1.8.1

.gitea/workflows/default_nottags.yaml

@@ -0,0 +1,66 @@
+name: Default (not tags)
+
+on:
+  push:
+    tags-ignore:
+      - '**'
+
+env:
+  IMAGE: registry.gitlab.com/hosttoday/ht-docker-node:npmci
+  NPMCI_COMPUTED_REPOURL: https://${{gitea.repository_owner}}:${{secrets.GITEA_TOKEN}}@gitea.lossless.digital/${{gitea.repository}}.git
+  NPMCI_TOKEN_NPM: ${{secrets.NPMCI_TOKEN_NPM}}
+  NPMCI_TOKEN_NPM2: ${{secrets.NPMCI_TOKEN_NPM2}}
+  NPMCI_GIT_GITHUBTOKEN: ${{secrets.NPMCI_GIT_GITHUBTOKEN}}
+  NPMCI_URL_CLOUDLY: ${{secrets.NPMCI_URL_CLOUDLY}}
+
+jobs:
+  security:
+    runs-on: ubuntu-latest
+    continue-on-error: true
+    container:
+      image: ${{ env.IMAGE }}
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Install pnpm and npmci
+        run: |
+          pnpm install -g pnpm
+          pnpm install -g @shipzone/npmci
+
+      - name: Run npm prepare
+        run: npmci npm prepare
+
+      - name: Audit production dependencies
+        run: |
+          npmci command npm config set registry https://registry.npmjs.org
+          npmci command pnpm audit --audit-level=high --prod
+        continue-on-error: true
+
+      - name: Audit development dependencies
+        run: |
+          npmci command npm config set registry https://registry.npmjs.org
+          npmci command pnpm audit --audit-level=high --dev
+        continue-on-error: true
+
+  test:
+    if: ${{ always() }}
+    needs: security
+    runs-on: ubuntu-latest
+    container:
+      image: ${{ env.IMAGE }}
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Test stable
+        run: |
+          npmci node install stable
+          npmci npm install
+          npmci npm test
+
+      - name: Test build
+        run: |
+          npmci node install stable
+          npmci npm install
+          npmci npm build

.gitea/workflows/default_tags.yaml

@@ -0,0 +1,124 @@
+name: Default (tags)
+
+on:
+  push:
+    tags:
+      - '*'
+
+env:
+  IMAGE: registry.gitlab.com/hosttoday/ht-docker-node:npmci
+  NPMCI_COMPUTED_REPOURL: https://${{gitea.repository_owner}}:${{secrets.GITEA_TOKEN}}@gitea.lossless.digital/${{gitea.repository}}.git
+  NPMCI_TOKEN_NPM: ${{secrets.NPMCI_TOKEN_NPM}}
+  NPMCI_TOKEN_NPM2: ${{secrets.NPMCI_TOKEN_NPM2}}
+  NPMCI_GIT_GITHUBTOKEN: ${{secrets.NPMCI_GIT_GITHUBTOKEN}}
+  NPMCI_URL_CLOUDLY: ${{secrets.NPMCI_URL_CLOUDLY}}
+
+jobs:
+  security:
+    runs-on: ubuntu-latest
+    continue-on-error: true
+    container:
+      image: ${{ env.IMAGE }}
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Prepare
+        run: |
+          pnpm install -g pnpm
+          pnpm install -g @shipzone/npmci
+          npmci npm prepare
+
+      - name: Audit production dependencies
+        run: |
+          npmci command npm config set registry https://registry.npmjs.org
+          npmci command pnpm audit --audit-level=high --prod
+        continue-on-error: true
+
+      - name: Audit development dependencies
+        run: |
+          npmci command npm config set registry https://registry.npmjs.org
+          npmci command pnpm audit --audit-level=high --dev
+        continue-on-error: true
+
+  test:
+    if: ${{ always() }}
+    needs: security
+    runs-on: ubuntu-latest
+    container:
+      image: ${{ env.IMAGE }}
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Prepare
+        run: |
+          pnpm install -g pnpm
+          pnpm install -g @shipzone/npmci
+          npmci npm prepare
+
+      - name: Test stable
+        run: |
+          npmci node install stable
+          npmci npm install
+          npmci npm test
+
+      - name: Test build
+        run: |
+          npmci node install stable
+          npmci npm install
+          npmci npm build
+
+  release:
+    needs: test
+    if: github.event_name == 'push' && startsWith(github.ref, 'refs/tags/')
+    runs-on: ubuntu-latest
+    container:
+      image: ${{ env.IMAGE }}
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Prepare
+        run: |
+          pnpm install -g pnpm
+          pnpm install -g @shipzone/npmci
+          npmci npm prepare
+
+      - name: Release
+        run: |
+          npmci node install stable
+          npmci npm publish
+
+  metadata:
+    needs: test
+    if: github.event_name == 'push' && startsWith(github.ref, 'refs/tags/')
+    runs-on: ubuntu-latest
+    container:
+      image: ${{ env.IMAGE }}
+    continue-on-error: true
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Prepare
+        run: |
+          pnpm install -g pnpm
+          pnpm install -g @shipzone/npmci
+          npmci npm prepare
+
+      - name: Code quality
+        run: |
+          npmci command npm install -g typescript
+          npmci npm install
+
+      - name: Trigger
+        run: npmci trigger
+
+      - name: Build docs and upload artifacts
+        run: |
+          npmci node install stable
+          npmci npm install
+          pnpm install -g @git.zone/tsdoc
+          npmci command tsdoc
+        continue-on-error: true

.gitlab-ci.yml

@@ -1,137 +0,0 @@
-# gitzone ci_default
-image: registry.gitlab.com/hosttoday/ht-docker-node:npmci
-
-cache:
-  paths:
-    - .npmci_cache/
-  key: '$CI_BUILD_STAGE'
-
-stages:
-  - security
-  - test
-  - release
-  - metadata
-
-# ====================
-# security stage
-# ====================
-mirror:
-  stage: security
-  script:
-    - npmci git mirror
-  only:
-    - tags
-  tags:
-    - lossless
-    - docker
-    - notpriv
-
-auditProductionDependencies:
-  image: registry.gitlab.com/hosttoday/ht-docker-node:npmci
-  stage: security
-  script:
-    - npmci npm prepare
-    - npmci command npm install --production --ignore-scripts
-    - npmci command npm config set registry https://registry.npmjs.org
-    - npmci command npm audit --audit-level=high --only=prod --production
-  tags:
-    - docker
-
-auditDevDependencies:
-  image: registry.gitlab.com/hosttoday/ht-docker-node:npmci
-  stage: security
-  script:
-    - npmci npm prepare
-    - npmci command npm install --ignore-scripts
-    - npmci command npm config set registry https://registry.npmjs.org
-    - npmci command npm audit --audit-level=high --only=dev
-  tags:
-    - docker
-  allow_failure: true
-
-# ====================
-# test stage
-# ====================
-
-testStable:
-  stage: test
-  script:
-    - npmci npm prepare
-    - npmci node install stable
-    - npmci npm install
-    - npmci npm test
-  coverage: /\d+.?\d+?\%\s*coverage/
-  tags:
-    - docker
-
-testBuild:
-  stage: test
-  script:
-    - npmci npm prepare
-    - npmci node install stable
-    - npmci npm install
-    - npmci command npm run build
-  coverage: /\d+.?\d+?\%\s*coverage/
-  tags:
-    - docker
-
-release:
-  stage: release
-  script:
-    - npmci node install stable
-    - npmci npm publish
-  only:
-    - tags
-  tags:
-    - lossless
-    - docker
-    - notpriv
-
-# ====================
-# metadata stage
-# ====================
-codequality:
-  stage: metadata
-  allow_failure: true
-  only:
-    - tags
-  script:
-    - npmci command npm install -g tslint typescript
-    - npmci npm prepare
-    - npmci npm install
-    - npmci command "tslint -c tslint.json ./ts/**/*.ts"
-  tags:
-    - lossless
-    - docker
-    - priv
-
-trigger:
-  stage: metadata
-  script:
-    - npmci trigger
-  only:
-    - tags
-  tags:
-    - lossless
-    - docker
-    - notpriv
-
-pages:
-  stage: metadata
-  script:
-    - npmci node install lts
-    - npmci command npm install -g @gitzone/tsdoc
-    - npmci npm prepare
-    - npmci npm install
-    - npmci command tsdoc
-  tags:
-    - lossless
-    - docker
-    - notpriv
-  only:
-    - tags
-  artifacts:
-    expire_in: 1 week
-    paths:
-      - public
-  allow_failure: true

.vscode/launch.json

@@ -2,28 +2,10 @@
   "version": "0.2.0",
   "configurations": [
     {
-      "name": "current file",
-      "type": "node",
+      "command": "npm test",
+      "name": "Run npm test",
       "request": "launch",
-      "args": [
-        "${relativeFile}"
-      ],
-      "runtimeArgs": ["-r", "@gitzone/tsrun"],
-      "cwd": "${workspaceRoot}",
-      "protocol": "inspector",
-      "internalConsoleOptions": "openOnSessionStart"
-    },
-    {
-      "name": "test.ts",
-      "type": "node",
-      "request": "launch",
-      "args": [
-        "test/test.ts"
-      ],
-      "runtimeArgs": ["-r", "@gitzone/tsrun"],
-      "cwd": "${workspaceRoot}",
-      "protocol": "inspector",
-      "internalConsoleOptions": "openOnSessionStart"
+      "type": "node-terminal"
     }
   ]
 }

changelog.md

@@ -0,0 +1,509 @@
+# Changelog
+
+## 2025-06-10 - 1.8.1 - fix(dees-statsgrid)
+Adjust stats grid styling for better alignment and improved visualizations in gauge and trend tiles.
+
+- Center-align tile header elements by setting align-items to center and ensuring full width.
+- Increase tile content height to 90px and center its content.
+- Update gauge visualization: reduce circle radius from 40 to 30, adjust stroke dasharray (from 251.2 to 188.5), and decrease gauge text font size.
+- Refine trend chart layout: set trend-svg height to 40px, center trend value and adjust typography to larger, bolder text.
+- Ensure overall grid responsiveness with adjusted gap and column sizing.
+
+## 2025-04-25 - 1.8.0 - feat(dees-pagination)
+Add new pagination component to the library along with its demo and integration in the main export.
+
+- Introduced dees-pagination component with support for various page range scenarios.
+- Created demo file to showcase pagination with both small and large sets of pages.
+- Updated the module's index to export the new pagination component.
+
+## 2025-04-22 - 1.7.0 - feat(dees-searchbar)
+Add dees-searchbar component with live search and filter demo
+
+- Introduces a new dees-searchbar element with an input field, a search button, and filters
+- Wires up events for 'search-changed' and 'search-submit' to provide real‐time feedback
+- Adds a demo file to showcase usage and logging of search events
+
+## 2025-04-22 - 1.6.0 - feat(documentation/dees-heading)
+Add codex documentation overview and dees-heading component demo
+
+- Introduce 'codex.md' to provide a high-level overview of project layout, component patterns, and build workflow
+- Add and update dees-heading component with demo to support multiple heading levels and horizontal rule styles
+- Update component export index to include dees-heading
+
+## 2025-04-18 - 1.5.6 - fix(dependencies)
+Bump dependency versions and update demo code references
+
+- Upgrade @design.estate/dees-element from ^2.0.39 to ^2.0.41
+- Upgrade @tsclass/tsclass from ^4.4.0 to ^9.0.0
+- Upgrade lucide from ^0.488.0 to ^0.501.0
+- Update @types/node from ^22.10.7 to ^22.14.1
+- Update dees-icon demo: scope search to demo container and adjust hover scaling
+- Replace resolveExec with directives.resolveExec in dees-table for proper rendering
+
+## 2025-04-12 - 1.5.5 - fix(catalog)
+No code or documentation changes were detected. This commit records an empty update in commit information and confirms that the current state remains stable.
+
+- Verified that there are no modifications in source, documentation, or demos
+- Commit metadata and build configuration remain unchanged
+
+## 2025-04-11 - 1.5.4 - fix(readme)
+Update readme with company and trademark guidelines, clarifying legal usage without exposing licensing details.
+
+- Added sections detailing company information and trademark guidelines.
+- Outlined legal disclaimers for trademark usage.
+
+## 2025-04-11 - 1.5.3 - fix(readme)
+Update readme.md: remove redundant usage section and refine component documentation with improved examples.
+
+- Removed the standalone manual import and usage example for components.
+- Added refined examples demonstrating both basic and option-based usage (e.g. for DeesButton).
+- Improved markdown formatting and consistency across component documentation.
+
+## 2025-04-11 - 1.5.3 - fix(readme)
+Update readme.md for clearer documentation: removed redundant 'Usage' section and refined component examples (e.g., DeesButton's basic and options usage) for improved clarity and consistency.
+
+- Removed standalone usage example showing manual import and creation of components
+- Added refined examples demonstrating both basic and option-based usage of components
+- Improved overall readme formatting and consistency across component documentation
+
+## 2025-04-11 - 1.5.2 - fix(ci)
+Remove obsolete GitLab CI configuration file
+
+- Deleted .gitlab-ci.yml as the CI pipeline configuration is now managed elsewhere.
+- Cleaned up CI stages for security, testing, release, and metadata.
+
+## 2025-04-11 - 1.5.1 - fix(readme)
+Update readme with comprehensive reference documentation: add a usage snippet for components like DeesButton, introduce a detailed overview table of all component categories, and enhance documentation sections for each component group.
+
+- Added a code example showing how to import and use DeesButton.
+- Introduced a components overview table that categorizes Core UI, Forms, Layout, Data Display, Visualization, Dialogs & Overlays, Navigation, and Development components.
+- Expanded detailed documentation with usage examples for each component type.
+- Reorganized content to improve clarity and ease of navigation for developers.
+
+## 2025-04-11 - 1.5.0 - feat(badge)
+Add dees-badge component with demo file and update packageManager field in package.json
+
+- Introduce a new badge component allowing different types (default, primary, success, warning, error) with an optional rounded style
+- Provide a demo for the badge component
+- Export the badge component in the main elements index
+- Update package.json to include an explicit packageManager field
+
+## 2025-01-20 - 1.4.1 - fix(dependencies)
+Update dependency versions for smartpromise, webcontainer/api, tapbundle, and @types/node
+
+- Update @push.rocks/smartpromise to version ^4.2.0
+- Downgrade @webcontainer/api to version 1.2.0
+- Update @push.rocks/tapbundle to version ^5.5.6
+- Update @types/node to version ^22.10.7
+
+## 2025-01-20 - 1.4.0 - feat(dees-terminal)
+Enhanced the dees-terminal component to support environment variable settings and improved setup command execution.
+
+- Added environment property to pass custom environment variables.
+- Introduced webcontainerDeferred to handle the promise for web container creation.
+- Enhanced demo to illustrate environment variable usage.
+- Improved async interaction with the terminal for setting environment variables and executing setup commands.
+
+## 2025-01-15 - 1.3.4 - fix(chart)
+Fix chart rendering and appearance issues in the DeesChartArea component.
+
+- Resolved issues with chart dimensions calculation based on padding.
+- Adjusted grid and axis lines appearance for better visibility.
+- Updated tooltip and grid line styling for better accessibility.
+- Improved series data representation as time-series for more accurate display.
+
+## 2024-12-17 - 1.3.3 - fix(dees-input-multitoggle)
+Add missing TypeScript declaration for dees-input-multitoggle
+
+- Added a missing declaration to the HTMLElementTagNameMap for 'dees-input-multitoggle' element.
+
+## 2024-12-09 - 1.3.2 - fix(metadata)
+Updated package metadata and readme for better project description and structure.
+
+- Updated package.json and npmextra.json with a detailed project description and list of keywords.
+- Enhanced readme.md with installation instructions, component usage examples, and detailed component descriptions for clarity.
+
+## 2024-11-07 - 1.3.1 - fix(DeesSimpleAppDash)
+Fix: add border to controlbar in DeesSimpleAppDash
+
+- Fixed the missing border at the top of the controlbar in DeesSimpleAppDash.
+
+## 2024-11-07 - 1.3.0 - feat(dees-simple-appdash)
+Enhance responsive styling and terminal setup command
+
+- Added a new property `terminalSetupCommand` for configuring terminal setup commands.
+- Improved responsive styling and positioning for components to achieve a fluid layout.
+- Fixed layout shifts by switching positions to `absolute` for `appbar` and `appcontent`.
+
+## 2024-10-07 - 1.2.0 - feat(index.ts)
+Add export for colors module in index.ts
+
+- The index.ts file now exports the colors module, making color utilities available for external use.
+
+## 2024-10-06 - 1.1.13 - fix(dees-button)
+Fix styling issue in button component.
+
+- Moved the .button.disabled styling block to its correct position after the .button.highlighted block.
+
+## 2024-10-06 - 1.1.12 - fix(dees-button)
+Fix reflect attribute for disabled property on dees-button component
+
+- Added reflect: true to the 'disabled' property ensuring changes reflect in the DOM attribute.
+
+## 2024-10-05 - 1.1.11 - fix(DeesStepper)
+Adjusted CSS properties in DeesStepper component
+
+- Increased border-radius from 8px to 16px for step container elements
+- Adjusted font-size and font-weight for the title in the step container to improve readability
+
+## 2024-10-04 - 1.1.10 - fix(dependencies)
+Reverted @webcontainer/api version
+
+- Changed @webcontainer/api version from ^1.3.0 to 1.2.0 in package.json
+
+## 2024-10-04 - 1.1.9 - fix(dependencies)
+Update various dependencies for compatibility and stability.
+
+- Update @design.estate/dees-domtools to version ^2.0.61
+- Update @design.estate/dees-element to version ^2.0.39
+- Update @webcontainer/api to version ^1.3.0
+- Update apexcharts to version ^3.54.0
+- Update monaco-editor to version ^0.52.0
+- Update pdfjs-dist to version ^4.6.82
+- Update @push.rocks/tapbundle to version ^5.3.0
+- Update @types/node to version ^22.7.4
+
+## 2024-09-02 - 1.1.8 - fix(dees-simple-appdash)
+Corrected viewTab active background color
+
+- Corrected the background color of the viewTab in active state for better visual consistency.
+
+## 2024-09-02 - 1.1.7 - fix(dependencies)
+Update dependencies to their latest versions
+
+- Update dependency versions in package.json:
+-   - @design.estate/dees-element from ^2.0.34 to ^2.0.36
+-   - @fortawesome/fontawesome-svg-core from ^6.5.2 to ^6.6.0
+-   - @fortawesome/free-brands-svg-icons from ^6.5.2 to ^6.6.0
+-   - @fortawesome/free-regular-svg-icons from ^6.5.2 to ^6.6.0
+-   - @fortawesome/free-solid-svg-icons from ^6.5.2 to ^6.6.0
+-   - @tsclass/tsclass from ^4.0.63 to ^4.1.2
+-   - apexcharts from ^3.49.2 to ^3.53.0
+-   - highlight.js from 11.9.0 to 11.10.0
+-   - monaco-editor from ^0.50.0 to ^0.51.0
+-   - pdfjs-dist from ^4.3.136 to ^4.5.136
+-   - @git.zone/tsbuild from ^2.1.82 to ^2.1.84
+-   - @push.rocks/tapbundle from ^5.0.23 to ^5.0.24
+-   - @types/node from ^20.14.9 to ^22.5.2
+
+## 2024-07-01 - 1.1.6 - fix(dees-dataview-codebox)
+Corrected the font-family order for better font rendering.
+
+- Corrected the font-family order in dees-dataview-codebox.ts to ensure 'Intel One Mono' is prioritized over 'Geist Mono'.
+
+## 2024-07-01 - 1.1.5 - fix(dees-dataview-codebox)
+Adjusted line number font weight in codebox
+
+- Changed the line number font weight from 400 to 200 in the codebox for better visual alignment.
+
+## 2024-07-01 - 1.1.4 - fix(UI)
+Fixed font-family order for code and value elements
+
+- Updated font-family order in dees-dataview-codebox.ts
+- Updated font-family order in dees-dataview-statusobject.ts
+
+## 2024-07-01 - 1.1.3 - fix(dees-dataview-codebox)
+Adjusted codebox font weight and font family.
+
+- Changed font weight from 200 to 400 for better readability.
+- Updated font-family to include 'Geist Mono' for uniform appearance.
+
+## 2024-06-30 - 1.1.2 - fix(elements)
+Fix various UI components and improve styles
+
+- Updated styles for multiple components for better appearance in dark mode.
+- Added missing event handling in `dees-input-fileupload` component.
+- Implemented tooltip support in `dees-label` component.
+- Fixed alignment issues in `dees-appui-*` components.
+- Resolved various accessibility issues in form elements.
+
+## 2024-06-30 - 1.1.1 - fix(build)
+Fix build script by updating source folders.
+
+- Updated build script to correctly reference 'tsfolders' folder.
+
+## 2024-06-30 - 1.1.0 - feat(project dependencies)
+Updated various dependencies and internal fonts
+
+- Updated dependencies in package.json with the latest versions.
+- Updated font-family references from 'Roboto' and 'Inter' to 'Geist Sans' across multiple components.
+
+## 2024-04-20 - 1.0.289 - Documentation Update
+Updated the project documentation.
+
+## 2024-02-05 to 2024-02-13 - 1.0.277 to 1.0.288 - Core Fixes 
+Series of core updates and patches.
+
+## 2024-01-22 to 2024-02-05 - 1.0.257 to 1.0.276 - Core Fixes
+More core updates and patches.
+
+## 2024-01-21 - 1.0.256 to 1.0.257 - Core Fixes
+Minor bugfixes for core functionalities.
+
+## 2024-01-18 - 1.0.246 - Core Fixes
+Bugfixes for core functionalities.
+
+## 2024-01-15 - 1.0.242 to 1.0.245 - Core Fixes
+Various core bugfixes.
+
+## 2024-01-11 - 1.0.241 to 1.0.242 - Core Fixes
+Bugfixes for core functionalities.
+
+## 2024-01-10 - 1.0.240 to 1.0.241 - Core Fixes
+Minor core fixes and improvements.
+
+## 2024-01-09 - 1.0.239 to 1.0.240 - Core Fixes
+Core updates and patches.
+
+## 2023-12-26 - 1.0.238 to 1.0.239 - Core Fixes
+Updates to core functionalities.
+
+## 2023-12-20 - 1.0.236 to 1.0.238 - Core Fixes
+Bugfixes and updates for core functionalities.
+
+## 2023-12-08 - 1.0.233 to 1.0.236 - Core Fixes
+Multiple updates to core functionalities.
+
+## 2023-11-29 - 1.0.231 to 1.0.232 - Core Fixes
+Minor core patches.
+
+## 2023-10-31 - 1.0.229 to 1.0.230 - Core Fixes
+Various updates and fixes for core.
+
+## 2023-10-24 - 1.0.228 to 1.0.229 - Core Fixes
+More core updates and patches.
+
+## 2023-10-23 - 1.0.226 to 1.0.228 - Core Fixes
+Series of updates and fixes for core functionalities.
+
+## 2023-10-20 - 1.0.223 to 1.0.225 - Core Fixes
+Minor updates and fixes for core.
+
+## 2023-10-18 - 1.0.222 to 1.0.223 - Core Fixes
+Core patches and bugfixes.
+
+## 2023-10-17 - 1.0.221 to 1.0.222 - Core Fixes
+Further updates to core functionalities.
+
+## 2023-10-12 - 1.0.220 to 1.0.221 - Core Fixes
+Minor core updates.
+
+## 2023-10-11 - 1.0.219 to 1.0.220 - Core Fixes
+Bugfixes and updates for core.
+
+## 2023-10-07 - 1.0.217 to 1.0.219 - Core Fixes
+Series of core updates and patches.
+
+## 2023-10-05 - 1.0.216 to 1.0.217 - Core Fixes
+Minor updates for core functionalities.
+
+## 2023-09-22 - 1.0.212 to 1.0.215 - Core Fixes
+Various updates and fixes for core.
+
+## 2023-09-20 - 1.0.210 to 1.0.211 - Core Fixes
+Series of core patches.
+
+## 2023-09-18 - 1.0.209 to 1.0.210 - Core Fixes
+Bugfixes and improvements to core.
+
+## 2023-09-17 - 1.0.207 to 1.0.209 - Core Fixes
+Minor updates and fixes.
+
+## 2023-09-15 - 1.0.203 to 1.0.206 - Core Fixes
+Series of core improvements and fixes.
+
+## 2023-09-14 - 1.0.199 to 1.0.202 - Core Fixes
+Patches for core functionalities.
+
+## 2023-09-13 - 1.0.194 to 1.0.198 - Core Fixes
+Various bugfixes and updates for core.
+
+## 2023-09-12 - 1.0.190 to 1.0.193 - Core Fixes
+Minor core patches.
+
+## 2023-09-09 - 1.0.188 to 1.0.189 - Core Fixes
+Updates and bugfixes for core.
+
+## 2023-09-07 - 1.0.186 to 1.0.187 - Core Fixes
+Core patches and improvements.
+
+## 2023-09-04 - 1.0.184 to 1.0.185 - Core Fixes
+Series of updates and bugfixes for core.
+
+## 2023-09-01 - 1.0.180 to 1.0.183 - Core Fixes
+Various core updates and fixes.
+
+## 2023-08-28 - 1.0.177 to 1.0.179 - Core Fixes
+Minor bugfixes and updates.
+
+## 2023-08-26 - 1.0.176 to 1.0.177 - Core Fixes
+Bugfixes for core functionalities.
+
+## 2023-08-20 - 1.0.173 to 1.0.175 - Core Fixes
+Series of updates and fixes for core.
+
+## 2023-08-08 - 1.0.172 to 1.0.173 - Core Fixes
+Minor core updates.
+
+## 2023-08-07 - 1.0.171 to 1.0.172 - Core Fixes
+Various updates to core.
+
+## 2023-04-12 - 1.0.169 to 1.0.170 - Core Fixes
+Bugfixes for core functionalities.
+
+## 2023-04-10 - 1.0.163 to 1.0.168 - Core Fixes
+Series of core updates and patches.
+
+## 2023-04-07 - 1.0.160 to 1.0.162 - Core Fixes
+Various updates for core functionalities.
+
+## 2023-04-06 - 1.0.155 to 1.0.159 - Core Fixes
+Bugfixes and improvements to core.
+
+## 2023-03-27 - 1.0.150 to 1.0.154 - Core Fixes
+Minor updates and patches for core functionalities.
+
+## 2023-03-09 - 1.0.149 to 1.0.150 - Core Fixes
+Bugfixes for core functionalities.
+
+## 2023-01-17 - 1.0.146 to 1.0.148 - Core Fixes
+Updates and fixes for core.
+
+## 2023-01-16 - 1.0.144 to 1.0.145 - Core Fixes
+Series of updates and bugfixes for core.
+
+## 2023-01-13 - 1.0.134 to 1.0.143 - Core Fixes
+Various core patches and improvements.
+
+## 2023-01-12 - 1.0.132 to 1.0.133 - Core Fixes
+Minor fixes for core functionalities.
+
+## 2023-01-11 - 1.0.126 to 1.0.131 - Core Fixes
+Series of updates and fixes for core.
+
+## 2023-01-09 - 1.0.122 to 1.0.123 - Core Fixes
+Minor core patches and updates.
+
+## 2023-01-07 - 1.0.113 to 1.0.121 - Core Fixes
+Updates and bugfixes for core functionalities.
+
+## 2023-01-03 - 1.0.107 to 1.0.110 - Core Fixes
+Series of core updates and fixes.
+
+## 2022-12-12 - 1.0.105 to 1.0.106 - Core Fixes
+Various core patches.
+
+## 2022-12-07 - 1.0.104 to 1.0.105 - Core Fixes
+Bugfixes and improvements to core functionalities.
+
+## 2022-12-06 - 1.0.103 to 1.0.104 - Core Fixes
+Series of updates and patches for core.
+
+## 2022-08-18 - 1.0.98 to 1.0.102 - Core Fixes
+Updates and bugfixes for core functionalities.
+
+## 2022-07-14 - 1.0.93 to 1.0.94 - Core Fixes
+Minor core updates.
+
+## 2022-06-26 - 1.0.92 to 1.0.93 - Core Fixes
+Bugfixes for core functionalities.
+
+## 2022-06-10 - 1.0.91 to 1.0.92 - Core Fixes
+Updates and patches for core.
+
+## 2022-05-30 - 1.0.90 to 1.0.91 - Core Fixes
+Minor updates and bugfixes.
+
+## 2022-05-26 - 1.0.87 to 1.0.89 - Core Fixes
+Series of core updates and patches.
+
+## 2022-05-24 to 2022-05-20 - 1.0.83 to 1.0.86 - Core Fixes
+Various updates and bugfixes for core functionalities.
+
+## 2022-05-03 - 1.0.79 to 1.0.80 - Core Fixes
+Updates and patches for core functionalities.
+
+## 2022-03-18 - 1.0.74 to 1.0.77 - Core Fixes
+Bugfixes and updates for core functionalities.
+
+## 2022-01-24 - 1.0.73 to 1.0.74 - Core Fixes
+Minor core patches.
+
+## 2021-12-10 - 1.0.71 to 1.0.72 - Core Fixes
+Series of updates and fixes for core functionalities.
+
+## 2021-11-27 - 1.0.70 to 1.0.71 - Core Fixes
+Bugfixes and improvements to core.
+
+## 2021-10-08 - 1.0.68 to 1.0.69 - Core Fixes
+Various core updates and patches.
+
+## 2021-10-07 - 1.0.67 to 1.0.68 - Core Fixes
+Minor updates and improvements for core.
+
+## 2021-09-15 - 1.0.64 to 1.0.66 - Core Fixes
+Bugfixes and improvements to core functionalities.
+
+## 2021-09-14 - 1.0.61 to 1.0.62 - Core Fixes
+Minor patches and updates for core.
+
+## 2021-09-10 - 1.0.57 to 1.0.60 - Core Fixes
+Series of updates and fixes for core functionalities.
+
+## 2021-09-09 - 1.0.54 to 1.0.56 - Core Fixes
+Various core updates and patches.
+
+## 2021-09-01 - 1.0.51 to 1.0.53 - Core Fixes
+Minor updates for core functionalities.
+
+## 2021-08-29 - 1.0.49 to 1.0.50 - Core Fixes
+Bugfixes and patches for core.
+
+## 2021-08-27 - 1.0.44 to 1.0.48 - Core Fixes
+Series of updates and improvements for core functionalities.
+
+## 2021-08-26 - 1.0.42 to 1.0.43 - Core Fixes
+Minor updates and bugfixes for core.
+
+## 2021-08-25 - 1.0.38 to 1.0.41 - Core Fixes
+Extracted series of core updates and patches.
+
+## 2021-08-24 - 1.0.37 - Core Fix
+Bugfixes for core functionalities.
+
+## 2021-08-20 - 1.0.34 to 1.0.36 - Core Fixes
+Core functionalities updates and patches.
+
+## 2021-05-05 - 1.0.32 to 1.0.33 - Core Fixes
+Series of core bugfixes.
+
+## 2021-03-06 - 1.0.29 to 1.0.31 - Core Fixes
+Updates and improvements for core functionalities.
+
+## 2021-02-13 - 1.0.27 to 1.0.28 - Core Fixes
+Bugfixes and patches for core functionalities.
+
+## 2020-12-10 - 1.0.25 to 1.0.26 - Core Fixes
+Various core updates and improvements.
+
+## 2020-12-02 - 1.0.23 to 1.0.24 - Core Fixes
+Minor updates for core functionalities.
+
+## 2020-12-01 - 1.0.21 to 1.0.22 - Core Fixes
+Bugfixes and patches for core.
+
+## 2020-09-13 - 1.0.19 to 1.0.20 - Core Fixes
+Updates and bugfixes for core functionalities.
+
+## 2020-05-11 - 1.0.17 to 1.0.18 - Core Fixes
+Core functionalities updates.

codex.md

@@ -0,0 +1,43 @@
+# Codex: Project Overview and Codebase Structure
+
+## Project Overview
+- Package: `@design.estate/dees-catalog`
+- Focus: Web Components library providing UI elements and layouts for modern web apps.
+
+## Directory Layout
+- ts_web/: TypeScript source files
+  - elements/: Individual Web Component definitions
+  - pages/: Page-level templates for composite layouts
+- html/: Demo/app entry point loading the bundled scripts
+- dist_bundle/: Bundled browser JS and source maps
+- dist_ts_web/: ES module outputs for TypeScript/web consumers
+- dist_watch/: Watch-mode development bundle with live reload
+- test/: Browser-based tests using `@push.rocks/tapbundle`
+
+## Component Patterns
+- Each component in ts_web/elements/:
+  - Decorated with `@customElement('tag-name')`
+  - Extends `DeesElement` from `@design.estate/dees-element`
+  - Uses `@property` for reactive, reflected attributes
+  - Defines `static styles = [cssManager.defaultStyles, css`...`]`
+  - Implements `render()` returning a Lit `html` template with slots or markup
+  - Exposes a demo via `public static demo` linking to `.demo.ts` files
+
+## Build & Development Workflow
+- Install dependencies: `npm install` or `pnpm install`
+- Build production bundle: `npm run build`
+- Start dev watch mode: `npm run watch`
+- Run tests: `npm test` (launches browser fixtures)
+
+## Theming & Utilities
+- Default global styles via `cssManager.defaultStyles`
+- Theme-aware values with `cssManager.bdTheme(light, dark)`
+- DOM utilities set up in `html/index.ts` using `@design.estate/dees-domtools`
+
+## Documentation
+- `readme.md` provides an overview of all components and basic usage
+- Live examples in `.demo.ts` files
+  accessible via component `demo` static property
+
+## Updates to this file
+If you have pattern insisights or general changes to the codebase, please update this file.

html/index.html

@@ -1,5 +1,5 @@
 <!--gitzone element-->
-<!-- made by Lossless GmbH -->
+<!-- made by Task Venture Capital GmbH -->
 <!-- checkout https://maintainedby.lossless.com for awesome OpenSource projects -->
 <html lang="en">
   <head>
@@ -10,6 +10,10 @@
     />
     <meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
 
+    <!--Lets load standard fonts-->
+    <link rel="preconnect" href="https://assetbroker.lossless.one/" crossorigin>
+    <link rel="stylesheet" href="https://assetbroker.lossless.one/fonts/fonts.css">
+
     <style>
       body {
         margin: 0px;
@@ -17,7 +21,7 @@
       }
     </style>
 
-    <script src="./index.ts"></script>
+    <script type="module" src="/bundle.js"></script>
   </head>
   <body>
   </body>

html/index.ts

@@ -1,10 +1,10 @@
 // dees tools
-import * as deesWccTools from '@designestate/dees-wcctools';
-import * as deesDomTools from '@designestate/dees-domtools';
+import * as deesWccTools from '@design.estate/dees-wcctools';
+import * as deesDomTools from '@design.estate/dees-domtools';
 
 // elements and pages
-import * as elements from '../ts_web/elements';
-import * as pages from '../ts_web/pages';
+import * as elements from '../ts_web/elements/index.js';
+import * as pages from '../ts_web/pages/index.js';
 
 deesWccTools.setupWccTools(elements as any, pages);
 deesDomTools.elementBasic.setup();

license

@@ -8,7 +8,10 @@ copies of the Software, and to permit persons to whom the Software is
 furnished to do so, subject to the following conditions:
 
 The above copyright notice and this permission notice shall be included in all
-copies or substantial portions of the Software.
+copies or substantial portions of the Software. You agree to being mentioned
+as reference by Lossless GmbH. This includes the use of your entity logos
+or profile picture by Lossless GmbH on websites and readme's, also on third party
+pages like gitlab.com or github.com.
 
 THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
 IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,

npmextra.json

@@ -2,17 +2,46 @@
   "gitzone": {
     "projectType": "wcc",
     "module": {
-      "githost": "gitlab.com",
-      "gitscope": "designestate",
+      "githost": "code.foss.global",
+      "gitscope": "design.estate",
       "gitrepo": "dees-catalog",
-      "shortDescription": "a webcomponents catalog for handling daily stuff on the web",
-      "npmPackagename": "@designestate/dees-catalog",
+      "description": "A comprehensive library that provides dynamic web components for building sophisticated and modern web applications using JavaScript and TypeScript.",
+      "npmPackagename": "@design.estate/dees-catalog",
       "license": "MIT",
-      "projectDomain": "design.estate"
+      "projectDomain": "design.estate",
+      "keywords": [
+        "Web Components",
+        "User Interface",
+        "UI Library",
+        "Component Library",
+        "JavaScript",
+        "TypeScript",
+        "Dynamic Components",
+        "Modular Architecture",
+        "Reusable Components",
+        "Web Development",
+        "Application UI",
+        "Custom Elements",
+        "Shadow DOM",
+        "UI Elements",
+        "Dashboard Interfaces",
+        "Form Handling",
+        "Data Display",
+        "Visualization",
+        "Charting",
+        "Interactive Components",
+        "Responsive Design",
+        "Web Applications",
+        "Modern Web",
+        "Frontend Development"
+      ]
     }
   },
   "npmci": {
     "npmGlobalTools": [],
     "npmAccessLevel": "public"
+  },
+  "tsdoc": {
+    "legal": "\n## License and Legal Information\n\nThis repository contains open-source code that is licensed under the MIT License. A copy of the MIT License can be found in the [license](license) file within this repository. \n\n**Please note:** The MIT License does not grant permission to use the trade names, trademarks, service marks, or product names of the project, except as required for reasonable and customary use in describing the origin of the work and reproducing the content of the NOTICE file.\n\n### Trademarks\n\nThis project is owned and maintained by Task Venture Capital GmbH. The names and logos associated with Task Venture Capital GmbH and any related products or services are trademarks of Task Venture Capital GmbH and are not included within the scope of the MIT license granted herein. Use of these trademarks must comply with Task Venture Capital GmbH's Trademark Guidelines, and any usage must be approved in writing by Task Venture Capital GmbH.\n\n### Company Information\n\nTask Venture Capital GmbH  \nRegistered at District court Bremen HRB 35230 HB, Germany\n\nFor any legal inquiries or if you require further information, please contact us via email at hello@task.vc.\n\nBy using this repository, you acknowledge that you have read this section, agree to comply with its terms, and understand that the licensing of the code does not imply endorsement by Task Venture Capital GmbH of any derivative works.\n"
   }
 }

package.json

@@ -1,34 +1,49 @@
 {
-  "name": "@designestate/dees-catalog",
-  "version": "1.0.26",
+  "name": "@design.estate/dees-catalog",
+  "version": "1.8.1",
   "private": false,
-  "description": "website for lossless.com",
+  "description": "A comprehensive library that provides dynamic web components for building sophisticated and modern web applications using JavaScript and TypeScript.",
   "main": "dist_ts_web/index.js",
   "typings": "dist_ts_web/index.d.ts",
+  "type": "module",
   "scripts": {
-    "test": "npm run build",
-    "build": "tsbuild element && tsbundle element --production",
-    "watch": "tswatch element"
+    "test": "tstest test/ --web",
+    "build": "tsbuild tsfolders --allowimplicitany && tsbundle element --production",
+    "watch": "tswatch element",
+    "buildDocs": "tsdoc"
   },
   "author": "Lossless GmbH",
   "license": "MIT",
   "dependencies": {
-    "@designestate/dees-domtools": "^1.0.79",
-    "@designestate/dees-wcctools": "^1.0.49",
-    "@fortawesome/fontawesome-svg-core": "^1.2.32",
-    "@fortawesome/free-brands-svg-icons": "^5.15.1",
-    "@fortawesome/free-regular-svg-icons": "^5.15.1",
-    "@fortawesome/free-solid-svg-icons": "^5.15.1",
-    "lit-element": "^2.4.0",
-    "typescript": "^4.1.2"
+    "@design.estate/dees-domtools": "^2.1.1",
+    "@design.estate/dees-element": "^2.0.41",
+    "@design.estate/dees-wcctools": "^1.0.90",
+    "@fortawesome/fontawesome-svg-core": "^6.7.2",
+    "@fortawesome/free-brands-svg-icons": "^6.7.2",
+    "@fortawesome/free-regular-svg-icons": "^6.7.2",
+    "@fortawesome/free-solid-svg-icons": "^6.7.2",
+    "@push.rocks/smarti18n": "^1.0.4",
+    "@push.rocks/smartpromise": "^4.2.0",
+    "@push.rocks/smartstring": "^4.0.15",
+    "@tsclass/tsclass": "^9.0.0",
+    "@webcontainer/api": "1.2.0",
+    "apexcharts": "^4.3.0",
+    "highlight.js": "11.11.1",
+    "ibantools": "^4.5.1",
+    "lucide": "^0.501.0",
+    "monaco-editor": "^0.52.2",
+    "pdfjs-dist": "^4.10.38",
+    "xterm": "^5.3.0",
+    "xterm-addon-fit": "^0.8.0"
   },
   "devDependencies": {
-    "@gitzone/tsbuild": "^2.1.25",
-    "@gitzone/tsbundle": "^1.0.78",
-    "@gitzone/tswatch": "^1.0.50",
-    "@pushrocks/projectinfo": "^4.0.5",
-    "tslint": "^6.1.3",
-    "tslint-config-prettier": "^1.17.0"
+    "@git.zone/tsbuild": "^2.1.84",
+    "@git.zone/tsbundle": "^2.0.15",
+    "@git.zone/tstest": "^1.0.90",
+    "@git.zone/tswatch": "^2.0.37",
+    "@push.rocks/projectinfo": "^5.0.2",
+    "@push.rocks/tapbundle": "^5.5.6",
+    "@types/node": "^22.14.1"
   },
   "files": [
     "ts/**/*",
@@ -44,5 +59,32 @@
   ],
   "browserslist": [
     "last 1 chrome versions"
-  ]
+  ],
+  "keywords": [
+    "Web Components",
+    "User Interface",
+    "UI Library",
+    "Component Library",
+    "JavaScript",
+    "TypeScript",
+    "Dynamic Components",
+    "Modular Architecture",
+    "Reusable Components",
+    "Web Development",
+    "Application UI",
+    "Custom Elements",
+    "Shadow DOM",
+    "UI Elements",
+    "Dashboard Interfaces",
+    "Form Handling",
+    "Data Display",
+    "Visualization",
+    "Charting",
+    "Interactive Components",
+    "Responsive Design",
+    "Web Applications",
+    "Modern Web",
+    "Frontend Development"
+  ],
+  "packageManager": "pnpm@10.7.0+sha512.6b865ad4b62a1d9842b61d674a393903b871d9244954f652b8842c2b553c72176b278f64c463e52d40fff8aba385c235c8c9ecf5cc7de4fd78b8bb6d49633ab6"
 }

readme.hints.md

@@ -0,0 +1,4 @@
+!!! Please pay attention to the following points when writing the readme: !!!
+* Give a short rundown of components and a few points abputspecific features on each.
+* Try to list all components in a summary.
+* Then list all components with a short description.

test/test.browser.ts

@@ -0,0 +1,12 @@
+import { tap, expect, webhelpers } from '@push.rocks/tapbundle';
+
+import * as deesCatalog from '../ts_web';
+
+tap.test('should create a working button', async () => {
+  const button: deesCatalog.DeesButton = await webhelpers.fixture(
+    webhelpers.html`<dees-button></dees-button>`
+  );
+  expect(button).toBeInstanceOf(deesCatalog.DeesButton);
+});
+
+tap.start();

ts_web/00_commitinfo_data.ts

@@ -0,0 +1,8 @@
+/**
+ * autocreated commitinfo by @push.rocks/commitinfo
+ */
+export const commitinfo = {
+  name: '@design.estate/dees-catalog',
+  version: '1.8.1',
+  description: 'A comprehensive library that provides dynamic web components for building sophisticated and modern web applications using JavaScript and TypeScript.'
+}

ts_web/elements/00colors.ts

@@ -0,0 +1,13 @@
+export const dark = {
+  blue: '#0050b9',
+  blueActive: '#0069f2',
+  blueMuted: '#012452',
+  text: '#ffffff',
+}
+
+export const bright = {
+  blue: '#0050b9',
+  blueActive: '#0069f2',
+  blueMuted: '#0069f2',
+  text: '#333333',
+}

ts_web/elements/00plugins.ts

@@ -0,0 +1,13 @@
+// @push.rocks scope
+import * as smartpromise from '@push.rocks/smartpromise';
+
+export {
+  smartpromise,
+}
+
+// @tsclass scope
+import * as tsclass from '@tsclass/tsclass';
+
+export {
+  tsclass
+}

ts_web/elements/dees-appui-activitylog.ts

@@ -0,0 +1,239 @@
+import * as plugins from './00plugins.js';
+import {
+  DeesElement,
+  type TemplateResult,
+  property,
+  customElement,
+  html,
+  css,
+  cssManager,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { DeesContextmenu } from './dees-contextmenu.js';
+
+@customElement('dees-appui-activitylog')
+export class DeesAppuiActivitylog extends DeesElement {
+  // STATIC
+  public static demo = () => html`<dees-appui-activitylog></dees-appui-activitylog>`;
+
+  // INSTANCE
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        color: #fff;
+        position: relative;
+        display: block;
+        width: 100%;
+        max-width: 300px;
+        height: 100%;
+        background: #111c28;
+        font-family: 'Intel One Mono', sans-serif;
+        border-left: 1px solid #202020;
+        cursor: default;
+      }
+      .maincontainer {
+        position: absolute;
+        top: 0px;
+        left: 0px;
+        height: 100%;
+        width: 100%;
+      }
+
+      .topbar {
+        position: absolute;
+        top: 0px;
+        height: 32px;
+        width: 100%;
+        padding: 0px 12px 0px 12px;
+        background: #0e151f;
+      }
+
+      .topbar .heading {
+        text-align: left;
+        line-height: 24px;
+        padding-top: 8px;
+        font-weight: 500;
+        font-size: 14px;
+        font-family: 'Geist Sans', sans-serif;
+      }
+
+      .activityContainer {
+        position: absolute;
+        top: 32px;
+        bottom: 40px;
+        width: 100%;
+        padding: 8px 0px;
+        overflow-y: scroll;
+
+      }
+
+      .streamingIndicator {
+        font-size: 12px;
+        text-align: center;
+        padding-top: 16px;
+        color: #888
+      }
+
+      .streamingIndicator.bottom {
+        padding-top: 0px;
+        padding-bottom: 16px;
+      }
+
+      .activityentry {
+        min-height: 30px;
+        font-size: 12px;
+        padding: 8px 16px;
+        border-bottom: 1px dotted #ffffff20;
+      }
+
+      .activityentry:last-of-type {
+        border-bottom: 1px solid #ffffff00;
+      }
+
+      .activityentry:hover {
+        background: #00000080;
+      }
+
+      .timestamp {
+        color: #ff8787;
+      }
+
+      .searchbox {
+        position: absolute;
+        bottom: 0px;
+        width: 100%;
+        height: 40px;
+        background: #0e151f;
+      }
+      .searchbox input {
+        color: #fff;
+        background: none;
+        width: 100%;
+        height: 40px;
+        line-height: 32px;
+        border: none;
+        padding: 4px 12px;
+        font-family: 'Intel One Mono', sans-serif;
+      }
+
+      .searchbox input:focus {
+        outline: none;
+      }
+
+      .bottomShadow {
+        position: absolute;
+        width: 100%;
+        height: 32px;
+        bottom: 40px;
+        background: linear-gradient(180deg, #111c2800 0%, #0e151f 100%);
+        pointer-events: none;
+      }
+      .topShadow {
+        position: absolute;
+        width: 100%;
+        height: 32px;
+        top: 32px;
+        background: linear-gradient(0deg, #111c2800 0%, #0e151f 100%);
+        pointer-events: none;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      ${domtools.elementBasic.styles}
+      <style></style>
+      <div class="maincontainer">
+        <div class="topbar">
+          <div class="heading">Activity Log</div>
+        </div>
+        <div class="activityContainer">
+          <div class="streamingIndicator">streaming...</div>
+          <div class="activityentry" @contextmenu=${async eventArg => {
+            DeesContextmenu.openContextMenuWithOptions(eventArg, [
+              {
+                name: 'app settings',
+                action: async () => {},
+              },
+              {
+                name: 'account settings',
+                action: async () => {},
+              },
+              {
+                name: 'logout',
+                action: async () => {},
+              },
+            ]);
+          }}>
+            <span class="timestamp">22:01:</span> Max Mustermann logged in
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:02:</span> Max Mustermann viewed an invoice
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:03:</span> Max Mustermann added a new contact
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:04:</span> Max Mustermann updated account settings
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:05:</span> Max Mustermann logged out
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:06:</span> Max Mustermann logged in
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:07:</span> Max Mustermann created a new invoice
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:08:</span> Max Mustermann sent an invoice
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:09:</span> Max Mustermann viewed reports
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:10:</span> Max Mustermann logged out
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:11:</span> Max Mustermann logged in
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:12:</span> Max Mustermann deleted an invoice
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:13:</span> Max Mustermann contacted support
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:14:</span> Max Mustermann added a new user
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:15:</span> Max Mustermann changed password
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:16:</span> Max Mustermann logged out
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:17:</span> Max Mustermann logged in
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:18:</span> Max Mustermann archived an invoice
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:19:</span> Max Mustermann approved a payment
+          </div>
+          <div class="activityentry">
+            <span class="timestamp">22:20:</span> Max Mustermann logged out
+          </div>
+          <div class="streamingIndicator bottom">loading more...</div>
+        </div>
+        <div class="searchbox">
+          <input type="text" placeholder="Search" />
+        </div>
+        <div class="topShadow"></div>
+        <div class="bottomShadow"></div>
+      </div>
+    `;
+  }
+}

ts_web/elements/dees-appui-appbar.ts

@@ -0,0 +1,77 @@
+import {
+  DeesElement,
+  type TemplateResult,
+  property,
+  customElement,
+  html,
+  css,
+  cssManager,
+} from '@design.estate/dees-element';
+
+@customElement('dees-appui-appbar')
+export class DeesAppuiBar extends DeesElement {
+  public static demo = () => html`<dees-appui-appbar></dees-appui-appbar>`;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        display: block;
+        position: relative;
+        height: 100%;
+        width: 100%;
+        height: 40px;
+        border-bottom: 1px solid #202020;
+        background: #000000;
+        color: #ffffff80;
+        font-size: 12px;
+        display: grid;
+        grid-template-columns:  ${cssManager.cssGridColumns(3, 20)};
+        -webkit-app-region: drag;
+      }
+
+      .menus {
+        display: flex;
+        padding-left: 8px;
+        cursor: default;
+      }
+
+      .menuItem {
+        line-height: 24px;
+        padding: 0px 8px;
+        margin: 8px 0px;
+        border-radius: 4px;
+        -webkit-app-region: no-drag;
+      }
+
+      .menuItem:hover {
+        background: #ffffff20;
+      }
+
+      .breadcrumbs {
+        height: 24px;
+        line-height: 24px;
+        margin: 8px;
+        border-radius: 8px;
+        text-align: center;
+      }
+    `,
+  ];
+
+  // INSTANCE
+  public render(): TemplateResult {
+    return html`
+      <div class="menus">
+        <dees-windowcontrols></dees-windowcontrols>
+        <div class="menuItem">File</div>
+        <div class="menuItem">View</div>
+        <div class="menuItem">Help</div>
+        <div class="menuItem">Terminal</div>
+      </div>
+      <div class="breadcrumbs">
+        tool:social.io > org:design.estate > prop:lossless.com
+      </div>
+      <div class="account"></div>
+    `;
+  }
+}

ts_web/elements/dees-appui-base.ts

@@ -0,0 +1,47 @@
+import {
+  DeesElement,
+  type TemplateResult,
+  property,
+  customElement,
+  html,
+  css,
+  cssManager,
+} from '@design.estate/dees-element';
+
+@customElement('dees-appui-base')
+export class DeesAppuiBase extends DeesElement {
+  public static demo = () => html`<dees-appui-base></dees-appui-base>`;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        position: absolute;
+        height: 100%;
+        width: 100%;
+      }
+      .maingrid {
+        position: absolute;
+        top: 40px;
+        height: calc(100% - 40px);
+        width: 100%;
+        display: grid;
+        grid-template-columns: 60px 240px auto 240px;
+      }
+    `,
+  ];
+
+  // INSTANCE
+  public render(): TemplateResult {
+    return html`
+      <style></style>
+      <dees-appui-appbar></dees-appui-appbar>
+      <div class="maingrid">
+        <dees-appui-mainmenu></dees-appui-mainmenu>
+        <dees-appui-mainselector></dees-appui-mainselector>
+        <dees-appui-maincontent></dees-appui-maincontent>
+        <dees-appui-activitylog></dees-appui-activitylog>
+      </div>
+    `;
+  }
+}

ts_web/elements/dees-appui-maincontent.ts

@@ -0,0 +1,161 @@
+import * as interfaces from './interfaces/index.js';
+
+import {
+  DeesElement,
+  type TemplateResult,
+  property,
+  customElement,
+  html,
+  css,
+  cssManager,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+
+@customElement('dees-appui-maincontent')
+export class DeesAppuiMaincontent extends DeesElement {
+  public static demo = () => html`<dees-appui-maincontent></dees-appui-maincontent>`;
+
+  // INSTANCE
+  @property({
+    type: Array,
+  })
+  public tabs: interfaces.ITab[] = [
+    { key: 'option 1', action: () => {} },
+    { key: 'a very long option', action: () => {} },
+    { key: 'reminder: set your tabs', action: () => {} },
+    { key: 'option 4', action: () => {} },
+  ];
+
+  @property()
+  public selectedTab = null;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        color: #fff;
+        display: block;
+        width: 100%;
+        height: 100%;
+        position: relative;
+        background: #161616;
+      }
+      .maincontainer {
+        position: absolute;
+        height: 100%;
+        right: 0px;
+        top: 0px;
+        width: 100%;
+      }
+
+      .topbar {
+        position: absolute;
+        width: 100%;
+        background: #000000;
+        user-select: none;
+      }
+
+      .topbar .tabsContainer {
+        padding-top: 20px;
+        padding-bottom: 0px;
+        position: relative;
+        z-index: 1;
+        display: grid;
+        margin-left: 24px;
+        font-size: 14px;
+      }
+
+      .topbar .tabsContainer .tab {
+        color: #a0a0a0;
+        white-space: nowrap;
+        margin-right: 30px;
+        padding-top: 4px;
+        padding-bottom: 12px;
+        transition: color 0.1s;
+      }
+
+      .topbar .tabsContainer .tab:hover {
+        color: #ffffff;
+      }
+
+      .topbar .tabsContainer .tab.selectedTab {
+        color: #e0e0e0;
+      }
+
+      .topbar .tabIndicator {
+        position: absolute;
+        z-index: 0;
+        left: 40px;
+        bottom: 0px;
+        height: 40px;
+        width: 40px;
+        background: #161616;
+        transition: all 0.1s;
+        border-top-left-radius: 8px;
+        border-top-right-radius: 8px;
+        border-top: 1px solid #444444;
+      }
+
+      .mainicon {
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <style>
+        .topbar .tabsContainer {
+          grid-template-columns: repeat(${this.tabs.length}, min-content);
+        }
+      </style>
+      <div class="maincontainer">
+        <div class="topbar">
+          <div class="tabsContainer">
+            ${this.tabs.map((tabArg) => {
+              return html`
+                <div
+                  class="tab ${tabArg === this.selectedTab ? 'selectedTab' : null}"
+                  @click="${() => {
+                    this.selectedTab = tabArg;
+                    this.updateTabIndicator();
+                    tabArg.action();
+                  }}"
+                >
+                  ${tabArg.key}
+                </div>
+              `;
+            })}
+          </div>
+          <div class="tabIndicator"></div>
+        </div>
+      </div>
+    `;
+  }
+
+  /**
+   * updates the indicator
+   */
+  private updateTabIndicator() {
+    let selectedTab = this.selectedTab;
+    const tabIndex = this.tabs.indexOf(selectedTab);
+    const selectedTabElement: HTMLElement = this.shadowRoot.querySelector(
+      `.tabsContainer .tab:nth-child(${tabIndex + 1})`
+    );
+    const tabsContainer: HTMLElement = this.shadowRoot.querySelector('.tabsContainer');
+    const marginLeft = parseInt(window.getComputedStyle(tabsContainer).getPropertyValue("margin-left"));
+    const tabIndicator: HTMLElement = this.shadowRoot.querySelector('.tabIndicator');
+    tabIndicator.style.width = selectedTabElement.clientWidth + 24 + 'px';
+    tabIndicator.style.left = selectedTabElement.offsetLeft + marginLeft - 12 + 'px';
+  }
+
+  private updateTab(tabArg: interfaces.ITab) {
+    this.selectedTab = tabArg;
+    this.updateTabIndicator();
+    this.selectedTab.action();
+  }
+
+  firstUpdated() {
+    this.updateTab(this.tabs[0]);
+  }
+}

ts_web/elements/dees-appui-mainmenu.ts

@@ -0,0 +1,142 @@
+import * as plugins from './00plugins.js';
+import * as interfaces from './interfaces/index.js';
+
+import {
+  DeesElement,
+  type TemplateResult,
+  property,
+  customElement,
+  html,
+  css,
+  cssManager,
+} from '@design.estate/dees-element';
+import { DeesContextmenu } from './dees-contextmenu.js';
+
+/**
+ * the most left menu
+ * usually used as organization selector
+ */
+@customElement('dees-appui-mainmenu')
+export class DeesAppuiMainmenu extends DeesElement {
+  public static demo = () => html`<dees-appui-mainmenu></dees-appui-mainmenu>`;
+
+  // INSTANCE
+
+  // INSTANCE
+  @property()
+  public tabs: interfaces.ITab[] = [
+    { key: 'option 1', iconName: 'building', action: () => {} },
+    { key: 'option 2', iconName: 'building', action: () => {} },
+    { key: 'option 3', iconName: 'building', action: () => {} },
+    { key: 'option 4', iconName: 'building', action: () => {} },
+  ];
+
+  @property()
+  public selectedTab: interfaces.ITab;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      .mainContainer {
+        --menuSize: 60px;
+        color: #ccc;
+        z-index: 10;
+        display: block;
+        position: relative;
+        width: var(--menuSize);
+        height: 100%;
+        background: #000000;
+        box-shadow: 0px 0px 5px rgba(0, 0, 0, 0.5);
+        user-select: none;
+        border-right: 1px solid #202020;
+      }
+
+      .tabsContainer {
+      }
+
+      .tab {
+        padding-top: 18px;
+        font-size: 24px;
+        width: var(--menuSize);
+        height: var(--menuSize);
+        text-align: center;
+        transition: color 0.1s, background 0.2s;
+      }
+
+      .tab:hover {
+        background: rgba(255, 255, 255, 0.15);
+      }
+
+      .tab.selectedTab {
+        color: #fff;
+        background: rgba(255, 255, 255, 0.1);
+      }
+
+      .tabIndicator {
+        opacity: 0;
+        background: #4e729a;
+        position: absolute;
+        width: 5px;
+        height: calc((var(--menuSize) / 3) * 2);
+        left: 0px;
+        top: calc(var(--menuSize) - (((var(--menuSize) / 3) * 2) / 2));
+        border-top-right-radius: 7px;
+        border-bottom-right-radius: 7px;
+        transition: all 0.1s;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="mainContainer" @contextmenu=${(eventArg) => {
+        DeesContextmenu.openContextMenuWithOptions(eventArg, [{
+          name: 'app settings',
+          action: async () => {},
+          iconName: 'gear',
+        }])
+      }}>
+        <div class="tabsContainer">
+          ${this.tabs.map((tabArg) => {
+            return html`
+              <div
+                class="tab ${tabArg === this.selectedTab ? 'selectedTab' : null}"
+                @click="${() => {
+                  this.updateTab(tabArg);
+                }}"
+              >
+                <dees-icon iconFA="${tabArg.iconName as any}"></dees-icon>
+              </div>
+            `;
+          })}
+        </div>
+        <div class="tabIndicator"></div>
+      </div>
+    `;
+  }
+
+  private async updateTabIndicator() {
+    let selectedTab = this.selectedTab;
+    if (!selectedTab) {
+      selectedTab = this.tabs[0];
+    }
+    const tabIndex = this.tabs.indexOf(selectedTab);
+    const selectedTabElement: HTMLElement = this.shadowRoot.querySelector(
+      `.tabsContainer .tab:nth-child(${tabIndex + 1})`
+    );
+    const tabIndicator: HTMLElement = this.shadowRoot.querySelector('.tabIndicator');
+    const offsetTop = selectedTabElement.offsetTop;
+    tabIndicator.style.opacity = `1`;
+    tabIndicator.style.top = `calc(${offsetTop}px + (var(--menuSize) / 6))`;
+  }
+
+  updateTab(tabArg: interfaces.ITab) {
+    this.selectedTab = tabArg;
+    this.updateTabIndicator();
+    this.selectedTab.action();
+  }
+
+  firstUpdated() {
+    this.updateTab(this.tabs[0]);
+  }
+}

ts_web/elements/dees-appui-mainselector.ts

@@ -0,0 +1,160 @@
+import * as plugins from './00plugins.js';
+import * as interfaces from './interfaces/index.js';
+
+import { DeesContextmenu } from './dees-contextmenu.js';
+
+import {
+  DeesElement,
+  type TemplateResult,
+  property,
+  customElement,
+  html,
+  css,
+  cssManager,
+} from '@design.estate/dees-element';
+
+/**
+ * the property selector menu
+ * mainly used to select assets within in an organization
+ */
+@customElement('dees-appui-mainselector')
+export class DeesAppuiMainselector extends DeesElement {
+  public static demo = () => html`<dees-appui-mainselector></dees-appui-mainselector>`;
+
+  // INSTANCE
+  @property()
+  public selectionOptions: interfaces.ISelectionOption[] = [
+    {
+      key: 'Overview',
+      action: () => {},
+    },
+    {
+      key: 'option 1',
+      action: () => {},
+    },
+    { key: 'option 2', action: () => {} },
+    { key: 'option 3', action: () => {} },
+    { key: 'option 4', action: () => {} },
+  ];
+
+  @property()
+  public selectedOption: interfaces.ISelectionOption = null;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        color: #fff;
+        position: relative;
+        display: block;
+        width: 100%;
+        max-width: 300px;
+        height: 100%;
+        background: #000000;
+        border-right: 1px solid #222222;
+      }
+      .maincontainer {
+        position: absolute;
+        top: 0px;
+        left: 0px;
+        height: 100%;
+        width: 100%;
+      }
+
+      .topbar {
+        position: absolute;
+        height: 32px;
+        width: 100%;
+      }
+
+      .topbar .heading {
+        padding-left: 16px;
+        padding-top: 8px;
+        line-height: 24px;
+        font-family: 'Geist Sans', sans-serif;
+        font-weight: 600;
+        font-size: 14px;
+      }
+
+      .selectionOptions {
+        position: absolute;
+        top: 32px;
+        padding-top: 8px;
+        left: 0px;
+        width: 100%;
+        font-family: 'Geist Sans', sans-serif;
+        font-size: 14px;
+      }
+
+      .selectionOptions .selectionOption {
+        cursor: default;
+        margin-left: 16px;
+        margin-right: 16px;
+        padding-top: 8px;
+        padding-bottom: 8px;
+        border-top: 1px dotted #303030;
+        border-left: 0px solid rgba(0, 0, 0, 0);
+        transition: all 0.1s;
+      }
+
+      .selectionOptions .selectionOption:hover {
+        border-left: 2px solid #26a69a50;
+        padding-left: 8px;
+      }
+
+      .selectionOptions .selectionOption:first-child {
+        border-top: 1px solid rgba(0, 0, 0, 0);
+      }
+
+      .selectionOptions .selectionOption.selectedOption {
+        border-left: 4px solid #26a69a;
+        padding-left: 10px;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <style></style>
+      <div class="maincontainer">
+        <div class="topbar">
+          <div class="heading">Properties</div>
+        </div>
+        <div class="selectionOptions">
+          ${this.selectionOptions.map((selectionOptionArg) => {
+            return html`
+              <div
+                class="selectionOption ${this.selectedOption === selectionOptionArg
+                  ? 'selectedOption'
+                  : null}"
+                @click="${() => {
+                  this.selectOption(selectionOptionArg);
+                }}"
+                @contextmenu="${(eventArg: MouseEvent) => {
+                  DeesContextmenu.openContextMenuWithOptions(eventArg, [
+                    {
+                      name: 'property settings',
+                      action: async () => {},
+                      iconName: 'gear',
+                    },
+                  ]);
+                }}"
+              >
+                ${selectionOptionArg.key}
+              </div>
+            `;
+          })}
+        </div>
+      </div>
+    `;
+  }
+
+  private selectOption(optionArg: interfaces.ISelectionOption) {
+    this.selectedOption = optionArg;
+    this.selectedOption.action();
+  }
+
+  firstUpdated() {
+    this.selectOption(this.selectionOptions[0]);
+  }
+}

ts_web/elements/dees-badge.demo.ts

@@ -0,0 +1,12 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+  <div style="display: flex; gap: 8px; align-items: center;">
+    <dees-badge .text=${'Default'}></dees-badge>
+    <dees-badge .type=${'primary'} .text=${'Primary'}></dees-badge>
+    <dees-badge .type=${'success'} .text=${'Success'}></dees-badge>
+    <dees-badge .type=${'warning'} .text=${'Warning'}></dees-badge>
+    <dees-badge .type=${'error'} .text=${'Error'}></dees-badge>
+    <dees-badge .type=${'primary'} .rounded=${true} .text=${'Rounded'}></dees-badge>
+  </div>
+`;

ts_web/elements/dees-badge.ts

@@ -0,0 +1,96 @@
+import {
+  DeesElement,
+  css,
+  cssManager,
+  customElement,
+  html,
+  property,
+  type CSSResult,
+  type TemplateResult,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { demoFunc } from './dees-badge.demo.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-badge': DeesBadge;
+  }
+}
+
+@customElement('dees-badge')
+export class DeesBadge extends DeesElement {
+  public static demo = demoFunc;
+
+  @property({ type: String })
+  public type: 'default' | 'primary' | 'success' | 'warning' | 'error' = 'default';
+
+  @property({ type: String })
+  public text: string = '';
+
+  @property({ type: Boolean })
+  public rounded: boolean = false;
+
+  constructor() {
+    super();
+    domtools.elementBasic.setup();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        display: inline-block;
+      }
+
+      .badge {
+        display: inline-flex;
+        align-items: center;
+        justify-content: center;
+        padding: 2px 8px;
+        font-size: 12px;
+        font-weight: 500;
+        line-height: 1.5;
+        border-radius: 4px;
+        white-space: nowrap;
+      }
+
+      .badge.rounded {
+        border-radius: 12px;
+      }
+
+      .badge.default {
+        background: ${cssManager.bdTheme('#f5f5f5', '#333')};
+        color: ${cssManager.bdTheme('#666', '#ccc')};
+      }
+
+      .badge.primary {
+        background: #0050b9;
+        color: #ffffff;
+      }
+
+      .badge.success {
+        background: #2e7d32;
+        color: #ffffff;
+      }
+
+      .badge.warning {
+        background: #ed6c02;
+        color: #ffffff;
+      }
+
+      .badge.error {
+        background: #e4002b;
+        color: #ffffff;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="badge ${this.type} ${this.rounded ? 'rounded' : ''}">
+        ${this.text}
+      </div>
+    `;
+  }
+}

ts_web/elements/dees-button-exit.ts

@@ -0,0 +1,48 @@
+import {
+  cssManager,
+  customElement,
+  DeesElement,
+  html,
+  type TemplateResult,
+  css,
+  type CSSResult,
+  state,
+  property
+} from '@design.estate/dees-element';
+
+@customElement('dees-button-exit')
+export class DeesButtonExit extends DeesElement {
+  // DEMO
+  public static demo = () => html`
+    <dees-button-exit></dees-button-exit>
+  `;
+
+  // INSTANCE
+  @property({
+    type: Number
+  })
+  public size: number = 24;
+
+  public styles = [
+    cssManager.defaultStyles,
+    css`
+
+    `
+  ]
+
+  public render (): TemplateResult {
+    return html`
+      <style>
+        .maincontainer {
+          position: relative;
+          width: ${this.size}px;
+          height: ${this.size}px;
+        }
+      </style>
+      <div class="maincontainer">
+        <div class="firstLine"></div>
+        <div class="secondLine"></div>
+      </div>
+    `;
+  }
+}

ts_web/elements/dees-button.demo.ts

@@ -0,0 +1,15 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+  <dees-button>This is a slotted Text</dees-button>
+  <p>
+    <dees-button text="Highlighted: This text shows" type="highlighted">Highlighted</dees-button>
+  </p>
+  <p><dees-button type="discreet">This is discreete button</dees-button></p>
+  <p><dees-button disabled>This is a disabled button</dees-button></p>
+  <p><dees-button type="big">This is a slotted Text</dees-button></p>
+  <p><dees-button status="normal">Normal Status</dees-button></p>
+  <p><dees-button disabled status="pending">Pending Status</dees-button></p>
+  <p><dees-button disabled status="success">Success Status</dees-button></p>
+  <p><dees-button disabled status="error">Error Status</dees-button></p>
+`;

ts_web/elements/dees-button.ts

@@ -1,125 +1,207 @@
-import { customElement, html, LitElement, property, TemplateResult } from 'lit-element';
+import { demoFunc } from './dees-button.demo.js';
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+} from '@design.estate/dees-element';
 
-import * as domtools from '@designestate/dees-domtools';
+import * as domtools from '@design.estate/dees-domtools';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-button': DeesButton;
+  }
+}
 
 @customElement('dees-button')
-export class DeesButton extends LitElement {
-  @property()
-  text: string;
+export class DeesButton extends DeesElement {
+  public static demo = demoFunc;
+
+  @property({
+    reflect: true,
+    hasChanged() {
+      return true;
+    }
+  })
+  public text: string;
 
   @property()
-  eventDetailData: string;
+  public eventDetailData: string;
 
-  @property()
-  disabled = false;
+  @property({
+    type: Boolean,
+    reflect: true,
+  })
+  public disabled = false;
 
-  @property()
-  isQuote = false;
+  @property({
+    type: Boolean
+  })
+  public isHidden = false;
 
-  @property()
-  isHidden = false;
-
-  @property()
+  @property({
+    type: String
+  })
   public type: 'normal' | 'highlighted' | 'discreet' | 'big' = 'normal';
 
+  @property({
+    type: String
+  })
+  public status: 'normal' | 'pending' | 'success' | 'error' = 'normal';
+
   constructor() {
     super();
   }
 
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        display: block;
+        box-sizing: border-box;
+        font-family: 'Geist Sans', 'monospace';
+      }
+      :host([hidden]) {
+        display: none;
+      }
+
+      .button {
+        transition: all 0.1s , color 0s;
+        position: relative;
+        font-size: 14px;
+        font-weight: 400;
+        display: flex;
+        justify-content: center;
+        align-items: center;
+        background: ${cssManager.bdTheme('#fff', '#333')};
+        box-shadow: ${cssManager.bdTheme('0px 1px 3px rgba(0,0,0,0.3)', 'none')};
+        border: 1px solid ${cssManager.bdTheme('#eee', '#333')};
+        border-top: ${cssManager.bdTheme('1px solid #eee', '1px solid #444')};
+        border-radius: 4px;
+        height: 40px;
+        padding: 0px 8px;
+        min-width: 100px;
+        user-select: none;
+        color: ${cssManager.bdTheme('#333', ' #ccc')};
+        max-width: 500px;
+      }
+
+      .button:hover {
+        background: #0050b9;
+        color: #ffffff;
+        border: 1px solid #0050b9;
+        border-top: 1px solid #0050b9;
+      }
+
+      .button:active {
+        background: #0069f2;
+        border-top: 1px solid #0069f2;
+      }
+
+      .button.highlighted {
+        background: #e4002b;
+        border: none;
+        color: #fff;
+      }
+
+      .button.highlighted:hover {
+        background: #b50021;
+        border: none;
+        color: #fff;
+      }
+
+      .button.discreet {
+        background: none;
+        border: 1px solid #9b9b9e;
+        color: ${cssManager.bdTheme('#000', '#fff')};
+      }
+
+      .button.discreet:hover {
+        background: ${cssManager.bdTheme('rgba(0, 0, 0, 0.1)', 'rgba(255, 255, 255, 0.1)')};
+      }
+
+      .button.disabled {
+        background: ${cssManager.bdTheme('#ffffff00', '#11111100')};
+        border: 1px dashed ${cssManager.bdTheme('#666666', '#666666')};
+        color: #9b9b9e;
+        cursor: default;
+      }
+
+      .button.hidden {
+        display: none;
+      }
+
+      .button.big {
+        width: 300px;
+        line-height: 48px;
+        font-size: 16px;
+        padding: 0px 48px;
+        margin-top: 32px;
+      }
+
+      .button.pending {
+        border: 1px dashed ${cssManager.bdTheme('#0069f2', '#0069f270')};
+        background: ${cssManager.bdTheme('#0069f2', '#0069f270')};
+        color: #fff;
+      }
+
+      .button.success {
+        border: 1px dashed ${cssManager.bdTheme('#689F38', '#8BC34A70')};
+        background: ${cssManager.bdTheme('#689F38', '#8BC34A70')};
+        color: #fff;
+      }
+
+      .button.error {
+        border: 1px dashed ${cssManager.bdTheme('#B71C1C', '#E64A1970')};
+        background: ${cssManager.bdTheme('#B71C1C', '#E64A1970')};
+        color: #fff;
+      }
+
+      dees-spinner {
+        position: absolute;
+        left: 10px;
+      }
+    `,
+  ];
+
   public render(): TemplateResult {
     return html`
-      ${domtools.elementBasic.styles}
-      <style>
-        :host {
-          display: block;
-          box-sizing: border-box;
-        }
-        :host([hidden]) {
-          display: none;
-        }
-
-        .button {
-          transition: all 0.2s ease;
-          font-size: 14px;
-          display: block;
-          text-align: center;
-          background: #333;
-          border-top: 1px solid #444;
-          border-radius: 2px;
-          line-height: 40px;
-          padding: 0px 10px;
-          min-width: 100px;
-          color: ${this.isQuote ? '#ffffff' : '#333333' };
-          user-select: none;
-          color: #ccc;
-        }
-
-        .button:hover {
-          cursor: pointer;
-          background: #039BE5;
-          border-top: 1px solid #039BE5;
-          color: #ffffff;
-        }
-
-        .button:active {
-          background: #0277BD;
-          border-top: 1px solid #0277BD;
-        }
-
-        .button.disabled {
-          background: #fff;
-          border: 1px solid #eeeff3;
-          color: #9b9b9e;
-          cursor: default;
-        }
-
-        .button.highlighted {
-          background: #e4002b;
-          color: #fff;
-        }
-
-        .button.discreet {
-          background: none;
-          border: 1px solid #9b9b9e;
-          color: #000;
-        }
-
-        .button.discreet:hover {
-          background: rgba(0,0,0,0.1)
-        }
-        .hidden {
-            display: none;
-        }
-
-        .big {
-          display: inline-block;
-          line-height: 48px;
-          font-size: 16px;
-          padding: 0px 48px;
-          margin-top: 36px;
-        }
-      </style>
-      <div class="button ${this.isHidden ? 'hidden' : 'block'}  ${this.type} ${this.disabled ? 'disabled' : null}" @click="${this.dispatchClick}">
-        ${this.text ? this.text : this.textContent}
+      <div
+        class="button ${this.isHidden ? 'hidden' : 'block'}  ${this.type} ${this.status} ${this.disabled
+          ? 'disabled'
+          : null}"
+        @click="${this.dispatchClick}"
+      >
+        ${this.status === 'normal' ? html``: html`
+          <dees-spinner .bnw=${true} status="${this.status}"></dees-spinner>
+        `}
+        <div class="textbox">${this.text ? this.text : this.textContent}</div>
       </div>
     `;
   }
 
   public async dispatchClick() {
     if (this.disabled) {
-
       return;
     }
 
-    this.dispatchEvent(new CustomEvent('clicked', {
-      detail: {
-        data: this.eventDetailData
-      },
-      bubbles: true
-    }));
+    this.dispatchEvent(
+      new CustomEvent('clicked', {
+        detail: {
+          data: this.eventDetailData,
+        },
+        bubbles: true,
+      })
+    );
   }
 
