1.0.244

.gitea/workflows/default_nottags.yaml

@@ -0,0 +1,66 @@
+name: Default (not tags)
+
+on:
+  push:
+    tags-ignore:
+      - '**'
+
+env:
+  IMAGE: registry.gitlab.com/hosttoday/ht-docker-node:npmci
+  NPMCI_COMPUTED_REPOURL: https://${{gitea.repository_owner}}:${{secrets.GITEA_TOKEN}}@gitea.lossless.digital/${{gitea.repository}}.git
+  NPMCI_TOKEN_NPM: ${{secrets.NPMCI_TOKEN_NPM}}
+  NPMCI_TOKEN_NPM2: ${{secrets.NPMCI_TOKEN_NPM2}}
+  NPMCI_GIT_GITHUBTOKEN: ${{secrets.NPMCI_GIT_GITHUBTOKEN}}
+  NPMCI_URL_CLOUDLY: ${{secrets.NPMCI_URL_CLOUDLY}}
+
+jobs:
+  security:
+    runs-on: ubuntu-latest
+    continue-on-error: true
+    container:
+      image: ${{ env.IMAGE }}
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Install pnpm and npmci
+        run: |
+          pnpm install -g pnpm
+          pnpm install -g @shipzone/npmci
+
+      - name: Run npm prepare
+        run: npmci npm prepare
+
+      - name: Audit production dependencies
+        run: |
+          npmci command npm config set registry https://registry.npmjs.org
+          npmci command pnpm audit --audit-level=high --prod
+        continue-on-error: true
+
+      - name: Audit development dependencies
+        run: |
+          npmci command npm config set registry https://registry.npmjs.org
+          npmci command pnpm audit --audit-level=high --dev
+        continue-on-error: true
+
+  test:
+    if: ${{ always() }}
+    needs: security
+    runs-on: ubuntu-latest
+    container:
+      image: ${{ env.IMAGE }}
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Test stable
+        run: |
+          npmci node install stable
+          npmci npm install
+          npmci npm test
+
+      - name: Test build
+        run: |
+          npmci node install stable
+          npmci npm install
+          npmci npm build

.gitea/workflows/default_tags.yaml

@@ -0,0 +1,124 @@
+name: Default (tags)
+
+on:
+  push:
+    tags:
+      - '*'
+
+env:
+  IMAGE: registry.gitlab.com/hosttoday/ht-docker-node:npmci
+  NPMCI_COMPUTED_REPOURL: https://${{gitea.repository_owner}}:${{secrets.GITEA_TOKEN}}@gitea.lossless.digital/${{gitea.repository}}.git
+  NPMCI_TOKEN_NPM: ${{secrets.NPMCI_TOKEN_NPM}}
+  NPMCI_TOKEN_NPM2: ${{secrets.NPMCI_TOKEN_NPM2}}
+  NPMCI_GIT_GITHUBTOKEN: ${{secrets.NPMCI_GIT_GITHUBTOKEN}}
+  NPMCI_URL_CLOUDLY: ${{secrets.NPMCI_URL_CLOUDLY}}
+
+jobs:
+  security:
+    runs-on: ubuntu-latest
+    continue-on-error: true
+    container:
+      image: ${{ env.IMAGE }}
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Prepare
+        run: |
+          pnpm install -g pnpm
+          pnpm install -g @shipzone/npmci
+          npmci npm prepare
+
+      - name: Audit production dependencies
+        run: |
+          npmci command npm config set registry https://registry.npmjs.org
+          npmci command pnpm audit --audit-level=high --prod
+        continue-on-error: true
+
+      - name: Audit development dependencies
+        run: |
+          npmci command npm config set registry https://registry.npmjs.org
+          npmci command pnpm audit --audit-level=high --dev
+        continue-on-error: true
+
+  test:
+    if: ${{ always() }}
+    needs: security
+    runs-on: ubuntu-latest
+    container:
+      image: ${{ env.IMAGE }}
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Prepare
+        run: |
+          pnpm install -g pnpm
+          pnpm install -g @shipzone/npmci
+          npmci npm prepare
+
+      - name: Test stable
+        run: |
+          npmci node install stable
+          npmci npm install
+          npmci npm test
+
+      - name: Test build
+        run: |
+          npmci node install stable
+          npmci npm install
+          npmci npm build
+
+  release:
+    needs: test
+    if: github.event_name == 'push' && startsWith(github.ref, 'refs/tags/')
+    runs-on: ubuntu-latest
+    container:
+      image: ${{ env.IMAGE }}
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Prepare
+        run: |
+          pnpm install -g pnpm
+          pnpm install -g @shipzone/npmci
+          npmci npm prepare
+
+      - name: Release
+        run: |
+          npmci node install stable
+          npmci npm publish
+
+  metadata:
+    needs: test
+    if: github.event_name == 'push' && startsWith(github.ref, 'refs/tags/')
+    runs-on: ubuntu-latest
+    container:
+      image: ${{ env.IMAGE }}
+    continue-on-error: true
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Prepare
+        run: |
+          pnpm install -g pnpm
+          pnpm install -g @shipzone/npmci
+          npmci npm prepare
+
+      - name: Code quality
+        run: |
+          npmci command npm install -g typescript
+          npmci npm install
+
+      - name: Trigger
+        run: npmci trigger
+
+      - name: Build docs and upload artifacts
+        run: |
+          npmci node install stable
+          npmci npm install
+          pnpm install -g @git.zone/tsdoc
+          npmci command tsdoc
+        continue-on-error: true

.gitlab-ci.yml

@@ -12,40 +12,36 @@ stages:
   - release
   - metadata
 
+before_script:
+  - pnpm install -g pnpm
+  - pnpm install -g @shipzone/npmci
+  - npmci npm prepare
+
+# ====================
+# security stage
+# ====================
 # ====================
 # security stage
 # ====================
-mirror:
-  stage: security
-  script:
-    - npmci git mirror
-  only:
-    - tags
-  tags:
-    - lossless
-    - docker
-    - notpriv
-
 auditProductionDependencies:
   image: registry.gitlab.com/hosttoday/ht-docker-node:npmci
   stage: security
   script:
-    - npmci npm prepare
-    - npmci command npm install --production --ignore-scripts
-    - npmci command npm config set registry https://registry.npmjs.org
-    - npmci command npm audit --audit-level=high --only=prod --production
+     - npmci command npm config set registry https://registry.npmjs.org
+     - npmci command pnpm audit --audit-level=high --prod
   tags:
+    - lossless
     - docker
+  allow_failure: true
 
 auditDevDependencies:
   image: registry.gitlab.com/hosttoday/ht-docker-node:npmci
   stage: security
   script:
-    - npmci npm prepare
-    - npmci command npm install --ignore-scripts
     - npmci command npm config set registry https://registry.npmjs.org
-    - npmci command npm audit --audit-level=high --only=dev
+    - npmci command pnpm audit --audit-level=high --dev
   tags:
+    - lossless
     - docker
   allow_failure: true
 
@@ -56,7 +52,6 @@ auditDevDependencies:
 testStable:
   stage: test
   script:
-    - npmci npm prepare
     - npmci node install stable
     - npmci npm install
     - npmci npm test
@@ -67,10 +62,9 @@ testStable:
 testBuild:
   stage: test
   script:
-    - npmci npm prepare
     - npmci node install stable
     - npmci npm install
-    - npmci command npm run build
+    - npmci npm build
   coverage: /\d+.?\d+?\%\s*coverage/
   tags:
     - docker
@@ -96,10 +90,9 @@ codequality:
   only:
     - tags
   script:
-    - npmci command npm install -g tslint typescript
+    - npmci command npm install -g typescript
     - npmci npm prepare
     - npmci npm install
-    - npmci command "tslint -c tslint.json ./ts/**/*.ts"
   tags:
     - lossless
     - docker
@@ -119,11 +112,9 @@ trigger:
 pages:
   stage: metadata
   script:
-    - npmci node install lts
-    - npmci command npm install -g @gitzone/tsdoc
-    - npmci npm prepare
+    - npmci node install stable
     - npmci npm install
-    - npmci command tsdoc
+    - npmci command npm run buildDocs
   tags:
     - lossless
     - docker

.vscode/launch.json

@@ -2,28 +2,10 @@
   "version": "0.2.0",
   "configurations": [
     {
-      "name": "current file",
-      "type": "node",
+      "command": "npm test",
+      "name": "Run npm test",
       "request": "launch",
-      "args": [
-        "${relativeFile}"
-      ],
-      "runtimeArgs": ["-r", "@gitzone/tsrun"],
-      "cwd": "${workspaceRoot}",
-      "protocol": "inspector",
-      "internalConsoleOptions": "openOnSessionStart"
-    },
-    {
-      "name": "test.ts",
-      "type": "node",
-      "request": "launch",
-      "args": [
-        "test/test.ts"
-      ],
-      "runtimeArgs": ["-r", "@gitzone/tsrun"],
-      "cwd": "${workspaceRoot}",
-      "protocol": "inspector",
-      "internalConsoleOptions": "openOnSessionStart"
+      "type": "node-terminal"
     }
   ]
 }

html/index.html

@@ -1,5 +1,5 @@
 <!--gitzone element-->
-<!-- made by Lossless GmbH -->
+<!-- made by Task Venture Capital GmbH -->
 <!-- checkout https://maintainedby.lossless.com for awesome OpenSource projects -->
 <html lang="en">
   <head>
@@ -10,6 +10,10 @@
     />
     <meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
 
+    <!--Lets load standard fonts-->
+    <link rel="preconnect" href="https://assetbroker.lossless.one/" crossorigin>
+    <link rel="stylesheet" href="https://assetbroker.lossless.one/fonts/fonts.css">
+
     <style>
       body {
         margin: 0px;
@@ -17,7 +21,7 @@
       }
     </style>
 
-    <script src="./index.ts"></script>
+    <script type="module" src="/bundle.js"></script>
   </head>
   <body>
   </body>

html/index.ts

@@ -1,10 +1,10 @@
 // dees tools
-import * as deesWccTools from '@designestate/dees-wcctools';
-import * as deesDomTools from '@designestate/dees-domtools';
+import * as deesWccTools from '@design.estate/dees-wcctools';
+import * as deesDomTools from '@design.estate/dees-domtools';
 
 // elements and pages
-import * as elements from '../ts_web/elements';
-import * as pages from '../ts_web/pages';
+import * as elements from '../ts_web/elements/index.js';
+import * as pages from '../ts_web/pages/index.js';
 
 deesWccTools.setupWccTools(elements as any, pages);
 deesDomTools.elementBasic.setup();

license

@@ -8,7 +8,10 @@ copies of the Software, and to permit persons to whom the Software is
 furnished to do so, subject to the following conditions:
 
 The above copyright notice and this permission notice shall be included in all
-copies or substantial portions of the Software.
+copies or substantial portions of the Software. You agree to being mentioned
+as reference by Lossless GmbH. This includes the use of your entity logos
+or profile picture by Lossless GmbH on websites and readme's, also on third party
+pages like gitlab.com or github.com.
 
 THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
 IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,

npmextra.json

@@ -3,10 +3,10 @@
     "projectType": "wcc",
     "module": {
       "githost": "gitlab.com",
-      "gitscope": "designestate",
+      "gitscope": "design.estate",
       "gitrepo": "dees-catalog",
-      "shortDescription": "a webcomponents catalog for handling daily stuff on the web",
-      "npmPackagename": "@designestate/dees-catalog",
+      "description": "a webcomponents catalog for handling daily stuff on the web",
+      "npmPackagename": "@design.estate/dees-catalog",
       "license": "MIT",
       "projectDomain": "design.estate"
     }

package.json

@@ -1,30 +1,43 @@
 {
-  "name": "@designestate/dees-catalog",
-  "version": "1.0.20",
+  "name": "@design.estate/dees-catalog",
+  "version": "1.0.244",
   "private": false,
   "description": "website for lossless.com",
   "main": "dist_ts_web/index.js",
   "typings": "dist_ts_web/index.d.ts",
+  "type": "module",
   "scripts": {
-    "test": "npm run build",
-    "build": "tsbuild element && tsbundle element --production",
-    "watch": "tswatch element"
+    "test": "tstest test/ --web",
+    "build": "tsbuild element --allowimplicitany && tsbundle element --production",
+    "watch": "tswatch element",
+    "buildDocs": "tsdoc"
   },
   "author": "Lossless GmbH",
   "license": "MIT",
   "dependencies": {
-    "@designestate/dees-domtools": "^1.0.47",
-    "@designestate/dees-wcctools": "^1.0.37",
-    "lit-element": "^2.4.0",
-    "typescript": "^4.0.2"
+    "@design.estate/dees-domtools": "^2.0.55",
+    "@design.estate/dees-element": "^2.0.33",
+    "@design.estate/dees-wcctools": "^1.0.85",
+    "@fortawesome/fontawesome-svg-core": "^6.5.1",
+    "@fortawesome/free-brands-svg-icons": "^6.5.1",
+    "@fortawesome/free-regular-svg-icons": "^6.5.1",
+    "@fortawesome/free-solid-svg-icons": "^6.5.1",
+    "@push.rocks/smarti18n": "^1.0.4",
+    "@push.rocks/smartpromise": "^4.0.3",
+    "@push.rocks/smartstring": "^4.0.13",
+    "@tsclass/tsclass": "^4.0.46",
+    "highlight.js": "11.9.0",
+    "ibantools": "^4.3.8",
+    "pdfjs-dist": "^4.0.379"
   },
   "devDependencies": {
-    "@gitzone/tsbuild": "^2.1.25",
-    "@gitzone/tsbundle": "^1.0.78",
-    "@gitzone/tswatch": "^1.0.50",
-    "@pushrocks/projectinfo": "^4.0.5",
-    "tslint": "^6.1.3",
-    "tslint-config-prettier": "^1.17.0"
+    "@git.zone/tsbuild": "^2.1.72",
+    "@git.zone/tsbundle": "^2.0.14",
+    "@git.zone/tstest": "^1.0.77",
+    "@git.zone/tswatch": "^2.0.21",
+    "@push.rocks/projectinfo": "^5.0.2",
+    "@push.rocks/tapbundle": "^5.0.15",
+    "@types/node": "^20.10.8"
   },
   "files": [
     "ts/**/*",

readme.md

@@ -1,27 +1,26 @@
-# @designestate/dees-catalog
+# @design.estate/dees-catalog
 a webcomponents catalog for handling daily stuff on the web
 
 ## Availabililty and Links
-* [npmjs.org (npm package)](https://www.npmjs.com/package/@designestate/dees-catalog)
-* [gitlab.com (source)](https://gitlab.com/designestate/dees-catalog)
-* [github.com (source mirror)](https://github.com/designestate/dees-catalog)
-* [docs (typedoc)](https://designestate.gitlab.io/dees-catalog/)
+* [npmjs.org (npm package)](https://www.npmjs.com/package/@design.estate/dees-catalog)
+* [gitlab.com (source)](https://gitlab.com/design.estate/dees-catalog)
+* [github.com (source mirror)](https://github.com/design.estate/dees-catalog)
+* [docs (typedoc)](https://design.estate.gitlab.io/dees-catalog/)
 
 ## Status for master
 
 Status Category | Status Badge
 -- | --
-GitLab Pipelines | [![pipeline status](https://gitlab.com/designestate/dees-catalog/badges/master/pipeline.svg)](https://lossless.cloud)
-GitLab Pipline Test Coverage | [![coverage report](https://gitlab.com/designestate/dees-catalog/badges/master/coverage.svg)](https://lossless.cloud)
-npm | [![npm downloads per month](https://badgen.net/npm/dy/@designestate/dees-catalog)](https://lossless.cloud)
-Snyk | [![Known Vulnerabilities](https://badgen.net/snyk/designestate/dees-catalog)](https://lossless.cloud)
+GitLab Pipelines | [![pipeline status](https://gitlab.com/design.estate/dees-catalog/badges/master/pipeline.svg)](https://lossless.cloud)
+GitLab Pipline Test Coverage | [![coverage report](https://gitlab.com/design.estate/dees-catalog/badges/master/coverage.svg)](https://lossless.cloud)
+npm | [![npm downloads per month](https://badgen.net/npm/dy/@design.estate/dees-catalog)](https://lossless.cloud)
+Snyk | [![Known Vulnerabilities](https://badgen.net/snyk/design.estate/dees-catalog)](https://lossless.cloud)
 TypeScript Support | [![TypeScript](https://badgen.net/badge/TypeScript/>=%203.x/blue?icon=typescript)](https://lossless.cloud)
 node Support | [![node](https://img.shields.io/badge/node->=%2010.x.x-blue.svg)](https://nodejs.org/dist/latest-v10.x/docs/api/)
 Code Style | [![Code Style](https://badgen.net/badge/style/prettier/purple)](https://lossless.cloud)
-PackagePhobia (total standalone install weight) | [![PackagePhobia](https://badgen.net/packagephobia/install/@designestate/dees-catalog)](https://lossless.cloud)
-PackagePhobia (package size on registry) | [![PackagePhobia](https://badgen.net/packagephobia/publish/@designestate/dees-catalog)](https://lossless.cloud)
-BundlePhobia (total size when bundled) | [![BundlePhobia](https://badgen.net/bundlephobia/minzip/@designestate/dees-catalog)](https://lossless.cloud)
-Platform support | [![Supports Windows 10](https://badgen.net/badge/supports%20Windows%2010/yes/green?icon=windows)](https://lossless.cloud) [![Supports Mac OS X](https://badgen.net/badge/supports%20Mac%20OS%20X/yes/green?icon=apple)](https://lossless.cloud)
+PackagePhobia (total standalone install weight) | [![PackagePhobia](https://badgen.net/packagephobia/install/@design.estate/dees-catalog)](https://lossless.cloud)
+PackagePhobia (package size on registry) | [![PackagePhobia](https://badgen.net/packagephobia/publish/@design.estate/dees-catalog)](https://lossless.cloud)
+BundlePhobia (total size when bundled) | [![BundlePhobia](https://badgen.net/bundlephobia/minzip/@design.estate/dees-catalog)](https://lossless.cloud)
 
 ## Usage
 
@@ -35,7 +34,6 @@ We are always happy for code contributions. If you are not the code contributing
 
 For further information read the linked docs at the top of this readme.
 
-> MIT licensed | **©** [Lossless GmbH](https://lossless.gmbh)
+## Legal
+> MIT licensed | **©** [Task Venture Capital GmbH](https://task.vc)
 | By using this npm module you agree to our [privacy policy](https://lossless.gmbH/privacy)
-
-[![repo-footer](https://lossless.gitlab.io/publicrelations/repofooter.svg)](https://maintainedby.lossless.com)

test/test.browser.ts

@@ -0,0 +1,12 @@
+import { tap, expect, webhelpers } from '@push.rocks/tapbundle';
+
+import * as deesCatalog from '../ts_web';
+
+tap.test('should create a working button', async () => {
+  const button: deesCatalog.DeesButton = await webhelpers.fixture(
+    webhelpers.html`<dees-button></dees-button>`
+  );
+  expect(button).toBeInstanceOf(deesCatalog.DeesButton);
+});
+
+tap.start();

ts_web/00_commitinfo_data.ts

@@ -0,0 +1,8 @@
+/**
+ * autocreated commitinfo by @pushrocks/commitinfo
+ */
+export const commitinfo = {
+  name: '@design.estate/dees-catalog',
+  version: '1.0.244',
+  description: 'website for lossless.com'
+}

ts_web/elements/00colors.ts

@@ -0,0 +1,11 @@
+export const dark = {
+  blue: '#0050b9',
+  blueActive: '#0069f2',
+  text: '#ffffff',
+}
+
+export const bright = {
+  blue: '#0050b9',
+  blueActive: '#0069f2',
+  text: '#333333',
+}

ts_web/elements/00plugins.ts

@@ -0,0 +1,13 @@
+// @push.rocks scope
+import * as smartpromise from '@push.rocks/smartpromise';
+
+export {
+  smartpromise,
+}
+
+// @tsclass scope
+import * as tsclass from '@tsclass/tsclass';
+
+export {
+  tsclass
+}

ts_web/elements/dees-button-exit.ts

@@ -0,0 +1,48 @@
+import {
+  cssManager,
+  customElement,
+  DeesElement,
+  html,
+  type TemplateResult,
+  css,
+  type CSSResult,
+  state,
+  property
+} from '@design.estate/dees-element';
+
+@customElement('dees-button-exit')
+export class DeesButtonExit extends DeesElement {
+  // DEMO
+  public static demo = () => html`
+    <dees-button-exit></dees-button-exit>
+  `;
+
+  // INSTANCE
+  @property({
+    type: Number
+  })
+  public size: number = 24;
+
+  public styles = [
+    cssManager.defaultStyles,
+    css`
+
+    `
+  ]
+
+  public render (): TemplateResult {
+    return html`
+      <style>
+        .maincontainer {
+          position: relative;
+          width: ${this.size}px;
+          height: ${this.size}px;
+        }
+      </style>
+      <div class="maincontainer">
+        <div class="firstLine"></div>
+        <div class="secondLine"></div>
+      </div>
+    `;
+  }
+}

ts_web/elements/dees-button.demo.ts

@@ -0,0 +1,15 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+  <dees-button>This is a slotted Text</dees-button>
+  <p>
+    <dees-button text="Highlighted: This text shows" type="highlighted">Highlighted</dees-button>
+  </p>
+  <p><dees-button type="discreet">This is discreete button</dees-button></p>
+  <p><dees-button disabled>This is a disabled button</dees-button></p>
+  <p><dees-button type="big">This is a slotted Text</dees-button></p>
+  <p><dees-button status="normal">Normal Status</dees-button></p>
+  <p><dees-button disabled status="pending">Pending Status</dees-button></p>
+  <p><dees-button disabled status="success">Success Status</dees-button></p>
+  <p><dees-button disabled status="error">Error Status</dees-button></p>
+`;

ts_web/elements/dees-button.ts

@@ -1,125 +1,206 @@
-import { customElement, html, LitElement, property, TemplateResult } from 'lit-element';
+import { demoFunc } from './dees-button.demo.js';
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+} from '@design.estate/dees-element';
 
-import * as domtools from '@designestate/dees-domtools';
+import * as domtools from '@design.estate/dees-domtools';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-button': DeesButton;
+  }
+}
 
 @customElement('dees-button')
-export class DeesButton extends LitElement {
-  @property()
-  text: string;
+export class DeesButton extends DeesElement {
+  public static demo = demoFunc;
+
+  @property({
+    reflect: true,
+    hasChanged() {
+      return true;
+    }
+  })
+  public text: string;
 
   @property()
-  eventDetailData: string;
+  public eventDetailData: string;
 
-  @property()
-  disabled = false;
+  @property({
+    type: Boolean
+  })
+  public disabled = false;
 
-  @property()
-  isQuote = false;
+  @property({
+    type: Boolean
+  })
+  public isHidden = false;
 
-  @property()
-  isHidden = false;
-
-  @property()
+  @property({
+    type: String
+  })
   public type: 'normal' | 'highlighted' | 'discreet' | 'big' = 'normal';
 
+  @property({
+    type: String
+  })
+  public status: 'normal' | 'pending' | 'success' | 'error' = 'normal';
+
   constructor() {
     super();
   }
 
