ${error instanceof Error ? error.message : String(error)}`,
+      );
+      // Try alternative methods
+      await this.tryAlternativeShutdownMethods();
+    }
+  }
+
+  /**
+   * Execute the primary shutdown command
+   * @param delayMinutes Minutes to delay before shutdown
+   */
+  private async executeShutdownCommand(delayMinutes: number): Promise<void> {
+    // Find shutdown command in common system paths
+    const shutdownPaths = [
+      '/sbin/shutdown',
+      '/usr/sbin/shutdown',
+      '/bin/shutdown',
+      '/usr/bin/shutdown',
+    ];
+
+    let shutdownCmd = '';
+    for (const path of shutdownPaths) {
+      try {
+        if (fs.existsSync(path)) {
+          shutdownCmd = path;
+          logger.log(`Found shutdown command at: ${shutdownCmd}`);
+          break;
+        }
+      } catch (_e) {
+        // Continue checking other paths
+      }
+    }
+
+    if (shutdownCmd) {
+      // Execute shutdown command with delay to allow for VM graceful shutdown
+      const message = `UPS battery critical, shutting down in ${delayMinutes} minutes`;
+      logger.log(`Executing: ${shutdownCmd} -h +${delayMinutes} "${message}"`);
+
+      const { stdout } = await execFileAsync(shutdownCmd, [
+        '-h',
+        `+${delayMinutes}`,
+        message,
+      ]);
+
+      logger.log(`Shutdown initiated: ${stdout}`);
+      logger.log(`Allowing ${delayMinutes} minutes for VMs to shut down safely`);
+    } else {
+      throw new Error('Shutdown command not found in common paths');
+    }
+  }
+
+  /**
+   * Try alternative shutdown methods if primary command fails
+   */
+  private async tryAlternativeShutdownMethods(): Promise<void> {
+    logger.error('Trying alternative shutdown methods...');
+
+    const alternatives = [
+      { cmd: 'poweroff', args: ['--force'] },
+      { cmd: 'halt', args: ['-p'] },
+      { cmd: 'systemctl', args: ['poweroff'] },
+      { cmd: 'reboot', args: ['-p'] }, // Some systems allow reboot -p for power off
+    ];
+
+    for (const alt of alternatives) {
+      try {
+        // First check if command exists in common system paths
+        const paths = [
+          `/sbin/${alt.cmd}`,
+          `/usr/sbin/${alt.cmd}`,
+          `/bin/${alt.cmd}`,
+          `/usr/bin/${alt.cmd}`,
+        ];
+
+        let cmdPath = '';
+        for (const path of paths) {
+          if (fs.existsSync(path)) {
+            cmdPath = path;
+            break;
+          }
+        }
+
+        if (cmdPath) {
+          logger.log(`Trying alternative shutdown method: ${cmdPath} ${alt.args.join(' ')}`);
+          await execFileAsync(cmdPath, alt.args);
+          logger.log(`Alternative method ${alt.cmd} succeeded`);
+          return; // Exit if successful
+        }
+      } catch (_altError) {
+        logger.error(`Alternative method ${alt.cmd} failed`);
+        // Continue to next method
+      }
+    }
+
+    logger.error('All shutdown methods failed');
+  }
+}

ts/actions/webhook-action.ts

@@ -0,0 +1,141 @@
+import * as http from 'node:http';
+import * as https from 'node:https';
+import { URL } from 'node:url';
+import { Action, type IActionConfig, type IActionContext } from './base-action.ts';
+import { logger } from '../logger.ts';
+
+/**
+ * WebhookAction - Calls an HTTP webhook with UPS state information
+ *
+ * Sends UPS status to a configured webhook URL via GET or POST.
+ * This is useful for remote notifications and integrations with external systems.
+ */
+export class WebhookAction extends Action {
+  readonly type = 'webhook';
+
+  /**
+   * Execute the webhook action
+   * @param context Action context with UPS state
+   */
+  async execute(context: IActionContext): Promise<void> {
+    // Check if we should execute based on trigger mode
+    if (!this.shouldExecute(context)) {
+      logger.info(`Webhook action skipped (trigger mode: ${this.config.triggerMode || 'powerChangesAndThresholds'})`);
+      return;
+    }
+
+    if (!this.config.webhookUrl) {
+      logger.error('Webhook URL not configured');
+      return;
+    }
+
+    const method = this.config.webhookMethod || 'POST';
+    const timeout = this.config.webhookTimeout || 10000;
+
+    logger.info(`Calling webhook: ${method} ${this.config.webhookUrl}`);
+
+    try {
+      await this.callWebhook(context, method, timeout);
+      logger.success('Webhook call successful');
+    } catch (error) {
+      logger.error(
+        `Webhook call failed: ${error instanceof Error ? error.message : String(error)}`,
+      );
+      // Don't throw - webhook failures shouldn't stop other actions
+    }
+  }
+
+  /**
+   * Call the webhook with UPS state data
+   * @param context Action context
+   * @param method HTTP method (GET or POST)
+   * @param timeout Request timeout in milliseconds
+   */
+  private async callWebhook(
+    context: IActionContext,
+    method: 'GET' | 'POST',
+    timeout: number,
+  ): Promise<void> {
+    const payload: any = {
+      upsId: context.upsId,
+      upsName: context.upsName,
+      powerStatus: context.powerStatus,
+      batteryCapacity: context.batteryCapacity,
+      batteryRuntime: context.batteryRuntime,
+      triggerReason: context.triggerReason,
+      timestamp: context.timestamp,
+    };
+
+    // Include action's own thresholds if configured
+    if (this.config.thresholds) {
+      payload.thresholds = {
+        battery: this.config.thresholds.battery,
+        runtime: this.config.thresholds.runtime,
+      };
+    }
+
+    const url = new URL(this.config.webhookUrl!);
+
+    if (method === 'GET') {
+      // Append payload as query parameters for GET
+      url.searchParams.append('upsId', payload.upsId);
+      url.searchParams.append('upsName', payload.upsName);
+      url.searchParams.append('powerStatus', payload.powerStatus);
+      url.searchParams.append('batteryCapacity', String(payload.batteryCapacity));
+      url.searchParams.append('batteryRuntime', String(payload.batteryRuntime));
+      
+      url.searchParams.append('triggerReason', payload.triggerReason);
+      url.searchParams.append('timestamp', String(payload.timestamp));
+    }
+
+    return new Promise((resolve, reject) => {
+      const protocol = url.protocol === 'https:' ? https : http;
+
+      const options: http.RequestOptions = {
+        method,
+        headers: method === 'POST'
+          ? {
+            'Content-Type': 'application/json',
+            'User-Agent': 'nupst',
+          }
+          : {
+            'User-Agent': 'nupst',
+          },
+        timeout,
+      };
+
+      const req = protocol.request(url, options, (res) => {
+        let data = '';
+
+        res.on('data', (chunk) => {
+          data += chunk;
+        });
+
+        res.on('end', () => {
+          if (res.statusCode && res.statusCode >= 200 && res.statusCode < 300) {
+            logger.dim(`Webhook response (${res.statusCode}): ${data.substring(0, 100)}`);
+            resolve();
+          } else {
+            reject(new Error(`Webhook returned status ${res.statusCode}`));
+          }
+        });
+      });
+
+      req.on('error', (error) => {
+        reject(error);
+      });
+
+      req.on('timeout', () => {
+        req.destroy();
+        reject(new Error(`Webhook request timed out after ${timeout}ms`));
+      });
+
+      // Send POST data if applicable
+      if (method === 'POST') {
+        req.write(JSON.stringify(payload));
+      }
+
+      req.end();
+    });
+  }
+}

ts/cli.ts

@@ -1,6 +1,7 @@
 import { execSync } from 'node:child_process';
 import { Nupst } from './nupst.ts';
-import { logger } from './logger.ts';
+import { logger, type ITableColumn } from './logger.ts';
+import { theme, symbols } from './colors.ts';
 
 /**
  * Class for handling CLI commands
@@ -302,154 +303,162 @@ export class NupstCli {
       try {
         await this.nupst.getDaemon().loadConfig();
       } catch (_error) {
-        const errorBoxWidth = 45;
+        logger.logBox('Configuration Error', [
-        logger.logBoxTitle('Configuration Error', errorBoxWidth);
+          'No configuration found.',
-        logger.logBoxLine('No configuration found.');
+          "Please run 'nupst ups add' first to create a configuration.",
-        logger.logBoxLine("Please run 'nupst setup' first to create a configuration.");
+        ], 50, 'error');
-        logger.logBoxEnd();
         return;
       }
 
       // Get current configuration
       const config = this.nupst.getDaemon().getConfig();
 
-      const boxWidth = 50;
-      logger.logBoxTitle('NUPST Configuration', boxWidth);
-
       // Check if multi-UPS config
       if (config.upsDevices && Array.isArray(config.upsDevices)) {
-        // Multi-UPS configuration
+        // === Multi-UPS Configuration ===
-        logger.logBoxLine(`UPS Devices: ${config.upsDevices.length}`);
-        logger.logBoxLine(`Groups: ${config.groups ? config.groups.length : 0}`);
-        logger.logBoxLine(`Check Interval: ${config.checkInterval / 1000} seconds`);
-        logger.logBoxLine('');
-        logger.logBoxLine('Configuration File Location:');
-        logger.logBoxLine('  /etc/nupst/config.json');
-        logger.logBoxEnd();
         
-        // Show UPS devices
+        // Overview Box
+        logger.log('');
+        logger.logBox('NUPST Configuration', [
+          `UPS Devices: ${theme.highlight(String(config.upsDevices.length))}`,
+          `Groups: ${theme.highlight(String(config.groups ? config.groups.length : 0))}`,
+          `Check Interval: ${theme.info(String(config.checkInterval / 1000))} seconds`,
+          '',
+          theme.dim('Configuration File:'),
+          `  ${theme.path('/etc/nupst/config.json')}`,
+        ], 60, 'info');
+
+        // UPS Devices Table
         if (config.upsDevices.length > 0) {
-          logger.logBoxTitle('UPS Devices', boxWidth);
+          const upsRows = config.upsDevices.map((ups) => ({
-          for (const ups of config.upsDevices) {
+            name: ups.name,
-            logger.logBoxLine(`${ups.name} (${ups.id}):`);
+            id: theme.dim(ups.id),
-            logger.logBoxLine(`  Host: ${ups.snmp.host}:${ups.snmp.port}`);
+            host: `${ups.snmp.host}:${ups.snmp.port}`,
-            logger.logBoxLine(`  Model: ${ups.snmp.upsModel}`);
+            model: ups.snmp.upsModel || 'cyberpower',
-            logger.logBoxLine(
+            actions: `${(ups.actions || []).length} configured`,
-              `  Thresholds: ${ups.thresholds.battery}% battery, ${ups.thresholds.runtime} min runtime`,
+            groups: ups.groups.length > 0 ? ups.groups.join(', ') : theme.dim('None'),
-            );
+          }));
-            logger.logBoxLine(
+
-              `  Groups: ${ups.groups.length > 0 ? ups.groups.join(', ') : 'None'}`,
+          const upsColumns: ITableColumn[] = [
-            );
+            { header: 'Name', key: 'name', align: 'left', color: theme.highlight },
-            logger.logBoxLine('');
+            { header: 'ID', key: 'id', align: 'left' },
-          }
+            { header: 'Host:Port', key: 'host', align: 'left', color: theme.info },
-          logger.logBoxEnd();
+            { header: 'Model', key: 'model', align: 'left' },
+            { header: 'Actions', key: 'actions', align: 'left' },
+            { header: 'Groups', key: 'groups', align: 'left' },
+          ];
+
+          logger.log('');
+          logger.info(`UPS Devices (${config.upsDevices.length}):`);
+          logger.log('');
+          logger.logTable(upsColumns, upsRows);
         }
 
-        // Show groups
+        // Groups Table
         if (config.groups && config.groups.length > 0) {
-          logger.logBoxTitle('UPS Groups', boxWidth);
+          const groupRows = config.groups.map((group) => {
-          for (const group of config.groups) {
-            logger.logBoxLine(`${group.name} (${group.id}):`);
-            logger.logBoxLine(`  Mode: ${group.mode}`);
-            if (group.description) {
-              logger.logBoxLine(`  Description: ${group.description}`);
-            }
-
-            // List UPS devices in this group
             const upsInGroup = config.upsDevices.filter((ups) =>
               ups.groups && ups.groups.includes(group.id)
             );
-            logger.logBoxLine(
+            return {
-              `  UPS Devices: ${
+              name: group.name,
-                upsInGroup.length > 0 ? upsInGroup.map((ups) => ups.name).join(', ') : 'None'
+              id: theme.dim(group.id),
-              }`,
+              mode: group.mode,
-            );
+              upsCount: String(upsInGroup.length),
-            logger.logBoxLine('');
+              ups: upsInGroup.length > 0 
-          }
+                ? upsInGroup.map((ups) => ups.name).join(', ') 
-          logger.logBoxEnd();
+                : theme.dim('None'),
+              description: group.description || theme.dim('—'),
+            };
+          });
+
+          const groupColumns: ITableColumn[] = [
+            { header: 'Name', key: 'name', align: 'left', color: theme.highlight },
+            { header: 'ID', key: 'id', align: 'left' },
+            { header: 'Mode', key: 'mode', align: 'left', color: theme.info },
+            { header: 'UPS', key: 'upsCount', align: 'right' },
+            { header: 'UPS Devices', key: 'ups', align: 'left' },
+            { header: 'Description', key: 'description', align: 'left' },
+          ];
+
+          logger.log('');
+          logger.info(`UPS Groups (${config.groups.length}):`);
+          logger.log('');
+          logger.logTable(groupColumns, groupRows);
         }
       } else {
-        // Legacy single UPS configuration
+        // === Legacy Single UPS Configuration ===
+        
         if (!config.snmp) {
-          logger.logBoxLine('Error: Legacy configuration missing SNMP settings');
+          logger.logBox('Configuration Error', [
-        } else {
+            'Error: Legacy configuration missing SNMP settings',
-          // SNMP Settings
+          ], 60, 'error');
-          logger.logBoxLine('SNMP Settings:');
+          return;
-          logger.logBoxLine(`  Host: ${config.snmp.host}`);
-          logger.logBoxLine(`  Port: ${config.snmp.port}`);
-          logger.logBoxLine(`  Version: ${config.snmp.version}`);
-          logger.logBoxLine(`  UPS Model: ${config.snmp.upsModel || 'cyberpower'}`);
-
-          if (config.snmp.version === 1 || config.snmp.version === 2) {
-            logger.logBoxLine(`  Community: ${config.snmp.community}`);
-          } else if (config.snmp.version === 3) {
-            logger.logBoxLine(`  Security Level: ${config.snmp.securityLevel}`);
-            logger.logBoxLine(`  Username: ${config.snmp.username}`);
-
-            // Show auth and privacy details based on security level
-            if (
-              config.snmp.securityLevel === 'authNoPriv' ||
-              config.snmp.securityLevel === 'authPriv'
-            ) {
-              logger.logBoxLine(`  Auth Protocol: ${config.snmp.authProtocol || 'None'}`);
-            }
-
-            if (config.snmp.securityLevel === 'authPriv') {
-              logger.logBoxLine(`  Privacy Protocol: ${config.snmp.privProtocol || 'None'}`);
-            }
-
-            // Show timeout value
-            logger.logBoxLine(`  Timeout: ${config.snmp.timeout / 1000} seconds`);
-          }
-
-          // Show OIDs if custom model is selected
-          if (config.snmp.upsModel === 'custom' && config.snmp.customOIDs) {
-            logger.logBoxLine('Custom OIDs:');
-            logger.logBoxLine(
-              `  Power Status: ${config.snmp.customOIDs.POWER_STATUS || 'Not set'}`,
-            );
-            logger.logBoxLine(
-              `  Battery Capacity: ${config.snmp.customOIDs.BATTERY_CAPACITY || 'Not set'}`,
-            );
-            logger.logBoxLine(
-              `  Battery Runtime: ${config.snmp.customOIDs.BATTERY_RUNTIME || 'Not set'}`,
-            );
-          }
         }
 
-        // Thresholds
+        logger.log('');
-        if (!config.thresholds) {
+        logger.logBox('NUPST Configuration (Legacy)', [
-          logger.logBoxLine('Error: Legacy configuration missing threshold settings');
+          theme.warning('Legacy single-UPS configuration format'),
-        } else {
+          '',
-          logger.logBoxLine('Thresholds:');
+          theme.dim('SNMP Settings:'),
-          logger.logBoxLine(`  Battery: ${config.thresholds.battery}%`);
+          `  Host: ${theme.info(config.snmp.host)}`,
-          logger.logBoxLine(`  Runtime: ${config.thresholds.runtime} minutes`);
+          `  Port: ${theme.info(String(config.snmp.port))}`,
-        }
+          `  Version: ${config.snmp.version}`,
-        logger.logBoxLine(`Check Interval: ${config.checkInterval / 1000} seconds`);
+          `  UPS Model: ${config.snmp.upsModel || 'cyberpower'}`,
+          ...(config.snmp.version === 1 || config.snmp.version === 2 
+            ? [`  Community: ${config.snmp.community}`]
+            : []
+          ),
+          ...(config.snmp.version === 3 
+            ? [
+                `  Security Level: ${config.snmp.securityLevel}`,
+                `  Username: ${config.snmp.username}`,
+                ...(config.snmp.securityLevel === 'authNoPriv' || config.snmp.securityLevel === 'authPriv'
+                  ? [`  Auth Protocol: ${config.snmp.authProtocol || 'None'}`]
+                  : []
+                ),
+                ...(config.snmp.securityLevel === 'authPriv'
+                  ? [`  Privacy Protocol: ${config.snmp.privProtocol || 'None'}`]
+                  : []
+                ),
+                `  Timeout: ${config.snmp.timeout / 1000} seconds`,
+              ]
+            : []
+          ),
+          ...(config.snmp.upsModel === 'custom' && config.snmp.customOIDs
+            ? [
+                theme.dim('Custom OIDs:'),
+                `  Power Status: ${config.snmp.customOIDs.POWER_STATUS || 'Not set'}`,
+                `  Battery Capacity: ${config.snmp.customOIDs.BATTERY_CAPACITY || 'Not set'}`,
+                `  Battery Runtime: ${config.snmp.customOIDs.BATTERY_RUNTIME || 'Not set'}`,
+              ]
+            : []
+          ),
+          '',
           