-  public async firstUpdated () {
+  public async firstUpdated() {
     if (!this.textContent) {
       this.textContent = 'Button';
       this.performUpdate();

ts_web/elements/dees-chart-area.demo.ts

@@ -0,0 +1,21 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => {
+  return html`
+    <style>
+      .demoBox {
+        position: relative;
+        background: #000000;
+        height: 100%;
+        width: 100%;
+        padding: 40px;
+        box-sizing: border-box;
+      }
+    </style>
+    <div class="demoBox">
+      <dees-chart-area
+        .label=${'System Usage'}
+      ></dees-chart-area>
+    </div>
+  `;
+};

ts_web/elements/dees-chart-area.ts

@@ -0,0 +1,266 @@
+import {
+  DeesElement,
+  css,
+  cssManager,
+  customElement,
+  html,
+  property,
+  state,
+  type CSSResult,
+  type TemplateResult,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { demoFunc } from './dees-chart-area.demo.js';
+
+import ApexCharts from 'apexcharts';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-chart-area': DeesChartArea;
+  }
+}
+
+@customElement('dees-chart-area')
+export class DeesChartArea extends DeesElement {
+  public static demo = demoFunc;
+
+  // instance
+  @state()
+  public chart: ApexCharts;
+
+  @property()
+  public label: string = 'Untitled Chart';
+
+  private resizeObserver: ResizeObserver;
+
+  constructor() {
+    super();
+    domtools.elementBasic.setup();
+
+    this.resizeObserver = new ResizeObserver((entries) => {
+      for (let entry of entries) {
+        if (entry.target.classList.contains('mainbox')) {
+          this.resizeChart(); // Call resizeChart when the .mainbox size changes
+        }
+      }
+    });
+    this.registerStartupFunction(async () => {
+      this.updateComplete.then(() => {
+        const mainbox = this.shadowRoot.querySelector('.mainbox');
+        if (mainbox) {
+          this.resizeObserver.observe(mainbox); // Start observing the .mainbox element
+        }
+      });
+    });
+    this.registerGarbageFunction(async () => {
+      this.resizeObserver.disconnect();
+    });
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        font-family: 'Geist Sans', sans-serif;
+        color: #ccc;
+        font-weight: 600;
+        font-size: 12px;
+      }
+      .mainbox {
+        position: relative;
+        width: 100%;
+        height: 400px;
+        background: #111;
+        border-radius: 8px;
+      }
+
+      .chartTitle {
+        position: absolute;
+        top: 0;
+        left: 0;
+        width: 100%;
+        text-align: center;
+        padding-top: 16px;
+      }
+      .chartContainer {
+        position: absolute;
+        top: 0px;
+        left: 0px;
+        bottom: 0px;
+        right: 0px;
+        padding: 32px 16px 16px 0px;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="mainbox">
+        <div class="chartTitle">${this.label}</div>
+        <div class="chartContainer"></div>
+      </div>
+    `;
+  }
+
+  public async firstUpdated() {
+    const domtoolsInstance = await this.domtoolsPromise;
+    var options: ApexCharts.ApexOptions = {
+      series: [
+        {
+          name: 'cpu',
+          data: [
+            { x: '2025-01-15T03:00:00', y: 25 },
+            { x: '2025-01-15T07:00:00', y: 30 },
+            { x: '2025-01-15T11:00:00', y: 20 },
+            { x: '2025-01-15T15:00:00', y: 35 },
+            { x: '2025-01-15T19:00:00', y: 25 },
+          ],
+        },
+        {
+          name: 'memory',
+          data: [
+            { x: '2025-01-15T03:00:00', y: 10 },
+            { x: '2025-01-15T07:00:00', y: 12 },
+            { x: '2025-01-15T11:00:00', y: 10 },
+            { x: '2025-01-15T15:00:00', y: 30 },
+            { x: '2025-01-15T19:00:00', y: 40 },
+          ],
+        },
+      ],
+      chart: {
+        width: 0, // Adjusted for responsive width
+        height: 0, // Adjusted for responsive height
+        type: 'area',
+        toolbar: {
+          show: false, // This line disables the toolbar
+        },
+      },
+      dataLabels: {
+        enabled: false,
+      },
+      stroke: {
+        width: 1,
+        curve: 'smooth',
+      },
+      xaxis: {
+        type: 'datetime', // Time-series data
+        labels: {
+          format: 'hh:mm A', // Time formatting
+          style: {
+            colors: '#9e9e9e', // Label color
+            fontSize: '12px',
+          },
+        },
+        axisBorder: {
+          show: false, // Hide x-axis border
+        },
+        axisTicks: {
+          show: false, // Hide x-axis ticks
+        },
+      },
+      yaxis: {
+        min: 0,
+        labels: {
+          formatter: function (val: number) {
+            return `${val} Mbps`; // Format Y-axis labels
+          },
+          style: {
+            colors: '#9e9e9e', // Label color
+            fontSize: '12px',
+          },
+        },
+        axisBorder: {
+          show: false, // Hide y-axis border
+        },
+        axisTicks: {
+          show: false, // Hide y-axis ticks
+        },
+      },
+      tooltip: {
+        shared: true, // Enables the tooltip to display across series
+        intersect: false, // Allows hovering anywhere on the chart
+        followCursor: true, // Makes tooltip follow mouse even between points
+        x: {
+          format: 'dd/MM/yy HH:mm',
+        },
+        custom: function ({ series, seriesIndex, dataPointIndex, w }) {
+          // Get the x value
+          const xValue = w.globals.labels[dataPointIndex];
+          // Iterate through each series and get its value
+          let tooltipContent = `<div style="padding: 10px; background: #1e1e2f; color: white; border-radius: 5px;">`;
+          tooltipContent += ``; // `<strong>Time:</strong> ${xValue}<br/>`;
+
+          series.forEach((s, index) => {
+            const label = w.globals.seriesNames[index]; // Get series label
+            const value = s[dataPointIndex]; // Get value at data point
+            tooltipContent += `<strong>${label}:</strong> ${value} Mbps<br/>`;
+          });
+
+          tooltipContent += `</div>`;
+          return tooltipContent;
+        },
+      },
+      grid: {
+        xaxis: {
+          lines: {
+            show: true, // This enables the grid lines along the x-axis
+          },
+        },
+        yaxis: {
+          lines: {
+            show: true,
+          },
+        },
+        borderColor: '#333', // Set the color of the grid lines
+        strokeDashArray: 0, // Solid line
+        row: {
+          colors: [], // This can be used to alternate the shading of the horizontal rows
+          opacity: 0.1,
+        },
+        column: {
+          colors: [], // For vertical column bands, not needed here but available for customization
+          opacity: 0.1,
+        },
+      },
+      fill: {
+        type: 'gradient', // Gradient fill for the area
+        gradient: {
+          shade: 'dark',
+          type: 'vertical',
+          gradientToColors: ['#9c27b0'], // Gradient color ending
+          stops: [0, 100],
+        },
+      },
+    };
+    this.chart = new ApexCharts(this.shadowRoot.querySelector('.chartContainer'), options);
+    await this.chart.render();
+    await this.resizeChart();
+  }
+
+  public async resizeChart() {
+    const mainbox: HTMLDivElement = this.shadowRoot.querySelector('.mainbox');
+    const chartContainer: HTMLDivElement = this.shadowRoot.querySelector('.chartContainer');
+
+    // Get computed style of the element
+    const styleMainbox = window.getComputedStyle(mainbox);
+    const styleChartContainer = window.getComputedStyle(chartContainer);
+
+    // Extract padding values
+    const paddingTop = parseInt(styleChartContainer.paddingTop, 10);
+    const paddingBottom = parseInt(styleChartContainer.paddingBottom, 10);
+    const paddingLeft = parseInt(styleChartContainer.paddingLeft, 10);
+    const paddingRight = parseInt(styleChartContainer.paddingRight, 10);
+
+    // Calculate the actual width and height to use, subtracting padding
+    const actualWidth = mainbox.clientWidth - paddingLeft - paddingRight;
+    const actualHeight = mainbox.offsetHeight - paddingTop - paddingBottom;
+
+    await this.chart.updateOptions({
+      chart: {
+        width: actualWidth,
+        height: actualHeight,
+      },
+    });
+  }
+}

ts_web/elements/dees-chart-log.demo.ts

@@ -0,0 +1,20 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => {
+  return html`
+    <style>
+      .demoBox {
+        position: relative;
+        background: #000000;
+        height: 100%;
+        width: 100%;
+        padding: 40px;
+      }
+    </style>
+    <div class="demoBox">
+      <dees-chart-log
+        .label=${'Event Log'}
+      ></dees-chart-log>
+    </div>
+  `;
+};

ts_web/elements/dees-chart-log.ts

@@ -0,0 +1,89 @@
+import {
+  DeesElement,
+  css,
+  cssManager,
+  customElement,
+  html,
+  property,
+  state,
+  type CSSResult,
+  type TemplateResult,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { demoFunc } from './dees-chart-log.demo.js';
+
+import ApexCharts from 'apexcharts';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-chart-log': DeesChartLog;
+  }
+}
+
+@customElement('dees-chart-log')
+export class DeesChartLog extends DeesElement {
+  public static demo = demoFunc;
+
+  // instance
+  @state()
+  public chart: ApexCharts;
+
+  @property()
+  public label: string = 'Untitled Chart';
+
+  constructor() {
+    super();
+    domtools.elementBasic.setup();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        font-family: 'Geist Sans', sans-serif;
+        color: #ccc;
+        font-weight: 600;
+        font-size: 12px;
+      }
+      .mainbox {
+        position: relative;
+        width: 100%;
+        height: 400px;
+        background: #222;
+        border-radius: 8px;
+        padding: 32px 16px 16px 0px;
+      }
+
+      .chartTitle {
+        position: absolute;
+        top: 0;
+        left: 0;
+        width: 100%;
+        text-align: center;
+        padding-top: 16px;
+      }
+      .chartContainer {
+        position: relative;
+        width: 100%;
+        height: 100%;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html` <div class="mainbox">
+      <div class="chartTitle">${this.label}</div>
+      <div class="chartContainer"></div>
+    </div> `;
+  }
+
+  public async firstUpdated() {
+    const domtoolsInstance = await this.domtoolsPromise;
+    
+  }
+
+  public async updateLog() {
+    
+  }
+}

ts_web/elements/dees-chips.demo.ts

@@ -0,0 +1,41 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+  <style>
+    .demoContainer {
+      display: flex;
+      flex-direction: column;
+      align-items: center;
+      justify-content: center;
+      height: 100%;
+      background: #222;
+    }
+  </style>
+  <div class="demoContainer">
+    <dees-chips
+      selectionMode="none"
+      .selectableChips=${[
+        { key: 'account1', value: 'Payment Account 1' },
+        { key: 'account2', value: 'PaymentAccount2' },
+        { key: 'account3', value: 'Payment Account 3' },
+      ]}
+    ></dees-chips>
+    <dees-chips
+      selectionMode="single"
+      chipsAreRemovable
+      .selectableChips=${[
+        { key: 'account1', value: 'Payment Account 1' },
+        { key: 'account2', value: 'PaymentAccount2' },
+        { key: 'account3', value: 'Payment Account 3' },
+      ]}
+    ></dees-chips>
+    <dees-chips
+      selectionMode="multiple"
+      .selectableChips=${[
+        { key: 'account1', value: 'Payment Account 1' },
+        { key: 'account2', value: 'PaymentAccount2' },
+        { key: 'account3', value: 'Payment Account 3' },
+      ]}
+    ></dees-chips>
+  </div>
+`;

ts_web/elements/dees-chips.ts

@@ -0,0 +1,195 @@
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { demoFunc } from './dees-chips.demo.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-chips': DeesChips;
+  }
+}
+
+type Tag = { key: string; value: string };
+
+@customElement('dees-chips')
+export class DeesChips extends DeesElement {
+  public static demo = demoFunc;
+
+  @property()
+  public selectionMode: 'none' | 'single' | 'multiple' = 'single';
+
+  @property({
+    type: Boolean,
+  })
+  public chipsAreRemovable: boolean = false;
+
+  @property({
+    type: Array,
+  })
+  public selectableChips: Tag[] = [];
+
+  @property()
+  public selectedChip: Tag = null;
+
+  @property({
+    type: Array,
+  })
+  public selectedChips: Tag[] = [];
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        display: block;
+        box-sizing: border-box;
+      }
+
+      .mainbox {
+        user-select: none;
+      }
+
+      .chip {
+        border-top: ${cssManager.bdTheme('1px solid #CCC', '1px solid #444')};
+        background: #333333;
+        display: inline-flex;
+        height: 20px;
+        line-height: 20px;
+        padding: 0px 8px;
+        font-size: 12px;
+        color: #fff;
+        border-radius: 40px;
+        margin-right: 4px;
+        margin-bottom: 4px;
+        position: relative;
+        overflow: hidden;
+        box-shadow: 0px 1px 2px rgba(0, 0, 0, 0.3);
+      }
+
+      .chip:hover {
+        background: #666666;
+      }
+
+      .chip.selected {
+        background: #00a3ff;
+      }
+
+      .chipKey {
+        background: rgba(0, 0, 0, 0.3);
+        height: 100%;
+        display: inline-block;
+        margin-left: -8px;
+        padding-left: 8px;
+        padding-right: 8px;
+        margin-right: 8px;
+      }
+
+      dees-icon {
+        padding: 0px 6px 0px 4px;
+        margin-left: 4px;
+        margin-right: -8px;
+        background: rgba(0, 0, 0, 0.3);
+      }
+
+      dees-icon:hover {
+        background: #e4002b;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="mainbox">
+        ${this.selectableChips.map(
+          (chip) => html`
+            <div
+              @click=${() => this.selectChip(chip)}
+              class="chip ${this.isSelected(chip) ? 'selected' : ''}"
+            >
+              ${chip.key ? html`<div class="chipKey">${chip.key}</div>` : html``} ${chip.value}
+              ${this.chipsAreRemovable
+                ? html`
+                    <dees-icon
+                      @click=${(event: Event) => {
+                        event.stopPropagation(); // prevent the selectChip event from being triggered
+                        this.removeChip(chip);
+                      }}
+                      .iconFA=${'xmark'}
+                    ></dees-icon>
+                  `
+                : html``}
+            </div>
+          `
+        )}
+      </div>
+    `;
+  }
+
+  public async firstUpdated() {
+    if (!this.textContent) {
+      this.textContent = 'Button';
+      this.performUpdate();
+    }
+  }
+
+  private isSelected(chip: Tag): boolean {
+    if (this.selectionMode === 'single') {
+      return this.selectedChip?.key === chip.key;
+    } else {
+      return this.selectedChips.some((selected) => selected.key === chip.key);
+    }
+  }
+
+  public async selectChip(chip: Tag) {
+    if (this.selectionMode === 'none') {
+      return;
+    }
+
+    if (this.selectionMode === 'single') {
+      if (this.isSelected(chip)) {
+        this.selectedChip = null;
+        this.selectedChips = [];
+      } else {
+        this.selectedChip = chip;
+        this.selectedChips = [chip];
+      }
+    } else if (this.selectionMode === 'multiple') {
+      if (this.isSelected(chip)) {
+        this.selectedChips = this.selectedChips.filter((selected) => selected.key !== chip.key);
+      } else {
+        this.selectedChips = [...this.selectedChips, chip];
+      }
+      this.requestUpdate();
+    }
+    console.log(this.selectedChips);
+  }
+
+  public removeChip(chipToRemove: Tag): void {
+    // Remove the chip from selectableChips
+    this.selectableChips = this.selectableChips.filter((chip) => chip.key !== chipToRemove.key);
+
+    // Remove the chip from selectedChips if present
+    this.selectedChips = this.selectedChips.filter((chip) => chip.key !== chipToRemove.key);
+
+    // If the removed chip was the selectedChip, set selectedChip to null
+    if (this.selectedChip && this.selectedChip.key === chipToRemove.key) {
+      this.selectedChip = null;
+    }
+
+    // Trigger an update to re-render the component
+    this.requestUpdate();
+  }
+}

ts_web/elements/dees-contextmenu.demo.ts

@@ -0,0 +1,57 @@
+import { html } from '@design.estate/dees-element';
+import * as plugins from './00plugins.js';
+
+import { DeesContextmenu } from './dees-contextmenu.js';
+
+export const demoFunc = () => html`
+<style>
+  .withMargin {
+    display: block;
+    margin: 20px;
+  }
+</style>
+<dees-button @contextmenu=${(eventArg) => {
+  DeesContextmenu.openContextMenuWithOptions(eventArg, [
+    {
+      name: 'copy',
+      iconName: 'copySolid',
+      action: async () => {
+        return null;
+      },
+    },
+    {
+      name: 'edit',
+      iconName: 'penToSquare',
+      action: async () => {
+        return null;
+      },
+    },{
+      name: 'paste',
+      iconName: 'pasteSolid',
+      action: async () => {
+        return null;
+      },
+    },
+  ]);
+}}>Right-Click for contextmenu</dees-button>
+<dees-contextmenu class="withMargin"></dees-contextmenu>
+<dees-contextmenu
+  class="withMargin"
+  .menuItems=${[
+    {
+      name: 'copy',
+      iconName: 'copySolid',
+      action: async () => {},
+    },
+    {
+      name: 'edit',
+      iconName: 'penToSquare',
+      action: async () => {},
+    },{
+      name: 'paste',
+      iconName: 'pasteSolid',
+      action: async () => {},
+    },
+  ] as plugins.tsclass.website.IMenuItem[]}
+></dees-contextmenu>
+`;

ts_web/elements/dees-contextmenu.ts

@@ -0,0 +1,189 @@
+import * as colors from './00colors.js';
+import * as plugins from './00plugins.js';
+import { demoFunc } from './dees-contextmenu.demo.js';
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { DeesWindowLayer } from './dees-windowlayer.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-contextmenu': DeesContextmenu;
+  }
+}
+
+@customElement('dees-contextmenu')
+export class DeesContextmenu extends DeesElement {
+  // DEMO
+  public static demo = demoFunc
+
+  // STATIC
+  // This will store all the accumulated menu items
+  public static contextMenuDeactivated = false;
+  public static accumulatedMenuItems: plugins.tsclass.website.IMenuItem[] = [];
+
+  // Add a global event listener for the right-click context menu
+  public static initializeGlobalListener() {
+    document.addEventListener('contextmenu', (event: MouseEvent) => {
+      if (this.contextMenuDeactivated) {
+        return;
+      }
+      event.preventDefault();
+
+      // Get the target element of the right-click
+      let target: EventTarget | null = event.target;
+
+      // Clear previously accumulated items
+      DeesContextmenu.accumulatedMenuItems = [];
+
+      // Traverse up the DOM tree to accumulate menu items
+      while (target) {
+        if ((target as any).getContextMenuItems) {
+          DeesContextmenu.accumulatedMenuItems.push(...(target as any).getContextMenuItems());
+        }
+        target = (target as Node).parentNode;
+      }
+
+      // Open the context menu with the accumulated items
+      DeesContextmenu.openContextMenuWithOptions(event, DeesContextmenu.accumulatedMenuItems);
+    });
+  }
+
+  // allows opening of a contextmenu with options
+  public static async openContextMenuWithOptions(eventArg: MouseEvent, menuItemsArg: plugins.tsclass.website.IMenuItem[]) {
+    if (this.contextMenuDeactivated) {
+      return;
+    }
+    eventArg.preventDefault();
+    eventArg.stopPropagation();
+    const contextMenu = new DeesContextmenu();
+    contextMenu.style.position = 'fixed';
+    contextMenu.style.zIndex = '2000';
+    contextMenu.style.top = `${eventArg.clientY.toString()}px`;
+    contextMenu.style.left = `${eventArg.clientX.toString()}px`;
+    contextMenu.style.opacity = '0';
+    contextMenu.style.transform = 'scale(0.95,0.95)';
+    contextMenu.style.transformOrigin = 'top left';
+    contextMenu.menuItems = menuItemsArg;
+    contextMenu.windowLayer = await DeesWindowLayer.createAndShow();
+    contextMenu.windowLayer.addEventListener('click', async () => {
+      await contextMenu.destroy();
+    })
+    document.body.append(contextMenu);
+    await domtools.plugins.smartdelay.delayFor(0);
+    contextMenu.style.opacity = '1';
+    contextMenu.style.transform = 'scale(1,1)';
+  }
+
+  // INSTANCE
+  @property({
+    type: Array,
+  })
+  public menuItems: plugins.tsclass.website.IMenuItem[] = [];
+  windowLayer: DeesWindowLayer;
+
+  constructor() {
+    super();
+  }
+
+  /**
+   * STATIC STYLES
+   */
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        display: block;
+        transition: all 0.1s;
+      }
+
+      .mainbox {
+        color: ${cssManager.bdTheme('#222', '#ccc')};
+        font-size: 14px;
+        width: 200px;
+        border: 1px solid ${cssManager.bdTheme('#fff', '#ffffff10')};
+        min-height: 34px;
+        border-radius: 3px;
+        background: ${cssManager.bdTheme('#fff', '#222')};
+        box-shadow: 0px 1px 4px ${cssManager.bdTheme('#00000020', '#000000')};
+        user-select: none;
+        padding: 4px;
+      }
+
+      .mainbox .menuitem {
+        padding: 4px 8px;
+        border-radius: 3px;
+      }
+
+      .mainbox .menuitem dees-icon {
+        display: inline-block;
+        margin-right: 8px;
+        width: 14px;
+        transform: translateY(2px);
+      }
+
+      .mainbox .menuitem:hover {
+        background: ${cssManager.bdTheme(colors.bright.blue, colors.dark.blue)};
+      }
+
+      .mainbox .menuitem:active {
+        background: #ffffff05;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="mainbox">
+        ${this.menuItems.map((menuItemArg) => {
+          return html`
+            <div class="menuitem" @click=${() => this.handleClick(menuItemArg)}>
+              <dees-icon .iconFA=${(menuItemArg.iconName as any) || 'minus'}></dees-icon
+              >${menuItemArg.name}
+            </div>
+          `;
+        })}
+        ${this.menuItems.length === 0 ? html`
+            <div class="menuitem" @click=${() => {
+              DeesContextmenu.contextMenuDeactivated = true;
+              this.destroy();
+            }}>
+              <dees-icon .iconFA=${'xmark'}></dees-icon
+              >allow native context
+            </div>
+        ` : html``}
+      </div>
+    `;
+  }
+
+  public async firstUpdated() {
+    
+  }
+
+  public async handleClick(menuItem: plugins.tsclass.website.IMenuItem) {
+    menuItem.action();
+    await this.destroy();
+  }
+
+  public async destroy() {
+    if (this.windowLayer) {
+      this.windowLayer.destroy();
+    }
+    this.style.opacity = '0';
+    this.style.transform = 'scale(0.95,0,95)';
+    await domtools.plugins.smartdelay.delayFor(100);
+    this.parentElement.removeChild(this);
+  }
+}
+
+DeesContextmenu.initializeGlobalListener();

ts_web/elements/dees-dataview-codebox.demo.ts

@@ -0,0 +1,18 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html` <style>
+.demoWrapper {
+  box-sizing: border-box;
+  position: absolute;
+  width: 100%;
+  height: 100%;
+  padding: 20px;
+  background: none;
+}
+</style>
+<div class="demoWrapper">
+<dees-dataview-codebox proglang="typescript">
+  import * as text from './hello'; const hiThere = 'nice'; const myFunction = async () => {
+  console.log('nice one'); }
+</dees-dataview-codebox>
+</div>`

ts_web/elements/dees-dataview-codebox.ts

@@ -0,0 +1,237 @@
+import { demoFunc } from './dees-dataview-codebox.demo.js';
+import {
+  DeesElement,
+  html,
+  customElement,
+  type TemplateResult,
+  property,
+  state,
+  cssManager,
+} from '@design.estate/dees-element';
+
+import hlight from 'highlight.js';
+
+import * as smartstring from '@push.rocks/smartstring';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { DeesContextmenu } from './dees-contextmenu.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-dataview-codebox': DeesDataviewCodebox;
+  }
+}
+
+@customElement('dees-dataview-codebox')
+export class DeesDataviewCodebox extends DeesElement {
+  public static demo = demoFunc;
+
+  @property()
+  public progLang: string = 'typescript';
+
+  @property({
+    type: String,
+    reflect: true,
+  })
+  public codeToDisplay: string = '';
+
+  constructor() {
+    super();
+  }
+
+  render(): TemplateResult {
+    return html`
+      ${domtools.elementBasic.styles}
+      <style>
+        :host {
+          position: relative;
+          display: block;
+          text-align: left;
+          font-size: 16px;
+          font-family: 'Geist Sans', sans-serif;
+        }
+        .mainbox {
+          position: relative;
+          color: ${this.goBright ? '#333333' : '#ffffff'};
+          border-top: 1px solid ${this.goBright ? '#ffffff' : '#333333'};
+          box-shadow: 0px 0px 5px ${this.goBright ? 'rgba(0,0,0,0.1)' : 'rgba(0,0,0,0.5)'};
+          background: ${this.goBright ? '#ffffff' : '#191919'};
+          border-radius: 16px;
+          overflow: hidden;
+        }
+
+        .appbar {
+          position: relative;
+          color: ${cssManager.bdTheme('#333', '#ccc')};
+          background: ${cssManager.bdTheme('#ffffff', '#161616')};
+          border-bottom: 1px solid ${cssManager.bdTheme('#eeeeeb', '#222222')};
+          height: 24px;
+          display: flex;
+          font-size: 12px;
+          line-height: 24px;
+          justify-content: center;
+          align-items: center;
+        }
+
+        .appbar .fileName {
+          line-height: inherit;
+          position: relative;
+          flex: 1;
+          text-align: center;
+        }
+
+        .bottomBar {
+          color: ${cssManager.bdTheme('#333', '#ccc')};
+          background: ${cssManager.bdTheme('#ffffff', '#161616')};
+          border-top: 1px solid ${cssManager.bdTheme('#eeeeeb', '#222222')};
+          height: 24px;
+          font-size: 12px;
+          line-height: 24px;
+          text-align: right;
+          padding-right: 100px;
+        }
+
+        .languageLabel {
+          color: ${cssManager.bdTheme('#333', '#ccc')};
+          font-size: 12px;
+          line-height: 24px;
+          z-index: 10;
+          background: #6596ff20;
+          display: inline-block;
+          position: absolute;
+          bottom: 0px;
+          right: 0px;
+          padding: 0px 16px 0px 8px;
+        }
+
+        .hljs-keyword {
+          color: #ff65ec;
+        }
+
+        .codegrid {
+          display: grid;
+          grid-template-columns: 50px auto;
+          overflow: hidden;
+        }
+
+        .lineNumbers {
+          color: ${this.goBright ? '#acacac' : '#666666'};
+          padding: 30px 16px 0px 0px;
+          text-align: right;
+          border-right: 1px solid ${this.goBright ? '#eaeaea' : '#222222'};
+        }
+
+        .lineCounter:last-child {
+          opacity: 50%;
+        }
+
+        pre {
+          overflow-x: auto;
+          margin: 0px;
+          padding: 30px 40px;
+        }
+
+        code {
+          font-weight: ${this.goBright ? '400' : '300'};
+          padding: 0px;
+          margin: 0px;
+        }
+
+        code,
+        code *,
+        .lineNumbers {
+          line-height: 1.4em;
+          font-weight: 200;
+          font-family: 'Intel One Mono', 'Geist Mono', 'monospace';
+        }
+
+        .hljs-string {
+          color: #ffa465;
+        }
+
+        .hljs-built_in {
+          color: #65ff6a;
+        }
+
+        .hljs-function {
+          color: ${this.goBright ? '#2765DF' : '#6596ff'};
+        }
+
+        .hljs-params {
+          color: ${this.goBright ? '#3DB420' : '#65d5ff'};
+        }
+
+        .hljs-comment {
+          color: ${this.goBright ? '#EF9300' : '#ffd765'};
+        }
+      </style>
+      <div
+        class="mainbox"
+        @contextmenu="${(eventArg) => {
+          DeesContextmenu.openContextMenuWithOptions(eventArg, [
+            {
+              name: 'About',
+              iconName: 'circleInfo',
+              action: async () => {
+                return null;
+              },
+            },
+          ]);
+        }}"
+      >
+        <div class="appbar">
+          <dees-windowcontrols type="mac" position="left"></dees-windowcontrols>
+          <div class="fileName">index.ts</div>
+          <dees-windowcontrols type="mac" position="right"></dees-windowcontrols>
+        </div>
+        <div class="codegrid">
+          <div class="lineNumbers">
+            ${(() => {
+              let lineCounter = 0;
+              return this.codeToDisplay.split('\n').map((lineArg) => {
+                lineCounter++;
+                return html`<div class="lineCounter">${lineCounter}</div>`;
+              });
+            })()}
+          </div>
+          <pre><code></code></pre>
+        </div>
+        <div class="bottomBar">
+          Spaces: 2
+          <div class="languageLabel">${this.progLang}</div>
+        </div>
+      </div>
+    `;
+  }
+
+  @state()
+  private codeToDisplayStore = '';
+
+  public async updated(_changedProperties) {
+    super.updated(_changedProperties);
+    console.log('highlighting now');
+    console.log(this.childNodes);
+    const slottedCodeNodes: Text[] = [];
+    this.childNodes.forEach((childNode) => {
+      if (childNode.nodeName === '#text') {
+        slottedCodeNodes.push(childNode as Text);
+      }
+    });
+    if (this.codeToDisplay && this.codeToDisplay !== this.codeToDisplayStore) {
+      this.codeToDisplayStore = smartstring.indent.normalize(this.codeToDisplay).trimStart();
+    }
+    if (slottedCodeNodes[0] && slottedCodeNodes[0].wholeText && !this.codeToDisplay) {
+      this.codeToDisplayStore = smartstring.indent
+        .normalize(slottedCodeNodes[0].wholeText)
+        .trimStart();
+      this.codeToDisplay = this.codeToDisplayStore;
+    }
+    await domtools.plugins.smartdelay.delayFor(0);
+    const localCodeNode = this.shadowRoot.querySelector('code');
+    const html = hlight.highlight(this.codeToDisplayStore, {
+      language: this.progLang,
+      ignoreIllegals: true,
+    });
+    localCodeNode.innerHTML = html.value;
+  }
+}

ts_web/elements/dees-dataview-statusobject.demo.ts

@@ -0,0 +1,49 @@
+import { html, cssManager } from '@design.estate/dees-element';
+import * as tsclass from '@tsclass/tsclass';
+
+export const demoFunc = () => html` <style>
+    .demo {
+      background: ${cssManager.bdTheme('#eeeeeb', '#000000')};
+      display: block;
+      content: '';
+      padding: 40px;
+    }
+  </style>
+  <div class="demo">
+    <dees-dataview-statusobject
+      .statusObject=${{
+        id: '1',
+        name: 'Demo Item',
+        combinedStatus: 'partly_ok',
+        combinedStatusText: 'partly_ok',
+        details: [
+          {
+            name: 'Detail 1',
+            value: 'Value 1',
+            status: 'ok',
+            statusText: 'OK',
+          },
+          {
+            name: 'Detail 2',
+            value: 'Value 2',
+            status: 'partly_ok',
+            statusText: 'partly_ok',
+          },
+          {
+            name: 'Detail 3',
+            value: 'Value 3',
+            status: 'not_ok',
+            statusText: 'not_ok',
+          },
+          {
+            name: 'Detail 4',
+            value:
+              'Value 4 jhdkfjhalskdfjhfdjskalsdkfjhfdjskalskdjfhjdkslaksjdhfjdkslaskdfjhfjdkslaskdjfhjdskalskdjhfdjskalskdjfhdjskl',
+            status: 'ok',
+            statusText: 'OK',
+          },
+        ],
+      } as tsclass.code.IStatusObject}
+    >
+    </dees-dataview-statusobject>
+  </div>`;

ts_web/elements/dees-dataview-statusobject.ts

@@ -0,0 +1,165 @@
+import * as colors from './00colors.js';
+import * as plugins from './00plugins.js';
+
+import { demoFunc } from './dees-dataview-statusobject.demo.js';
+import {
+  DeesElement,
+  html,
+  customElement,
+  type TemplateResult,
+  property,
+  state,
+  cssManager,
+  css,
+  type CSSResult,
+} from '@design.estate/dees-element';
+
+import * as tsclass from '@tsclass/tsclass';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-dataview-statusobject': DeesDataviewStatusobject;
+  }
+}
+
+@customElement('dees-dataview-statusobject')
+export class DeesDataviewStatusobject extends DeesElement {
+  public static demo = demoFunc;
+
+  @property({ type: Object }) statusObject: tsclass.code.IStatusObject;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      .mainbox {
+        border-radius: 8px;
+        background: ${cssManager.bdTheme('#fff', '#1b1b1b')};
+        box-shadow: 0px 1px 3px #00000030;
+        min-height: 48px;
+        color: ${cssManager.bdTheme('#000', '#fff')};
+        border-top: ${cssManager.bdTheme('none', '1px solid #ffffff10')};
+        cursor: default;
+      }
+
+      .heading {
+        display: grid;
+        align-items: center;
+        grid-template-columns: 40px auto 120px;
+      }
+
+      h1 {
+        display: block;
+        margin: 0px;
+        padding: 0px;
+        height: 48px;
+        text-transform: uppercase;
+        font-size: 12px;
+        line-height: 48px;
+      }
+
+      .statusdot {
+        height: 8px;
+        width: 8px;
+        border-radius: 6px;
+        background: grey;
+        margin: auto;
+      }
+
+      .copyMain {
+        font-size: 10px;
+        font-weight: 600;
+        text-transform: uppercase;
+        border: 1px solid ${cssManager.bdTheme('#e0e0e0', '#444')};
+        text-align: center;
+        padding: 4px;
+        border-radius: 3px;
+        margin-right: 16px;
+        color: ${cssManager.bdTheme('#333', '#ffffff80')};
+        user-select: none;
+      }
+
+      .copyMain:hover {
+        background: ${cssManager.bdTheme(colors.bright.blue, colors.dark.blue)};
+        border: 1px solid ${cssManager.bdTheme(colors.bright.blue, colors.dark.blue)};
+        color: #fff;
+      }
+
+      .copyMain:active {
+        background: ${cssManager.bdTheme(colors.bright.blueActive, colors.dark.blueActive)};
+        border: 1px solid ${cssManager.bdTheme(colors.bright.blueActive, colors.dark.blueActive)};
+        color: #fff;
+      }
+
+      .statusdot.ok {
+        background: green;
+      }
+
+      .statusdot.not_ok{
+        background: red;
+      }
+
+      .statusdot.partly_ok {
+        background: orange;
+      }
+
+      .detail {
+        min-height: 60px;
+        align-items: center;
+        display: grid;
+        grid-template-columns: 40px auto;
+        border-top: 1px dotted ${cssManager.bdTheme('#e0e0e0', '#282828')};
+        transition: all 0.2s;
+      }
+
+      .detail:hover {
+        background: #ffffff05;
+      }
+
+      .detail:active {
+        background: #ffffff10;
+      }
+
+      .detail .detailsText {
+        padding-top: 8px;
+        padding-bottom: 8px;
+        padding-right: 8px;
+        word-break: break-all;
+      }
+
+      .detail .detailsText .label {
+        font-size: 12px;
+        color: #ffffff80
+      }
+
+      .detail .detailsText .value {
+        font-size: 14px;
+        font-family: 'Intel One Mono', 'Geist Mono';
+      }
+    `,
+  ];
+
+  render(): TemplateResult {
+    return html`
+      <div class="mainbox">
+        <div class="heading">
+          <div class="statusdot ${this.statusObject?.combinedStatus}"></div>
+          <h1>${this.statusObject?.name || 'no status object assigned'}</h1>
+          <div class="copyMain">Copy as JSON</div>
+        </div>
+        ${this.statusObject?.details?.map((detailArg) => {
+          return html`
+            <div class="detail">
+              <div class="statusdot ${detailArg.status}"></div>
+              <div class="detailsText">
+                <div class="label">${detailArg.name}</div>
+                <div class="value">${detailArg.value}</div>
+              </div>
+            </div>
+          `;
+        })}
+      </div>
+    `;
+  }
+
+  async firstUpdated() {}
+}

ts_web/elements/dees-editor-markdown.ts

@@ -0,0 +1,98 @@
+import {
+  DeesElement,
+  property,
+  html,
+  customElement,
+  type TemplateResult,
+  css,
+  cssManager,
+  domtools
+} from '@design.estate/dees-element';
+
+const deferred = domtools.plugins.smartpromise.defer();
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-editormarkdown': DeesEditorMarkdown;
+  }
+}
+
+@customElement('dees-editormarkdown')
+export class DeesEditorMarkdown extends DeesElement {
+  public static demo = () => html`<dees-editormarkdown></dees-editormarkdown>`;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      .gridcontainer {
+        position: absolute;
+        height: 100%;
+        width: 100%;
+        display: grid;
+        grid-template-columns: 60% 40%;
+      }
+      .editorContainer {
+        position: relative;
+      }
+      .outletContainer {
+        background: #111;
+        color: #fff;
+        font-family: 'Roboto Slab';
+        padding: 20px;
+        overflow-y: scroll;
+      }
+    `,
+  ];
+
+  public render() {
+    return html`
+      <div class="gridcontainer">
+        <div class="editorContainer">
+          <dees-editor
+            .language=${'markdown'}
+            .content=${`# a test content
+
+This is test content that is of longer form an hopefully starts to wrap when I need it. And yes, it does perfectly. nice.
+
+Test | Hello
+--- | ---
+Yeah | So good
+
+This is real asset I think. Why would we want to leave that on the table? Can you tell my that?
+
+Why are we here?
+
+Do you know?
+
+> note:
+There is something going on.
+
+\`\`\`typescript
+const hello = 'yes'
+\`\`\`
+`}
+            wordWrap="bounded"
+          ></dees-editor>
+        </div>
+        <div class="outletContainer">
+          <dees-editormarkdownoutlet></dees-editormarkdownoutlet>
+        </div>
+      </div>
+    `;
+  }
+
+  public async firstUpdated(_changedPropertiesArg) {
+    await super.firstUpdated(_changedPropertiesArg);
+    const editor = this.shadowRoot.querySelector('dees-editor');
+    
+    // lets care about wiring the markdown stuff.
+    const markdownOutlet = this.shadowRoot.querySelector('dees-editormarkdownoutlet');
+    const smartmarkdownInstance = new domtools.plugins.smartmarkdown.SmartMarkdown();
+    const mdParsedResult = await smartmarkdownInstance.getMdParsedResultFromMarkdown('loading...')
+    editor.contentSubject.subscribe(async contentArg => {
+      await mdParsedResult.updateFromMarkdownString(contentArg)
+      const html = mdParsedResult.html;
+      markdownOutlet.updateHtmlText(html);
+    })
+  }
+}

ts_web/elements/dees-editor-markdownoutlet.ts

@@ -0,0 +1,42 @@
+import { customElement, DeesElement, html, type TemplateResult } from '@design.estate/dees-element';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-editormarkdownoutlet': DeesEditorMarkdownOutlet;
+  }
+}
+
+@customElement('dees-editormarkdownoutlet')
+export class DeesEditorMarkdownOutlet extends DeesElement {
+  // DEMO
+  public static demo = () => html`<dees-editormarkdownoutlet></dees-editormarkdownoutlet>`;
+
+  // INSTANCE
+  private outlet: HTMLElement;
+
+  public render(): TemplateResult {
+    return html`
+      <div class="outlet markdown-body">
+        <h1>Hi there</h1>
+      </div>
+    `;
+  }
+
+  public async firstUpdated(_changedProperties: Map<string | number | symbol, unknown>) {
+    await super.firstUpdated(_changedProperties);
+    const styleElement = document.createElement('style');
+    const cssText = await (
+      await fetch('https://unpkg.com/github-markdown-css@5.1.0/github-markdown-dark.css')
+    ).text();
+    styleElement.textContent = cssText;
+    this.shadowRoot.append(styleElement);
+  }
+
+  public async updateHtmlText(htmlTextArg: string) {
+    await this.updateComplete;
+    if (!this.outlet) {
+      this.outlet = this.shadowRoot.querySelector('.outlet');
+    }
+    this.outlet.innerHTML = htmlTextArg;
+  }
+}

ts_web/elements/dees-editor.ts

@@ -0,0 +1,126 @@
+import {
+  DeesElement,
+  property,
+  html,
+  customElement,
+  type TemplateResult,
+  css,
+  cssManager,
+} from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
+
+import type * as monaco from 'monaco-editor';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-editor': DeesEditor;
+  }
+}
+
+@customElement('dees-editor')
+export class DeesEditor extends DeesElement {
+  // DEMO
+  public static demo = () => html` <dees-editor></dees-editor> `;
+
+  // STATIC
+  public static monacoDeferred: ReturnType<typeof domtools.plugins.smartpromise.defer>;
+
+  // INSTANCE
+  public editorDeferred = domtools.plugins.smartpromise.defer<monaco.editor.IStandaloneCodeEditor>();
+  public language = 'typescript';
+
+  @property({
+    type: String
+  })
+  public content = "function hello() {\n\talert('Hello world!');\n}";
+
+  @property({
+    type: Object
+  })
+  public contentSubject = new domtools.plugins.smartrx.rxjs.Subject<string>();
+
+  @property({
+    type: Boolean
+  })
+  public wordWrap: monaco.editor.IStandaloneEditorConstructionOptions['wordWrap'] = 'off';
+
+  constructor() {
+    super();
+    domtools.DomTools.setupDomTools();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+      }
+
+      * {
+        box-sizing: border-box;
+      }
+
+      #container {
+        position: absolute;
+        height: 100%;
+        width: 100%;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="mainbox">
+        <div id="container"></div>
+      </div>
+    `;
+  }
+
+  public async firstUpdated(
+    _changedProperties: Map<string | number | symbol, unknown>
+  ): Promise<void> {
+    super.firstUpdated(_changedProperties);
+    const container = this.shadowRoot.getElementById('container');
+
+    if (!DeesEditor.monacoDeferred) {
+      DeesEditor.monacoDeferred = domtools.plugins.smartpromise.defer();
+      const scriptUrl = `https://cdn.jsdelivr.net/npm/monaco-editor/min/vs/loader.js`;
+      const script = document.createElement('script');
+      script.src = scriptUrl;
+      script.onload = () => {
+        DeesEditor.monacoDeferred.resolve();
+      };
+      document.head.appendChild(script);
+    }
+    await DeesEditor.monacoDeferred.promise;
+
+    (window as any).require.config({
+      paths: { vs: 'https://cdn.jsdelivr.net/npm/monaco-editor/min/vs' },
+    });
+    (window as any).require(['vs/editor/editor.main'], async () => {
+      const editor = ((window as any).monaco.editor as typeof monaco.editor).create(container, {
+        value: this.content,
+        language: this.language,
+        theme: 'vs-dark',
+        useShadowDOM: true,
+        fontSize: 16,
+        automaticLayout: true,
+        wordWrap: this.wordWrap
+      });
+      this.editorDeferred.resolve(editor);
+    });
+    const css = await (
+      await fetch('https://cdn.jsdelivr.net/npm/monaco-editor/min/vs/editor/editor.main.css')
+    ).text();
+    const styleElement = document.createElement('style');
+    styleElement.textContent = css;
+    this.shadowRoot.append(styleElement);
+
+
+    // editor is setup let do the rest
+    const editor = await this.editorDeferred.promise;
+    editor.onDidChangeModelContent(async eventArg => {
+      this.contentSubject.next(editor.getValue());
+    });
+    this.contentSubject.next(editor.getValue());
+  }
+}

ts_web/elements/dees-form-submit.ts

@@ -1,19 +1,71 @@
-import { customElement, html, LitElement } from 'lit-element';
+import {
+  customElement,
+  html,
+  DeesElement,
+  css,
+  cssManager,
+  property,
+  type CSSResult,
+} from '@design.estate/dees-element';
+import { DeesForm } from './dees-form.js';
 
-import {DeesForm} from './dees-form';
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-form-submit': DeesFormSubmit;
+  }
+}
 
 @customElement('dees-form-submit')
-export class DeesFormSubmit extends LitElement {
+export class DeesFormSubmit extends DeesElement {
+  public static demo = () => html`<dees-form-submit>This is a sloted text</dees-form-submit>`;
 
+  @property({
+    type: Boolean,
+    reflect: true,
+  })
+  public disabled = false;
+
+  @property({
+    type: String,
+  })
+  public text: string;
+
+  @property({
+    type: String,
+  })
+  public status: 'normal' | 'pending' | 'success' | 'error' = 'normal';
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [cssManager.defaultStyles, css``];
 
   public render() {
     return html`
-      <dees-button @click="${this.submit}">${this.textContent}</dees-button>
+      <dees-button
+        status=${this.status}
+        @click=${this.submit}
+        .disabled=${this.disabled}
+        .text=${this.text ? this.text : this.textContent}
+      >
+      </dees-button>
     `;
   }
 
   public async submit() {
+    if (this.disabled) {
+      return;
+    }
     const parentElement: DeesForm = this.parentElement as DeesForm;
     parentElement.gatherAndDispatch();
   }
+
+  public async focus() {
+    const domtools = await this.domtoolsPromise;
+    if (!this.disabled) {
+      domtools.convenience.smartdelay.delayFor(0);
+      this.submit();
+    }
+  }
 }

ts_web/elements/dees-form.demo.ts

@@ -0,0 +1,69 @@
+import { html, domtools, cssManager } from '@design.estate/dees-element';
+import type { DeesForm } from './dees-form.js';
+
+export const demoFunc = () => html`
+  <style>
+    .demoContainer {
+      max-width: 400px;
+      margin: 24px auto;
+      padding: 16px;
+      background: ${cssManager.bdTheme('#eeeeeb', '#111')};
+      box-shadow: 0px 1px 3px #00000030;
+    }
+  </style>
+  <div class="demoContainer">
+    <dees-form
+      style="display: block; margin:auto; max-width: 500px; padding: 20px"
+      @formData=${async (eventArg) => {
+        const form: DeesForm = eventArg.currentTarget;
+        form.setStatus('pending', 'authenticating...');
+        await domtools.plugins.smartdelay.delayFor(1000);
+        form.setStatus('success', 'authenticated!');
+      }}
+    >
+      <dees-input-dropdown
+        .label=${'title'}
+        .options=${[
+          { option: 'option 1', key: 'option1' },
+          { option: 'option 2', key: 'option2' },
+          { option: 'option 3', key: 'option3' },
+        ]}
+      ></dees-input-dropdown>
+      <dees-input-multiselect
+        .label=${'title'}
+        .options=${[
+          { option: 'option 1', key: 'option1' },
+          { option: 'option 2', key: 'option2' },
+          { option: 'option 3', key: 'option3' },
+        ]}></dees-input-multiselect>
+      <dees-input-typelist
+        .label=${'a type list'}
+      ></dees-input-typelist>
+      <dees-input-text .required="${true}" key="hello1" label="a text" .description=${`
+        This is an awesome description.
+      `}></dees-input-text>
+      <dees-input-text .required="${true}" key="hello2" label="also a text"></dees-input-text>
+      <dees-input-text
+        .required="${true}"
+        key="hello3"
+        label="a password"
+        isPasswordBool
+      ></dees-input-text>
+      <dees-input-checkbox
+        .required="${true}"
+        key="hello3"
+        label="another text"
+      ></dees-input-checkbox>
+      <dees-input-iban></dees-input-iban>
+      <dees-input-multitoggle
+        .label=${'multi select'}
+        .options=${['option 1', 'option 2', 'option 3']}
+        .selectedOption=${'option 1'}
+      ></dees-input-multitoggle>
+      <dees-input-fileupload
+        .label=${'attachments'}
+      ></dees-input-fileupload>
+      <dees-form-submit>Submit</dees-form-submit>
+    </dees-form>
+  </div>
+`;

ts_web/elements/dees-form.ts

@@ -1,20 +1,52 @@
-import { customElement, html, TemplateResult, LitElement } from 'lit-element';
+import {
+  customElement,
+  html,
+  type TemplateResult,
+  DeesElement,
+  type CSSResult,
+} from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
 