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+
+      :host {
+        display: block;
+        box-sizing: border-box;
+        font-family: 'Roboto', 'monospace';
+      }
+      :host([hidden]) {
+        display: none;
+      }
+
+      .button {
+        transition: all 0.1s , color 0s;
+        position: relative;
+        font-size: 14px;
+        font-weight: 400;
+        display: flex;
+        justify-content: center;
+        align-items: center;
+        background: ${cssManager.bdTheme('#fff', '#333')};
+        box-shadow: ${cssManager.bdTheme('0px 1px 3px rgba(0,0,0,0.3)', 'none')};
+        border: 1px solid ${cssManager.bdTheme('#eee', '#333')};
+        border-top: ${cssManager.bdTheme('1px solid #eee', '1px solid #444')};
+        border-radius: 4px;
+        line-height: 40px;
+        padding: 0px 8px;
+        min-width: 100px;
+        user-select: none;
+        color: ${cssManager.bdTheme('#333', ' #ccc')};
+        max-width: 500px;
+      }
+
+      .button:hover {
+        background: #0050b9;
+        color: #ffffff;
+        border: 1px solid #0050b9;
+        border-top: 1px solid #0050b9;
+      }
+
+      .button:active {
+        background: #0069f2;
+        border-top: 1px solid #0069f2;
+      }
+
+      .button.disabled {
+        background: ${cssManager.bdTheme('#ffffff00', '#11111100')};
+        border: 1px dashed ${cssManager.bdTheme('#666666', '#666666')};
+        color: #9b9b9e;
+        cursor: default;
+      }
+
+      .button.highlighted {
+        background: #e4002b;
+        border: none;
+        color: #fff;
+      }
+
+      .button.highlighted:hover {
+        background: #b50021;
+        border: none;
+        color: #fff;
+      }
+
+      .button.discreet {
+        background: none;
+        border: 1px solid #9b9b9e;
+        color: ${cssManager.bdTheme('#000', '#fff')};
+      }
+
+      .button.discreet:hover {
+        background: ${cssManager.bdTheme('rgba(0, 0, 0, 0.1)', 'rgba(255, 255, 255, 0.1)')};
+      }
+      .button.hidden {
+        display: none;
+      }
+
+      .button.big {
+        width: 300px;
+        line-height: 48px;
+        font-size: 16px;
+        padding: 0px 48px;
+        margin-top: 32px;
+      }
+
+      .button.pending {
+        border: 1px dashed ${cssManager.bdTheme('#0069f2', '#0069f270')};
+        background: ${cssManager.bdTheme('#0069f2', '#0069f270')};
+        color: #fff;
+      }
+
+      .button.success {
+        border: 1px dashed ${cssManager.bdTheme('#689F38', '#8BC34A70')};
+        background: ${cssManager.bdTheme('#689F38', '#8BC34A70')};
+        color: #fff;
+      }
+
+      .button.error {
+        border: 1px dashed ${cssManager.bdTheme('#B71C1C', '#E64A1970')};
+        background: ${cssManager.bdTheme('#B71C1C', '#E64A1970')};
+        color: #fff;
+      }
+
+      dees-spinner {
+        position: absolute;
+        left: 10px;
+      }
+    `,
+  ];
+
   public render(): TemplateResult {
     return html`
-      ${domtools.elementBasic.styles}
-      <style>
-        :host {
-          display: block;
-          box-sizing: border-box;
-        }
-        :host([hidden]) {
-          display: none;
-        }
-
-        .button {
-          transition: all 0.2s ease;
-          font-size: 14px;
-          display: block;
-          text-align: center;
-          background: #333;
-          border-top: 1px solid #444;
-          border-radius: 2px;
-          line-height: 40px;
-          padding: 0px 10px;
-          min-width: 100px;
-          color: ${this.isQuote ? '#ffffff' : '#333333' };
-          user-select: none;
-          color: #ccc;
-        }
-
-        .button:hover {
-          cursor: pointer;
-          background: #039BE5;
-          border-top: 1px solid #039BE5;
-          color: #ffffff;
-        }
-
-        .button:active {
-          background: #0277BD;
-          border-top: 1px solid #0277BD;
-        }
-
-        .button.disabled {
-          background: #fff;
-          border: 1px solid #eeeff3;
-          color: #9b9b9e;
-          cursor: default;
-        }
-
-        .button.highlighted {
-          background: #e4002b;
-          color: #fff;
-        }
-
-        .button.discreet {
-          background: none;
-          border: 1px solid #9b9b9e;
-          color: #000;
-        }
-
-        .button.discreet:hover {
-          background: rgba(0,0,0,0.1)
-        }
-        .hidden {
-            display: none;
-        }
-
-        .big {
-          display: inline-block;
-          line-height: 48px;
-          font-size: 16px;
-          padding: 0px 48px;
-          margin-top: 36px;
-        }
-      </style>
-      <div class="button ${this.isHidden ? 'hidden' : 'block'}  ${this.type} ${this.disabled ? 'disabled' : null}" @click="${this.dispatchClick}">
-        ${this.text ? this.text : this.textContent}
+      <div
+        class="button ${this.isHidden ? 'hidden' : 'block'}  ${this.type} ${this.status} ${this.disabled
+          ? 'disabled'
+          : null}"
+        @click="${this.dispatchClick}"
+      >
+        ${this.status === 'normal' ? html``: html`
+          <dees-spinner .bnw=${true} status="${this.status}"></dees-spinner>
+        `}
+        <div class="textbox">${this.text ? this.text : this.textContent}</div>
       </div>
     `;
   }
 
   public async dispatchClick() {
     if (this.disabled) {
-
       return;
     }
 
-    this.dispatchEvent(new CustomEvent('clicked', {
-      detail: {
-        data: this.eventDetailData
-      },
-      bubbles: true
-    }));
+    this.dispatchEvent(
+      new CustomEvent('clicked', {
+        detail: {
+          data: this.eventDetailData,
+        },
+        bubbles: true,
+      })
+    );
   }
 
-  public async firstUpdated () {
+  public async firstUpdated() {
     if (!this.textContent) {
       this.textContent = 'Button';
       this.performUpdate();

ts_web/elements/dees-chips.demo.ts

@@ -0,0 +1,41 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+  <style>
+    .demoContainer {
+      display: flex;
+      flex-direction: column;
+      align-items: center;
+      justify-content: center;
+      height: 100%;
+      background: #222;
+    }
+  </style>
+  <div class="demoContainer">
+    <dees-chips
+      selectionMode="none"
+      .selectableChips=${[
+        { key: 'account1', value: 'Payment Account 1' },
+        { key: 'account2', value: 'PaymentAccount2' },
+        { key: 'account3', value: 'Payment Account 3' },
+      ]}
+    ></dees-chips>
+    <dees-chips
+      selectionMode="single"
+      chipsAreRemovable
+      .selectableChips=${[
+        { key: 'account1', value: 'Payment Account 1' },
+        { key: 'account2', value: 'PaymentAccount2' },
+        { key: 'account3', value: 'Payment Account 3' },
+      ]}
+    ></dees-chips>
+    <dees-chips
+      selectionMode="multiple"
+      .selectableChips=${[
+        { key: 'account1', value: 'Payment Account 1' },
+        { key: 'account2', value: 'PaymentAccount2' },
+        { key: 'account3', value: 'Payment Account 3' },
+      ]}
+    ></dees-chips>
+  </div>
+`;

ts_web/elements/dees-chips.ts

@@ -0,0 +1,195 @@
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { demoFunc } from './dees-chips.demo.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-chips': DeesChips;
+  }
+}
+
+type Tag = { key: string; value: string };
+
+@customElement('dees-chips')
+export class DeesChips extends DeesElement {
+  public static demo = demoFunc;
+
+  @property()
+  public selectionMode: 'none' | 'single' | 'multiple' = 'single';
+
+  @property({
+    type: Boolean,
+  })
+  public chipsAreRemovable: boolean = false;
+
+  @property({
+    type: Array,
+  })
+  public selectableChips: Tag[] = [];
+
+  @property()
+  public selectedChip: Tag = null;
+
+  @property({
+    type: Array,
+  })
+  public selectedChips: Tag[] = [];
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        display: block;
+        box-sizing: border-box;
+      }
+
+      .mainbox {
+        user-select: none;
+      }
+
+      .chip {
+        border-top: ${cssManager.bdTheme('1px solid #CCC', '1px solid #444')};
+        background: #333333;
+        display: inline-flex;
+        height: 20px;
+        line-height: 20px;
+        padding: 0px 8px;
+        font-size: 12px;
+        color: #fff;
+        border-radius: 40px;
+        margin-right: 4px;
+        margin-bottom: 4px;
+        position: relative;
+        overflow: hidden;
+        box-shadow: 0px 1px 2px rgba(0, 0, 0, 0.3);
+      }
+
+      .chip:hover {
+        background: #666666;
+      }
+
+      .chip.selected {
+        background: #00a3ff;
+      }
+
+      .chipKey {
+        background: rgba(0, 0, 0, 0.3);
+        height: 100%;
+        display: inline-block;
+        margin-left: -8px;
+        padding-left: 8px;
+        padding-right: 8px;
+        margin-right: 8px;
+      }
+
+      dees-icon {
+        padding: 0px 6px 0px 4px;
+        margin-left: 4px;
+        margin-right: -8px;
+        background: rgba(0, 0, 0, 0.3);
+      }
+
+      dees-icon:hover {
+        background: #e4002b;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="mainbox">
+        ${this.selectableChips.map(
+          (chip) => html`
+            <div
+              @click=${() => this.selectChip(chip)}
+              class="chip ${this.isSelected(chip) ? 'selected' : ''}"
+            >
+              ${chip.key ? html`<div class="chipKey">${chip.key}</div>` : html``} ${chip.value}
+              ${this.chipsAreRemovable
+                ? html`
+                    <dees-icon
+                      @click=${(event: Event) => {
+                        event.stopPropagation(); // prevent the selectChip event from being triggered
+                        this.removeChip(chip);
+                      }}
+                      .iconFA=${'xmark'}
+                    ></dees-icon>
+                  `
+                : html``}
+            </div>
+          `
+        )}
+      </div>
+    `;
+  }
+
+  public async firstUpdated() {
+    if (!this.textContent) {
+      this.textContent = 'Button';
+      this.performUpdate();
+    }
+  }
+
+  private isSelected(chip: Tag): boolean {
+    if (this.selectionMode === 'single') {
+      return this.selectedChip?.key === chip.key;
+    } else {
+      return this.selectedChips.some((selected) => selected.key === chip.key);
+    }
+  }
+
+  public async selectChip(chip: Tag) {
+    if (this.selectionMode === 'none') {
+      return;
+    }
+
+    if (this.selectionMode === 'single') {
+      if (this.isSelected(chip)) {
+        this.selectedChip = null;
+        this.selectedChips = [];
+      } else {
+        this.selectedChip = chip;
+        this.selectedChips = [chip];
+      }
+    } else if (this.selectionMode === 'multiple') {
+      if (this.isSelected(chip)) {
+        this.selectedChips = this.selectedChips.filter((selected) => selected.key !== chip.key);
+      } else {
+        this.selectedChips = [...this.selectedChips, chip];
+      }
+      this.requestUpdate();
+    }
+    console.log(this.selectedChips);
+  }
+
+  public removeChip(chipToRemove: Tag): void {
+    // Remove the chip from selectableChips
+    this.selectableChips = this.selectableChips.filter((chip) => chip.key !== chipToRemove.key);
+
+    // Remove the chip from selectedChips if present
+    this.selectedChips = this.selectedChips.filter((chip) => chip.key !== chipToRemove.key);
+
+    // If the removed chip was the selectedChip, set selectedChip to null
+    if (this.selectedChip && this.selectedChip.key === chipToRemove.key) {
+      this.selectedChip = null;
+    }
+
+    // Trigger an update to re-render the component
+    this.requestUpdate();
+  }
+}

ts_web/elements/dees-contextmenu.demo.ts

@@ -0,0 +1,57 @@
+import { html } from '@design.estate/dees-element';
+import * as plugins from './00plugins.js';
+
+import { DeesContextmenu } from './dees-contextmenu.js';
+
+export const demoFunc = () => html`
+<style>
+  .withMargin {
+    display: block;
+    margin: 20px;
+  }
+</style>
+<dees-button @contextmenu=${(eventArg) => {
+  DeesContextmenu.openContextMenuWithOptions(eventArg, [
+    {
+      name: 'copy',
+      iconName: 'copySolid',
+      action: async () => {
+        return null;
+      },
+    },
+    {
+      name: 'edit',
+      iconName: 'penToSquare',
+      action: async () => {
+        return null;
+      },
+    },{
+      name: 'paste',
+      iconName: 'pasteSolid',
+      action: async () => {
+        return null;
+      },
+    },
+  ]);
+}}>Right-Click for contextmenu</dees-button>
+<dees-contextmenu class="withMargin"></dees-contextmenu>
+<dees-contextmenu
+  class="withMargin"
+  .menuItems=${[
+    {
+      name: 'copy',
+      iconName: 'copySolid',
+      action: async () => {},
+    },
+    {
+      name: 'edit',
+      iconName: 'penToSquare',
+      action: async () => {},
+    },{
+      name: 'paste',
+      iconName: 'pasteSolid',
+      action: async () => {},
+    },
+  ] as plugins.tsclass.website.IMenuItem[]}
+></dees-contextmenu>
+`;

ts_web/elements/dees-contextmenu.ts

@@ -0,0 +1,186 @@
+import { demoFunc } from './dees-contextmenu.demo.js';
+import * as plugins from './00plugins.js';
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { DeesWindowLayer } from './dees-windowlayer.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-contextmenu': DeesContextmenu;
+  }
+}
+
+@customElement('dees-contextmenu')
+export class DeesContextmenu extends DeesElement {
+  // DEMO
+  public static demo = demoFunc
+
+  // STATIC
+  // This will store all the accumulated menu items
+  public static contextMenuDeactivated = false;
+  public static accumulatedMenuItems: plugins.tsclass.website.IMenuItem[] = [];
+
+  // Add a global event listener for the right-click context menu
+  public static initializeGlobalListener() {
+    document.addEventListener('contextmenu', (event: MouseEvent) => {
+      if (this.contextMenuDeactivated) {
+        return;
+      }
+      event.preventDefault();
+
+      // Get the target element of the right-click
+      let target: EventTarget | null = event.target;
+
+      // Clear previously accumulated items
+      DeesContextmenu.accumulatedMenuItems = [];
+
+      // Traverse up the DOM tree to accumulate menu items
+      while (target) {
+        if ((target as any).getContextMenuItems) {
+          DeesContextmenu.accumulatedMenuItems.push(...(target as any).getContextMenuItems());
+        }
+        target = (target as Node).parentNode;
+      }
+
+      // Open the context menu with the accumulated items
+      DeesContextmenu.openContextMenuWithOptions(event, DeesContextmenu.accumulatedMenuItems);
+    });
+  }
+
+  // allows opening of a contextmenu with options
+  public static async openContextMenuWithOptions(eventArg: MouseEvent, menuItemsArg: plugins.tsclass.website.IMenuItem[]) {
+    if (this.contextMenuDeactivated) {
+      return;
+    }
+    eventArg.preventDefault();
+    eventArg.stopPropagation();
+    const contextMenu = new DeesContextmenu();
+    contextMenu.style.position = 'fixed';
+    contextMenu.style.zIndex = '2000';
+    contextMenu.style.top = `${eventArg.clientY.toString()}px`;
+    contextMenu.style.left = `${eventArg.clientX.toString()}px`;
+    contextMenu.style.opacity = '0';
+    contextMenu.style.transform = 'scale(0.95,0.95)';
+    contextMenu.style.transformOrigin = 'top left';
+    contextMenu.menuItems = menuItemsArg;
+    contextMenu.windowLayer = await DeesWindowLayer.createAndShow();
+    contextMenu.windowLayer.addEventListener('click', async () => {
+      await contextMenu.destroy();
+    })
+    document.body.append(contextMenu);
+    await domtools.plugins.smartdelay.delayFor(0);
+    contextMenu.style.opacity = '1';
+    contextMenu.style.transform = 'scale(1,1)';
+  }
+
+  // INSTANCE
+  @property({
+    type: Array,
+  })
+  public menuItems: plugins.tsclass.website.IMenuItem[] = [];
+  windowLayer: DeesWindowLayer;
+
+  constructor() {
+    super();
+  }
+
+  /**
+   * STATIC STYLES
+   */
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        display: block;
+        transition: all 0.1s;
+      }
+
+      .mainbox {
+        color: ${cssManager.bdTheme('#222', '#ccc')};
+        font-size: 14px;
+        width: 200px;
+        border: 1px solid ${cssManager.bdTheme('#fff', '#444')};
+        min-height: 34px;
+        border-radius: 3px;
+        background: ${cssManager.bdTheme('#fff', '#222')};
+        box-shadow: 0px 1px 4px ${cssManager.bdTheme('#00000020', '#000000')};
+        user-select: none;
+      }
+
+      .mainbox .menuitem {
+        padding: 8px;
+      }
+
+      .mainbox .menuitem dees-icon {
+        display: inline-block;
+        margin-right: 8px;
+        width: 14px;
+        transform: translateY(2px);
+      }
+
+      .mainbox .menuitem:hover {
+        background: ${cssManager.bdTheme('#00000010', '#ffffff10')};
+      }
+
+      .mainbox .menuitem:active {
+        background: #ffffff05;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="mainbox">
+        ${this.menuItems.map((menuItemArg) => {
+          return html`
+            <div class="menuitem" @click=${() => this.handleClick(menuItemArg)}>
+              <dees-icon .iconFA=${(menuItemArg.iconName as any) || 'minus'}></dees-icon
+              >${menuItemArg.name}
+            </div>
+          `;
+        })}
+        ${this.menuItems.length === 0 ? html`
+            <div class="menuitem" @click=${() => {
+              DeesContextmenu.contextMenuDeactivated = true;
+              this.destroy();
+            }}>
+              <dees-icon .iconFA=${'xmark'}></dees-icon
+              >Deactivate Contextmenu globally.
+            </div>
+        ` : html``}
+      </div>
+    `;
+  }
+
+  public async firstUpdated() {
+    
+  }
+
+  public async handleClick(menuItem: plugins.tsclass.website.IMenuItem) {
+    menuItem.action();
+    await this.destroy();
+  }
+
+  public async destroy() {
+    if (this.windowLayer) {
+      this.windowLayer.destroy();
+    }
+    this.style.opacity = '0';
+    this.style.transform = 'scale(0.95,0,95)';
+    await domtools.plugins.smartdelay.delayFor(100);
+    this.parentElement.removeChild(this);
+  }
+}
+
+DeesContextmenu.initializeGlobalListener();

ts_web/elements/dees-dataview-codebox.demo.ts

@@ -0,0 +1,18 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html` <style>
+.demoWrapper {
+  box-sizing: border-box;
+  position: absolute;
+  width: 100%;
+  height: 100%;
+  padding: 20px;
+  background: none;
+}
+</style>
+<div class="demoWrapper">
+<dees-dataview-codebox proglang="typescript">
+  import * as text from './hello'; const hiThere = 'nice'; const myFunction = async () => {
+  console.log('nice one'); }
+</dees-dataview-codebox>
+</div>`

ts_web/elements/dees-dataview-codebox.ts

@@ -0,0 +1,237 @@
+import { demoFunc } from './dees-dataview-codebox.demo.js';
+import {
+  DeesElement,
+  html,
+  customElement,
+  type TemplateResult,
+  property,
+  state,
+  cssManager,
+} from '@design.estate/dees-element';
+
+import hlight from 'highlight.js';
+
+import * as smartstring from '@push.rocks/smartstring';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { DeesContextmenu } from './dees-contextmenu.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-dataview-codebox': DeesDataviewCodebox;
+  }
+}
+
+@customElement('dees-dataview-codebox')
+export class DeesDataviewCodebox extends DeesElement {
+  public static demo = demoFunc;
+
+  @property()
+  public progLang: string = 'typescript';
+
+  @property({
+    type: String,
+    reflect: true,
+  })
+  public codeToDisplay: string = '';
+
+  constructor() {
+    super();
+  }
+
+  render(): TemplateResult {
+    return html`
+      ${domtools.elementBasic.styles}
+      <style>
+        :host {
+          position: relative;
+          display: block;
+          text-align: left;
+          font-size: 16px;
+          font-family: 'Roboto', 'Inter', sans-serif;
+        }
+        .mainbox {
+          position: relative;
+          color: ${this.goBright ? '#333333' : '#ffffff'};
+          border-top: 1px solid ${this.goBright ? '#ffffff' : '#333333'};
+          box-shadow: 0px 0px 5px ${this.goBright ? 'rgba(0,0,0,0.1)' : 'rgba(0,0,0,0.5)'};
+          background: ${this.goBright ? '#ffffff' : '#191919'};
+          border-radius: 16px;
+          overflow: hidden;
+        }
+
+        .appbar {
+          position: relative;
+          color: ${cssManager.bdTheme('#333', '#ccc')};
+          background: ${cssManager.bdTheme('#ffffff', '#161616')};
+          border-bottom: 1px solid ${cssManager.bdTheme('#eeeeeb', '#222222')};
+          height: 24px;
+          display: flex;
+          font-size: 12px;
+          line-height: 24px;
+          justify-content: center;
+          align-items: center;
+        }
+
+        .appbar .fileName {
+          line-height: inherit;
+          position: relative;
+          flex: 1;
+          text-align: center;
+        }
+
+        .bottomBar {
+          color: ${cssManager.bdTheme('#333', '#ccc')};
+          background: ${cssManager.bdTheme('#ffffff', '#161616')};
+          border-top: 1px solid ${cssManager.bdTheme('#eeeeeb', '#222222')};
+          height: 24px;
+          font-size: 12px;
+          line-height: 24px;
+          text-align: right;
+          padding-right: 100px;
+        }
+
+        .languageLabel {
+          color: ${cssManager.bdTheme('#333', '#ccc')};
+          font-size: 12px;
+          line-height: 24px;
+          z-index: 10;
+          background: #6596ff20;
+          display: inline-block;
+          position: absolute;
+          bottom: 0px;
+          right: 0px;
+          padding: 0px 16px 0px 8px;
+        }
+
+        .hljs-keyword {
+          color: #ff65ec;
+        }
+
+        .codegrid {
+          display: grid;
+          grid-template-columns: 50px auto;
+          overflow: hidden;
+        }
+
+        .lineNumbers {
+          color: ${this.goBright ? '#acacac' : '#666666'};
+          padding: 30px 16px 0px 0px;
+          text-align: right;
+          border-right: 1px solid ${this.goBright ? '#eaeaea' : '#222222'};
+        }
+
+        .lineCounter:last-child {
+          opacity: 50%;
+        }
+
+        pre {
+          overflow-x: auto;
+          margin: 0px;
+          padding: 30px 40px;
+        }
+
+        code {
+          font-weight: ${this.goBright ? '400' : '300'};
+          padding: 0px;
+          margin: 0px;
+        }
+
+        code,
+        code *,
+        .lineNumbers {
+          line-height: 1.4em;
+          font-weight: 200;
+          font-family: 'Intel One Mono', 'monospace';
+        }
+
+        .hljs-string {
+          color: #ffa465;
+        }
+
+        .hljs-built_in {
+          color: #65ff6a;
+        }
+
+        .hljs-function {
+          color: ${this.goBright ? '#2765DF' : '#6596ff'};
+        }
+
+        .hljs-params {
+          color: ${this.goBright ? '#3DB420' : '#65d5ff'};
+        }
+
+        .hljs-comment {
+          color: ${this.goBright ? '#EF9300' : '#ffd765'};
+        }
+      </style>
+      <div
+        class="mainbox"
+        @contextmenu="${(eventArg) => {
+          DeesContextmenu.openContextMenuWithOptions(eventArg, [
+            {
+              name: 'About',
+              iconName: 'circleInfo',
+              action: async () => {
+                return null;
+              },
+            },
+          ]);
+        }}"
+      >
+        <div class="appbar">
+          <dees-windowcontrols type="mac" position="left"></dees-windowcontrols>
+          <div class="fileName">index.ts</div>
+          <dees-windowcontrols type="mac" position="right"></dees-windowcontrols>
+        </div>
+        <div class="codegrid">
+          <div class="lineNumbers">
+            ${(() => {
+              let lineCounter = 0;
+              return this.codeToDisplay.split('\n').map((lineArg) => {
+                lineCounter++;
+                return html`<div class="lineCounter">${lineCounter}</div>`;
+              });
+            })()}
+          </div>
+          <pre><code></code></pre>
+        </div>
+        <div class="bottomBar">
+          Spaces: 2
+          <div class="languageLabel">${this.progLang}</div>
+        </div>
+      </div>
+    `;
+  }
+
+  @state()
+  private codeToDisplayStore = '';
+
+  public async updated(_changedProperties) {
+    super.updated(_changedProperties);
+    console.log('highlighting now');
+    console.log(this.childNodes);
+    const slottedCodeNodes: Text[] = [];
+    this.childNodes.forEach((childNode) => {
+      if (childNode.nodeName === '#text') {
+        slottedCodeNodes.push(childNode as Text);
+      }
+    });
+    if (this.codeToDisplay && this.codeToDisplay !== this.codeToDisplayStore) {
+      this.codeToDisplayStore = smartstring.indent.normalize(this.codeToDisplay).trimStart();
+    }
+    if (slottedCodeNodes[0] && slottedCodeNodes[0].wholeText && !this.codeToDisplay) {
+      this.codeToDisplayStore = smartstring.indent
+        .normalize(slottedCodeNodes[0].wholeText)
+        .trimStart();
+      this.codeToDisplay = this.codeToDisplayStore;
+    }
+    await domtools.plugins.smartdelay.delayFor(0);
+    const localCodeNode = this.shadowRoot.querySelector('code');
+    const html = hlight.highlight(this.codeToDisplayStore, {
+      language: this.progLang,
+      ignoreIllegals: true,
+    });
+    localCodeNode.innerHTML = html.value;
+  }
+}