-        // Configuration file location
+          `  Check Interval: ${config.checkInterval / 1000} seconds`,
-        logger.logBoxLine('');
+          '',
-        logger.logBoxLine('Configuration File Location:');
+          theme.dim('Configuration File:'),
-        logger.logBoxLine('  /etc/nupst/config.json');
+          `  ${theme.path('/etc/nupst/config.json')}`,
-        logger.logBoxLine('');
+          '',
-        logger.logBoxLine('Note: Using legacy single-UPS configuration format.');
+          theme.warning('Note: Using legacy single-UPS configuration format.'),
-        logger.logBoxLine('Consider using "nupst add" to migrate to multi-UPS format.');
+          `Consider using ${theme.command('nupst ups add')} to migrate to multi-UPS format.`,
-
+        ], 70, 'warning');
-        logger.logBoxEnd();
       }
 
-      // Show service status
+      // Service Status
       try {
         const isActive =
           execSync('systemctl is-active nupst.service || true').toString().trim() === 'active';
         const isEnabled =
           execSync('systemctl is-enabled nupst.service || true').toString().trim() === 'enabled';
 
-        const statusBoxWidth = 45;
+        logger.log('');
-        logger.logBoxTitle('Service Status', statusBoxWidth);
+        logger.logBox('Service Status', [
-        logger.logBoxLine(`Service Active: ${isActive ? 'Yes' : 'No'}`);
+          `Active: ${isActive ? theme.success('Yes') : theme.dim('No')}`,
-        logger.logBoxLine(`Service Enabled: ${isEnabled ? 'Yes' : 'No'}`);
+          `Enabled: ${isEnabled ? theme.success('Yes') : theme.dim('No')}`,
-        logger.logBoxEnd();
+        ], 50, isActive ? 'success' : 'default');
+        logger.log('');
       } catch (_error) {
         // Ignore errors checking service status
       }
@@ -468,65 +477,90 @@ export class NupstCli {
   private showVersion(): void {
     const version = this.nupst.getVersion();
     logger.log(`NUPST version ${version}`);
-    logger.log('Deno-powered UPS monitoring tool');
+    logger.log('Network UPS Shutdown Tool (https://nupst.serve.zone)');
   }
 
   /**
    * Display help message
    */
   private showHelp(): void {
-    logger.log(`
+    console.log('');
-NUPST - UPS Shutdown Tool
+    logger.highlight('NUPST - UPS Shutdown Tool');
+    logger.dim('Deno-powered UPS monitoring and shutdown automation');
+    console.log('');
 
-Usage:
+    // Usage section
-  nupst <command> [options]
+    logger.log(theme.info('Usage:'));
+    logger.log(`  ${theme.command('nupst')} ${theme.dim('<command> [options]')}`);
+    console.log('');
 
-Commands:
+    // Main commands section
-  service <subcommand>      - Manage systemd service
+    logger.log(theme.info('Commands:'));
-  ups <subcommand>          - Manage UPS devices
+    this.printCommand('service <subcommand>', 'Manage systemd service');
-  group <subcommand>        - Manage UPS groups
+    this.printCommand('ups <subcommand>', 'Manage UPS devices');
-  config [show]             - Display current configuration
+    this.printCommand('group <subcommand>', 'Manage UPS groups');
-  update                    - Update NUPST from repository (requires root)
+    this.printCommand('config [show]', 'Display current configuration');
-  uninstall                 - Completely remove NUPST from system (requires root)
+    this.printCommand('update', 'Update NUPST from repository', theme.dim('(requires root)'));
-  help, --help, -h          - Show this help message
+    this.printCommand('uninstall', 'Completely remove NUPST', theme.dim('(requires root)'));
-  --version, -v             - Show version information
+    this.printCommand('help, --help, -h', 'Show this help message');
+    this.printCommand('--version, -v', 'Show version information');
+    console.log('');
 
-Service Subcommands:
+    // Service subcommands
-  nupst service enable      - Install and enable systemd service (requires root)
+    logger.log(theme.info('Service Subcommands:'));
-  nupst service disable     - Stop and disable systemd service (requires root)
+    this.printCommand('nupst service enable', 'Install and enable systemd service', theme.dim('(requires root)'));
-  nupst service start       - Start the systemd service
+    this.printCommand('nupst service disable', 'Stop and disable systemd service', theme.dim('(requires root)'));
-  nupst service stop        - Stop the systemd service
+    this.printCommand('nupst service start', 'Start the systemd service');
-  nupst service restart     - Restart the systemd service
+    this.printCommand('nupst service stop', 'Stop the systemd service');
-  nupst service status      - Show service and UPS status
+    this.printCommand('nupst service restart', 'Restart the systemd service');
-  nupst service logs        - Show service logs in real-time
+    this.printCommand('nupst service status', 'Show service and UPS status');
-  nupst service start-daemon - Start daemon process directly
+    this.printCommand('nupst service logs', 'Show service logs in real-time');
+    this.printCommand('nupst service start-daemon', 'Start daemon process directly');
+    console.log('');
 
-UPS Subcommands:
+    // UPS subcommands
-  nupst ups add             - Add a new UPS device
+    logger.log(theme.info('UPS Subcommands:'));
-  nupst ups edit [id]       - Edit a UPS device (default if no ID)
+    this.printCommand('nupst ups add', 'Add a new UPS device');
-  nupst ups remove <id>     - Remove a UPS device by ID
+    this.printCommand('nupst ups edit [id]', 'Edit a UPS device (default if no ID)');
-  nupst ups list (or ls)    - List all configured UPS devices
+    this.printCommand('nupst ups remove <id>', 'Remove a UPS device by ID');
-  nupst ups test            - Test UPS connections
+    this.printCommand('nupst ups list (or ls)', 'List all configured UPS devices');
+    this.printCommand('nupst ups test', 'Test UPS connections');
+    console.log('');
 
-Group Subcommands:
+    // Group subcommands
-  nupst group add           - Add a new UPS group
+    logger.log(theme.info('Group Subcommands:'));
-  nupst group edit <id>     - Edit an existing UPS group
+    this.printCommand('nupst group add', 'Add a new UPS group');
-  nupst group remove <id>   - Remove a UPS group by ID
+    this.printCommand('nupst group edit <id>', 'Edit an existing UPS group');
-  nupst group list (or ls)  - List all UPS groups
+    this.printCommand('nupst group remove <id>', 'Remove a UPS group by ID');
+    this.printCommand('nupst group list (or ls)', 'List all UPS groups');
+    console.log('');
 
-Options:
+    // Options
-  --debug, -d              - Enable debug mode for detailed SNMP logging
+    logger.log(theme.info('Options:'));
-                             (Example: nupst ups test --debug)
+    this.printCommand('--debug, -d', 'Enable debug mode for detailed SNMP logging');
+    logger.dim('                     (Example: nupst ups test --debug)');
+    console.log('');
 
-Examples:
+    // Examples
-  nupst service enable     - Install and start the service
+    logger.log(theme.info('Examples:'));
-  nupst ups add            - Add a new UPS interactively
+    logger.dim('  nupst service enable     # Install and start the service');
-  nupst group list         - Show all configured groups
+    logger.dim('  nupst ups add            # Add a new UPS interactively');
-  nupst config             - Display current configuration
+    logger.dim('  nupst group list         # Show all configured groups');
+    logger.dim('  nupst config             # Display current configuration');
+    console.log('');
 
-Note: Old command format (e.g., 'nupst add') still works but is deprecated.
+    // Note about deprecated commands
-      Use the new format (e.g., 'nupst ups add') going forward.
+    logger.warn('Note: Old command format (e.g., \'nupst add\') still works but is deprecated.');
-`);
+    logger.dim('      Use the new format (e.g., \'nupst ups add\') going forward.');
+    console.log('');
+  }
+
+  /**
+   * Helper to print a command with description
+   */
+  private printCommand(command: string, description: string, extra?: string): void {
+    const paddedCommand = command.padEnd(30);
+    logger.log(`  ${theme.command(paddedCommand)} ${description}${extra ? ' ' + extra : ''}`);
   }
 
   /**

ts/cli/group-handler.ts

@@ -1,6 +1,7 @@
 import process from 'node:process';
 import { Nupst } from '../nupst.ts';
-import { logger } from '../logger.ts';
+import { logger, type ITableColumn } from '../logger.ts';
+import { theme } from '../colors.ts';
 import * as helpers from '../helpers/index.ts';
 import { type IGroupConfig } from '../daemon.ts';
 
@@ -28,11 +29,10 @@ export class GroupHandler {
       try {
         await this.nupst.getDaemon().loadConfig();
       } catch (error) {
-        const errorBoxWidth = 45;
+        logger.logBox('Configuration Error', [
-        logger.logBoxTitle('Configuration Error', errorBoxWidth);
+          'No configuration found.',
-        logger.logBoxLine('No configuration found.');
+          "Please run 'nupst ups add' first to create a configuration.",
-        logger.logBoxLine("Please run 'nupst setup' first to create a configuration.");
+        ], 50, 'error');
-        logger.logBoxEnd();
         return;
       }
 
@@ -41,43 +41,53 @@ export class GroupHandler {
 
       // Check if multi-UPS config
       if (!config.groups || !Array.isArray(config.groups)) {
-        // Legacy or missing groups configuration
+        logger.logBox('UPS Groups', [
-        const boxWidth = 45;
+          'No groups configured.',
-        logger.logBoxTitle('UPS Groups', boxWidth);
+          '',
-        logger.logBoxLine('No groups configured.');
+          `${theme.dim('Run')} ${theme.command('nupst group add')} ${theme.dim('to add a group')}`,
-        logger.logBoxLine('Use "nupst group add" to add a UPS group.');
+        ], 50, 'info');
-        logger.logBoxEnd();
         return;
       }
 
-      // Display group list
+      // Display group list with modern table
-      const boxWidth = 60;
-      logger.logBoxTitle('UPS Groups', boxWidth);
-
       if (config.groups.length === 0) {
-        logger.logBoxLine('No UPS groups configured.');
+        logger.logBox('UPS Groups', [
-        logger.logBoxLine('Use "nupst group add" to add a UPS group.');
+          'No UPS groups configured.',
-      } else {
+          '',
-        logger.logBoxLine(`Found ${config.groups.length} group(s)`);
+          `${theme.dim('Run')} ${theme.command('nupst group add')} ${theme.dim('to add a group')}`,
-        logger.logBoxLine('');
+        ], 60, 'info');
-        logger.logBoxLine('ID         | Name                 | Mode         | UPS Devices');
+        return;
-        logger.logBoxLine('-----------+----------------------+--------------+----------------');
-
-        for (const group of config.groups) {
-          const id = group.id.padEnd(10, ' ').substring(0, 10);
-          const name = (group.name || '').padEnd(20, ' ').substring(0, 20);
-          const mode = (group.mode || 'unknown').padEnd(12, ' ').substring(0, 12);
-
-          // Count UPS devices in this group
-          const upsInGroup = config.upsDevices.filter((ups) => ups.groups.includes(group.id));
-          const upsCount = upsInGroup.length;
-          const upsNames = upsInGroup.map((ups) => ups.name).join(', ');
-
-          logger.logBoxLine(`${id} | ${name} | ${mode} | ${upsCount > 0 ? upsNames : 'None'}`);
-        }
       }
 
-      logger.logBoxEnd();
+      // Prepare table data
+      const rows = config.groups.map((group) => {
+        // Count UPS devices in this group
+        const upsInGroup = config.upsDevices.filter((ups) => ups.groups.includes(group.id));
+        const upsCount = upsInGroup.length;
+        const upsNames = upsInGroup.map((ups) => ups.name).join(', ');
+
+        return {
+          id: group.id,
+          name: group.name || '',
+          mode: group.mode || 'unknown',
+          count: String(upsCount),
+          devices: upsCount > 0 ? upsNames : theme.dim('None'),
+        };
+      });
+
+      const columns: ITableColumn[] = [
+        { header: 'ID', key: 'id', align: 'left', color: theme.highlight },
+        { header: 'Name', key: 'name', align: 'left' },
+        { header: 'Mode', key: 'mode', align: 'left', color: theme.info },
+        { header: 'UPS Count', key: 'count', align: 'right' },
+        { header: 'UPS Devices', key: 'devices', align: 'left' },
+      ];
+
+      logger.log('');
+      logger.info(`UPS Groups (${config.groups.length}):`);
+      logger.log('');
+      logger.logTable(columns, rows);
+      logger.log('');
     } catch (error) {
       logger.error(
         `Failed to list UPS groups: ${error instanceof Error ? error.message : String(error)}`,
@@ -192,6 +202,7 @@ export class GroupHandler {
         logger.log('\nGroup setup complete!');
       } finally {
         rl.close();
+        process.stdin.destroy();
       }
     } catch (error) {
       logger.error(`Add group error: ${error instanceof Error ? error.message : String(error)}`);
@@ -309,6 +320,7 @@ export class GroupHandler {
         logger.log('\nGroup edit complete!');
       } finally {
         rl.close();
+        process.stdin.destroy();
       }
     } catch (error) {
       logger.error(`Edit group error: ${error instanceof Error ? error.message : String(error)}`);
@@ -366,6 +378,7 @@ export class GroupHandler {
       });
 
       rl.close();
+      process.stdin.destroy();
 
       if (confirm !== 'y' && confirm !== 'yes') {
         logger.log('Deletion cancelled.');

ts/cli/service-handler.ts

@@ -129,81 +129,57 @@ export class ServiceHandler {
     try {
       // Check if running as root
       this.checkRootAccess(
-        'This command must be run as root to update NUPST and refresh the systemd service.',
+        'This command must be run as root to update NUPST.',
       );
 
-      const boxWidth = 45;
+      console.log('');
-      logger.logBoxTitle('NUPST Update Process', boxWidth);
+      logger.info('Checking for updates...');
-      logger.logBoxLine('Updating NUPST from repository...');
-
-      // Determine the installation directory (assuming it's either /opt/nupst or the current directory)
-      const { existsSync } = await import('fs');
-      let installDir = '/opt/nupst';
-
-      if (!existsSync(installDir)) {
-        // If not installed in /opt/nupst, use the current directory
-        const { dirname } = await import('path');
-        installDir = dirname(dirname(process.argv[1])); // Go up two levels from the executable
-        logger.logBoxLine(`Using local installation directory: ${installDir}`);
-      }
 
       try {
-        // 1. Update the repository
+        // Get current version
-        logger.logBoxLine('Pulling latest changes from git repository...');
+        const currentVersion = this.nupst.getVersion();
-        execSync(`cd ${installDir} && git fetch origin && git reset --hard origin/main`, {
+
-          stdio: 'pipe',
+        // Fetch latest version from Gitea API
+        const apiUrl = 'https://code.foss.global/api/v1/repos/serve.zone/nupst/releases/latest';
+        const response = execSync(`curl -sSL ${apiUrl}`).toString();
+        const release = JSON.parse(response);
+        const latestVersion = release.tag_name; // e.g., "v4.0.7"
+
+        // Normalize versions for comparison (ensure both have "v" prefix)
+        const normalizedCurrent = currentVersion.startsWith('v') ? currentVersion : `v${currentVersion}`;
+        const normalizedLatest = latestVersion.startsWith('v') ? latestVersion : `v${latestVersion}`;
+
+        logger.dim(`Current version: ${normalizedCurrent}`);
+        logger.dim(`Latest version:  ${normalizedLatest}`);
+        console.log('');
+
+        // Compare normalized versions
+        if (normalizedCurrent === normalizedLatest) {
+          logger.success('Already up to date!');
+          console.log('');
+          return;
+        }
+
+        logger.info(`New version available: ${latestVersion}`);
+        logger.dim('Downloading and installing...');
+        console.log('');
+
+        // Download and run the install script
+        // This handles everything: download binary, stop service, replace, restart
+        const installUrl = 'https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh';
+
+        execSync(`curl -sSL ${installUrl} | bash`, {
+          stdio: 'inherit', // Show install script output to user
         });
 