-import { DeesInputCheckbox } from './dees-input-checkbox';
-import { DeesInputText } from './dees-input-text';
-import { DeesInputQuantitySelector } from './dees-input-quantityselector';
-import { DeesInputRadio } from './dees-input-radio';
+import { DeesInputCheckbox } from './dees-input-checkbox.js';
+import { DeesInputText } from './dees-input-text.js';
+import { DeesInputQuantitySelector } from './dees-input-quantityselector.js';
+import { DeesInputRadio } from './dees-input-radio.js';
+import { DeesFormSubmit } from './dees-form-submit.js';
+import { DeesTable } from './dees-table.js';
+import { demoFunc } from './dees-form.demo.js';
+import { DeesInputIban } from './dees-input-iban.js';
+
+// Unified set for form input types
+const FORM_INPUT_TYPES = [
+  DeesInputCheckbox,
+  DeesInputIban,
+  DeesInputText,
+  DeesInputQuantitySelector,
+  DeesInputRadio,
+  DeesTable,
+];
+
+export type TFormInputElement =
+  | DeesInputCheckbox
+  | DeesInputIban
+  | DeesInputText
+  | DeesInputQuantitySelector
+  | DeesInputRadio
+  | DeesTable<any>;
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-form': DeesForm;
+  }
+}
 
 @customElement('dees-form')
-export class DeesForm extends LitElement {
-  public static demo = () => html`
-    <dees-form style="display: block; margin:auto; width: 500px; padding: 20px; background: #111;">
-      <dees-input-text key="hello1"></dees-input-text>
-      <dees-input-text key="hello2"></dees-input-text>
-      <dees-form-submit>Submit</dees-form-submit>
-    </dees-form>`;
+export class DeesForm extends DeesElement {
+  public static demo = demoFunc;
 
   public name: string = 'myform';
+  public changeSubject = new domtools.plugins.smartrx.rxjs.Subject();
+  public readyDeferred = domtools.plugins.smartpromise.defer();
 
   public render(): TemplateResult {
     return html`
@@ -27,24 +59,147 @@ export class DeesForm extends LitElement {
     `;
   }
 
-  public async gatherAndDispatch() {
+  public async firstUpdated() {
+    const formChildren = this.getFormElements();
+    this.updateRequiredStatus();
 
-    const children: Array<DeesInputCheckbox | DeesInputText | DeesInputQuantitySelector | DeesInputRadio> = this.children as any;
-    const valueObject: { [key: string]: string | number | boolean} = {};
-    for (const child of children) {
-      if (child instanceof DeesInputCheckbox || child instanceof DeesInputText || child instanceof DeesInputQuantitySelector) {
-        valueObject[child.key] = child.value;
+    for (const child of formChildren) {
+      child.changeSubject.subscribe(async () => {
+        const valueObject = await this.collectFormData();
+        this.changeSubject.next(valueObject);
+        console.log(valueObject);
+        this.updateRequiredStatus();
+      });
+    }
+    await this.addBehaviours();
+    this.readyDeferred.resolve();
+  }
+
+  public getFormElements(): Array<TFormInputElement> {
+    return Array.from(this.children).filter((child) =>
+      FORM_INPUT_TYPES.includes(child.constructor as any)
+    ) as unknown as TFormInputElement[];
+  }
+
+  public getSubmitButton(): DeesFormSubmit | undefined {
+    return Array.from(this.children).find(
+      (child) => child instanceof DeesFormSubmit
+    ) as DeesFormSubmit;
+  }
+
+  public async updateRequiredStatus() {
+    console.log('checking the required status.');
+
+    let requiredOK = true;
+    for (const childArg of this.getFormElements()) {
+      if (childArg.required && !childArg.value) {
+        requiredOK = false;
       }
     }
+    if (this.getSubmitButton()) {
+      this.getSubmitButton().disabled = !requiredOK;
+    }
+  }
 
+  /**
+   * collects the form data
+   * @returns
+   */
+  public async collectFormData() {
+    const children = this.getFormElements();
+    const valueObject: { [key: string]: string | number | boolean | any[] } = {};
+    for (const child of children) {
+      if (!child.key) {
+        console.log(`form element with label "${child.label}" has no key. skipping.`);
+      }
+      valueObject[child.key] = child.value;
+    }
+    return valueObject;
+  }
 
-    console.log(valueObject);
+  public async gatherAndDispatch() {
+    const valueObject = await this.collectFormData();
     const formDataEvent = new CustomEvent('formData', {
       detail: {
-        data: valueObject
+        data: valueObject,
       },
-      bubbles: true
+      bubbles: true,
     });
     this.dispatchEvent(formDataEvent);
+    console.log('dispatched data:');
+    console.log(valueObject);
+  }
+
+  public setStatus(
+    visualStateArg: 'normal' | 'pending' | 'error' | 'success',
+    textStateArg: string
+  ) {
+    const inputChildren = this.getFormElements();
+    const submitButton = this.getSubmitButton();
+
+    switch (visualStateArg) {
+      case 'normal':
+        submitButton.disabled = false;
+        submitButton.status = 'normal';
+        for (const inputChild of inputChildren) {
+          inputChild.disabled = false;
+        }
+        break;
+      case 'pending':
+        submitButton.disabled = true;
+        submitButton.status = 'pending';
+        for (const inputChild of inputChildren) {
+          inputChild.disabled = true;
+        }
+        break;
+      case 'success':
+        submitButton.disabled = true;
+        submitButton.status = 'success';
+        for (const inputChild of inputChildren) {
+          inputChild.disabled = true;
+        }
+        break;
+      case 'error':
+        submitButton.disabled = true;
+        submitButton.status = 'error';
+        for (const inputChild of inputChildren) {
+          inputChild.disabled = true;
+        }
+        break;
+    }
+
+    submitButton.text = textStateArg;
+  }
+
+  /**
+   * resets the form
+   */
+  reset() {
+    const inputChildren = this.getFormElements();
+    const submitButton = this.getSubmitButton();
+
+    for (const inputChild of inputChildren) {
+      inputChild.value = null;
+    }
+    this.setStatus('normal', 'Submit');
+  }
+
+  public async addBehaviours() {
+    // Use event delegation
+    this.addEventListener('keydown', (event: KeyboardEvent) => {
+      const target = event.target as DeesElement;
+      if (!FORM_INPUT_TYPES.includes(target.constructor as any)) return;
+
+      if (event.key === 'Enter') {
+        const children = this.getFormElements();
+        const currentIndex = children.indexOf(target as any);
+        if (currentIndex < children.length - 1) {
+          children[currentIndex + 1].focus();
+        } else {
+          target.blur();
+          this.getSubmitButton()?.focus();
+        }
+      }
+    });
   }
 }

ts_web/elements/dees-heading.demo.ts

@@ -0,0 +1,14 @@
+import { html } from '@design.estate/dees-element';
+
+export function demoFunc() {
+  return html`
+    <dees-heading level="1">This is a H1 heading</dees-heading>
+    <dees-heading level="2">This is a H2 heading</dees-heading>
+    <dees-heading level="3">This is a H3 heading</dees-heading>
+    <dees-heading level="4">This is a H4 heading</dees-heading>
+    <dees-heading level="5">This is a H5 heading</dees-heading>
+    <dees-heading level="6">This is a H6 heading</dees-heading>
+    <dees-heading level="hr">This is an hr heading</dees-heading>
+    <dees-heading level="hr-small">This is an hr small heading</dees-heading>
+  `;
+}

ts_web/elements/dees-heading.ts

@@ -0,0 +1,115 @@
+import {
+  customElement,
+  html,
+  css,
+  property,
+  cssManager,
+  type TemplateResult,
+  DeesElement,
+  type CSSResult,
+} from '@design.estate/dees-element';
+
+import { demoFunc } from './dees-heading.demo.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-heading': DeesHeading;
+  }
+}
+
+@customElement('dees-heading')
+export class DeesHeading extends DeesElement {
+  // demo
+  public static demo = demoFunc;
+
+  // properties
+  /**
+   * Heading level: 1-6 for h1-h6, or 'hr' for horizontal rule style
+   */
+  @property({ type: String, reflect: true })
+  public level: '1' | '2' | '3' | '4' | '5' | '6' | 'hr' | 'hr-small' = '1';
+
+  // STATIC STYLES
+  public static styles: CSSResult[] = [
+    cssManager.defaultStyles,
+    css`
+      /* Heading styles */
+      h1, h2, h3, h4, h5, h6 {
+        margin: 16px 0 8px;
+        font-weight: 600;
+        color: ${cssManager.bdTheme('#000', '#fff')};
+      }
+      h1 { font-size: 32px; font-family: 'Cal Sans'; letter-spacing: 0.025em;}
+      h2 { font-size: 28px; }
+      h3 { font-size: 24px; }
+      h4 { font-size: 20px; }
+      h5 { font-size: 16px; }
+      h6 { font-size: 14px; }
+      /* Horizontal rule style heading */
+      .heading-hr {
+        display: flex;
+        align-items: center;
+        text-align: center;
+        margin: 16px 0;
+        color: ${cssManager.bdTheme('#000', '#fff')};
+      }
+      /* Fade lines toward and away from text for hr style */
+      .heading-hr::before {
+        content: '';
+        flex: 1;
+        height: 1px;
+        /* fade in toward center */
+        background: ${cssManager.bdTheme(
+          'linear-gradient(to right, transparent, #ccc)',
+          'linear-gradient(to right, transparent, #333)'
+        )};
+        margin: 0 8px;
+      }
+      .heading-hr::after {
+        content: '';
+        flex: 1;
+        height: 1px;
+        /* fade out away from center */
+        background: ${cssManager.bdTheme(
+          'linear-gradient(to right, #ccc, transparent)',
+          'linear-gradient(to right, #333, transparent)'
+        )};
+        margin: 0 8px;
+      }
+      /* Small hr variant with reduced margins */
+      .heading-hr.heading-hr-small {
+        margin: 8px 0;
+        font-size: 12px;
+      }
+      .heading-hr.heading-hr-small::before,
+      .heading-hr.heading-hr-small::after {
+        margin: 0 8px;
+      }
+    `,
+  ];
+
+
+  // INSTANCE
+  public render(): TemplateResult {
+    switch (this.level) {
+      case '1':
+        return html`<h1><slot></slot></h1>`;
+      case '2':
+        return html`<h2><slot></slot></h2>`;
+      case '3':
+        return html`<h3><slot></slot></h3>`;
+      case '4':
+        return html`<h4><slot></slot></h4>`;
+      case '5':
+        return html`<h5><slot></slot></h5>`;
+      case '6':
+        return html`<h6><slot></slot></h6>`;
+      case 'hr':
+        return html`<div class="heading-hr"><slot></slot></div>`;
+      case 'hr-small':
+        return html`<div class="heading-hr heading-hr-small"><slot></slot></div>`;
+      default:
+        return html`<h1><slot></slot></h1>`;
+    }
+  }
+}

ts_web/elements/dees-hint.demo.ts

@@ -0,0 +1,5 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+  <dees-hint></dees-hint>
+`;

ts_web/elements/dees-hint.ts

@@ -0,0 +1,38 @@
+import {
+  DeesElement,
+  css,
+  cssManager,
+  customElement,
+  html,
+  property,
+  type CSSResult,
+  type TemplateResult,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { demoFunc } from './dees-hint.demo.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-hint': DeesHint;
+  }
+}
+
+@customElement('dees-hint')
+export class DeesHint extends DeesElement {
+  public static demo = demoFunc;
+
+  @property({ type: String })
+  public type: 'info' | 'warn' | 'error' | 'critical' = 'info';
+
+  constructor() {
+    super();
+    domtools.elementBasic.setup();
+  }
+
+  public static styles = [cssManager.defaultStyles, css``];
+
+  public render(): TemplateResult {
+    return html` <div class="mainbox"></div> `;
+  }
+}

ts_web/elements/dees-icon.demo.ts

@@ -0,0 +1,292 @@
+import { html } from '@design.estate/dees-element';
+import { icons, type IconWithPrefix } from './dees-icon.js';
+import * as lucideIcons from 'lucide';
+
+export const demoFunc = () => {
+  // Group FontAwesome icons by type
+  const faIcons = Object.keys(icons.fa);
+  
+  // Extract Lucide icons from the lucideIcons object directly
+  // Log the first few keys to understand the structure
+  console.log('First few Lucide keys:', Object.keys(lucideIcons).slice(0, 5));
+  
+  // Get all icon functions from lucideIcons (they have PascalCase names)
+  const lucideIconsList = Object.keys(lucideIcons)
+    .filter(key => {
+      // Skip utility functions and focus on icon components (first letter is uppercase)
+      const isUppercaseFirst = key[0] === key[0].toUpperCase() && key[0] !== key[0].toLowerCase();
+      const isFunction = typeof lucideIcons[key] === 'function';
+      const notUtility = !['createElement', 'createIcons', 'default'].includes(key);
+      return isFunction && isUppercaseFirst && notUtility;
+    })
+    .map(pascalName => {
+      // Convert PascalCase to camelCase
+      return pascalName.charAt(0).toLowerCase() + pascalName.slice(1);
+    });
+  
+  // Log how many icons we found
+  console.log(`Found ${lucideIconsList.length} Lucide icons`);
+  
+  // If we didn't find any, try an alternative approach
+  if (lucideIconsList.length === 0) {
+    console.log('Trying alternative approach to find Lucide icons');
+    
+    // Try to get icon names from a known property if available
+    if (lucideIcons.icons) {
+      const iconSource = lucideIcons.icons || {};
+      lucideIconsList.push(...Object.keys(iconSource));
+      console.log(`Found ${lucideIconsList.length} icons via alternative method`);
+    }
+  }
+
+  // Define the functions in TS scope instead of script tags
+  const searchIcons = (event: InputEvent) => {
+    const searchTerm = (event.target as HTMLInputElement).value.toLowerCase().trim();
+    // Get the demo container first, then search within it
+    const demoContainer = (event.target as HTMLElement).closest('.demoContainer');
+    const containers = demoContainer.querySelectorAll('.iconContainer');
+    
+    containers.forEach(container => {
+      const iconName = container.getAttribute('data-name');
+      
+      if (searchTerm === '') {
+        container.classList.remove('hidden');
+      } else if (iconName && iconName.includes(searchTerm)) {
+        container.classList.remove('hidden');
+      } else {
+        container.classList.add('hidden');
+      }
+    });
+    
+    // Update counts - search within demoContainer
+    demoContainer.querySelectorAll('.section-container').forEach(section => {
+      const visibleIcons = section.querySelectorAll('.iconContainer:not(.hidden)').length;
+      const countElement = section.querySelector('.icon-count');
+      if (countElement) {
+        const totalIconsCount = section.classList.contains('fa-section') 
+          ? faIcons.length 
+          : lucideIconsList.length;
+        
+        countElement.textContent = visibleIcons === totalIconsCount 
+          ? `${totalIconsCount} icons` 
+          : `${visibleIcons} of ${totalIconsCount} icons`;
+      }
+    });
+  };
+  
+  const copyIconName = (iconNameToCopy: string, type: 'fa' | 'lucide') => {
+    // Use the new prefix format
+    const textToCopy = `${type}:${iconNameToCopy}`;
+    
+    navigator.clipboard.writeText(textToCopy).then(() => {
+      // Find the event target
+      const currentEvent = window.event as MouseEvent;
+      const currentTarget = currentEvent.currentTarget as HTMLElement;
+      // Show feedback
+      const tooltip = currentTarget.querySelector('.copy-tooltip');
+      if (tooltip) {
+        tooltip.textContent = 'Copied!';
+        
+        setTimeout(() => {
+          tooltip.textContent = 'Click to copy';
+        }, 2000);
+      }
+    });
+  };
+
+  return html`
+  <style>
+    .demoContainer {
+      width: 100%;
+      box-sizing: border-box;
+      display: flex;
+      flex-wrap: wrap;
+      background: #111111;
+      padding: 20px;
+      font-size: 30px;
+      font-family: -apple-system, BlinkMacSystemFont, "Segoe UI", Roboto, Oxygen-Sans, Ubuntu, Cantarell, "Helvetica Neue", sans-serif;
+    }
+    
+    .search-container {
+      width: 100%;
+      margin-bottom: 20px;
+      display: flex;
+    }
+    
+    #iconSearch {
+      flex: 1;
+      padding: 12px 16px;
+      font-size: 16px;
+      border: none;
+      border-radius: 4px;
+      background: #222;
+      color: #fff;
+      border: 1px solid #333;
+    }
+    
+    #iconSearch:focus {
+      outline: none;
+      border-color: #e4002b;
+    }
+    
+    dees-icon {
+      transition: all 0.2s ease;
+      color: #ffffff;
+    }
+
+    .iconContainer {
+      display: flex;
+      flex-direction: column;
+      align-items: center;
+      padding: 20px 16px 0px 16px;
+      border: 1px solid #333333;
+      margin-right: 10px;
+      margin-bottom: 10px;
+      border-radius: 4px;
+      transition: background-color 0.2s;
+      cursor: pointer;
+      position: relative;
+    }
+    
+    .iconContainer:hover {
+      background-color: #222;
+    }
+
+    .iconName {
+      font-size: 12px;
+      text-align: center;
+      color: #ccc;
+      background: #333333;
+      padding: 6px 10px;
+      margin-left: -16px;
+      margin-right: -16px;
+      margin-top: 20px;
+      white-space: nowrap;
+      overflow: hidden;
+      text-overflow: ellipsis;
+      max-width: 120px;
+      border-radius: 0 0 4px 4px;
+    }
+
+    .section-title {
+      width: 100%;
+      color: #ffffff;
+      font-size: 24px;
+      margin: 20px 0;
+      padding-bottom: 10px;
+      border-bottom: 1px solid #333333;
+      display: flex;
+      justify-content: space-between;
+      align-items: center;
+    }
+    
+    .api-note {
+      font-size: 14px;
+      color: #e4002b;
+      margin-bottom: 20px;
+      padding: 10px;
+      border: 1px solid #e4002b;
+      border-radius: 4px;
+      background: rgba(228, 0, 43, 0.1);
+    }
+    
+    .icon-count {
+      font-size: 14px;
+      color: #888;
+      font-weight: normal;
+      background: #222;
+      padding: 5px 10px;
+      border-radius: 20px;
+    }
+    
+    .icons-grid {
+      display: flex;
+      flex-wrap: wrap;
+      width: 100%;
+    }
+    
+    .section-container {
+      width: 100%;
+      margin-bottom: 30px;
+    }
+    
+    .copy-tooltip {
+      position: absolute;
+      background: #333;
+      color: white;
+      padding: 5px 10px;
+      border-radius: 4px;
+      font-size: 12px;
+      top: -30px;
+      opacity: 0;
+      transition: opacity 0.3s;
+      pointer-events: none;
+    }
+    
+    .iconContainer:hover .copy-tooltip {
+      opacity: 1;
+    }
+
+    .iconContainer:hover dees-icon {
+      transform: scale(1.1);
+    }
+    
+    .hidden {
+      display: none !important;
+    }
+  </style>
+  
+  <div class="demoContainer">
+    <div class="search-container">
+      <input type="text" id="iconSearch" placeholder="Search icons..." @input=${searchIcons}>
+    </div>
+    
+    <div class="api-note">
+      New API: Use <code>icon="fa:iconName"</code> or <code>icon="lucide:iconName"</code> instead of <code>iconFA</code>. 
+      Click any icon to copy its new format to clipboard.
+    </div>
+    
+    <div class="section-container fa-section">
+      <div class="section-title">
+        FontAwesome Icons
+        <span class="icon-count">${faIcons.length} icons</span>
+      </div>
+      <div class="icons-grid">
+        ${faIcons.map(
+          (iconName) => {
+            const prefixedName = `fa:${iconName}`;
+            return html`
+              <div class="iconContainer fa-icon" data-name=${iconName.toLowerCase()} @click=${() => copyIconName(iconName, 'fa')}>
+                <dees-icon .icon=${prefixedName as IconWithPrefix} iconSize="24"></dees-icon>
+                <div class="iconName">${iconName}</div>
+                <span class="copy-tooltip">Click to copy</span>
+              </div>
+            `;
+          }
+        )}
+      </div>
+    </div>
+
+    <div class="section-container lucide-section">
+      <div class="section-title">
+        Lucide Icons
+        <span class="icon-count">${lucideIconsList.length} icons</span>
+      </div>
+      <div class="icons-grid">
+        ${lucideIconsList.map(
+          (iconName) => {
+            const prefixedName = `lucide:${iconName}`;
+            return html`
+              <div class="iconContainer lucide-icon" data-name=${iconName.toLowerCase()} @click=${() => copyIconName(iconName, 'lucide')}>
+                <dees-icon .icon=${prefixedName as IconWithPrefix} iconSize="24"></dees-icon>
+                <div class="iconName">${iconName}</div>
+                <span class="copy-tooltip">Click to copy</span>
+              </div>
+            `;
+          }
+        )}
+      </div>
+    </div>
+  </div>
+  `;
+};

ts_web/elements/dees-icon.ts

@@ -1,8 +1,16 @@
-import { LitElement, html, property, customElement } from 'lit-element';
+import {
+  DeesElement,
+  html,
+  property,
+  customElement,
+  cssManager,
+  css,
+  type CSSResult,
+} from '@design.estate/dees-element';
 
-import * as domtools from '@designestate/dees-domtools';
+import * as domtools from '@design.estate/dees-domtools';
 
-import { icon, IconDefinition } from '@fortawesome/fontawesome-svg-core';
+import { icon, type IconDefinition } from '@fortawesome/fontawesome-svg-core';
 import {
   faFacebook,
   faGoogle,
@@ -10,109 +18,436 @@ import {
   faMedium,
   faSlackHash,
   faTwitter,
+  faInstagram,
+  faTiktok,
 } from '@fortawesome/free-brands-svg-icons';
 
-import {} from '@fortawesome/free-regular-svg-icons';
-import { faDesktop, faRss, faUsers } from '@fortawesome/free-solid-svg-icons';
+import {
+  faCopy as faCopyRegular,
+  faCircleCheck as faCircleCheckRegular,
+  faCircleXmark as faCircleXmarkRegular,
+  faMessage as faMessageRegular,
+  faPaste as faPasteRegular,
+  faSun as faSunRegular,
+  faTrashCan as faTrashCanRegular,
+} from '@fortawesome/free-regular-svg-icons';
+import {
+  faArrowRight as faArrowRightSolid,
+  faArrowUpRightFromSquare as faArrowUpRightFromSquareSolid,
+  faBell as faBellSolid,
+  faBug as faBugSolid,
+  faBuilding as faBuildingSolid,
+  faCaretLeft as faCaretLeftSolid,
+  faCaretRight as faCaretRightSolid,
+  faCheck as faCheckSolid,
+  faCircleInfo as faCircleInfoSolid,
+  faCircleCheck as faCircleCheckSolid,
+  faCircleXmark as faCircleXmarkSolid,
+  faClockRotateLeft as faClockRotateLeftSolid,
+  faCopy as faCopySolid,
+  faDesktop as faDesktopSolid,
+  faEye as faEyeSolid,
+  faEyeSlash as faEyeSlashSolid,
+  faFileInvoice as faFileInvoiceSolid,
+  faFileInvoiceDollar as faFileInvoiceDollarSolid,
+  faGear as faGearSolid,
+  faGrip as faGripSolid,
+  faMagnifyingGlass as faMagnifyingGlassSolid,
+  faMessage as faMessageSolid,
+  faMoneyCheckDollar as faMoneyCheckDollarSolid,
+  faMugHot as faMugHotSolid,
+  faMinus as faMinusSolid,
+  faNetworkWired as faNetworkWiredSolid,
+  faPaperclip as faPaperclipSolid,
+  faPaste as faPasteSolid,
+  faPenToSquare as faPenToSquareSolid,
+  faPlus as faPlusSolid,
+  faReceipt as faReceiptSolid,
+  faRss as faRssSolid,
+  faUsers as faUsersSolid,
+  faShare as faShareSolid,
+  faSun as faSunSolid,
+  faTerminal as faTerminalSolid,
+  faTrash as faTrashSolid,
+  faTrashCan as faTrashCanSolid,
+  faWallet as faWalletSolid,
+  faXmark as faXmarkSolid,
+} from '@fortawesome/free-solid-svg-icons';
+import { demoFunc } from './dees-icon.demo.js';
 
-type TFontAwesomeIcon =
+// Import Lucide icons and the createElement function
+import * as lucideIcons from 'lucide';
+import { createElement } from 'lucide';
+
+// Collect FontAwesome icons
+const faIcons = {
   // normal
-  | 'desktop'
-  | 'rss'
-  // brands
-  | 'facebook'
-  | 'google'
-  | 'twitter'
-  | 'linkedin'
-  | 'medium'
-  | 'slack'
-  | 'users';
-const faIcons: { [key: string]: IconDefinition } = {
-  // normal
-  desktop: faDesktop,
-  rss: faRss,
+  arrowRight: faArrowRightSolid,
+  arrowUpRightFromSquare: faArrowUpRightFromSquareSolid,
+  bell: faBellSolid,
+  bug: faBugSolid,
+  building: faBuildingSolid,
+  caretLeft: faCaretLeftSolid,
+  caretRight: faCaretRightSolid,
+  check: faCheckSolid,
+  circleInfo: faCircleInfoSolid,
+  circleCheck: faCircleCheckRegular,
+  circleCheckSolid: faCircleCheckSolid,
+  circleXmark: faCircleXmarkRegular,
+  circleXmarkSolid: faCircleXmarkSolid,
+  clockRotateLeft: faClockRotateLeftSolid,
+  copy: faCopyRegular,
+  copySolid: faCopySolid,
+  desktop: faDesktopSolid,
+  eye: faEyeSolid,
+  eyeSlash: faEyeSlashSolid,
+  fileInvoice: faFileInvoiceSolid,
+  fileInvoiceDoller: faFileInvoiceDollarSolid,
+  gear: faGearSolid,
+  grip: faGripSolid,
+  magnifyingGlass: faMagnifyingGlassSolid,
+  message: faMessageRegular,
+  messageSolid: faMessageSolid,
+  moneyCheckDollar: faMoneyCheckDollarSolid,
+  mugHot: faMugHotSolid,
+  minus: faMinusSolid,
+  networkWired: faNetworkWiredSolid,
+  paperclip: faPaperclipSolid,
+  paste: faPasteRegular,
+  pasteSolid: faPasteSolid,
+  penToSquare: faPenToSquareSolid,
+  plus: faPlusSolid,
+  receipt: faReceiptSolid,
+  rss: faRssSolid,
+  share: faShareSolid,
+  sun: faSunRegular,
+  sunSolid: faSunSolid,
+  terminal: faTerminalSolid,
+  trash: faTrashSolid,
+  trashSolid: faTrashSolid,
+  trashCan: faTrashCanRegular,
+  trashCanSolid: faTrashCanSolid,
+  users: faUsersSolid,
+  wallet: faWalletSolid,
+  xmark: faXmarkSolid,
   // brands
   facebook: faFacebook,
   google: faGoogle,
+  instagram: faInstagram,
   linkedin: faLinkedin,
   medium: faMedium,
   slack: faSlackHash,
+  tiktok: faTiktok,
   twitter: faTwitter,
-  users: faUsers,
 };
 
+// Create a string literal type for all FA icons
+type FAIconKey = keyof typeof faIcons;
+
+// Create union types for the icons with prefixes
+export type IconWithPrefix = `fa:${FAIconKey}` | `lucide:${string}`;
+
+// Export only FontAwesome icons directly
+export const icons = {
+  fa: faIcons
+};
+
+// Legacy type for backward compatibility
+export type TIconKey = FAIconKey | `lucide:${string}`;
+
+// Use a global static cache for all icons to reduce rendering
+const iconCache = new Map<string, string>();
+
+// Clear cache items occasionally to prevent memory leaks 
+const MAX_CACHE_SIZE = 500;
+function limitCacheSize() {
+  if (iconCache.size > MAX_CACHE_SIZE) {
+    // Remove oldest entries (first 20% of items)
+    const keysToDelete = Array.from(iconCache.keys()).slice(0, MAX_CACHE_SIZE / 5);
+    keysToDelete.forEach(key => iconCache.delete(key));
+  }
+}
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-icon': DeesIcon;
+  }
+}
+
 @customElement('dees-icon')
-export class DeesIcon extends LitElement {
-  public static demo = () => html`
-    <div style="background: #fff; padding: 10px;">
-      <dees-icon iconName="visibility"></dees-icon>
-      <dees-icon brandName="facebook"></dees-icon>
-    </div>
-  `;
+export class DeesIcon extends DeesElement {
+  public static demo = demoFunc;
 
-  @property()
-  public iconName: string;
+  /**
+   * @deprecated Use the `icon` property instead with format "fa:iconName" or "lucide:iconName"
+   */
+  @property({
+    type: String,
+    converter: {
+      // Convert attribute string to property (for reflected attributes)
+      fromAttribute: (value: string): TIconKey => value as TIconKey,
+      // Convert property to attribute (for reflection)
+      toAttribute: (value: TIconKey): string => value
+    }
+  })
+  public iconFA?: TIconKey;
 
-  @property()
-  public brandName: TFontAwesomeIcon;
+  /**
+   * The preferred icon property. Use format "fa:iconName" or "lucide:iconName"
+   * Examples: "fa:check", "lucide:menu"
+   */
+  @property({
+    type: String,
+    converter: {
+      fromAttribute: (value: string): IconWithPrefix => value as IconWithPrefix,
+      toAttribute: (value: IconWithPrefix): string => value
+    }
+  })
+  public icon?: IconWithPrefix;
 
-  @property()
-  public svgSize: number = 20;
+  @property({ type: Number })
+  public iconSize: number;
+
+  @property({ type: String })
+  public color: string = 'currentColor';
+
+  @property({ type: Number })
+  public strokeWidth: number = 2;
+
+  // For tracking when we need to re-render
+  private lastIcon: IconWithPrefix | TIconKey | null = null;
+  private lastIconSize: number | null = null;
+  private lastColor: string | null = null;
+  private lastStrokeWidth: number | null = null;
 
   constructor() {
     super();
     domtools.elementBasic.setup();
   }
 
+  /**
+   * Gets the effective icon value, supporting both the new `icon` property
+   * and the legacy `iconFA` property for backward compatibility.
+   * Prefers `icon` if both are set.
+   */
+  private getEffectiveIcon(): IconWithPrefix | TIconKey | null {
+    // Prefer the new API
+    if (this.icon) {
+      return this.icon;
+    }
+    
+    // Fall back to the old API
+    if (this.iconFA) {
+      // If iconFA is already in the proper format (lucide:name), use it directly
+      if (this.iconFA.startsWith('lucide:')) {
+        return this.iconFA;
+      }
+      
+      // For FontAwesome icons with no prefix, add the prefix
+      return `fa:${this.iconFA}` as IconWithPrefix;
+    }
+    
+    return null;
+  }
+  
+  /**
+   * Parses an icon string into its type and name parts
+   * @param iconStr The icon string in format "type:name"
+   * @returns Object with type and name properties
+   */
+  private parseIconString(iconStr: string): { type: 'fa' | 'lucide', name: string } {
+    if (iconStr.startsWith('fa:')) {
+      return {
+        type: 'fa',
+        name: iconStr.substring(3) // Remove 'fa:' prefix
+      };
+    } else if (iconStr.startsWith('lucide:')) {
+      return {
+        type: 'lucide',
+        name: iconStr.substring(7) // Remove 'lucide:' prefix
+      };
+    } else {
+      // For backward compatibility, assume FontAwesome if no prefix
+      return {
+        type: 'fa',
+        name: iconStr
+      };
+    }
+  }
+
+  private renderLucideIcon(iconName: string): string {
+    // Create a cache key based on all visual properties
+    const cacheKey = `lucide:${iconName}:${this.iconSize}:${this.color}:${this.strokeWidth}`;
+    
+    // Check if we already have this icon in the cache
+    if (iconCache.has(cacheKey)) {
+      return iconCache.get(cacheKey) || '';
+    }
+
+    try {
+      // Get the Pascal case icon name (Menu instead of menu)
+      const pascalCaseName = iconName.charAt(0).toUpperCase() + iconName.slice(1);
+      
+      // Check if the icon exists in lucideIcons
+      if (!lucideIcons[pascalCaseName]) {
+        console.warn(`Lucide icon '${pascalCaseName}' not found in lucideIcons object`);
+        return '';
+      }
+      
+      // Use the exact pattern from Lucide documentation
+      const svgElement = createElement(lucideIcons[pascalCaseName], {
+        color: this.color,
+        size: this.iconSize,
+        strokeWidth: this.strokeWidth
+      });
+      
+      if (!svgElement) {
+        console.warn(`createElement returned empty result for ${pascalCaseName}`);
+        return '';
+      }
+      
+      // Get the HTML
+      const result = svgElement.outerHTML;
+      
+      // Cache the result for future use
+      iconCache.set(cacheKey, result);
+      limitCacheSize();
+      
+      return result;
+    } catch (error) {
+      console.error(`Error rendering Lucide icon ${iconName}:`, error);
+      
+      // Create a fallback SVG with the icon name
+      return `<svg xmlns="http://www.w3.org/2000/svg" width="${this.iconSize}" height="${this.iconSize}" viewBox="0 0 24 24" fill="none" stroke="${this.color}" stroke-width="${this.strokeWidth}" stroke-linecap="round" stroke-linejoin="round">
+        <text x="50%" y="50%" font-size="6" text-anchor="middle" dominant-baseline="middle" fill="${this.color}">${iconName}</text>
+      </svg>`;
+    }
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        display: inline-flex;
+        align-items: center;
+        justify-content: center;
+        line-height: 1;
+        vertical-align: middle;
+      }
+      
+      /* Improve rendering performance */
+      #iconContainer svg {
+        display: block;
+        height: 100%;
+        width: 100%;
+        will-change: transform; /* Helps with animations */
+        contain: strict; /* Performance optimization */
+      }
+    `,
+  ];
+
   public render() {
     return html`
       ${domtools.elementBasic.styles}
       <style>
-        :host {
-          display: block;
-          line-height: inherit;
-          font-size: inherit;
-        }
-        #iconContainer svg {
-          display: inline-block;
-          height: ${this.svgSize}px;
-        }
-        .material-icons {
-          font-family: 'Material Icons';
-          font-weight: normal;
-          font-style: normal;
-          line-height: inherit;
-          font-size: inherit;
-          display: inline-block;
-          line-height: inherit;
-          text-transform: none;
-          letter-spacing: normal;
-          word-wrap: normal;
-          white-space: nowrap;
-          direction: ltr;
-
-          /* Support for all WebKit browsers. */
-          -webkit-font-smoothing: antialiased;
-          /* Support for Safari and Chrome. */
-          text-rendering: optimizeLegibility;
-
-          /* Support for Firefox. */
-          -moz-osx-font-smoothing: grayscale;
-
-          /* Support for IE. */
-          font-feature-settings: 'liga';
+        #iconContainer {
+          width: ${this.iconSize}px;
+          height: ${this.iconSize}px;
         }
       </style>
-      ${this.iconName ? html`<i class="material-icons">${this.iconName}</i>` : html``}
-      ${this.brandName ? html`<div id="iconContainer"></div>` : html``}
+      <div id="iconContainer"></div>
     `;
   }
 
-  firstUpdated() {
-    if (this.brandName && !this.iconName) {
-      this.shadowRoot.querySelector('#iconContainer').innerHTML = icon(
-        faIcons[this.brandName]
-      ).html[0];
+  public updated() {
+    // If size is not specified, use font size as a base
+    if (!this.iconSize) {
+      this.iconSize = parseInt(globalThis.getComputedStyle(this).fontSize.replace(/\D/g,''));
+    }
+    
+    // Get the effective icon (either from icon or iconFA property)
+    const effectiveIcon = this.getEffectiveIcon();
+    
+    // Check if we actually need to update the icon
+    // This prevents unnecessary DOM operations when properties haven't changed
+    if (this.lastIcon === effectiveIcon && 
+        this.lastIconSize === this.iconSize && 
+        this.lastColor === this.color && 
+        this.lastStrokeWidth === this.strokeWidth) {
+      return; // No visual changes - skip update
+    }
+    
+    // Update our "last properties" for future change detection
+    this.lastIcon = effectiveIcon;
+    this.lastIconSize = this.iconSize;
+    this.lastColor = this.color;
+    this.lastStrokeWidth = this.strokeWidth;
+    
+    const container = this.shadowRoot?.querySelector('#iconContainer');
+    if (!container || !effectiveIcon) return;
+
+    try {
+      // Parse the icon string to get type and name
+      const { type, name } = this.parseIconString(effectiveIcon);
+      
+      if (type === 'lucide') {
+        // For Lucide, use direct DOM manipulation as shown in the docs
+        // This approach avoids HTML string issues
+        container.innerHTML = ''; // Clear container
+        
+        try {
+          // Convert to PascalCase
+          const pascalCaseName = name.charAt(0).toUpperCase() + name.slice(1);
+          
+          if (lucideIcons[pascalCaseName]) {
+            // Use the documented pattern from Lucide docs
+            const svgElement = createElement(lucideIcons[pascalCaseName], {
+              color: this.color,
+              size: this.iconSize,
+              strokeWidth: this.strokeWidth
+            });
+            
+            if (svgElement) {
+              // Directly append the element
+              container.appendChild(svgElement);
+              return; // Exit early since we've added the element
+            }
+          }
+          
+          // If we reach here, something went wrong
+          throw new Error(`Could not create element for ${pascalCaseName}`);
+        } catch (error) {
+          console.error(`Error rendering Lucide icon:`, error);
+          
+          // Fall back to the string-based approach
+          const iconHtml = this.renderLucideIcon(name);
+          if (iconHtml) {
+            container.innerHTML = iconHtml;
+          }
+        }
+      } else {
+        // Use FontAwesome rendering via HTML string
+        const faIcon = icons.fa[name as FAIconKey];
+        if (faIcon) {
+          const iconHtml = icon(faIcon).html[0];
+          container.innerHTML = iconHtml;
+        } else {
+          console.warn(`FontAwesome icon not found: ${name}`);
+        }
+      }
+    } catch (error) {
+      console.error(`Error updating icon ${effectiveIcon}:`, error);
     }
   }
-}
+
+  // Clean up resources when element is removed
+  async disconnectedCallback() {
+    super.disconnectedCallback();
+    
+    // Clear our references
+    this.lastIcon = null;
+    this.lastIconSize = null;
+    this.lastColor = null;
+    this.lastStrokeWidth = null;
+  }
+}

ts_web/elements/dees-input-checkbox.ts

@@ -1,19 +1,55 @@
-import { customElement, LitElement, TemplateResult, property, html } from 'lit-element';
-import * as domtools from '@designestate/dees-domtools';
+import {
+  customElement,
+  DeesElement,
+  type TemplateResult,
+  property,
+  html,
+  css,
+  cssManager,
+  type CSSResult,
+} from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-input-checkbox': DeesInputCheckbox;
+  }
+}
 
 @customElement('dees-input-checkbox')
-export class DeesInputCheckbox extends LitElement {
+export class DeesInputCheckbox extends DeesElement {
+  // STATIC
   public static demo = () => html`<dees-input-checkbox></dees-input-checkbox>`;
 
-  @property()
+  // INSTANCE
+  public changeSubject = new domtools.plugins.smartrx.rxjs.Subject();
+
+  @property({
+    type: String,
+    reflect: true,
+  })
   public key: string;
 
-  @property()
+  @property({
+    type: String,
+  })
   public label: string = 'Label';
 
-  @property()
+  @property({
+    type: Boolean,
+  })
   public value: boolean = false;
 
