1.0.195

.gitea/workflows/default_nottags.yaml

@@ -0,0 +1,66 @@
+name: Default (not tags)
+
+on:
+  push:
+    tags-ignore:
+      - '**'
+
+env:
+  IMAGE: registry.gitlab.com/hosttoday/ht-docker-node:npmci
+  NPMCI_COMPUTED_REPOURL: https://${{gitea.repository_owner}}:${{secrets.GITEA_TOKEN}}@gitea.lossless.digital/${{gitea.repository}}.git
+  NPMCI_TOKEN_NPM: ${{secrets.NPMCI_TOKEN_NPM}}
+  NPMCI_TOKEN_NPM2: ${{secrets.NPMCI_TOKEN_NPM2}}
+  NPMCI_GIT_GITHUBTOKEN: ${{secrets.NPMCI_GIT_GITHUBTOKEN}}
+  NPMCI_URL_CLOUDLY: ${{secrets.NPMCI_URL_CLOUDLY}}
+
+jobs:
+  security:
+    runs-on: ubuntu-latest
+    continue-on-error: true
+    container:
+      image: ${{ env.IMAGE }}
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Install pnpm and npmci
+        run: |
+          pnpm install -g pnpm
+          pnpm install -g @shipzone/npmci
+
+      - name: Run npm prepare
+        run: npmci npm prepare
+
+      - name: Audit production dependencies
+        run: |
+          npmci command npm config set registry https://registry.npmjs.org
+          npmci command pnpm audit --audit-level=high --prod
+        continue-on-error: true
+
+      - name: Audit development dependencies
+        run: |
+          npmci command npm config set registry https://registry.npmjs.org
+          npmci command pnpm audit --audit-level=high --dev
+        continue-on-error: true
+
+  test:
+    if: ${{ always() }}
+    needs: security
+    runs-on: ubuntu-latest
+    container:
+      image: ${{ env.IMAGE }}
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Test stable
+        run: |
+          npmci node install stable
+          npmci npm install
+          npmci npm test
+
+      - name: Test build
+        run: |
+          npmci node install stable
+          npmci npm install
+          npmci npm build

.gitea/workflows/default_tags.yaml

@@ -0,0 +1,124 @@
+name: Default (tags)
+
+on:
+  push:
+    tags:
+      - '*'
+
+env:
+  IMAGE: registry.gitlab.com/hosttoday/ht-docker-node:npmci
+  NPMCI_COMPUTED_REPOURL: https://${{gitea.repository_owner}}:${{secrets.GITEA_TOKEN}}@gitea.lossless.digital/${{gitea.repository}}.git
+  NPMCI_TOKEN_NPM: ${{secrets.NPMCI_TOKEN_NPM}}
+  NPMCI_TOKEN_NPM2: ${{secrets.NPMCI_TOKEN_NPM2}}
+  NPMCI_GIT_GITHUBTOKEN: ${{secrets.NPMCI_GIT_GITHUBTOKEN}}
+  NPMCI_URL_CLOUDLY: ${{secrets.NPMCI_URL_CLOUDLY}}
+
+jobs:
+  security:
+    runs-on: ubuntu-latest
+    continue-on-error: true
+    container:
+      image: ${{ env.IMAGE }}
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Prepare
+        run: |
+          pnpm install -g pnpm
+          pnpm install -g @shipzone/npmci
+          npmci npm prepare
+
+      - name: Audit production dependencies
+        run: |
+          npmci command npm config set registry https://registry.npmjs.org
+          npmci command pnpm audit --audit-level=high --prod
+        continue-on-error: true
+
+      - name: Audit development dependencies
+        run: |
+          npmci command npm config set registry https://registry.npmjs.org
+          npmci command pnpm audit --audit-level=high --dev
+        continue-on-error: true
+
+  test:
+    if: ${{ always() }}
+    needs: security
+    runs-on: ubuntu-latest
+    container:
+      image: ${{ env.IMAGE }}
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Prepare
+        run: |
+          pnpm install -g pnpm
+          pnpm install -g @shipzone/npmci
+          npmci npm prepare
+
+      - name: Test stable
+        run: |
+          npmci node install stable
+          npmci npm install
+          npmci npm test
+
+      - name: Test build
+        run: |
+          npmci node install stable
+          npmci npm install
+          npmci npm build
+
+  release:
+    needs: test
+    if: github.event_name == 'push' && startsWith(github.ref, 'refs/tags/')
+    runs-on: ubuntu-latest
+    container:
+      image: ${{ env.IMAGE }}
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Prepare
+        run: |
+          pnpm install -g pnpm
+          pnpm install -g @shipzone/npmci
+          npmci npm prepare
+
+      - name: Release
+        run: |
+          npmci node install stable
+          npmci npm publish
+
+  metadata:
+    needs: test
+    if: github.event_name == 'push' && startsWith(github.ref, 'refs/tags/')
+    runs-on: ubuntu-latest
+    container:
+      image: ${{ env.IMAGE }}
+    continue-on-error: true
+
+    steps:
+      - uses: actions/checkout@v3
+
+      - name: Prepare
+        run: |
+          pnpm install -g pnpm
+          pnpm install -g @shipzone/npmci
+          npmci npm prepare
+
+      - name: Code quality
+        run: |
+          npmci command npm install -g typescript
+          npmci npm install
+
+      - name: Trigger
+        run: npmci trigger
+
+      - name: Build docs and upload artifacts
+        run: |
+          npmci node install stable
+          npmci npm install
+          pnpm install -g @gitzone/tsdoc
+          npmci command tsdoc
+        continue-on-error: true

.gitlab-ci.yml

@@ -12,40 +12,36 @@ stages:
   - release
   - metadata
 
+before_script:
+  - pnpm install -g pnpm
+  - pnpm install -g @shipzone/npmci
+  - npmci npm prepare
+
+# ====================
+# security stage
+# ====================
 # ====================
 # security stage
 # ====================
-mirror:
-  stage: security
-  script:
-    - npmci git mirror
-  only:
-    - tags
-  tags:
-    - lossless
-    - docker
-    - notpriv
-
 auditProductionDependencies:
   image: registry.gitlab.com/hosttoday/ht-docker-node:npmci
   stage: security
   script:
-    - npmci npm prepare
-    - npmci command npm install --production --ignore-scripts
-    - npmci command npm config set registry https://registry.npmjs.org
-    - npmci command npm audit --audit-level=high --only=prod --production
+     - npmci command npm config set registry https://registry.npmjs.org
+     - npmci command pnpm audit --audit-level=high --prod
   tags:
+    - lossless
     - docker
+  allow_failure: true
 
 auditDevDependencies:
   image: registry.gitlab.com/hosttoday/ht-docker-node:npmci
   stage: security
   script:
-    - npmci npm prepare
-    - npmci command npm install --ignore-scripts
     - npmci command npm config set registry https://registry.npmjs.org
-    - npmci command npm audit --audit-level=high --only=dev
+    - npmci command pnpm audit --audit-level=high --dev
   tags:
+    - lossless
     - docker
   allow_failure: true
 