-        // 2. Run the install.sh script
+        console.log('');
-        logger.logBoxLine('Running install.sh to update NUPST...');
+        logger.success(`Updated to ${latestVersion}`);
-        execSync(`cd ${installDir} && bash ./install.sh`, { stdio: 'pipe' });
+        console.log('');
-
-        // 3. Run the setup.sh script with force flag to update Node.js and dependencies
-        logger.logBoxLine('Running setup.sh to update Node.js and dependencies...');
-        execSync(`cd ${installDir} && bash ./setup.sh --force`, { stdio: 'pipe' });
-
-        // 4. Refresh the systemd service
-        logger.logBoxLine('Refreshing systemd service...');
-
-        // First check if service exists
-        let serviceExists = false;
-        try {
-          const output = execSync('systemctl list-unit-files | grep nupst.service').toString();
-          serviceExists = output.includes('nupst.service');
-        } catch (error) {
-          // If grep fails (service not found), serviceExists remains false
-          serviceExists = false;
-        }
-
-        if (serviceExists) {
-          // Stop the service if it's running
-          const isRunning =
-            execSync('systemctl is-active nupst.service || true').toString().trim() === 'active';
-          if (isRunning) {
-            logger.logBoxLine('Stopping nupst service...');
-            execSync('systemctl stop nupst.service');
-          }
-
-          // Reinstall the service
-          logger.logBoxLine('Reinstalling systemd service...');
-          await this.nupst.getSystemd().install();
-
-          // Restart the service if it was running
-          if (isRunning) {
-            logger.logBoxLine('Restarting nupst service...');
-            execSync('systemctl start nupst.service');
-          }
-        } else {
-          logger.logBoxLine('Systemd service not installed, skipping service refresh.');
-          logger.logBoxLine('Run "nupst enable" to install the service.');
-        }
-
-        logger.logBoxLine('Update completed successfully!');
-        logger.logBoxEnd();
       } catch (error) {
-        logger.logBoxLine('Error during update process:');
+        console.log('');
-        logger.logBoxLine(`${error instanceof Error ? error.message : String(error)}`);
+        logger.error('Update failed');
-        logger.logBoxEnd();
+        logger.dim(`${error instanceof Error ? error.message : String(error)}`);
+        console.log('');
         process.exit(1);
       }
     } catch (error) {
@@ -237,9 +213,11 @@ export class ServiceHandler {
         });
       };
 
-      console.log('\nNUPST Uninstaller');
+      logger.log('');
-      console.log('===============');
+      logger.highlight('NUPST Uninstaller');
-      console.log('This will completely remove NUPST from your system.\n');
+      logger.dim('===============');
+      logger.log('This will completely remove NUPST from your system.');
+      logger.log('');
 
       // Ask about removing configuration
       const removeConfig = await prompt(
@@ -275,17 +253,20 @@ export class ServiceHandler {
         }
 
         if (!uninstallScriptPath) {
-          console.error('Could not locate uninstall.sh script. Aborting uninstall.');
+          logger.error('Could not locate uninstall.sh script. Aborting uninstall.');
           rl.close();
+          process.stdin.destroy();
           process.exit(1);
         }
       }
 
       // Close readline before executing script
       rl.close();
+      process.stdin.destroy();
 
       // Execute uninstall.sh with the appropriate option
-      console.log(`\nRunning uninstaller from ${uninstallScriptPath}...`);
+      logger.log('');
+      logger.log(`Running uninstaller from ${uninstallScriptPath}...`);
 
       // Pass the configuration removal option as an environment variable
       const env = {
@@ -301,7 +282,7 @@ export class ServiceHandler {
         stdio: 'inherit', // Show output in the terminal
       });
     } catch (error) {
-      console.error(`Uninstall failed: ${error instanceof Error ? error.message : String(error)}`);
+      logger.error(`Uninstall failed: ${error instanceof Error ? error.message : String(error)}`);
       process.exit(1);
     }
   }

ts/cli/ups-handler.ts

@@ -1,7 +1,8 @@
 import process from 'node:process';
 import { execSync } from 'node:child_process';
 import { Nupst } from '../nupst.ts';
-import { logger } from '../logger.ts';
+import { logger, type ITableColumn } from '../logger.ts';
+import { theme } from '../colors.ts';
 import * as helpers from '../helpers/index.ts';
 import type { TUpsModel } from '../snmp/types.ts';
 import type { INupstConfig } from '../daemon.ts';
@@ -47,6 +48,7 @@ export class UpsHandler {
         await this.runAddProcess(prompt);
       } finally {
         rl.close();
+        process.stdin.destroy();
       }
     } catch (error) {
       logger.error(`Add UPS error: ${error instanceof Error ? error.message : String(error)}`);
@@ -75,10 +77,10 @@ export class UpsHandler {
           checkInterval: config.checkInterval,
           upsDevices: [{
             id: 'default',
-            name: 'Default UPS',
+        name: 'Default UPS',
-            snmp: config.snmp,
+        snmp: config.snmp,
-            thresholds: config.thresholds,
+        groups: [],
-            groups: [],
+        actions: [],
           }],
           groups: [],
         };
@@ -115,14 +117,12 @@ export class UpsHandler {
         runtime: 20,
       },
       groups: [],
+      actions: [],
     };
 
     // Gather SNMP settings
     await this.gatherSnmpSettings(newUps.snmp, prompt);
 
-    // Gather threshold settings
-    await this.gatherThresholdSettings(newUps.thresholds, prompt);
-
     // Gather UPS model settings
     await this.gatherUpsModelSettings(newUps.snmp, prompt);
 
@@ -134,6 +134,9 @@ export class UpsHandler {
       await groupHandler.assignUpsToGroups(newUps, config.groups, prompt);
     }
 
+// Gather action settings
+    await this.gatherActionSettings(newUps.actions, prompt);
+
     // Add the new UPS to the config
     config.upsDevices.push(newUps);
 
@@ -178,6 +181,7 @@ export class UpsHandler {
         await this.runEditProcess(upsId, prompt);
       } finally {
         rl.close();
+        process.stdin.destroy();
       }
     } catch (error) {
       logger.error(`Edit UPS error: ${error instanceof Error ? error.message : String(error)}`);
@@ -218,16 +222,16 @@ export class UpsHandler {
     // Convert old format to new format if needed
     if (!config.upsDevices) {
       // Initialize with the current config as the first UPS
-      if (!config.snmp || !config.thresholds) {
+      if (!config.snmp) {
-        logger.error('Legacy configuration is missing required SNMP or threshold settings');
+        logger.error('Legacy configuration is missing required SNMP settings');
         return;
       }
       config.upsDevices = [{
         id: 'default',
         name: 'Default UPS',
         snmp: config.snmp,
-        thresholds: config.thresholds,
         groups: [],
+        actions: [],
       }];
       config.groups = [];
       logger.log('Converting existing configuration to multi-UPS format.');
@@ -262,9 +266,6 @@ export class UpsHandler {
     // Edit SNMP settings
     await this.gatherSnmpSettings(upsToEdit.snmp, prompt);
 
-    // Edit threshold settings
-    await this.gatherThresholdSettings(upsToEdit.thresholds, prompt);
-
     // Edit UPS model settings
     await this.gatherUpsModelSettings(upsToEdit.snmp, prompt);
 
@@ -276,6 +277,14 @@ export class UpsHandler {
       await groupHandler.assignUpsToGroups(upsToEdit, config.groups, prompt);
     }
 
+    // Initialize actions array if not exists
+    if (!upsToEdit.actions) {
+      upsToEdit.actions = [];
+    }
+
+    // Edit action settings
+    await this.gatherActionSettings(upsToEdit.actions, prompt);
+
     // Save the configuration
     await this.nupst.getDaemon().saveConfig(config);
 
@@ -344,6 +353,7 @@ export class UpsHandler {
       });
 
       rl.close();
+      process.stdin.destroy();
 
       if (confirm !== 'y' && confirm !== 'yes') {
         logger.log('Deletion cancelled.');
@@ -376,11 +386,10 @@ export class UpsHandler {
       try {
         await this.nupst.getDaemon().loadConfig();
       } catch (error) {
-        const errorBoxWidth = 45;
+        logger.logBox('Configuration Error', [
-        logger.logBoxTitle('Configuration Error', errorBoxWidth);
+          'No configuration found.',
-        logger.logBoxLine('No configuration found.');
+          "Please run 'nupst ups add' first to create a configuration.",
-        logger.logBoxLine("Please run 'nupst setup' first to create a configuration.");
+        ], 50, 'error');
-        logger.logBoxEnd();
         return;
       }
 
@@ -390,58 +399,56 @@ export class UpsHandler {
       // Check if multi-UPS config
       if (!config.upsDevices || !Array.isArray(config.upsDevices)) {
         // Legacy single UPS configuration
-        const boxWidth = 45;
+        logger.logBox('UPS Devices', [
-        logger.logBoxTitle('UPS Devices', boxWidth);
+          'Legacy single-UPS configuration detected.',
-        logger.logBoxLine('Legacy single-UPS configuration detected.');
+          '',
-        if (!config.snmp || !config.thresholds) {
+          ...(!config.snmp 
-          logger.logBoxLine('');
+            ? ['Error: Configuration missing SNMP settings']
-          logger.logBoxLine('Error: Configuration missing SNMP or threshold settings');
+            : [
-          logger.logBoxEnd();
+                'Default UPS:',
-          return;
+                `  Host: ${config.snmp.host}:${config.snmp.port}`,
-        }
+                `  Model: ${config.snmp.upsModel || 'cyberpower'}`,
-        logger.logBoxLine('');
+                '',
-        logger.logBoxLine('Default UPS:');
+                'Use "nupst ups add" to add more UPS devices and migrate',
-        logger.logBoxLine(`  Host: ${config.snmp.host}:${config.snmp.port}`);
+                'to the multi-UPS configuration format.',
-        logger.logBoxLine(`  Model: ${config.snmp.upsModel || 'cyberpower'}`);
+              ]
-        logger.logBoxLine(
+          ),
-          `  Thresholds: ${config.thresholds.battery}% battery, ${config.thresholds.runtime} min runtime`,
+        ], 60, 'warning');
-        );
-        logger.logBoxLine('');
-        logger.logBoxLine('Use "nupst add" to add more UPS devices and migrate');
-        logger.logBoxLine('to the multi-UPS configuration format.');
-        logger.logBoxEnd();
         return;
       }
 
-      // Display UPS list
+      // Display UPS list with modern table
-      const boxWidth = 60;
-      logger.logBoxTitle('UPS Devices', boxWidth);
-
       if (config.upsDevices.length === 0) {
-        logger.logBoxLine('No UPS devices configured.');
+        logger.logBox('UPS Devices', [
-        logger.logBoxLine('Use "nupst add" to add a UPS device.');
+          'No UPS devices configured.',
-      } else {
+          '',
-        logger.logBoxLine(`Found ${config.upsDevices.length} UPS device(s)`);
+          `${theme.dim('Run')} ${theme.command('nupst ups add')} ${theme.dim('to add a device')}`,
-        logger.logBoxLine('');
+        ], 60, 'info');
-        logger.logBoxLine(
+        return;
-          'ID         | Name                 | Host            | Mode         | Groups',
-        );
-        logger.logBoxLine(
-          '-----------+----------------------+-----------------+--------------+----------------',
-        );
-
-        for (const ups of config.upsDevices) {
-          const id = ups.id.padEnd(10, ' ').substring(0, 10);
-          const name = (ups.name || '').padEnd(20, ' ').substring(0, 20);
-          const host = `${ups.snmp.host}:${ups.snmp.port}`.padEnd(15, ' ').substring(0, 15);
-          const model = (ups.snmp.upsModel || 'cyberpower').padEnd(12, ' ').substring(0, 12);
-          const groups = ups.groups.length > 0 ? ups.groups.join(', ') : 'None';
-
-          logger.logBoxLine(`${id} | ${name} | ${host} | ${model} | ${groups}`);
-        }
       }
 
-      logger.logBoxEnd();
+      // Prepare table data
+      const rows = config.upsDevices.map((ups) => ({
+        id: ups.id,
+        name: ups.name || '',
+        host: `${ups.snmp.host}:${ups.snmp.port}`,
+        model: ups.snmp.upsModel || 'cyberpower',
+        groups: ups.groups.length > 0 ? ups.groups.join(', ') : theme.dim('None'),
+      }));
+
+      const columns: ITableColumn[] = [
+        { header: 'ID', key: 'id', align: 'left', color: theme.highlight },
+        { header: 'Name', key: 'name', align: 'left' },
+        { header: 'Host:Port', key: 'host', align: 'left', color: theme.info },
+        { header: 'Model', key: 'model', align: 'left' },
+        { header: 'Groups', key: 'groups', align: 'left' },
+      ];
+
+      logger.log('');
+      logger.info(`UPS Devices (${config.upsDevices.length}):`);
+      logger.log('');
+      logger.logTable(columns, rows);
+      logger.log('');
     } catch (error) {
       logger.error(
         `Failed to list UPS devices: ${error instanceof Error ? error.message : String(error)}`,
@@ -504,9 +511,8 @@ export class UpsHandler {
    */
   private displayTestConfig(config: any): void {
     // Check if this is a UPS device or full configuration
-    const isUpsConfig = config.snmp && config.thresholds;
+    const isUpsConfig = config.snmp;
     const snmpConfig = isUpsConfig ? config.snmp : config.snmp || {};
-    const thresholds = isUpsConfig ? config.thresholds : config.thresholds || {};
     const checkInterval = config.checkInterval || 30000;
 
     // Get UPS name and ID if available
@@ -550,10 +556,6 @@ export class UpsHandler {
       );
       logger.logBoxLine(`  Battery Runtime: ${snmpConfig.customOIDs.BATTERY_RUNTIME || 'Not set'}`);
     }
-    logger.logBoxLine('Thresholds:');
-    logger.logBoxLine(`  Battery: ${thresholds.battery}%`);
-    logger.logBoxLine(`  Runtime: ${thresholds.runtime} minutes`);
-
     // Show group assignments if this is a UPS config
     if (config.groups && Array.isArray(config.groups)) {
       logger.logBoxLine(
@@ -577,7 +579,6 @@ export class UpsHandler {
     try {
       // Create a test config with a short timeout
       const snmpConfig = config.snmp ? config.snmp : config.snmp;
-      const thresholds = config.thresholds ? config.thresholds : config.thresholds;
 
       const testConfig = {
         ...snmpConfig,
@@ -594,10 +595,7 @@ export class UpsHandler {
       logger.logBoxLine(`  Runtime Remaining: ${status.batteryRuntime} minutes`);
       logger.logBoxEnd();
 
-      // Check status against thresholds if on battery
+      
-      if (status.powerStatus === 'onBattery') {
-        this.analyzeThresholds(status, thresholds);
-      }
     } catch (error) {
       const errorBoxWidth = 45;
       logger.logBoxTitle(`Connection Failed: ${upsName}`, errorBoxWidth);
@@ -667,10 +665,11 @@ export class UpsHandler {
 
     // SNMP Version
     const defaultVersion = snmpConfig.version || 1;
-    console.log('\nSNMP Version:');
+    logger.log('');
-    console.log('  1) SNMPv1');
+    logger.info('SNMP Version:');
-    console.log('  2) SNMPv2c');
+    logger.dim('  1) SNMPv1');
-    console.log('  3) SNMPv3 (with security features)');
+    logger.dim('  2) SNMPv2c');
+    logger.dim('  3) SNMPv3 (with security features)');
     const versionInput = await prompt(`Select SNMP version [${defaultVersion}]: `);
     const version = parseInt(versionInput, 10);
     snmpConfig.version = versionInput.trim() && (version === 1 || version === 2 || version === 3)
@@ -697,13 +696,15 @@ export class UpsHandler {
     snmpConfig: any,
     prompt: (question: string) => Promise<string>,
   ): Promise<void> {
-    console.log('\nSNMPv3 Security Settings:');
+    logger.log('');
+    logger.info('SNMPv3 Security Settings:');
 
     // Security Level
-    console.log('\nSecurity Level:');
+    logger.log('');
-    console.log('  1) noAuthNoPriv (No Authentication, No Privacy)');
+    logger.info('Security Level:');
-    console.log('  2) authNoPriv (Authentication, No Privacy)');
+    logger.dim('  1) noAuthNoPriv (No Authentication, No Privacy)');
-    console.log('  3) authPriv (Authentication and Privacy)');
+    logger.dim('  2) authNoPriv (Authentication, No Privacy)');
+    logger.dim('  3) authPriv (Authentication and Privacy)');
     const defaultSecLevel = snmpConfig.securityLevel
       ? snmpConfig.securityLevel === 'noAuthNoPriv'
         ? 1
@@ -752,8 +753,9 @@ export class UpsHandler {
 
       // Allow customizing the timeout value
       const defaultTimeout = snmpConfig.timeout / 1000; // Convert from ms to seconds for display
-      console.log(
+      logger.log('');
-        '\nSNMPv3 operations with authentication and privacy may require longer timeouts.',
+      logger.info(
+        'SNMPv3 operations with authentication and privacy may require longer timeouts.',
       );
       const timeoutInput = await prompt(`SNMP Timeout in seconds [${defaultTimeout}]: `);
       const timeout = parseInt(timeoutInput, 10);
@@ -773,9 +775,10 @@ export class UpsHandler {
     prompt: (question: string) => Promise<string>,
   ): Promise<void> {
     // Authentication protocol
-    console.log('\nAuthentication Protocol:');
+    logger.log('');
-    console.log('  1) MD5');
+    logger.info('Authentication Protocol:');
-    console.log('  2) SHA');
+    logger.dim('  1) MD5');
+    logger.dim('  2) SHA');
     const defaultAuthProtocol = snmpConfig.authProtocol === 'SHA' ? 2 : 1;
     const authProtocolInput = await prompt(
       `Select Authentication Protocol [${defaultAuthProtocol}]: `,
@@ -799,9 +802,10 @@ export class UpsHandler {
     prompt: (question: string) => Promise<string>,
   ): Promise<void> {
     // Privacy protocol
-    console.log('\nPrivacy Protocol:');
+    logger.log('');
-    console.log('  1) DES');
+    logger.info('Privacy Protocol:');
-    console.log('  2) AES');
+    logger.dim('  1) DES');
+    logger.dim('  2) AES');
     const defaultPrivProtocol = snmpConfig.privProtocol === 'AES' ? 2 : 1;
     const privProtocolInput = await prompt(`Select Privacy Protocol [${defaultPrivProtocol}]: `);
     const privProtocol = parseInt(privProtocolInput, 10) || defaultPrivProtocol;
@@ -813,38 +817,6 @@ export class UpsHandler {
     snmpConfig.privKey = privKey.trim() || defaultPrivKey;
   }
 