+  @property({
+    type: Boolean,
+  })
+  public required: boolean = false;
+
+  @property({
+    type: Boolean
+  })
+  public disabled: boolean = false;
+
   public render(): TemplateResult {
     return html`
       ${domtools.elementBasic.styles}
@@ -26,18 +62,21 @@ export class DeesInputCheckbox extends LitElement {
           display: block;
           position: relative;
           margin: 20px 0px;
-          cursor: pointer;
+          cursor: default;
+        }
+        :host(:hover) {
+          filter: ${cssManager.bdTheme('brightness(0.95)', 'brightness(1.1)')};
         }
 
         .maincontainer {
           display: grid;
           grid-template-columns: 25px auto;
           padding: 5px 0px;
-          color: #ccc;
+          color: ${this.goBright ? '#333' : '#ccc'};
         }
 
         .maincontainer:hover {
-          color: #fff;
+          ${this.goBright ? '#000' : '#ccc'};
         }
 
         .label {
@@ -55,20 +94,25 @@ export class DeesInputCheckbox extends LitElement {
         .checkbox {
           transition: all 0.1s;
           box-sizing: border-box;
-          border: 1px solid #999;
+          border: 1px solid ${this.goBright ? '#CCC' : '#999'};
           border-radius: 2px;
           height: 24px;
           width: 24px;
           display: inline-block;
-          background: #222;
+          background: ${this.goBright ? '#fafafa' : '#222'};
         }
 
         .checkbox.selected {
-          background: #039BE5;
-          border: 1px solid #039BE5;
+          background: #0050b9;
+          border: 1px solid #0050b9;
         }
 
-        .checkmark {
+        .checkbox.disabled {
+          background: none;
+          border: 1px dashed ${cssManager.bdTheme('#666666', '#666666')};
+        }
+
+        .checkbox .checkmark {
           display: inline-block;
           width: 22px;
           height: 22px;
@@ -77,16 +121,16 @@ export class DeesInputCheckbox extends LitElement {
           transform: rotate(45deg);
         }
 
-        .checkmark_stem {
+        .checkbox .checkmark_stem {
           position: absolute;
           width: 3px;
           height: 9px;
-          background-color: #ccc;
+          background-color: #fff;
           left: 11px;
           top: 6px;
         }
 
-        .checkmark_kick {
+        .checkbox .checkmark_kick {
           position: absolute;
           width: 3px;
           height: 3px;
@@ -95,12 +139,16 @@ export class DeesInputCheckbox extends LitElement {
           top: 12px;
         }
 
+        .checkbox.disabled .checkmark_stem, .checkbox.disabled .checkmark_kick {
+          background-color: ${cssManager.bdTheme('#333', '#fff')};
+        }
+
         img {
           padding: 4px;
         }
       </style>
       <div class="maincontainer" @click="${this.toggleSelected}">
-        <div class="checkbox ${this.value ? 'selected' : ''}">
+        <div class="checkbox ${this.value ? 'selected' : ''} ${this.disabled ? 'disabled' : ''}" tabindex="0">
           ${this.value
             ? html`
                 <span class="checkmark">
@@ -116,6 +164,9 @@ export class DeesInputCheckbox extends LitElement {
   }
 
   public async toggleSelected() {
+    if (this.disabled) {
+      return;
+    }
     this.value = !this.value;
     this.dispatchEvent(
       new CustomEvent('newValue', {
@@ -123,5 +174,13 @@ export class DeesInputCheckbox extends LitElement {
         bubbles: true,
       })
     );
+    this.changeSubject.next(this);
+  }
+
+  public focus(): void {
+    const checkboxDiv = this.shadowRoot.querySelector('.checkbox');
+    if (checkboxDiv) {
+      (checkboxDiv as any).focus();
+    }
   }
 }

ts_web/elements/dees-input-dropdown.demo.ts

@@ -0,0 +1,27 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+<dees-input-dropdown
+  .options=${[
+    {option: 'option 1', key: 'option1'},
+    {option: 'option 2', key: 'option2'},
+    {option: 'option 3', key: 'option3'}
+  ]}
+></dees-input-dropdown>
+<dees-input-dropdown
+  .enableSearch=${false}
+  .options=${[
+    {option: 'option 1', key: 'option1'},
+    {option: 'option 2', key: 'option2'},
+    {option: 'option 3', key: 'option3'}
+  ]}
+></dees-input-dropdown>
+<div style="height: 300px"></div>
+<dees-input-dropdown
+  .options=${[
+    {option: 'option 1', key: 'option1'},
+    {option: 'option 2', key: 'option2'},
+    {option: 'option 3', key: 'option3'}
+  ]}
+></dees-input-dropdown>
+`

ts_web/elements/dees-input-dropdown.ts

@@ -1,116 +1,375 @@
-import { customElement, LitElement, TemplateResult, property, html } from 'lit-element';
+import {
+  customElement,
+  DeesElement,
+  type TemplateResult,
+  property,
+  state,
+  html,
+  css,
+  cssManager,
+  type CSSResult,
+} from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
+import { demoFunc } from './dees-input-dropdown.demo.js';
+import { DeesWindowLayer } from './dees-windowlayer.js';
 
-import * as domtools from '@designestate/dees-domtools';
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-input-dropdown': DeesInputDropdown;
+  }
+}
 
 @customElement('dees-input-dropdown')
-export class DeesInputDropdown extends LitElement {
-  @property()
+export class DeesInputDropdown extends DeesElement {
+  public static demo = demoFunc;
+
+  // INSTANCE
+  public changeSubject = new domtools.plugins.smartrx.rxjs.Subject();
+
+  @property({
+    type: String,
+    reflect: true,
+  })
   public label: string = 'Label';
 
   @property()
   public key: string;
 
   @property()
-  public options: {option: string, key: string, payload?: any}[] = [];
+  public options: { option: string; key: string; payload?: any }[] = [];
 
   @property()
-  public selectedOption: {option: string, key: string, payload?: any} = {
-    key: null,
-    option: null,
-    payload: null
-  };
+  public selectedOption: { option: string; key: string; payload?: any } = null;
+
+  @property({
+    type: Boolean,
+  })
+  public required: boolean = false;
+
+  @property({
+    type: Boolean,
+  })
+  public enableSearch: boolean = true;
+
+  @property({
+    type: Boolean,
+  })
+  public disabled: boolean = false;
+
+  @state()
+  public opensToTop: boolean = false;
+
+  @state()
+  private filteredOptions: { option: string; key: string; payload?: any }[] = [];
+
+  @state()
+  private highlightedIndex: number = 0;
+
+  @state()
+  public isOpened = false;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      * {
+        box-sizing: border-box;
+      }
+
+      :host {
+        font-family: Roboto;
+        position: relative;
+        display: block;
+        color: ${cssManager.bdTheme('#222', '#fff')};
+        margin-bottom: 24px;
+      }
+
+      .maincontainer {
+        display: block;
+      }
+
+      .label {
+        font-size: 14px;
+        margin-bottom: 8px;
+      }
+
+      .selectedBox {
+        user-select: none;
+        position: relative;
+        max-width: 420px;
+        height: 40px;
+        line-height: 40px;
+        padding: 0px 8px;
+        background: ${cssManager.bdTheme('#fafafa', '#222222')};
+        box-shadow: ${cssManager.bdTheme('0px 1px 4px rgba(0,0,0,0.3)', 'none')};
+        border-radius: 3px;
+        border-top: ${cssManager.bdTheme('1px solid #CCC', '1px solid #ffffff10')};
+        border-bottom: ${cssManager.bdTheme('1px solid #CCC', '1px solid #222')};
+        transition: all 0.2s ease;
+        font-size: 16px;
+        color: ${cssManager.bdTheme('#222', '#ccc')};
+      }
+
+      .selectedBox:hover {
+        filter: ${cssManager.bdTheme('brightness(0.95)', 'brightness(1.1)')};
+      }
+
+      .accentBottom {
+        filter: none !important;
+      }
+
+      .accentTop {
+        filter: none !important;
+      }
+
+      .selectionBox {
+        will-change: transform;
+        pointer-events: none;
+        transition: all 0.2s ease;
+        opacity: 0;
+        background: ${cssManager.bdTheme('#ffffff', '#222222')};
+        max-width: 420px;
+        box-shadow: 0px 0px 5px rgba(0, 0, 0, 0.2);
+        min-height: 40px;
+        border-radius: 8px;
+        padding: 4px 8px;
+        position: absolute;
+        user-select: none;
+        margin: 3px 0px 0px 0px;
+        border-top: ${cssManager.bdTheme('1px solid #CCC', '1px solid #ffffff10')};
+      }
+      .selectionBox.top {
+        transform: translate(0px, 4px);
+      }
+      .selectionBox.bottom {
+        transform: translate(0px, -4px);
+      }
+
+      .selectionBox.show {
+        pointer-events: all;
+        transform: scale(1, 1) translate(0px, 0px);
+        opacity: 1;
+        box-shadow: 0px 0px 8px rgba(0, 0, 0, 0.8);
+      }
+
+      .option {
+        transition: all 0.1s;
+        line-height: 32px;
+        padding: 0px 4px;
+        border-radius: 3px;
+        margin: 4px 0px;
+      }
+
+      .option.highlighted {
+        border-left: 2px solid #0069f2;
+        padding-left: 6px;
+        background: #ffffff20;
+      }
+
+      .option:hover {
+        color: #fff;
+        padding-left: 8px;
+        background: #0069f2;
+      }
+
+      .search.top {
+        padding-top: 4px;
+      }
+      .search.bottom {
+        padding-bottom: 4px;
+      }
+      .search input {
+        display: block;
+        background: none;
+        border: none;
+        height: 24px;
+        color: inherit;
+        text-align: left;
+        font-size: 12px;
+        font-weight: 600;
+        width: 100%;
+        margin: auto;
+      }
+
+      .search.top input {
+        border-bottom: 1px dotted #333;
+      }
+      .search.bottom input {
+        border-top: 1px dotted #333;
+      }
+
+      .search input:focus {
+        outline: none;
+      }
+    `,
+  ];
 
   public render(): TemplateResult {
     return html`
-      ${domtools.elementBasic.styles}
-      <style>
-        * {
-          box-sizing: border-box;
-        }
-
-        :host {
-          position: relative;
-          display: block;
-          height: 40px;
-        }
-
-        .maincontainer {
-          display: block;
-        }
-
-        .label {
-          font-size: 14px;
-          margin-bottom: 15px;
-        }
-
-        .selectedBox {
-          cursor: pointer;
-          position: relative;
-          max-width: 420px;
-          height: 40px;
-          border: 1px solid #CCC;
-          padding: 12px;
-          z-index: 0px;
-        }
-
-        .selectionBox {
-          pointer-events: none;
-          cursor: pointer;
-          transition: all 0.2s ease;
-          opacity: 0;
-          position: relative;
-          background: #ffffff;
-          max-width: 420px;
-          box-shadow: 0px 0px 5px  rgba(0,0,0,0.2);
-          height: 40px;
-          margin-top: -40px;
-          z-index: 100;
-        }
-
-        .selectionBox.show {
-          pointer-events: all;
-          opacity: 1;
-          min-height: 160px;
-        }
-
-        .option {
-          padding: 12px;
-        }
-
-        .option:hover {
-          background: #fafafa;
-        }
-      </style>
-      <div class="maincontainer">
-        <div class="selectedBox" @click="${event => {this.toggleSelectionBox();}}">
-          ${this.selectedOption?.option}
-        </div>
+      <div class="maincontainer" @keydown="${this.isOpened ? this.handleKeyDown : undefined}">
+        ${this.label ? html`<div class="label">${this.label}</div>` : html``}
         <div class="selectionBox">
-          ${this.options.map(option => {
+          ${this.enableSearch && !this.opensToTop
+            ? html`
+                <div class="search top">
+                  <input type="text" placeholder="Search" @input="${this.handleSearch}" />
+                </div>
+              `
+            : null}
+          ${this.filteredOptions.map((option, index) => {
+            const isHighlighted = this.highlightedIndex === index;
             return html`
-              <div class="option" @click=${() => {this.updateSelection(option);}}>${option.option}</div>
-            `
+              <div
+                class="option ${isHighlighted ? 'highlighted' : ''}"
+                @click=${() => {
+                  this.updateSelection(option);
+                }}
+              >
+                ${option.option}
+              </div>
+            `;
           })}
+          ${this.enableSearch && this.opensToTop
+            ? html`
+                <div class="search bottom">
+                  <input type="text" placeholder="Search" @input="${this.handleSearch}" />
+                </div>
+              `
+            : null}
+        </div>
+        <div
+          class="selectedBox"
+          @click="${(event) => {
+            if (!this.isElevated) {
+              this.toggleSelectionBox();
+            } else {
+              this.updateSelection(this.selectedOption);
+            }
+          }}"
+        >
+          ${this.selectedOption?.option || 'Select...'} 
         </div>
       </div>
     `;
   }
 
   firstUpdated() {
-    this.selectedOption = this.options[0] || null;
+    this.selectedOption = this.selectedOption || null;
+    this.filteredOptions = this.options; // Initialize filteredOptions
   }
 
   public async updateSelection(selectedOption) {
     this.selectedOption = selectedOption;
 
-    this.dispatchEvent(new CustomEvent('selectedOption', {
-      detail: selectedOption,
-      bubbles: true
-    }));
-    this.toggleSelectionBox();
+    this.dispatchEvent(
+      new CustomEvent('selectedOption', {
+        detail: selectedOption,
+        bubbles: true,
+      })
+    );
+    if (this.isElevated) {
+      this.toggleSelectionBox();
+    }
+    this.changeSubject.next(this);
   }
 
-  public toggleSelectionBox() {
-    this.shadowRoot.querySelector('.selectionBox').classList.toggle('show');
+  private isElevated: boolean = false;
+  private windowOverlay: DeesWindowLayer;
+  public async toggleSelectionBox() {
+    this.isOpened = !this.isOpened;
+    const domtoolsInstance = await this.domtoolsPromise;
+    const selectedBox: HTMLElement = this.shadowRoot.querySelector('.selectedBox');
+    const selectionBox: HTMLElement = this.shadowRoot.querySelector('.selectionBox');
+    if (!this.isElevated) {
+      this.windowOverlay = await DeesWindowLayer.createAndShow({
+        blur: false,
+      });
+      const elevatedDropdown = new DeesInputDropdown();
+      elevatedDropdown.isElevated = true;
+      elevatedDropdown.label = this.label;
+      elevatedDropdown.enableSearch = this.enableSearch;
+      elevatedDropdown.required = this.required;
+      elevatedDropdown.disabled = this.disabled;
+      elevatedDropdown.style.position = 'fixed';
+      elevatedDropdown.style.top = this.getBoundingClientRect().top + 'px';
+      elevatedDropdown.style.left = this.getBoundingClientRect().left + 'px';
+      elevatedDropdown.style.width = this.clientWidth + 'px';
+      elevatedDropdown.options = this.options;
+      elevatedDropdown.selectedOption = this.selectedOption;
+      elevatedDropdown.highlightedIndex = elevatedDropdown.selectedOption ? elevatedDropdown.options.indexOf(
+        elevatedDropdown.options.find((option) => option.key === this.selectedOption.key)
+      ) : -1;
+      console.log(elevatedDropdown.options);
+      console.log(elevatedDropdown.selectedOption);
+      console.log(elevatedDropdown.highlightedIndex);
+      this.windowOverlay.appendChild(elevatedDropdown);
+      await domtoolsInstance.convenience.smartdelay.delayFor(0);
+      elevatedDropdown.toggleSelectionBox();
+      const destroyOverlay = async () => {
+        (elevatedDropdown.shadowRoot.querySelector('.selectionBox') as HTMLElement).style.opacity =
+          '0';
+        elevatedDropdown.removeEventListener('selectedOption', handleSelection);
+        this.windowOverlay.removeEventListener('clicked', destroyOverlay);
+        this.windowOverlay.destroy();
+      };
+      const handleSelection = async (event) => {
+        await this.updateSelection(elevatedDropdown.selectedOption);
+        destroyOverlay();
+      };
+      elevatedDropdown.addEventListener('selectedOption', handleSelection);
+      this.windowOverlay.addEventListener('clicked', destroyOverlay);
+    } else {
+      if (!selectionBox.classList.contains('show')) {
+        selectionBox.style.width = selectedBox.clientWidth + 'px';
+        const spaceData = selectedBox.getBoundingClientRect();
+        if (300 > window.innerHeight - spaceData.bottom) {
+          this.opensToTop = true;
+          selectedBox.classList.add('accentTop');
+          selectionBox.classList.add('top');
+          selectionBox.style.bottom = selectedBox.clientHeight + 2 + 'px';
+        } else {
+          selectedBox.classList.add('accentBottom');
+          selectionBox.classList.add('bottom');
+          this.opensToTop = false;
+          const labelOffset = this.label ? 24 : 0;
+          selectionBox.style.top = selectedBox.clientHeight + labelOffset + 'px';
+        }
+        await domtoolsInstance.convenience.smartdelay.delayFor(0);
+        const searchInput = selectionBox.querySelector('input');
+        searchInput?.focus();
+        selectionBox.classList.add('show');
+      } else {
+        selectedBox.style.pointerEvents = 'none';
+        selectionBox.classList.remove('show');
+        // selectedBox.style.opacity = '0';
+      }
+    }
+  }
+
+  private handleSearch(event: Event): void {
+    const searchTerm = (event.target as HTMLInputElement).value.toLowerCase();
+    this.filteredOptions = this.options.filter((option) =>
+      option.option.toLowerCase().includes(searchTerm)
+    );
+    this.highlightedIndex = 0; // Reset highlighted index
+  }
+
+  private handleKeyDown(event: KeyboardEvent): void {
+    if (!this.isOpened) {
+      console.log('discarded key event. Check why this function is called.');
+      return;
+    }
+    const key = event.key;
+    const maxIndex = this.filteredOptions.length - 1;
+
+    if (key === 'ArrowDown') {
+      this.highlightedIndex = this.highlightedIndex + 1 > maxIndex ? 0 : this.highlightedIndex + 1;
+      event.preventDefault();
+    } else if (key === 'ArrowUp') {
+      this.highlightedIndex = this.highlightedIndex - 1 < 0 ? maxIndex : this.highlightedIndex - 1;
+      event.preventDefault();
+    } else if (key === 'Enter') {
+      this.updateSelection(this.filteredOptions[this.highlightedIndex]);
+      event.preventDefault();
+    }
   }
 }

ts_web/elements/dees-input-fileupload.ts

@@ -0,0 +1,266 @@
+import * as colors from './00colors.js';
+import * as plugins from './00plugins.js';
+
+import { DeesContextmenu } from './dees-contextmenu.js';
+
+import {
+  customElement,
+  DeesElement,
+  type TemplateResult,
+  property,
+  html,
+  css,
+  unsafeCSS,
+  cssManager,
+  type CSSResult,
+  domtools,
+} from '@design.estate/dees-element';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-input-fileupload': DeesInputFileupload;
+  }
+}
+
+@customElement('dees-input-fileupload')
+export class DeesInputFileupload extends DeesElement {
+  public static demo = () =>
+    html`<dees-input-fileupload .label=${'Attachments'}></dees-input-fileupload>`;
+
+  // INSTANCE
+  public changeSubject = new domtools.plugins.smartrx.rxjs.Subject();
+
+  @property({
+    type: String,
+  })
+  public label: string = null;
+
+  @property({
+    type: String,
+    reflect: true,
+  })
+  public key: string;
+
+  @property({
+    attribute: false,
+  })
+  public value: File[] = [];
+
+  @property()
+  public state: 'idle' | 'dragOver' | 'dropped' | 'uploading' | 'completed' = 'idle';
+
+  @property({
+    type: Boolean,
+  })
+  public required: boolean = false;
+
+  @property({
+    type: Boolean,
+  })
+  public disabled: boolean = false;
+
+  @property({
+    type: String,
+  })
+  public buttonText: string = 'Upload File...';
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        position: relative;
+        display: grid;
+        margin: 10px 0px;
+        margin-bottom: 24px;
+        color: ${cssManager.bdTheme('#333', '#ccc')};
+      }
+
+      .hidden {
+        display: none;
+      }
+
+      .maincontainer {
+        position: relative;
+        border-radius: 3px;
+        padding: 8px;
+        background: ${cssManager.bdTheme('#fafafa', '#222222')};
+        color: ${cssManager.bdTheme('#333', '#ccc')};
+        border-top: 1px solid #ffffff10;
+      }
+
+      .maincontainer::after {
+        top: 2px;
+        right: 2px;
+        left: 2px;
+        bottom: 2px;
+        transform: scale3d(0.98, 0.9, 1);
+        position: absolute;
+        content: '';
+        display: block;
+        border: 2px dashed rgba(255, 255, 255, 0);
+        transition: all 0.2s;
+        pointer-events: none;
+        background: #00000000;
+      }
+      .maincontainer.dragOver::after {
+        transform: scale3d(1, 1, 1);
+        border: 2px dashed rgba(255, 255, 255, 0.3);
+        background: #00000080;
+      }
+
+      .label {
+        font-size: 14px;
+        margin-bottom: 8px;
+      }
+
+      .uploadButton {
+        position: relative;
+        padding: 8px;
+        max-width: 600px;
+        background: ${cssManager.bdTheme('#fafafa', '#333333')};
+        border-radius: 3px;
+        text-align: center;
+        font-size: 14px;
+        cursor: default;
+      }
+
+      .uploadButton:hover {
+        color: #fff;
+        background: ${unsafeCSS(colors.dark.blue)};
+      }
+
+      .uploadCandidate {
+        display: grid;
+        grid-template-columns: 48px auto;
+        background: #333;
+        padding: 8px 8px 8px 0px;
+        margin-bottom: 8px;
+        text-align: left;
+        border-radius: 3px;
+        color: ${cssManager.bdTheme('#666', '#ccc')};
+        font-family: 'Geist Sans', sans-serif;
+        cursor: default;
+        transition: all 0.2s;
+        border-top: 1px solid #ffffff10;
+      }
+
+      .uploadCandidate:last-child {
+        margin-bottom: 8px;
+      }
+
+      .uploadCandidate .icon {
+        display: flex;
+        align-items: center;
+        justify-content: center;
+        font-size: 16px;
+      }
+
+      .uploadCandidate:hover {
+        background: #393939;
+      }
+
+      .uploadCandidate .description {
+        font-size: 14px;
+        border-left: 1px solid #ffffff10;
+        padding-left: 8px;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="hidden">
+        <input type="file"></div>
+      </div>
+      ${this.label ? html`<div class="label">${this.label}</div>` : null}
+      <div class="maincontainer ${this.state === 'dragOver' ? 'dragOver' : ''}">
+        ${this.value.map(
+          (fileArg) => html`
+          <div class="uploadCandidate" @contextmenu=${eventArg => {
+            DeesContextmenu.openContextMenuWithOptions(eventArg, [{
+              iconName: 'trash',
+              name: 'Remove',
+              action: async () => {
+                this.value.splice(this.value.indexOf(fileArg), 1);
+                this.requestUpdate();
+              }
+            }]);
+          }}>
+            <div class="icon">
+              <dees-icon .iconFA=${'paperclip'}></dees-icon>
+            </div>
+            <div class="description">
+              <span style="font-weight: 600">${fileArg.name}</span><br />
+              <span style="font-weight: 400">${fileArg.size}</span>
+            </div>
+          </div> `
+        )}
+        <div class="uploadButton" @click=${
+          this.openFileSelector
+        }>
+          ${this.buttonText}
+        </div>
+      </div>
+    `;
+  }
+
+  public async openFileSelector() {
+    const inputFile: HTMLInputElement = this.shadowRoot.querySelector('input[type="file"]');
+    inputFile.click();
+    this.state = 'idle';
+    this.buttonText = 'Upload more files...';
+  }
+
+  public async updateValue(eventArg: Event) {
+    const target: any = eventArg.target;
+    this.value = target.value;
+    this.changeSubject.next(this);
+  }
+
+  public firstUpdated() {
+    const inputFile: HTMLInputElement = this.shadowRoot.querySelector('input[type="file"]');
+    inputFile.addEventListener('change', (event: Event) => {
+      const target = event.target as HTMLInputElement;
+      for (const file of Array.from(target.files)) {
+        this.value.push(file);
+      }
+      this.requestUpdate();
+      console.log(`Got ${this.value.length} files!`);
+      // Reset the input value to allow selecting the same file again if needed
+      target.value = '';
+    });
+
+    // lets handle drag and drop
+    const dropArea = this.shadowRoot.querySelector('.maincontainer');
+    const handlerFunction = (eventArg: DragEvent) => {
+      eventArg.preventDefault();
+      switch (eventArg.type) {
+        case 'dragover':
+          this.state = 'dragOver';
+          this.buttonText = 'release to upload file...';
+          break;
+        case 'dragleave':
+          this.state = 'idle';
+          this.buttonText = 'Upload File...';
+          break;
+        case 'drop':
+          this.state = 'idle';
+          this.buttonText = 'Upload more files...';
+      }
+      console.log(eventArg);
+      for (const file of Array.from(eventArg.dataTransfer.files)) {
+        this.value.push(file);
+        this.requestUpdate();
+      }
+      console.log(`Got ${this.value.length} files!`);
+    };
+    dropArea.addEventListener('dragenter', handlerFunction, false);
+    dropArea.addEventListener('dragleave', handlerFunction, false);
+    dropArea.addEventListener('dragover', handlerFunction, false);
+    dropArea.addEventListener('drop', handlerFunction, false);
+  }
+}

ts_web/elements/dees-input-iban.demo.ts

@@ -0,0 +1,3 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`<dees-input-iban .label=${'IBAN'}></dees-input-iban>`;

ts_web/elements/dees-input-iban.ts

@@ -0,0 +1,98 @@
+import {
+  customElement,
+  DeesElement,
+  type TemplateResult,
+  state,
+  html,
+  domtools,
+  property,
+} from '@design.estate/dees-element';
+
+import * as ibantools from 'ibantools';
+import { demoFunc } from './dees-input-iban.demo.js';
+
+@customElement('dees-input-iban')
+export class DeesInputIban extends DeesElement {
+  // STATIC
+  public static demo = demoFunc;
+
+  // INSTANCE
+  @state()
+  enteredString: string = '';
+
+  @state()
+  enteredIbanIsValid: boolean = false;
+
+  @property({
+    type: Boolean,
+  })
+  public disabled = false;
+
+  @property({
+    type: Boolean,
+  })
+  public required = false;
+
+  @property({
+    type: String,
+  })
+  public label = '';
+
+  @property({
+    type: String,
+  })
+  public key = '';
+
+  @property({
+    type: String,
+  })
+  public value = '';
+
+  public changeSubject = new domtools.plugins.smartrx.rxjs.Subject<DeesInputIban>();
+
+  public render(): TemplateResult {
+    return html`
+      <style>
+        input[type='text'] {
+          line-height: 20px;
+          padding: 5px;
+          width: 250px;
+        }
+      </style>
+      <dees-input-text
+        .label=${'IBAN'}
+        .value=${this.value}
+        @input=${(eventArg: InputEvent) => {
+          this.validateIban(eventArg);
+        }}
+      ></dees-input-text>
+    `;
+  }
+
+  public async firstUpdated() {
+    const deesInputText = this.shadowRoot.querySelector('dees-input-text');
+    deesInputText.disabled = this.disabled;
+    deesInputText.required = this.required;
+    deesInputText.changeSubject.subscribe(valueArg => {
+      this.value = valueArg.value;
+      this.changeSubject.next(this);
+    })
+  }
+
+  public async validateIban(eventArg: InputEvent): Promise<void> {
+    const inputElement: HTMLInputElement = eventArg.target as HTMLInputElement;
+    let enteredString = inputElement?.value;
+    enteredString = enteredString || '';
+    if (this.enteredString !== enteredString) {
+      this.enteredString = ibantools.friendlyFormatIBAN(enteredString) || '';
+      if (inputElement) {
+        inputElement.value = this.enteredString;
+        this.value = this.enteredString;
+        this.changeSubject.next(this);
+      }
+    }
+    this.enteredIbanIsValid = ibantools.isValidIBAN(this.enteredString.replace(/ /g, ''));
+    const deesInputText = this.shadowRoot.querySelector('dees-input-text');
+    deesInputText.validationText = `IBAN is valid: ${this.enteredIbanIsValid}`;
+  }
+}

ts_web/elements/dees-input-multitoggle.demo.ts

@@ -0,0 +1,14 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+  <dees-input-multitoggle
+    .options=${['option 1', 'option 2', 'a longer option with multiple words']}
+    .selectedOption=${'option 2'}
+  ></dees-input-multitoggle>
+  <dees-input-multitoggle
+    .type=${'boolean'}
+    .booleanTrueName=${'enabled'}
+    .booleanFalseName=${'disabled'}
+    .selectedOption=${'true'}
+  ></dees-input-multitoggle>
+`;

ts_web/elements/dees-input-multitoggle.ts

@@ -0,0 +1,159 @@
+import {
+  customElement,
+  DeesElement,
+  type TemplateResult,
+  state,
+  html,
+  domtools,
+  property,
+  css,
+  cssManager,
+} from '@design.estate/dees-element';
+
+const { demoFunc } = await import('./dees-input-multitoggle.demo.js');
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-input-multitoggle': DeesInputMultitoggle;
+  }
+}
+
+@customElement('dees-input-multitoggle')
+export class DeesInputMultitoggle extends DeesElement {
+  public static demo = demoFunc;
+
+  @property({
+    type: String,
+  })
+  public label: string;
+
+  @property({
+    type: String,
+  })
+  public description: string;
+
+  @property()
+  type: 'boolean' | 'multi' | 'single' = 'multi';
+
+  @property()
+  booleanTrueName: string = 'true';
+
+  @property()
+  booleanFalseName: string = 'false';
+
+  @property({
+    type: Array,
+  })
+  options: string[] = [];
+
+  @property()
+  selectedOption: string = '';
+
+  @property()
+  boolValue: boolean = false;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        display: block;
+        color: ${cssManager.bdTheme('#333', '#ccc')};
+        user-select: none;
+        margin: 8px 0px 24px 0px;
+      }
+
+      .label {
+        font-size: 14px;
+        margin-bottom: 8px;
+      }
+
+      .selections {
+        position: relative;
+        display: flex;
+        flex-direction: row;
+        flex-wrap: nowrap;
+        background: ${cssManager.bdTheme('#fff', '#222')};
+        width: min-content;
+        border-radius: 20px;
+        height: 32px;
+        border-top: 1px solid #ffffff10;
+      }
+
+      .option {
+        color: #ccc;
+        position: relative;
+        padding: 0px 16px;
+        line-height: 32px;
+        cursor: default;
+        width: min-content; /* Make the width as per the content */
+        white-space: nowrap; /* Prevent text wrapping */
+        transition: all 0.1s;
+        font-size: 14px;
+        transform: translateY(-1px);
+      }
+
+      .option:hover {
+        color: #fff;
+      }
+
+      .option.selected {
+        color: #fff;
+      }
+
+      .indicator {
+        opacity: 0;
+        position: absolute;
+        height: 24px;
+        left: 4px;
+        top: 3px;
+        border-radius: 16px;
+        background: #0050b9;
+        min-width: 36px;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <dees-label .label=${this.label} .description=${this.description}></dees-label>
+      <div class="mainbox">
+        <div class="selections">
+          <div class="indicator"></div>
+          ${this.options.map(
+            (option) =>
+              html`<div class="option ${option === this.selectedOption ? 'selected': ''}" @click=${() => this.handleSelection(option)}>
+                ${option}
+              </div> `
+          )}
+        </div>
+      </div>
+    `;
+  }
+
+  public async firstUpdated() {
+    if (this.type === 'boolean') {
+      this.options = [this.booleanTrueName || 'true', this.booleanFalseName || 'false'];
+    }
+    this.setIndicator();
+  }
+
+  public async handleSelection(optionArg: string) {
+    this.selectedOption = optionArg;
+    this.setIndicator();
+  }
+
+  public async setIndicator() {
+    const indicator: HTMLDivElement = this.shadowRoot.querySelector('.indicator');
+    const option: HTMLDivElement = this.shadowRoot.querySelector(
+      `.option:nth-child(${this.options.indexOf(this.selectedOption) + 2})`
+    );
+    if (indicator && option) {
+      indicator.style.width = `${option.clientWidth - 8}px`;
+      indicator.style.left = `${option.offsetLeft + 4}px`;
+      indicator.style.opacity = '1';
+    }
+    setTimeout(() => {
+      indicator.style.transition = 'all 0.1s';
+    }, 100);
+  }
+}

ts_web/elements/dees-input-phone.demo.ts

@@ -0,0 +1,3 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`<dees-input-phone .label=${'Phone Number'}></dees-input-phone>`;

ts_web/elements/dees-input-phone.ts

@@ -0,0 +1,29 @@
+import {
+  customElement,
+  DeesElement,
+  type TemplateResult,
+  property,
+  html,
+  css,
+  unsafeCSS,
+  cssManager,
+  type CSSResult,
+} from '@design.estate/dees-element';
+import { demoFunc } from './dees-input-phone.demo.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-input-phone': DeesInputPhone;
+  }
+}
+
+@customElement('dees-input-phone')
+export class DeesInputPhone extends DeesElement {
+  // STATIC
+  public static demo = demoFunc;
+
+  // INSTANCE
+  public render() {
+    return html`<div>Phone Input</div>`;
+  }
+}

ts_web/elements/dees-input-quantityselector.ts

@@ -1,11 +1,26 @@
-import { customElement, property, html, TemplateResult, LitElement } from 'lit-element';
-import * as domtools from '@designestate/dees-domtools';
+import { customElement, property, html, type TemplateResult, DeesElement, type CSSResult, } from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-input-quantityselector': DeesInputQuantitySelector;
+  }
+}
 
 @customElement('dees-input-quantityselector')
-export class DeesInputQuantitySelector extends LitElement {
+export class DeesInputQuantitySelector extends DeesElement {
   public static demo = () => html`<dees-input-quantityselector></dees-input-quantityselector>`;
 
+  // INSTANCE
+  public changeSubject = new domtools.plugins.smartrx.rxjs.Subject();
+
   @property()
+  public label: string = 'Label';
+
+  @property({
+    type: String,
+    reflect: true,
+  })
   public key: string;
 
   @property({
@@ -13,6 +28,20 @@ export class DeesInputQuantitySelector extends LitElement {
   })
   public value: number = 1;
 
+  @property({
+    type: Boolean,
+  })
+  public required: boolean = false;
+
+  @property({
+    type: Boolean
+  })
+  public disabled: boolean = false;
+
+  constructor() {
+    super();
+  }
+
   public render(): TemplateResult {
     return html`
       ${domtools.elementBasic.styles}
@@ -32,8 +61,14 @@ export class DeesInputQuantitySelector extends LitElement {
           line-height: 40px;
           padding: 0px;
           min-width: 100px;
-          color: #CCC;
-          border: 1px solid #CCC;
+          color: ${this.goBright ? '#666' : '#CCC'};
+          border: ${this.goBright ? '1px solid #333' : '1px solid #CCC'};
+          border-radius: 4px;
+        }
+
+        .mainContainer:hover {
+          color: ${this.goBright ? '#333' : '#fff'};
+          border: ${this.goBright ? '1px solid #333' : '1px solid #fff'};
         }
 
         .minus {
@@ -50,17 +85,13 @@ export class DeesInputQuantitySelector extends LitElement {
         }
 
         .selector:hover {
-          cursor: pointer;
         }
 
         .quantity {
           text-align: center;
         }
 
-        .mainContainer:hover {
-          color: #fff;
-          border: 1px solid #fff;
-        }
+        
       </style>
 
       <div class="maincontainer">
@@ -73,6 +104,7 @@ export class DeesInputQuantitySelector extends LitElement {
 
   public increase () {
     this.value++;
+    this.changeSubject.next(this);
   }
 
   public decrease () {
@@ -81,5 +113,6 @@ export class DeesInputQuantitySelector extends LitElement {
     } else {
       // nothing to do here
     }
+    this.changeSubject.next(this);
   }
 }

ts_web/elements/dees-input-radio.ts

@@ -1,10 +1,23 @@
-import {customElement, LitElement, TemplateResult, property, html} from 'lit-element';
+import {customElement, DeesElement, type TemplateResult, property, html, type CSSResult,} from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-input-radio': DeesInputRadio;
+  }
+}
 
 @customElement('dees-input-radio')
-export class DeesInputRadio extends LitElement {
+export class DeesInputRadio extends DeesElement {
   public static demo = () => html`<dees-input-radio></dees-input-radio>`;
 
-  @property()
+  // INSTANCE
+  public changeSubject = new domtools.plugins.smartrx.rxjs.Subject();
+
+  @property({
+    type: String,
+    reflect: true,
+  })
   public key: string;
 
   @property()
@@ -13,6 +26,20 @@ export class DeesInputRadio extends LitElement {
   @property()
   public value: boolean = false;
 
+  @property({
+    type: Boolean,
+  })
+  public required: boolean = false;
+
+  @property({
+    type: Boolean
+  })
+  public disabled: boolean = false;
+
+  constructor() {
+    super();
+  }
+
   public render(): TemplateResult {
     return html `
       <style>
@@ -24,7 +51,6 @@ export class DeesInputRadio extends LitElement {
           display: block;
           position: relative;
           margin: 20px 0px;
-          cursor: pointer;
         }
 
         .maincontainer {
@@ -64,8 +90,8 @@ export class DeesInputRadio extends LitElement {
         }
 
         .checkbox.selected {
-          background: #039BE5;
-          border: 1px solid #039BE5;
+          background: #0050b9;
+          border: 1px solid #0050b9;
         }
 
         .maincontainer:hover .checkbox.selected {
@@ -96,5 +122,6 @@ export class DeesInputRadio extends LitElement {
       detail: this.value,
       bubbles: true
     }));
+    this.changeSubject.next(this);
   }
 }

ts_web/elements/dees-input-text.ts

@@ -1,73 +1,254 @@
-import {customElement, LitElement, TemplateResult, property, html} from 'lit-element';
+import * as colors from './00colors.js';
+
+import {
+  customElement,
+  DeesElement,
+  type TemplateResult,
+  property,
+  html,
+  cssManager,
+  css,
+  type CSSResult,
+} from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-input-text': DeesInputText;
+  }
+}
 
 @customElement('dees-input-text')
-export class DeesInputText extends LitElement {
-  public static demo = () => html`<dees-input-text></dees-input-text>`;
+export class DeesInputText extends DeesElement {
+  public static demo = () => html`
+    <dees-input-text .label=${'this is a label'} .value=${'test'}></dees-input-text>
+    <dees-input-text .isPasswordBool=${true}></dees-input-text>
+  `;
 
-  @property()
-  public label: string = 'Label';
+  // INSTANCE
+  public changeSubject = new domtools.plugins.smartrx.rxjs.Subject<DeesInputText>();
 
-  @property()
+  @property({
+    type: String,
+  })
+  public label: string;
+
+  @property({
+    type: String,
+  })
+  public description: string;
+
+  @property({
+    type: String,
+    reflect: true,
+  })
   public key: string;
 