@@ -56,7 +52,6 @@ auditDevDependencies:
 testStable:
   stage: test
   script:
-    - npmci npm prepare
     - npmci node install stable
     - npmci npm install
     - npmci npm test
@@ -67,10 +62,9 @@ testStable:
 testBuild:
   stage: test
   script:
-    - npmci npm prepare
     - npmci node install stable
     - npmci npm install
-    - npmci command npm run build
+    - npmci npm build
   coverage: /\d+.?\d+?\%\s*coverage/
   tags:
     - docker
@@ -96,10 +90,9 @@ codequality:
   only:
     - tags
   script:
-    - npmci command npm install -g tslint typescript
+    - npmci command npm install -g typescript
     - npmci npm prepare
     - npmci npm install
-    - npmci command "tslint -c tslint.json ./ts/**/*.ts"
   tags:
     - lossless
     - docker
@@ -119,11 +112,9 @@ trigger:
 pages:
   stage: metadata
   script:
-    - npmci node install lts
-    - npmci command npm install -g @gitzone/tsdoc
-    - npmci npm prepare
+    - npmci node install stable
     - npmci npm install
-    - npmci command tsdoc
+    - npmci command npm run buildDocs
   tags:
     - lossless
     - docker

.vscode/launch.json

@@ -2,28 +2,10 @@
   "version": "0.2.0",
   "configurations": [
     {
-      "name": "current file",
-      "type": "node",
+      "command": "npm test",
+      "name": "Run npm test",
       "request": "launch",
-      "args": [
-        "${relativeFile}"
-      ],
-      "runtimeArgs": ["-r", "@gitzone/tsrun"],
-      "cwd": "${workspaceRoot}",
-      "protocol": "inspector",
-      "internalConsoleOptions": "openOnSessionStart"
-    },
-    {
-      "name": "test.ts",
-      "type": "node",
-      "request": "launch",
-      "args": [
-        "test/test.ts"
-      ],
-      "runtimeArgs": ["-r", "@gitzone/tsrun"],
-      "cwd": "${workspaceRoot}",
-      "protocol": "inspector",
-      "internalConsoleOptions": "openOnSessionStart"
+      "type": "node-terminal"
     }
   ]
 }

html/index.html

@@ -1,5 +1,5 @@
 <!--gitzone element-->
-<!-- made by Lossless GmbH -->
+<!-- made by Task Venture Capital GmbH -->
 <!-- checkout https://maintainedby.lossless.com for awesome OpenSource projects -->
 <html lang="en">
   <head>
@@ -10,6 +10,10 @@
     />
     <meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
 
+    <!--Lets load standard fonts-->
+    <link rel="preconnect" href="https://assetbroker.lossless.one/" crossorigin>
+    <link rel="stylesheet" href="https://assetbroker.lossless.one/fonts/fonts.css">
+
     <style>
       body {
         margin: 0px;
@@ -17,7 +21,7 @@
       }
     </style>
 
-    <script src="./index.ts"></script>
+    <script type="module" src="/bundle.js"></script>
   </head>
   <body>
   </body>

html/index.ts

@@ -1,10 +1,10 @@
 // dees tools
-import * as deesWccTools from '@designestate/dees-wcctools';
-import * as deesDomTools from '@designestate/dees-domtools';
+import * as deesWccTools from '@design.estate/dees-wcctools';
+import * as deesDomTools from '@design.estate/dees-domtools';
 
 // elements and pages
-import * as elements from '../ts_web/elements';
-import * as pages from '../ts_web/pages';
+import * as elements from '../ts_web/elements/index.js';
+import * as pages from '../ts_web/pages/index.js';
 
 deesWccTools.setupWccTools(elements as any, pages);
 deesDomTools.elementBasic.setup();

license

@@ -8,7 +8,10 @@ copies of the Software, and to permit persons to whom the Software is
 furnished to do so, subject to the following conditions:
 
 The above copyright notice and this permission notice shall be included in all
-copies or substantial portions of the Software.
+copies or substantial portions of the Software. You agree to being mentioned
+as reference by Lossless GmbH. This includes the use of your entity logos
+or profile picture by Lossless GmbH on websites and readme's, also on third party
+pages like gitlab.com or github.com.
 
 THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
 IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,

npmextra.json

@@ -3,10 +3,10 @@
     "projectType": "wcc",
     "module": {
       "githost": "gitlab.com",
-      "gitscope": "designestate",
+      "gitscope": "design.estate",
       "gitrepo": "dees-catalog",
-      "shortDescription": "a webcomponents catalog for handling daily stuff on the web",
-      "npmPackagename": "@designestate/dees-catalog",
+      "description": "a webcomponents catalog for handling daily stuff on the web",
+      "npmPackagename": "@design.estate/dees-catalog",
       "license": "MIT",
       "projectDomain": "design.estate"
     }

package.json

@@ -1,36 +1,41 @@
 {
-  "name": "@designestate/dees-catalog",
-  "version": "1.0.55",
+  "name": "@design.estate/dees-catalog",
+  "version": "1.0.195",
   "private": false,
   "description": "website for lossless.com",
   "main": "dist_ts_web/index.js",
   "typings": "dist_ts_web/index.d.ts",
+  "type": "module",
   "scripts": {
     "test": "tstest test/ --web",
-    "build": "tsbuild element && tsbundle element --production",
-    "watch": "tswatch element"
+    "build": "tsbuild element --allowimplicitany && tsbundle element --production",
+    "watch": "tswatch element",
+    "buildDocs": "tsdoc"
   },
   "author": "Lossless GmbH",
   "license": "MIT",
   "dependencies": {
-    "@designestate/dees-domtools": "^1.0.91",
-    "@designestate/dees-element": "^1.0.19",
-    "@designestate/dees-wcctools": "^1.0.57",
-    "@fortawesome/fontawesome-svg-core": "^1.2.36",
-    "@fortawesome/free-brands-svg-icons": "^5.15.4",
-    "@fortawesome/free-regular-svg-icons": "^5.15.4",
-    "@fortawesome/free-solid-svg-icons": "^5.15.4",
-    "typescript": "^4.4.2"
+    "@design.estate/dees-domtools": "^2.0.40",
+    "@design.estate/dees-element": "^2.0.27",
+    "@design.estate/dees-wcctools": "^1.0.78",
+    "@fortawesome/fontawesome-svg-core": "^6.4.2",
+    "@fortawesome/free-brands-svg-icons": "^6.4.2",
+    "@fortawesome/free-regular-svg-icons": "^6.4.2",
+    "@fortawesome/free-solid-svg-icons": "^6.4.2",
+    "@push.rocks/smartpromise": "^4.0.3",
+    "@push.rocks/smartstring": "^4.0.9",
+    "@tsclass/tsclass": "^4.0.43",
+    "highlight.js": "11.8.0",
+    "pdfjs-dist": "^3.10.111"
   },
   "devDependencies": {
-    "@gitzone/tsbuild": "^2.1.26",
-    "@gitzone/tsbundle": "^1.0.87",
-    "@gitzone/tstest": "^1.0.57",
-    "@gitzone/tswatch": "^1.0.56",
-    "@pushrocks/projectinfo": "^4.0.5",
-    "@pushrocks/tapbundle": "^3.2.14",
-    "tslint": "^6.1.3",
-    "tslint-config-prettier": "^1.17.0"
+    "@gitzone/tsbuild": "^2.1.66",
+    "@gitzone/tsbundle": "^2.0.8",
+    "@gitzone/tstest": "^1.0.77",
+    "@gitzone/tswatch": "^2.0.7",
+    "@push.rocks/projectinfo": "^5.0.2",
+    "@push.rocks/tapbundle": "^5.0.15",
+    "@types/node": "^20.6.0"
   },
   "files": [
     "ts/**/*",