-  /**
-   * Gather threshold settings
-   * @param thresholds Thresholds configuration object to update
-   * @param prompt Function to prompt for user input
-   */
-  private async gatherThresholdSettings(
-    thresholds: any,
-    prompt: (question: string) => Promise<string>,
-  ): Promise<void> {
-    console.log('\nShutdown Thresholds:');
-
-    // Battery threshold
-    const defaultBatteryThreshold = thresholds.battery || 60;
-    const batteryThresholdInput = await prompt(
-      `Battery percentage threshold [${defaultBatteryThreshold}%]: `,
-    );
-    const batteryThreshold = parseInt(batteryThresholdInput, 10);
-    thresholds.battery = batteryThresholdInput.trim() && !isNaN(batteryThreshold)
-      ? batteryThreshold
-      : defaultBatteryThreshold;
-
-    // Runtime threshold
-    const defaultRuntimeThreshold = thresholds.runtime || 20;
-    const runtimeThresholdInput = await prompt(
-      `Runtime minutes threshold [${defaultRuntimeThreshold} minutes]: `,
-    );
-    const runtimeThreshold = parseInt(runtimeThresholdInput, 10);
-    thresholds.runtime = runtimeThresholdInput.trim() && !isNaN(runtimeThreshold)
-      ? runtimeThreshold
-      : defaultRuntimeThreshold;
-  }
-
   /**
    * Gather UPS model settings
    * @param snmpConfig SNMP configuration object to update
@@ -854,13 +826,14 @@ export class UpsHandler {
     snmpConfig: any,
     prompt: (question: string) => Promise<string>,
   ): Promise<void> {
-    console.log('\nUPS Model Selection:');
+    logger.log('');
-    console.log('  1) CyberPower');
+    logger.info('UPS Model Selection:');
-    console.log('  2) APC');
+    logger.dim('  1) CyberPower');
-    console.log('  3) Eaton');
+    logger.dim('  2) APC');
-    console.log('  4) TrippLite');
+    logger.dim('  3) Eaton');
-    console.log('  5) Liebert/Vertiv');
+    logger.dim('  4) TrippLite');
-    console.log('  6) Custom (Advanced)');
+    logger.dim('  5) Liebert/Vertiv');
+    logger.dim('  6) Custom (Advanced)');
 
     const defaultModelValue = snmpConfig.upsModel === 'cyberpower'
       ? 1
@@ -891,8 +864,9 @@ export class UpsHandler {
       snmpConfig.upsModel = 'liebert';
     } else if (modelValue === 6) {
       snmpConfig.upsModel = 'custom';
-      console.log('\nEnter custom OIDs for your UPS:');
+      logger.log('');
-      console.log('(Leave blank to use standard RFC 1628 OIDs as fallback)');
+      logger.info('Enter custom OIDs for your UPS:');
+      logger.dim('(Leave blank to use standard RFC 1628 OIDs as fallback)');
 
       // Custom OIDs
       const powerStatusOID = await prompt('Power Status OID: ');
@@ -908,6 +882,151 @@ export class UpsHandler {
     }
   }
 
+  /**
+   * Gather action configuration settings
+   * @param actions Actions array to configure
+   * @param prompt Function to prompt for user input
+   */
+  private async gatherActionSettings(
+    actions: any[],
+    prompt: (question: string) => Promise<string>,
+  ): Promise<void> {
+    logger.log('');
+    logger.info('Action Configuration (Optional):');
+    logger.dim('Actions are triggered on power status changes and threshold violations.');
+    logger.dim('Leave empty to use default shutdown behavior on threshold violations.');
+
+    const configureActions = await prompt('Configure custom actions? (y/N): ');
+    if (configureActions.toLowerCase() !== 'y') {
+      return; // Keep existing actions or use default
+    }
+
+    // Clear existing actions
+    actions.length = 0;
+
+    let addMore = true;
+    while (addMore) {
+      logger.log('');
+      logger.info('Action Type:');
+      logger.dim('  1) Shutdown (system shutdown)');
+      logger.dim('  2) Webhook (HTTP notification)');
+      logger.dim('  3) Custom Script (run .sh file from /etc/nupst)');
+
+      const typeInput = await prompt('Select action type [1]: ');
+      const typeValue = parseInt(typeInput, 10) || 1;
+
+      const action: any = {};
+
+      if (typeValue === 1) {
+        // Shutdown action
+        action.type = 'shutdown';
+
+        const delayInput = await prompt('Shutdown delay in minutes [5]: ');
+        const delay = parseInt(delayInput, 10);
+        if (delayInput.trim() && !isNaN(delay)) {
+          action.shutdownDelay = delay;
+        }
+      } else if (typeValue === 2) {
+        // Webhook action
+        action.type = 'webhook';
+
+        const url = await prompt('Webhook URL: ');
+        if (!url.trim()) {
+          logger.warn('Webhook URL required, skipping action');
+          continue;
+        }
+        action.webhookUrl = url.trim();
+
+        logger.log('');
+        logger.info('HTTP Method:');
+        logger.dim('  1) POST (JSON body)');
+        logger.dim('  2) GET (query parameters)');
+        const methodInput = await prompt('Select method [1]: ');
+        action.webhookMethod = methodInput === '2' ? 'GET' : 'POST';
+
+        const timeoutInput = await prompt('Timeout in seconds [10]: ');
+        const timeout = parseInt(timeoutInput, 10);
+        if (timeoutInput.trim() && !isNaN(timeout)) {
+          action.webhookTimeout = timeout * 1000; // Convert to ms
+        }
+      } else if (typeValue === 3) {
+        // Script action
+        action.type = 'script';
+
+        const scriptPath = await prompt('Script filename (in /etc/nupst/, must end with .sh): ');
+        if (!scriptPath.trim() || !scriptPath.trim().endsWith('.sh')) {
+          logger.warn('Script path must end with .sh, skipping action');
+          continue;
+        }
+        action.scriptPath = scriptPath.trim();
+
+        const timeoutInput = await prompt('Script timeout in seconds [60]: ');
+        const timeout = parseInt(timeoutInput, 10);
+        if (timeoutInput.trim() && !isNaN(timeout)) {
+          action.scriptTimeout = timeout * 1000; // Convert to ms
+        }
+      } else {
+        logger.warn('Invalid action type, skipping');
+        continue;
+      }
+
+      // Configure trigger mode (applies to all action types)
+      logger.log('');
+      logger.info('Trigger Mode:');
+      logger.dim('  1) Power changes + thresholds (default)');
+      logger.dim('  2) Only power status changes');
+      logger.dim('  3) Only threshold violations');
+      logger.dim('  4) Any change (every ~30s check)');
+      const triggerInput = await prompt('Select trigger mode [1]: ');
+      const triggerValue = parseInt(triggerInput, 10) || 1;
+      
+      switch (triggerValue) {
+        case 2:
+          action.triggerMode = 'onlyPowerChanges';
+          break;
+        case 3:
+          action.triggerMode = 'onlyThresholds';
+          break;
+        case 4:
+          action.triggerMode = 'anyChange';
+          break;
+        default:
+          action.triggerMode = 'powerChangesAndThresholds';
+      }
+
+      // Configure thresholds if needed for onlyThresholds or powerChangesAndThresholds modes
+      if (action.triggerMode === 'onlyThresholds' || action.triggerMode === 'powerChangesAndThresholds') {
+        logger.log('');
+        logger.info('Action Thresholds:');
+        logger.dim('Action will trigger when battery or runtime falls below these values (while on battery)');
+        
+        const batteryInput = await prompt('Battery threshold percentage [60]: ');
+        const battery = parseInt(batteryInput, 10);
+        const batteryThreshold = (batteryInput.trim() && !isNaN(battery)) ? battery : 60;
+
+        const runtimeInput = await prompt('Runtime threshold in minutes [20]: ');
+        const runtime = parseInt(runtimeInput, 10);
+        const runtimeThreshold = (runtimeInput.trim() && !isNaN(runtime)) ? runtime : 20;
+
+        action.thresholds = {
+          battery: batteryThreshold,
+          runtime: runtimeThreshold,
+        };
+      }
+
+      actions.push(action);
+      logger.success(`${action.type.charAt(0).toUpperCase() + action.type.slice(1)} action added (mode: ${action.triggerMode || 'powerChangesAndThresholds'})`);
+
+      const more = await prompt('Add another action? (y/N): ');
+      addMore = more.toLowerCase() === 'y';
+    }
+
+    if (actions.length > 0) {
+      logger.log('');
+      logger.success(`${actions.length} action(s) configured`);
+    }
+  }
+
   /**
    * Display UPS configuration summary
    * @param ups UPS configuration
@@ -920,9 +1039,7 @@ export class UpsHandler {
     logger.logBoxLine(`SNMP Host: ${ups.snmp.host}:${ups.snmp.port}`);
     logger.logBoxLine(`SNMP Version: ${ups.snmp.version}`);
     logger.logBoxLine(`UPS Model: ${ups.snmp.upsModel}`);
-    logger.logBoxLine(
+    
-      `Thresholds: ${ups.thresholds.battery}% battery, ${ups.thresholds.runtime} min runtime`,
-    );
     if (ups.groups && ups.groups.length > 0) {
       logger.logBoxLine(`Groups: ${ups.groups.join(', ')}`);
     } else {

ts/colors.ts

@@ -0,0 +1,88 @@
+/**
+ * Color theme and styling utilities for NUPST CLI
+ * Uses Deno standard library colors module
+ */
+import * as colors from '@std/fmt/colors';
+
+/**
+ * Color theme for consistent CLI styling
+ */
+export const theme = {
+  // Message types
+  error: colors.red,
+  warning: colors.yellow,
+  success: colors.green,
+  info: colors.cyan,
+  dim: colors.dim,
+  highlight: colors.bold,
+
+  // Status indicators
+  statusActive: (text: string) => colors.green(colors.bold(text)),
+  statusInactive: (text: string) => colors.red(text),
+  statusWarning: (text: string) => colors.yellow(text),
+  statusUnknown: (text: string) => colors.dim(text),
+
+  // Battery level colors
+  batteryGood: colors.green, // > 60%
+  batteryMedium: colors.yellow, // 30-60%
+  batteryCritical: colors.red, // < 30%
+
+  // Box borders
+  borderSuccess: colors.green,
+  borderError: colors.red,
+  borderWarning: colors.yellow,
+  borderInfo: colors.cyan,
+  borderDefault: (text: string) => text, // No color
+
+  // Command/code highlighting
+  command: colors.cyan,
+  code: colors.dim,
+  path: colors.blue,
+};
+
+/**
+ * Status symbols with colors
+ */
+export const symbols = {
+  success: colors.green('✓'),
+  error: colors.red('✗'),
+  warning: colors.yellow('⚠'),
+  info: colors.cyan('ℹ'),
+  running: colors.green('●'),
+  stopped: colors.red('○'),
+  starting: colors.yellow('◐'),
+  unknown: colors.dim('◯'),
+};
+
+/**
+ * Get color for battery level
+ */
+export function getBatteryColor(percentage: number): (text: string) => string {
+  if (percentage >= 60) return theme.batteryGood;
+  if (percentage >= 30) return theme.batteryMedium;
+  return theme.batteryCritical;
+}
+
+/**
+ * Get color for runtime remaining
+ */
+export function getRuntimeColor(minutes: number): (text: string) => string {
+  if (minutes >= 20) return theme.batteryGood;
+  if (minutes >= 10) return theme.batteryMedium;
+  return theme.batteryCritical;
+}
+
+/**
+ * Format UPS power status with color
+ */
+export function formatPowerStatus(status: 'online' | 'onBattery' | 'unknown'): string {
+  switch (status) {
+    case 'online':
+      return theme.success('Online');
+    case 'onBattery':
+      return theme.warning('On Battery');
+    case 'unknown':
+    default:
+      return theme.dim('Unknown');
+  }
+}

ts/daemon.ts

@@ -4,8 +4,12 @@ import * as path from 'node:path';
 import { exec, execFile } from 'node:child_process';
 import { promisify } from 'node:util';
 import { NupstSnmp } from './snmp/manager.ts';
-import type { ISnmpConfig } from './snmp/types.ts';
+import type { ISnmpConfig, IUpsStatus as ISnmpUpsStatus } from './snmp/types.ts';
-import { logger } from './logger.ts';
+import { logger, type ITableColumn } from './logger.ts';
+import { MigrationRunner } from './migrations/index.ts';
+import { theme, symbols, getBatteryColor, getRuntimeColor, formatPowerStatus } from './colors.ts';
+import type { IActionConfig } from './actions/base-action.ts';
+import { ActionManager, type IActionContext, type TPowerStatus } from './actions/index.ts';
 
 const execAsync = promisify(exec);
 const execFileAsync = promisify(execFile);
@@ -20,15 +24,10 @@ export interface IUpsConfig {
   name: string;
   /** SNMP configuration settings */
   snmp: ISnmpConfig;
-  /** Threshold settings for initiating shutdown */
-  thresholds: {
-    /** Shutdown when battery below this percentage */
-    battery: number;
-    /** Shutdown when runtime below this minutes */
-    runtime: number;
-  };
   /** Group IDs this UPS belongs to */
   groups: string[];
+  /** Actions to trigger on power status changes and threshold violations */
+  actions?: IActionConfig[];
 }
 
 /**
@@ -43,12 +42,16 @@ export interface IGroupConfig {
   mode: 'redundant' | 'nonRedundant';
   /** Optional description */
   description?: string;
+  /** Actions to trigger on power status changes and threshold violations */
+  actions?: IActionConfig[];
 }
 
 /**
  * Configuration interface for the daemon
  */
 export interface INupstConfig {
+  /** Configuration format version */
+  version?: string;
   /** UPS devices configuration */
   upsDevices: IUpsConfig[];
   /** Groups configuration */
@@ -56,10 +59,12 @@ export interface INupstConfig {
   /** Check interval in milliseconds */
   checkInterval: number;
 
-  // Legacy fields for backward compatibility
+  // Legacy fields for backward compatibility (will be migrated away)
-  /** SNMP configuration settings (legacy) */
+  /** UPS list (v3 format - legacy) */
+  upsList?: IUpsConfig[];
+  /** SNMP configuration settings (v1 format - legacy) */
   snmp?: ISnmpConfig;
-  /** Threshold settings (legacy) */
+  /** Threshold settings (v1 format - legacy) */
   thresholds?: {
     /** Shutdown when battery below this percentage */
     battery: number;
@@ -71,7 +76,7 @@ export interface INupstConfig {
 /**
  * UPS status tracking interface
  */
-interface IUpsStatus {
+export interface IUpsStatus {
   id: string;
   name: string;
   powerStatus: 'online' | 'onBattery' | 'unknown';
@@ -91,6 +96,7 @@ export class NupstDaemon {
 
   /** Default configuration */
   private readonly DEFAULT_CONFIG: INupstConfig = {
+    version: '4.2',
     upsDevices: [
       {
         id: 'default',
@@ -111,16 +117,23 @@ export class NupstDaemon {
           // UPS model for OID selection
           upsModel: 'cyberpower',
         },
-        thresholds: {
-          battery: 60, // Shutdown when battery below 60%
-          runtime: 20, // Shutdown when runtime below 20 minutes
-        },
         groups: [],
+        actions: [
+          {
+            type: 'shutdown',
+            triggerMode: 'onlyThresholds',
+            thresholds: {
+              battery: 60, // Shutdown when battery below 60%
+              runtime: 20, // Shutdown when runtime below 20 minutes
+            },
+            shutdownDelay: 5,
+          },
+        ],
       },
     ],
     groups: [],
     checkInterval: 30000, // Check every 30 seconds
-  };
+  }
 
   private config: INupstConfig;
   private snmp: NupstSnmp;
@@ -153,29 +166,18 @@ export class NupstDaemon {
       const configData = fs.readFileSync(this.CONFIG_PATH, 'utf8');
       const parsedConfig = JSON.parse(configData);
 
-      // Handle legacy configuration format
+      // Run migrations to upgrade config format if needed
-      if (!parsedConfig.upsDevices && parsedConfig.snmp) {
+      const migrationRunner = new MigrationRunner();
-        // Convert legacy format to new format
+      const { config: migratedConfig, migrated } = await migrationRunner.run(parsedConfig);
-        this.config = {
-          upsDevices: [
-            {
-              id: 'default',
-              name: 'Default UPS',
-              snmp: parsedConfig.snmp,
-              thresholds: parsedConfig.thresholds,
-              groups: [],
-            },
-          ],
-          groups: [],
-          checkInterval: parsedConfig.checkInterval,
-        };
 
-        logger.log('Legacy configuration format detected. Converting to multi-UPS format.');
+      // Save migrated config back to disk if any migrations ran
-
+      // Cast to INupstConfig since migrations ensure the output is valid
-        // Save the new format
+      const validConfig = migratedConfig as unknown as INupstConfig;
+      if (migrated) {
+        this.config = validConfig;
         await this.saveConfig(this.config);
       } else {
-        this.config = parsedConfig;
+        this.config = validConfig;
       }
 
       return this.config;
@@ -202,14 +204,21 @@ export class NupstDaemon {
       if (!fs.existsSync(configDir)) {
         fs.mkdirSync(configDir, { recursive: true });
       }
-      fs.writeFileSync(this.CONFIG_PATH, JSON.stringify(config, null, 2));
-      this.config = config;
 