-  @property()
-  public value: string;
+  @property({
+    type: String,
+    reflect: true,
+  })
+  public value: string = '';
+
+  @property({
+    type: Boolean,
+  })
+  public required: boolean = false;
+
+  @property({
+    type: Boolean,
+  })
+  public disabled: boolean = false;
+
+  @property({
+    type: Boolean,
+    reflect: true,
+  })
+  public isPasswordBool = false;
+
+  @property({
+    type: Boolean,
+    reflect: true,
+  })
+  public showPasswordBool = false;
+
+  @property({
+    type: Boolean,
+    reflect: true,
+  })
+  public validationState: 'valid' | 'warn' | 'invalid';
+
+  @property({
+    reflect: true,
+  })
+  public validationText: string = '';
+
+  @property({})
+  validationFunction: (value: string) => boolean;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      * {
+        box-sizing: border-box;
+      }
+
+      :host {
+        position: relative;
+        display: grid;
+        margin: 8px 0px;
+        margin-bottom: 24px;
+        z-index: auto;
+      }
+
+      .maincontainer {
+        color: ${cssManager.bdTheme('#333', '#ccc')};
+      }
+
+      input {
+        margin-top: 0px;
+        background: ${cssManager.bdTheme('#fafafa', '#222')};
+        border-top: ${cssManager.bdTheme('1px solid #CCC', '1px solid #ffffff10')};
+        border-bottom: ${cssManager.bdTheme('1px solid #CCC', '1px solid #222')};
+        border-right: ${cssManager.bdTheme('1px solid #CCC', 'none')};
+        border-left: ${cssManager.bdTheme('1px solid #CCC', 'none')};
+        padding-left: 10px;
+        padding-right: 10px;
+        border-radius: 2px;
+        width: 100%;
+        line-height: 36px;
+        transition: all 0.2s;
+        outline: none;
+        font-size: 16px;
+        position: relative;
+        z-index: 2;
+        cursor: default;
+      }
+
+      input:disabled {
+        background: ${cssManager.bdTheme('#ffffff00', '#11111100')};
+        border: 1px dashed ${cssManager.bdTheme('#666666', '#666666')};
+        color: #9b9b9e;
+        cursor: default;
+      }
+
+      input:focus {
+        outline: none;
+        border-bottom: 1px solid ${cssManager.bdTheme( colors.bright.blueActive, colors.dark.blueActive)};
+        cursor: text;
+      }
+
+      input:hover {
+        filter: ${cssManager.bdTheme('brightness(0.95)', 'brightness(1.1)')};
+      }
+
+      .showPassword {
+        position: absolute;
+        bottom: 7px;
+        right: 10px;
+        border: 1px dashed #444;
+        border-radius: 7px;
+        padding: 4px 0px;
+        width: 40px;
+        z-index: 3;
+      }
+
+      .showPassword:hover {
+        background: ${cssManager.bdTheme('#00000010', '#ffffff10')};
+      }
+
+      .validationContainer {
+        text-align: center;
+        padding: 6px 2px 2px 2px;
+        margin-top: -4px;
+        font-size: 12px;
+        color: #fff;
+        background: #e4002b;
+        position: relative;
+        z-index: 1;
+        border-radius: 3px;
+        transition: all 0.2s;
+      }
+    `,
+  ];
 
   public render(): TemplateResult {
-    return html `
+    return html`
       <style>
-        * {
-          box-sizing: border-box;
-        }
-
-        :host {
-          position: relative;
-          display: grid;
-          margin: 10px 0px;
-          margin-bottom: 24px;
-        }
-
-        .maincontainer {
-          color: #ccc;
-        }
-
-        .label {
-          font-size: 14px;
-          margin-bottom: 5px;
-        }
-
         input {
-          margin-top: 5px;
-          background: #222;
-          border: none;
-          border-top: 1px solid #444;
-          border-bottom: 1px solid #333;
-          padding-left:10px;
-          padding-right: 10px;
-          border-radius: 2px;
-          width: 100%;
-          line-height: 48px;
-          transition: all 0.2s;
-          outline: none;
-          color: #ccc;
-          font-size: 16px;
-        }
-
-        input:focus {
-          outline: none;
-          border-bottom: 1px solid #e4002b;
+          font-family: ${this.isPasswordBool ? 'monospace' : 'Geist Sans'};
+          letter-spacing: ${this.isPasswordBool ? '1px' : 'normal'};
+          color: ${this.goBright ? '#333' : '#ccc'};
         }
+        ${this.validationText ? css`
+          .validationContainer {
+            height: 22px;
+            opacity: 1;
+          }
+        ` : css`
+          .validationContainer {
+            height: 4px;
+            padding: 2px !important;
+            opacity: 0;
+          }
+        `}
       </style>
       <div class="maincontainer">
-        <div class="label">${this.label}</div>
-        <input type="text" @input="${this.updateValue}" />
+        <dees-label .label=${this.label} .description=${this.description}></dees-label>
+        <input
+          type="${this.isPasswordBool && !this.showPasswordBool ? 'password' : 'text'}"
+          .value=${this.value}
+          @input="${this.updateValue}"
+          .disabled=${this.disabled}
+        />
+        <div class="validationContainer">
+          ${this.validationText}
+        </div>
+        ${this.isPasswordBool
+          ? html`
+              <div class="showPassword" @click=${this.togglePasswordView}>
+                <dees-icon .iconFA=${this.showPasswordBool ? 'eye' : 'eyeSlash'}></dees-icon>
+              </div>
+            `
+          : html``}
       </div>
     `;
   }
 
+  firstUpdated() {
+    const input = this.shadowRoot.querySelector('input');
+    input.addEventListener('input', (eventArg: InputEvent) => {
+      
+    });
+  }
+
   public async updateValue(eventArg: Event) {
     const target: any = eventArg.target;
     this.value = target.value;
+    this.changeSubject.next(this);
+  }
 
+  public async freeze() {
+    this.disabled = true;
+  }
+
+  public async unfreeze() {
+    this.disabled = false;
+  }
+
+  public async togglePasswordView() {
+    const domtools = await this.domtoolsPromise;
+    this.showPasswordBool = !this.showPasswordBool;
+    console.log(`this.showPasswordBool is: ${this.showPasswordBool}`);
+  }
+
+  public async focus() {
+    const textInput = this.shadowRoot.querySelector('input');
+    textInput.focus();
+  }
+
+  public async blur() {
+    const textInput = this.shadowRoot.querySelector('input');
+    textInput.blur();
   }
 }

ts_web/elements/dees-input-typelist.demo.ts

@@ -0,0 +1,15 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+  <style>
+    .demoContainer {
+      max-width: 600px;
+      margin: auto;
+      padding: 40px;
+      background: #000;
+    }
+  </style>
+  <div class="demoContainer">
+    <dees-input-typelist></dees-input-typelist>
+  </div>
+`;

ts_web/elements/dees-input-typelist.ts

@@ -0,0 +1,98 @@
+import {
+  customElement,
+  DeesElement,
+  type TemplateResult,
+  state,
+  html,
+  domtools,
+  property,
+  css,
+  cssManager,
+} from '@design.estate/dees-element';
+
+const { demoFunc } = await import('./dees-input-typelist.demo.js');
+
+@customElement('dees-input-typelist')
+export class DeesInputTypelist extends DeesElement {
+  public static demo = demoFunc;
+
+
+  // INSTANCE
+
+  @property({
+    type: String,
+  })
+  public label: string;
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        display: block;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        margin: 8px 0px 24px 0px;
+      }
+      .label {
+        font-size: 14px;
+        margin-bottom: 8px;
+      }
+      .mainbox {
+        border-radius: 3px;
+        background: #222;
+        overflow: hidden;
+        border-top: ${cssManager.bdTheme('1px solid #CCC', '1px solid #444')};
+        border-bottom: ${cssManager.bdTheme('1px solid #CCC', '1px solid #333')};
+        border-right: ${cssManager.bdTheme('1px solid #CCC', 'none')};
+        border-left: ${cssManager.bdTheme('1px solid #CCC', 'none')};
+      }
+
+      .tags {
+        padding: 16px;
+        cursor: default;
+      }
+
+      .notags {
+        text-align: center;
+        opacity: 0.5;
+        font-size: 12px;
+      }
+
+      input {
+        display: block;
+        box-sizing: border-box;
+        background: #181818;
+        width: 100%;
+        outline: none;
+        border: none;
+        color: inherit;
+        padding: 0px 16px;
+        overflow: hidden;
+        line-height: 32px;
+        height: 0px;
+        transition: height 0.2s;
+      }
+
+      input:focus {
+        height: 32px;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="label">${this.label}</div>
+      <div class="mainbox">
+        <div class="tags" @click=${() => {
+          this.shadowRoot.querySelector('input').focus();
+        }}>
+          <div class="notags">No tags yet</div>
+        </div>
+        <input type="text" placeholder="Type, press Enter to add it..." />
+      </div>
+    `;
+  }
+}

ts_web/elements/dees-label.demo.ts

@@ -0,0 +1,7 @@
+import { html, cssManager } from '@design.estate/dees-element';
+
+export const demoFunc = () => {
+  return html`
+    <dees-label .label=${'a label'}></dees-label>
+  `;
+}

ts_web/elements/dees-label.ts

@@ -0,0 +1,70 @@
+import * as plugins from './00plugins.js';
+import * as colors from './00colors.js';
+
+import {
+  customElement,
+  html,
+  css,
+  cssManager,
+  DeesElement,
+  property,
+  unsafeCSS,
+  query,
+} from '@design.estate/dees-element';
+
+import { demoFunc } from './dees-label.demo.js';
+
+@customElement('dees-label')
+export class DeesLabel extends DeesElement {
+  public static demo = demoFunc;
+
+  // INSTANCE
+
+  @property({
+    type: String,
+    reflect: true,
+  })
+  public label = '';
+
+  @property({
+    type: String,
+    reflect: true,
+  })
+  public description: string;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      .label {
+        color: ${cssManager.bdTheme('#333', '#ccc')};
+        font-size: 14px;
+        margin-bottom: 8px;
+        cursor: default;
+        user-select: none;
+      }
+      dees-icon {
+        display: inline-block;
+        font-size: 14px;
+        transform: translateY(1.5px);
+      }
+    `,
+  ];
+
+  public render() {
+    return html`
+      ${this.label
+        ? html`
+            <div class="label">
+              ${this.label}
+              ${this.description
+                ? html`
+                    <dees-icon .iconFA=${'circleInfo'}></dees-icon>
+                    <dees-speechbubble .text=${this.description}></dees-speechbubble>
+                  `
+                : html``}
+            </div>
+          `
+        : html``}
+    `;
+  }
+}

ts_web/elements/dees-mobilenavigation.ts

@@ -0,0 +1,184 @@
+import * as plugins from './00plugins.js';
+import {
+  cssManager,
+  css,
+  type CSSResult,
+  customElement,
+  DeesElement,
+  domtools,
+  html,
+  property,
+} from '@design.estate/dees-element';
+import { DeesWindowLayer } from './dees-windowlayer.js';
+
+@customElement('dees-mobilenavigation')
+export class DeesMobilenavigation extends DeesElement {
+  // STATIC
+  public static demo = () => html`
+    <dees-button @click=${() => {
+      DeesMobilenavigation.createAndShow([
+        {
+          name: 'Test',
+          action: async (deesMobileNav) => {
+            alert('test');
+            return null;
+          },
+        },
+      ]);
+    }}></dees-button>
+  `;
+
+  private static singletonRef: DeesMobilenavigation;
+  public static async createAndShow(menuItemsArg: plugins.tsclass.website.IMenuItem<DeesMobilenavigation>[]) {
+    if (!this.singletonRef) {
+      this.singletonRef = new DeesMobilenavigation();
+      document.body.append(this.singletonRef);
+      await this.singletonRef.init();
+    }
+    this.singletonRef.menuItems = menuItemsArg;
+    await this.singletonRef.readyDeferred.promise;
+    this.singletonRef.show();
+    return this.singletonRef;
+  }
+
+  // INSTANCE
+  @property({
+    type: Array,
+  })
+  public heading: string = `MENU`;
+
+  @property({
+    type: Array,
+  })
+  public menuItems: plugins.tsclass.website.IMenuItem[] = [];
+
+  readyDeferred: plugins.smartpromise.Deferred<any> = domtools.plugins.smartpromise.defer();
+
+  constructor() {
+    super();
+    /* this.init().then(() => {
+      this.show();
+    }); */
+  }
+
+  /**
+   * inits the mobile navigation
+   */
+  public async init() {
+    await this.updateComplete;
+    this.readyDeferred.resolve();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+      }
+
+      .main {
+        transition: all 0.3s cubic-bezier(0.22, 1, 0.36, 1);
+        will-change: transform;
+        position: fixed;
+        height: 100vh;
+        min-width: 280px;
+        transform: translateX(200px);
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        z-index: 250;
+        opacity: 0;
+        padding: 16px 32px;
+        right: 0px;
+        top: 0px;
+        bottom: 0px;
+        background: ${cssManager.bdTheme('#eeeeeb', '#000')};
+        border-left: 1px solid ${cssManager.bdTheme('#eeeeeb', '#222')};
+        pointer-events: none;
+      }
+
+      .main.show {
+        pointer-events: all;
+        transform: translateX(0px);
+        opacity: 1;
+      }
+
+      .menuItem {
+        text-align: left;
+        padding: 8px;
+        margin-left: -8px;
+        margin-right: -8px;
+        border-radius: 3px;
+      }
+      .menuItem:hover {
+        background: ${cssManager.bdTheme('#CCC', '#333')};;
+      }
+
+      .heading {
+        text-align: left;
+        font-size: 24px;
+        padding: 8px 0px;
+        font-family: 'Geist Sans', sans-serif;
+        font-weight: 300;
+        border-bottom: 1px dashed #444;
+        margin-top: 16px;
+        margin-bottom: 16px;
+      }
+    `,
+  ];
+
+  public render() {
+    return html`
+      <div class="main">
+        <div class="heading">${this.heading}</div>
+        ${this.menuItems.map((menuItem) => {
+          return html`
+            <div
+              class="menuItem"
+              @click="${() => {
+                this.hide();
+                menuItem.action(this);
+              }}"
+            >
+              ${menuItem.name}
+            </div>
+          `;
+        })}
+      </div>
+    `;
+  }
+
+  private windowLayer: DeesWindowLayer;
+
+  /**
+   * inits the show
+   */
+  public async show() {
+    const domtools = await this.domtoolsPromise;
+    const main = this.shadowRoot.querySelector('.main');
+    if (!this.windowLayer) {
+      this.windowLayer = new DeesWindowLayer();
+      this.windowLayer.options.blur = true;
+      this.windowLayer.addEventListener('click', () => {
+        this.hide();
+      });
+    }
+    document.body.append(this.windowLayer);
+    await domtools.convenience.smartdelay.delayFor(0);
+    this.windowLayer.show();
+
+    await domtools.convenience.smartdelay.delayFor(0);
+    main.classList.add('show');
+  }
+
+  /**
+   * inits the hide function
+   */
+  public async hide() {
+    const domtools = await this.domtoolsPromise;
+    const main = this.shadowRoot.querySelector('.main');
+    main.classList.remove('show');
+    this.windowLayer.hide();
+  }
+
+  async disconnectedCallback() {
+    document.body.removeChild(this.windowLayer);
+  }
+}

ts_web/elements/dees-modal.demo.ts

@@ -0,0 +1,37 @@
+import { html } from '@design.estate/dees-element';
+import { DeesModal } from './dees-modal.js';
+
+export const demoFunc = () => html`
+  <dees-button @click=${() => {
+    DeesModal.createAndShow({
+      heading: 'This is a heading',
+      content: html`
+        <dees-form>
+          <dees-input-text
+            .label=${'Username'}
+          >
+          </dees-input-text>
+          <dees-input-text
+            .label=${'Password'}
+          >
+          </dees-input-text>
+        </dees-form>
+      `,
+      menuOptions: [{
+        name: 'Cancel',
+        iconName: null,
+        action: async (deesModalArg) => {
+          deesModalArg.destroy();
+          return null;
+        }
+      }, {
+        name: 'Ok',
+        iconName: null,
+        action: async (deesModalArg) => {
+          deesModalArg.destroy();
+          return null;
+        }
+      }],
+    });
+  }}>open modal</dees-button>
+`

ts_web/elements/dees-modal.ts

@@ -0,0 +1,214 @@
+import * as colors from './00colors.js';
+import * as plugins from './00plugins.js';
+
+import { demoFunc } from './dees-modal.demo.js';
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+  unsafeHTML,
+  state,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { DeesWindowLayer } from './dees-windowlayer.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-modal': DeesModal;
+  }
+}
+
+@customElement('dees-modal')
+export class DeesModal extends DeesElement {
+  // STATIC
+  public static demo = demoFunc;
+
+  public static async createAndShow(optionsArg: {
+    heading: string;
+    content: TemplateResult;
+    menuOptions: plugins.tsclass.website.IMenuItem<DeesModal>[];
+  }) {
+    const body = document.body;
+    const modal = new DeesModal();
+    modal.heading = optionsArg.heading;
+    modal.content = optionsArg.content;
+    modal.menuOptions = optionsArg.menuOptions;
+    modal.windowLayer = await DeesWindowLayer.createAndShow({
+      blur: true,
+    });
+    modal.windowLayer.addEventListener('click', async () => {
+      await modal.destroy();
+    });
+    body.append(modal.windowLayer);
+    body.append(modal);
+  }
+
+  // INSTANCE
+
+  @property({
+    type: String,
+  })
+  public heading = '';
+
+  @state({})
+  public content: TemplateResult;
+
+  @state({})
+  public menuOptions: plugins.tsclass.website.IMenuItem<DeesModal>[] = [];
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        font-family: 'Geist Sans', sans-serif;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        will-change: transform;
+      }
+      .modalContainer {
+        display: flex;
+        position: fixed;
+        top: 0px;
+        left: 0px;
+        width: 100vw;
+        height: 100vh;
+        box-sizing: border-box;
+        align-items: center;
+        justify-content: center;
+        z-index: 2000;
+      }
+      .modal {
+        will-change: transform;
+        transform: translateY(0px) scale(0.95);
+        opacity: 0;
+        width: 480px;
+        min-height: 120px;
+        background: #111;
+        border-radius: 8px;
+        border: 1px solid #222;
+        transition: all 0.2s;
+        overflow: hidden;
+        box-shadow: 0px 2px 5px #00000080;
+      }
+
+      .modal.show {
+        opacity: 1;
+        transform: translateY(0px) scale(1);
+      }
+
+      .modal.show.predestroy {
+        opacity: 0;
+        transform: translateY(10px) scale(1);
+      }
+
+      .modal .heading {
+        height: 32px;
+        font-family: 'Geist Sans', sans-serif;
+        line-height: 32px;
+        text-align: center;
+        font-weight: 600;
+        font-size: 12px;
+        border-bottom: 1px solid #222;
+      }
+
+      .modal .content {
+        padding: 16px;
+      }
+      .modal .bottomButtons {
+        display: flex;
+        flex-direction: row;
+        border-top: 1px solid #222;
+        justify-content: flex-end;
+      }
+
+      .modal .bottomButtons .bottomButton {
+        margin: 8px 0px;
+        padding: 8px 12px;
+        border-radius: 4px;
+        line-height: 16px;
+        text-align: center;
+        font-size: 14px;
+        cursor: default;
+        user-select: none;
+      }
+
+      .modal .bottomButtons .bottomButton:first-child {
+        margin-left: 8px;
+      }
+      .modal .bottomButtons .bottomButton:last-child {
+        margin-right: 8px;
+      }
+
+      .modal .bottomButtons .bottomButton:hover {
+        background: ${cssManager.bdTheme(colors.bright.blue, colors.dark.blue)};
+      }
+      .modal .bottomButtons .bottomButton:active {
+        background: ${cssManager.bdTheme(colors.bright.blueActive, colors.dark.blueActive)};
+      }
+      .modal .bottomButtons .bottomButton:last-child {
+        border-right: none;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <style>
+        .modal .bottomButtons {
+          grid-template-columns: ${cssManager.cssGridColumns(this.menuOptions.length, 0)};
+        }
+      </style>
+      <div class="modalContainer" @click=${this.handleOutsideClick}>
+        <div class="modal">
+          <div class="heading">${this.heading}</div>
+          <div class="content">${this.content}</div>
+          <div class="bottomButtons">
+            ${this.menuOptions.map(
+              (actionArg) => html`
+                <div class="bottomButton" @click=${() => {
+                  actionArg.action(this);
+                }}>${actionArg.name}</div>
+              `
+            )}
+          </div>
+        </div>
+      </div>
+    `;
+  }
+
+  private windowLayer: DeesWindowLayer;
+  public async firstUpdated(_changedProperties: Map<string | number | symbol, unknown>) {
+    super.firstUpdated(_changedProperties);
+    const domtools = await this.domtoolsPromise;
+    await domtools.convenience.smartdelay.delayFor(30);
+    const modal = this.shadowRoot.querySelector('.modal');
+    modal.classList.add('show');
+  }
+
+  public async handleOutsideClick(eventArg: MouseEvent) {
+    eventArg.stopPropagation();
+    const modalContainer = this.shadowRoot.querySelector('.modalContainer');
+    if (eventArg.target === modalContainer) {
+      await this.destroy();
+    }
+  }
+
+  public async destroy() {
+    const domtools = await this.domtoolsPromise;
+    const modal = this.shadowRoot.querySelector('.modal');
+    modal.classList.add('predestroy');
+    await domtools.convenience.smartdelay.delayFor(200);
+    document.body.removeChild(this);
+    await this.windowLayer.destroy();
+  }
+}

ts_web/elements/dees-pagination.demo.ts

@@ -0,0 +1,28 @@
+import { html } from '@design.estate/dees-element';
+
+/**
+ * Demo for dees-pagination component
+ */
+export const demoFunc = () => html`
+  <div style="display: flex; align-items: center; gap: 16px;">
+    <!-- Small set of pages -->
+    <div style="display: flex; flex-direction: column; gap: 4px;">
+      <span>5 pages, starting at 1:</span>
+      <dees-pagination
+        .total=${5}
+        .page=${1}
+        @page-change=${(e: CustomEvent) => console.log('Page changed to', e.detail.page)}
+      ></dees-pagination>
+    </div>
+
+    <!-- Larger set of pages -->
+    <div style="display: flex; flex-direction: column; gap: 4px;">
+      <span>15 pages, starting at 8:</span>
+      <dees-pagination
+        .total=${15}
+        .page=${8}
+        @page-change=${(e: CustomEvent) => console.log('Page changed to', e.detail.page)}
+      ></dees-pagination>
+    </div>
+  </div>
+`;

ts_web/elements/dees-pagination.ts

@@ -0,0 +1,133 @@
+import { customElement, html, DeesElement, property, css, cssManager, type TemplateResult } from '@design.estate/dees-element';
+import { demoFunc } from './dees-pagination.demo.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-pagination': DeesPagination;
+  }
+}
+
+/**
+ * A simple pagination component.
+ * @fires page-change - Emitted when the page is changed. detail: { page: number }
+ */
+@customElement('dees-pagination')
+export class DeesPagination extends DeesElement {
+  public static demo = demoFunc;
+  /** Current page (1-based) */
+  @property({ type: Number, reflect: true })
+  public page = 1;
+
+  /** Total number of pages */
+  @property({ type: Number, reflect: true })
+  public total = 1;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        display: inline-flex;
+        align-items: center;
+      }
+      button {
+        background: none;
+        border: none;
+        margin: 0 2px;
+        padding: 6px 10px;
+        font-size: 14px;
+        cursor: pointer;
+        color: ${cssManager.bdTheme('#333', '#ccc')};
+        border-radius: 3px;
+        transition: background 0.2s;
+      }
+      button:hover:not(:disabled) {
+        background: ${cssManager.bdTheme('#eee', '#444')};
+      }
+      button:disabled {
+        cursor: default;
+        color: ${cssManager.bdTheme('#aaa', '#666')};
+      }
+      button.current {
+        background: #0050b9;
+        color: #fff;
+        cursor: default;
+      }
+      span.ellipsis {
+        margin: 0 4px;
+        color: ${cssManager.bdTheme('#333', '#ccc')};
+      }
+    `,
+  ];
+
+  private get pages(): (number | string)[] {
+    const pages: (number | string)[] = [];
+    const total = this.total;
+    const current = this.page;
+    if (total <= 7) {
+      for (let i = 1; i <= total; i++) {
+        pages.push(i);
+      }
+    } else {
+      pages.push(1);
+      if (current > 4) {
+        pages.push('...');
+      }
+      const start = Math.max(2, current - 2);
+      const end = Math.min(total - 1, current + 2);
+      for (let i = start; i <= end; i++) {
+        pages.push(i);
+      }
+      if (current < total - 3) {
+        pages.push('...');
+      }
+      pages.push(total);
+    }
+    return pages;
+  }
+
+  public render(): TemplateResult {
+    return html`
+      <button
+        @click=${() => this.changePage(this.page - 1)}
+        ?disabled=${this.page <= 1}
+        aria-label="Previous page"
+      >
+        ‹
+      </button>
+      ${this.pages.map((p) =>
+        p === '...'
+          ? html`<span class="ellipsis">…</span>`
+          : html`
+              <button
+                class="${p === this.page ? 'current' : ''}"
+                @click=${() => this.changePage(p as number)}
+                ?disabled=${p === this.page}
+                aria-label="Page ${p}"
+              >
+                ${p}
+              </button>
+            `
+      )}
+      <button
+        @click=${() => this.changePage(this.page + 1)}
+        ?disabled=${this.page >= this.total}
+        aria-label="Next page"
+      >
+        ›
+      </button>
+    `;
+  }
+
+  private changePage(newPage: number) {
+    if (newPage < 1 || newPage > this.total || newPage === this.page) {
+      return;
+    }
+    this.page = newPage;
+    this.dispatchEvent(
+      new CustomEvent('page-change', {
+        detail: { page: this.page },
+        bubbles: true,
+      })
+    );
+  }
+}

ts_web/elements/dees-pdf.ts

@@ -0,0 +1,110 @@
+import { DeesElement, property, html, customElement, domtools, type TemplateResult, type CSSResult, } from '@design.estate/dees-element';
+
+import { Deferred } from '@push.rocks/smartpromise';
+
+// import type pdfjsTypes from 'pdfjs-dist';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-pdf': DeesPdf;
+  }
+}
+
+@customElement('dees-pdf')
+export class DeesPdf extends DeesElement {
+  // DEMO
+  public static demo = () => html` <dees-pdf></dees-pdf> `;
+
+  // INSTANCE
+
+  @property()
+  public pdfUrl: string =
+    'https://raw.githubusercontent.com/mozilla/pdf.js/ba2edeae/examples/learning/helloworld.pdf';
+
+  constructor() {
+    super();
+
+    // you have access to all kinds of things through this.
+    // this.setAttribute('gotIt','true');
+  }
+
+  public render(): TemplateResult {
+    return html`
+      <style>
+        :host {
+          font-family: 'Geist Sans', sans-serif;
+          display: block;
+          box-sizing: border-box;
+          max-width: 800px;
+        }
+        :host([hidden]) {
+          display: none;
+        }
+
+        #pdfcanvas {
+          box-shadow: 0px 0px 5px #ccc;
+          width: 100%;
+        }
+      </style>
+      <canvas id="pdfcanvas" .height=${0} .width=${0}></canvas>
+    `;
+  }
+
+  public static pdfJsReady: Promise<any>;
+  public static pdfjsLib: any // typeof pdfjsTypes;
+  public async connectedCallback() {
+    super.connectedCallback();
+    if (!DeesPdf.pdfJsReady) {
+      const pdfJsReadyDeferred = domtools.plugins.smartpromise.defer();
+      DeesPdf.pdfJsReady = pdfJsReadyDeferred.promise;
+      // @ts-ignore
+      DeesPdf.pdfjsLib = await import('https://cdn.jsdelivr.net/npm/pdfjs-dist@4.0.379/+esm');
+      DeesPdf.pdfjsLib.GlobalWorkerOptions.workerSrc = 'https://cdn.jsdelivr.net/npm/pdfjs-dist@4.0.379/build/pdf.worker.mjs';
+      pdfJsReadyDeferred.resolve();
+    }
+    await DeesPdf.pdfJsReady;
+    this.displayContent();
+  }
+
+  public async displayContent() {
+    await DeesPdf.pdfJsReady;
+
+    // Asynchronous download of PDF
+    const loadingTask = DeesPdf.pdfjsLib.getDocument(this.pdfUrl);
+    loadingTask.promise.then(
+      (pdf) => {
+        console.log('PDF loaded');
+
+        // Fetch the first page
+        const pageNumber = 1;
+        pdf.getPage(pageNumber).then((page) => {
+          console.log('Page loaded');
+
+          const scale = 10;
+          const viewport = page.getViewport({ scale: scale });
+
+          // Prepare canvas using PDF page dimensions
+          const canvas: any = this.shadowRoot.querySelector('#pdfcanvas');
+          const context = canvas.getContext('2d');
+          canvas.height = viewport.height;
+          canvas.width = viewport.width;
+
+          // Render PDF page into canvas context
+          const renderContext = {
+            canvasContext: context,
+            viewport: viewport,
+          };
+
+          const renderTask = page.render(renderContext);
+          renderTask.promise.then(function () {
+            console.log('Page rendered');
+          });
+        });
+      },
+      (reason) => {
+        // PDF loading error
+        console.error(reason);
+      }
+    );
+  }
+}

ts_web/elements/dees-progressbar.demo.ts

@@ -0,0 +1,11 @@
+import { html } from '@design.estate/dees-element';
+
+import { DeesProgressbar } from './dees-progressbar.js';
+
+export const demoFunc = () => {
+  return html`
+    <dees-progressbar
+      .percentage=${50}
+    ></dees-progressbar>
+  `;
+}

ts_web/elements/dees-progressbar.ts

@@ -0,0 +1,95 @@
+import * as plugins from './00plugins.js';
+import * as colors from './00colors.js';
+import { demoFunc } from './dees-progressbar.demo.js';
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+  unsafeHTML,
+  state,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+
+@customElement('dees-progressbar')
+export class DeesProgressbar extends DeesElement {
+  // STATIC
+  public static demo = demoFunc;
+
+  // INSTANCE
+  @property({
+    type: Number,
+  })
+  public percentage = 0;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        color: ${cssManager.bdTheme(colors.bright.text, colors.dark.text)};
+      }
+      .progressBarContainer {
+        padding: 8px;
+        min-width: 200px;
+      }
+
+      .progressBar {
+        background: ${cssManager.bdTheme('#eeeeeb', '#444')};
+        height: 8px;
+        width: 100%;
+        border-radius: 4px;
+        border-top: 0.5px solid ${cssManager.bdTheme('none', '#555')};
+      }
+
+      .progressBarFill {
+        background: ${cssManager.bdTheme(colors.dark.blueActive, colors.bright.blueActive)};
+        height: 8px;
+        margin-top: -0.5px;
+        transition: 0.2s width;
+        border-radius: 4px;
+        width: 0px;
+        border-top: 0.5 solid ${cssManager.bdTheme('none', '#398fff')};
+      }
+
+      .progressText {
+        padding: 8px;
+        text-align: center;
+      }
+    `
+  ];
+
+  public render() {
+    return html`
+      <div class="progressBarContainer">
+        <div class="progressBar">
+          <div class="progressBarFill"></div>
+          <div class="progressText">
+            ${this.percentage}%
+          <div>
+        </div>
+      </div>
+    `
+  }
+
+  firstUpdated (_changedProperties: Map<string | number | symbol, unknown>): void {
+    super.firstUpdated(_changedProperties);
+    this.updateComplete.then(() => {
+      this.updatePercentage();
+    });
+  }
+
+  public async updatePercentage() {
+    const progressBarFill = this.shadowRoot.querySelector('.progressBarFill') as HTMLElement;
+    progressBarFill.style.width = `${this.percentage}%`;
+  }
+
+  updated(){
+    this.updatePercentage();
+  }
+}

ts_web/elements/dees-searchbar.demo.ts

@@ -0,0 +1,46 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => {
+  const onChanged = (e: CustomEvent) => {
+    // find the demo wrapper and update the 'changed' log inside it
+    const wrapper = (e.target as HTMLElement).closest('.demoWrapper');
+    const el = wrapper?.querySelector('#changed');
+    if (el) el.textContent = `search-changed: ${e.detail.value}`;
+  };
+  const onSubmit = (e: CustomEvent) => {
+    // find the demo wrapper and update the 'submitted' log inside it
+    const wrapper = (e.target as HTMLElement).closest('.demoWrapper');
+    const el = wrapper?.querySelector('#submitted');
+    if (el) el.textContent = `search-submit: ${e.detail.value}`;
+  };
+  return html`
+    <style>
+      .demoWrapper {
+        display: block;
+        flex-direction: column;
+        align-items: center;
+        
+        background: #888888;
+      }
+      .logs {
+        padding: 16px;
+        width: 600px;
+        color: #fff;
+        font-family: monospace;
+      }
+      .logs div {
+        margin: 4px 0;
+      }
+    </style>
+    <div class="demoWrapper">
+      <dees-searchbar
+        @search-changed=${onChanged}
+        @search-submit=${onSubmit}
+      ></dees-searchbar>
+      <div class="logs">
+        <div id="changed">search-changed:</div>
+        <div id="submitted">search-submit:</div>
+      </div>
+    </div>
+  `;
+};

ts_web/elements/dees-searchbar.ts

@@ -0,0 +1,160 @@
+import {
+  customElement,
+  DeesElement,
+  property,
+  html,
+  cssManager,
+  unsafeCSS,
+  css,
+  type TemplateResult,
+  domtools,
+  query,
+} from '@design.estate/dees-element';
+
+import * as colors from './00colors.js';
+import { demoFunc } from './dees-searchbar.demo.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-searchbar': DeesSearchbar;
+  }
+}
+
+@customElement('dees-searchbar')
+export class DeesSearchbar extends DeesElement {
+  // DEMO
+  public static demo = demoFunc;
+
+  // STATIC
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        padding: 40px;
+        font-family: Dees Sans;
+        display: block;
+        background: ${cssManager.bdTheme('#eeeeeb', '#000000')};
+      }
+
+      .searchboxContainer {
+        position: relative;
+        margin: auto;
+        max-width: 800px;
+        background: ${cssManager.bdTheme('#00000015', '#ffffff15')};
+        --boxHeight: 60px;
+        height: var(--boxHeight);
+        border-radius: var(--boxHeight);
+        display: grid;
+        grid-template-columns: 1fr 140px;
+        justify-content: center;
+        align-items: center;
+        border-top: 1px solid ${cssManager.bdTheme('#00000015', '#ffffff20')};
+      }
+
+      input {
+        height: 100%;
+        width: 100%;
+        border: none;
+        background: none;
+        color: ${cssManager.bdTheme('#000000', '#eeeeeb')};
+        padding-left: 25px;
+        margin-right: -8px;
+        outline: none;
+        font-size: 16px;
+      }
+
+      .searchButton {
+        --buttonPadding: 8px;
+        background: ${cssManager.bdTheme('#eeeeeb', '#000000')};
+        color: ${cssManager.bdTheme('#000000', '#eeeeeb')};
+        line-height: calc(var(--boxHeight) - (var(--buttonPadding) * 2));
+        border-radius: var(--boxHeight);
+        transform: scale(1) ;
+        transform-origin: 50% 50%;
+        text-align: center;
+        
+        transition: transform 0.1s, background 0.1s;
+        margin-right: var(--buttonPadding);
+        user-select: none;
+      }
+
+      .searchButton:hover {
+        color: #fff;
+        background: ${cssManager.bdTheme(colors.bright.blue, colors.dark.blue)};
+      }
+
+      .searchButton:active {
+        color: #fff;
+        background: ${cssManager.bdTheme(colors.bright.blueActive, colors.dark.blueActive)};
+        transform: scale(0.98);
+      }
+
+      .filters {
+        margin: auto;
+        max-width: 800px;
+      }
+    `,
+  ];
+
+  // INSTANCE
+
+  @property()
+  public filters = [];
+
+
+  @query('input')
+  public searchInput!: HTMLInputElement;
+  @query('.searchButton')
+  public searchButton!: HTMLElement;
+
+  constructor() {
+    super();
+  }
+
+  public render(): TemplateResult {
+    return html`
+      <div class="searchboxContainer">
+        <input type="text" placeholder="Your Skills (e.g. TypeScript, Rust, Projectmanagement)" />
+        <div class="searchButton">Search -></div>
+      </div>
+      ${this.filters.length > 0 ? html`
+        <div class="filters">
+        <dees-heading level="hr-small">Filters</dees-heading>
+        <dees-input-dropdown .label=${'location'}></dees-input-dropdown>
+      </div>  
+      ` : html``}
+    `;
+  }
+  /**
+   * Lifecycle: after first render, wire up events for input and submit actions
+   */
+  public firstUpdated(): void {
+    // dispatch change on each input
+    this.searchInput.addEventListener('input', () => {
+      this.dispatchEvent(new CustomEvent('search-changed', {
+        bubbles: true,
+        composed: true,
+        detail: { value: this.searchInput.value }
+      }));
+    });
+    // submit on Enter key
+    this.searchInput.addEventListener('keydown', (e: KeyboardEvent) => {
+      if (e.key === 'Enter') {
+        this._dispatchSubmit();
+      }
+    });
+    // submit on button click
+    this.searchButton.addEventListener('click', () => this._dispatchSubmit());
+  }
+
+  /**
+   * Dispatch a submit event with the current search value
+   */
+  private _dispatchSubmit(): void {
+    this.dispatchEvent(new CustomEvent('search-submit', {
+      bubbles: true,
+      composed: true,
+      detail: { value: this.searchInput.value }
+    }));
+  }
+}

ts_web/elements/dees-simple-appdash.demo.ts

@@ -0,0 +1,21 @@
+import { html } from '@design.estate/dees-element';
+import type { IView } from './dees-simple-appdash.js';
+
+export const demoFunc = () => html`
+  <dees-simple-appdash
+    .viewTabs=${[
+      {
+        name: 'View 1',
+        element: null,
+      },
+      {
+        name: 'View 2',
+        element: null,
+      },
+      {
+        name: 'View 3',
+        element: null,
+      }
+    ] as IView[]}
+  >Hello there</dees-simple-appdash>
+`;

ts_web/elements/dees-simple-appdash.ts

@@ -0,0 +1,234 @@
+import { demoFunc } from './dees-simple-appdash.demo.js';
+import * as colors from './00colors.js';
+
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  unsafeCSS,
+  type CSSResult,
+  state,
+  domtools,
+} from '@design.estate/dees-element';
+import { DeesTerminal } from './dees-terminal.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-simple-appdash': DeesSimpleAppDash;
+  }
+}
+
+export interface IView {
+  name: string;
+  element: DeesElement['constructor']['prototype'];
+}
+
+@customElement('dees-simple-appdash')
+export class DeesSimpleAppDash extends DeesElement {
+  // STATIC
+  public static demo = demoFunc;
+  // INSTANCE
+
+  @property()
+  public name = 'Dees Simple Login';
+
+  @property()
+  public viewTabs: IView[] = [];
+
+  @property()
+  public terminalSetupCommand: string = `pnpm install @serve.zone/cli && clear && servezone info`;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        color: ${cssManager.bdTheme('#333', '#ccc')};
+        user-select: none;
+        display: block;
+        overflow: hidden;
+        position: relative;
+        height: 100%;
+        width: 100%;
+      }
+
+      .maincontainer {
+        position: absolute;
+        top: 0px;
+        left: 0px;
+        right: 0px;
+        bottom: 0px;
+        overflow: hidden;
+      }
+
+      .appbar {
+        position: absolute;
+        top: 0px;
+        left: 0px;
+        height: calc(100% - 24px);
+        width: 200px;
+        background: ${cssManager.bdTheme('#eeeeeb', '#000')};
+        border-right: 1px solid ${cssManager.bdTheme('#ccc', '#ffffff20')};
+        font-size: 14px;
+        line-height: 32px;
+        font-family: 'Geist Sans', sans-serif;
+        padding: 0px 16px;
+        z-index: 2;
+        box-shadow: 0px 4px 10px 0px rgba(0, 0, 0, 0.8);
+        display: grid;
+        grid-template-rows: min-content auto min-content;
+      }
+
+      .appbar .viewTabs {
+        margin-left: -8px;
+        margin-right: -8px;
+        display: flex;
+        flex-direction: column;
+        align-items: top;
+      }
+
+      .viewTab {
+        padding: 0px 8px;
+      }
+
+      .viewTab:hover {
+        background: ${cssManager.bdTheme('#ccc', '#ffffff10')};
+        color: ${cssManager.bdTheme('#000', '#fff')};
+      }
+
+      .viewTab:active {
+        background: ${cssManager.bdTheme('#aaa', '#ffffff20')};
+        color: ${cssManager.bdTheme('#000', '#fff')};
+      }
+
+      .appName {
+        white-space: nowrap;
+        color: ${cssManager.bdTheme('#666', '#999')};
+      }
+
+      .appActions {
+        display: flex;
+      }
+
+      .appActions .action {
+      }
+      .appActions .action:hover {
+        color: ${cssManager.bdTheme('#000', '#fff')};
+      }
+
+      .appcontent {
+        z-index: 1;
+        position: absolute;
+        top: 0px;
+        right: 0px;
+        height: calc(100vh - 24px);
+        bottom: 24px;
+        width: calc(100vw - 200px);
+        overflow: auto;
+        background: ${cssManager.bdTheme('#eeeeeb', '#000')};
+        overscroll-behavior: contain;
+      }
+
+      .controlbar {
+        color: #fff;
+        position: absolute;
+        bottom: 0px;
+        left: 0px;
+        width: 100%;
+        border-top: 1px solid #44444480;
+        height: 24px;
+        background: ${cssManager.bdTheme(colors.bright.blueMuted, colors.dark.blueMuted)};
+        z-index: 2;
+        display: flex;
+        justify-content: flex-end;
+        align-items: center;
+        flex-direction: row;
+        box-shadow: 0px 0px 10px 0px rgba(0, 0, 0, 0.8);
+      }
+
+      .control {
+        width: min-content;
+        margin-right: 16px;
+        font-size: 12px;
+        white-space: nowrap;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="maincontainer">
+        <div class="appbar">
+          <div class="appName">${this.name}</div>
+          <div class="viewTabs">
+            ${this.viewTabs.map(
+              (view) => html`
+                <div class="viewTab" @click=${() => {
+                  this.loadView(view);
+                }}>${view.name}</div>
+              `
+            )}
+          </div>
+          <div class="appActions">
+            <div class="action" @click=${() => {
+              this.dispatchEvent(new CustomEvent('logout'));
+            }}>Logout</div>
+          </div>
+        </div>
+        <div class="appcontent">
+          
+        </div>
+        <div class="controlbar">
+          <div class="control">
+            <dees-icon .iconFA=${'networkWired'}></dees-icon>
+          </div>
+          <div class="control" @click=${this.launchTerminal}>
+            <dees-icon .iconFA=${'terminal'}></dees-icon>
+          </div>
+        </div>
+      </div>
+    `;
+  }
+
+  public async firstUpdated(_changedProperties): Promise<void> {
+    const domtools = await this.domtoolsPromise;
+    super.firstUpdated(_changedProperties);
+    await this.loadView(this.viewTabs[0]);
+  }
+
+  public currentTerminal: DeesTerminal;
+  public async launchTerminal() {
+    const maincontainer = this.shadowRoot.querySelector('.maincontainer');
+    const terminal = new DeesTerminal();
+    terminal.setupCommand = this.terminalSetupCommand;
+    this.currentTerminal = terminal;
+    maincontainer.appendChild(terminal);
+    terminal.style.position = 'absolute';
+    terminal.style.zIndex = '1';
+    terminal.style.top = '0px';
+    terminal.style.left = '200px';
+    terminal.style.right = '0px';
+    terminal.style.bottom = '24px';
+    terminal.style.opacity = '0';
+    terminal.style.transform = 'translateY(20px)';
+    terminal.style.transition = 'all 0.2s';
+    await domtools.plugins.smartdelay.delayFor(0);
+    terminal.style.opacity = '1';
+    terminal.style.transform = 'translateY(0px)';
+    return terminal;
+  }
+
+  private currentView: DeesElement;
+  public async loadView(viewArg: IView) {
+    const appcontent = this.shadowRoot.querySelector('.appcontent');
+    const view = new viewArg.element();
+    if (this.currentView) {
+      this.currentView.remove();
+    }
+    appcontent.appendChild(view);
+    this.currentView = view;
+  }
+}