readme.md

@@ -1,27 +1,26 @@
-# @designestate/dees-catalog
+# @design.estate/dees-catalog
 a webcomponents catalog for handling daily stuff on the web
 
 ## Availabililty and Links
-* [npmjs.org (npm package)](https://www.npmjs.com/package/@designestate/dees-catalog)
-* [gitlab.com (source)](https://gitlab.com/designestate/dees-catalog)
-* [github.com (source mirror)](https://github.com/designestate/dees-catalog)
-* [docs (typedoc)](https://designestate.gitlab.io/dees-catalog/)
+* [npmjs.org (npm package)](https://www.npmjs.com/package/@design.estate/dees-catalog)
+* [gitlab.com (source)](https://gitlab.com/design.estate/dees-catalog)
+* [github.com (source mirror)](https://github.com/design.estate/dees-catalog)
+* [docs (typedoc)](https://design.estate.gitlab.io/dees-catalog/)
 
 ## Status for master
 
 Status Category | Status Badge
 -- | --
-GitLab Pipelines | [![pipeline status](https://gitlab.com/designestate/dees-catalog/badges/master/pipeline.svg)](https://lossless.cloud)
-GitLab Pipline Test Coverage | [![coverage report](https://gitlab.com/designestate/dees-catalog/badges/master/coverage.svg)](https://lossless.cloud)
-npm | [![npm downloads per month](https://badgen.net/npm/dy/@designestate/dees-catalog)](https://lossless.cloud)
-Snyk | [![Known Vulnerabilities](https://badgen.net/snyk/designestate/dees-catalog)](https://lossless.cloud)
+GitLab Pipelines | [![pipeline status](https://gitlab.com/design.estate/dees-catalog/badges/master/pipeline.svg)](https://lossless.cloud)
+GitLab Pipline Test Coverage | [![coverage report](https://gitlab.com/design.estate/dees-catalog/badges/master/coverage.svg)](https://lossless.cloud)
+npm | [![npm downloads per month](https://badgen.net/npm/dy/@design.estate/dees-catalog)](https://lossless.cloud)
+Snyk | [![Known Vulnerabilities](https://badgen.net/snyk/design.estate/dees-catalog)](https://lossless.cloud)
 TypeScript Support | [![TypeScript](https://badgen.net/badge/TypeScript/>=%203.x/blue?icon=typescript)](https://lossless.cloud)
 node Support | [![node](https://img.shields.io/badge/node->=%2010.x.x-blue.svg)](https://nodejs.org/dist/latest-v10.x/docs/api/)
 Code Style | [![Code Style](https://badgen.net/badge/style/prettier/purple)](https://lossless.cloud)
-PackagePhobia (total standalone install weight) | [![PackagePhobia](https://badgen.net/packagephobia/install/@designestate/dees-catalog)](https://lossless.cloud)
-PackagePhobia (package size on registry) | [![PackagePhobia](https://badgen.net/packagephobia/publish/@designestate/dees-catalog)](https://lossless.cloud)
-BundlePhobia (total size when bundled) | [![BundlePhobia](https://badgen.net/bundlephobia/minzip/@designestate/dees-catalog)](https://lossless.cloud)
-Platform support | [![Supports Windows 10](https://badgen.net/badge/supports%20Windows%2010/yes/green?icon=windows)](https://lossless.cloud) [![Supports Mac OS X](https://badgen.net/badge/supports%20Mac%20OS%20X/yes/green?icon=apple)](https://lossless.cloud)
+PackagePhobia (total standalone install weight) | [![PackagePhobia](https://badgen.net/packagephobia/install/@design.estate/dees-catalog)](https://lossless.cloud)
+PackagePhobia (package size on registry) | [![PackagePhobia](https://badgen.net/packagephobia/publish/@design.estate/dees-catalog)](https://lossless.cloud)
+BundlePhobia (total size when bundled) | [![BundlePhobia](https://badgen.net/bundlephobia/minzip/@design.estate/dees-catalog)](https://lossless.cloud)
 
 ## Usage
 
@@ -35,7 +34,6 @@ We are always happy for code contributions. If you are not the code contributing
 
 For further information read the linked docs at the top of this readme.
 
-> MIT licensed | **©** [Lossless GmbH](https://lossless.gmbh)
+## Legal
+> MIT licensed | **©** [Task Venture Capital GmbH](https://task.vc)
 | By using this npm module you agree to our [privacy policy](https://lossless.gmbH/privacy)
-
-[![repo-footer](https://lossless.gitlab.io/publicrelations/repofooter.svg)](https://maintainedby.lossless.com)

test/test.browser.ts

@@ -1,4 +1,4 @@
-import { tap, expect, webhelpers } from '@pushrocks/tapbundle';
+import { tap, expect, webhelpers } from '@push.rocks/tapbundle';
 
 import * as deesCatalog from '../ts_web';
 