ts_web/elements/dees-dataview-statusobject.demo.ts

@@ -0,0 +1,39 @@
+import { html } from '@design.estate/dees-element';
+import * as tsclass from '@tsclass/tsclass';
+
+export const demoFunc = () => html`<dees-dataview-statusobject
+  .statusObject=${{
+    id: '1',
+    name: 'Demo Item',
+    combinedStatus: 'partly_ok',
+    combinedStatusText: 'partly_ok',
+    details: [
+      {
+        name: 'Detail 1',
+        value: 'Value 1',
+        status: 'ok',
+        statusText: 'OK',
+      },
+      {
+        name: 'Detail 2',
+        value: 'Value 2',
+        status: 'partly_ok',
+        statusText: 'partly_ok',
+      },
+      {
+        name: 'Detail 3',
+        value: 'Value 3',
+        status: 'not_ok',
+        statusText: 'not_ok',
+      },
+      {
+        name: 'Detail 4',
+        value:
+          'Value 4 jhdkfjhalskdfjhfdjskalsdkfjhfdjskalskdjfhjdkslaksjdhfjdkslaskdfjhfjdkslaskdjfhjdskalskdjhfdjskalskdjfhdjskl',
+        status: 'ok',
+        statusText: 'OK',
+      },
+    ],
+  } as tsclass.code.IStatusObject}
+>
+</dees-dataview-statusobject>`;

ts_web/elements/dees-dataview-statusobject.ts

@@ -0,0 +1,138 @@
+import { demoFunc } from './dees-dataview-statusobject.demo.js';
+import {
+  DeesElement,
+  html,
+  customElement,
+  type TemplateResult,
+  property,
+  state,
+  cssManager,
+  css,
+  type CSSResult,
+} from '@design.estate/dees-element';
+
+import * as tsclass from '@tsclass/tsclass';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-dataview-statusobject': DeesDataviewStatusobject;
+  }
+}
+
+@customElement('dees-dataview-statusobject')
+export class DeesDataviewStatusobject extends DeesElement {
+  public static demo = demoFunc;
+
+  @property({ type: Object }) statusObject: tsclass.code.IStatusObject;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      .mainbox {
+        border-radius: 8px;
+        background: ${cssManager.bdTheme('#fff', '#1b1b1b')};
+        box-shadow: 0px 1px 3px #00000030;
+        min-height: 48px;
+        color: ${cssManager.bdTheme('#000', '#fff')};
+      }
+
+      .heading {
+        display: grid;
+        align-items: center;
+        grid-template-columns: 40px auto 120px;
+      }
+
+      h1 {
+        display: block;
+        margin: 0px;
+        padding: 0px;
+        height: 48px;
+        text-transform: uppercase;
+        font-size: 12px;
+        line-height: 48px;
+      }
+
+      .statusdot {
+        height: 8px;
+        width: 8px;
+        border-radius: 6px;
+        background: grey;
+        margin: auto;
+      }
+
+      .copyMain {
+        font-size: 10px;
+        font-weight: 600;
+        text-transform: uppercase;
+        border: 1px solid ${cssManager.bdTheme('#999', '#444')};
+        text-align: center;
+        padding: 4px;
+        border-radius: 3px;
+        margin-right: 16px;
+        color: #ffffff80
+      }
+
+      .statusdot.ok {
+        background: green;
+      }
+
+      .statusdot.not_ok{
+        background: red;
+      }
+
+      .statusdot.partly_ok {
+        background: orange;
+      }
+
+      .detail {
+        minheight: 60px;
+        align-items: center;
+        display: grid;
+        grid-template-columns: 40px auto;
+        border-top: 1px dotted ${cssManager.bdTheme('#999', '#282828')};
+      }
+
+      .detail .detailsText {
+        padding-top: 8px;
+        padding-bottom: 8px;
+        padding-right: 8px;
+        word-break: break-all;
+      }
+
+      .detail .detailsText .label {
+        font-size: 12px;
+        color: #ffffff80
+      }
+
+      .detail .detailsText .value {
+        font-size: 14px;
+        font-family: 'Intel One Mono';
+      }
+    `,
+  ];
+
+  render(): TemplateResult {
+    return html`
+      <div class="mainbox">
+        <div class="heading">
+          <div class="statusdot ${this.statusObject?.combinedStatus}"></div>
+          <h1>${this.statusObject?.name || 'no status object assigned'}</h1>
+          <div class="copyMain">Copy as JSON</div>
+        </div>
+        ${this.statusObject?.details?.map((detailArg) => {
+          return html`
+            <div class="detail">
+              <div class="statusdot ${detailArg.status}"></div>
+              <div class="detailsText">
+                <div class="label">${detailArg.name}</div>
+                <div class="value">${detailArg.value}</div>
+              </div>
+            </div>
+          `;
+        })}
+      </div>
+    `;
+  }
+
+  async firstUpdated() {}
+}

ts_web/elements/dees-form-submit.ts

@@ -1,19 +1,71 @@
-import { customElement, html, LitElement } from 'lit-element';
+import {
+  customElement,
+  html,
+  DeesElement,
+  css,
+  cssManager,
+  property,
+  type CSSResult,
+} from '@design.estate/dees-element';
+import { DeesForm } from './dees-form.js';
 
-import {DeesForm} from './dees-form';
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-form-submit': DeesFormSubmit;
+  }
+}
 
 @customElement('dees-form-submit')
-export class DeesFormSubmit extends LitElement {
+export class DeesFormSubmit extends DeesElement {
+  public static demo = () => html`<dees-form-submit>This is a sloted text</dees-form-submit>`;
 
+  @property({
+    type: Boolean,
+    reflect: true,
+  })
+  public disabled = false;
+
+  @property({
+    type: String,
+  })
+  public text: string;
+
+  @property({
+    type: String,
+  })
+  public status: 'normal' | 'pending' | 'success' | 'error' = 'normal';
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [cssManager.defaultStyles, css``];
 
   public render() {
     return html`
-      <dees-button @click="${this.submit}">${this.textContent}</dees-button>
+      <dees-button
+        status=${this.status}
+        @click=${this.submit}
+        .disabled=${this.disabled}
+        .text=${this.text ? this.text : this.textContent}
+      >
+      </dees-button>
     `;
   }
 
   public async submit() {
+    if (this.disabled) {
+      return;
+    }
     const parentElement: DeesForm = this.parentElement as DeesForm;
     parentElement.gatherAndDispatch();
   }
+
+  public async focus() {
+    const domtools = await this.domtoolsPromise;
+    if (!this.disabled) {
+      domtools.convenience.smartdelay.delayFor(0);
+      this.submit();
+    }
+  }
 }

ts_web/elements/dees-form.demo.ts

@@ -0,0 +1,56 @@
+import { html, domtools } from '@design.estate/dees-element';
+import type { DeesForm } from './dees-form.js';
+
+export const demoFunc = () => html`
+  <style>
+    .demoContainer {
+      max-width: 400px;
+      margin: auto;
+      padding: 16px;
+      background: #111;
+    }
+  </style>
+  <div class="demoContainer">
+    <dees-form
+      style="display: block; margin:auto; max-width: 500px; padding: 20px"
+      @formData=${async (eventArg) => {
+        const form: DeesForm = eventArg.currentTarget;
+        form.setStatus('pending', 'authenticating...');
+        await domtools.plugins.smartdelay.delayFor(1000);
+        form.setStatus('success', 'authenticated!');
+      }}
+    >
+      <dees-input-dropdown
+        .label=${'title'}
+        .options=${[
+          { option: 'option 1', key: 'option1' },
+          { option: 'option 2', key: 'option2' },
+          { option: 'option 3', key: 'option3' },
+        ]}
+      ></dees-input-dropdown>
+      <dees-input-multiselect
+        .label=${'title'}
+        .options=${[
+          { option: 'option 1', key: 'option1' },
+          { option: 'option 2', key: 'option2' },
+          { option: 'option 3', key: 'option3' },
+        ]}></dees-input-multiselect>
+      <dees-input-typelist></dees-input-typelist>
+      <dees-input-text .required="${true}" key="hello1" label="a text"></dees-input-text>
+      <dees-input-text .required="${true}" key="hello2" label="also a text"></dees-input-text>
+      <dees-input-text
+        .required="${true}"
+        key="hello3"
+        label="a password"
+        isPasswordBool
+      ></dees-input-text>
+      <dees-input-checkbox
+        .required="${true}"
+        key="hello3"
+        label="another text"
+      ></dees-input-checkbox>
+      <dees-input-iban></dees-input-iban>
+      <dees-form-submit>Submit</dees-form-submit>
+    </dees-form>
+  </div>
+`;

ts_web/elements/dees-form.ts

@@ -1,20 +1,52 @@
-import { customElement, html, TemplateResult, LitElement } from 'lit-element';
+import {
+  customElement,
+  html,
+  type TemplateResult,
+  DeesElement,
+  type CSSResult,
+} from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
 
-import { DeesInputCheckbox } from './dees-input-checkbox';
-import { DeesInputText } from './dees-input-text';
-import { DeesInputQuantitySelector } from './dees-input-quantityselector';
-import { DeesInputRadio } from './dees-input-radio';
+import { DeesInputCheckbox } from './dees-input-checkbox.js';
+import { DeesInputText } from './dees-input-text.js';
+import { DeesInputQuantitySelector } from './dees-input-quantityselector.js';
+import { DeesInputRadio } from './dees-input-radio.js';
+import { DeesFormSubmit } from './dees-form-submit.js';
+import { DeesTable } from './dees-table.js';
+import { demoFunc } from './dees-form.demo.js';
+import { DeesInputIban } from './dees-input-iban.js';
+
+// Unified set for form input types
+const FORM_INPUT_TYPES = [
+  DeesInputCheckbox,
+  DeesInputIban,
+  DeesInputText,
+  DeesInputQuantitySelector,
+  DeesInputRadio,
+  DeesTable,
+];
+
+export type TFormInputElement =
+  | DeesInputCheckbox
+  | DeesInputIban
+  | DeesInputText
+  | DeesInputQuantitySelector
+  | DeesInputRadio
+  | DeesTable<any>;
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-form': DeesForm;
+  }
+}
 
 @customElement('dees-form')
-export class DeesForm extends LitElement {
-  public static demo = () => html`
-    <dees-form style="display: block; margin:auto; width: 500px; padding: 20px; background: #111;">
-      <dees-input-text key="hello1"></dees-input-text>
-      <dees-input-text key="hello2"></dees-input-text>
-      <dees-form-submit>Submit</dees-form-submit>
-    </dees-form>`;
+export class DeesForm extends DeesElement {
+  public static demo = demoFunc;
 
   public name: string = 'myform';
+  public changeSubject = new domtools.plugins.smartrx.rxjs.Subject();
+  public readyDeferred = domtools.plugins.smartpromise.defer();
 
   public render(): TemplateResult {
     return html`
@@ -27,24 +59,143 @@ export class DeesForm extends LitElement {
     `;
   }
 
-  public async gatherAndDispatch() {
+  public async firstUpdated() {
+    const formChildren = this.getFormElements();
+    this.updateRequiredStatus();
 
-    const children: Array<DeesInputCheckbox | DeesInputText | DeesInputQuantitySelector | DeesInputRadio> = this.children as any;
-    const valueObject: { [key: string]: string | number | boolean} = {};
-    for (const child of children) {
-      if (child instanceof DeesInputCheckbox || child instanceof DeesInputText || child instanceof DeesInputQuantitySelector) {
-        valueObject[child.key] = child.value;
+    for (const child of formChildren) {
+      child.changeSubject.subscribe(async () => {
+        const valueObject = await this.collectFormData();
+        this.changeSubject.next(valueObject);
+        console.log(valueObject);
+        this.updateRequiredStatus();
+      });
+    }
+    await this.addBehaviours();
+    this.readyDeferred.resolve();
+  }
+
+  public getFormElements(): Array<TFormInputElement> {
+    return Array.from(this.children).filter((child) =>
+      FORM_INPUT_TYPES.includes(child.constructor as any)
+    ) as unknown as TFormInputElement[];
+  }
+
+  public getSubmitButton(): DeesFormSubmit | undefined {
+    return Array.from(this.children).find(
+      (child) => child instanceof DeesFormSubmit
+    ) as DeesFormSubmit;
+  }
+
+  public async updateRequiredStatus() {
+    console.log('checking the required status.');
+
+    let requiredOK = true;
+    for (const childArg of this.getFormElements()) {
+      if (childArg.required && !childArg.value) {
+        requiredOK = false;
       }
     }
+    if (this.getSubmitButton()) {
+      this.getSubmitButton().disabled = !requiredOK;
+    }
+  }
 
+  public async collectFormData() {
+    const children = this.getFormElements();
+    const valueObject: { [key: string]: string | number | boolean | any[] } = {};
+    for (const child of children) {
+      if (!child.key) {
+        console.log(`form element with label "${child.label}" has no key. skipping.`);
+      }
+      valueObject[child.key] = child.value;
+    }
+    return valueObject;
+  }
 
-    console.log(valueObject);
+  public async gatherAndDispatch() {
+    const valueObject = await this.collectFormData();
     const formDataEvent = new CustomEvent('formData', {
       detail: {
-        data: valueObject
+        data: valueObject,
       },
-      bubbles: true
+      bubbles: true,
     });
     this.dispatchEvent(formDataEvent);
+    console.log('dispatched data:');
+    console.log(valueObject);
+  }
+
+  public setStatus(
+    visualStateArg: 'normal' | 'pending' | 'error' | 'success',
+    textStateArg: string
+  ) {
+    const inputChildren = this.getFormElements();
+    const submitButton = this.getSubmitButton();
+
+    switch (visualStateArg) {
+      case 'normal':
+        submitButton.disabled = false;
+        submitButton.status = 'normal';
+        for (const inputChild of inputChildren) {
+          inputChild.disabled = false;
+        }
+        break;
+      case 'pending':
+        submitButton.disabled = true;
+        submitButton.status = 'pending';
+        for (const inputChild of inputChildren) {
+          inputChild.disabled = true;
+        }
+        break;
+      case 'success':
+        submitButton.disabled = true;
+        submitButton.status = 'success';
+        for (const inputChild of inputChildren) {
+          inputChild.disabled = true;
+        }
+        break;
+      case 'error':
+        submitButton.disabled = true;
+        submitButton.status = 'error';
+        for (const inputChild of inputChildren) {
+          inputChild.disabled = true;
+        }
+        break;
+    }
+
+    submitButton.text = textStateArg;
+  }
+
+  /**
+   * resets the form
+   */
+  reset() {
+    const inputChildren = this.getFormElements();
+    const submitButton = this.getSubmitButton();
+
+    for (const inputChild of inputChildren) {
+      inputChild.value = null;
+    }
+    this.setStatus('normal', 'Submit');
+  }
+
+  public async addBehaviours() {
+    // Use event delegation
+    this.addEventListener('keydown', (event: KeyboardEvent) => {
+      const target = event.target as DeesElement;
+      if (!FORM_INPUT_TYPES.includes(target.constructor as any)) return;
+
+      if (event.key === 'Enter') {
+        const children = this.getFormElements();
+        const currentIndex = children.indexOf(target as any);
+        if (currentIndex < children.length - 1) {
+          children[currentIndex + 1].focus();
+        } else {
+          target.blur();
+          this.getSubmitButton()?.focus();
+        }
+      }
+    });
   }
 }

ts_web/elements/dees-hint.demo.ts

@@ -0,0 +1,5 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+  <dees-hint></dees-hint>
+`;

ts_web/elements/dees-hint.ts

@@ -0,0 +1,38 @@
+import {
+  DeesElement,
+  css,
+  cssManager,
+  customElement,
+  html,
+  property,
+  type CSSResult,
+  type TemplateResult,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { demoFunc } from './dees-hint.demo.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-hint': DeesHint;
+  }
+}
+
+@customElement('dees-hint')
+export class DeesHint extends DeesElement {
+  public static demo = demoFunc;
+
+  @property({ type: String })
+  public type: 'info' | 'warn' | 'error' | 'critical' = 'info';
+
+  constructor() {
+    super();
+    domtools.elementBasic.setup();
+  }
+
+  public static styles = [cssManager.defaultStyles, css``];
+
+  public render(): TemplateResult {
+    return html` <div class="mainbox"></div> `;
+  }
+}

ts_web/elements/dees-icon.demo.ts

@@ -0,0 +1,55 @@
+import { html } from '@design.estate/dees-element';
+
+import { faIcons } from './dees-icon.js';
+
+export const demoFunc = () => html`
+  <style>
+    .demoContainer {
+      
+      width: 100%;
+      display: flex;
+      flex-wrap: wrap;
+      background: #111111;
+      padding: 10px; font-size: 30px;
+    }
+    dees-icon {
+      transition: color 0.02s;
+      color: #ffffff;
+    }
+    dees-icon:hover {
+      color: #e4002b;
+    }
+
+    .iconContainer {
+      display: block;
+      padding: 16px 16px 0px 16px;
+      border: 1px solid #333333;
+      margin-right: 8px;
+      margin-bottom: 8px;
+    }
+
+    .iconName {
+      font-size: 12px;
+      text-align: center;
+      color: #ccc;
+      background: #333333;
+      padding: 4px 8px;
+      padding-bottom: 4px;
+      margin-left: -16px;
+      margin-right: -16px;
+      margin-top: 16px;
+    }
+  </style>
+  
+    <div class="demoContainer">
+      ${Object.keys(faIcons).map(
+        (iconName) => html`
+          <div class="iconContainer">
+            <dees-icon .iconFA=${iconName as any}></dees-icon>
+            <div class="iconName">${iconName}</div>
+          </div>
+        `
+      )}
+    </div>
+  
+`;

ts_web/elements/dees-icon.ts

@@ -0,0 +1,195 @@
+import {
+  DeesElement,
+  html,
+  property,
+  customElement,
+  cssManager,
+  css,
+  type CSSResult,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+
+import { icon, type IconDefinition } from '@fortawesome/fontawesome-svg-core';
+import {
+  faFacebook,
+  faGoogle,
+  faLinkedin,
+  faMedium,
+  faSlackHash,
+  faTwitter,
+  faInstagram,
+  faTiktok,
+} from '@fortawesome/free-brands-svg-icons';
+
+import {
+  faCopy as faCopyRegular,
+  faCircleCheck as faCircleCheckRegular,
+  faCircleXmark as faCircleXmarkRegular,
+  faMessage as faMessageRegular,
+  faPaste as faPasteRegular,
+  faSun as faSunRegular,
+  faTrashCan as faTrashCanRegular,
+} from '@fortawesome/free-regular-svg-icons';
+import {
+  faArrowRight as faArrowRightSolid,
+  faArrowUpRightFromSquare as faArrowUpRightFromSquareSolid,
+  faBell as faBellSolid,
+  faBug as faBugSolid,
+  faBuilding as faBuildingSolid,
+  faCaretLeft as faCaretLeftSolid,
+  faCaretRight as faCaretRightSolid,
+  faCheck as faCheckSolid,
+  faCircleInfo as faCircleInfoSolid,
+  faCircleCheck as faCircleCheckSolid,
+  faCircleXmark as faCircleXmarkSolid,
+  faClockRotateLeft as faClockRotateLeftSolid,
+  faCopy as faCopySolid,
+  faDesktop as faDesktopSolid,
+  faEye as faEyeSolid,
+  faEyeSlash as faEyeSlashSolid,
+  faFileInvoice as faFileInvoiceSolid,
+  faFileInvoiceDollar as faFileInvoiceDollarSolid,
+  faGear as faGearSolid,
+  faGrip as faGripSolid,
+  faMessage as faMessageSolid,
+  faMoneyCheckDollar as faMoneyCheckDollarSolid,
+  faMugHot as faMugHotSolid,
+  faMinus as faMinusSolid,
+  faPaste as faPasteSolid,
+  faPenToSquare as faPenToSquareSolid,
+  faPlus as faPlusSolid,
+  faReceipt as faReceiptSolid,
+  faRss as faRssSolid,
+  faUsers as faUsersSolid,
+  faShare as faShareSolid,
+  faSun as faSunSolid,
+  faTrash as faTrashSolid,
+  faTrashCan as faTrashCanSolid,
+  faWallet as faWalletSolid,
+  faXmark as faXmarkSolid,
+} from '@fortawesome/free-solid-svg-icons';
+import { demoFunc } from './dees-icon.demo.js';
+
+export const faIcons = {
+  // normal
+  arrowRight: faArrowRightSolid,
+  arrowUpRightFromSquare: faArrowUpRightFromSquareSolid,
+  bell: faBellSolid,
+  bug: faBugSolid,
+  building: faBuildingSolid,
+  caretLeft: faCaretLeftSolid,
+  caretRight: faCaretRightSolid,
+  check: faCheckSolid,
+  circleInfo: faCircleInfoSolid,
+  circleCheck: faCircleCheckRegular,
+  circleCheckSolid: faCircleCheckSolid,
+  circleXmark: faCircleXmarkRegular,
+  circleXmarkSolid: faCircleXmarkSolid,
+  clockRotateLeft: faClockRotateLeftSolid,
+  copy: faCopyRegular,
+  copySolid: faCopySolid,
+  desktop: faDesktopSolid,
+  eye: faEyeSolid,
+  eyeSlash: faEyeSlashSolid,
+  fileInvoice: faFileInvoiceSolid,
+  fileInvoiceDoller: faFileInvoiceDollarSolid,
+  gear: faGearSolid,
+  grip: faGripSolid,
+  message: faMessageRegular,
+  messageSolid: faMessageSolid,
+  moneyCheckDollar: faMoneyCheckDollarSolid,
+  mugHot: faMugHotSolid,
+  minus: faMinusSolid,
+  paste: faPasteRegular,
+  pasteSolid: faPasteSolid,
+  penToSquare: faPenToSquareSolid,
+  plus: faPlusSolid,
+  receipt: faReceiptSolid,
+  rss: faRssSolid,
+  share: faShareSolid,
+  sun: faSunRegular,
+  sunSolid: faSunSolid,
+  trash: faTrashSolid,
+  trashSolid: faTrashSolid,
+  trashCan: faTrashCanRegular,
+  trashCanSolid: faTrashCanSolid,
+  users: faUsersSolid,
+  wallet: faWalletSolid,
+  xmark: faXmarkSolid,
+  // brands
+  facebook: faFacebook,
+  google: faGoogle,
+  instagram: faInstagram,
+  linkedin: faLinkedin,
+  medium: faMedium,
+  slack: faSlackHash,
+  tiktok: faTiktok,
+  twitter: faTwitter,
+};
+
+export type TIconKey = keyof typeof faIcons;
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-icon': DeesIcon;
+  }
+}
+
+@customElement('dees-icon')
+export class DeesIcon extends DeesElement {
+  public static demo = demoFunc;
+
+  @property({
+    type: String
+  })
+  public iconFA: keyof typeof faIcons;
+
+  @property()
+  public iconSize: number;
+
+  constructor() {
+    super();
+    domtools.elementBasic.setup();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        display: block;
+        white-space: nowrap;
+        display: flex;
+        align-items: center;
+        justify-content: center;
+      }
+      * {
+        transition: inherit !important;
+      }
+    `,
+  ];
+
+  public render() {
+    return html`
+      ${domtools.elementBasic.styles}
+      <style>
+        #iconContainer svg {
+          display: block;
+          height: ${this.iconSize}px;
+        }
+      </style>
+      <div id="iconContainer"></div>
+    `;
+  }
+
+  public async updated() {
+    if (!this.iconSize) {
+      this.iconSize = parseInt(globalThis.getComputedStyle(this).fontSize.replace(/\D/g,''));
+    }
+    if (this.iconFA) {
+      this.shadowRoot.querySelector('#iconContainer').innerHTML = this.iconFA
+        ? icon(faIcons[this.iconFA]).html[0]
+        : 'icon not found';
+    }
+  }
+}

ts_web/elements/dees-input-checkbox.ts

@@ -1,19 +1,55 @@
-import { customElement, LitElement, TemplateResult, property, html } from 'lit-element';
-import * as domtools from '@designestate/dees-domtools';
+import {
+  customElement,
+  DeesElement,
+  type TemplateResult,
+  property,
+  html,
+  css,
+  cssManager,
+  type CSSResult,
+} from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-input-checkbox': DeesInputCheckbox;
+  }
+}
 