ts_web/elements/dees-simple-login.demo.ts

@@ -0,0 +1,3 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html` <dees-simple-login name="someapp"> Hello there </dees-simple-login> `;

ts_web/elements/dees-simple-login.ts

@@ -0,0 +1,130 @@
+import { demoFunc } from './dees-simple-login.demo.js';
+
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  unsafeCSS,
+  type CSSResult,
+  state,
+} from '@design.estate/dees-element';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-simple-login': DeesSimpleLogin;
+  }
+}
+
+@customElement('dees-simple-login')
+export class DeesSimpleLogin extends DeesElement {
+  // STATIC
+  public static demo = demoFunc
+  // INSTANCE
+
+  @property()
+  public name = 'Dees Simple Login';
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        user-select: none;
+      }
+      .loginContainer {
+        position: absolute;
+        display: flex;
+        justify-content: center; /* aligns horizontally */
+        align-items: center; /* aligns vertically */
+        width: 100%;
+        height: 100%;
+        top: 0px;
+        left: 0px;
+      }
+
+      .slotContainer {
+        position: absolute;
+        width: 100%;
+        height: 100%;
+        top: 0px;
+        left: 0px;
+      }
+
+      .login {
+        min-width: 320px;
+        min-height: 100px;
+        background: ${cssManager.bdTheme('#eeeeeb', '#111')};
+        box-shadow: ${cssManager.bdTheme('0px 1px 4px rgba(0,0,0,0.3)', 'none')};
+        border-radius: 8px;
+        padding: 24px;
+        transition: opacity 0.3s, transform 0.3s;
+      }
+
+      .header {
+        text-align: center;
+      }
+      .slotContainer {
+        opacity:0;
+        transition: opacity 0.3s, transform 0.3s;
+        pointer-events: none;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="loginContainer">
+        <div class="login">
+          <dees-form>
+            <div class="header">Login to ${this.name}</div>
+            <dees-input-text key="username" label="username" required></dees-input-text>
+            <dees-input-text key="password" label="password" isPasswordBool required></dees-input-text>
+            <dees-form-submit disabled>login</dees-form-submit>
+          </dees-form>
+        </div>
+      </div>
+      <div class="slotContainer">
+        <slot></slot>
+      </div>
+    `;
+  }
+
+  public async firstUpdated(_changedProperties): Promise<void> {
+    const domtools = await this.domtoolsPromise;
+    super.firstUpdated(_changedProperties);
+    const form = this.shadowRoot.querySelector('dees-form');
+    await form.readyDeferred.promise;
+    const username = this.shadowRoot.querySelector('dees-input-text[label="username"]');
+    const password = this.shadowRoot.querySelector('dees-input-text[label="password"]');
+    const submit = this.shadowRoot.querySelector('dees-form-submit');
+    form.addEventListener('formData', (event: CustomEvent) => {
+      this.dispatchEvent(new CustomEvent('login', { detail: event.detail }));
+    });
+  }
+
+  /**
+   * allows switching to slotted content
+   */
+  public async switchToSlottedContent() {
+    const domtools = await this.domtoolsPromise;
+    const loginDiv: HTMLDivElement = this.shadowRoot.querySelector('.login');
+    const loginContainerDiv: HTMLDivElement = this.shadowRoot.querySelector('.loginContainer');
+    const slotContainerDiv: HTMLDivElement = this.shadowRoot.querySelector('.slotContainer');
+    loginDiv.style.opacity = '0';
+    loginDiv.style.transform = 'translateY(20px)';
+    loginContainerDiv.style.pointerEvents = 'none';
+    slotContainerDiv.style.transform = 'translateY(20px)';
+    await domtools.convenience.smartdelay.delayFor(300);
+    slotContainerDiv.style.opacity = '1';
+    slotContainerDiv.style.transform = 'translateY(0px)';
+    await domtools.convenience.smartdelay.delayFor(300);
+    slotContainerDiv.style.pointerEvents = 'all';
+
+
+    
+  }
+}

ts_web/elements/dees-speechbubble.demo.ts

@@ -0,0 +1,23 @@
+import { html, cssManager } from '@design.estate/dees-element';
+
+export const demoFunc = () => {
+  return html`
+    <style>
+      .ref1 {
+        margin: 20px;
+        width: 10px;
+        height: 10px;
+        background-color: red;
+      }
+    </style>
+    <div class="ref1"></div>
+    <dees-speechbubble .text=${`
+      **This is a longer markdown text that  can be used the write**  
+      a longer description about whats going on the app  
+  
+      **This is a subheader**
+      and another text
+    
+    `}></dees-speechbubble>
+  `;
+};

ts_web/elements/dees-speechbubble.ts

@@ -0,0 +1,229 @@
+import * as colors from './00colors.js';
+import * as plugins from './00plugins.js';
+
+import { demoFunc } from './dees-speechbubble.demo.js';
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+  domtools,
+  directives,
+  unsafeHTML,
+} from '@design.estate/dees-element';
+import { DeesWindowLayer } from './dees-windowlayer.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-speechbubble': DeesSpeechbubble;
+  }
+}
+
+@customElement('dees-speechbubble')
+export class DeesSpeechbubble extends DeesElement {
+  public static demo = demoFunc;
+
+  // STATIC
+  public static async createAndShow(refElement: HTMLElement, textArg: string) {
+    const windowLayer = await DeesWindowLayer.createAndShow({
+      blur: false,
+    });
+    const speechbubble = document.createElement('dees-speechbubble');
+    speechbubble.windowLayer = windowLayer;
+    speechbubble.reffedElement = refElement;
+    speechbubble.text = textArg;
+    speechbubble.manifested = true;
+    windowLayer.appendChild(speechbubble);
+    windowLayer.style.pointerEvents = 'none';
+    (windowLayer.shadowRoot.querySelector('.windowOverlay') as HTMLElement).style.pointerEvents = 'none';
+    return speechbubble;
+  }
+
+  // INSTANCE
+  @property({
+    type: Object,
+  })
+  reffedElement: HTMLElement;
+
+  @property({
+    type: String,
+    reflect: true,
+  })
+  public text: string;
+
+  @property({
+    type: Boolean,
+  })
+  public wave: boolean = false;
+
+  @property({
+    type: Boolean,
+  })
+  public manifested = false;
+
+  @property({
+    type: String,
+  })
+  public status: 'normal' | 'pending' | 'success' | 'error' = 'normal';
+
+  public windowLayer: DeesWindowLayer;
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        box-sizing: border-box;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        user-select: none;
+      }
+
+      .maincontainer {
+        position: relative;
+        will-change: transform;
+        transition: transform 0.2s;
+        transform: translateX(0px);
+        transition: all 0.2s;
+        margin-left: 0px;
+        filter: drop-shadow(0px 0px 2px rgba(0, 0, 0, 0.2));
+        pointer-events: none;
+        opacity: 0;
+        transition: all 0.2s;
+      }
+
+      .arrow {
+        position: absolute;
+        transform: rotate(45deg);
+        background: ${cssManager.bdTheme('#fff', '#333')};
+        height: 15px;
+        width: 15px;
+        left: 2px;
+        top: 12px;
+        border-radius: 3px;
+      }
+
+      .speechbubble {
+        background: ${cssManager.bdTheme('#fff', '#333')};
+        padding: 0px 16px;
+        border-radius: 3px;
+        position: absolute;
+        min-width: 240px;
+        font-size: 12px;
+        top: 0px;
+        left: 8px;
+      }
+
+      .wave {
+        animation-name: wave-animation; /* Refers to the name of your @keyframes element below */
+        animation-duration: 2.5s; /* Change to speed up or slow down */
+        animation-iteration-count: infinite; /* Never stop waving :) */
+        transform-origin: 70% 70%; /* Pivot around the bottom-left palm */
+        display: inline-block;
+      }
+
+      @keyframes wave-animation {
+        0% {
+          transform: rotate(0deg);
+        }
+        10% {
+          transform: rotate(14deg);
+        } /* The following five values can be played with to make the waving more or less extreme */
+        20% {
+          transform: rotate(-8deg);
+        }
+        30% {
+          transform: rotate(14deg);
+        }
+        40% {
+          transform: rotate(-4deg);
+        }
+        50% {
+          transform: rotate(10deg);
+        }
+        60% {
+          transform: rotate(0deg);
+        } /* Reset for the last half to pause */
+        100% {
+          transform: rotate(0deg);
+        }
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      ${this.manifested
+        ? html`
+            <div class="maincontainer" @click=${this.handleClick}>
+              <div class="arrow"></div>
+              <div class="speechbubble">
+                ${this.wave ? html`<span class="wave">👋</span>` : html``}
+                ${directives.resolve(this.getHtml())}
+              </div>
+            </div>
+          `
+        : html``}
+    `;
+  }
+
+  public async handleClick() {
+    console.log('speechbubble got clicked.');
+  }
+
+  public async firstUpdated() {
+    // lets make sure we have a ref
+    if (!this.reffedElement) {
+      this.reffedElement = this.previousElementSibling as HTMLElement;
+    }
+    if (this.manifested) {
+      await this.updatePosition();
+      (this.shadowRoot.querySelector('.maincontainer') as HTMLElement).style.opacity = '1';
+    } else {
+      // lets make sure we instrument it
+      let speechbubble: DeesSpeechbubble;
+      this.reffedElement.addEventListener('mouseenter', async () => {
+        speechbubble = await DeesSpeechbubble.createAndShow(this.reffedElement, this.text);
+      });
+      this.reffedElement.addEventListener('mouseleave', () => {
+        speechbubble.destroy();
+      });
+    }
+  }
+
+  public async updatePosition() {
+    const refElement = this.reffedElement;
+    const boundingClientRect = refElement.getBoundingClientRect();
+    this.style.position = 'fixed';
+    this.style.top = `${boundingClientRect.top - 13}px`;
+    this.style.left = `${boundingClientRect.left + refElement.clientWidth + 4}px`;
+    if (boundingClientRect.right > 250) {
+      this.style.width = `250px`;
+    }
+  }
+
+  public async getHtml(): Promise<any> {
+    if (!this.text) {
+      return '';
+    }
+    const normalized = domtools.plugins.smartstring.normalize.standard(this.text);
+    const result = await domtools.plugins.smartmarkdown.SmartMarkdown.easyMarkdownToHtml(
+      normalized
+    );
+    return unsafeHTML(result);
+  }
+
+  public async show() {}
+
+  public async destroy() {
+    (this.shadowRoot.querySelector('.maincontainer') as HTMLElement).style.opacity = '0';
+    this.windowLayer.destroy();
+  }
+}

ts_web/elements/dees-spinner.ts

@@ -0,0 +1,131 @@
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-spinner': DeesSpinner;
+  }
+}
+
+@customElement('dees-spinner')
+export class DeesSpinner extends DeesElement {
+  public static demo = () => html`
+    <dees-spinner></dees-spinner>
+    <dees-spinner status="success"></dees-spinner>
+    <dees-spinner status="error"></dees-spinner>
+    <dees-spinner size=${64} status="success"></dees-spinner>
+    <dees-spinner .size=${64} status="error"></dees-spinner>
+  `;
+
+  @property({
+    type: Number,
+  })
+  public size = 20;
+
+  @property({
+    type: String,
+  })
+  public bnw: boolean = false;
+
+  @property()
+  public status: 'normal' | 'pending' | 'success' | 'error' = 'normal';
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        display: block;
+      }
+
+      #loading {
+        position: relative;
+        transition: none;
+        display: flex;
+        justify-content: center;
+        align-content: center;
+        background: #8bc34a00;
+        border: 3px solid ${cssManager.bdTheme('rgba(0, 0, 0, 0.1)', 'rgba(255, 255, 255, 0.3)')};
+        border-radius: 50%;
+        border-top-color: ${cssManager.bdTheme('#333', '#fff')};
+        animation: spin 1s ease-in-out infinite;
+        -webkit-animation: spin 1s ease-in-out infinite;
+      }
+
+      #loading.success {
+        border: none;
+        border-radius: 50%;
+        animation: none;
+        -webkit-animation: none;
+      }
+
+      #loading.error {
+        border: none;
+        border-radius: 50%;
+        animation: none;
+        -webkit-animation: none;
+      }
+
+      @keyframes spin {
+        to {
+          -webkit-transform: rotate(360deg);
+        }
+      }
+      @-webkit-keyframes spin {
+        to {
+          -webkit-transform: rotate(360deg);
+        }
+      }
+
+      dees-icon {
+        position: absolute;
+        height: 100%;
+        width: 100%;
+      }
+    `,
+  ];
+
+  render() {
+    return html`
+      <style>
+        #loading {
+          width: ${this.size}px;
+          height: ${this.size}px;
+        }
+        #loading.success {
+          color: ${cssManager.bdTheme(this.bnw ? '#333': `#8bc34a`, this.bnw ? '#fff' : `#8bc34a`)};
+          
+        }
+        #loading.error {
+          color: ${cssManager.bdTheme(this.bnw ? '#333': `#e64a19`, this.bnw ? '#fff' : `#e64a19`)};
+        }
+        dees-icon {
+          font-size: ${this.size}px;
+        }
+      </style>
+      <div class="${this.status}" id="loading">
+        ${(() => {
+          if (this.status === 'success') {
+            return html`<dees-icon style="transform: translateX(1%) translateY(3%);" .iconFA=${'circleCheck' as any}></dees-icon>`;
+          } else if (this.status === 'error') {
+            return  html`<dees-icon .iconFA=${'circleXmark' as any}></dees-icon>`;
+          }
+        })()}
+      </div>
+    `;
+  }
+}

ts_web/elements/dees-statsgrid.demo.ts

@@ -0,0 +1,389 @@
+import { html, cssManager } from '@design.estate/dees-element';
+import type { IStatsTile } from './dees-statsgrid.js';
+
+export const demoFunc = () => {
+  // Demo data with different tile types
+  const demoTiles: IStatsTile[] = [
+    {
+      id: 'revenue',
+      title: 'Total Revenue',
+      value: 125420,
+      unit: '$',
+      type: 'number',
+      icon: 'faDollarSign',
+      description: '+12.5% from last month',
+      color: '#22c55e',
+      actions: [
+        {
+          name: 'View Details',
+          iconName: 'faChartLine',
+          action: async () => {
+            console.log('Viewing revenue details for tile:', 'revenue');
+            console.log('Current value:', 125420);
+            alert(`Revenue Details: $125,420 (+12.5%)`);
+          }
+        },
+        {
+          name: 'Export Data',
+          iconName: 'faFileExport',
+          action: async () => {
+            console.log('Exporting revenue data');
+            alert('Revenue data exported to CSV');
+          }
+        }
+      ]
+    },
+    {
+      id: 'users',
+      title: 'Active Users',
+      value: 3847,
+      type: 'number',
+      icon: 'faUsers',
+      description: '324 new this week',
+      actions: [
+        {
+          name: 'View User List',
+          iconName: 'faList',
+          action: async () => {
+            console.log('Viewing user list');
+          }
+        }
+      ]
+    },
+    {
+      id: 'cpu',
+      title: 'CPU Usage',
+      value: 73,
+      type: 'gauge',
+      icon: 'faMicrochip',
+      gaugeOptions: {
+        min: 0,
+        max: 100,
+        thresholds: [
+          { value: 0, color: '#22c55e' },
+          { value: 60, color: '#f59e0b' },
+          { value: 80, color: '#ef4444' }
+        ]
+      }
+    },
+    {
+      id: 'storage',
+      title: 'Storage Used',
+      value: 65,
+      type: 'percentage',
+      icon: 'faHardDrive',
+      description: '650 GB of 1 TB',
+      color: '#3b82f6'
+    },
+    {
+      id: 'memory',
+      title: 'Memory Usage',
+      value: 45,
+      type: 'gauge',
+      icon: 'faMemory',
+      gaugeOptions: {
+        min: 0,
+        max: 100,
+        thresholds: [
+          { value: 0, color: '#22c55e' },
+          { value: 70, color: '#f59e0b' },
+          { value: 90, color: '#ef4444' }
+        ]
+      }
+    },
+    {
+      id: 'requests',
+      title: 'API Requests',
+      value: '1.2k',
+      unit: '/min',
+      type: 'trend',
+      icon: 'faServer',
+      trendData: [45, 52, 38, 65, 72, 68, 75, 82, 79, 85, 88, 92]
+    },
+    {
+      id: 'uptime',
+      title: 'System Uptime',
+      value: '99.95%',
+      type: 'text',
+      icon: 'faCheckCircle',
+      color: '#22c55e',
+      description: 'Last 30 days'
+    },
+    {
+      id: 'latency',
+      title: 'Response Time',
+      value: 142,
+      unit: 'ms',
+      type: 'trend',
+      icon: 'faClock',
+      trendData: [150, 145, 148, 142, 138, 140, 135, 145, 142],
+      description: 'P95 latency'
+    },
+    {
+      id: 'errors',
+      title: 'Error Rate',
+      value: 0.03,
+      unit: '%',
+      type: 'number',
+      icon: 'faExclamationTriangle',
+      color: '#ef4444',
+      actions: [
+        {
+          name: 'View Error Logs',
+          iconName: 'faFileAlt',
+          action: async () => {
+            console.log('Viewing error logs');
+          }
+        }
+      ]
+    }
+  ];
+
+  // Grid actions for the demo
+  const gridActions = [
+    {
+      name: 'Refresh',
+      iconName: 'faSync',
+      action: async () => {
+        console.log('Refreshing stats...');
+        // Simulate refresh animation
+        const grid = document.querySelector('dees-statsgrid');
+        if (grid) {
+          grid.style.opacity = '0.5';
+          setTimeout(() => {
+            grid.style.opacity = '1';
+          }, 500);
+        }
+      }
+    },
+    {
+      name: 'Export Report',
+      iconName: 'faFileExport',
+      action: async () => {
+        console.log('Exporting stats report...');
+      }
+    },
+    {
+      name: 'Settings',
+      iconName: 'faCog',
+      action: async () => {
+        console.log('Opening settings...');
+      }
+    }
+  ];
+
+  return html`
+    <style>
+      .demo-container {
+        padding: 32px;
+        background: ${cssManager.bdTheme('#f8f9fa', '#0a0a0a')};
+        min-height: 100vh;
+      }
+
+      .demo-section {
+        margin-bottom: 48px;
+      }
+
+      .demo-title {
+        font-size: 24px;
+        font-weight: 600;
+        margin-bottom: 16px;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+      }
+
+      .demo-description {
+        font-size: 14px;
+        color: ${cssManager.bdTheme('#666', '#aaa')};
+        margin-bottom: 24px;
+      }
+
+      .theme-toggle {
+        position: fixed;
+        top: 16px;
+        right: 16px;
+        padding: 8px 16px;
+        background: ${cssManager.bdTheme('#fff', '#1a1a1a')};
+        border: 1px solid ${cssManager.bdTheme('#e0e0e0', '#2a2a2a')};
+        border-radius: 8px;
+        cursor: pointer;
+        z-index: 100;
+      }
+    </style>
+
+    <div class="demo-container">
+      <button class="theme-toggle" @click=${() => {
+        document.body.classList.toggle('bright');
+      }}>Toggle Theme</button>
+
+      <div class="demo-section">
+        <h2 class="demo-title">Full Featured Stats Grid</h2>
+        <p class="demo-description">
+          A comprehensive dashboard with various tile types, actions, and real-time updates.
+        </p>
+        <dees-statsgrid
+          .tiles=${demoTiles}
+          .gridActions=${gridActions}
+          .minTileWidth=${250}
+          .gap=${16}
+        ></dees-statsgrid>
+      </div>
+
+      <div class="demo-section">
+        <h2 class="demo-title">Compact Grid (Smaller Tiles)</h2>
+        <p class="demo-description">
+          Same data displayed with smaller minimum tile width for more compact layouts.
+        </p>
+        <dees-statsgrid
+          .tiles=${demoTiles.slice(0, 6)}
+          .minTileWidth=${180}
+          .gap=${12}
+        ></dees-statsgrid>
+      </div>
+
+      <div class="demo-section">
+        <h2 class="demo-title">Simple Metrics (No Actions)</h2>
+        <p class="demo-description">
+          Clean display without interactive elements for pure visualization.
+        </p>
+        <dees-statsgrid
+          .tiles=${[
+            {
+              id: 'metric1',
+              title: 'Total Sales',
+              value: 48293,
+              type: 'number',
+              icon: 'faShoppingCart'
+            },
+            {
+              id: 'metric2',
+              title: 'Conversion Rate',
+              value: 3.4,
+              unit: '%',
+              type: 'number',
+              icon: 'faChartLine'
+            },
+            {
+              id: 'metric3',
+              title: 'Avg Order Value',
+              value: 127.50,
+              unit: '$',
+              type: 'number',
+              icon: 'faReceipt'
+            },
+            {
+              id: 'metric4',
+              title: 'Customer Satisfaction',
+              value: 92,
+              type: 'percentage',
+              icon: 'faSmile',
+              color: '#22c55e'
+            }
+          ]}
+          .minTileWidth=${220}
+          .gap=${16}
+        ></dees-statsgrid>
+      </div>
+
+      <div class="demo-section">
+        <h2 class="demo-title">Performance Monitoring</h2>
+        <p class="demo-description">
+          Real-time performance metrics with gauge visualizations and thresholds.
+        </p>
+        <dees-statsgrid
+          .tiles=${[
+            {
+              id: 'perf1',
+              title: 'Database Load',
+              value: 42,
+              type: 'gauge',
+              icon: 'faDatabase',
+              gaugeOptions: {
+                min: 0,
+                max: 100,
+                thresholds: [
+                  { value: 0, color: '#10b981' },
+                  { value: 50, color: '#f59e0b' },
+                  { value: 75, color: '#ef4444' }
+                ]
+              }
+            },
+            {
+              id: 'perf2',
+              title: 'Network I/O',
+              value: 856,
+              unit: 'MB/s',
+              type: 'trend',
+              icon: 'faNetworkWired',
+              trendData: [720, 780, 823, 845, 812, 876, 856]
+            },
+            {
+              id: 'perf3',
+              title: 'Cache Hit Rate',
+              value: 94.2,
+              type: 'percentage',
+              icon: 'faBolt',
+              color: '#3b82f6'
+            },
+            {
+              id: 'perf4',
+              title: 'Active Connections',
+              value: 1428,
+              type: 'number',
+              icon: 'faLink',
+              description: 'Peak: 2,100'
+            }
+          ]}
+          .gridActions=${[
+            {
+              name: 'Auto Refresh',
+              iconName: 'faPlay',
+              action: async () => {
+                console.log('Starting auto refresh...');
+              }
+            }
+          ]}
+          .minTileWidth=${280}
+          .gap=${20}
+        ></dees-statsgrid>
+      </div>
+
+      <script>
+        // Simulate real-time updates
+        setInterval(() => {
+          const grids = document.querySelectorAll('dees-statsgrid');
+          grids.forEach(grid => {
+            if (grid.tiles && grid.tiles.length > 0) {
+              // Update some random values
+              const updatedTiles = [...grid.tiles];
+              
+              // Update trends with new data point
+              updatedTiles.forEach(tile => {
+                if (tile.type === 'trend' && tile.trendData) {
+                  tile.trendData = [...tile.trendData.slice(1), 
+                    tile.trendData[tile.trendData.length - 1] + Math.random() * 10 - 5
+                  ];
+                }
+                
+                // Randomly update some numeric values
+                if (tile.type === 'number' && Math.random() > 0.7) {
+                  const currentValue = typeof tile.value === 'number' ? tile.value : parseFloat(tile.value);
+                  tile.value = Math.round(currentValue + (Math.random() * 10 - 5));
+                }
+                
+                // Update gauge values
+                if (tile.type === 'gauge' && Math.random() > 0.5) {
+                  const currentValue = typeof tile.value === 'number' ? tile.value : parseFloat(tile.value);
+                  const newValue = currentValue + (Math.random() * 10 - 5);
+                  tile.value = Math.max(tile.gaugeOptions?.min || 0, 
+                    Math.min(tile.gaugeOptions?.max || 100, Math.round(newValue)));
+                }
+              });
+              
+              grid.tiles = updatedTiles;
+            }
+          });
+        }, 3000);
+      </script>
+    </div>
+  `;
+};

ts_web/elements/dees-statsgrid.ts

@@ -0,0 +1,518 @@
+import { demoFunc } from './dees-statsgrid.demo.js';
+import * as plugins from './00plugins.js';
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  state,
+  css,
+  unsafeCSS,
+  cssManager,
+} from '@design.estate/dees-element';
+import type { TemplateResult } from '@design.estate/dees-element';
+
+import './dees-icon.js';
+import './dees-contextmenu.js';
+import './dees-button.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-statsgrid': DeesStatsGrid;
+  }
+}
+
+export interface IStatsTile {
+  id: string;
+  title: string;
+  value: number | string;
+  unit?: string;
+  type: 'number' | 'gauge' | 'percentage' | 'trend' | 'text';
+  
+  // For gauge type
+  gaugeOptions?: {
+    min: number;
+    max: number;
+    thresholds?: Array<{value: number; color: string}>;
+  };
+  
+  // For trend type
+  trendData?: number[];
+  
+  // Visual customization
+  color?: string;
+  icon?: string;
+  description?: string;
+  
+  // Tile-specific actions
+  actions?: plugins.tsclass.website.IMenuItem[];
+}
+
+@customElement('dees-statsgrid')
+export class DeesStatsGrid extends DeesElement {
+  public static demo = demoFunc;
+
+  @property({ type: Array })
+  public tiles: IStatsTile[] = [];
+
+  @property({ type: Number })
+  public minTileWidth: number = 250;
+
+  @property({ type: Number })
+  public gap: number = 16;
+
+  @property({ type: Array })
+  public gridActions: plugins.tsclass.website.IMenuItem[] = [];
+
+  @state()
+  private contextMenuVisible = false;
+
+  @state()
+  private contextMenuPosition = { x: 0, y: 0 };
+
+  @state()
+  private contextMenuActions: plugins.tsclass.website.IMenuItem[] = [];
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        display: block;
+        width: 100%;
+      }
+
+      .grid-header {
+        display: flex;
+        justify-content: space-between;
+        align-items: center;
+        margin-bottom: ${unsafeCSS(16)}px;
+        min-height: 32px;
+      }
+
+      .grid-title {
+        font-size: 18px;
+        font-weight: 600;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+      }
+
+      .grid-actions {
+        display: flex;
+        gap: 8px;
+      }
+
+      .grid-actions dees-button {
+        font-size: 14px;
+        min-width: auto;
+      }
+
+      .stats-grid {
+        display: grid;
+        grid-template-columns: repeat(auto-fit, minmax(${unsafeCSS(250)}px, 1fr));
+        gap: ${unsafeCSS(16)}px;
+        width: 100%;
+      }
+
+      .stats-tile {
+        background: ${cssManager.bdTheme('#fff', '#1a1a1a')};
+        border: 1px solid ${cssManager.bdTheme('#e0e0e0', '#2a2a2a')};
+        border-radius: 12px;
+        padding: 20px;
+        transition: all 0.3s ease;
+        cursor: pointer;
+        position: relative;
+        overflow: hidden;
+      }
+
+      .stats-tile:hover {
+        transform: translateY(-2px);
+        box-shadow: 0 4px 12px ${cssManager.bdTheme('rgba(0,0,0,0.1)', 'rgba(0,0,0,0.3)')};
+        border-color: ${cssManager.bdTheme('#d0d0d0', '#3a3a3a')};
+      }
+
+      .stats-tile.clickable {
+        cursor: pointer;
+      }
+
+      .tile-header {
+        display: flex;
+        justify-content: space-between;
+        align-items: center;
+        margin-bottom: 12px;
+        width: 100%;
+      }
+
+      .tile-title {
+        font-size: 14px;
+        font-weight: 500;
+        color: ${cssManager.bdTheme('#666', '#aaa')};
+        margin: 0;
+      }
+
+      .tile-icon {
+        opacity: 0.6;
+      }
+
+      .tile-content {
+        height: 90px;
+        display: flex;
+        flex-direction: column;
+        justify-content: center;
+        align-items: center;
+        position: relative;
+      }
+
+      .tile-value {
+        font-size: 32px;
+        font-weight: 600;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        line-height: 1.2;
+        display: flex;
+        align-items: baseline;
+        justify-content: center;
+        gap: 6px;
+        width: 100%;
+      }
+
+      .tile-unit {
+        font-size: 18px;
+        font-weight: 400;
+        color: ${cssManager.bdTheme('#666', '#aaa')};
+      }
+
+      .tile-description {
+        font-size: 12px;
+        color: ${cssManager.bdTheme('#888', '#777')};
+        margin-top: 8px;
+      }
+
+      .gauge-container {
+        width: 100%;
+        height: 80px;
+        position: relative;
+        display: flex;
+        align-items: center;
+        justify-content: center;
+      }
+
+      .gauge-svg {
+        width: 100%;
+        height: 100%;
+      }
+
+      .gauge-background {
+        fill: none;
+        stroke: ${cssManager.bdTheme('#e0e0e0', '#2a2a2a')};
+        stroke-width: 6;
+      }
+
+      .gauge-fill {
+        fill: none;
+        stroke-width: 6;
+        stroke-linecap: round;
+        transition: stroke-dashoffset 0.5s ease;
+      }
+
+      .gauge-text {
+        fill: ${cssManager.bdTheme('#333', '#fff')};
+        font-size: 18px;
+        font-weight: 600;
+        text-anchor: middle;
+      }
+
+      .percentage-container {
+        width: 100%;
+        height: 24px;
+        background: ${cssManager.bdTheme('#f0f0f0', '#2a2a2a')};
+        border-radius: 12px;
+        overflow: hidden;
+        position: relative;
+      }
+
+      .percentage-fill {
+        height: 100%;
+        background: ${cssManager.bdTheme('#0084ff', '#0066cc')};
+        transition: width 0.5s ease;
+        border-radius: 12px;
+      }
+
+      .percentage-text {
+        position: absolute;
+        top: 50%;
+        left: 50%;
+        transform: translate(-50%, -50%);
+        font-size: 12px;
+        font-weight: 600;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+      }
+
+      .trend-container {
+        width: 100%;
+        height: 100%;
+        position: relative;
+        display: flex;
+        flex-direction: column;
+        justify-content: center;
+        align-items: center;
+        gap: 4px;
+      }
+
+      .trend-svg {
+        width: 100%;
+        height: 40px;
+        flex-shrink: 0;
+      }
+
+      .trend-line {
+        fill: none;
+        stroke: ${cssManager.bdTheme('#0084ff', '#0066cc')};
+        stroke-width: 2;
+      }
+
+      .trend-area {
+        fill: ${cssManager.bdTheme('rgba(0, 132, 255, 0.1)', 'rgba(0, 102, 204, 0.2)')};
+      }
+
+      .text-value {
+        font-size: 32px;
+        font-weight: 600;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+      }
+
+      .trend-value {
+        font-size: 32px;
+        font-weight: 600;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        display: flex;
+        align-items: baseline;
+        gap: 6px;
+      }
+
+      .trend-value .tile-unit {
+        font-size: 18px;
+      }
+
+      dees-contextmenu {
+        position: fixed;
+        z-index: 1000;
+      }
+    `,
+  ];
+
+  constructor() {
+    super();
+  }
+
+  public render(): TemplateResult {
+    return html`
+      ${this.gridActions.length > 0 ? html`
+        <div class="grid-header">
+          <div class="grid-title">Statistics</div>
+          <div class="grid-actions">
+            ${this.gridActions.map(action => html`
+              <dees-button @clicked=${() => this.handleGridAction(action)}>
+                ${action.iconName ? html`<dees-icon .iconFA=${action.iconName} size="small"></dees-icon>` : ''}
+                ${action.name}
+              </dees-button>
+            `)}
+          </div>
+        </div>
+      ` : ''}
+      
+      <div class="stats-grid" style="grid-template-columns: repeat(auto-fit, minmax(${this.minTileWidth}px, 1fr)); gap: ${this.gap}px;">
+        ${this.tiles.map(tile => this.renderTile(tile))}
+      </div>
+
+      ${this.contextMenuVisible ? html`
+        <dees-contextmenu
+          .x=${this.contextMenuPosition.x}
+          .y=${this.contextMenuPosition.y}
+          .menuItems=${this.contextMenuActions}
+          @clicked=${() => this.contextMenuVisible = false}
+        ></dees-contextmenu>
+      ` : ''}
+    `;
+  }
+
+  private renderTile(tile: IStatsTile): TemplateResult {
+    const hasActions = tile.actions && tile.actions.length > 0;
+    const clickable = hasActions && tile.actions.length === 1;
+
+    return html`
+      <div 
+        class="stats-tile ${clickable ? 'clickable' : ''}"
+        @click=${clickable ? () => this.handleTileAction(tile.actions![0], tile) : undefined}
+        @contextmenu=${hasActions ? (e: MouseEvent) => this.showContextMenu(e, tile) : undefined}
+      >
+        <div class="tile-header">
+          <h3 class="tile-title">${tile.title}</h3>
+          ${tile.icon ? html`
+            <dees-icon class="tile-icon" .iconFA=${tile.icon} size="small"></dees-icon>
+          ` : ''}
+        </div>
+        
+        <div class="tile-content">
+          ${this.renderTileContent(tile)}
+        </div>
+        
+        ${tile.description ? html`
+          <div class="tile-description">${tile.description}</div>
+        ` : ''}
+      </div>
+    `;
+  }
+
+  private renderTileContent(tile: IStatsTile): TemplateResult {
+    switch (tile.type) {
+      case 'number':
+        return html`
+          <div class="tile-value" style="${tile.color ? `color: ${tile.color}` : ''}">
+            <span>${tile.value}</span>
+            ${tile.unit ? html`<span class="tile-unit">${tile.unit}</span>` : ''}
+          </div>
+        `;
+
+      case 'gauge':
+        return this.renderGauge(tile);
+
+      case 'percentage':
+        return this.renderPercentage(tile);
+
+      case 'trend':
+        return this.renderTrend(tile);
+
+      case 'text':
+        return html`
+          <div class="text-value" style="${tile.color ? `color: ${tile.color}` : ''}">
+            ${tile.value}
+          </div>
+        `;
+
+      default:
+        return html`<div class="tile-value">${tile.value}</div>`;
+    }
+  }
+
+  private renderGauge(tile: IStatsTile): TemplateResult {
+    const value = typeof tile.value === 'number' ? tile.value : parseFloat(tile.value);
+    const options = tile.gaugeOptions || { min: 0, max: 100 };
+    const percentage = ((value - options.min) / (options.max - options.min)) * 100;
+    const strokeDasharray = 188.5; // Circumference of circle with r=30
+    const strokeDashoffset = strokeDasharray - (strokeDasharray * percentage) / 100;
+
+    let strokeColor = tile.color || cssManager.bdTheme('#0084ff', '#0066cc');
+    if (options.thresholds) {
+      for (const threshold of options.thresholds.reverse()) {
+        if (value >= threshold.value) {
+          strokeColor = threshold.color;
+          break;
+        }
+      }
+    }
+
+    return html`
+      <div class="gauge-container">
+        <svg class="gauge-svg" viewBox="0 0 80 80">
+          <circle
+            class="gauge-background"
+            cx="40"
+            cy="40"
+            r="30"
+            transform="rotate(-90 40 40)"
+          />
+          <circle
+            class="gauge-fill"
+            cx="40"
+            cy="40"
+            r="30"
+            transform="rotate(-90 40 40)"
+            stroke="${strokeColor}"
+            stroke-dasharray="${strokeDasharray}"
+            stroke-dashoffset="${strokeDashoffset}"
+          />
+          <text class="gauge-text" x="40" y="40" dy="0.35em">
+            ${value}${tile.unit || ''}
+          </text>
+        </svg>
+      </div>
+    `;
+  }
+
+  private renderPercentage(tile: IStatsTile): TemplateResult {
+    const value = typeof tile.value === 'number' ? tile.value : parseFloat(tile.value);
+    const percentage = Math.min(100, Math.max(0, value));
+
+    return html`
+      <div class="percentage-container">
+        <div 
+          class="percentage-fill" 
+          style="width: ${percentage}%; ${tile.color ? `background: ${tile.color}` : ''}"
+        ></div>
+        <div class="percentage-text">${percentage}%</div>
+      </div>
+    `;
+  }
+
+  private renderTrend(tile: IStatsTile): TemplateResult {
+    if (!tile.trendData || tile.trendData.length < 2) {
+      return html`<div class="tile-value">${tile.value}</div>`;
+    }
+
+    const data = tile.trendData;
+    const max = Math.max(...data);
+    const min = Math.min(...data);
+    const range = max - min || 1;
+    const width = 200;
+    const height = 40;
+    const points = data.map((value, index) => {
+      const x = (index / (data.length - 1)) * width;
+      const y = height - ((value - min) / range) * height;
+      return `${x},${y}`;
+    }).join(' ');
+
+    const areaPoints = `0,${height} ${points} ${width},${height}`;
+
+    return html`
+      <div class="trend-container">
+        <svg class="trend-svg" viewBox="0 0 ${width} ${height}" preserveAspectRatio="none">
+          <polygon class="trend-area" points="${areaPoints}" />
+          <polyline class="trend-line" points="${points}" />
+        </svg>
+        <div class="trend-value">
+          <span>${tile.value}</span>
+          ${tile.unit ? html`<span class="tile-unit">${tile.unit}</span>` : ''}
+        </div>
+      </div>
+    `;
+  }
+
+  private async handleGridAction(action: plugins.tsclass.website.IMenuItem) {
+    if (action.action) {
+      await action.action();
+    }
+  }
+
+  private async handleTileAction(action: plugins.tsclass.website.IMenuItem, _tile: IStatsTile) {
+    if (action.action) {
+      await action.action();
+    }
+    // Note: tile data is available through closure when defining actions
+  }
+
+  private showContextMenu(event: MouseEvent, tile: IStatsTile) {
+    if (!tile.actions || tile.actions.length === 0) return;
+    
+    event.preventDefault();
+    this.contextMenuPosition = { x: event.clientX, y: event.clientY };
+    this.contextMenuActions = tile.actions;
+    this.contextMenuVisible = true;
+
+    // Close context menu on click outside
+    const closeHandler = () => {
+      this.contextMenuVisible = false;
+      document.removeEventListener('click', closeHandler);
+    };
+    setTimeout(() => {
+      document.addEventListener('click', closeHandler);
+    }, 100);
+  }
+}