@@ -6,7 +6,7 @@ tap.test('should create a working button', async () => {
   const button: deesCatalog.DeesButton = await webhelpers.fixture(
     webhelpers.html`<dees-button></dees-button>`
   );
-  expect(button).to.be.instanceOf(deesCatalog.DeesButton);
+  expect(button).toBeInstanceOf(deesCatalog.DeesButton);
 });
 
 tap.start();

ts_web/00_commitinfo_data.ts

@@ -0,0 +1,8 @@
+/**
+ * autocreated commitinfo by @pushrocks/commitinfo
+ */
+export const commitinfo = {
+  name: '@design.estate/dees-catalog',
+  version: '1.0.195',
+  description: 'website for lossless.com'
+}

ts_web/elements/dees-button-exit.ts

@@ -0,0 +1,48 @@
+import {
+  cssManager,
+  customElement,
+  DeesElement,
+  html,
+  type TemplateResult,
+  css,
+  type CSSResult,
+  state,
+  property
+} from '@design.estate/dees-element';
+
+@customElement('dees-button-exit')
+export class DeesButtonExit extends DeesElement {
+  // DEMO
+  public static demo = () => html`
+    <dees-button-exit></dees-button-exit>
+  `;
+
+  // INSTANCE
+  @property({
+    type: Number
+  })
+  public size: number = 24;
+
+  public styles = [
+    cssManager.defaultStyles,
+    css`
+
+    `
+  ]
+
+  public render (): TemplateResult {
+    return html`
+      <style>
+        .maincontainer {
+          position: relative;
+          width: ${this.size}px;
+          height: ${this.size}px;
+        }
+      </style>
+      <div class="maincontainer">
+        <div class="firstLine"></div>
+        <div class="secondLine"></div>
+      </div>
+    `;
+  }
+}

ts_web/elements/dees-button.demo.ts

@@ -0,0 +1,15 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+  <dees-button>This is a slotted Text</dees-button>
+  <p>
+    <dees-button text="Highlighted: This text shows" type="highlighted">Highlighted</dees-button>
+  </p>
+  <p><dees-button type="discreet">This is discreete button</dees-button></p>
+  <p><dees-button disabled>This is a disabled button</dees-button></p>
+  <p><dees-button type="big">This is a slotted Text</dees-button></p>
+  <p><dees-button status="normal">Normal Status</dees-button></p>
+  <p><dees-button disabled status="pending">Pending Status</dees-button></p>
+  <p><dees-button disabled status="success">Success Status</dees-button></p>
+  <p><dees-button disabled status="error">Error Status</dees-button></p>
+`;

ts_web/elements/dees-button.ts

@@ -1,15 +1,17 @@
+import { demoFunc } from './dees-button.demo.js';
 import {
   customElement,
   html,
   DeesElement,
   property,
-  TemplateResult,
+  type TemplateResult,
   cssManager,
   css,
+  type CSSResult,
   unsafeCSS,
-} from '@designestate/dees-element';
+} from '@design.estate/dees-element';
 
-import * as domtools from '@designestate/dees-domtools';
+import * as domtools from '@design.estate/dees-domtools';
 
 declare global {
   interface HTMLElementTagNameMap {
@@ -19,19 +21,14 @@ declare global {
 
 @customElement('dees-button')
 export class DeesButton extends DeesElement {
-  public static demo = () => html`
-    <dees-button>This is a slotted Text</dees-button>
-    <p><dees-button text="Highlighted: This text shows" type="highlighted">Highlighted</dees-button></p>
-    <p><dees-button type="discreet">This is discreete button</dees-button></p>
-    <p><dees-button disabled>This is a disabled button</dees-button></p>
-    <p><dees-button type="big">This is a slotted Text</dees-button></p>
-    <p><dees-button status="normal">Normal Status</dees-button></p>
-    <p><dees-button disabled status="pending">Pending Status</dees-button></p>
-    <p><dees-button disabled status="success">Success Status</dees-button></p>
-    <p><dees-button disabled status="error">Error Status</dees-button></p>
-  `;
+  public static demo = demoFunc;
 
-  @property()
+  @property({
+    reflect: true,
+    hasChanged() {
+      return true;
+    }
+  })
   public text: string;
 
   @property()
@@ -74,19 +71,20 @@ export class DeesButton extends DeesElement {
       }
 
       .button {
-        transition: all 0.1s ease;
+        transition: all 0.1s , color 0s;
         position: relative;
         font-size: 14px;
+        font-weight: 400;
         display: flex;
         justify-content: center;
         align-items: center;
-        background: ${cssManager.bdTheme('#eee', '#333')};
-        box-shadow: ${cssManager.bdTheme('0px 0px 5px rgba(0,0,0,0.1)', 'none')};
+        background: ${cssManager.bdTheme('#fff', '#333')};
+        box-shadow: ${cssManager.bdTheme('0px 1px 3px rgba(0,0,0,0.3)', 'none')};
         border: 1px solid ${cssManager.bdTheme('#eee', '#333')};
         border-top: ${cssManager.bdTheme('1px solid #eee', '1px solid #444')};
-        border-radius: 2px;
+        border-radius: 4px;
         line-height: 40px;
-        padding: 0px 10px;
+        padding: 0px 8px;
         min-width: 100px;
         user-select: none;
         color: ${cssManager.bdTheme('#333', ' #ccc')};
@@ -96,9 +94,9 @@ export class DeesButton extends DeesElement {
       .button:hover {
         cursor: pointer;
         background: #039be5;
+        color: #ffffff;
         border: 1px solid #039be5;
         border-top: 1px solid #039be5;
-        color: #ffffff;
       }
 
       .button:active {
@@ -143,7 +141,7 @@ export class DeesButton extends DeesElement {
         line-height: 48px;
         font-size: 16px;
         padding: 0px 48px;
-        margin-top: 36px;
+        margin-top: 32px;
       }
 
       .button.pending {
@@ -180,9 +178,9 @@ export class DeesButton extends DeesElement {
         @click="${this.dispatchClick}"
       >
         ${this.status === 'normal' ? html``: html`
-          <dees-spinner status="${this.status}"></dees-spinner>
+          <dees-spinner .bnw=${true} status="${this.status}"></dees-spinner>
         `}
-        <div class="textbox">${this.text ? this.text : html`<slot></slot>`}</div>
+        <div class="textbox">${this.text ? this.text : this.textContent}</div>
       </div>
     `;
   }