 @customElement('dees-input-checkbox')
-export class DeesInputCheckbox extends LitElement {
+export class DeesInputCheckbox extends DeesElement {
+  // STATIC
   public static demo = () => html`<dees-input-checkbox></dees-input-checkbox>`;
 
-  @property()
+  // INSTANCE
+  public changeSubject = new domtools.plugins.smartrx.rxjs.Subject();
+
+  @property({
+    type: String,
+    reflect: true,
+  })
   public key: string;
 
-  @property()
+  @property({
+    type: String,
+  })
   public label: string = 'Label';
 
-  @property()
+  @property({
+    type: Boolean,
+  })
   public value: boolean = false;
 
+  @property({
+    type: Boolean,
+  })
+  public required: boolean = false;
+
+  @property({
+    type: Boolean
+  })
+  public disabled: boolean = false;
+
   public render(): TemplateResult {
     return html`
       ${domtools.elementBasic.styles}
@@ -26,18 +62,21 @@ export class DeesInputCheckbox extends LitElement {
           display: block;
           position: relative;
           margin: 20px 0px;
-          cursor: pointer;
+          cursor: default;
+        }
+        :host(:hover) {
+          filter: ${cssManager.bdTheme('brightness(0.95)', 'brightness(1.1)')};
         }
 
         .maincontainer {
           display: grid;
           grid-template-columns: 25px auto;
           padding: 5px 0px;
-          color: #ccc;
+          color: ${this.goBright ? '#333' : '#ccc'};
         }
 
         .maincontainer:hover {
-          color: #fff;
+          ${this.goBright ? '#000' : '#ccc'};
         }
 
         .label {
@@ -55,20 +94,25 @@ export class DeesInputCheckbox extends LitElement {
         .checkbox {
           transition: all 0.1s;
           box-sizing: border-box;
-          border: 1px solid #999;
+          border: 1px solid ${this.goBright ? '#CCC' : '#999'};
           border-radius: 2px;
           height: 24px;
           width: 24px;
           display: inline-block;
-          background: #222;
+          background: ${this.goBright ? '#fafafa' : '#222'};
         }
 
         .checkbox.selected {
-          background: #039BE5;
-          border: 1px solid #039BE5;
+          background: #0050b9;
+          border: 1px solid #0050b9;
         }
 
-        .checkmark {
+        .checkbox.disabled {
+          background: none;
+          border: 1px dashed ${cssManager.bdTheme('#666666', '#666666')};
+        }
+
+        .checkbox .checkmark {
           display: inline-block;
           width: 22px;
           height: 22px;
@@ -77,16 +121,16 @@ export class DeesInputCheckbox extends LitElement {
           transform: rotate(45deg);
         }
 
-        .checkmark_stem {
+        .checkbox .checkmark_stem {
           position: absolute;
           width: 3px;
           height: 9px;
-          background-color: #ccc;
+          background-color: #fff;
           left: 11px;
           top: 6px;
         }
 
-        .checkmark_kick {
+        .checkbox .checkmark_kick {
           position: absolute;
           width: 3px;
           height: 3px;
@@ -95,12 +139,16 @@ export class DeesInputCheckbox extends LitElement {
           top: 12px;
         }
 
+        .checkbox.disabled .checkmark_stem, .checkbox.disabled .checkmark_kick {
+          background-color: ${cssManager.bdTheme('#333', '#fff')};
+        }
+
         img {
           padding: 4px;
         }
       </style>
       <div class="maincontainer" @click="${this.toggleSelected}">
-        <div class="checkbox ${this.value ? 'selected' : ''}">
+        <div class="checkbox ${this.value ? 'selected' : ''} ${this.disabled ? 'disabled' : ''}" tabindex="0">
           ${this.value
             ? html`
                 <span class="checkmark">
@@ -116,6 +164,9 @@ export class DeesInputCheckbox extends LitElement {
   }
 
   public async toggleSelected() {
+    if (this.disabled) {
+      return;
+    }
     this.value = !this.value;
     this.dispatchEvent(
       new CustomEvent('newValue', {
@@ -123,5 +174,13 @@ export class DeesInputCheckbox extends LitElement {
         bubbles: true,
       })
     );
+    this.changeSubject.next(this);
+  }
+
+  public focus(): void {
+    const checkboxDiv = this.shadowRoot.querySelector('.checkbox');
+    if (checkboxDiv) {
+      (checkboxDiv as any).focus();
+    }
   }
 }

ts_web/elements/dees-input-dropdown.demo.ts

@@ -0,0 +1,27 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+<dees-input-dropdown
+  .options=${[
+    {option: 'option 1', key: 'option1'},
+    {option: 'option 2', key: 'option2'},
+    {option: 'option 3', key: 'option3'}
+  ]}
+></dees-input-dropdown>
+<dees-input-dropdown
+  .enableSearch=${false}
+  .options=${[
+    {option: 'option 1', key: 'option1'},
+    {option: 'option 2', key: 'option2'},
+    {option: 'option 3', key: 'option3'}
+  ]}
+></dees-input-dropdown>
+<div style="height: 300px"></div>
+<dees-input-dropdown
+  .options=${[
+    {option: 'option 1', key: 'option1'},
+    {option: 'option 2', key: 'option2'},
+    {option: 'option 3', key: 'option3'}
+  ]}
+></dees-input-dropdown>
+`

ts_web/elements/dees-input-dropdown.ts

@@ -1,116 +1,371 @@
-import { customElement, LitElement, TemplateResult, property, html } from 'lit-element';
+import {
+  customElement,
+  DeesElement,
+  type TemplateResult,
+  property,
+  state,
+  html,
+  css,
+  cssManager,
+  type CSSResult,
+} from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
+import { demoFunc } from './dees-input-dropdown.demo.js';
+import { DeesWindowLayer } from './dees-windowlayer.js';
 
-import * as domtools from '@designestate/dees-domtools';
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-input-dropdown': DeesInputDropdown;
+  }
+}
 
 @customElement('dees-input-dropdown')
-export class DeesInputDropdown extends LitElement {
-  @property()
+export class DeesInputDropdown extends DeesElement {
+  public static demo = demoFunc;
+
+  // INSTANCE
+  public changeSubject = new domtools.plugins.smartrx.rxjs.Subject();
+
+  @property({
+    type: String,
+    reflect: true,
+  })
   public label: string = 'Label';
 
   @property()
   public key: string;
 
   @property()
-  public options: {option: string, key: string, payload?: any}[] = [];
+  public options: { option: string; key: string; payload?: any }[] = [];
 
   @property()
-  public selectedOption: {option: string, key: string, payload?: any} = {
-    key: null,
-    option: null,
-    payload: null
-  };
+  public selectedOption: { option: string; key: string; payload?: any } = null;
+
+  @property({
+    type: Boolean,
+  })
+  public required: boolean = false;
+
+  @property({
+    type: Boolean,
+  })
+  public enableSearch: boolean = true;
+
+  @property({
+    type: Boolean,
+  })
+  public disabled: boolean = false;
+
+  @state()
+  public opensToTop: boolean = false;
+
+  @state()
+  private filteredOptions: { option: string; key: string; payload?: any }[] = [];
+
+  @state()
+  private highlightedIndex: number = 0;
+
+  @state()
+  public isOpened = false;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      * {
+        box-sizing: border-box;
+      }
+
+      :host {
+        font-family: Roboto;
+        position: relative;
+        display: block;
+        color: ${cssManager.bdTheme('#222', '#fff')};
+        margin-bottom: 24px;
+      }
+
+      .maincontainer {
+        display: block;
+      }
+
+      .label {
+        font-size: 14px;
+        margin-bottom: 4px;
+      }
+
+      .selectedBox {
+        user-select: none;
+        position: relative;
+        max-width: 420px;
+        height: 40px;
+        line-height: 40px;
+        padding: 0px 8px;
+        background: ${cssManager.bdTheme('#fafafa', '#222222')};
+        box-shadow: ${cssManager.bdTheme('0px 1px 4px rgba(0,0,0,0.3)', 'none')};
+        border-radius: 3px;
+        border-top: ${cssManager.bdTheme('1px solid #CCC', '1px solid #444')};
+        border-bottom: ${cssManager.bdTheme('1px solid #CCC', '1px solid #333')};
+        transition: all 0.2s ease;
+      }
+
+      .selectedBox:hover {
+        filter: ${cssManager.bdTheme('brightness(0.95)', 'brightness(1.1)')};
+      }
+
+      .accentBottom {
+        filter: none !important;
+      }
+
+      .accentTop {
+        filter: none !important;
+      }
+
+      .selectionBox {
+        will-change: transform;
+        pointer-events: none;
+        transition: all 0.2s ease;
+        opacity: 0;
+        background: ${cssManager.bdTheme('#ffffff', '#222222')};
+        max-width: 420px;
+        box-shadow: 0px 0px 5px rgba(0, 0, 0, 0.2);
+        min-height: 40px;
+        border-radius: 8px;
+        padding: 4px 8px;
+        position: absolute;
+        user-select: none;
+      }
+      .selectionBox.top {
+        transform: translate(0px, 4px);
+      }
+      .selectionBox.bottom {
+        transform: translate(0px, -4px);
+      }
+
+      .selectionBox.show {
+        pointer-events: all;
+        transform: scale(1, 1) translate(0px, 0px);
+        opacity: 1;
+        box-shadow: 0px 0px 8px rgba(0, 0, 0, 0.8);
+      }
+
+      .option {
+        transition: all 0.1s;
+        line-height: 32px;
+        padding: 0px 4px;
+        border-radius: 3px;
+        margin: 4px 0px;
+      }
+
+      .option.highlighted {
+        border-left: 2px solid #0069f2;
+        padding-left: 6px;
+        background: #ffffff20;
+      }
+
+      .option:hover {
+        color: #fff;
+        padding-left: 8px;
+        background: #0069f2;
+      }
+
+      .search.top {
+        padding-top: 4px;
+      }
+      .search.bottom {
+        padding-bottom: 4px;
+      }
+      .search input {
+        display: block;
+        background: none;
+        border: none;
+        height: 24px;
+        color: inherit;
+        text-align: left;
+        font-size: 12px;
+        font-weight: 600;
+        width: 100%;
+        margin: auto;
+      }
+
+      .search.top input {
+        border-bottom: 1px dotted #333;
+      }
+      .search.bottom input {
+        border-top: 1px dotted #333;
+      }
+
+      .search input:focus {
+        outline: none;
+      }
+    `,
+  ];
 
   public render(): TemplateResult {
     return html`
-      ${domtools.elementBasic.styles}
-      <style>
-        * {
-          box-sizing: border-box;
-        }
-
-        :host {
-          position: relative;
-          display: block;
-          height: 40px;
-        }
-
-        .maincontainer {
-          display: block;
-        }
-
-        .label {
-          font-size: 14px;
-          margin-bottom: 15px;
-        }
-
-        .selectedBox {
-          cursor: pointer;
-          position: relative;
-          max-width: 420px;
-          height: 40px;
-          border: 1px solid #CCC;
-          padding: 12px;
-          z-index: 0px;
-        }
-
-        .selectionBox {
-          pointer-events: none;
-          cursor: pointer;
-          transition: all 0.2s ease;
-          opacity: 0;
-          position: relative;
-          background: #ffffff;
-          max-width: 420px;
-          box-shadow: 0px 0px 5px  rgba(0,0,0,0.2);
-          height: 40px;
-          margin-top: -40px;
-          z-index: 100;
-        }
-
-        .selectionBox.show {
-          pointer-events: all;
-          opacity: 1;
-          min-height: 160px;
-        }
-
-        .option {
-          padding: 12px;
-        }
-
-        .option:hover {
-          background: #fafafa;
-        }
-      </style>
-      <div class="maincontainer">
-        <div class="selectedBox" @click="${event => {this.toggleSelectionBox();}}">
-          ${this.selectedOption?.option}
-        </div>
+      <div class="maincontainer" @keydown="${this.isOpened ? this.handleKeyDown : undefined}">
+        ${this.label ? html`<div class="label">${this.label}</div>` : html``}
         <div class="selectionBox">
-          ${this.options.map(option => {
+          ${this.enableSearch && !this.opensToTop
+            ? html`
+                <div class="search top">
+                  <input type="text" placeholder="Search" @input="${this.handleSearch}" />
+                </div>
+              `
+            : null}
+          ${this.filteredOptions.map((option, index) => {
+            const isHighlighted = this.highlightedIndex === index;
             return html`
-              <div class="option" @click=${() => {this.updateSelection(option);}}>${option.option}</div>
-            `
+              <div
+                class="option ${isHighlighted ? 'highlighted' : ''}"
+                @click=${() => {
+                  this.updateSelection(option);
+                }}
+              >
+                ${option.option}
+              </div>
+            `;
           })}
+          ${this.enableSearch && this.opensToTop
+            ? html`
+                <div class="search bottom">
+                  <input type="text" placeholder="Search" @input="${this.handleSearch}" />
+                </div>
+              `
+            : null}
+        </div>
+        <div
+          class="selectedBox"
+          @click="${(event) => {
+            if (!this.isElevated) {
+              this.toggleSelectionBox();
+            } else {
+              this.updateSelection(this.selectedOption);
+            }
+          }}"
+        >
+          ${this.selectedOption?.option || 'Select...'} 
         </div>
       </div>
     `;
   }
 
   firstUpdated() {
-    this.selectedOption = this.options[0] || null;
+    this.selectedOption = this.selectedOption || null;
+    this.filteredOptions = this.options; // Initialize filteredOptions
   }
 
   public async updateSelection(selectedOption) {
     this.selectedOption = selectedOption;
 
-    this.dispatchEvent(new CustomEvent('selectedOption', {
-      detail: selectedOption,
-      bubbles: true
-    }));
-    this.toggleSelectionBox();
+    this.dispatchEvent(
+      new CustomEvent('selectedOption', {
+        detail: selectedOption,
+        bubbles: true,
+      })
+    );
+    if (this.isElevated) {
+      this.toggleSelectionBox();
+    }
+    this.changeSubject.next(this);
   }
 
-  public toggleSelectionBox() {
-    this.shadowRoot.querySelector('.selectionBox').classList.toggle('show');
+  private isElevated: boolean = false;
+  private windowOverlay: DeesWindowLayer;
+  public async toggleSelectionBox() {
+    this.isOpened = !this.isOpened;
+    const domtoolsInstance = await this.domtoolsPromise;
+    const selectedBox: HTMLElement = this.shadowRoot.querySelector('.selectedBox');
+    const selectionBox: HTMLElement = this.shadowRoot.querySelector('.selectionBox');
+    if (!this.isElevated) {
+      this.windowOverlay = await DeesWindowLayer.createAndShow({
+        blur: false,
+      });
+      const elevatedDropdown = new DeesInputDropdown();
+      elevatedDropdown.isElevated = true;
+      elevatedDropdown.label = this.label;
+      elevatedDropdown.enableSearch = this.enableSearch;
+      elevatedDropdown.required = this.required;
+      elevatedDropdown.disabled = this.disabled;
+      elevatedDropdown.style.position = 'fixed';
+      elevatedDropdown.style.top = this.getBoundingClientRect().top + 'px';
+      elevatedDropdown.style.left = this.getBoundingClientRect().left + 'px';
+      elevatedDropdown.style.width = this.clientWidth + 'px';
+      elevatedDropdown.options = this.options;
+      elevatedDropdown.selectedOption = this.selectedOption;
+      elevatedDropdown.highlightedIndex = elevatedDropdown.selectedOption ? elevatedDropdown.options.indexOf(
+        elevatedDropdown.options.find((option) => option.key === this.selectedOption.key)
+      ) : -1;
+      console.log(elevatedDropdown.options);
+      console.log(elevatedDropdown.selectedOption);
+      console.log(elevatedDropdown.highlightedIndex);
+      this.windowOverlay.appendChild(elevatedDropdown);
+      await domtoolsInstance.convenience.smartdelay.delayFor(0);
+      elevatedDropdown.toggleSelectionBox();
+      const destroyOverlay = async () => {
+        (elevatedDropdown.shadowRoot.querySelector('.selectionBox') as HTMLElement).style.opacity =
+          '0';
+        elevatedDropdown.removeEventListener('selectedOption', handleSelection);
+        this.windowOverlay.removeEventListener('clicked', destroyOverlay);
+        this.windowOverlay.destroy();
+      };
+      const handleSelection = async (event) => {
+        await this.updateSelection(elevatedDropdown.selectedOption);
+        destroyOverlay();
+      };
+      elevatedDropdown.addEventListener('selectedOption', handleSelection);
+      this.windowOverlay.addEventListener('clicked', destroyOverlay);
+    } else {
+      if (!selectionBox.classList.contains('show')) {
+        selectionBox.style.width = selectedBox.clientWidth + 'px';
+        const spaceData = selectedBox.getBoundingClientRect();
+        if (300 > window.innerHeight - spaceData.bottom) {
+          this.opensToTop = true;
+          selectedBox.classList.add('accentTop');
+          selectionBox.classList.add('top');
+          selectionBox.style.bottom = selectedBox.clientHeight + 2 + 'px';
+        } else {
+          selectedBox.classList.add('accentBottom');
+          selectionBox.classList.add('bottom');
+          this.opensToTop = false;
+          const labelOffset = this.label ? 24 : 0;
+          selectionBox.style.top = selectedBox.clientHeight + labelOffset + 'px';
+        }
+        await domtoolsInstance.convenience.smartdelay.delayFor(0);
+        const searchInput = selectionBox.querySelector('input');
+        searchInput?.focus();
+        selectionBox.classList.add('show');
+      } else {
+        selectedBox.style.pointerEvents = 'none';
+        selectionBox.classList.remove('show');
+        // selectedBox.style.opacity = '0';
+      }
+    }
+  }
+
+  private handleSearch(event: Event): void {
+    const searchTerm = (event.target as HTMLInputElement).value.toLowerCase();
+    this.filteredOptions = this.options.filter((option) =>
+      option.option.toLowerCase().includes(searchTerm)
+    );
+    this.highlightedIndex = 0; // Reset highlighted index
+  }
+
+  private handleKeyDown(event: KeyboardEvent): void {
+    if (!this.isOpened) {
+      console.log('discarded key event. Check why this function is called.');
+      return;
+    }
+    const key = event.key;
+    const maxIndex = this.filteredOptions.length - 1;
+
+    if (key === 'ArrowDown') {
+      this.highlightedIndex = this.highlightedIndex + 1 > maxIndex ? 0 : this.highlightedIndex + 1;
+      event.preventDefault();
+    } else if (key === 'ArrowUp') {
+      this.highlightedIndex = this.highlightedIndex - 1 < 0 ? maxIndex : this.highlightedIndex - 1;
+      event.preventDefault();
+    } else if (key === 'Enter') {
+      this.updateSelection(this.filteredOptions[this.highlightedIndex]);
+      event.preventDefault();
+    }
   }
 }