-      console.log('┌─ Configuration Saved ─────────────────────┐');
+      // Ensure version is always set and remove legacy fields before saving
-      console.log(`│ Location: ${this.CONFIG_PATH}`);
+      const configToSave: INupstConfig = {
-      console.log('└──────────────────────────────────────────┘');
+        version: '4.1',
+        upsDevices: config.upsDevices,
+        groups: config.groups,
+        checkInterval: config.checkInterval,
+      };
+
+      fs.writeFileSync(this.CONFIG_PATH, JSON.stringify(configToSave, null, 2));
+      this.config = configToSave;
+
+      logger.logBox('Configuration Saved', [`Location: ${this.CONFIG_PATH}`], 45, 'success');
     } catch (error) {
-      console.error('Error saving configuration:', error);
+      logger.error(`Error saving configuration: ${error}`);
     }
   }
 
@@ -217,10 +226,7 @@ export class NupstDaemon {
    * Helper method to log configuration errors consistently
    */
   private logConfigError(message: string): void {
-    console.error('┌─ Configuration Error ─────────────────────┐');
+    logger.logBox('Configuration Error', [message, "Please run 'nupst setup' first to create a configuration."], 45, 'error');
-    console.error(`│ ${message}`);
-    console.error("│ Please run 'nupst setup' first to create a configuration.");
-    console.error('└───────────────────────────────────────────┘');
   }
 
   /**
@@ -313,29 +319,57 @@ export class NupstDaemon {
    * Log the loaded configuration settings
    */
   private logConfigLoaded(): void {
-    const boxWidth = 50;
-    logger.logBoxTitle('Configuration Loaded', boxWidth);
-
-    if (this.config.upsDevices && this.config.upsDevices.length > 0) {
-      logger.logBoxLine(`UPS Devices: ${this.config.upsDevices.length}`);
-      for (const ups of this.config.upsDevices) {
-        logger.logBoxLine(`  - ${ups.name} (${ups.id}): ${ups.snmp.host}:${ups.snmp.port}`);
-      }
-    } else {
-      logger.logBoxLine('No UPS devices configured');
-    }
-
-    if (this.config.groups && this.config.groups.length > 0) {
-      logger.logBoxLine(`Groups: ${this.config.groups.length}`);
-      for (const group of this.config.groups) {
-        logger.logBoxLine(`  - ${group.name} (${group.id}): ${group.mode} mode`);
-      }
-    } else {
-      logger.logBoxLine('No Groups configured');
-    }
     
+    logger.log('');
+    logger.logBoxTitle('Configuration Loaded', 70, 'success');
     logger.logBoxLine(`Check Interval: ${this.config.checkInterval / 1000} seconds`);
     logger.logBoxEnd();
+    logger.log('');
+
+    // Display UPS devices in a table
+    if (this.config.upsDevices && this.config.upsDevices.length > 0) {
+      logger.info(`UPS Devices (${this.config.upsDevices.length}):`);
+      
+      const upsColumns: Array<{ header: string; key: string; align?: 'left' | 'right'; color?: (val: string) => string }> = [
+        { header: 'Name', key: 'name', align: 'left', color: theme.highlight },
+        { header: 'ID', key: 'id', align: 'left', color: theme.dim },
+        { header: 'Host:Port', key: 'host', align: 'left', color: theme.info },
+        { header: 'Actions', key: 'actions', align: 'left' },
+      ];
+
+      const upsRows: Array<Record<string, string>> = this.config.upsDevices.map((ups) => ({
+        name: ups.name,
+        id: ups.id,
+        host: `${ups.snmp.host}:${ups.snmp.port}`,
+        actions: `${(ups.actions || []).length} configured`,
+      }));
+
+      logger.logTable(upsColumns, upsRows);
+      logger.log('');
+    } else {
+      logger.warn('No UPS devices configured');
+      logger.log('');
+    }
+
+    // Display groups in a table
+    if (this.config.groups && this.config.groups.length > 0) {
+      logger.info(`Groups (${this.config.groups.length}):`);
+      
+      const groupColumns: Array<{ header: string; key: string; align?: 'left' | 'right'; color?: (val: string) => string }> = [
+        { header: 'Name', key: 'name', align: 'left', color: theme.highlight },
+        { header: 'ID', key: 'id', align: 'left', color: theme.dim },
+        { header: 'Mode', key: 'mode', align: 'left', color: theme.info },
+      ];
+
+      const groupRows: Array<Record<string, string>> = this.config.groups.map((group) => ({
+        name: group.name,
+        id: group.id,
+        mode: group.mode,
+      }));
+
+      logger.logTable(groupColumns, groupRows);
+      logger.log('');
+    }
   }
 
   /**
@@ -353,8 +387,9 @@ export class NupstDaemon {
     logger.log('Starting UPS monitoring...');
 
     if (!this.config.upsDevices || this.config.upsDevices.length === 0) {
-      logger.error('No UPS devices found in configuration. Monitoring stopped.');
+      logger.warn('No UPS devices found in configuration. Daemon will remain idle...');
-      this.isRunning = false;
+      // Don't exit - enter idle monitoring mode instead
+      await this.idleMonitoring();
       return;
     }
 
@@ -374,9 +409,6 @@ export class NupstDaemon {
           lastLogTime = currentTime;
         }
 
-        // Check if shutdown is required based on group configurations
-        await this.evaluateGroupShutdownConditions();
-
         // Wait before next check
         await this.sleep(this.config.checkInterval);
       } catch (error) {
@@ -430,11 +462,42 @@ export class NupstDaemon {
 
         // Check if power status changed
         if (currentStatus && currentStatus.powerStatus !== status.powerStatus) {
-          logger.logBoxTitle(`Power Status Change: ${ups.name}`, 50);
+          logger.log('');
-          logger.logBoxLine(`Status changed: ${currentStatus.powerStatus} → ${status.powerStatus}`);
+          logger.logBoxTitle(`Power Status Change: ${ups.name}`, 60, 'warning');
+          logger.logBoxLine(`Previous: ${formatPowerStatus(currentStatus.powerStatus)}`);
+          logger.logBoxLine(`Current:  ${formatPowerStatus(status.powerStatus)}`);
+          logger.logBoxLine(`Time: ${new Date().toISOString()}`);
           logger.logBoxEnd();
+          logger.log('');
 
           updatedStatus.lastStatusChange = currentTime;
+
+          // Trigger actions for power status change
+          await this.triggerUpsActions(ups, updatedStatus, currentStatus, 'powerStatusChange');
+        }
+
+        // Check if any action's thresholds are exceeded (for threshold violation triggers)
+        // Only check when on battery power
+        if (status.powerStatus === 'onBattery' && ups.actions && ups.actions.length > 0) {
+          let anyThresholdExceeded = false;
+          
+          for (const actionConfig of ups.actions) {
+            if (actionConfig.thresholds) {
+              if (
+                status.batteryCapacity < actionConfig.thresholds.battery ||
+                status.batteryRuntime < actionConfig.thresholds.runtime
+              ) {
+                anyThresholdExceeded = true;
+                break;
+              }
+            }
+          }
+
+          // Trigger actions with threshold violation reason if any threshold is exceeded
+          // Actions will individually check their own thresholds in shouldExecute()
+          if (anyThresholdExceeded) {
+            await this.triggerUpsActions(ups, updatedStatus, currentStatus, 'thresholdViolation');
+          }
         }
 
         // Update the status in the map
@@ -454,171 +517,100 @@ export class NupstDaemon {
    */
   private logAllUpsStatus(): void {
     const timestamp = new Date().toISOString();
-    const boxWidth = 60;
+    
-    logger.logBoxTitle('Periodic Status Update', boxWidth);
+    logger.log('');
+    logger.logBoxTitle('Periodic Status Update', 70, 'info');
     logger.logBoxLine(`Timestamp: ${timestamp}`);
-    logger.logBoxLine('');
-
-    for (const [id, status] of this.upsStatus.entries()) {
-      logger.logBoxLine(`UPS: ${status.name} (${id})`);
-      logger.logBoxLine(`  Power Status: ${status.powerStatus}`);
-      logger.logBoxLine(
-        `  Battery: ${status.batteryCapacity}% | Runtime: ${status.batteryRuntime} min`,
-      );
-      logger.logBoxLine('');
-    }
-
     logger.logBoxEnd();
+    logger.log('');
+
+    // Build table data
+    const columns: Array<{ header: string; key: string; align?: 'left' | 'right'; color?: (val: string) => string }> = [
+      { header: 'UPS Name', key: 'name', align: 'left', color: theme.highlight },
+      { header: 'ID', key: 'id', align: 'left', color: theme.dim },
+      { header: 'Power Status', key: 'powerStatus', align: 'left' },
+      { header: 'Battery', key: 'battery', align: 'right' },
+      { header: 'Runtime', key: 'runtime', align: 'right' },
+    ];
+
+    const rows: Array<Record<string, string>> = [];
+    for (const [id, status] of this.upsStatus.entries()) {
+      const batteryColor = getBatteryColor(status.batteryCapacity);
+      const runtimeColor = getRuntimeColor(status.batteryRuntime);
+      
+      rows.push({
+        name: status.name,
+        id: id,
+        powerStatus: formatPowerStatus(status.powerStatus),
+        battery: batteryColor(status.batteryCapacity + '%'),
+        runtime: runtimeColor(status.batteryRuntime + ' min'),
+      });
+    }
+
+    logger.logTable(columns, rows);
+    logger.log('');
+  }
+
+  
+
+    
+
+  /**
+   * Build action context from UPS state
+   * @param ups UPS configuration
+   * @param status Current UPS status
+   * @param triggerReason Why this action is being triggered
+   * @returns Action context
+   */
+  private buildActionContext(
+    ups: IUpsConfig,
+    status: IUpsStatus,
+    triggerReason: 'powerStatusChange' | 'thresholdViolation',
+  ): IActionContext {
+    return {
+      upsId: ups.id,
+      upsName: ups.name,
+      powerStatus: status.powerStatus as TPowerStatus,
+      batteryCapacity: status.batteryCapacity,
+      batteryRuntime: status.batteryRuntime,
+      previousPowerStatus: 'unknown' as TPowerStatus, // Will be set from map in calling code
+      timestamp: Date.now(),
+      triggerReason,
+    };
   }
 
   /**
-   * Evaluate if shutdown is required based on group configurations
+   * Trigger actions for a UPS device
+   * @param ups UPS configuration
+   * @param status Current UPS status
+   * @param previousStatus Previous UPS status (for determining previousPowerStatus)
+   * @param triggerReason Why actions are being triggered
    */
-  private async evaluateGroupShutdownConditions(): Promise<void> {
+  private async triggerUpsActions(
-    if (!this.config.groups || this.config.groups.length === 0) {
+    ups: IUpsConfig,
-      // No groups defined, check individual UPS conditions
+    status: IUpsStatus,
-      for (const [id, status] of this.upsStatus.entries()) {
+    previousStatus: IUpsStatus | undefined,
-        if (status.powerStatus === 'onBattery') {
+    triggerReason: 'powerStatusChange' | 'thresholdViolation',
-          // Find the UPS config
-          const ups = this.config.upsDevices.find((u) => u.id === id);
-          if (ups) {
-            await this.evaluateUpsShutdownCondition(ups, status);
-          }
-        }
-      }
-      return;
-    }
-
-    // Evaluate each group
-    for (const group of this.config.groups) {
-      // Find all UPS devices in this group
-      const upsDevicesInGroup = this.config.upsDevices.filter((ups) =>
-        ups.groups && ups.groups.includes(group.id)
-      );
-
-      if (upsDevicesInGroup.length === 0) {
-        // No UPS devices in this group
-        continue;
-      }
-
-      if (group.mode === 'redundant') {
-        // Redundant mode: only shutdown if ALL UPS devices in the group are in critical condition
-        await this.evaluateRedundantGroup(group, upsDevicesInGroup);
-      } else {
-        // Non-redundant mode: shutdown if ANY UPS device in the group is in critical condition
-        await this.evaluateNonRedundantGroup(group, upsDevicesInGroup);
-      }
-    }
-  }
-
-  /**
-   * Evaluate a redundant group for shutdown conditions
-   * In redundant mode, we only shut down if ALL UPS devices are in critical condition
-   */
-  private async evaluateRedundantGroup(
-    group: IGroupConfig,
-    upsDevices: IUpsConfig[],
   ): Promise<void> {
-    // Count UPS devices on battery and in critical condition
+    const actions = ups.actions || [];
-    let upsOnBattery = 0;
-    let upsInCriticalCondition = 0;
-
-    for (const ups of upsDevices) {
-      const status = this.upsStatus.get(ups.id);
-      if (!status) continue;
-
-      if (status.powerStatus === 'onBattery') {
-        upsOnBattery++;
-
-        // Check if this UPS is in critical condition
-        if (
-          status.batteryCapacity < ups.thresholds.battery ||
-          status.batteryRuntime < ups.thresholds.runtime
-        ) {
-          upsInCriticalCondition++;
-        }
-      }
-    }
-
-    // All UPS devices must be online for a redundant group to be considered healthy
-    const allUpsCount = upsDevices.length;
-
-    // If all UPS are on battery and in critical condition, shutdown
-    if (upsOnBattery === allUpsCount && upsInCriticalCondition === allUpsCount) {
-      logger.logBoxTitle(`Group Shutdown Required: ${group.name}`, 50);
-      logger.logBoxLine(`Mode: Redundant`);
-      logger.logBoxLine(`All ${allUpsCount} UPS devices in critical condition`);
-      logger.logBoxEnd();
-
-      await this.initiateShutdown(
-        `All UPS devices in redundant group "${group.name}" in critical condition`,
-      );
-    }
-  }
-
-  /**
-   * Evaluate a non-redundant group for shutdown conditions
-   * In non-redundant mode, we shut down if ANY UPS device is in critical condition
-   */
-  private async evaluateNonRedundantGroup(
-    group: IGroupConfig,
-    upsDevices: IUpsConfig[],
-  ): Promise<void> {
-    for (const ups of upsDevices) {
-      const status = this.upsStatus.get(ups.id);
-      if (!status) continue;
-
-      if (status.powerStatus === 'onBattery') {
-        // Check if this UPS is in critical condition
-        if (
-          status.batteryCapacity < ups.thresholds.battery ||
-          status.batteryRuntime < ups.thresholds.runtime
-        ) {
-          logger.logBoxTitle(`Group Shutdown Required: ${group.name}`, 50);
-          logger.logBoxLine(`Mode: Non-Redundant`);
-          logger.logBoxLine(`UPS ${ups.name} in critical condition`);
-          logger.logBoxLine(
-            `Battery: ${status.batteryCapacity}% (threshold: ${ups.thresholds.battery}%)`,
-          );
-          logger.logBoxLine(
-            `Runtime: ${status.batteryRuntime} min (threshold: ${ups.thresholds.runtime} min)`,
-          );
-          logger.logBoxEnd();
-
-          await this.initiateShutdown(
-            `UPS "${ups.name}" in non-redundant group "${group.name}" in critical condition`,
-          );
-          return; // Exit after initiating shutdown
-        }
-      }
-    }
-  }
-
-  /**
-   * Evaluate an individual UPS for shutdown conditions
-   */
-  private async evaluateUpsShutdownCondition(ups: IUpsConfig, status: IUpsStatus): Promise<void> {
-    // Only evaluate UPS devices not in any group
-    if (ups.groups && ups.groups.length > 0) {
-      return;
-    }
-
-    // Check threshold conditions
-    if (
-      status.batteryCapacity < ups.thresholds.battery ||
-      status.batteryRuntime < ups.thresholds.runtime
-    ) {
-      logger.logBoxTitle(`UPS Shutdown Required: ${ups.name}`, 50);
-      logger.logBoxLine(
-        `Battery: ${status.batteryCapacity}% (threshold: ${ups.thresholds.battery}%)`,
-      );
-      logger.logBoxLine(
-        `Runtime: ${status.batteryRuntime} min (threshold: ${ups.thresholds.runtime} min)`,
-      );
-      logger.logBoxEnd();
 
+    // Backward compatibility: if no actions configured, use default shutdown behavior
+    if (actions.length === 0 && triggerReason === 'thresholdViolation') {
+      // Fall back to old shutdown logic for backward compatibility
       await this.initiateShutdown(`UPS "${ups.name}" battery or runtime below threshold`);
+      return;
     }
+
+    if (actions.length === 0) {
+      return; // No actions to execute
+    }
+
+    // Build action context
+    const context = this.buildActionContext(ups, status, triggerReason);
+    context.previousPowerStatus = (previousStatus?.powerStatus || 'unknown') as TPowerStatus;
+
+    // Execute actions
+    await ActionManager.executeActions(actions, context);
   }
 
   /**
@@ -747,38 +739,61 @@ export class NupstDaemon {
     const MAX_MONITORING_TIME = 5 * 60 * 1000; // Max 5 minutes of monitoring
     const startTime = Date.now();
 
-    logger.log(
+    logger.log('');
-      `Emergency shutdown threshold: ${EMERGENCY_RUNTIME_THRESHOLD} minutes remaining battery runtime`,
+    logger.logBoxTitle('Shutdown Monitoring Active', 60, 'warning');
-    );
+    logger.logBoxLine(`Emergency threshold: ${EMERGENCY_RUNTIME_THRESHOLD} minutes runtime`);
+    logger.logBoxLine(`Check interval: ${CHECK_INTERVAL / 1000} seconds`);
+    logger.logBoxLine(`Max monitoring time: ${MAX_MONITORING_TIME / 1000} seconds`);
+    logger.logBoxEnd();
+    logger.log('');
 