ts_web/elements/dees-chips.ts

@@ -0,0 +1,124 @@
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-chips': DeesChips;
+  }
+}
+
+@customElement('dees-chips')
+export class DeesChips extends DeesElement {
+  public static demo = () => html`
+    <dees-chips .selectableChips=${['Payment Account 1', 'PaymentAccount2', 'Payment Account 3']}></dees-chips>
+    <dees-chips selectionMode="multiple" .selectableChips=${['Payment Account 1', 'PaymentAccount2', 'Payment Account 3']}></dees-chips>
+    
+  `;
+
+  @property()
+  public selectionMode: 'single' | 'multiple' = 'single';
+
+  @property({
+    type: Array
+  })
+  public selectableChips: string[] = [];
+
+  @property()
+  public selectedChip: string = null;
+
+  @property({
+    type: Array
+  })
+  public selectedChips: string[] = [];
+  
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+
+      :host {
+        display: block;
+        box-sizing: border-box;
+      }
+
+      .mainbox {
+
+      }
+
+      .chip {
+        background: #494949;
+        display: inline-block;
+        padding: 8px 12px;
+        font-size: 14px;
+        color: #fff;
+        border-radius: 40px;
+        margin-right: 4px;
+        margin-bottom: 8px;
+      }
+
+      .chip:hover {
+        background: #666666;
+        cursor: pointer; 
+      }
+
+      .chip.selected {
+        background: #00A3FF;
+      }
+      
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="mainbox">
+        ${this.selectableChips.map(chipArg => html`
+          <div @click=${() => this.selectChip(chipArg)} class="chip ${this.selectedChip === chipArg || this.selectedChips.includes(chipArg) ? 'selected' : ''}">
+            ${chipArg}
+          </div>
+        `)}
+      </div>
+    `;
+  }
+
+  public async firstUpdated() {
+    if (!this.textContent) {
+      this.textContent = 'Button';
+      this.performUpdate();
+    }
+  }
+
+  public async selectChip(chipArg: string) {
+    if (this.selectionMode === 'single') {
+      if (this.selectedChip === chipArg) {
+        this.selectedChip = null;
+        this.selectedChips = [];
+      } else {
+        this.selectedChip = chipArg;
+        this.selectedChips = [chipArg];
+      }
+    } else if(this.selectionMode === 'multiple') {
+      if (this.selectedChips.includes(chipArg)) {
+        this.selectedChips = this.selectedChips.filter(chipArg2 => chipArg !== chipArg2)
+      } else {
+        this.selectedChips.push(chipArg);
+      }
+      this.requestUpdate();
+    }
+    console.log(this.selectedChips);
+  }
+}

ts_web/elements/dees-contextmenu.demo.ts

@@ -0,0 +1,57 @@
+import { html } from '@design.estate/dees-element';
+import * as plugins from './plugins.js';
+
+import { DeesContextmenu } from './dees-contextmenu.js';
+
+export const demoFunc = () => html`
+<style>
+  .withMargin {
+    display: block;
+    margin: 20px;
+  }
+</style>
+<dees-button @contextmenu=${(eventArg) => {
+  DeesContextmenu.openContextMenuWithOptions(eventArg, [
+    {
+      name: 'copy',
+      iconName: 'copySolid',
+      action: async () => {
+        return null;
+      },
+    },
+    {
+      name: 'edit',
+      iconName: 'penToSquare',
+      action: async () => {
+        return null;
+      },
+    },{
+      name: 'paste',
+      iconName: 'pasteSolid',
+      action: async () => {
+        return null;
+      },
+    },
+  ]);
+}}>Right-Click for contextmenu</dees-button>
+<dees-contextmenu class="withMargin"></dees-contextmenu>
+<dees-contextmenu
+  class="withMargin"
+  .menuItems=${[
+    {
+      name: 'copy',
+      iconName: 'copySolid',
+      action: async () => {},
+    },
+    {
+      name: 'edit',
+      iconName: 'penToSquare',
+      action: async () => {},
+    },{
+      name: 'paste',
+      iconName: 'pasteSolid',
+      action: async () => {},
+    },
+  ] as plugins.tsclass.website.IMenuItem[]}
+></dees-contextmenu>
+`;

ts_web/elements/dees-contextmenu.ts

@@ -0,0 +1,146 @@
+import { demoFunc } from './dees-contextmenu.demo.js';
+import * as plugins from './plugins.js';
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { DeesWindowLayer } from './dees-windowlayer.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-contextmenu': DeesContextmenu;
+  }
+}
+
+@customElement('dees-contextmenu')
+export class DeesContextmenu extends DeesElement {
+  // DEMO
+  public static demo = demoFunc
+
+  // STATIC
+  public static async openContextMenuWithOptions(eventArg: MouseEvent, menuItemsArg: plugins.tsclass.website.IMenuItem[]) {
+    eventArg.preventDefault();
+    eventArg.stopPropagation();
+    const contextMenu = new DeesContextmenu();
+    contextMenu.style.position = 'fixed';
+    contextMenu.style.zIndex = '2000';
+    contextMenu.style.top = `${eventArg.clientY.toString()}px`;
+    contextMenu.style.left = `${eventArg.clientX.toString()}px`;
+    contextMenu.style.opacity = '0';
+    contextMenu.style.transform = 'scale(0.95,0.95)';
+    contextMenu.style.transformOrigin = 'top left';
+    contextMenu.menuItems = menuItemsArg;
+    contextMenu.windowLayer = await DeesWindowLayer.createAndShow();
+    contextMenu.windowLayer.addEventListener('click', async () => {
+      await contextMenu.destroy();
+    })
+    document.body.append(contextMenu);
+    await domtools.plugins.smartdelay.delayFor(0);
+    contextMenu.style.opacity = '1';
+    contextMenu.style.transform = 'scale(1,1)';
+  }
+
+  @property({
+    type: Array,
+  })
+  public menuItems: plugins.tsclass.website.IMenuItem[] = [];
+  windowLayer: DeesWindowLayer;
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        display: block;
+        transition: all 0.1s;
+      }
+
+      .mainbox {
+        color: ${cssManager.bdTheme('#222', '#ccc')};
+        font-size: 14px;
+        width: 200px;
+        border: 1px solid #444;
+        min-height: 34px;
+        border-radius: 3px;
+        background: #222;
+        box-shadow: 0px 1px 4px #000;
+        user-select: none;
+      }
+
+      .mainbox .menuitem {
+        padding: 8px;
+      }
+
+      .mainbox .menuitem dees-icon {
+        display: inline-block;
+        margin-right: 8px;
+        width: 14px;
+        transform: translateY(2px);
+      }
+
+      .mainbox .menuitem:hover {
+        cursor: pointer;
+        background: #ffffff10;
+      }
+
+      .mainbox .menuitem:active {
+        cursor: pointer;
+        background: #ffffff05;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="mainbox">
+        ${this.menuItems.map((menuItemArg) => {
+          return html`
+            <div class="menuitem" @click=${() => this.handleClick(menuItemArg)}>
+              <dees-icon .iconFA=${(menuItemArg.iconName as any) || 'minus'}></dees-icon
+              >${menuItemArg.name}
+            </div>
+          `;
+        })}
+        ${this.menuItems.length === 0 ? html`
+            <div class="menuitem" @click=${() => {
+              alert('No menu items...')
+            }}>
+              <dees-icon .iconFA=${'xmark'}></dees-icon
+              >No menu item present...
+            </div>
+        ` : html``}
+      </div>
+    `;
+  }
+
+  public async firstUpdated() {
+    
+  }
+
+  public async handleClick(menuItem: plugins.tsclass.website.IMenuItem) {
+    menuItem.action();
+    await this.destroy();
+  }
+
+  public async destroy() {
+    if (this.windowLayer) {
+      this.windowLayer.destroy();
+    }
+    this.style.opacity = '0';
+    this.style.transform = 'scale(0.95,0,95)';
+    await domtools.plugins.smartdelay.delayFor(100);
+    this.parentElement.removeChild(this);
+  }
+}