ts_web/elements/dees-input-fileupload.ts

@@ -0,0 +1,211 @@
+import {
+  customElement,
+  DeesElement,
+  type TemplateResult,
+  property,
+  html,
+  css,
+  unsafeCSS,
+  cssManager,
+  type CSSResult,
+  domtools,
+} from '@design.estate/dees-element';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-input-fileupload': DeesInputFileupload;
+  }
+}
+
+@customElement('dees-input-fileupload')
+export class DeesInputFileupload extends DeesElement {
+  public static demo = () => html`<dees-input-fileupload .label=${'Attachments'}></dees-input-fileupload>`;
+
+  // INSTANCE
+  public changeSubject = new domtools.plugins.smartrx.rxjs.Subject();
+
+  @property({
+    type: String,
+  })
+  public label: string = null;
+
+  @property({
+    type: String,
+    reflect: true,
+  })
+  public key: string;
+
+  @property({
+    attribute: false,
+  })
+  public value: File[] = [];
+
+  @property()
+  public state: 'idle' | 'dragOver' | 'dropped' | 'uploading' | 'completed' = 'idle';
+
+  @property({
+    type: Boolean,
+  })
+  public required: boolean = false;
+
+  @property({
+    type: Boolean,
+  })
+  public disabled: boolean = false;
+
+  @property({
+    type: String,
+  })
+  public buttonText: string = 'Upload File...';
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        position: relative;
+        display: grid;
+        margin: 10px 0px;
+        margin-bottom: 24px;
+      }
+
+      .hidden {
+        display: none;
+      }
+
+      .maincontainer {
+        color: ${cssManager.bdTheme('#333', '#ccc')};
+        
+      }
+
+      .label {
+        font-size: 14px;
+        margin-bottom: 5px;
+      }
+
+      .uploadButton {
+        position: relative;
+        padding: 8px;
+        max-width: 600px;
+        background: ${cssManager.bdTheme('#fafafa', '#333333')};
+        border-radius: 3px;
+        text-align: center;
+      }
+
+      .uploadButton:hover {
+        color: #fff;
+        background: rgb(3, 155, 229);
+      }
+
+      .uploadButton::after {
+        top: 2px;
+        right: 2px;
+        left: 2px;
+        bottom: 2px;
+        transform: scale3d(0.98, 0.9, 1);
+        position: absolute;
+        content: '';
+        display: block;
+        border: 2px dashed rgba(255, 255, 255, 0);
+        transition: all 0.2s;
+      }
+      .uploadButton.dragOver::after {
+        transform: scale3d(1, 1, 1);
+        border: 2px dashed rgba(255, 255, 255, 0.3);
+      }
+
+      .uploadCandidate {
+        text-align: left;
+        border-bottom: 1px dashed #444;
+        color: ${cssManager.bdTheme('#666', '#ccc')};
+        padding: 8px;
+        font-family: 'Roboto', 'Inter', sans-serif;
+      }
+
+      .uploadButton:hover .uploadCandidate {
+        color: ${cssManager.bdTheme('#fff', '#fff')};
+        border-bottom: 1px dashed #fff;
+      }
+
+      .uploadCandidate:last-child {
+        margin-bottom: 8px;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="hidden">
+        <input type="file"></div>
+      </div>
+      <div class="maincontainer">
+        ${this.label ? html`<div class="label">${this.label}</div>` : null}
+        ${this.value.map((fileArg) => html` <div class="uploadCandidate">${fileArg.name} | ${fileArg.size}</div> `)}
+        <div class="uploadButton ${this.state === 'dragOver' ? 'dragOver' : ''}" @click=${this.openFileSelector}>
+          ${this.buttonText}
+        </div>
+      </div>
+    `;
+  }
+
+  public async openFileSelector() {
+    const inputFile: HTMLInputElement = this.shadowRoot.querySelector('input[type="file"]');
+    inputFile.click();
+    this.state = 'idle';
+    this.buttonText = 'Upload more files...';
+  }
+  
+
+  public async updateValue(eventArg: Event) {
+    const target: any = eventArg.target;
+    this.value = target.value;
+    this.changeSubject.next(this);
+  }
+
+  public firstUpdated() {
+    const inputFile: HTMLInputElement = this.shadowRoot.querySelector('input[type="file"]');
+    inputFile.addEventListener('change', (event: Event) => {
+      const target = event.target as HTMLInputElement;
+      for (const file of Array.from(target.files)) {
+        this.value.push(file);
+      }
+      this.requestUpdate();
+      console.log(`Got ${this.value.length} files!`);
+      // Reset the input value to allow selecting the same file again if needed
+      target.value = '';
+    });
+
+
+    // lets handle drag and drop
+    const dropArea = this.shadowRoot.querySelector('.uploadButton');
+    const handlerFunction = (eventArg: DragEvent) => {
+      eventArg.preventDefault();
+      switch (eventArg.type) {
+        case 'dragover':
+          this.state = 'dragOver';
+          this.buttonText = 'release to upload file...';
+          break;
+        case 'dragleave':
+          this.state = 'idle';
+          this.buttonText = 'Upload File...';
+          break;
+        case 'drop':
+          this.state = 'idle';
+          this.buttonText = 'Upload more files...';
+      }
+      console.log(eventArg);
+      for (const file of Array.from(eventArg.dataTransfer.files)) {
+        this.value.push(file);
+        this.requestUpdate();
+      }
+      console.log(`Got ${this.value.length} files!`);
+    };
+    dropArea.addEventListener('dragenter', handlerFunction, false);
+    dropArea.addEventListener('dragleave', handlerFunction, false);
+    dropArea.addEventListener('dragover', handlerFunction, false);
+    dropArea.addEventListener('drop', handlerFunction, false);
+  }
+}

ts_web/elements/dees-input-iban.demo.ts

@@ -0,0 +1,3 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`<dees-input-iban .label=${'IBAN'}></dees-input-iban>`;

ts_web/elements/dees-input-iban.ts

@@ -0,0 +1,98 @@
+import {
+  customElement,
+  DeesElement,
+  type TemplateResult,
+  state,
+  html,
+  domtools,
+  property,
+} from '@design.estate/dees-element';
+
+import * as ibantools from 'ibantools';
+import { demoFunc } from './dees-input-iban.demo.js';
+
+@customElement('dees-input-iban')
+export class DeesInputIban extends DeesElement {
+  // STATIC
+  public static demo = demoFunc;
+
+  // INSTANCE
+  @state()
+  enteredString: string = '';
+
+  @state()
+  enteredIbanIsValid: boolean = false;
+
+  @property({
+    type: Boolean,
+  })
+  public disabled = false;
+
+  @property({
+    type: Boolean,
+  })
+  public required = false;
+
+  @property({
+    type: String,
+  })
+  public label = '';
+
+  @property({
+    type: String,
+  })
+  public key = '';
+
+  @property({
+    type: String,
+  })
+  public value = '';
+
+  public changeSubject = new domtools.plugins.smartrx.rxjs.Subject<DeesInputIban>();
+
+  public render(): TemplateResult {
+    return html`
+      <style>
+        input[type='text'] {
+          line-height: 20px;
+          padding: 5px;
+          width: 250px;
+        }
+      </style>
+      <dees-input-text
+        .label=${'IBAN'}
+        .value=${this.value}
+        @input=${(eventArg: InputEvent) => {
+          this.validateIban(eventArg);
+        }}
+      ></dees-input-text>
+    `;
+  }
+
+  public async firstUpdated() {
+    const deesInputText = this.shadowRoot.querySelector('dees-input-text');
+    deesInputText.disabled = this.disabled;
+    deesInputText.required = this.required;
+    deesInputText.changeSubject.subscribe(valueArg => {
+      this.value = valueArg.value;
+      this.changeSubject.next(this);
+    })
+  }
+
+  public async validateIban(eventArg: InputEvent): Promise<void> {
+    const inputElement: HTMLInputElement = eventArg.target as HTMLInputElement;
+    let enteredString = inputElement?.value;
+    enteredString = enteredString || '';
+    if (this.enteredString !== enteredString) {
+      this.enteredString = ibantools.friendlyFormatIBAN(enteredString) || '';
+      if (inputElement) {
+        inputElement.value = this.enteredString;
+        this.value = this.enteredString;
+        this.changeSubject.next(this);
+      }
+    }
+    this.enteredIbanIsValid = ibantools.isValidIBAN(this.enteredString.replace(/ /g, ''));
+    const deesInputText = this.shadowRoot.querySelector('dees-input-text');
+    deesInputText.validationText = `IBAN is valid: ${this.enteredIbanIsValid}`;
+  }
+}

ts_web/elements/dees-input-multitoggle.demo.ts

@@ -0,0 +1,14 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+  <dees-input-multitoggle
+    .options=${['option 1', 'option 2', 'a longer option with multiple words']}
+    .selectedOption=${'option 2'}
+  ></dees-input-multitoggle>
+  <dees-input-multitoggle
+    .type=${'boolean'}
+    .booleanTrueName=${'enabled'}
+    .booleanFalseName=${'disabled'}
+    .selectedOption=${'true'}
+  ></dees-input-multitoggle>
+`;

ts_web/elements/dees-input-multitoggle.ts

@@ -0,0 +1,121 @@
+import {
+  customElement,
+  DeesElement,
+  type TemplateResult,
+  state,
+  html,
+  domtools,
+  property,
+  css,
+  cssManager,
+} from '@design.estate/dees-element';
+
+const { demoFunc } = await import('./dees-input-multitoggle.demo.js');
+
+@customElement('dees-input-multitoggle')
+export class DeesInputMultitoggle extends DeesElement {
+  public static demo = demoFunc;
+
+  @property()
+  type: 'boolean' | 'multi' | 'single' = 'multi';
+
+  @property()
+  booleanTrueName: string = 'true';
+
+  @property()
+  booleanFalseName: string = 'false';
+
+  @property({
+    type: Array,
+  })
+  options: string[] = [];
+
+  @property()
+  selectedOption: string = '';
+
+  @property()
+  boolValue: boolean = false;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        user-select: none;
+      }
+      .selections {
+        position: relative;
+        display: flex;
+        flex-direction: row;
+        flex-wrap: nowrap;
+        background: #333;
+        width: min-content;
+        border-radius: 20px;
+        height: 40px;
+      }
+
+      .option {
+        color: #CCC;
+        position: relative;
+        padding: 0px 16px;
+        line-height: 40px;
+        cursor: default;
+        width: min-content; /* Make the width as per the content */
+        white-space: nowrap; /* Prevent text wrapping */
+        transition: all 0.1s;
+      }
+
+      .option:hover {
+        color: #fff;
+      }
+
+      .indicator {
+        opacity: 0;
+        position: absolute;
+        height: 32px;
+        left: 4px;
+        top: 4px;
+        border-radius: 16px;
+        background: #0050b9;
+        min-width: 36px;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="label">MultiSelect</div>
+      <div class="mainbox">
+        <div class="selections">
+          <div class="indicator"></div>
+          ${this.options.map((option) => html` <div class="option" @click=${() => this.handleSelection(option)}>${option}</div> `)}
+        </div>
+      </div>
+    `;
+  }
+
+  public async firstUpdated() {
+    if (this.type === 'boolean') {
+      this.options = [this.booleanTrueName || 'true', this.booleanFalseName || 'false'];
+    }
+    this.setIndicator();
+  }
+
+  public async handleSelection(optionArg: string) {
+    this.selectedOption = optionArg;
+    this.setIndicator();
+  }
+
+  public async setIndicator() {
+    const indicator: HTMLDivElement = this.shadowRoot.querySelector('.indicator');
+    const option: HTMLDivElement = this.shadowRoot.querySelector(`.option:nth-child(${this.options.indexOf(this.selectedOption) + 2})`);
+    if (indicator && option) {
+      indicator.style.width = `${option.clientWidth - 8}px`;
+      indicator.style.left = `${option.offsetLeft + 4}px`;
+      indicator.style.opacity = '1';
+    }
+    setTimeout(() => {
+      indicator.style.transition = 'all 0.1s';
+    }, 100);
+  }
+}

ts_web/elements/dees-input-phone.demo.ts

@@ -0,0 +1,3 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`<dees-input-phone .label=${'Phone Number'}></dees-input-phone>`;

ts_web/elements/dees-input-phone.ts

@@ -0,0 +1,29 @@
+import {
+  customElement,
+  DeesElement,
+  type TemplateResult,
+  property,
+  html,
+  css,
+  unsafeCSS,
+  cssManager,
+  type CSSResult,
+} from '@design.estate/dees-element';
+import { demoFunc } from './dees-input-phone.demo.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-input-phone': DeesInputPhone;
+  }
+}
+
+@customElement('dees-input-phone')
+export class DeesInputPhone extends DeesElement {
+  // STATIC
+  public static demo = demoFunc;
+
+  // INSTANCE
+  public render() {
+    return html`<div>Phone Input</div>`;
+  }
+}

ts_web/elements/dees-input-quantityselector.ts

@@ -1,11 +1,26 @@
-import { customElement, property, html, TemplateResult, LitElement } from 'lit-element';
-import * as domtools from '@designestate/dees-domtools';
+import { customElement, property, html, type TemplateResult, DeesElement, type CSSResult, } from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-input-quantityselector': DeesInputQuantitySelector;
+  }
+}
 
 @customElement('dees-input-quantityselector')
-export class DeesInputQuantitySelector extends LitElement {
+export class DeesInputQuantitySelector extends DeesElement {
   public static demo = () => html`<dees-input-quantityselector></dees-input-quantityselector>`;
 
+  // INSTANCE
+  public changeSubject = new domtools.plugins.smartrx.rxjs.Subject();
+
   @property()
+  public label: string = 'Label';
+
+  @property({
+    type: String,
+    reflect: true,
+  })
   public key: string;
 
   @property({
@@ -13,6 +28,20 @@ export class DeesInputQuantitySelector extends LitElement {
   })
   public value: number = 1;
 
+  @property({
+    type: Boolean,
+  })
+  public required: boolean = false;
+
+  @property({
+    type: Boolean
+  })
+  public disabled: boolean = false;
+
+  constructor() {
+    super();
+  }
+
   public render(): TemplateResult {
     return html`
       ${domtools.elementBasic.styles}
@@ -32,8 +61,14 @@ export class DeesInputQuantitySelector extends LitElement {
           line-height: 40px;
           padding: 0px;
           min-width: 100px;
-          color: #CCC;
-          border: 1px solid #CCC;
+          color: ${this.goBright ? '#666' : '#CCC'};
+          border: ${this.goBright ? '1px solid #333' : '1px solid #CCC'};
+          border-radius: 4px;
+        }
+
+        .mainContainer:hover {
+          color: ${this.goBright ? '#333' : '#fff'};
+          border: ${this.goBright ? '1px solid #333' : '1px solid #fff'};
         }
 
         .minus {
@@ -50,17 +85,13 @@ export class DeesInputQuantitySelector extends LitElement {
         }
 
         .selector:hover {
-          cursor: pointer;
         }
 
         .quantity {
           text-align: center;
         }
 
-        .mainContainer:hover {
-          color: #fff;
-          border: 1px solid #fff;
-        }
+        
       </style>
 
       <div class="maincontainer">
@@ -73,6 +104,7 @@ export class DeesInputQuantitySelector extends LitElement {
 
   public increase () {
     this.value++;
+    this.changeSubject.next(this);
   }
 
   public decrease () {
@@ -81,5 +113,6 @@ export class DeesInputQuantitySelector extends LitElement {
     } else {
       // nothing to do here
     }
+    this.changeSubject.next(this);
   }
 }

ts_web/elements/dees-input-radio.ts

@@ -1,10 +1,23 @@
-import {customElement, LitElement, TemplateResult, property, html} from 'lit-element';
+import {customElement, DeesElement, type TemplateResult, property, html, type CSSResult,} from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-input-radio': DeesInputRadio;
+  }
+}
 
 @customElement('dees-input-radio')
-export class DeesInputRadio extends LitElement {
+export class DeesInputRadio extends DeesElement {
   public static demo = () => html`<dees-input-radio></dees-input-radio>`;
 
-  @property()
+  // INSTANCE
+  public changeSubject = new domtools.plugins.smartrx.rxjs.Subject();
+
+  @property({
+    type: String,
+    reflect: true,
+  })
   public key: string;
 
   @property()
@@ -13,6 +26,20 @@ export class DeesInputRadio extends LitElement {
   @property()
   public value: boolean = false;
 
+  @property({
+    type: Boolean,
+  })
+  public required: boolean = false;
+
+  @property({
+    type: Boolean
+  })
+  public disabled: boolean = false;
+
+  constructor() {
+    super();
+  }
+
   public render(): TemplateResult {
     return html `
       <style>
@@ -24,7 +51,6 @@ export class DeesInputRadio extends LitElement {
           display: block;
           position: relative;
           margin: 20px 0px;
-          cursor: pointer;
         }
 
         .maincontainer {
@@ -64,8 +90,8 @@ export class DeesInputRadio extends LitElement {
         }
 
         .checkbox.selected {
-          background: #039BE5;
-          border: 1px solid #039BE5;
+          background: #0050b9;
+          border: 1px solid #0050b9;
         }
 
         .maincontainer:hover .checkbox.selected {
@@ -96,5 +122,6 @@ export class DeesInputRadio extends LitElement {
       detail: this.value,
       bubbles: true
     }));
+    this.changeSubject.next(this);
   }
 }

ts_web/elements/dees-input-text.ts

@@ -1,73 +1,252 @@
-import {customElement, LitElement, TemplateResult, property, html} from 'lit-element';
+import {
+  customElement,
+  DeesElement,
+  type TemplateResult,
+  property,
+  html,
+  cssManager,
+  css,
+  type CSSResult,
+} from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-input-text': DeesInputText;
+  }
+}
 
 @customElement('dees-input-text')
-export class DeesInputText extends LitElement {
-  public static demo = () => html`<dees-input-text></dees-input-text>`;
+export class DeesInputText extends DeesElement {
+  public static demo = () => html`
+    <dees-input-text .label=${'this is a label'} .value=${'test'}></dees-input-text>
+    <dees-input-text .isPasswordBool=${true}></dees-input-text>
+  `;
 
-  @property()
-  public label: string = 'Label';
+  // INSTANCE
+  public changeSubject = new domtools.plugins.smartrx.rxjs.Subject<DeesInputText>();
 
-  @property()
+  @property({
+    type: String,
+  })
+  public label: string;
+
+  @property({
+    type: String,
+    reflect: true,
+  })
   public key: string;
 
-  @property()
-  public value: string;
+  @property({
+    type: String,
+    reflect: true,
+  })
+  public value: string = '';
+
+  @property({
+    type: Boolean,
+  })
+  public required: boolean = false;
+
+  @property({
+    type: Boolean,
+  })
+  public disabled: boolean = false;
+
+  @property({
+    type: Boolean,
+    reflect: true,
+  })
+  public isPasswordBool = false;
+
+  @property({
+    type: Boolean,
+    reflect: true,
+  })
+  public showPasswordBool = false;
+
+  @property({
+    type: Boolean,
+    reflect: true,
+  })
+  public validationState: 'valid' | 'warn' | 'invalid';
+
+  @property({
+    reflect: true,
+  })
+  public validationText: string = '';
+
+  @property({})
+  validationFunction: (value: string) => boolean;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      * {
+        box-sizing: border-box;
+      }
+
+      :host {
+        position: relative;
+        display: grid;
+        margin: 8px 0px;
+        margin-bottom: 24px;
+        z-index: auto;
+      }
+
+      .maincontainer {
+        color: ${cssManager.bdTheme('#333', '#ccc')};
+      }
+
+      .label {
+        font-size: 14px;
+        margin-bottom: 4px;
+      }
+
+      input {
+        margin-top: 5px;
+        background: ${cssManager.bdTheme('#fafafa', '#222')};
+        border-top: ${cssManager.bdTheme('1px solid #CCC', '1px solid #444')};
+        border-bottom: ${cssManager.bdTheme('1px solid #CCC', '1px solid #333')};
+        border-right: ${cssManager.bdTheme('1px solid #CCC', 'none')};
+        border-left: ${cssManager.bdTheme('1px solid #CCC', 'none')};
+        padding-left: 10px;
+        padding-right: 10px;
+        border-radius: 2px;
+        width: 100%;
+        line-height: 36px;
+        transition: all 0.2s;
+        outline: none;
+        font-size: 16px;
+        position: relative;
+        z-index: 2;
+        cursor: default;
+      }
+
+      input:disabled {
+        background: ${cssManager.bdTheme('#ffffff00', '#11111100')};
+        border: 1px dashed ${cssManager.bdTheme('#666666', '#666666')};
+        color: #9b9b9e;
+        cursor: default;
+      }
+
+      input:focus {
+        outline: none;
+        border-bottom: 1px solid #e4002b;
+        cursor: text;
+      }
+
+      input:hover {
+        filter: ${cssManager.bdTheme('brightness(0.95)', 'brightness(1.1)')};
+      }
+
+      .showPassword {
+        position: absolute;
+        bottom: 7px;
+        right: 10px;
+        border: 1px dashed #444;
+        border-radius: 7px;
+        padding: 4px 0px;
+        width: 40px;
+        z-index: 3;
+      }
+
+      .showPassword:hover {
+        background: ${cssManager.bdTheme('#00000010', '#ffffff10')};
+      }
+
+      .validationContainer {
+        text-align: center;
+        padding: 6px 2px 2px 2px;
+        margin-top: -4px;
+        font-size: 12px;
+        color: #fff;
+        background: #e4002b;
+        position: relative;
+        z-index: 1;
+        border-radius: 3px;
+        transition: all 0.2s;
+      }
+    `,
+  ];
 
   public render(): TemplateResult {
-    return html `
+    return html`
       <style>
-        * {
-          box-sizing: border-box;
-        }
-
-        :host {
-          position: relative;
-          display: grid;
-          margin: 10px 0px;
-          margin-bottom: 24px;
-        }
-
-        .maincontainer {
-          color: #ccc;
-        }
-
-        .label {
-          font-size: 14px;
-          margin-bottom: 5px;
-        }
-
         input {
-          margin-top: 5px;
-          background: #222;
-          border: none;
-          border-top: 1px solid #444;
-          border-bottom: 1px solid #333;
-          padding-left:10px;
-          padding-right: 10px;
-          border-radius: 2px;
-          width: 100%;
-          line-height: 48px;
-          transition: all 0.2s;
-          outline: none;
-          color: #ccc;
-          font-size: 16px;
-        }
-
-        input:focus {
-          outline: none;
-          border-bottom: 1px solid #e4002b;
+          font-family: ${this.isPasswordBool ? 'monospace' : 'Roboto'};
+          letter-spacing: ${this.isPasswordBool ? '1px' : 'normal'};
+          color: ${this.goBright ? '#333' : '#ccc'};
         }
+        ${this.validationText ? css`
+          .validationContainer {
+            height: 22px;
+            opacity: 1;
+          }
+        ` : css`
+          .validationContainer {
+            height: 4px;
+            padding: 2px !important;
+            opacity: 0;
+          }
+        `}
       </style>
       <div class="maincontainer">
-        <div class="label">${this.label}</div>
-        <input type="text" @input="${this.updateValue}" />
+        ${this.label ? html`<div class="label">${this.label}</div>` : html``}
+        <input
+          type="${this.isPasswordBool && !this.showPasswordBool ? 'password' : 'text'}"
+          .value=${this.value}
+          @input="${this.updateValue}"
+          .disabled=${this.disabled}
+        />
+        <div class="validationContainer">
+          ${this.validationText}
+        </div>
+        ${this.isPasswordBool
+          ? html`
+              <div class="showPassword" @click=${this.togglePasswordView}>
+                <dees-icon .iconFA=${this.showPasswordBool ? 'eye' : 'eyeSlash'}></dees-icon>
+              </div>
+            `
+          : html``}
       </div>
     `;
   }
 
+  firstUpdated() {
+    const input = this.shadowRoot.querySelector('input');
+    input.addEventListener('input', (eventArg: InputEvent) => {
+      
+    });
+  }
+
   public async updateValue(eventArg: Event) {
     const target: any = eventArg.target;
     this.value = target.value;
+    this.changeSubject.next(this);
+  }
 