     // Continue monitoring until max monitoring time is reached
     while (Date.now() - startTime < MAX_MONITORING_TIME) {
       try {
-        logger.log('Checking UPS status during shutdown...');
+        logger.info('Checking UPS status during shutdown...');
+
+        // Build table for UPS status during shutdown
+        const columns: Array<{ header: string; key: string; align?: 'left' | 'right'; color?: (val: string) => string }> = [
+          { header: 'UPS Name', key: 'name', align: 'left', color: theme.highlight },
+          { header: 'Battery', key: 'battery', align: 'right' },
+          { header: 'Runtime', key: 'runtime', align: 'right' },
+          { header: 'Status', key: 'status', align: 'left' },
+        ];
+
+        const rows: Array<Record<string, string>> = [];
+        let emergencyDetected = false;
+        let emergencyUps: { ups: IUpsConfig; status: ISnmpUpsStatus } | null = null;
 
         // Check all UPS devices
         for (const ups of this.config.upsDevices) {
           try {
             const status = await this.snmp.getUpsStatus(ups.snmp);
 
-            logger.log(
+            const batteryColor = getBatteryColor(status.batteryCapacity);
-              `UPS ${ups.name}: Battery ${status.batteryCapacity}%, Runtime: ${status.batteryRuntime} minutes`,
+            const runtimeColor = getRuntimeColor(status.batteryRuntime);
-            );
 
-            // If any UPS battery runtime gets critically low, force immediate shutdown
+            const isCritical = status.batteryRuntime < EMERGENCY_RUNTIME_THRESHOLD;
-            if (status.batteryRuntime < EMERGENCY_RUNTIME_THRESHOLD) {
-              logger.logBoxTitle('EMERGENCY SHUTDOWN', 50);
-              logger.logBoxLine(
-                `UPS ${ups.name} runtime critically low: ${status.batteryRuntime} minutes`,
-              );
-              logger.logBoxLine('Forcing immediate shutdown!');
-              logger.logBoxEnd();
             
-              // Force immediate shutdown
+            rows.push({
-              await this.forceImmediateShutdown();
+              name: ups.name,
-              return;
+              battery: batteryColor(status.batteryCapacity + '%'),
+              runtime: runtimeColor(status.batteryRuntime + ' min'),
+              status: isCritical ? theme.error('CRITICAL!') : theme.success('OK'),
+            });
+
+            // If any UPS battery runtime gets critically low, flag for immediate shutdown
+            if (isCritical && !emergencyDetected) {
+              emergencyDetected = true;
+              emergencyUps = { ups, status };
             }
           } catch (upsError) {
+            rows.push({
+              name: ups.name,
+              battery: theme.error('N/A'),
+              runtime: theme.error('N/A'),
+              status: theme.error('ERROR'),
+            });
+            
             logger.error(
               `Error checking UPS ${ups.name} during shutdown: ${
                 upsError instanceof Error ? upsError.message : String(upsError)
@@ -787,6 +802,27 @@ export class NupstDaemon {
           }
         }
 
+        // Display the table
+        logger.logTable(columns, rows);
+        logger.log('');
+
+        // If emergency detected, trigger immediate shutdown
+        if (emergencyDetected && emergencyUps) {
+          logger.log('');
+          logger.logBoxTitle('EMERGENCY SHUTDOWN', 60, 'error');
+          logger.logBoxLine(
+            `UPS ${emergencyUps.ups.name} runtime critically low: ${emergencyUps.status.batteryRuntime} minutes`,
+          );
+          logger.logBoxLine(`Emergency threshold: ${EMERGENCY_RUNTIME_THRESHOLD} minutes`);
+          logger.logBoxLine('Forcing immediate shutdown!');
+          logger.logBoxEnd();
+          logger.log('');
+
+          // Force immediate shutdown
+          await this.forceImmediateShutdown();
+          return;
+        }
+
         // Wait before checking again
         await this.sleep(CHECK_INTERVAL);
       } catch (error) {
@@ -799,7 +835,9 @@ export class NupstDaemon {
       }
     }
 
-    logger.log('UPS monitoring during shutdown completed');
+    logger.log('');
+    logger.success('UPS monitoring during shutdown completed');
+    logger.log('');
   }
 
   /**
@@ -890,6 +928,133 @@ export class NupstDaemon {
     }
   }
 
+  /**
+   * Idle monitoring loop when no UPS devices are configured
+   * Watches for config changes and reloads when detected
+   */
+  private async idleMonitoring(): Promise<void> {
+    const IDLE_CHECK_INTERVAL = 60000; // Check every 60 seconds
+    let lastConfigCheck = Date.now();
+    const CONFIG_CHECK_INTERVAL = 60000; // Check config every minute
+
+    logger.log('Entering idle monitoring mode...');
+    logger.log('Daemon will check for config changes every 60 seconds');
+
+    // Start file watcher for hot-reload
+    this.watchConfigFile();
+
+    while (this.isRunning) {
+      try {
+        const currentTime = Date.now();
+
+        // Periodically check if config has been updated
+        if (currentTime - lastConfigCheck >= CONFIG_CHECK_INTERVAL) {
+          try {
+            // Try to load config
+            const newConfig = await this.loadConfig();
+
+            // Check if we now have UPS devices configured
+            if (newConfig.upsDevices && newConfig.upsDevices.length > 0) {
+              logger.success('Configuration updated! UPS devices found. Starting monitoring...');
+              this.initializeUpsStatus();
+              // Exit idle mode and start monitoring
+              await this.monitor();
+              return;
+            }
+          } catch (error) {
+            // Config still doesn't exist or invalid, continue waiting
+          }
+
+          lastConfigCheck = currentTime;
+        }
+
+        await this.sleep(IDLE_CHECK_INTERVAL);
+      } catch (error) {
+        logger.error(
+          `Error during idle monitoring: ${error instanceof Error ? error.message : String(error)}`,
+        );
+        await this.sleep(IDLE_CHECK_INTERVAL);
+      }
+    }
+
+    logger.log('Idle monitoring stopped');
+  }
+
+  /**
+   * Watch config file for changes and reload automatically
+   */
+  private watchConfigFile(): void {
+    try {
+      // Use Deno's file watcher to monitor config file
+      const configDir = path.dirname(this.CONFIG_PATH);
+
+      // Spawn a background watcher (non-blocking)
+      (async () => {
+        try {
+          const watcher = Deno.watchFs(configDir);
+
+          logger.log('Config file watcher started');
+
+          for await (const event of watcher) {
+            // Only respond to modify events on the config file
+            if (
+              event.kind === 'modify' &&
+              event.paths.some((p) => p.includes('config.json'))
+            ) {
+              logger.info('Config file changed, reloading...');
+              await this.reloadConfig();
+            }
+
+            // Stop watching if daemon stopped
+            if (!this.isRunning) {
+              break;
+            }
+          }
+        } catch (error) {
+          // Watcher error - not critical, just log it
+          logger.dim(
+            `Config watcher stopped: ${error instanceof Error ? error.message : String(error)}`,
+          );
+        }
+      })();
+    } catch (error) {
+      // If we can't start the watcher, just log and continue
+      // The periodic check will still work
+      logger.dim('Could not start config file watcher, using periodic checks only');
+    }
+  }
+
+  /**
+   * Reload configuration and restart monitoring if needed
+   */
+  private async reloadConfig(): Promise<void> {
+    try {
+      const oldDeviceCount = this.config.upsDevices?.length || 0;
+
+      // Load the new configuration
+      await this.loadConfig();
+      const newDeviceCount = this.config.upsDevices?.length || 0;
+
+      if (newDeviceCount > 0 && oldDeviceCount === 0) {
+        logger.success(`Configuration reloaded! Found ${newDeviceCount} UPS device(s)`);
+        logger.info('Monitoring will start automatically...');
+      } else if (newDeviceCount !== oldDeviceCount) {
+        logger.success(
+          `Configuration reloaded! UPS devices: ${oldDeviceCount} → ${newDeviceCount}`,
+        );
+
+        // Reinitialize UPS status tracking
+        this.initializeUpsStatus();
+      } else {
+        logger.success('Configuration reloaded successfully');
+      }
+    } catch (error) {
+      logger.warn(
+        `Failed to reload config: ${error instanceof Error ? error.message : String(error)}`,
+      );
+    }
+  }
+
   /**
    * Sleep for the specified milliseconds
    */

ts/logger.ts

@@ -1,9 +1,38 @@
+import { theme, symbols } from './colors.ts';
+
+/**
+ * Table column alignment options
+ */
+export type TColumnAlign = 'left' | 'right' | 'center';
+
+/**
+ * Table column definition
+ */
+export interface ITableColumn {
+  /** Column header text */
+  header: string;
+  /** Column key in data object */
+  key: string;
+  /** Column alignment (default: left) */
+  align?: TColumnAlign;
+  /** Column width (auto-calculated if not specified) */
+  width?: number;
+  /** Color function to apply to cell values */
+  color?: (value: string) => string;
+}
+
+/**
+ * Box style types with colors
+ */
+export type TBoxStyle = 'default' | 'success' | 'error' | 'warning' | 'info';
+
 /**
  * A simple logger class that provides consistent formatting for log messages
  * including support for logboxes with title, lines, and closing
  */
 export class Logger {
   private currentBoxWidth: number | null = null;
+  private currentBoxStyle: TBoxStyle = 'default';
   private static instance: Logger;
 
   /** Default width to use when no width is specified */
@@ -36,36 +65,83 @@ export class Logger {
   }
 
   /**
-   * Log an error message
+   * Log an error message (red with ✗ symbol)
    * @param message Error message to log
    */
   public error(message: string): void {
-    console.error(message);
+    console.error(`${symbols.error} ${theme.error(message)}`);
   }
 
   /**
-   * Log a warning message with a warning emoji
+   * Log a warning message (yellow with ⚠ symbol)
    * @param message Warning message to log
    */
   public warn(message: string): void {
-    console.warn(`⚠️ ${message}`);
+    console.warn(`${symbols.warning} ${theme.warning(message)}`);
   }
 
   /**
-   * Log a success message with a checkmark
+   * Log a success message (green with ✓ symbol)
    * @param message Success message to log
    */
   public success(message: string): void {
-    console.log(`✓ ${message}`);
+    console.log(`${symbols.success} ${theme.success(message)}`);
+  }
+
+  /**
+   * Log an info message (cyan with ℹ symbol)
+   * @param message Info message to log
+   */
+  public info(message: string): void {
+    console.log(`${symbols.info} ${theme.info(message)}`);
+  }
+
+  /**
+   * Log a dim/secondary message
+   * @param message Message to log in dim style
+   */
+  public dim(message: string): void {
+    console.log(theme.dim(message));
+  }
+
+  /**
+   * Log a highlighted/bold message
+   * @param message Message to highlight
+   */
+  public highlight(message: string): void {
+    console.log(theme.highlight(message));
+  }
+
+  /**
+   * Get color function for box based on style
+   */
+  private getBoxColor(style: TBoxStyle): (text: string) => string {
+    switch (style) {
+      case 'success':
+        return theme.borderSuccess;
+      case 'error':
+        return theme.borderError;
+      case 'warning':
+        return theme.borderWarning;
+      case 'info':
+        return theme.borderInfo;
+      case 'default':
+      default:
+        return theme.borderDefault;
+    }
   }
 
   /**
    * Log a logbox title and set the current box width
    * @param title Title of the logbox
    * @param width Width of the logbox (including borders), defaults to DEFAULT_WIDTH
+   * @param style Box style for coloring (default, success, error, warning, info)
    */
-  public logBoxTitle(title: string, width?: number): void {
+  public logBoxTitle(title: string, width?: number, style?: TBoxStyle): void {
     this.currentBoxWidth = width || this.DEFAULT_WIDTH;
+    this.currentBoxStyle = style || 'default';
+
+    const colorFn = this.getBoxColor(this.currentBoxStyle);
 
     // Create the title line with appropriate padding
     const paddedTitle = ` ${title} `;
@@ -74,7 +150,7 @@ export class Logger {
     // Title line: ┌─ Title ───┐
     const titleLine = `┌─${paddedTitle}${'─'.repeat(Math.max(0, remainingSpace))}┐`;
 
-    console.log(titleLine);
+    console.log(colorFn(titleLine));
   }
 
   /**
@@ -89,17 +165,21 @@ export class Logger {
     }
 
     const boxWidth = width || this.currentBoxWidth || this.DEFAULT_WIDTH;
+    const colorFn = this.getBoxColor(this.currentBoxStyle);
 
-    // Calculate the available space for content
+    // Calculate the available space for content (use visible length)
     const availableSpace = boxWidth - 2; // Account for left and right borders
+    const visibleLen = this.visibleLength(content);
 
-    if (content.length <= availableSpace - 1) {
+    if (visibleLen <= availableSpace - 1) {
       // If content fits with at least one space for the right border stripe
-      const padding = availableSpace - content.length - 1;
+      const padding = availableSpace - visibleLen - 1;
-      console.log(`│ ${content}${' '.repeat(padding)}│`);
+      const line = `│ ${content}${' '.repeat(padding)}│`;
+      console.log(colorFn(line));
     } else {
       // Content is too long, let it flow out of boundaries.
-      console.log(`│ ${content}`);
+      const line = `│ ${content}`;
+      console.log(colorFn(line));
     }
   }
 
@@ -109,12 +189,15 @@ export class Logger {
    */
   public logBoxEnd(width?: number): void {
     const boxWidth = width || this.currentBoxWidth || this.DEFAULT_WIDTH;
+    const colorFn = this.getBoxColor(this.currentBoxStyle);
 
     // Create the bottom border: └────────┘
-    console.log(`└${'─'.repeat(boxWidth - 2)}┘`);
+    const bottomLine = `└${'─'.repeat(boxWidth - 2)}┘`;
+    console.log(colorFn(bottomLine));
 
-    // Reset the current box width
+    // Reset the current box width and style
     this.currentBoxWidth = null;
+    this.currentBoxStyle = 'default';
   }
 
   /**
@@ -122,9 +205,10 @@ export class Logger {
    * @param title Title of the logbox
    * @param lines Array of content lines
    * @param width Width of the logbox, defaults to DEFAULT_WIDTH
+   * @param style Box style for coloring
    */
-  public logBox(title: string, lines: string[], width?: number): void {
+  public logBox(title: string, lines: string[], width?: number, style?: TBoxStyle): void {
-    this.logBoxTitle(title, width || this.DEFAULT_WIDTH);
+    this.logBoxTitle(title, width || this.DEFAULT_WIDTH, style);
 
     for (const line of lines) {
       this.logBoxLine(line);
@@ -141,6 +225,108 @@ export class Logger {
   public logDivider(width?: number, character: string = '─'): void {
     console.log(character.repeat(width || this.DEFAULT_WIDTH));
   }
+
+  /**
+   * Strip ANSI color codes from string for accurate length calculation
+   */
+  private stripAnsi(text: string): string {
+    // Remove ANSI escape codes
+    return text.replace(/\x1b\[[0-9;]*m/g, '');
+  }
+
+  /**
+   * Get visible length of string (excluding ANSI codes)
+   */
+  private visibleLength(text: string): number {
+    return this.stripAnsi(text).length;
+  }
+
+  /**
+   * Align text within a column (handles ANSI color codes correctly)
+   */
+  private alignText(text: string, width: number, align: TColumnAlign = 'left'): string {
+    const visibleLen = this.visibleLength(text);
+
+    if (visibleLen >= width) {
+      // Text is too long, truncate the visible part
+      const stripped = this.stripAnsi(text);
+      return stripped.substring(0, width);
+    }
+
+    const padding = width - visibleLen;
+
+    switch (align) {
+      case 'right':
+        return ' '.repeat(padding) + text;
+      case 'center': {
+        const leftPad = Math.floor(padding / 2);
+        const rightPad = padding - leftPad;
+        return ' '.repeat(leftPad) + text + ' '.repeat(rightPad);
+      }
+      case 'left':
+      default:
+        return text + ' '.repeat(padding);
+    }
+  }
+
+  /**
+   * Log a formatted table
+   * @param columns Column definitions
+   * @param rows Array of data objects
+   * @param title Optional table title
+   */
+  public logTable(columns: ITableColumn[], rows: Record<string, string>[], title?: string): void {
+    if (rows.length === 0) {
+      this.dim('No data to display');
+      return;
+    }
+
+    // Calculate column widths
+    const columnWidths = columns.map((col) => {
+      if (col.width) return col.width;
+
+      // Auto-calculate width based on header and data (use visible length)
+      let maxWidth = this.visibleLength(col.header);
+      for (const row of rows) {
+        const value = String(row[col.key] || '');
+        maxWidth = Math.max(maxWidth, this.visibleLength(value));
+      }
+      return maxWidth;
+    });
+
+    // Calculate total table width
+    const totalWidth = columnWidths.reduce((sum, w) => sum + w, 0) + (columns.length * 3) + 1;
+
+    // Print title if provided
+    if (title) {
+      this.logBoxTitle(title, totalWidth);
+    } else {
+      // Print top border
+      console.log('┌' + columnWidths.map((w) => '─'.repeat(w + 2)).join('┬') + '┐');
+    }
+
+    // Print header row
+    const headerCells = columns.map((col, i) =>
+      theme.highlight(this.alignText(col.header, columnWidths[i], col.align))
+    );
+    console.log('│ ' + headerCells.join(' │ ') + ' │');
+
+    // Print separator
+    console.log('├' + columnWidths.map((w) => '─'.repeat(w + 2)).join('┼') + '┤');
+
+    // Print data rows
+    for (const row of rows) {
+      const cells = columns.map((col, i) => {
+        const value = String(row[col.key] || '');
+        const aligned = this.alignText(value, columnWidths[i], col.align);
+        return col.color ? col.color(aligned) : aligned;
+      });
+      console.log('│ ' + cells.join(' │ ') + ' │');
+    }
+
+    // Print bottom border
+    console.log('└' + columnWidths.map((w) => '─'.repeat(w + 2)).join('┴') + '┘');
+  }
 }
 