ts_web/elements/dees-dataview-codebox.demo.ts

@@ -0,0 +1,18 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html` <style>
+.demoWrapper {
+  box-sizing: border-box;
+  position: absolute;
+  width: 100%;
+  height: 100%;
+  padding: 20px;
+  background: none;
+}
+</style>
+<div class="demoWrapper">
+<dees-dataview-codebox proglang="typescript">
+  import * as text from './hello'; const hiThere = 'nice'; const myFunction = async () => {
+  console.log('nice one'); }
+</dees-dataview-codebox>
+</div>`

ts_web/elements/dees-dataview-codebox.ts

@@ -0,0 +1,213 @@
+import  { demoFunc } from './dees-dataview-codebox.demo.js';
+import {
+  DeesElement,
+  html,
+  customElement,
+  type TemplateResult,
+  property,
+  state,
+} from '@design.estate/dees-element';
+
+import hlight from 'highlight.js';
+
+import * as smartstring from '@push.rocks/smartstring';
+
+import * as domtools from '@design.estate/dees-domtools';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-dataview-codebox': DeesDataviewCodebox;
+  }
+}
+
+@customElement('dees-dataview-codebox')
+export class DeesDataviewCodebox extends DeesElement {
+  public static demo = demoFunc;
+
+  @property()
+  public progLang: string = 'typescript';
+
+  @property({
+    type: String,
+    reflect: true,
+  })
+  public codeToDisplay: string = '';
+
+  constructor() {
+    super();
+  }
+
+  render(): TemplateResult {
+    return html`
+      ${domtools.elementBasic.styles}
+      <style>
+        :host {
+          position: relative;
+          display: block;
+          text-align: left;
+          font-size: 16px;
+        }
+        .mainbox {
+          position: relative;
+          color: ${this.goBright ? '#333333' : '#ffffff'};
+          border-top: 1px solid ${this.goBright ? '#ffffff' : '#333333'};
+          box-shadow: 0px 0px 5px ${this.goBright ? 'rgba(0,0,0,0.1)' : 'rgba(0,0,0,0.5)'};
+          background: ${this.goBright ? '#ffffff' : '#191919'};
+          border-radius: 16px;
+          overflow: hidden;
+        }
+
+        .appbar {
+          height: 24px;
+          background: #161616;
+          border-bottom: 1px solid #222222;
+          font-size: 12px;
+          color: #CCC;
+          font-family: 'Hubot Sans', 'monospace';
+          line-height: 24px;
+        }
+
+        .appbar .fileName {
+          text-align: center;
+        }
+
+        .bottomBar {
+          height: 24px;
+          background: #161616;
+          border-top: 1px solid #222222;
+          font-size: 12px;
+          color: #CCC;
+          font-family: 'Hubot Sans', 'monospace';
+          line-height: 24px;
+        }
+
+        .languageLabel {
+          color: #fff;
+          font-size: 12px;
+          line-height: 24px;
+          z-index: 10;
+          background: #6596ff20;
+          display: inline-block;
+          position: absolute;
+          bottom: 0px;
+          right: 0px;
+          padding: 0px 16px 0px 8px;
+        }
+
+        .hljs-keyword {
+          color: #ff65ec;
+        }
+
+        .codegrid {
+          display: grid;
+          grid-template-columns: 50px auto;
+          overflow: hidden;
+        }
+
+        .lineNumbers {
+          
+          color: ${this.goBright ? '#acacac' : '#666666'};
+          padding: 30px 16px 0px 0px;
+          text-align: right;
+          border-right: 1px solid ${this.goBright ? '#eaeaea' : '#222222'};
+        }
+
+        .lineCounter:last-child {
+          opacity: 50%;
+        }
+
+        pre {
+          overflow-x: auto;
+          margin: 0px;
+          padding: 30px 40px;
+        }
+
+        code {
+          font-weight: ${this.goBright ? '400' : '300'};
+          padding: 0px;
+          margin: 0px;
+        }
+
+        code,
+        code *,
+        .lineNumbers {
+          line-height: 1.4em;
+          font-weight: 200;
+          font-family: 'Intel One Mono', 'monospace';
+        }
+
+        .hljs-string {
+          color: #ffa465;
+        }
+
+        .hljs-built_in {
+          color: #65ff6a;
+        }
+
+        .hljs-function {
+          color: ${this.goBright ? '#2765DF' : '#6596ff'};
+        }
+
+        .hljs-params {
+          color: ${this.goBright ? '#3DB420' : '#65d5ff'};
+        }
+
+        .hljs-comment {
+          color: ${this.goBright ? '#EF9300' : '#ffd765'};
+        }
+      </style>
+      <div class="mainbox">
+        <div class="appbar">
+          <div class="fileName">index.ts</div>
+        </div>
+        <div class="codegrid">
+          <div class="lineNumbers">
+            ${(() => {
+              let lineCounter = 0;
+              return this.codeToDisplay.split('\n').map((lineArg) => {
+                lineCounter++;
+                return html`<div class="lineCounter">${lineCounter}</div>`;
+              });
+            })()}
+          </div>
+          <pre><code></code></pre>
+        </div>
+        <div class="bottomBar">
+          Spaces: 2
+          <div class="languageLabel">${this.progLang}</div>
+        </div>
+      </div>
+    `;
+  }
+
+  @state()
+  private codeToDisplayStore = '';
+
+  public async updated(_changedProperties) {
+    super.updated(_changedProperties);
+    console.log('highlighting now');
+    console.log(this.childNodes);
+    const slottedCodeNodes: Text[] = [];
+    this.childNodes.forEach((childNode) => {
+      if (childNode.nodeName === '#text') {
+        slottedCodeNodes.push(childNode as Text);
+      }
+    });
+    if (this.codeToDisplay && this.codeToDisplay !== this.codeToDisplayStore) {
+      this.codeToDisplayStore = smartstring.indent.normalize(this.codeToDisplay).trimStart();
+    }
+    if (slottedCodeNodes[0] && slottedCodeNodes[0].wholeText && !this.codeToDisplay) {
+      this.codeToDisplayStore = smartstring.indent
+        .normalize(slottedCodeNodes[0].wholeText)
+        .trimStart();
+      this.codeToDisplay = this.codeToDisplayStore;
+    }
+    await domtools.plugins.smartdelay.delayFor(0);
+    const localCodeNode = this.shadowRoot.querySelector('code');
+    const html = hlight.highlight(this.codeToDisplayStore, {
+      language: this.progLang,
+      ignoreIllegals: true,
+    });
+    localCodeNode.innerHTML = html.value;
+  }
+}