+  public async freeze() {
+    this.disabled = true;
+  }
+
+  public async unfreeze() {
+    this.disabled = false;
+  }
+
+  public async togglePasswordView() {
+    const domtools = await this.domtoolsPromise;
+    this.showPasswordBool = !this.showPasswordBool;
+    console.log(`this.showPasswordBool is: ${this.showPasswordBool}`);
+  }
+
+  public async focus() {
+    const textInput = this.shadowRoot.querySelector('input');
+    textInput.focus();
+  }
+
+  public async blur() {
+    const textInput = this.shadowRoot.querySelector('input');
+    textInput.blur();
   }
 }

ts_web/elements/dees-input-typelist.demo.ts

@@ -0,0 +1,15 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+  <style>
+    .demoContainer {
+      max-width: 600px;
+      margin: auto;
+      padding: 40px;
+      background: #000;
+    }
+  </style>
+  <div class="demoContainer">
+    <dees-input-typelist></dees-input-typelist>
+  </div>
+`;

ts_web/elements/dees-input-typelist.ts

@@ -0,0 +1,88 @@
+import {
+  customElement,
+  DeesElement,
+  type TemplateResult,
+  state,
+  html,
+  domtools,
+  property,
+  css,
+  cssManager,
+} from '@design.estate/dees-element';
+
+const { demoFunc } = await import('./dees-input-typelist.demo.js');
+
+@customElement('dees-input-typelist')
+export class DeesInputTypelist extends DeesElement {
+  public static demo = demoFunc;
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        color: ${cssManager.bdTheme('#333', '#fff')}
+      }
+      .label {
+        font-size: 14px;
+        margin-bottom: 4px;
+      }
+      .mainbox {
+        border-radius: 3px;
+        background: #222;
+        overflow: hidden;
+        border-top: ${cssManager.bdTheme('1px solid #CCC', '1px solid #444')};
+        border-bottom: ${cssManager.bdTheme('1px solid #CCC', '1px solid #333')};
+        border-right: ${cssManager.bdTheme('1px solid #CCC', 'none')};
+        border-left: ${cssManager.bdTheme('1px solid #CCC', 'none')};
+      }
+
+      .tags {
+        padding: 16px;
+        cursor: default;
+      }
+
+      .notags {
+        text-align: center;
+        opacity: 0.5;
+        font-size: 12px;
+      }
+
+      input {
+        display: block;
+        box-sizing: border-box;
+        background: #181818;
+        width: 100%;
+        outline: none;
+        border: none;
+        color: inherit;
+        padding: 0px 16px;
+        overflow: hidden;
+        line-height: 32px;
+        height: 0px;
+        transition: height 0.2s;
+      }
+
+      input:focus {
+        height: 32px;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="label">Type List</div>
+      <div class="mainbox">
+        <div class="tags" @click=${() => {
+          this.shadowRoot.querySelector('input').focus();
+        }}>
+          <div class="notags">No tags yet</div>
+        </div>
+        <input type="text" placeholder="Type, press Enter to add it..." />
+      </div>
+    `;
+  }
+}

ts_web/elements/dees-mobilenavigation.ts

@@ -0,0 +1,184 @@
+import * as plugins from './00plugins.js';
+import {
+  cssManager,
+  css,
+  type CSSResult,
+  customElement,
+  DeesElement,
+  domtools,
+  html,
+  property,
+} from '@design.estate/dees-element';
+import { DeesWindowLayer } from './dees-windowlayer.js';
+
+@customElement('dees-mobilenavigation')
+export class DeesMobilenavigation extends DeesElement {
+  // STATIC
+  public static demo = () => html`
+    <dees-button @click=${() => {
+      DeesMobilenavigation.createAndShow([
+        {
+          name: 'Test',
+          action: async (deesMobileNav) => {
+            alert('test');
+            return null;
+          },
+        },
+      ]);
+    }}></dees-button>
+  `;
+
+  private static singletonRef: DeesMobilenavigation;
+  public static async createAndShow(menuItemsArg: plugins.tsclass.website.IMenuItem<DeesMobilenavigation>[]) {
+    if (!this.singletonRef) {
+      this.singletonRef = new DeesMobilenavigation();
+      document.body.append(this.singletonRef);
+      await this.singletonRef.init();
+    }
+    this.singletonRef.menuItems = menuItemsArg;
+    await this.singletonRef.readyDeferred.promise;
+    this.singletonRef.show();
+    return this.singletonRef;
+  }
+
+  // INSTANCE
+  @property({
+    type: Array,
+  })
+  public heading: string = `MENU`;
+
+  @property({
+    type: Array,
+  })
+  public menuItems: plugins.tsclass.website.IMenuItem[] = [];
+
+  readyDeferred: plugins.smartpromise.Deferred<any> = domtools.plugins.smartpromise.defer();
+
+  constructor() {
+    super();
+    /* this.init().then(() => {
+      this.show();
+    }); */
+  }
+
+  /**
+   * inits the mobile navigation
+   */
+  public async init() {
+    await this.updateComplete;
+    this.readyDeferred.resolve();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+      }
+
+      .main {
+        transition: all 0.3s cubic-bezier(0.22, 1, 0.36, 1);
+        will-change: transform;
+        position: fixed;
+        height: 100vh;
+        min-width: 280px;
+        transform: translateX(200px);
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        z-index: 250;
+        opacity: 0;
+        padding: 16px 32px;
+        right: 0px;
+        top: 0px;
+        bottom: 0px;
+        background: ${cssManager.bdTheme('#eeeeeb', '#000')};
+        border-left: 1px solid ${cssManager.bdTheme('#eeeeeb', '#222')};
+        pointer-events: none;
+      }
+
+      .main.show {
+        pointer-events: all;
+        transform: translateX(0px);
+        opacity: 1;
+      }
+
+      .menuItem {
+        text-align: left;
+        padding: 8px;
+        margin-left: -8px;
+        margin-right: -8px;
+        border-radius: 3px;
+      }
+      .menuItem:hover {
+        background: ${cssManager.bdTheme('#CCC', '#333')};;
+      }
+
+      .heading {
+        text-align: left;
+        font-size: 24px;
+        padding: 8px 0px;
+        font-family: 'Roboto', 'Inter', sans-serif;
+        font-weight: 300;
+        border-bottom: 1px dashed #444;
+        margin-top: 16px;
+        margin-bottom: 16px;
+      }
+    `,
+  ];
+
+  public render() {
+    return html`
+      <div class="main">
+        <div class="heading">${this.heading}</div>
+        ${this.menuItems.map((menuItem) => {
+          return html`
+            <div
+              class="menuItem"
+              @click="${() => {
+                this.hide();
+                menuItem.action(this);
+              }}"
+            >
+              ${menuItem.name}
+            </div>
+          `;
+        })}
+      </div>
+    `;
+  }
+
+  private windowLayer: DeesWindowLayer;
+
+  /**
+   * inits the show
+   */
+  public async show() {
+    const domtools = await this.domtoolsPromise;
+    const main = this.shadowRoot.querySelector('.main');
+    if (!this.windowLayer) {
+      this.windowLayer = new DeesWindowLayer();
+      this.windowLayer.options.blur = true;
+      this.windowLayer.addEventListener('click', () => {
+        this.hide();
+      });
+    }
+    document.body.append(this.windowLayer);
+    await domtools.convenience.smartdelay.delayFor(0);
+    this.windowLayer.show();
+
+    await domtools.convenience.smartdelay.delayFor(0);
+    main.classList.add('show');
+  }
+
+  /**
+   * inits the hide function
+   */
+  public async hide() {
+    const domtools = await this.domtoolsPromise;
+    const main = this.shadowRoot.querySelector('.main');
+    main.classList.remove('show');
+    this.windowLayer.hide();
+  }
+
+  async disconnectedCallback() {
+    document.body.removeChild(this.windowLayer);
+  }
+}

ts_web/elements/dees-modal.demo.ts

@@ -0,0 +1,37 @@
+import { html } from '@design.estate/dees-element';
+import { DeesModal } from './dees-modal.js';
+
+export const demoFunc = () => html`
+  <dees-button @click=${() => {
+    DeesModal.createAndShow({
+      heading: 'This is a heading',
+      content: html`
+        <dees-form>
+          <dees-input-text
+            .label=${'Username'}
+          >
+          </dees-input-text>
+          <dees-input-text
+            .label=${'Password'}
+          >
+          </dees-input-text>
+        </dees-form>
+      `,
+      menuOptions: [{
+        name: 'Cancel',
+        iconName: null,
+        action: async (deesModalArg) => {
+          deesModalArg.destroy();
+          return null;
+        }
+      }, {
+        name: 'Ok',
+        iconName: null,
+        action: async (deesModalArg) => {
+          deesModalArg.destroy();
+          return null;
+        }
+      }],
+    });
+  }}>open modal</dees-button>
+`

ts_web/elements/dees-modal.ts

@@ -0,0 +1,196 @@
+import * as plugins from './00plugins.js';
+import { demoFunc } from './dees-modal.demo.js';
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+  unsafeHTML,
+  state,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { DeesWindowLayer } from './dees-windowlayer.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-modal': DeesModal;
+  }
+}
+
+@customElement('dees-modal')
+export class DeesModal extends DeesElement {
+  // STATIC
+  public static demo = demoFunc;
+
+  public static async createAndShow(optionsArg: {
+    heading: string;
+    content: TemplateResult;
+    menuOptions: plugins.tsclass.website.IMenuItem<DeesModal>[];
+  }) {
+    const body = document.body;
+    const modal = new DeesModal();
+    modal.heading = optionsArg.heading;
+    modal.content = optionsArg.content;
+    modal.menuOptions = optionsArg.menuOptions;
+    modal.windowLayer = await DeesWindowLayer.createAndShow({
+      blur: true,
+    });
+    modal.windowLayer.addEventListener('click', async () => {
+      await modal.destroy();
+    });
+    body.append(modal.windowLayer);
+    body.append(modal);
+  }
+
+  // INSTANCE
+
+  @property({
+    type: String,
+  })
+  public heading = '';
+
+  @state({})
+  public content: TemplateResult;
+
+  @state({})
+  public menuOptions: plugins.tsclass.website.IMenuItem<DeesModal>[] = [];
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        font-family: 'Roboto', 'Inter', sans-serif;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        will-change: transform;
+      }
+      .modalContainer {
+        display: flex;
+        position: fixed;
+        top: 0px;
+        left: 0px;
+        width: 100vw;
+        height: 100vh;
+        box-sizing: border-box;
+        align-items: center;
+        justify-content: center;
+        z-index: 2000;
+      }
+      .modal {
+        will-change: transform;
+        transform: translateY(0px) scale(0.95);
+        opacity: 0;
+        width: 480px;
+        min-height: 120px;
+        background: #111;
+        border-radius: 8px;
+        border: 1px solid #222;
+        transition: all 0.2s;
+        overflow: hidden;
+        box-shadow: 0px 2px 5px #00000080;
+      }
+
+      .modal.show {
+        opacity: 1;
+        transform: translateY(0px) scale(1);
+      }
+
+      .modal.show.predestroy {
+        opacity: 0;
+        transform: translateY(10px) scale(1);
+      }
+
+      .modal .heading {
+        height: 32px;
+        font-family: 'Roboto', 'Inter', sans-serif;
+        line-height: 32px;
+        text-align: center;
+        font-weight: 600;
+        font-size: 12px;
+        border-bottom: 1px solid #222;
+      }
+
+      .modal .content {
+        padding: 16px;
+      }
+      .modal .bottomButtons {
+        display: grid;
+        border-top: 1px solid #222;
+      }
+
+      .modal .bottomButtons .bottomButton {
+        height: 40px;
+        line-height: 40px;
+        text-align: center;
+        font-size: 14px;
+        border-right: 1px solid #222;
+      }
+      .modal .bottomButtons .bottomButton:hover {
+        background: #222;
+      }
+      .modal .bottomButtons .bottomButton:last-child {
+        border-right: none;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <style>
+        .modal .bottomButtons {
+          grid-template-columns: ${cssManager.cssGridColumns(this.menuOptions.length, 0)};
+        }
+      </style>
+      <div class="modalContainer" @click=${this.handleOutsideClick}>
+        <div class="modal">
+          <div class="heading">${this.heading}</div>
+          <div class="content">${this.content}</div>
+          <div class="bottomButtons">
+            ${this.menuOptions.map(
+              (actionArg) => html`
+                <div class="bottomButton" @click=${() => {
+                  actionArg.action(this);
+                }}>${actionArg.name}</div>
+              `
+            )}
+          </div>
+        </div>
+      </div>
+    `;
+  }
+
+  private windowLayer: DeesWindowLayer;
+  public async firstUpdated(_changedProperties: Map<string | number | symbol, unknown>) {
+    super.firstUpdated(_changedProperties);
+    const domtools = await this.domtoolsPromise;
+    await domtools.convenience.smartdelay.delayFor(30);
+    const modal = this.shadowRoot.querySelector('.modal');
+    modal.classList.add('show');
+  }
+
+  public async handleOutsideClick(eventArg: MouseEvent) {
+    eventArg.stopPropagation();
+    const modalContainer = this.shadowRoot.querySelector('.modalContainer');
+    if (eventArg.target === modalContainer) {
+      await this.destroy();
+    }
+  }
+
+  public async destroy() {
+    const domtools = await this.domtoolsPromise;
+    const modal = this.shadowRoot.querySelector('.modal');
+    modal.classList.add('predestroy');
+    await domtools.convenience.smartdelay.delayFor(200);
+    document.body.removeChild(this);
+    await this.windowLayer.destroy();
+  }
+}

ts_web/elements/dees-pdf.ts

@@ -0,0 +1,110 @@
+import { DeesElement, property, html, customElement, domtools, type TemplateResult, type CSSResult, } from '@design.estate/dees-element';
+
+import { Deferred } from '@push.rocks/smartpromise';
+
+// import type pdfjsTypes from 'pdfjs-dist';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-pdf': DeesPdf;
+  }
+}
+
+@customElement('dees-pdf')
+export class DeesPdf extends DeesElement {
+  // DEMO
+  public static demo = () => html` <dees-pdf></dees-pdf> `;
+
+  // INSTANCE
+
+  @property()
+  public pdfUrl: string =
+    'https://raw.githubusercontent.com/mozilla/pdf.js/ba2edeae/examples/learning/helloworld.pdf';
+
+  constructor() {
+    super();
+
+    // you have access to all kinds of things through this.
+    // this.setAttribute('gotIt','true');
+  }
+
+  public render(): TemplateResult {
+    return html`
+      <style>
+        :host {
+          font-family: 'Roboto', 'Inter', sans-serif;
+          display: block;
+          box-sizing: border-box;
+          max-width: 800px;
+        }
+        :host([hidden]) {
+          display: none;
+        }
+
+        #pdfcanvas {
+          box-shadow: 0px 0px 5px #ccc;
+          width: 100%;
+        }
+      </style>
+      <canvas id="pdfcanvas" .height=${0} .width=${0}></canvas>
+    `;
+  }
+
+  public static pdfJsReady: Promise<any>;
+  public static pdfjsLib: any // typeof pdfjsTypes;
+  public async connectedCallback() {
+    super.connectedCallback();
+    if (!DeesPdf.pdfJsReady) {
+      const pdfJsReadyDeferred = domtools.plugins.smartpromise.defer();
+      DeesPdf.pdfJsReady = pdfJsReadyDeferred.promise;
+      // @ts-ignore
+      DeesPdf.pdfjsLib = await import('https://cdn.jsdelivr.net/npm/pdfjs-dist@4.0.379/+esm');
+      DeesPdf.pdfjsLib.GlobalWorkerOptions.workerSrc = 'https://cdn.jsdelivr.net/npm/pdfjs-dist@4.0.379/build/pdf.worker.mjs';
+      pdfJsReadyDeferred.resolve();
+    }
+    await DeesPdf.pdfJsReady;
+    this.displayContent();
+  }
+
+  public async displayContent() {
+    await DeesPdf.pdfJsReady;
+
+    // Asynchronous download of PDF
+    const loadingTask = DeesPdf.pdfjsLib.getDocument(this.pdfUrl);
+    loadingTask.promise.then(
+      (pdf) => {
+        console.log('PDF loaded');
+
+        // Fetch the first page
+        const pageNumber = 1;
+        pdf.getPage(pageNumber).then((page) => {
+          console.log('Page loaded');
+
+          const scale = 10;
+          const viewport = page.getViewport({ scale: scale });
+
+          // Prepare canvas using PDF page dimensions
+          const canvas: any = this.shadowRoot.querySelector('#pdfcanvas');
+          const context = canvas.getContext('2d');
+          canvas.height = viewport.height;
+          canvas.width = viewport.width;
+
+          // Render PDF page into canvas context
+          const renderContext = {
+            canvasContext: context,
+            viewport: viewport,
+          };
+
+          const renderTask = page.render(renderContext);
+          renderTask.promise.then(function () {
+            console.log('Page rendered');
+          });
+        });
+      },
+      (reason) => {
+        // PDF loading error
+        console.error(reason);
+      }
+    );
+  }
+}

ts_web/elements/dees-progressbar.demo.ts

@@ -0,0 +1,11 @@
+import { html } from '@design.estate/dees-element';
+
+import { DeesProgressbar } from './dees-progressbar.js';
+
+export const demoFunc = () => {
+  return html`
+    <dees-progressbar
+      .percentage=${50}
+    ></dees-progressbar>
+  `;
+}

ts_web/elements/dees-progressbar.ts

@@ -0,0 +1,95 @@
+import * as plugins from './00plugins.js';
+import * as colors from './00colors.js';
+import { demoFunc } from './dees-progressbar.demo.js';
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+  unsafeHTML,
+  state,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+
+@customElement('dees-progressbar')
+export class DeesProgressbar extends DeesElement {
+  // STATIC
+  public static demo = demoFunc;
+
+  // INSTANCE
+  @property({
+    type: Number,
+  })
+  public percentage = 0;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        color: ${cssManager.bdTheme(colors.bright.text, colors.dark.text)};
+      }
+      .progressBarContainer {
+        padding: 8px;
+        min-width: 200px;
+      }
+
+      .progressBar {
+        background: ${cssManager.bdTheme('#eeeeeb', '#444')};
+        height: 8px;
+        width: 100%;
+        border-radius: 4px;
+        border-top: 0.5px solid ${cssManager.bdTheme('none', '#555')};
+      }
+
+      .progressBarFill {
+        background: ${cssManager.bdTheme(colors.dark.blueActive, colors.bright.blueActive)};
+        height: 8px;
+        margin-top: -0.5px;
+        transition: 0.2s width;
+        border-radius: 4px;
+        width: 0px;
+        border-top: 0.5 solid ${cssManager.bdTheme('none', '#398fff')};
+      }
+
+      .progressText {
+        padding: 8px;
+        text-align: center;
+      }
+    `
+  ];
+
+  public render() {
+    return html`
+      <div class="progressBarContainer">
+        <div class="progressBar">
+          <div class="progressBarFill"></div>
+          <div class="progressText">
+            ${this.percentage}%
+          <div>
+        </div>
+      </div>
+    `
+  }
+
+  firstUpdated (_changedProperties: Map<string | number | symbol, unknown>): void {
+    super.firstUpdated(_changedProperties);
+    this.updateComplete.then(() => {
+      this.updatePercentage();
+    });
+  }
+
+  public async updatePercentage() {
+    const progressBarFill = this.shadowRoot.querySelector('.progressBarFill') as HTMLElement;
+    progressBarFill.style.width = `${this.percentage}%`;
+  }
+
+  updated(){
+    this.updatePercentage();
+  }
+}

ts_web/elements/dees-simple-appdash.demo.ts

@@ -0,0 +1,5 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+  <dees-simple-appdash>Hello there</dees-simple-appdash>
+`;

ts_web/elements/dees-simple-appdash.ts

@@ -0,0 +1,74 @@
+import { demoFunc } from './dees-simple-appdash.demo.js';
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  unsafeCSS,
+  type CSSResult,
+  state,
+} from '@design.estate/dees-element';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-simple-appdash': DeesSimpleAppDash;
+  }
+}
+
+@customElement('dees-simple-appdash')
+export class DeesSimpleAppDash extends DeesElement {
+  // STATIC
+  public static demo = demoFunc;
+  // INSTANCE
+
+  @property()
+  public name = 'Dees Simple Login';
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        user-select: none;
+      }
+      .appbar {
+        position: absolute;
+        top: 0;
+        height: 40px;
+        width: 100%;
+        background: ${cssManager.bdTheme('#eeeeeb', '#000')};
+        border-bottom: 1px solid ${cssManager.bdTheme('#ccc', '#333')};
+        font-size: 14px;
+        line-height: 40px;
+        font-family: 'Roboto', 'Inter', sans-serif;
+        padding: 0px 16px;
+      }
+      .appcontent {
+        position: absolute;
+        top: 40px;
+        bottom: 0;
+        width: 100%;
+        background: ${cssManager.bdTheme('#eeeeeb', '#000')};
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="appbar">
+        configvault v1.2.3
+      </div>
+      <div class="appcontent">
+        <slot></slot>
+      </div>
+    `;
+  }
+
+  public async firstUpdated(_changedProperties): Promise<void> {
+    const domtools = await this.domtoolsPromise;
+    super.firstUpdated(_changedProperties);
+  }
+}

ts_web/elements/dees-simple-login.demo.ts

@@ -0,0 +1,3 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html` <dees-simple-login name="someapp"> Hello there </dees-simple-login> `;

ts_web/elements/dees-simple-login.ts

@@ -0,0 +1,120 @@
+import { demoFunc } from './dees-simple-login.demo.js';
+
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  unsafeCSS,
+  type CSSResult,
+  state,
+} from '@design.estate/dees-element';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-simple-login': DeesSimpleLogin;
+  }
+}
+
+@customElement('dees-simple-login')
+export class DeesSimpleLogin extends DeesElement {
+  // STATIC
+  public static demo = demoFunc
+  // INSTANCE
+
+  @property()
+  public name = 'Dees Simple Login';
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        user-select: none;
+      }
+      .loginContainer {
+        position: absolute;
+        display: flex;
+        justify-content: center; /* aligns horizontally */
+        align-items: center; /* aligns vertically */
+        width: 100%;
+        height: 100%;
+      }
+      .login {
+        min-width: 320px;
+        min-height: 100px;
+        background: ${cssManager.bdTheme('#eeeeeb', '#111')};
+        box-shadow: ${cssManager.bdTheme('0px 1px 4px rgba(0,0,0,0.3)', 'none')};
+        border-radius: 8px;
+        padding: 24px;
+        transition: opacity 0.3s, transform 0.3s;
+      }
+
+      .header {
+        text-align: center;
+      }
+      .slotContainer {
+        opacity:0;
+        transition: opacity 0.3s, transform 0.3s;
+        pointer-events: none;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="loginContainer">
+        <div class="login">
+          <dees-form>
+            <div class="header">Login to ${this.name}</div>
+            <dees-input-text key="username" label="username" required></dees-input-text>
+            <dees-input-text key="password" label="password" isPasswordBool required></dees-input-text>
+            <dees-form-submit disabled>login</dees-form-submit>
+          </dees-form>
+        </div>
+      </div>
+      <div class="slotContainer">
+        <slot></slot>
+      </div>
+    `;
+  }
+
+  public async firstUpdated(_changedProperties): Promise<void> {
+    const domtools = await this.domtoolsPromise;
+    super.firstUpdated(_changedProperties);
+    const form = this.shadowRoot.querySelector('dees-form');
+    await form.readyDeferred.promise;
+    const username = this.shadowRoot.querySelector('dees-input-text[label="username"]');
+    const password = this.shadowRoot.querySelector('dees-input-text[label="password"]');
+    const submit = this.shadowRoot.querySelector('dees-form-submit');
+    form.addEventListener('formData', (event: CustomEvent) => {
+      this.dispatchEvent(new CustomEvent('login', { detail: event.detail }));
+      // this.switchToSlottedContent();
+    });
+  }
+
+  /**
+   * allows switching to slotted content
+   */
+  public async switchToSlottedContent() {
+    const domtools = await this.domtoolsPromise;
+    const loginDiv: HTMLDivElement = this.shadowRoot.querySelector('.login');
+    const loginContainerDiv: HTMLDivElement = this.shadowRoot.querySelector('.loginContainer');
+    const slotContainerDiv: HTMLDivElement = this.shadowRoot.querySelector('.slotContainer');
+    loginDiv.style.opacity = '0';
+    loginDiv.style.transform = 'translateY(20px)';
+    loginContainerDiv.style.pointerEvents = 'none';
+    slotContainerDiv.style.transform = 'translateY(20px)';
+    await domtools.convenience.smartdelay.delayFor(300);
+    slotContainerDiv.style.opacity = '1';
+    slotContainerDiv.style.transform = 'translateY(0px)';
+    await domtools.convenience.smartdelay.delayFor(300);
+    slotContainerDiv.style.pointerEvents = 'all';
+
+
+    
+  }
+}