 // Export a singleton instance for easy use

ts/migrations/base-migration.ts

@@ -0,0 +1,67 @@
+/**
+ * Abstract base class for configuration migrations
+ *
+ * Each migration represents an upgrade from one config version to another.
+ * Migrations run in order based on the `order` field, allowing users to jump
+ * multiple versions (e.g., v1 → v4 runs migrations 2, 3, and 4).
+ */
+/**
+ * Abstract base class for configuration migrations
+ *
+ * Each migration represents an upgrade from one config version to another.
+ * Migrations run in order based on the `toVersion` field, allowing users to jump
+ * multiple versions (e.g., v1 → v4 runs migrations 2, 3, and 4).
+ */
+export abstract class BaseMigration {
+  /**
+   * Source version this migration upgrades from
+   * e.g., "1.x", "3.x"
+   */
+  abstract readonly fromVersion: string;
+
+  /**
+   * Target version this migration upgrades to
+   * e.g., "2.0", "4.0", "4.1"
+   */
+  abstract readonly toVersion: string;
+
+  /**
+   * Check if this migration should run on the given config
+   *
+   * @param config - Raw configuration object to check (unknown schema for migrations)
+   * @returns True if migration should run, false otherwise
+   */
+  abstract shouldRun(config: Record<string, unknown>): Promise<boolean>;
+
+  /**
+   * Perform the migration on the given config
+   *
+   * @param config - Raw configuration object to migrate (unknown schema for migrations)
+   * @returns Migrated configuration object
+   */
+  abstract migrate(config: Record<string, unknown>): Promise<Record<string, unknown>>;
+
+  /**
+   * Get human-readable name for this migration
+   *
+   * @returns Migration name
+   */
+  getName(): string {
+    return `Migration ${this.fromVersion} → ${this.toVersion}`;
+  }
+
+  /**
+   * Parse version string into a comparable number
+   * Supports formats like "2.0", "4.1", etc.
+   * Returns a number like 2.0, 4.1 for sorting
+   *
+   * @returns Parsed version number for ordering
+   */
+  getVersionOrder(): number {
+    const parsed = parseFloat(this.toVersion);
+    if (isNaN(parsed)) {
+      throw new Error(`Invalid version format: ${this.toVersion}`);
+    }
+    return parsed;
+  }
+}

ts/migrations/index.ts

@@ -0,0 +1,11 @@
+/**
+ * Configuration migrations module
+ *
+ * Exports the migration system for upgrading configs between versions.
+ */
+
+export { BaseMigration } from './base-migration.ts';
+export { MigrationRunner } from './migration-runner.ts';
+export { MigrationV1ToV2 } from './migration-v1-to-v2.ts';
+export { MigrationV3ToV4 } from './migration-v3-to-v4.ts';
+export { MigrationV4_0ToV4_1 } from './migration-v4.0-to-v4.1.ts';

ts/migrations/migration-runner.ts

@@ -0,0 +1,75 @@
+import { BaseMigration } from './base-migration.ts';
+import { MigrationV1ToV2 } from './migration-v1-to-v2.ts';
+import { MigrationV3ToV4 } from './migration-v3-to-v4.ts';
+import { MigrationV4_0ToV4_1 } from './migration-v4.0-to-v4.1.ts';
+import { logger } from '../logger.ts';
+
+/**
+ * Migration runner
+ *
+ * Discovers all available migrations, sorts them by order,
+ * and runs applicable migrations in sequence.
+ */
+export class MigrationRunner {
+  private migrations: BaseMigration[];
+
+  constructor() {
+    // Register all migrations here
+    this.migrations = [
+      new MigrationV1ToV2(),
+      new MigrationV3ToV4(),
+      new MigrationV4_0ToV4_1(),
+      // Add future migrations here (v4.3, v4.4, etc.)
+    ];
+
+    // Sort by version order to ensure they run in sequence
+    this.migrations.sort((a, b) => a.getVersionOrder() - b.getVersionOrder());
+  }
+
+  /**
+   * Run all applicable migrations on the config
+   *
+   * @param config - Raw configuration object to migrate
+   * @returns Migrated configuration and whether migrations ran
+   */
+  async run(
+    config: Record<string, unknown>,
+  ): Promise<{ config: Record<string, unknown>; migrated: boolean }> {
+    let currentConfig = config;
+    let anyMigrationsRan = false;
+
+    for (const migration of this.migrations) {
+      const shouldRun = await migration.shouldRun(currentConfig);
+
+      if (shouldRun) {
+        // Only show "checking" message when we actually need to migrate
+        if (!anyMigrationsRan) {
+          logger.dim('Checking for required config migrations...');
+        }
+        logger.info(`Running ${migration.getName()}...`);
+        currentConfig = await migration.migrate(currentConfig);
+        anyMigrationsRan = true;
+      }
+    }
+
+    if (anyMigrationsRan) {
+      logger.success('Configuration migrations complete');
+    } else {
+      logger.success('config format ok');
+    }
+
+    return {
+      config: currentConfig,
+      migrated: anyMigrationsRan,
+    };
+  }
+
+  /**
+   * Get all registered migrations
+   *
+   * @returns Array of all migrations sorted by order
+   */
+  getMigrations(): BaseMigration[] {
+    return [...this.migrations];
+  }
+}

ts/migrations/migration-v1-to-v2.ts

@@ -0,0 +1,55 @@
+import { BaseMigration } from './base-migration.ts';
+import { logger } from '../logger.ts';
+
+/**
+ * Migration from v1 (single SNMP config) to v2 (upsDevices array)
+ *
+ * Detects old format:
+ * {
+ *   snmp: { ... },
+ *   thresholds: { ... },
+ *   checkInterval: 30000
+ * }
+ *
+ * Converts to:
+ * {
+ *   version: "2.0",
+ *   upsDevices: [{ id: "default", name: "Default UPS", snmp: ..., thresholds: ... }],
+ *   groups: [],
+ *   checkInterval: 30000
+ * }
+ */
+export class MigrationV1ToV2 extends BaseMigration {
+  readonly fromVersion = '1.x';
+  readonly toVersion = '2.0';
+
+  async shouldRun(config: any): Promise<boolean> {
+    // V1 format has snmp field directly at root, no upsDevices or upsList
+    return !!config.snmp && !config.upsDevices && !config.upsList;
+  }
+
+  async migrate(config: any): Promise<any> {
+    logger.info(`${this.getName()}: Converting single SNMP config to multi-UPS format...`);
+
+    const migrated = {
+      version: this.toVersion,
+      upsDevices: [
+        {
+          id: 'default',
+          name: 'Default UPS',
+          snmp: config.snmp,
+          thresholds: config.thresholds || {
+            battery: 60,
+            runtime: 20,
+          },
+          groups: [],
+        },
+      ],
+      groups: [],
+      checkInterval: config.checkInterval || 30000,
+    };
+
+    logger.success(`${this.getName()}: Migration complete`);
+    return migrated;
+  }
+}

ts/migrations/migration-v3-to-v4.ts

@@ -0,0 +1,118 @@
+import { BaseMigration } from './base-migration.ts';
+import { logger } from '../logger.ts';
+
+/**
+ * Migration from v3 (upsList) to v4 (upsDevices)
+ *
+ * Transforms v3 format with flat SNMP config:
+ * {
+ *   upsList: [
+ *     {
+ *       id: "ups-1",
+ *       name: "UPS 1",
+ *       host: "192.168.1.1",
+ *       port: 161,
+ *       community: "public",
+ *       version: "1"  // string
+ *     }
+ *   ]
+ * }
+ *
+ * To v4 format with nested SNMP config:
+ * {
+ *   version: "4.0",
+ *   upsDevices: [
+ *     {
+ *       id: "ups-1",
+ *       name: "UPS 1",
+ *       snmp: {
+ *         host: "192.168.1.1",
+ *         port: 161,
+ *         community: "public",
+ *         version: 1,  // number
+ *         timeout: 5000
+ *       },
+ *       thresholds: { battery: 60, runtime: 20 },
+ *       groups: []
+ *     }
+ *   ]
+ * }
+ */
+export class MigrationV3ToV4 extends BaseMigration {
+  readonly fromVersion = '3.x';
+  readonly toVersion = '4.0';
+
+  async shouldRun(config: any): Promise<boolean> {
+    // V3 format has upsList OR has upsDevices with flat structure (host at top level)
+    if (config.upsList && !config.upsDevices) {
+      return true; // Classic v3 with upsList
+    }
+
+    // Check if upsDevices exists but has flat structure (v3 format)
+    if (config.upsDevices && config.upsDevices.length > 0) {
+      const firstDevice = config.upsDevices[0];
+      // V3 has host at top level, v4 has it nested in snmp object
+      return !!firstDevice.host && !firstDevice.snmp;
+    }
+
+    return false;
+  }
+
+  async migrate(config: any): Promise<any> {
+    logger.info(`${this.getName()}: Migrating v3 config to v4 format...`);
+    logger.dim(`  - Restructuring UPS devices (flat → nested snmp config)`);
+
+    // Get devices from either upsList or upsDevices (for partially migrated configs)
+    const sourceDevices = config.upsList || config.upsDevices;
+
+    // Transform each UPS device from v3 flat structure to v4 nested structure
+    const transformedDevices = sourceDevices.map((device: any) => {
+      // Build SNMP config object
+      const snmpConfig: any = {
+        host: device.host,
+        port: device.port || 161,
+        version: typeof device.version === 'string' ? parseInt(device.version, 10) : device.version,
+        timeout: device.timeout || 5000,
+      };
+
+      // Add SNMPv1/v2c fields
+      if (device.community) {
+        snmpConfig.community = device.community;
+      }
+
+      // Add SNMPv3 fields
+      if (device.securityLevel) snmpConfig.securityLevel = device.securityLevel;
+      if (device.username) snmpConfig.username = device.username;
+      if (device.authProtocol) snmpConfig.authProtocol = device.authProtocol;
+      if (device.authKey) snmpConfig.authKey = device.authKey;
+      if (device.privProtocol) snmpConfig.privProtocol = device.privProtocol;
+      if (device.privKey) snmpConfig.privKey = device.privKey;
+
+      // Add UPS model if present
+      if (device.upsModel) snmpConfig.upsModel = device.upsModel;
+      if (device.customOIDs) snmpConfig.customOIDs = device.customOIDs;
+
+      // Return v4 format with nested structure
+      return {
+        id: device.id,
+        name: device.name,
+        snmp: snmpConfig,
+        thresholds: device.thresholds || {
+          battery: 60,
+          runtime: 20,
+        },
+        groups: device.groups || [],
+      };
+    });
+
+    const migrated = {
+      version: this.toVersion,
+      upsDevices: transformedDevices,
+      groups: config.groups || [],
+      checkInterval: config.checkInterval || 30000,
+    };
+
+    logger.success(`${this.getName()}: Migration complete (${transformedDevices.length} devices transformed)`);
+    return migrated;
+  }
+}

ts/migrations/migration-v4.0-to-v4.1.ts

@@ -0,0 +1,127 @@
+import { BaseMigration } from './base-migration.ts';
+import { logger } from '../logger.ts';
+
+/**
+ * Migration from v4.0 to v4.1
+ *
+ * Major changes:
+ * 1. Moves thresholds from UPS level to action level
+ * 2. Creates default shutdown action for UPS devices that had thresholds
+ * 3. Adds empty actions array to UPS devices without actions
+ * 4. Adds empty actions array to groups
+ *
+ * Transforms v4.0 format (with UPS-level thresholds):
+ * {
+ *   version: "4.0",
+ *   upsDevices: [
+ *     {
+ *       id: "ups-1",
+ *       name: "UPS 1",
+ *       snmp: {...},
+ *       thresholds: { battery: 60, runtime: 20 },  // UPS-level
+ *       groups: []
+ *     }
+ *   ]
+ * }
+ *
+ * To v4.1 format (with action-level thresholds):
+ * {
+ *   version: "4.1",
+ *   upsDevices: [
+ *     {
+ *       id: "ups-1",
+ *       name: "UPS 1",
+ *       snmp: {...},
+ *       groups: [],
+ *       actions: [  // Thresholds moved here
+ *         {
+ *           type: "shutdown",
+ *           thresholds: { battery: 60, runtime: 20 },
+ *           triggerMode: "onlyThresholds",
+ *           shutdownDelay: 5
+ *         }
+ *       ]
+ *     }
+ *   ]
+ * }
+ */
+export class MigrationV4_0ToV4_1 extends BaseMigration {
+  readonly fromVersion = '4.0';
+  readonly toVersion = '4.1';
+
+  async shouldRun(config: Record<string, unknown>): Promise<boolean> {
+    // Run if config is version 4.0
+    if (config.version === '4.0') {
+      return true;
+    }
+
+    // Also run if config has upsDevices with thresholds at UPS level (v4.0 format)
+    if (Array.isArray(config.upsDevices) && config.upsDevices.length > 0) {
+      const firstDevice = config.upsDevices[0] as Record<string, unknown>;
+      // v4.0 has thresholds at UPS level, v4.1 has them in actions
+      return firstDevice.thresholds !== undefined;
+    }
+
+    return false;
+  }
+
+  async migrate(config: Record<string, unknown>): Promise<Record<string, unknown>> {
+    logger.info(`${this.getName()}: Migrating v4.0 config to v4.1 format...`);
+    logger.dim(`  - Moving thresholds from UPS level to action level`);
+    logger.dim(`  - Creating default shutdown actions from existing thresholds`);
+
+    // Migrate UPS devices
+    const devices = (config.upsDevices as Array<Record<string, unknown>>) || [];
+    const migratedDevices = devices.map((device) => {
+      const migrated: Record<string, unknown> = {
+        id: device.id,
+        name: device.name,
+        snmp: device.snmp,
+        groups: device.groups || [],
+      };
+
+      // If device has thresholds at UPS level, convert to shutdown action
+      const deviceThresholds = device.thresholds as { battery: number; runtime: number } | undefined;
+      if (deviceThresholds) {
+        migrated.actions = [
+          {
+            type: 'shutdown',
+            thresholds: {
+              battery: deviceThresholds.battery,
+              runtime: deviceThresholds.runtime,
+            },
+            triggerMode: 'onlyThresholds', // Preserve old behavior (only on threshold violation)
+            shutdownDelay: 5, // Default delay
+          },
+        ];
+        logger.dim(
+          `    → ${device.name}: Created shutdown action (battery: ${deviceThresholds.battery}%, runtime: ${deviceThresholds.runtime}min)`,
+        );
+      } else {
+        // No thresholds, just add empty actions array
+        migrated.actions = device.actions || [];
+      }
+
+      return migrated;
+    });
+
+    // Add actions to groups
+    const groups = (config.groups as Array<Record<string, unknown>>) || [];
+    const migratedGroups = groups.map((group) => ({
+      ...group,
+      actions: group.actions || [],
+    }));
+
+    const result = {
+      version: this.toVersion,
+      upsDevices: migratedDevices,
+      groups: migratedGroups,
+      checkInterval: config.checkInterval || 30000,
+    };
+
+    logger.success(
+      `${this.getName()}: Migration complete (${migratedDevices.length} devices, ${migratedGroups.length} groups updated)`,
+    );
+    return result;
+  }
+}

ts/snmp/manager.ts

@@ -525,6 +525,7 @@ export class NupstSnmp {
 
   /**
    * Determine power status based on UPS model and raw value
+   * Uses the value mappings defined in the OID sets
    * @param upsModel UPS model
    * @param powerStatusValue Raw power status value
    * @returns Standardized power status
@@ -533,39 +534,28 @@ export class NupstSnmp {
     upsModel: TUpsModel | undefined,
     powerStatusValue: number,
   ): 'online' | 'onBattery' | 'unknown' {
-    if (upsModel === 'cyberpower') {
+    // Get the OID set for this UPS model
-      // CyberPower RMCARD205: upsBaseOutputStatus values
+    if (upsModel && upsModel !== 'custom') {
-      // 2=onLine, 3=onBattery, 4=onBoost, 5=onSleep, 6=off, etc.
+      const oidSet = UpsOidSets.getOidSet(upsModel);
-      if (powerStatusValue === 2) {
+
-        return 'online';
+      // Use the value mappings if available
-      } else if (powerStatusValue === 3) {
+      if (oidSet.POWER_STATUS_VALUES) {
-        return 'onBattery';
+        if (powerStatusValue === oidSet.POWER_STATUS_VALUES.online) {
-      }
+          return 'online';
-    } else if (upsModel === 'eaton') {
+        } else if (powerStatusValue === oidSet.POWER_STATUS_VALUES.onBattery) {
-      // Eaton UPS: xupsOutputSource values
+          return 'onBattery';
-      // 3=normal/mains, 5=battery, etc.
+        }
-      if (powerStatusValue === 3) {
-        return 'online';
-      } else if (powerStatusValue === 5) {
-        return 'onBattery';
-      }
-    } else if (upsModel === 'apc') {
-      // APC UPS: upsBasicOutputStatus values
-      // 2=online, 3=onBattery, etc.
-      if (powerStatusValue === 2) {
-        return 'online';
-      } else if (powerStatusValue === 3) {
-        return 'onBattery';
-      }
-    } else {
-      // Default interpretation for other UPS models
-      if (powerStatusValue === 1) {
-        return 'online';
-      } else if (powerStatusValue === 2) {
-        return 'onBattery';
       }
     }
 