ts_web/elements/dees-dataview-statusobject.demo.ts

@@ -0,0 +1,39 @@
+import { html } from '@design.estate/dees-element';
+import * as tsclass from '@tsclass/tsclass';
+
+export const demoFunc = () => html`<dees-dataview-statusobject
+  .statusObject=${{
+    id: '1',
+    name: 'Demo Item',
+    combinedStatus: 'partly_ok',
+    combinedStatusText: 'partly_ok',
+    details: [
+      {
+        name: 'Detail 1',
+        value: 'Value 1',
+        status: 'ok',
+        statusText: 'OK',
+      },
+      {
+        name: 'Detail 2',
+        value: 'Value 2',
+        status: 'partly_ok',
+        statusText: 'partly_ok',
+      },
+      {
+        name: 'Detail 3',
+        value: 'Value 3',
+        status: 'not_ok',
+        statusText: 'not_ok',
+      },
+      {
+        name: 'Detail 4',
+        value:
+          'Value 4 jhdkfjhalskdfjhfdjskalsdkfjhfdjskalskdjfhjdkslaksjdhfjdkslaskdfjhfjdkslaskdjfhjdskalskdjhfdjskalskdjfhdjskl',
+        status: 'ok',
+        statusText: 'OK',
+      },
+    ],
+  } as tsclass.code.IStatusObject}
+>
+</dees-dataview-statusobject>`;

ts_web/elements/dees-dataview-statusobject.ts

@@ -0,0 +1,139 @@
+import { demoFunc } from './dees-dataview-statusobject.demo.js';
+import {
+  DeesElement,
+  html,
+  customElement,
+  type TemplateResult,
+  property,
+  state,
+  cssManager,
+  css,
+  type CSSResult,
+} from '@design.estate/dees-element';
+
+import * as tsclass from '@tsclass/tsclass';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-dataview-statusobject': DeesDataviewStatusobject;
+  }
+}
+
+@customElement('dees-dataview-statusobject')
+export class DeesDataviewStatusobject extends DeesElement {
+  public static demo = demoFunc;
+
+  @property({ type: Object }) statusObject: tsclass.code.IStatusObject;
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      .mainbox {
+        border-radius: 3px;
+        background: ${cssManager.bdTheme('#fff', '#1b1b1b')};
+        box-shadow: 0px 1px 3px #00000030;
+        min-height: 48px;
+        color: ${cssManager.bdTheme('#000', '#fff')};
+      }
+
+      .heading {
+        display: grid;
+        align-items: center;
+        grid-template-columns: 40px auto 120px;
+      }
+
+      h1 {
+        display: block;
+        margin: 0px;
+        padding: 0px;
+        height: 48px;
+        text-transform: uppercase;
+        font-size: 12px;
+        line-height: 48px;
+      }
+
+      .statusdot {
+        height: 8px;
+        width: 8px;
+        border-radius: 6px;
+        background: grey;
+        margin: auto;
+      }
+
+      .copyMain {
+        cursor: pointer;
+        font-size: 10px;
+        font-weight: 600;
+        text-transform: uppercase;
+        border: 1px solid ${cssManager.bdTheme('#999', '#444')};
+        text-align: center;
+        padding: 4px;
+        border-radius: 3px;
+        margin-right: 16px;
+        color: #ffffff80
+      }
+
+      .statusdot.ok {
+        background: green;
+      }
+
+      .statusdot.not_ok{
+        background: red;
+      }
+
+      .statusdot.partly_ok {
+        background: orange;
+      }
+
+      .detail {
+        minheight: 60px;
+        align-items: center;
+        display: grid;
+        grid-template-columns: 40px auto;
+        border-top: 1px dotted ${cssManager.bdTheme('#999', '#282828')};
+      }
+
+      .detail .detailsText {
+        padding-top: 8px;
+        padding-bottom: 8px;
+        padding-right: 8px;
+        word-break: break-all;
+      }
+
+      .detail .detailsText .label {
+        font-size: 12px;
+        color: #ffffff80
+      }
+
+      .detail .detailsText .value {
+        font-size: 14px;
+        font-family: 'Intel One Mono';
+      }
+    `,
+  ];
+
+  render(): TemplateResult {
+    return html`
+      <div class="mainbox">
+        <div class="heading">
+          <div class="statusdot ${this.statusObject?.combinedStatus}"></div>
+          <h1>${this.statusObject?.name || 'no status object assigned'}</h1>
+          <div class="copyMain">Copy as JSON</div>
+        </div>
+        ${this.statusObject?.details?.map((detailArg) => {
+          return html`
+            <div class="detail">
+              <div class="statusdot ${detailArg.status}"></div>
+              <div class="detailsText">
+                <div class="label">${detailArg.name}</div>
+                <div class="value">${detailArg.value}</div>
+              </div>
+            </div>
+          `;
+        })}
+      </div>
+    `;
+  }
+
+  async firstUpdated() {}
+}

ts_web/elements/dees-form-submit.ts

@@ -5,8 +5,9 @@ import {
   css,
   cssManager,
   property,
-} from '@designestate/dees-element';
-import { DeesForm } from './dees-form';
+  type CSSResult,
+} from '@design.estate/dees-element';
+import { DeesForm } from './dees-form.js';
 
 declare global {
   interface HTMLElementTagNameMap {
@@ -20,6 +21,7 @@ export class DeesFormSubmit extends DeesElement {
 
   @property({
     type: Boolean,
+    reflect: true,
   })
   public disabled = false;
 
@@ -29,7 +31,7 @@ export class DeesFormSubmit extends DeesElement {
   public text: string;
 
   @property({
-    type: String
+    type: String,
   })
   public status: 'normal' | 'pending' | 'success' | 'error' = 'normal';
 
@@ -41,8 +43,12 @@ export class DeesFormSubmit extends DeesElement {
 
   public render() {
     return html`
-      <dees-button status=${this.status} @click=${this.submit} .disabled=${this.disabled}>
-        ${this.text ? this.text : html`<slot></slot>`}
+      <dees-button
+        status=${this.status}
+        @click=${this.submit}
+        .disabled=${this.disabled}
+        .text=${this.text ? this.text : this.textContent}
+      >
       </dees-button>
     `;
   }
@@ -54,4 +60,12 @@ export class DeesFormSubmit extends DeesElement {
     const parentElement: DeesForm = this.parentElement as DeesForm;
     parentElement.gatherAndDispatch();
   }
+
+  public async focus() {
+    const domtools = await this.domtoolsPromise;
+    if (!this.disabled) {
+      domtools.convenience.smartdelay.delayFor(0);
+      this.submit();
+    }
+  }
 }

ts_web/elements/dees-form.ts

@@ -1,15 +1,21 @@
-import { customElement, html, TemplateResult, DeesElement } from '@designestate/dees-element';
+import { customElement, html, type TemplateResult, DeesElement, type CSSResult, } from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
 