ts_web/elements/dees-speechbubble.ts

@@ -0,0 +1,156 @@
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-speechbubble': DeesSpeechbubble;
+  }
+}
+
+@customElement('dees-speechbubble')
+export class DeesSpeechbubble extends DeesElement {
+  public static demo = () => html` <dees-speechbubble></dees-speechbubble> `;
+
+  @property()
+  public text: string;
+
+  @property({
+    type: Boolean,
+  })
+  public disabled = false;
+
+  @property({
+    type: Boolean,
+  })
+  public isHidden = false;
+
+  @property({
+    type: String,
+  })
+  public status: 'normal' | 'pending' | 'success' | 'error' = 'normal';
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        position: relative;
+        display: block;
+        box-sizing: border-box;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        user-select: none;
+      }
+      :host([hidden]) {
+        display: none;
+      }
+
+      .maincontainer {
+        will-change: transform;
+        transition: transform 0.2s;
+        transform: translateX(0px);
+        position: relative;
+        transition: all 0.2s;
+        margin-left: 0px;
+      }
+
+      .maincontainer:hover {
+        transform: translateX(3px);
+      }
+
+      .arrow {
+        position: absolute;
+        transform: rotate(45deg);
+        background: ${cssManager.bdTheme('#fff', '#333')};
+        height: 15px;
+        width: 15px;
+        left: 4px;
+        top: 5px;
+        border-radius: 2px;
+      }
+
+      .speechbubble {
+        background: ${cssManager.bdTheme('#fff', '#333')};
+        padding: 0px 10px;
+        border-radius: 3px;
+        position: absolute;
+        line-height: 25px;
+        font-size: 12px;
+        top: 0px;
+        left: 8px;
+      }
+
+      .wave {
+        animation-name: wave-animation; /* Refers to the name of your @keyframes element below */
+        animation-duration: 2.5s; /* Change to speed up or slow down */
+        animation-iteration-count: infinite; /* Never stop waving :) */
+        transform-origin: 70% 70%; /* Pivot around the bottom-left palm */
+        display: inline-block;
+      }
+
+      @keyframes wave-animation {
+        0% {
+          transform: rotate(0deg);
+        }
+        10% {
+          transform: rotate(14deg);
+        } /* The following five values can be played with to make the waving more or less extreme */
+        20% {
+          transform: rotate(-8deg);
+        }
+        30% {
+          transform: rotate(14deg);
+        }
+        40% {
+          transform: rotate(-4deg);
+        }
+        50% {
+          transform: rotate(10deg);
+        }
+        60% {
+          transform: rotate(0deg);
+        } /* Reset for the last half to pause */
+        100% {
+          transform: rotate(0deg);
+        }
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="maincontainer" @click=${this.handleClick}>
+        <div class="arrow"></div>
+        <div class="speechbubble"><span class="wave">👋</span> We build with launch.sh, and you can too.</div>
+      </div>
+    `;
+  }
+
+  public async handleClick() {
+    if (this.disabled) {
+      return;
+    }
+
+    globalThis.location.href = "https://launch.sh"
+  }
+
+  public async firstUpdated() {
+    if (!this.textContent) {
+      this.textContent = 'Button';
+      this.performUpdate();
+    }
+  }
+}

ts_web/elements/dees-spinner.ts

@@ -0,0 +1,131 @@
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-spinner': DeesSpinner;
+  }
+}
+
+@customElement('dees-spinner')
+export class DeesSpinner extends DeesElement {
+  public static demo = () => html`
+    <dees-spinner></dees-spinner>
+    <dees-spinner status="success"></dees-spinner>
+    <dees-spinner status="error"></dees-spinner>
+    <dees-spinner size=${64} status="success"></dees-spinner>
+    <dees-spinner .size=${64} status="error"></dees-spinner>
+  `;
+
+  @property({
+    type: Number,
+  })
+  public size = 20;
+
+  @property({
+    type: String,
+  })
+  public bnw: boolean = false;
+
+  @property()
+  public status: 'normal' | 'pending' | 'success' | 'error' = 'normal';
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        display: block;
+      }
+
+      #loading {
+        position: relative;
+        transition: none;
+        display: flex;
+        justify-content: center;
+        align-content: center;
+        background: #8bc34a00;
+        border: 3px solid ${cssManager.bdTheme('rgba(0, 0, 0, 0.1)', 'rgba(255, 255, 255, 0.3)')};
+        border-radius: 50%;
+        border-top-color: ${cssManager.bdTheme('#333', '#fff')};
+        animation: spin 1s ease-in-out infinite;
+        -webkit-animation: spin 1s ease-in-out infinite;
+      }
+
+      #loading.success {
+        border: none;
+        border-radius: 50%;
+        animation: none;
+        -webkit-animation: none;
+      }
+
+      #loading.error {
+        border: none;
+        border-radius: 50%;
+        animation: none;
+        -webkit-animation: none;
+      }
+
+      @keyframes spin {
+        to {
+          -webkit-transform: rotate(360deg);
+        }
+      }
+      @-webkit-keyframes spin {
+        to {
+          -webkit-transform: rotate(360deg);
+        }
+      }
+
+      dees-icon {
+        position: absolute;
+        height: 100%;
+        width: 100%;
+      }
+    `,
+  ];
+
+  render() {
+    return html`
+      <style>
+        #loading {
+          width: ${this.size}px;
+          height: ${this.size}px;
+        }
+        #loading.success {
+          color: ${cssManager.bdTheme(this.bnw ? '#333': `#8bc34a`, this.bnw ? '#fff' : `#8bc34a`)};
+          
+        }
+        #loading.error {
+          color: ${cssManager.bdTheme(this.bnw ? '#333': `#e64a19`, this.bnw ? '#fff' : `#e64a19`)};
+        }
+        dees-icon {
+          font-size: ${this.size}px;
+        }
+      </style>
+      <div class="${this.status}" id="loading">
+        ${(() => {
+          if (this.status === 'success') {
+            return html`<dees-icon style="transform: translateX(1%) translateY(3%);" .iconFA=${'circleCheck' as any}></dees-icon>`;
+          } else if (this.status === 'error') {
+            return  html`<dees-icon .iconFA=${'circleXmark' as any}></dees-icon>`;
+          }
+        })()}
+      </div>
+    `;
+  }
+}

ts_web/elements/dees-stepper.ts

@@ -0,0 +1,264 @@
+import {
+  DeesElement,
+  customElement,
+  html,
+  css,
+  unsafeCSS,
+  type CSSResult,
+  cssManager,
+  property,
+  type TemplateResult,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+
+export interface IStep {
+  title: string;
+  content: TemplateResult;
+  validationFunc?: (stepper: DeesStepper, htmlElement: HTMLElement) => Promise<any>;
+  onReturnToStepFunc?: (stepper: DeesStepper, htmlElement: HTMLElement) => Promise<any>;
+  validationFuncCalled?: boolean;
+}
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-stepper': DeesStepper;
+  }
+}
+
+@customElement('dees-stepper')
+export class DeesStepper extends DeesElement {
+  public static demo = () =>
+    html`
+      <dees-stepper
+        .steps=${[
+          {
+            title: 'Whats your name?',
+            content: html`
+              <dees-form>
+                <dees-input-text
+                  key="email"
+                  label="Your Email"
+                  value="hello@something.com"
+                  disabled
+                ></dees-input-text>
+                <dees-input-text key="firstName" required label="Vorname"></dees-input-text>
+                <dees-input-text key="lastName" required label="Nachname"></dees-input-text>
+                <dees-form-submit>Next</dees-form-submit>
+              </dees-form>
+            `,
+            validationFunc: async (stepperArg, elementArg) => {
+              const deesForm = elementArg.querySelector('dees-form');
+              deesForm.addEventListener('formData', (eventArg) => {
+                stepperArg.goNext();
+              });
+            },
+          },
+          {
+            title: 'Whats your mobile number?',
+            content: html``,
+          },
+        ] as IStep[]}
+      ></dees-stepper>
+    `;
+
+  @property({
+    type: Array,
+  })
+  public steps: IStep[] = [];
+
+  @property({
+    type: Object,
+  })
+  public selectedStep: IStep;
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        position: absolute;
+        width: 100%;
+        height: 100%;
+      }
+      .stepperContainer {
+        position: absolute;
+        width: 100%;
+        height: 100%;
+        background: ${cssManager.bdTheme('#eeeeeb', '#000')};
+        overflow: hidden;
+      }
+
+      .step {
+        position: relative;
+        pointer-events: none;
+        overflow: hidden;
+        transition: all 0.7s ease-in-out;
+        max-width: 500px;
+        min-height: 300px;
+        border-radius: 8px;
+        background: ${cssManager.bdTheme('#ffffff', '#181818')};
+        border-top: 1px solid ${cssManager.bdTheme('#ffffff', '#181818')};
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        margin: auto;
+        margin-bottom: 20px;
+        filter: opacity(0.5) grayscale(1);
+        box-shadow: 0px 0px 3px #00000010;
+        user-select: none;
+      }
+
+      .step.selected {
+        border-top: 1px solid #e4002b;
+        pointer-events: all;
+        filter: opacity(1) grayscale(0);
+        box-shadow: 0px 0px 5px #00000010;
+        user-select: auto;
+      }
+
+      .step.hiddenStep {
+        filter: opacity(0);
+      }
+
+      .step:last-child {
+        margin-bottom: 100vh;
+      }
+
+      .step .stepCounter {
+        color: #999;
+        position: absolute;
+        top: 0px;
+        right: 0px;
+        padding: 10px 15px;
+        font-size: 12px;
+        border-bottom-left-radius: 3px;
+        background: ${cssManager.bdTheme('#00000008', '#ffffff08')};
+      }
+
+      .step .goBack {
+        color: #999;
+        cursor: default;
+        position: absolute;
+        top: 0px;
+        left: 0px;
+        padding: 10px 15px;
+        font-size: 12px;
+        border-bottom-right-radius: 3px;
+        background: ${cssManager.bdTheme('#00000008', '#ffffff08')};
+      }
+
+      .step .goBack:hover {
+        background: ${cssManager.bdTheme('#00000012', '#ffffff12')};
+      }
+
+      .step .title {
+        text-align: center;
+        padding-top: 50px;
+        font-family: 'Roboto', 'Inter', sans-serif;
+        font-size: 25px;
+        font-weight: 300;
+      }
+
+      .step .content {
+        padding: 20px;
+      }
+    `,
+  ];
+
+  public render() {
+    return html`
+      <div class="stepperContainer">
+        ${this.steps.map(
+          (stepArg) =>
+            html`<div
+              class="step ${stepArg === this.selectedStep
+                ? 'selected'
+                : null} ${this.getIndexOfStep(stepArg) > this.getIndexOfStep(this.selectedStep)
+                ? 'hiddenStep'
+                : ''}"
+            >
+              ${this.getIndexOfStep(stepArg) > 0
+                ? html`<div class="goBack" @click=${this.goBack}><- go to previous step</div>`
+                : ``}
+              <div class="stepCounter">
+                Step ${this.steps.findIndex((elementArg) => elementArg === stepArg) + 1} of
+                ${this.steps.length}
+              </div>
+              <div class="title">${stepArg.title}</div>
+              <div class="content">${stepArg.content}</div>
+            </div> `
+        )}
+      </div>
+    `;
+  }
+
+  public getIndexOfStep = (stepArg: IStep): number => {
+    return this.steps.findIndex((stepArg2) => stepArg === stepArg2);
+  };
+
+  public async firstUpdated() {
+    await this.domtoolsPromise;
+    await this.domtools.convenience.smartdelay.delayFor(0);
+    this.selectedStep = this.steps[0];
+    this.setScrollStatus();
+  }
+
+  public async updated() {
+    this.setScrollStatus();
+  }
+
+  public scroller: typeof domtools.plugins.SweetScroll.prototype;
+
+  public async setScrollStatus() {
+    const stepperContainer: HTMLElement = this.shadowRoot.querySelector('.stepperContainer');
+    const firstStepElement: HTMLElement = this.shadowRoot.querySelector('.step');
+    const selectedStepElement: HTMLElement = this.shadowRoot.querySelector('.selected');
+    if (!selectedStepElement) {
+      return;
+    }
+    if (!stepperContainer.style.paddingTop) {
+      stepperContainer.style.paddingTop = `${
+        stepperContainer.offsetHeight / 2 - selectedStepElement.offsetHeight / 2
+      }px`;
+    }
+    console.log('Setting scroll status');
+    console.log(selectedStepElement);
+    const scrollPosition =
+      selectedStepElement.offsetTop -
+      stepperContainer.offsetHeight / 2 +
+      selectedStepElement.offsetHeight / 2;
+    console.log(scrollPosition);
+    const domtoolsInstance = await domtools.DomTools.setupDomTools();
+    if (!this.scroller) {
+      this.scroller = new domtools.plugins.SweetScroll(
+        {
+          vertical: true,
+          horizontal: false,
+          easing: 'easeInOutExpo',
+          duration: 700,
+        },
+        stepperContainer
+      );
+    }
+    if (!this.selectedStep.validationFuncCalled && this.selectedStep.validationFunc) {
+      this.selectedStep.validationFuncCalled = true;
+      await this.selectedStep.validationFunc(this, selectedStepElement);
+    }
+    this.scroller.to(scrollPosition);
+  }
+
+  public async goBack() {
+    const currentIndex = this.steps.findIndex((stepArg) => stepArg === this.selectedStep);
+    this.selectedStep = this.steps[currentIndex - 1];
+    await this.domtoolsPromise;
+    await this.domtools.convenience.smartdelay.delayFor(100);
+    this.selectedStep.onReturnToStepFunc?.(this, this.shadowRoot.querySelector('.selected'));
+  }
+
+  public goNext() {
+    const currentIndex = this.steps.findIndex((stepArg) => stepArg === this.selectedStep);
+    this.selectedStep = this.steps[currentIndex + 1];
+  }
+}

ts_web/elements/dees-table.demo.ts

@@ -0,0 +1,129 @@
+import { type ITableAction } from './dees-table.js';
+import * as plugins from './00plugins.js';
+import { html } from '@design.estate/dees-element';
+
+interface ITableDemoData {
+  date: string;
+  amount: string;
+  description: string;
+}
+
+export const demoFunc = () => html`
+  <style>
+    .demoWrapper {
+      box-sizing: border-box;
+      position: absolute;
+      width: 100%;
+      height: 100%;
+      padding: 20px;
+      background: #000000;
+    }
+  </style>
+  <div class="demoWrapper">
+    <dees-table
+      heading1="Current Account Statement"
+      heading2="Bunq - Payment Account 2 - April 2021"
+      .editableFields="${['description']}"
+      .data=${[
+        {
+          date: '2021-04-01',
+          amount: '2464.65 €',
+          description: 'Printing Paper (Office Supplies) - STAPLES BREMEN',
+        },
+        {
+          date: '2021-04-02',
+          amount: '165.65 €',
+          description: 'Logitech Mouse (Hardware) - logi.com OnlineShop',
+        },
+        {
+          date: '2021-04-03',
+          amount: '2999,00 €',
+          description: 'Macbook Pro 16inch (Hardware) - Apple.de OnlineShop',
+        },
+        {
+          date: '2021-04-01',
+          amount: '2464.65 €',
+          description: 'Office-Supplies - STAPLES BREMEN',
+        },
+        {
+          date: '2021-04-01',
+          amount: '2464.65 €',
+          description: 'Office-Supplies - STAPLES BREMEN',
+        },
+      ]}
+      dataName="transactions"
+      .dataActions="${[
+        {
+          name: 'upload',
+          iconName: 'bell',
+          useTableBehaviour: 'upload',
+          type: ['inRow'],
+          actionFunc: async (optionsArg) => {
+            alert(optionsArg.item.amount);
+          },
+        },
+        {
+          name: 'visibility',
+          iconName: 'copy',
+          type: ['inRow'],
+          useTableBehaviour: 'preview',
+          actionFunc: async (itemArg: any) => {},
+        },
+        {
+          name: 'create new',
+          iconName: 'instagram',
+          type: ['header'],
+          useTableBehaviour: 'preview',
+          actionFunc: async (itemArg: any) => {},
+        },
+        {
+          name: 'to gallery',
+          iconName: 'message',
+          type: ['footer'],
+          useTableBehaviour: 'preview',
+          actionFunc: async (itemArg: any) => {},
+        },
+        {
+          name: 'copy',
+          iconName: 'copySolid',
+          type: ['contextmenu', 'inRow'],
+          action: async () => {
+            return null;
+          },
+        },
+        {
+          name: 'edit (from demo)',
+          iconName: 'penToSquare',
+          type: ['contextmenu'],
+          action: async () => {
+            return null;
+          },
+        },
+        {
+          name: 'paste',
+          iconName: 'pasteSolid',
+          type: ['contextmenu'],
+          action: async () => {
+            return null;
+          },
+        },
+        {
+          name: 'preview',
+          type: ['doubleClick', 'contextmenu'],
+          iconName: 'eye',
+          actionFunc: async (itemArg) => {
+            alert(itemArg.item.amount);
+            return null;
+          },
+        }
+      ] as (ITableAction<ITableDemoData>)[] as any}"
+      .displayFunction=${(itemArg) => {
+        return {
+          ...itemArg,
+          onlyDisplayProp: 'onlyDisplay',
+        };
+      }}
+      >This is a slotted Text</dees-table
+    >
+  </div>
+`;