+    // Fallback for custom or undefined models (RFC 1628 standard)
+    // upsOutputSource: 3=normal (mains), 5=battery
+    if (powerStatusValue === 3) {
+      return 'online';
+    } else if (powerStatusValue === 5) {
+      return 'onBattery';
+    }
+
     return 'unknown';
   }
 

ts/snmp/oid-sets.ts

@@ -11,37 +11,57 @@ export class UpsOidSets {
   private static readonly UPS_OID_SETS: Record<TUpsModel, IOidSet> = {
     // Cyberpower OIDs for RMCARD205 (based on CyberPower_MIB_v2.11)
     cyberpower: {
-      POWER_STATUS: '1.3.6.1.4.1.3808.1.1.1.4.1.1.0', // upsBaseOutputStatus (2=online, 3=on battery)
+      POWER_STATUS: '1.3.6.1.4.1.3808.1.1.1.4.1.1.0', // upsBaseOutputStatus
       BATTERY_CAPACITY: '1.3.6.1.4.1.3808.1.1.1.2.2.1.0', // upsAdvanceBatteryCapacity (percentage)
       BATTERY_RUNTIME: '1.3.6.1.4.1.3808.1.1.1.2.2.4.0', // upsAdvanceBatteryRunTimeRemaining (TimeTicks)
+      POWER_STATUS_VALUES: {
+        online: 2, // upsBaseOutputStatus: 2=onLine
+        onBattery: 3, // upsBaseOutputStatus: 3=onBattery
+      },
     },
 
     // APC OIDs
     apc: {
-      POWER_STATUS: '1.3.6.1.4.1.318.1.1.1.4.1.1.0', // Power status (1=online, 2=on battery)
+      POWER_STATUS: '1.3.6.1.4.1.318.1.1.1.4.1.1.0', // upsBasicOutputStatus
       BATTERY_CAPACITY: '1.3.6.1.4.1.318.1.1.1.2.2.1.0', // Battery capacity in percentage
       BATTERY_RUNTIME: '1.3.6.1.4.1.318.1.1.1.2.2.3.0', // Remaining runtime in minutes
+      POWER_STATUS_VALUES: {
+        online: 2, // upsBasicOutputStatus: 2=onLine
+        onBattery: 3, // upsBasicOutputStatus: 3=onBattery
+      },
     },
 
     // Eaton OIDs
     eaton: {
-      POWER_STATUS: '1.3.6.1.4.1.534.1.4.4.0', // xupsOutputSource (3=normal/mains, 5=battery)
+      POWER_STATUS: '1.3.6.1.4.1.534.1.4.4.0', // xupsOutputSource
       BATTERY_CAPACITY: '1.3.6.1.4.1.534.1.2.4.0', // xupsBatCapacity (percentage)
       BATTERY_RUNTIME: '1.3.6.1.4.1.534.1.2.1.0', // xupsBatTimeRemaining (seconds)
+      POWER_STATUS_VALUES: {
+        online: 3, // xupsOutputSource: 3=normal (mains power)
+        onBattery: 5, // xupsOutputSource: 5=battery
+      },
     },
 
     // TrippLite OIDs
     tripplite: {
-      POWER_STATUS: '1.3.6.1.4.1.850.1.1.3.1.1.1.0', // Power status
+      POWER_STATUS: '1.3.6.1.4.1.850.1.1.3.1.1.1.0', // tlUpsOutputSource
       BATTERY_CAPACITY: '1.3.6.1.4.1.850.1.1.3.2.4.1.0', // Battery capacity in percentage
       BATTERY_RUNTIME: '1.3.6.1.4.1.850.1.1.3.2.2.1.0', // Remaining runtime in minutes
+      POWER_STATUS_VALUES: {
+        online: 2, // tlUpsOutputSource: 2=normal (mains power)
+        onBattery: 3, // tlUpsOutputSource: 3=onBattery
+      },
     },
 
     // Liebert/Vertiv OIDs
     liebert: {
-      POWER_STATUS: '1.3.6.1.4.1.476.1.42.3.9.20.1.20.1.2.1.2.1', // Power status
+      POWER_STATUS: '1.3.6.1.4.1.476.1.42.3.9.20.1.20.1.2.1.2.1', // lgpPwrOutputSource
       BATTERY_CAPACITY: '1.3.6.1.4.1.476.1.42.3.9.20.1.20.1.2.1.4.1', // Battery capacity in percentage
       BATTERY_RUNTIME: '1.3.6.1.4.1.476.1.42.3.9.20.1.20.1.2.1.5.1', // Remaining runtime in minutes
+      POWER_STATUS_VALUES: {
+        online: 2, // lgpPwrOutputSource: 2=normal (mains power)
+        onBattery: 3, // lgpPwrOutputSource: 3=onBattery
+      },
     },
 
     // Custom OIDs (to be provided by the user)

ts/snmp/types.ts

@@ -28,6 +28,13 @@ export interface IOidSet {
   BATTERY_CAPACITY: string;
   /** OID for battery runtime */
   BATTERY_RUNTIME: string;
+  /** Power status value mappings */
+  POWER_STATUS_VALUES?: {
+    /** SNMP value that indicates UPS is online (on AC power) */
+    online: number;
+    /** SNMP value that indicates UPS is on battery */
+    onBattery: number;
+  };
 }
 
 /**

ts/systemd.ts

@@ -1,8 +1,10 @@
 import process from 'node:process';
 import { promises as fs } from 'node:fs';
 import { execSync } from 'node:child_process';
-import { NupstDaemon } from './daemon.ts';
+import { NupstDaemon, type IUpsConfig } from './daemon.ts';
+import { NupstSnmp } from './snmp/manager.ts';
 import { logger } from './logger.ts';
+import { theme, symbols, getBatteryColor, getRuntimeColor, formatPowerStatus } from './colors.ts';
 
 /**
  * Class for managing systemd service
@@ -49,11 +51,11 @@ WantedBy=multi-user.target
     try {
       await fs.access(configPath);
     } catch (error) {
-      const boxWidth = 50;
+      logger.log('');
-      logger.logBoxTitle('Configuration Error', boxWidth);
+      logger.error('No configuration found');
-      logger.logBoxLine(`No configuration file found at ${configPath}`);
+      logger.log(`  ${theme.dim('Config file:')} ${configPath}`);
-      logger.logBoxLine("Please run 'nupst add' first to create a UPS configuration.");
+      logger.log(`  ${theme.dim('Run')} ${theme.command('nupst ups add')} ${theme.dim('to create a configuration')}`);
-      logger.logBoxEnd();
+      logger.log('');
       throw new Error('Configuration not found');
     }
   }
@@ -133,21 +135,59 @@ WantedBy=multi-user.target
    * Get status of the systemd service and UPS
    * @param debugMode Whether to enable debug mode for SNMP
    */
+  /**
+   * Display version information and update status
+   * @private
+   */
+  private async displayVersionInfo(): Promise<void> {
+    try {
+      const nupst = this.daemon.getNupstSnmp().getNupst();
+      const version = nupst.getVersion();
+      
+      // Check for updates
+      const updateAvailable = await nupst.checkForUpdates();
+      
+      // Display version info
+      if (updateAvailable) {
+        const updateStatus = nupst.getUpdateStatus();
+        logger.log('');
+        logger.log(
+          `${theme.dim('NUPST')} ${theme.dim('v' + version)}  ${symbols.warning} ${theme.statusWarning(`Update available: v${updateStatus.latestVersion}`)}`,
+        );
+        logger.log(`  ${theme.dim('Run')} ${theme.command('sudo nupst update')} ${theme.dim('to upgrade')}`);
+      } else {
+        logger.log('');
+        logger.log(
+          `${theme.dim('NUPST')} ${theme.dim('v' + version)}  ${symbols.success} ${theme.success('Up to date')}`,
+        );
+      }
+    } catch (error) {
+      // If version check fails, show at least the current version
+      try {
+        const nupst = this.daemon.getNupstSnmp().getNupst();
+        const version = nupst.getVersion();
+        logger.log('');
+        logger.log(`${theme.dim('NUPST')} ${theme.dim('v' + version)}`);
+      } catch (_innerError) {
+        // Silently fail if we can't even get the version
+      }
+    }
+  }
+
   public async getStatus(debugMode: boolean = false): Promise<void> {
     try {
       // Enable debug mode if requested
       if (debugMode) {
-        const boxWidth = 45;
+        console.log('');
-        logger.logBoxTitle('Debug Mode', boxWidth);
+        logger.info('Debug Mode: SNMP debugging enabled');
-        logger.logBoxLine('SNMP debugging enabled - detailed logs will be shown');
+        console.log('');
-        logger.logBoxEnd();
         this.daemon.getNupstSnmp().enableDebug();
       }
 
-      // Display version information
+      // Display version and update status first
-      this.daemon.getNupstSnmp().getNupst().logVersionInfo();
+      await this.displayVersionInfo();
 
-      // Check if config exists first
+      // Check if config exists
       try {
         await this.checkConfigExists();
       } catch (error) {
@@ -171,18 +211,50 @@ WantedBy=multi-user.target
   private displayServiceStatus(): void {
     try {
       const serviceStatus = execSync('systemctl status nupst.service').toString();
-      const boxWidth = 45;
+      const lines = serviceStatus.split('\n');
-      logger.logBoxTitle('Service Status', boxWidth);
+
-      // Process each line of the status output
+      // Parse key information from systemctl output
-      serviceStatus.split('\n').forEach((line) => {
+      let isActive = false;
-        logger.logBoxLine(line);
+      let pid = '';
-      });
+      let memory = '';
-      logger.logBoxEnd();
+      let cpu = '';
+
+      for (const line of lines) {
+        if (line.includes('Active:')) {
+          isActive = line.includes('active (running)');
+        } else if (line.includes('Main PID:')) {
+          const match = line.match(/Main PID:\s+(\d+)/);
+          if (match) pid = match[1];
+        } else if (line.includes('Memory:')) {
+          const match = line.match(/Memory:\s+([\d.]+[A-Z])/);
+          if (match) memory = match[1];
+        } else if (line.includes('CPU:')) {
+          const match = line.match(/CPU:\s+([\d.]+(?:ms|s))/);
+          if (match) cpu = match[1];
+        }
+      }
+
+      // Display beautiful status
+      logger.log('');
+      if (isActive) {
+        logger.log(`${symbols.running} ${theme.success('Service:')} ${theme.statusActive('active (running)')}`);
+      } else {
+        logger.log(`${symbols.stopped} ${theme.dim('Service:')} ${theme.statusInactive('inactive')}`);
+      }
+
+      if (pid || memory || cpu) {
+        const details = [];
+        if (pid) details.push(`PID: ${theme.dim(pid)}`);
+        if (memory) details.push(`Memory: ${theme.dim(memory)}`);
+        if (cpu) details.push(`CPU: ${theme.dim(cpu)}`);
+        logger.log(`  ${details.join('  ')}`);
+      }
+      logger.log('');
+
     } catch (error) {
-      const boxWidth = 45;
+      logger.log('');
-      logger.logBoxTitle('Service Status', boxWidth);
+      logger.log(`${symbols.stopped} ${theme.dim('Service:')} ${theme.statusInactive('not installed')}`);
-      logger.logBoxLine('Service is not running');
+      logger.log('');
-      logger.logBoxEnd();
     }
   }
 
@@ -199,33 +271,44 @@ WantedBy=multi-user.target
 
       // Check if we have the new multi-UPS config format
       if (config.upsDevices && Array.isArray(config.upsDevices) && config.upsDevices.length > 0) {
-        logger.log(`Found ${config.upsDevices.length} UPS device(s) in configuration`);
+        logger.info(`UPS Devices (${config.upsDevices.length}):`);
 
         // Show status for each UPS
         for (const ups of config.upsDevices) {
           await this.displaySingleUpsStatus(ups, snmp);
         }
       } else if (config.snmp) {
-        // Legacy single UPS configuration
+        // Legacy single UPS configuration (v1/v2 format)
-        const legacyUps = {
+        logger.info('UPS Devices (1):');
+        const legacyUps: IUpsConfig = {
           id: 'default',
           name: 'Default UPS',
           snmp: config.snmp,
-          thresholds: config.thresholds,
           groups: [],
+          actions: config.thresholds
+            ? [
+                {
+                  type: 'shutdown',
+                  thresholds: config.thresholds,
+                  triggerMode: 'onlyThresholds',
+                  shutdownDelay: 5,
+                },
+              ]
+            : [],
         };
 
         await this.displaySingleUpsStatus(legacyUps, snmp);
       } else {
-        logger.error('No UPS devices found in configuration');
+        logger.log('');
+        logger.warn('No UPS devices configured');
+        logger.log(`  ${theme.dim('Run')} ${theme.command('nupst ups add')} ${theme.dim('to add a device')}`);
+        logger.log('');
       }
     } catch (error) {
-      const boxWidth = 45;
+      logger.log('');
-      logger.logBoxTitle('UPS Status', boxWidth);
+      logger.error('Failed to retrieve UPS status');
-      logger.logBoxLine(
+      logger.log(`  ${theme.dim(error instanceof Error ? error.message : String(error))}`);
-        `Failed to retrieve UPS status: ${error instanceof Error ? error.message : String(error)}`,
+      logger.log('');
-      );
-      logger.logBoxEnd();
     }
   }
 
@@ -234,25 +317,7 @@ WantedBy=multi-user.target
    * @param ups UPS configuration
    * @param snmp SNMP manager
    */
-  private async displaySingleUpsStatus(ups: any, snmp: any): Promise<void> {
+  private async displaySingleUpsStatus(ups: IUpsConfig, snmp: NupstSnmp): Promise<void> {
-    const boxWidth = 45;
-    logger.logBoxTitle(`Connecting to UPS: ${ups.name}`, boxWidth);
-    logger.logBoxLine(`ID: ${ups.id}`);
-    logger.logBoxLine(`Host: ${ups.snmp.host}:${ups.snmp.port}`);
-    logger.logBoxLine(`UPS Model: ${ups.snmp.upsModel || 'cyberpower'}`);
-
-    if (ups.groups && ups.groups.length > 0) {
-      // Get group names if available
-      const config = this.daemon.getConfig();
-      const groupNames = ups.groups.map((groupId: string) => {
-        const group = config.groups?.find((g: { id: string }) => g.id === groupId);
-        return group ? group.name : groupId;
-      });
-      logger.logBoxLine(`Groups: ${groupNames.join(', ')}`);
-    }
-
-    logger.logBoxEnd();
-
     try {
       // Create a test config with a short timeout
       const testConfig = {
@@ -262,32 +327,52 @@ WantedBy=multi-user.target
 
       const status = await snmp.getUpsStatus(testConfig);
 
-      logger.logBoxTitle(`UPS Status: ${ups.name}`, boxWidth);
+      // Determine status symbol based on power status
-      logger.logBoxLine(`Power Status: ${status.powerStatus}`);
+      let statusSymbol = symbols.unknown;
-      logger.logBoxLine(`Battery Capacity: ${status.batteryCapacity}%`);
+      if (status.powerStatus === 'online') {
-      logger.logBoxLine(`Runtime Remaining: ${status.batteryRuntime} minutes`);
+        statusSymbol = symbols.running;
+      } else if (status.powerStatus === 'onBattery') {
+        statusSymbol = symbols.warning;
+      }
 
-      // Show threshold status
+      // Display UPS name and power status
-      logger.logBoxLine('');
+      logger.log(`  ${statusSymbol} ${theme.highlight(ups.name)} - ${formatPowerStatus(status.powerStatus)}`);
-      logger.logBoxLine('Thresholds:');
+
-      logger.logBoxLine(
+      // Display battery with color coding
-        `  Battery: ${status.batteryCapacity}% / ${ups.thresholds.battery}% ${
+      const batteryColor = getBatteryColor(status.batteryCapacity);
-          status.batteryCapacity < ups.thresholds.battery ? '⚠️' : '✓'
+
-        }`,
+      // Get threshold from actions (if any action has thresholds defined)
-      );
+      const actionWithThresholds = ups.actions?.find((action) => action.thresholds);
-      logger.logBoxLine(
+      const batteryThreshold = actionWithThresholds?.thresholds?.battery;
-        `  Runtime: ${status.batteryRuntime} min / ${ups.thresholds.runtime} min ${
+      const batterySymbol = batteryThreshold !== undefined && status.batteryCapacity >= batteryThreshold
-          status.batteryRuntime < ups.thresholds.runtime ? '⚠️' : '✓'
+        ? symbols.success
-        }`,
+        : batteryThreshold !== undefined
-      );
+        ? symbols.warning
+        : '';
+
+      logger.log(`    Battery: ${batteryColor(status.batteryCapacity + '%')} ${batterySymbol}  Runtime: ${getRuntimeColor(status.batteryRuntime)(status.batteryRuntime + ' min')}`);
+
+      // Display host info
+      logger.log(`    ${theme.dim(`Host: ${ups.snmp.host}:${ups.snmp.port}`)}`);
+
+      // Display groups if any
+      if (ups.groups && ups.groups.length > 0) {
+        const config = this.daemon.getConfig();
+        const groupNames = ups.groups.map((groupId: string) => {
+          const group = config.groups?.find((g: { id: string }) => g.id === groupId);
+          return group ? group.name : groupId;
+        });
+        logger.log(`    ${theme.dim(`Groups: ${groupNames.join(', ')}`)}`);
+      }
+
+      logger.log('');
 
-      logger.logBoxEnd();
     } catch (error) {
-      logger.logBoxTitle(`UPS Status: ${ups.name}`, boxWidth);
+      // Display error for this UPS
-      logger.logBoxLine(
+      logger.log(`  ${symbols.error} ${theme.highlight(ups.name)} - ${theme.error('Connection failed')}`);
-        `Failed to retrieve UPS status: ${error instanceof Error ? error.message : String(error)}`,
+      logger.log(`    ${theme.dim(error instanceof Error ? error.message : String(error))}`);
-      );
+      logger.log(`    ${theme.dim(`Host: ${ups.snmp.host}:${ups.snmp.port}`)}`);
-      logger.logBoxEnd();
+      logger.log('');
     }
   }