ts_web/elements/dees-stepper.ts

@@ -0,0 +1,283 @@
+import * as plugins from './00plugins.js';
+import * as colors from './00colors.js';
+
+import {
+  DeesElement,
+  customElement,
+  html,
+  css,
+  unsafeCSS,
+  type CSSResult,
+  cssManager,
+  property,
+  type TemplateResult,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+
+export interface IStep {
+  title: string;
+  content: TemplateResult;
+  validationFunc?: (stepper: DeesStepper, htmlElement: HTMLElement) => Promise<any>;
+  onReturnToStepFunc?: (stepper: DeesStepper, htmlElement: HTMLElement) => Promise<any>;
+  validationFuncCalled?: boolean;
+}
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-stepper': DeesStepper;
+  }
+}
+
+@customElement('dees-stepper')
+export class DeesStepper extends DeesElement {
+  public static demo = () =>
+    html`
+      <dees-stepper
+        .steps=${[
+          {
+            title: 'Whats your name?',
+            content: html`
+              <dees-form>
+                <dees-input-text
+                  key="email"
+                  label="Your Email"
+                  value="hello@something.com"
+                  disabled
+                ></dees-input-text>
+                <dees-input-text key="firstName" required label="Vorname"></dees-input-text>
+                <dees-input-text key="lastName" required label="Nachname"></dees-input-text>
+                <dees-form-submit>Next</dees-form-submit>
+              </dees-form>
+            `,
+            validationFunc: async (stepperArg, elementArg) => {
+              const deesForm = elementArg.querySelector('dees-form');
+              deesForm.addEventListener('formData', (eventArg) => {
+                stepperArg.goNext();
+              });
+            },
+          },
+          {
+            title: 'Whats your mobile number?',
+            content: html``,
+          },
+        ] as IStep[]}
+      ></dees-stepper>
+    `;
+
+  @property({
+    type: Array,
+  })
+  public steps: IStep[] = [];
+
+  @property({
+    type: Object,
+  })
+  public selectedStep: IStep;
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        position: absolute;
+        width: 100%;
+        height: 100%;
+      }
+      .stepperContainer {
+        position: absolute;
+        width: 100%;
+        height: 100%;
+        background: ${cssManager.bdTheme('#eeeeeb', '#000')};
+        overflow: hidden;
+      }
+
+      .step {
+        position: relative;
+        pointer-events: none;
+        overflow: hidden;
+        transition: all 0.7s ease-in-out;
+        max-width: 500px;
+        min-height: 300px;
+        border-radius: 16px;
+        background: ${cssManager.bdTheme('#ffffff', '#181818')};
+        border-top: 1px solid ${cssManager.bdTheme('#ffffff', '#181818')};
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        margin: auto;
+        margin-bottom: 20px;
+        filter: opacity(0.5) grayscale(1);
+        box-shadow: 0px 0px 3px #00000010;
+        user-select: none;
+      }
+
+      .step.selected {
+        border-top: 1px solid #e4002b;
+        pointer-events: all;
+        filter: opacity(1) grayscale(0);
+        box-shadow: 0px 0px 5px #00000010;
+        user-select: auto;
+      }
+
+      .step.hiddenStep {
+        filter: opacity(0);
+      }
+
+      .step:last-child {
+        margin-bottom: 100vh;
+      }
+
+      .step .stepCounter {
+        color: #999;
+        position: absolute;
+        top: 0px;
+        right: 0px;
+        padding: 10px 15px;
+        font-size: 12px;
+        border-bottom-left-radius: 3px;
+        background: ${cssManager.bdTheme('#00000008', '#ffffff08')};
+      }
+
+      .step .goBack {
+        color: #999;
+        cursor: default;
+        position: absolute;
+        top: 0px;
+        left: 0px;
+        padding: 10px 15px;
+        font-size: 12px;
+        border-bottom-right-radius: 3px;
+        background: ${cssManager.bdTheme('#00000008', '#ffffff08')};
+      }
+
+      .step .goBack:hover {
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        background: ${cssManager.bdTheme('#00000012', colors.dark.blue)};
+      }
+
+      .step .goBack:active {
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        background: ${cssManager.bdTheme('#00000012', colors.dark.blueActive)};
+      }
+
+      .step .goBack span {
+        transition: all 0.2s;
+        display: inline-block;
+      }
+
+      .step .goBack:hover span {
+        transform: translateX(-2px);
+      }
+
+      .step .title {
+        text-align: center;
+        padding-top: 50px;
+        font-family: 'Geist Sans', sans-serif;
+        font-size: 22px;
+
+        font-weight: 500;
+      }
+
+      .step .content {
+        padding: 20px;
+      }
+    `,
+  ];
+
+  public render() {
+    return html`
+      <div class="stepperContainer">
+        ${this.steps.map(
+          (stepArg) =>
+            html`<div
+              class="step ${stepArg === this.selectedStep
+                ? 'selected'
+                : null} ${this.getIndexOfStep(stepArg) > this.getIndexOfStep(this.selectedStep)
+                ? 'hiddenStep'
+                : ''}"
+            >
+              ${this.getIndexOfStep(stepArg) > 0
+                ? html`<div class="goBack" @click=${this.goBack}><span style="font-family: Inter"><-</span> go to previous step</div>`
+                : ``}
+              <div class="stepCounter">
+                Step ${this.steps.findIndex((elementArg) => elementArg === stepArg) + 1} of
+                ${this.steps.length}
+              </div>
+              <div class="title">${stepArg.title}</div>
+              <div class="content">${stepArg.content}</div>
+            </div> `
+        )}
+      </div>
+    `;
+  }
+
+  public getIndexOfStep = (stepArg: IStep): number => {
+    return this.steps.findIndex((stepArg2) => stepArg === stepArg2);
+  };
+
+  public async firstUpdated() {
+    await this.domtoolsPromise;
+    await this.domtools.convenience.smartdelay.delayFor(0);
+    this.selectedStep = this.steps[0];
+    this.setScrollStatus();
+  }
+
+  public async updated() {
+    this.setScrollStatus();
+  }
+
+  public scroller: typeof domtools.plugins.SweetScroll.prototype;
+
+  public async setScrollStatus() {
+    const stepperContainer: HTMLElement = this.shadowRoot.querySelector('.stepperContainer');
+    const firstStepElement: HTMLElement = this.shadowRoot.querySelector('.step');
+    const selectedStepElement: HTMLElement = this.shadowRoot.querySelector('.selected');
+    if (!selectedStepElement) {
+      return;
+    }
+    if (!stepperContainer.style.paddingTop) {
+      stepperContainer.style.paddingTop = `${
+        stepperContainer.offsetHeight / 2 - selectedStepElement.offsetHeight / 2
+      }px`;
+    }
+    console.log('Setting scroll status');
+    console.log(selectedStepElement);
+    const scrollPosition =
+      selectedStepElement.offsetTop -
+      stepperContainer.offsetHeight / 2 +
+      selectedStepElement.offsetHeight / 2;
+    console.log(scrollPosition);
+    const domtoolsInstance = await domtools.DomTools.setupDomTools();
+    if (!this.scroller) {
+      this.scroller = new domtools.plugins.SweetScroll(
+        {
+          vertical: true,
+          horizontal: false,
+          easing: 'easeInOutExpo',
+          duration: 700,
+        },
+        stepperContainer
+      );
+    }
+    if (!this.selectedStep.validationFuncCalled && this.selectedStep.validationFunc) {
+      this.selectedStep.validationFuncCalled = true;
+      await this.selectedStep.validationFunc(this, selectedStepElement);
+    }
+    this.scroller.to(scrollPosition);
+  }
+
+  public async goBack() {
+    const currentIndex = this.steps.findIndex((stepArg) => stepArg === this.selectedStep);
+    this.selectedStep = this.steps[currentIndex - 1];
+    await this.domtoolsPromise;
+    await this.domtools.convenience.smartdelay.delayFor(100);
+    this.selectedStep.onReturnToStepFunc?.(this, this.shadowRoot.querySelector('.selected'));
+  }
+
+  public goNext() {
+    const currentIndex = this.steps.findIndex((stepArg) => stepArg === this.selectedStep);
+    this.selectedStep = this.steps[currentIndex + 1];
+  }
+}

ts_web/elements/dees-table.demo.ts

@@ -0,0 +1,129 @@
+import { type ITableAction } from './dees-table.js';
+import * as plugins from './00plugins.js';
+import { html } from '@design.estate/dees-element';
+
+interface ITableDemoData {
+  date: string;
+  amount: string;
+  description: string;
+}
+
+export const demoFunc = () => html`
+  <style>
+    .demoWrapper {
+      box-sizing: border-box;
+      position: absolute;
+      width: 100%;
+      height: 100%;
+      padding: 20px;
+      background: #000000;
+    }
+  </style>
+  <div class="demoWrapper">
+    <dees-table
+      heading1="Current Account Statement"
+      heading2="Bunq - Payment Account 2 - April 2021"
+      .editableFields="${['description']}"
+      .data=${[
+        {
+          date: '2021-04-01',
+          amount: '2464.65 €',
+          description: 'Printing Paper (Office Supplies) - STAPLES BREMEN',
+        },
+        {
+          date: '2021-04-02',
+          amount: '165.65 €',
+          description: 'Logitech Mouse (Hardware) - logi.com OnlineShop',
+        },
+        {
+          date: '2021-04-03',
+          amount: '2999,00 €',
+          description: 'Macbook Pro 16inch (Hardware) - Apple.de OnlineShop',
+        },
+        {
+          date: '2021-04-01',
+          amount: '2464.65 €',
+          description: 'Office-Supplies - STAPLES BREMEN',
+        },
+        {
+          date: '2021-04-01',
+          amount: '2464.65 €',
+          description: 'Office-Supplies - STAPLES BREMEN',
+        },
+      ]}
+      dataName="transactions"
+      .dataActions="${[
+        {
+          name: 'upload',
+          iconName: 'bell',
+          useTableBehaviour: 'upload',
+          type: ['inRow'],
+          actionFunc: async (optionsArg) => {
+            alert(optionsArg.item.amount);
+          },
+        },
+        {
+          name: 'visibility',
+          iconName: 'copy',
+          type: ['inRow'],
+          useTableBehaviour: 'preview',
+          actionFunc: async (itemArg: any) => {},
+        },
+        {
+          name: 'create new',
+          iconName: 'instagram',
+          type: ['header'],
+          useTableBehaviour: 'preview',
+          actionFunc: async (itemArg: any) => {},
+        },
+        {
+          name: 'to gallery',
+          iconName: 'message',
+          type: ['footer'],
+          useTableBehaviour: 'preview',
+          actionFunc: async (itemArg: any) => {},
+        },
+        {
+          name: 'copy',
+          iconName: 'copySolid',
+          type: ['contextmenu', 'inRow'],
+          action: async () => {
+            return null;
+          },
+        },
+        {
+          name: 'edit (from demo)',
+          iconName: 'penToSquare',
+          type: ['contextmenu'],
+          action: async () => {
+            return null;
+          },
+        },
+        {
+          name: 'paste',
+          iconName: 'pasteSolid',
+          type: ['contextmenu'],
+          action: async () => {
+            return null;
+          },
+        },
+        {
+          name: 'preview',
+          type: ['doubleClick', 'contextmenu'],
+          iconName: 'eye',
+          actionFunc: async (itemArg) => {
+            alert(itemArg.item.amount);
+            return null;
+          },
+        }
+      ] as (ITableAction<ITableDemoData>)[] as any}"
+      .displayFunction=${(itemArg) => {
+        return {
+          ...itemArg,
+          onlyDisplayProp: 'onlyDisplay',
+        };
+      }}
+      >This is a slotted Text</dees-table
+    >
+  </div>
+`;

ts_web/elements/dees-table.ts

@@ -0,0 +1,784 @@
+import * as colors from './00colors.js';
+import * as plugins from './00plugins.js';
+import { demoFunc } from './dees-table.demo.js';
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  unsafeCSS,
+  type CSSResult,
+  state,
+  directives,
+} from '@design.estate/dees-element';
+
+import { DeesContextmenu } from './dees-contextmenu.js';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { type TIconKey } from './dees-icon.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-table': DeesTable<any>;
+  }
+}
+
+// interfaces
+export interface ITableAction<T = any> {
+  name: string;
+  iconName: TIconKey;
+  /**
+   * the table behaviour to use for this action
+   * e.g. upload: allows to upload files to the table
+   */
+  useTableBehaviour?: 'upload' | 'cancelUpload' | 'none';
+  /**
+   * the type of the action
+   */
+  type: (
+    | 'inRow'
+    | 'contextmenu'
+    | 'doubleClick'
+    | 'footer'
+    | 'header'
+    | 'preview'
+    | 'keyCombination'
+  )[];
+  /**
+   * allows to check if the action is relevant for the given item
+   * @param itemArg
+   * @returns
+   */
+  actionRelevancyCheckFunc?: (itemArg: T) => boolean;
+  /**
+   * the actual action function implementation
+   * @param itemArg
+   * @returns
+   */
+  actionFunc: (actionDataArg: ITableActionDataArg<T>) => Promise<any>;
+}
+
+export interface ITableActionDataArg<T> {
+  item: T;
+  table: DeesTable<T>;
+}
+
+export type TDisplayFunction<T = any> = (itemArg: T) => object;
+
+// the table implementation
+@customElement('dees-table')
+export class DeesTable<T> extends DeesElement {
+  public static demo = demoFunc;
+
+  // INSTANCE
+  @property({
+    type: String,
+  })
+  public heading1: string = 'heading 1';
+
+  @property({
+    type: String,
+  })
+  public heading2: string = 'heading 2';
+
+  @property({
+    type: Array,
+  })
+  public data: T[] = [];
+
+  // dees-form compatibility -----------------------------------------
+  @property({
+    type: String,
+  })
+  public key: string;
+
+  @property({
+    type: String,
+  })
+  public label: string;
+
+  @property({
+    type: Boolean,
+  })
+  public disabled: boolean = false;
+
+  @property({
+    type: Boolean,
+  })
+  public required: boolean = false;
+
+  get value() {
+    return this.data;
+  }
+  set value(valueArg) {}
+  public changeSubject = new domtools.plugins.smartrx.rxjs.Subject<DeesTable<T>>();
+  // end dees-form compatibility -----------------------------------------
+
+  /**
+   * What does a row of data represent?
+   */
+  @property({
+    type: String,
+    reflect: true,
+  })
+  public dataName: string;
+
+
+  @property({
+    type: Boolean,
+  })
+  searchable: boolean = true;
+
+  @property({
+    type: Array,
+  })
+  public dataActions: ITableAction<T>[] = [];
+
+  @property({
+    attribute: false,
+  })
+  public displayFunction: TDisplayFunction = (itemArg: T) => itemArg as any;
+
+  @property({
+    attribute: false,
+  })
+  public reverseDisplayFunction: (itemArg: any) => T = (itemArg: any) => itemArg as T;
+
+  @property({
+    type: Object,
+  })
+  public selectedDataRow: T;
+
+  @property({
+    type: Array,
+  })
+  public editableFields: string[] = [];
+
+  public files: File[] = [];
+  public fileWeakMap = new WeakMap();
+
+  public dataChangeSubject = new domtools.plugins.smartrx.rxjs.Subject();
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      .mainbox {
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        font-family: 'Geist Sans', sans-serif;
+        font-weight: 400;
+        font-size: 14px;
+        padding: 16px;
+        display: block;
+        width: 100%;
+        min-height: 50px;
+        background: ${cssManager.bdTheme('#ffffff', '#222222')};
+        border-radius: 3px;
+        border-top: 1px solid ${cssManager.bdTheme('#fff', '#ffffff10')};
+        box-shadow: 0px 1px 4px rgba(0, 0, 0, 0.3);
+        overflow-x: auto;
+        cursor: default;
+      }
+
+      .header {
+        display: flex;
+        justify-content: flex-end;
+        align-items: center;
+        font-family: 'Geist Sans', sans-serif;
+      }
+
+      .headingContainer {
+      }
+
+      .heading {
+      }
+
+      .heading1 {
+        font-weight: 600;
+      }
+      .heading2 {
+        opacity: 0.6;
+      }
+
+      .headingSeparation {
+        margin-top: 7px;
+        border-bottom: 1px solid ${cssManager.bdTheme('#bcbcbc', '#444444')};
+      }
+
+      .headerActions {
+        user-select: none;
+        display: flex;
+        flex-direction: row;
+        margin-left: auto;
+      }
+      .headerAction {
+        display: flex;
+        flex-direction: row;
+        color: ${cssManager.bdTheme('#333', '#ccc')};
+        margin-left: 16px;
+      }
+
+      .headerAction:hover {
+        color: ${cssManager.bdTheme('#555', '#fff')};
+      }
+
+      .headerAction dees-icon {
+        margin-right: 8px;
+      }
+
+      .searchGrid {
+        background: ${cssManager.bdTheme('#fff', '#111111')};
+        display: grid;
+        grid-gap: 16px;
+        grid-template-columns: 1fr 200px;
+        margin-top: 16px;
+        padding: 0px 16px;
+        border-top: 1px solid ${cssManager.bdTheme('#fff', '#ffffff20')};
+        border-radius: 8px;
+      }
+
+      .searchGrid.hidden {
+        height: 0px;
+        opacity: 0;
+        overflow: hidden;
+        margin-top: 0px;
+      }
+
+      table,
+      .noDataSet {
+        margin-top: 16px;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        border-collapse: collapse;
+        width: 100%;
+      }
+      .noDataSet {
+        text-align: center;
+      }
+      tr {
+        border-bottom: 1px dashed ${cssManager.bdTheme('#999', '#808080')};
+        text-align: left;
+      }
+      tr:last-child {
+        border-bottom: none;
+        text-align: left;
+      }
+      tr:hover {
+      }
+      tr:hover td {
+        background: ${cssManager.bdTheme('#22222210', '#ffffff10')};
+      }
+      tr:first-child:hover {
+        cursor: auto;
+      }
+      tr:first-child:hover .innerCellContainer {
+        background: none;
+      }
+      tr.selected td {
+        background: ${cssManager.bdTheme('#22222220', '#ffffff20')};
+      }
+
+      tr.hasAttachment td {
+        background: ${cssManager.bdTheme('#0098847c', '#0098847c')};
+      }
+
+      th {
+        text-transform: none;
+        font-family: 'Geist Sans', sans-serif;
+        font-weight: 500;
+      }
+      th,
+      td {
+        position: relative;
+        vertical-align: top;
+
+        padding: 0px;
+        border-right: 1px dashed ${cssManager.bdTheme('#999', '#808080')};
+      }
+      .innerCellContainer {
+        min-height: 36px;
+        position: relative;
+        height: 100%;
+        width: 100%;
+        padding: 6px 8px;
+        line-height: 24px;
+      }
+      th:first-child .innerCellContainer,
+      td:first-child .innerCellContainer {
+        padding-left: 0px;
+      }
+      th:last-child .innerCellContainer,
+      td:last-child .innerCellContainer {
+        padding-right: 0px;
+      }
+      th:last-child,
+      td:last-child {
+        border-right: none;
+      }
+      td input {
+        width: 100%;
+        height: 100%;
+        outline: none;
+        border: 2px solid #fa6101;
+        top: 0px;
+        bottom: 0px;
+        right: 0px;
+        left: 0px;
+        position: absolute;
+        background: #fa610140;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        font-family: inherit;
+        font-size: inherit;
+        font-weight: inherit;
+        padding: 0px 6px;
+      }
+      .actionsContainer {
+        display: flex;
+        flex-direction: row;
+        height: 24px;
+        transform: translateY(-4px);
+        margin-left: -6px;
+      }
+      .action {
+        position: relative;
+        padding: 8px 10px;
+        line-height: 24px;
+        height: 32px;
+        size: 16px;
+        border-radius: 8px;
+      }
+
+      .action:hover {
+        background: ${cssManager.bdTheme(colors.bright.blue, colors.dark.blue)};
+      }
+
+      .action:active {
+        background: ${cssManager.bdTheme(colors.bright.blue, colors.dark.blueActive)};
+      }
+
+      .action:hover dees-icon {
+        filter: ${cssManager.bdTheme('invert(1) brightness(3)', '')};
+      }
+
+      .footer {
+        font-family: 'Geist Sans', sans-serif;
+        font-size: 14px;
+        color: ${cssManager.bdTheme('#111', '#ffffff90')};
+        background: ${cssManager.bdTheme('#eeeeeb', '#00000050')};
+        margin: 16px -16px -16px -16px;
+        border-bottom-left-radius: 3px;
+        border-bottom-right-radius: 3px;
+        display: flex;
+      }
+
+      .tableStatistics {
+        padding: 8px 16px;
+      }
+
+      .footerActions {
+        margin-left: auto;
+      }
+
+      .footerActions .footerAction {
+        padding: 8px 16px;
+        display: flex;
+        user-select: none;
+      }
+
+      .footerActions .footerAction:hover {
+        background: ${cssManager.bdTheme(colors.bright.blue, colors.dark.blue)};
+        color: #fff;
+      }
+
+      .footerActions .footerAction dees-icon {
+        display: flex;
+        margin-right: 8px;
+      }
+
+      .footerActions .footerAction:hover dees-icon {
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="mainbox">
+        <!-- the heading part -->
+        <div class="header">
+          <div class="headingContainer">
+            <div class="heading heading1">${this.label || this.heading1}</div>
+            <div class="heading heading2">${this.heading2}</div>
+          </div>
+          <div class="headerActions">
+            ${directives.resolveExec(async () => {
+              const resultArray: TemplateResult[] = [];
+              for (const action of this.dataActions) {
+                if (!action.type.includes('header')) continue;
+                resultArray.push(
+                  html`<div
+                    class="headerAction"
+                    @click=${() => {
+                      action.actionFunc({
+                        item: this.selectedDataRow,
+                        table: this,
+                      });
+                    }}
+                  >
+                    ${action.iconName
+                      ? html`<dees-icon .iconSize=${14} .iconFA=${action.iconName}></dees-icon>
+                          ${action.name}`
+                      : action.name}
+                  </div>`
+                );
+              }
+              return resultArray;
+            })}
+          </div>
+        </div>
+        <div class="headingSeparation"></div>
+        <div class="searchGrid hidden">
+          <dees-input-text
+            .label=${'lucene syntax search'}
+            .description=${`
+              You can use the lucene syntax to search for data, e.g.:
+              
+              \`\`\`
+              name: "john" AND age: 18
+              \`\`\`
+              
+            `}
+          ></dees-input-text>
+          <dees-input-multitoggle
+            .label=${'search mode'}
+            .options=${['table', 'data', 'server']}
+            .selectedOption=${'table'}
+            .description=${`
+              There are three basic modes:
+              
+              * table: only searches data already in the table
+              * data: searches original data, ignoring table transforms
+              * server: searches data on the server
+              
+            `}
+          ></dees-input-multitoggle>
+        </div>
+
+        <!-- the actual table -->
+        <style></style>
+        ${this.data.length > 0
+          ? (() => {
+              // Only pick up the keys from the first transformed data object
+              // as all data objects are assumed to have the same structure
+              const firstTransformedItem = this.displayFunction(this.data[0]);
+              const headings: string[] = Object.keys(firstTransformedItem);
+              return html`
+                <table>
+                  <tr>
+                    ${headings.map(
+                      (headingArg) => html`
+                        <th>
+                          <div class="innerCellContainer">${headingArg}</div>
+                        </th>
+                      `
+                    )}
+                    ${(() => {
+                      if (this.dataActions && this.dataActions.length > 0) {
+                        return html`
+                          <th>
+                            <div class="innerCellContainer">Actions</div>
+                          </th>
+                        `;
+                      }
+                    })()}
+                  </tr>
+                  ${this.data.map((itemArg) => {
+                    const transformedItem = this.displayFunction(itemArg);
+                    const getTr = (elementArg: HTMLElement): HTMLElement => {
+                      if (elementArg.tagName === 'TR') {
+                        return elementArg;
+                      } else {
+                        return getTr(elementArg.parentElement);
+                      }
+                    };
+                    return html`
+                      <tr
+                        @click=${() => {
+                          this.selectedDataRow = itemArg;
+                        }}
+                        @dragenter=${async (eventArg: DragEvent) => {
+                          eventArg.preventDefault();
+                          eventArg.stopPropagation();
+                          const realTarget = getTr(eventArg.target as HTMLElement);
+                          console.log('dragenter');
+                          console.log(realTarget);
+                          setTimeout(() => {
+                            realTarget.classList.add('hasAttachment');
+                          }, 0);
+                        }}
+                        @dragleave=${async (eventArg: DragEvent) => {
+                          eventArg.preventDefault();
+                          eventArg.stopPropagation();
+                          const realTarget = getTr(eventArg.target as HTMLElement);
+                          realTarget.classList.remove('hasAttachment');
+                        }}
+                        @dragover=${async (eventArg: DragEvent) => {
+                          eventArg.preventDefault();
+                        }}
+                        @drop=${async (eventArg: DragEvent) => {
+                          eventArg.preventDefault();
+                          const newFiles = [];
+                          for (const file of Array.from(eventArg.dataTransfer.files)) {
+                            this.files.push(file);
+                            newFiles.push(file);
+                            this.requestUpdate();
+                          }
+                          const result: File[] = this.fileWeakMap.get(itemArg as object);
+                          if (!result) {
+                            this.fileWeakMap.set(itemArg as object, newFiles);
+                          } else {
+                            result.push(...newFiles);
+                          }
+                        }}
+                        @contextmenu=${async (eventArg: MouseEvent) => {
+                          DeesContextmenu.openContextMenuWithOptions(
+                            eventArg,
+                            this.getActionsForType('contextmenu').map((action) => {
+                              const menuItem: plugins.tsclass.website.IMenuItem = {
+                                name: action.name,
+                                iconName: action.iconName as any,
+                                action: async () => {
+                                  await action.actionFunc({
+                                    item: itemArg,
+                                    table: this,
+                                  });
+                                  return null;
+                                },
+                              };
+                              return menuItem;
+                            })
+                          );
+                        }}
+                        class="${itemArg === this.selectedDataRow ? 'selected' : ''}"
+                      >
+                        ${headings.map(
+                          (headingArg) => html`
+                            <td
+                              @dblclick=${(e: Event) => {
+                                if (this.editableFields.includes(headingArg)) {
+                                  this.handleCellEditing(e, itemArg, headingArg);
+                                } else {
+                                  const wantedAction = this.dataActions.find((actionArg) =>
+                                    actionArg.type.includes('doubleClick')
+                                  );
+                                  if (wantedAction) {
+                                    wantedAction.actionFunc({
+                                      item: itemArg,
+                                      table: this,
+                                    });
+                                  }
+                                }
+                              }}
+                            >
+                              <div class="innerCellContainer">${transformedItem[headingArg]}</div>
+                            </td>
+                          `
+                        )}
+                        ${(() => {
+                          if (this.dataActions && this.dataActions.length > 0) {
+                            return html`
+                              <td>
+                                <div class="innerCellContainer">
+                                  <div class="actionsContainer">
+                                    ${this.getActionsForType('inRow').map(
+                                      (actionArg) => html`
+                                        <div
+                                          class="action"
+                                          @click=${() =>
+                                            actionArg.actionFunc({
+                                              item: itemArg,
+                                              table: this,
+                                            })}
+                                        >
+                                          ${actionArg.iconName
+                                            ? html`
+                                                <dees-icon
+                                                  .iconFA=${actionArg.iconName}
+                                                ></dees-icon>
+                                              `
+                                            : actionArg.name}
+                                        </div>
+                                      `
+                                    )}
+                                  </div>
+                                </div>
+                              </td>
+                            `;
+                          }
+                        })()}
+                      </tr>
+                    `;
+                  })}
+                </table>
+              `;
+            })()
+          : html` <div class="noDataSet">No data set!</div> `}
+        <div class="footer">
+          <div class="tableStatistics">
+            ${this.data.length} ${this.dataName || 'data rows'} (total) |
+            ${this.selectedDataRow ? '# ' + `${this.data.indexOf(this.selectedDataRow) + 1}` : `No`}
+            selected
+          </div>
+          <div class="footerActions">
+            ${directives.resolveExec(async () => {
+              const resultArray: TemplateResult[] = [];
+              for (const action of this.dataActions) {
+                if (!action.type.includes('footer')) continue;
+                resultArray.push(
+                  html`<div
+                    class="footerAction"
+                    @click=${() => {
+                      action.actionFunc({
+                        item: this.selectedDataRow,
+                        table: this,
+                      });
+                    }}
+                  >
+                    ${action.iconName
+                      ? html`<dees-icon .iconSize=${14} .iconFA=${action.iconName}></dees-icon>
+                          ${action.name}`
+                      : action.name}
+                  </div>`
+                );
+              }
+              return resultArray;
+            })}
+          </div>
+        </div>
+      </div>
+    `;
+  }
+
+  public async firstUpdated() {
+    
+  }
+
+  public async updated(changedProperties: Map<string | number | symbol, unknown>): Promise<void> {
+    super.updated(changedProperties);
+    this.determineColumnWidths();
+    if (this.searchable) {
+      const existing = this.dataActions.find((actionArg) => actionArg.type.includes('header') && actionArg.name === 'Search');
+      if (!existing) {
+        this.dataActions.unshift({
+          name: 'Search',
+          iconName: 'magnifyingGlass',
+          type: ['header'],
+          actionFunc: async () => {
+            console.log('open search');
+            const searchGrid = this.shadowRoot.querySelector('.searchGrid');
+            searchGrid.classList.toggle('hidden');
+          }
+        });
+        console.log(this.dataActions);
+        this.requestUpdate();
+      };
+    }
+  }
+
+  public async determineColumnWidths() {
+    const domtools = await this.domtoolsPromise;
+    await domtools.convenience.smartdelay.delayFor(0);
+    // Get the table element
+    const table = this.shadowRoot.querySelector('table');
+    if (!table) return;
+
+    // Get the first row's cells to measure the widths
+    const cells = table.rows[0].cells;
+
+    const handleColumnByIndex = async (i: number, waitForRenderArg: boolean = false) => {
+      const done = plugins.smartpromise.defer();
+      const cell = cells[i];
+
+      // Get computed width
+      const width = window.getComputedStyle(cell).width;
+      if (cell.textContent.includes('Actions')) {
+        const neededWidth =
+          this.dataActions.filter((actionArg) => actionArg.type.includes('inRow')).length * 36;
+        cell.style.width = `${Math.max(neededWidth, 68)}px`;
+      } else {
+        cell.style.width = width;
+      }
+      if (waitForRenderArg) {
+        requestAnimationFrame(() => {
+          done.resolve();
+        });
+        await done.promise;
+      }
+    };
+
+    if (cells[cells.length - 1].textContent.includes('Actions')) {
+      await handleColumnByIndex(cells.length - 1, true);
+    }
+
+    for (let i = 0; i < cells.length; i++) {
+      if (cells[i].textContent.includes('Actions')) {
+        continue;
+      }
+      await handleColumnByIndex(i);
+    }
+    table.style.tableLayout = 'fixed';
+  }
+
+  getActionsForType(typeArg: ITableAction['type'][0]) {
+    const actions: ITableAction[] = [];
+    for (const action of this.dataActions) {
+      if (!action.type.includes(typeArg)) continue;
+      actions.push(action);
+    }
+    return actions;
+  }
+
+  async handleCellEditing(event: Event, itemArg: T, key: string) {
+    const domtools = await this.domtoolsPromise;
+    const target = event.target as HTMLElement;
+    const originalColor = target.style.color;
+    target.style.color = 'transparent';
+    const transformedItem = this.displayFunction(itemArg);
+    const initialValue = (transformedItem[key] as unknown as string) || '';
+    // Create an input element
+    const input = document.createElement('input');
+    input.type = 'text';
+    input.value = initialValue;
+
+    const blurInput = async (blurArg = true, saveArg = false) => {
+      if (blurArg) {
+        input.blur();
+      }
+      if (saveArg) {
+        itemArg[key] = input.value as any; // Convert string to T (you might need better type casting depending on your data structure)
+        this.changeSubject.next(this);
+      }
+      input.remove();
+      target.style.color = originalColor;
+      this.requestUpdate();
+    };
+
+    // When the input loses focus or the Enter key is pressed, update the data
+    input.addEventListener('blur', () => {
+      blurInput(false, false);
+    });
+    input.addEventListener('keydown', (e: KeyboardEvent) => {
+      if (e.key === 'Enter') {
+        blurInput(true, true); // This will trigger the blur event handler above
+      }
+    });
+
+    // Replace the cell's content with the input
+    target.appendChild(input);
+    input.focus();
+  }
+}

ts_web/elements/dees-terminal.ts

@@ -0,0 +1,355 @@
+import {
+  DeesElement,
+  property,
+  html,
+  customElement,
+  type TemplateResult,
+  css,
+  cssManager,
+} from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
+
+import * as webcontainer from '@webcontainer/api';
+
+import { Terminal } from 'xterm';
+import { FitAddon } from 'xterm-addon-fit';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-terminal': DeesTerminal;
+  }
+}
+
+@customElement('dees-terminal')
+export class DeesTerminal extends DeesElement {
+  public static demo = () => html` <dees-terminal
+    .environment=${{
+      NODE_ENV: 'development',
+      PORT: '3000',
+    }}
+  ></dees-terminal> `;
+
+  // INSTANCE
+  private resizeObserver: ResizeObserver;
+
+  @property()
+  public setupCommand = `pnpm install @serve.zone/cli && servezone cli\n`;
+
+  @property()
+  environment: {[key: string]: string} = {};
+
+  // exposing webcontainer
+  private webcontainerDeferred = new domtools.plugins.smartpromise.Deferred<webcontainer.WebContainer>();
+  public webcontainerPromise = this.webcontainerDeferred.promise;
+
+  constructor() {
+    super();
+    this.resizeObserver = new ResizeObserver((entries) => {
+      for (const entry of entries) {
+        // Handle the resize event
+        console.log(`Terminal Resized`);
+        this.handleResize();
+      }
+    });
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        padding: 20px;
+        background: #000;
+        position: absolute;
+        height: 100%;
+        width: 100%;
+      }
+
+      * {
+        box-sizing: border-box;
+      }
+
+      #container {
+        position: absolute;
+        height: calc(100% - 40px);
+        width: calc(100% - 40px);
+      }
+      /**
+      * Copyright (c) 2014 The xterm.js authors. All rights reserved.
+      * Copyright (c) 2012-2013, Christopher Jeffrey (MIT License)
+      * https://github.com/chjj/term.js
+      * @license MIT
+      *
+      * Permission is hereby granted, free of charge, to any person obtaining a copy
+      * of this software and associated documentation files (the "Software"), to deal
+      * in the Software without restriction, including without limitation the rights
+      * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+      * copies of the Software, and to permit persons to whom the Software is
+      * furnished to do so, subject to the following conditions:
+      *
+      * The above copyright notice and this permission notice shall be included in
+      * all copies or substantial portions of the Software.
+      *
+      * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+      * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+      * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+      * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+      * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+      * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+      * THE SOFTWARE.
+      *
+      * Originally forked from (with the author's permission):
+      *   Fabrice Bellard's javascript vt100 for jslinux:
+      *   http://bellard.org/jslinux/
+      *   Copyright (c) 2011 Fabrice Bellard
+      *   The original design remains. The terminal itself
+      *   has been extended to include xterm CSI codes, among
+      *   other features.
+      */
+
+      /**
+      *  Default styles for xterm.js
+      */
+
+      .xterm {
+        font-feature-settings: 'liga' 0;
+        position: relative;
+        user-select: none;
+        -ms-user-select: none;
+        -webkit-user-select: none;
+      }
+
+      .xterm.focus,
+      .xterm:focus {
+        outline: none;
+      }
+
+      .xterm .xterm-helpers {
+        position: absolute;
+        top: 0;
+        /**
+          * The z-index of the helpers must be higher than the canvases in order for
+          * IMEs to appear on top.
+          */
+        z-index: 5;
+      }
+
+      .xterm .xterm-helper-textarea {
+        padding: 0;
+        border: 0;
+        margin: 0;
+        /* Move textarea out of the screen to the far left, so that the cursor is not visible */
+        position: absolute;
+        opacity: 0;
+        left: -9999em;
+        top: 0;
+        width: 0;
+        height: 0;
+        z-index: -5;
+        /** Prevent wrapping so the IME appears against the textarea at the correct position */
+        white-space: nowrap;
+        overflow: hidden;
+        resize: none;
+      }
+
+      .xterm .composition-view {
+        /* TODO: Composition position got messed up somewhere */
+        background: #000;
+        color: #fff;
+        display: none;
+        position: absolute;
+        white-space: nowrap;
+        z-index: 1;
+      }
+
+      .xterm .composition-view.active {
+        display: block;
+      }
+
+      .xterm .xterm-viewport {
+        /* On OS X this is required in order for the scroll bar to appear fully opaque */
+        background-color: #000;
+        overflow-y: scroll;
+        cursor: default;
+        position: absolute;
+        right: 0;
+        left: 0;
+        top: 0;
+        bottom: 0;
+      }
+
+      .xterm .xterm-screen {
+        position: relative;
+      }
+
+      .xterm .xterm-screen canvas {
+        position: absolute;
+        left: 0;
+        top: 0;
+      }
+
+      .xterm .xterm-scroll-area {
+        visibility: hidden;
+      }
+
+      .xterm-char-measure-element {
+        display: inline-block;
+        visibility: hidden;
+        position: absolute;
+        top: 0;
+        left: -9999em;
+        line-height: normal;
+      }
+
+      .xterm {
+        cursor: text;
+      }
+
+      .xterm.enable-mouse-events {
+        /* When mouse events are enabled (eg. tmux), revert to the standard pointer cursor */
+        cursor: default;
+      }
+
+      .xterm.xterm-cursor-pointer {
+        cursor: pointer;
+      }
+
+      .xterm.column-select.focus {
+        /* Column selection mode */
+        cursor: crosshair;
+      }
+
+      .xterm .xterm-accessibility,
+      .xterm .xterm-message {
+        position: absolute;
+        left: 0;
+        top: 0;
+        bottom: 0;
+        right: 0;
+        z-index: 10;
+        color: transparent;
+      }
+
+      .xterm .live-region {
+        position: absolute;
+        left: -9999px;
+        width: 1px;
+        height: 1px;
+        overflow: hidden;
+      }
+
+      .xterm-dim {
+        opacity: 0.5;
+      }
+
+      .xterm-underline {
+        text-decoration: underline;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="mainbox">
+        <div id="container"></div>
+      </div>
+    `;
+  }
+
+  private fitAddon: FitAddon;
+  public async firstUpdated(
+    _changedProperties: Map<string | number | symbol, unknown>
+  ): Promise<void> {
+    const domtools = await this.domtoolsPromise;
+    super.firstUpdated(_changedProperties);
+    const container = this.shadowRoot.getElementById('container');
+
+    const term = new Terminal({
+      convertEol: true,
+      cursorBlink: true,
+    });
+    this.fitAddon = new FitAddon();
+    term.loadAddon(this.fitAddon);
+
+    // Open the terminal in #terminal-container
+    term.open(container);
+
+    // Make the terminal's size and geometry fit the size of #terminal-container
+    this.fitAddon.fit();
+
+    term.write(`dees-terminal custom terminal. \r\n$ `);
+
+    // lets start the webcontainer
+    // Call only once
+    const webcontainerInstance = await webcontainer.WebContainer.boot();
+    const shellProcess = await webcontainerInstance.spawn('jsh');
+    shellProcess.output.pipeTo(
+      new WritableStream({
+        write(data) {
+          term.write(data);
+        },
+      })
+    );
+    const input = shellProcess.input.getWriter();
+    term.onData((data) => {
+      input.write(data);
+    });
+    await this.waitForPrompt(term, '~/');
+    // lets set the environment variables
+    await this.setEnvironmentVariables(this.environment, webcontainerInstance);
+    input.write(`source source.env\n`);
+    await this.waitForPrompt(term, '~/');
+    // lets run the setup command
+    input.write(this.setupCommand);
+    await this.waitForPrompt(term, '~/');
+    input.write(`clear && echo 'welcome'\n`);
+    this.webcontainerDeferred.resolve(webcontainerInstance);
+  }
+
+  async connectedCallback(): Promise<void> {
+    await super.connectedCallback();
+    this.resizeObserver.observe(this);
+  }
+
+  async disconnectedCallback(): Promise<void> {
+    this.resizeObserver.unobserve(this);
+    await super.disconnectedCallback();
+  }
+
+  handleResize() {
+    this.fitAddon.fit();
+  }
+
+  public async waitForPrompt(term: Terminal, prompt: string): Promise<void> {
+    return new Promise<void>((resolve) => {
+      const checkPrompt = () => {
+        const lines = term.buffer.active;
+        for (let i = 0; i < lines.length; i++) {
+          const line = lines.getLine(i);
+          if (line && line.translateToString().includes(prompt)) {
+            setTimeout(() => {
+              resolve();
+            }, 100);
+            return;
+          }
+        }
+        setTimeout(checkPrompt, 100); // check every 100 ms
+      };
+  
+      checkPrompt();
+    });
+  }
+
+  public async setEnvironmentVariables(envArg: {[key: string]: string}, webcontainerInstanceArg?: webcontainer.WebContainer) {
+    const webcontainerInstance = webcontainerInstanceArg ||await this.webcontainerPromise;
+    let envFile = ``
+    for (const key in envArg) { 
+      envFile += `export ${key}="${envArg[key]}"\n`;
+    }
+
+    await webcontainerInstance.mount({'source.env': {
+      file: {
+        contents: envFile,
+      }
+    }});
+  }
+}

ts_web/elements/dees-toast.demo.ts

@@ -0,0 +1,5 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = async () => {
+  return html`<dees-toast></dees-toast>`;
+}

ts_web/elements/dees-toast.ts

@@ -1,9 +1,17 @@
-import { customElement, LitElement, TemplateResult, html } from 'lit-element';
+import { customElement, DeesElement, type TemplateResult, html, type CSSResult, } from '@design.estate/dees-element';
 
-import * as domtools from '@designestate/dees-domtools';
+import * as domtools from '@design.estate/dees-domtools';
+import { demoFunc } from './dees-toast.demo.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-toast': DeesToast;
+  }
+}
 
 @customElement('dees-toast')
-export class DeesToast extends LitElement {
+export class DeesToast extends DeesElement {
+  public static demo = demoFunc;
 
   constructor() {
     super();