ts_web/elements/dees-table.ts

@@ -0,0 +1,687 @@
+import * as plugins from './00plugins.js';
+import { demoFunc } from './dees-table.demo.js';
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  unsafeCSS,
+  type CSSResult,
+  state,
+  resolveExec,
+} from '@design.estate/dees-element';
+
+import { DeesContextmenu } from './dees-contextmenu.js';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { type TIconKey } from './dees-icon.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-table': DeesTable<any>;
+  }
+}
+
+// interfaces
+export interface ITableAction<T = any> {
+  name: string;
+  iconName: TIconKey;
+  /**
+   * the table behaviour to use for this action
+   * e.g. upload: allows to upload files to the table
+   */
+  useTableBehaviour?: 'upload' | 'cancelUpload' | 'none';
+  /**
+   * the type of the action
+   */
+  type: (
+    | 'inRow'
+    | 'contextmenu'
+    | 'doubleClick'
+    | 'footer'
+    | 'header'
+    | 'preview'
+    | 'keyCombination'
+  )[];
+  /**
+   * allows to check if the action is relevant for the given item
+   * @param itemArg
+   * @returns
+   */
+  actionRelevancyCheckFunc?: (itemArg: T) => boolean;
+  /**
+   * the actual action function implementation
+   * @param itemArg
+   * @returns
+   */
+  actionFunc: (actionDataArg: ITableActionDataArg<T>) => Promise<any>;
+}
+
+export interface ITableActionDataArg<T> {
+  item: T;
+  table: DeesTable<T>;
+}
+
+export type TDisplayFunction<T = any> = (itemArg: T) => object;
+
+// the table implementation
+@customElement('dees-table')
+export class DeesTable<T> extends DeesElement {
+  public static demo = demoFunc;
+
+  // INSTANCE
+  @property({
+    type: String,
+  })
+  public heading1: string = 'heading 1';
+
+  @property({
+    type: String,
+  })
+  public heading2: string = 'heading 2';
+
+  @property({
+    type: Array,
+  })
+  public data: T[] = [];
+
+  // dees-form compatibility -----------------------------------------
+  @property({
+    type: String,
+  })
+  public key: string;
+
+  @property({
+    type: String,
+  })
+  public label: string;
+
+  @property({
+    type: Boolean,
+  })
+  public disabled: boolean = false;
+
+  @property({
+    type: Boolean,
+  })
+  public required: boolean = false;
+
+  get value() {
+    return this.data;
+  }
+  set value(valueArg) {}
+  public changeSubject = new domtools.plugins.smartrx.rxjs.Subject<DeesTable<T>>();
+  // end dees-form compatibility -----------------------------------------
+
+  @property({
+    type: String,
+    reflect: true,
+  })
+  public dataName: string;
+
+  @property({
+    type: Array,
+  })
+  public dataActions: ITableAction<T>[] = [];
+
+  @property({
+    attribute: false,
+  })
+  public displayFunction: TDisplayFunction = (itemArg: T) => itemArg as any;
+
+  @property({
+    attribute: false,
+  })
+  public reverseDisplayFunction: (itemArg: any) => T = (itemArg: any) => itemArg as T;
+
+  @property({
+    type: Object,
+  })
+  public selectedDataRow: T;
+
+  @property({
+    type: Array,
+  })
+  public editableFields: string[] = [];
+
+  public files: File[] = [];
+  public fileWeakMap = new WeakMap();
+
+  public dataChangeSubject = new domtools.plugins.smartrx.rxjs.Subject();
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      .mainbox {
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        font-family: 'Roboto', 'Inter', sans-serif;
+        font-weight: 400;
+        font-size: 14px;
+        padding: 16px;
+        display: block;
+        width: 100%;
+        min-height: 50px;
+        background: ${cssManager.bdTheme('#ffffff', '#333333')};
+        border-radius: 3px;
+        border-top: 1px solid ${cssManager.bdTheme('#fff', '#444')};
+        box-shadow: 0px 1px 4px rgba(0, 0, 0, 0.3);
+        overflow-x: auto;
+      }
+
+      .header {
+        display: flex;
+        justify-content: flex-end;
+        align-items: center;
+        font-family: 'Roboto', 'Inter', sans-serif;
+      }
+
+      .headingContainer {
+      }
+
+      .heading {
+      }
+
+      .heading1 {
+        font-weight: 600;
+      }
+      .heading2 {
+        opacity: 0.6;
+      }
+
+      .headingSeparation {
+        margin-top: 7px;
+        border-bottom: 1px solid ${cssManager.bdTheme('#bcbcbc', '#bcbcbc')};
+      }
+
+      .headerActions {
+        margin-left: auto;
+      }
+      .headerAction {
+        display: flex;
+        color: ${cssManager.bdTheme('#333', '#ccc')};
+      }
+
+      .headerAction:hover {
+        color: ${cssManager.bdTheme('#555', '#fff')};
+      }
+
+      .headerAction dees-icon {
+        margin-right: 8px;
+      }
+
+      table,
+      .noDataSet {
+        margin-top: 16px;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        border-collapse: collapse;
+        width: 100%;
+      }
+      .noDataSet {
+        text-align: center;
+      }
+      tr {
+        border-bottom: 1px dashed ${cssManager.bdTheme('#999', '#808080')};
+        text-align: left;
+      }
+      tr:last-child {
+        border-bottom: none;
+        text-align: left;
+      }
+      tr:hover {
+        
+      }
+      tr:hover td {
+        background: ${cssManager.bdTheme('#22222210', '#ffffff10')};
+      }
+      tr:first-child:hover {
+        cursor: auto;
+      }
+      tr:first-child:hover .innerCellContainer {
+        background: none;
+      }
+      tr.selected td {
+        background: ${cssManager.bdTheme('#22222220', '#ffffff20')};
+      }
+
+      tr.hasAttachment td {
+        background: ${cssManager.bdTheme('#0098847c', '#0098847c')};
+      }
+
+      th {
+        text-transform: none;
+        font-family: 'Roboto', 'Inter', sans-serif;
+        font-weight: 500;
+      }
+      th,
+      td {
+        position: relative;
+        vertical-align: top;
+
+        padding: 0px;
+        border-right: 1px dashed ${cssManager.bdTheme('#999', '#808080')};
+      }
+      .innerCellContainer {
+        min-height: 36px;
+        position: relative;
+        height: 100%;
+        width: 100%;
+        padding: 6px 8px;
+        line-height: 24px;
+      }
+      th:first-child .innerCellContainer,
+      td:first-child .innerCellContainer {
+        padding-left: 0px;
+      }
+      th:last-child .innerCellContainer,
+      td:last-child .innerCellContainer {
+        padding-right: 0px;
+      }
+      th:last-child,
+      td:last-child {
+        border-right: none;
+      }
+      td input {
+        width: 100%;
+        height: 100%;
+        outline: none;
+        border: 2px solid #fa6101;
+        top: 0px;
+        bottom: 0px;
+        right: 0px;
+        left: 0px;
+        position: absolute;
+        background: #fa610140;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        font-family: inherit;
+        font-size: inherit;
+        font-weight: inherit;
+        padding: 0px 6px;
+      }
+
+      .action {
+        margin: -6px 0px;
+        padding: 10px;
+        line-height: 36px;
+        height: 36px;
+        display: inline-block;
+      }
+
+      .action:first-child {
+        margin-left: -8px;
+        width: min-content;
+      }
+
+      .action:hover {
+        background: ${cssManager.bdTheme('#CCC', '#00000030')};
+      }
+
+      .footer {
+        font-family: 'Roboto', 'Inter', sans-serif;
+        font-size: 14px;
+        color: ${cssManager.bdTheme('#111', '#ffffff90')};
+        background: ${cssManager.bdTheme('#eeeeeb', '#00000050')};
+        margin: 16px -16px -16px -16px;
+        border-bottom-left-radius: 3px;
+        border-bottom-right-radius: 3px;
+        display: flex;
+      }
+
+      .tableStatistics {
+        padding: 8px 16px;
+      }
+
+      .footerActions {
+        margin-left: auto;
+      }
+
+      .footerActions .footerAction {
+        padding: 8px 16px;
+        display: flex;
+      }
+
+      .footerActions .footerAction:hover {
+        background: ${cssManager.bdTheme('#CCC', '#111')};
+      }
+
+      .footerActions dees-icon {
+        display: flex;
+        margin-right: 8px;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="mainbox">
+        <!-- the heading part -->
+        <div class="header">
+          <div class="headingContainer">
+            <div class="heading heading1">${this.label || this.heading1}</div>
+            <div class="heading heading2">${this.heading2}</div>
+          </div>
+          <div class="headerActions">
+            ${resolveExec(async () => {
+              const resultArray: TemplateResult[] = [];
+              for (const action of this.dataActions) {
+                if (!action.type.includes('header')) continue;
+                resultArray.push(
+                  html`<div
+                    class="headerAction"
+                    @click=${() => {
+                      action.actionFunc({
+                        item: this.selectedDataRow,
+                        table: this,
+                      });
+                    }}
+                  >
+                    ${action.iconName
+                      ? html`<dees-icon .iconSize=${14} .iconFA=${action.iconName}></dees-icon>
+                          ${action.name}`
+                      : action.name}
+                  </div>`
+                );
+              }
+              return resultArray;
+            })}
+          </div>
+        </div>
+        <div class="headingSeparation"></div>
+
+        <dees-input-text></dees-input-text>
+
+        <!-- the actual table -->
+        <style></style>
+        ${this.data.length > 0
+          ? (() => {
+              // Only pick up the keys from the first transformed data object
+              // as all data objects are assumed to have the same structure
+              const firstTransformedItem = this.displayFunction(this.data[0]);
+              const headings: string[] = Object.keys(firstTransformedItem);
+              return html`
+                <table>
+                  <tr>
+                    ${headings.map(
+                      (headingArg) => html`
+                        <th>
+                          <div class="innerCellContainer">${headingArg}</div>
+                        </th>
+                      `
+                    )}
+                    ${(() => {
+                      if (this.dataActions && this.dataActions.length > 0) {
+                        return html`
+                          <th>
+                            <div class="innerCellContainer">Actions</div>
+                          </th>
+                        `;
+                      }
+                    })()}
+                  </tr>
+                  ${this.data.map((itemArg) => {
+                    const transformedItem = this.displayFunction(itemArg);
+                    const getTr = (elementArg: HTMLElement): HTMLElement => {
+                      if (elementArg.tagName === 'TR') {
+                        return elementArg;
+                      } else {
+                        return getTr(elementArg.parentElement);
+                      }
+                    };
+                    return html`
+                      <tr
+                        @click=${() => {
+                          this.selectedDataRow = itemArg;
+                        }}
+                        @dragenter=${async (eventArg: DragEvent) => {
+                          eventArg.preventDefault();
+                          eventArg.stopPropagation();
+                          const realTarget = getTr(eventArg.target as HTMLElement);
+                          console.log('dragenter');
+                          console.log(realTarget);
+                          setTimeout(() => {
+                            realTarget.classList.add('hasAttachment');
+                          }, 0);
+                        }}
+                        @dragleave=${async (eventArg: DragEvent) => {
+                          eventArg.preventDefault();
+                          eventArg.stopPropagation();
+                          const realTarget = getTr(eventArg.target as HTMLElement);
+                          realTarget.classList.remove('hasAttachment');
+                        }}
+                        @dragover=${async (eventArg: DragEvent) => {
+                          eventArg.preventDefault();
+                        }}
+                        @drop=${async (eventArg: DragEvent) => {
+                          eventArg.preventDefault();
+                          const newFiles = [];
+                          for (const file of Array.from(eventArg.dataTransfer.files)) {
+                            this.files.push(file);
+                            newFiles.push(file);
+                            this.requestUpdate();
+                          }
+                          const result: File[] = this.fileWeakMap.get(itemArg as object);
+                          if (!result) {
+                            this.fileWeakMap.set(itemArg as object, newFiles);
+                          } else {
+                            result.push(...newFiles);
+                          }
+                        }}
+                        @contextmenu=${async (eventArg: MouseEvent) => {
+                          DeesContextmenu.openContextMenuWithOptions(
+                            eventArg,
+                            this.getActionsForType('contextmenu').map((action) => {
+                              const menuItem: plugins.tsclass.website.IMenuItem = {
+                                name: action.name,
+                                iconName: action.iconName as any,
+                                action: async () => {
+                                  await action.actionFunc({
+                                    item: itemArg,
+                                    table: this,
+                                  });
+                                  return null;
+                                },
+                              };
+                              return menuItem;
+                            })
+                          );
+                        }}
+                        class="${itemArg === this.selectedDataRow ? 'selected' : ''}"
+                      >
+                        ${headings.map(
+                          (headingArg) => html`
+                            <td
+                              @dblclick=${(e: Event) => {
+                                if (this.editableFields.includes(headingArg)) {
+                                  this.handleCellEditing(e, itemArg, headingArg);
+                                } else {
+                                  const wantedAction = this.dataActions.find((actionArg) =>
+                                    actionArg.type.includes('doubleClick')
+                                  );
+                                  if (wantedAction) {
+                                    wantedAction.actionFunc({
+                                      item: itemArg,
+                                      table: this,
+                                    });
+                                  }
+                                }
+                              }}
+                            >
+                              <div class="innerCellContainer">${transformedItem[headingArg]}</div>
+                            </td>
+                          `
+                        )}
+                        ${(() => {
+                          if (this.dataActions && this.dataActions.length > 0) {
+                            return html`
+                              <td>
+                                <div class="innerCellContainer">
+                                  ${this.getActionsForType('inRow').map(
+                                    (actionArg) => html`<div
+                                      class="action"
+                                      @click=${() =>
+                                        actionArg.actionFunc({
+                                          item: itemArg,
+                                          table: this,
+                                        })}
+                                    >
+                                      ${actionArg.iconName
+                                        ? html`
+                                            <dees-icon .iconFA=${actionArg.iconName}></dees-icon>
+                                          `
+                                        : actionArg.name}
+                                    </div>`
+                                  )}
+                                </div>
+                              </td>
+                            `;
+                          }
+                        })()}
+                      </tr>
+                    `;
+                  })}
+                </table>
+              `;
+            })()
+          : html` <div class="noDataSet">No data set!</div> `}
+        <div class="footer">
+          <div class="tableStatistics">
+            ${this.data.length} ${this.dataName || 'data rows'} (total) |
+            ${this.selectedDataRow ? '# ' + `${this.data.indexOf(this.selectedDataRow) + 1}` : `No`}
+            selected
+          </div>
+          <div class="footerActions">
+            ${resolveExec(async () => {
+              const resultArray: TemplateResult[] = [];
+              for (const action of this.dataActions) {
+                if (!action.type.includes('footer')) continue;
+                resultArray.push(
+                  html`<div
+                    class="footerAction"
+                    @click=${() => {
+                      action.actionFunc({
+                        item: this.selectedDataRow,
+                        table: this,
+                      });
+                    }}
+                  >
+                    ${action.iconName
+                      ? html`<dees-icon .iconSize=${14} .iconFA=${action.iconName}></dees-icon>
+                          ${action.name}`
+                      : action.name}
+                  </div>`
+                );
+              }
+              return resultArray;
+            })}
+          </div>
+        </div>
+      </div>
+    `;
+  }
+
+  public async firstUpdated() {}
+
+  public async updated(changedProperties: Map<string | number | symbol, unknown>): Promise<void> {
+    super.updated(changedProperties);
+    this.determineColumnWidths();
+  }
+
+  public async determineColumnWidths() {
+    const domtools = await this.domtoolsPromise;
+    await domtools.convenience.smartdelay.delayFor(0);
+    // Get the table element
+    const table = this.shadowRoot.querySelector('table');
+    if (!table) return;
+
+    // Get the first row's cells to measure the widths
+    const cells = table.rows[0].cells;
+
+    const handleColumnByIndex = async (i: number, waitForRenderArg: boolean = false) => {
+      const done = plugins.smartpromise.defer();
+      const cell = cells[i];
+
+      // Get computed width
+      const width = window.getComputedStyle(cell).width;
+      if (cell.textContent.includes('Actions')) {
+        const neededWidth =
+          this.dataActions.filter((actionArg) => actionArg.type.includes('inRow')).length * 35;
+        cell.style.width = `${Math.max(neededWidth, 68)}px`;
+      } else {
+        cell.style.width = width;
+      }
+      if (waitForRenderArg) {
+        requestAnimationFrame(() => {
+          done.resolve();
+        });
+        await done.promise;
+      }
+    };
+
+    if (cells[cells.length - 1].textContent.includes('Actions')) {
+      await handleColumnByIndex(cells.length - 1, true);
+    }
+
+    for (let i = 0; i < cells.length; i++) {
+      if (cells[i].textContent.includes('Actions')) {
+        continue;
+      }
+      await handleColumnByIndex(i);
+    }
+    table.style.tableLayout = 'fixed';
+  }
+
+  getActionsForType(typeArg: ITableAction['type'][0]) {
+    const actions: ITableAction[] = [];
+    for (const action of this.dataActions) {
+      if (!action.type.includes(typeArg)) continue;
+      actions.push(action);
+    }
+    return actions;
+  }
+
+  async handleCellEditing(event: Event, itemArg: T, key: string) {
+    const domtools = await this.domtoolsPromise;
+    const target = event.target as HTMLElement;
+    const originalColor = target.style.color;
+    target.style.color = 'transparent';
+    const transformedItem = this.displayFunction(itemArg);
+    const initialValue = (transformedItem[key] as unknown as string) || '';
+    // Create an input element
+    const input = document.createElement('input');
+    input.type = 'text';
+    input.value = initialValue;
+
+    const blurInput = async (blurArg = true, saveArg = false) => {
+      if (blurArg) {
+        input.blur();
+      }
+      if (saveArg) {
+        itemArg[key] = input.value as any; // Convert string to T (you might need better type casting depending on your data structure)
+        this.changeSubject.next(this);
+      }
+      input.remove();
+      target.style.color = originalColor;
+      this.requestUpdate();
+    };
+
+    // When the input loses focus or the Enter key is pressed, update the data
+    input.addEventListener('blur', () => {
+      blurInput(false, false);
+    });
+    input.addEventListener('keydown', (e: KeyboardEvent) => {
+      if (e.key === 'Enter') {
+        blurInput(true, true); // This will trigger the blur event handler above
+      }
+    });
+
+    // Replace the cell's content with the input
+    target.appendChild(input);
+    input.focus();
+  }
+}

ts_web/elements/dees-toast.demo.ts

@@ -0,0 +1,5 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = async () => {
+  return html`<dees-toast></dees-toast>`;
+}

ts_web/elements/dees-toast.ts

@@ -1,9 +1,17 @@
-import { customElement, LitElement, TemplateResult, html } from 'lit-element';
+import { customElement, DeesElement, type TemplateResult, html, type CSSResult, } from '@design.estate/dees-element';
 
-import * as domtools from '@designestate/dees-domtools';
+import * as domtools from '@design.estate/dees-domtools';
+import { demoFunc } from './dees-toast.demo.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-toast': DeesToast;
+  }
+}
 
 @customElement('dees-toast')
-export class DeesToast extends LitElement {
+export class DeesToast extends DeesElement {
+  public static demo = demoFunc;
 
   constructor() {
     super();

ts_web/elements/dees-tooltip.ts

@@ -0,0 +1 @@
+import {} from '@design.estate/dees-element';

ts_web/elements/dees-updater.demo.ts

@@ -0,0 +1,10 @@
+import { html } from '@design.estate/dees-element';
+
+import { DeesUpdater } from './dees-updater.js';
+
+export const demoFunc = async () => {
+  const updater = await DeesUpdater.createAndShow();
+  setTimeout(async () => {
+    await updater.destroy();
+  }, 10000);
+}

ts_web/elements/dees-updater.ts

@@ -0,0 +1,110 @@
+import {
+  customElement,
+  DeesElement,
+  type TemplateResult,
+  html,
+  property,
+  type CSSResult,
+  domtools,
+} from '@design.estate/dees-element';
+import { demoFunc } from './dees-updater.demo.js';
+
+import './dees-windowlayer';
+import { css, cssManager } from '@design.estate/dees-element';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-updater': DeesUpdater;
+  }
+}
+
+@customElement('dees-updater')
+export class DeesUpdater extends DeesElement {
+  public static demo = demoFunc;
+
+  public static async createAndShow() {
+    const updater = new DeesUpdater();
+    document.body.appendChild(updater);
+    return updater;
+  }
+
+  @property({
+    type: String,
+  })
+  currentVersion: string;
+
+  @property({
+    type: String,
+  })
+  updatedVersion: string;
+
+  constructor() {
+    super();
+    domtools.elementBasic.setup();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      .modalContainer {
+        will-change: transform;
+        position: relative;
+        background: ${cssManager.bdTheme('#eeeeeb', '#222')};
+        max-width: 800px;
+        border-radius: 8px;
+        border-top: 1px solid ${cssManager.bdTheme('#eeeeeb', '#333')};
+      }
+
+      .headingContainer {
+        display: flex;
+        justify-content: center;
+        align-items: center;
+        padding: 40px 40px;
+      }
+
+      h1 {
+        margin: none;
+        font-size: 20px;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        margin-left: 20px;
+        font-weight: normal;
+      }
+
+      .buttonContainer {
+        display: grid;
+        grid-template-columns: 50% 50%;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <dees-windowlayer
+        @clicked="${this.windowLayerClicked}"
+        .options=${{
+          blur: true,
+        }}
+      >
+        <div class="modalContainer">
+          <div class="headingContainer">
+            <dees-spinner .size=${60}></dees-spinner>
+            <h1>Updating the application...</h1>
+          </div>
+          <div class="progress">
+            <dees-progressbar .progress=${0.5}></dees-progressbar>
+          </div>
+          <div class="buttonContainer">
+            <dees-button>More info</dees-button>
+            <dees-button>Changelog</dees-button>
+          </div>
+        </div> </dees-windowlayer
+      >>
+    `;
+  }
+
+  public async destroy() {
+    this.parentElement.removeChild(this);
+  }
+
+  private windowLayerClicked() {}
+}

ts_web/elements/dees-windowcontrols.ts

@@ -0,0 +1,99 @@
+import {
+  customElement,
+  DeesElement,
+  domtools,
+  type TemplateResult,
+  html,
+  property,
+  type CSSResult,
+  state,
+  css,
+  cssManager,
+} from '@design.estate/dees-element';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-windowcontrols': DeesWindowControls;
+  }
+}
+
+@customElement('dees-windowcontrols')
+export class DeesWindowControls extends DeesElement {
+  // STATIC
+  public static demo = () => html`<dees-windowcontrols></dees-windowcontrols>`;
+
+  // Instance
+  @property({
+    reflect: true,
+  })
+  public type: 'mac' | 'linux' | 'windows' = 'mac';
+
+  @property({
+    reflect: true,
+  })
+  public position: 'left' | 'right' = 'left';
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        position: relative;
+        display: block;
+        box-sizing: border-box;
+        padding-left: 16px;
+        padding-right: 16px;
+      }
+
+      .windowControls {
+        height: 100%;
+        position: relative;
+        display: flex;
+        justify-content: center;
+        align-items: center;
+      }
+
+      .windowControls div {
+        width: 12px;
+        height: 12px;
+        display: inline-block;
+        border-radius: 50%;
+        margin: 0px;
+        padding: 0px;
+        background: #222222;
+      }
+
+      .windowControls div.close {
+        background: #ff5f57;
+        margin-right: 12px;
+      }
+
+      .windowControls div.toDock {
+        background: #ffbd2e;
+        margin-right: 12px;
+      }
+
+      .windowControls div.minMax {
+        background: #27c93f;
+      }
+
+      .windowControls div:hover {
+        background: #333333;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      ${(this.type === 'mac' && this.position === 'left') ||
+      ((this.type === 'linux' || this.type === 'windows') && this.position === 'right')
+        ? html`
+            <div class="windowControls">
+              <div class="close"></div>
+              <div class="toDock"></div>
+              <div class="minMax"></div>
+            </div>
+          `
+        : html``}
+    `;
+  }
+}

ts_web/elements/dees-windowlayer.ts

@@ -0,0 +1,123 @@
+import { customElement, DeesElement, domtools, type TemplateResult, html, property, type CSSResult, state, } from '@design.estate/dees-element';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-windowlayer': DeesWindowLayer;
+  }
+}
+
+export interface IOptions_DeesWindowLayer {
+  blur: boolean;
+}
+
+@customElement('dees-windowlayer')
+export class DeesWindowLayer extends DeesElement {
+  // STATIC
+  public static demo = () => html`<dees-windowlayer></dees-windowlayer>`;
+
+  public static async createAndShow(optionsArg?: IOptions_DeesWindowLayer) {
+    const domtoolsInstance = domtools.DomTools.getGlobalDomToolsSync();
+    const windowLayer = new DeesWindowLayer();
+    windowLayer.options = {
+      ...windowLayer.options,
+      ...optionsArg,
+    }
+    document.body.append(windowLayer);
+    await domtoolsInstance.convenience.smartdelay.delayFor(0);
+    windowLayer.show();
+    return windowLayer;
+  }
+
+  @state()
+  public options: IOptions_DeesWindowLayer = {
+    blur: false
+  };
+
+  // INSTANCE
+  @property({
+    type: Boolean
+  })
+  public visible = false;
+
+  constructor() {
+    super();
+    domtools.elementBasic.setup();
+  }
+
+  public render(): TemplateResult {
+    return html`
+      ${domtools.elementBasic.styles}
+      <style>
+        .windowOverlay {
+          transition: all 0.2s;
+          will-change: transform;
+          position: fixed;
+          top: 0px;
+          left: 0px;
+          height: 100vh;
+          width: 100vw;
+          display: flex;
+          justify-content: center;
+          align-items: center;
+          background: rgba(0, 0, 0, 0.0);
+          backdrop-filter: brightness(1) ${this.options.blur ? 'blur(0px)' : ''};
+          pointer-events: none;
+          z-index: 200;
+        }
+        .slotContent {
+          position: fixed;
+          height: 100vh;
+          width: 100vw;
+          display: flex;
+          justify-content: center;
+          align-items: center;
+          z-index: 201;
+        }
+        
+        .visible {
+          background: rgba(0, 0, 0, 0.2);
+          backdrop-filter: brightness(0.9) ${this.options.blur ? 'blur(2px)' : ''};
+          pointer-events: all;
+        }
+      </style>
+      <div class="windowOverlay ${this.visible ? 'visible' : null}">
+      </div>
+      <div @click=${this.dispatchClicked} class="slotContent">
+        <slot></slot>
+      </div>
+    `;
+  }
+
+  firstUpdated() {
+    setTimeout(() => {
+      this.visible = true;
+    }, 100);
+  }
+
+  dispatchClicked() {
+    this.dispatchEvent(new CustomEvent('clicked'));
+  }
+
+  public toggleVisibility () {
+    this.visible = !this.visible;
+  }
+
+  public async show() {
+    const domtools = await this.domtoolsPromise;
+    await domtools.convenience.smartdelay.delayFor(0);
+    this.visible = true;
+  }
+
+  public async hide() {
+    const domtools = await this.domtoolsPromise;
+    await domtools.convenience.smartdelay.delayFor(0);
+    this.visible = false;
+  }
+
+  public async destroy() {
+    const domtools = await this.domtoolsPromise;
+    await this.hide();
+    await domtools.convenience.smartdelay.delayFor(300);
+    this.remove();
+  }
+}

ts_web/elements/helperclasses/formcontroller.ts

@@ -0,0 +1,3 @@
+export class FormController {
+  
+}

ts_web/elements/index.ts

@@ -1,9 +1,34 @@
-export * from './dees-button';
-export * from './dees-form';
-export * from './dees-form-submit';
-export * from './dees-input-checkbox';
-export * from './dees-input-dropdown';
-export * from './dees-input-quantityselector';
-export * from './dees-input-radio';
-export * from './dees-input-text';
-export * from './dees-toast';
+export * from './dees-button-exit.js';
+export * from './dees-button.js';
+export * from './dees-chips.js';
+export * from './dees-contextmenu.js';
+export * from './dees-dataview-codebox.js';
+export * from './dees-dataview-statusobject.js';
+export * from './dees-form-submit.js';
+export * from './dees-form.js';
+export * from './dees-hint.js';
+export * from './dees-icon.js';
+export * from './dees-input-checkbox.js';
+export * from './dees-input-dropdown.js';
+export * from './dees-input-fileupload.js';
+export * from './dees-input-iban.js';
+export * from './dees-input-typelist.js';
+export * from './dees-input-phone.js';
+export * from './dees-progressbar.js';
+export * from './dees-input-quantityselector.js';
+export * from './dees-input-radio.js';
+export * from './dees-input-text.js';
+export * from './dees-mobilenavigation.js';
+export * from './dees-modal.js';
+export * from './dees-input-multitoggle.js';
+export * from './dees-pdf.js';
+export * from './dees-simple-appdash.js';
+export * from './dees-simple-login.js';
+export * from './dees-speechbubble.js';
+export * from './dees-spinner.js';
+export * from './dees-stepper.js';
+export * from './dees-table.js';
+export * from './dees-toast.js';
+export * from './dees-updater.js';
+export * from './dees-windowcontrols.js';
+export * from './dees-windowlayer.js';

ts_web/index.ts

@@ -1 +1,2 @@
-export * from './elements/index';
+export * from './elements/index.js';
+export { commitinfo } from './00_commitinfo_data.js';

ts_web/themelogic/index.ts

@@ -1 +0,0 @@
-export {}

ts_web/tsconfig.json

@@ -1,16 +0,0 @@
-{
-  "compilerOptions": {
-    "target": "es2017",
-    "module": "es2015",
-    "moduleResolution": "node",
-    "lib": ["es2017", "dom"],
-    "declaration": true,
-    "inlineSources": true,
-    "inlineSourceMap": true,
-    "noUnusedLocals": true,
-    "noFallthroughCasesInSwitch": true,
-    "outDir": "dist/",
-    "skipLibCheck": true,
-    "experimentalDecorators": true
-  }
-}

tsconfig.json

@@ -1,7 +1,14 @@
 {
   "compilerOptions": {
     "experimentalDecorators": true,
-    "target": "ES2017",
-    "moduleResolution": "Node"
-  }
+    "useDefineForClassFields": false,
+    "target": "ES2022",
+    "module": "NodeNext",
+    "moduleResolution": "NodeNext",
+    "esModuleInterop": true,
+    "verbatimModuleSyntax": true
+  },
+  "exclude": [
+    "dist_*/**/*.d.ts"
+  ]
 }

tslint.json

@@ -1,17 +0,0 @@
-{
-  "extends": ["tslint:latest", "tslint-config-prettier"],
-  "rules": {
-    "semicolon": [true, "always"],
-    "no-console": false,
-    "ordered-imports": false,
-    "object-literal-sort-keys": false,
-    "member-ordering": {
-      "options":{
-        "order": [
-          "static-method"
-        ]
-      }
-    }
-  },
-  "defaultSeverity": "warning"
-}