-import { DeesInputCheckbox } from './dees-input-checkbox';
-import { DeesInputText } from './dees-input-text';
-import { DeesInputQuantitySelector } from './dees-input-quantityselector';
-import { DeesInputRadio } from './dees-input-radio';
-import * as domtools from '@designestate/dees-domtools';
-import { DeesFormSubmit } from './dees-form-submit';
+import { DeesInputCheckbox } from './dees-input-checkbox.js';
+import { DeesInputText } from './dees-input-text.js';
+import { DeesInputQuantitySelector } from './dees-input-quantityselector.js';
+import { DeesInputRadio } from './dees-input-radio.js';
+import { DeesFormSubmit } from './dees-form-submit.js';
 
-export type TFormElement = Array<
-  DeesInputCheckbox | DeesInputText | DeesInputQuantitySelector | DeesInputRadio
->;
+// Unified set for form input types
+const FORM_INPUT_TYPES = [
+  DeesInputCheckbox,
+  DeesInputText,
+  DeesInputQuantitySelector,
+  DeesInputRadio
+];
+
+export type TFormInputElement = DeesInputCheckbox | DeesInputText | DeesInputQuantitySelector | DeesInputRadio;
 
 declare global {
   interface HTMLElementTagNameMap {
@@ -19,6 +25,7 @@ declare global {
 
 @customElement('dees-form')
 export class DeesForm extends DeesElement {
+
   public static demo = () => html`
     <dees-form
       style="display: block; margin:auto; max-width: 500px; padding: 20px"
@@ -31,17 +38,14 @@ export class DeesForm extends DeesElement {
     >
       <dees-input-text .required="${true}" key="hello1" label="a text"></dees-input-text>
       <dees-input-text .required="${true}" key="hello2" label="also a text"></dees-input-text>
-      <dees-input-checkbox
-        .required="${true}"
-        key="hello3"
-        label="another text"
-      ></dees-input-checkbox>
+      <dees-input-checkbox .required="${true}" key="hello3" label="another text"></dees-input-checkbox>
       <dees-form-submit>Submit</dees-form-submit>
     </dees-form>
   `;
 
   public name: string = 'myform';
   public changeSubject = new domtools.rxjs.Subject();
+  public readyDeferred = domtools.plugins.smartpromise.defer();
 
   public render(): TemplateResult {
     return html`
@@ -54,69 +58,62 @@ export class DeesForm extends DeesElement {
     `;
   }
 
-  public firstUpdated() {
-    const formChildren = this.getFormChildren();
-    this.checkRequiredStatus();
+  public async firstUpdated() {
+    const formChildren = this.getFormElements();
+    this.updateRequiredStatus();
+
     for (const child of formChildren) {
-      child.changeSubject.subscribe(async (elementArg: TFormElement) => {
-        const valueObject = await this.gatherData();
+      child.changeSubject.subscribe(async () => {
+        const valueObject = await this.collectFormData();
         this.changeSubject.next(valueObject);
         console.log(valueObject);
-        this.checkRequiredStatus();
+        this.updateRequiredStatus();
       });
     }
+    await this.addBehaviours();
+    this.readyDeferred.resolve();
   }
 
-  public getFormChildren() {
-    const children: Array<DeesElement> = this.children as any;
-    const formChildren: TFormElement = [];
-
-    for (const child of children) {
-      if (
-        child instanceof DeesInputCheckbox ||
-        child instanceof DeesInputText ||
-        child instanceof DeesInputQuantitySelector
-      ) {
-        formChildren.push(child);
-      }
-    }
-    return formChildren;
+  public getFormElements(): Array<TFormInputElement> {
+    return (Array.from(this.children)).filter(child => 
+      FORM_INPUT_TYPES.includes(child.constructor as any)
+    ) as unknown as TFormInputElement[];
   }
 
-  public getSubmitButton() {
-    const children: Array<DeesElement> = this.children as any;
-    let submitButton: DeesFormSubmit;
-    for (const childArg of children) {
-      if (childArg instanceof DeesFormSubmit) {
-        submitButton = childArg;
-      }
-    }
-    return submitButton;
+  public getSubmitButton(): DeesFormSubmit | undefined {
+    return Array.from(this.children).find(child => 
+      child instanceof DeesFormSubmit
+    ) as DeesFormSubmit;
   }
 
-  public async checkRequiredStatus() {
+  public async updateRequiredStatus() {
     console.log('checking the required status.');
 
     let requiredOK = true;
-    for (const childArg of this.getFormChildren()) {
+    for (const childArg of this.getFormElements()) {
       if (childArg.required && !childArg.value) {
         requiredOK = false;
       }
     }
-    this.getSubmitButton().disabled = !requiredOK;
+    if (this.getSubmitButton()) {
+      this.getSubmitButton().disabled = !requiredOK;
+    }
   }
 
-  public async gatherData() {
-    const children = this.getFormChildren();
+  public async collectFormData() {
+    const children = this.getFormElements();
     const valueObject: { [key: string]: string | number | boolean } = {};
     for (const child of children) {
+      if (!child.key) {
+        console.log(`form element with label "${child.label}" has no key. skipping.`);
+      }
       valueObject[child.key] = child.value;
     }
     return valueObject;
   }
 
   public async gatherAndDispatch() {
-    const valueObject = await this.gatherData();
+    const valueObject = await this.collectFormData();
     const formDataEvent = new CustomEvent('formData', {
       detail: {
         data: valueObject,
@@ -132,10 +129,17 @@ export class DeesForm extends DeesElement {
     visualStateArg: 'normal' | 'pending' | 'error' | 'success',
     textStateArg: string
   ) {
-    const inputChildren = this.getFormChildren();
+    const inputChildren = this.getFormElements();
     const submitButton = this.getSubmitButton();
 
     switch (visualStateArg) {
+      case 'normal':
+        submitButton.disabled = false;
+        submitButton.status = 'normal';
+        for (const inputChild of inputChildren) {
+          inputChild.disabled = false;
+        }
+        break;
       case 'pending':
         submitButton.disabled = true;
         submitButton.status = 'pending';
@@ -161,4 +165,36 @@ export class DeesForm extends DeesElement {
 
     submitButton.text = textStateArg;
   }
+
+  /**
+   * resets the form
+   */
+  reset() {
+    const inputChildren = this.getFormElements();
+    const submitButton = this.getSubmitButton();
+
+    for (const inputChild of inputChildren) {
+      inputChild.value = null;
+    }
+    this.setStatus('normal', 'Submit');
+  }
+
+  public async addBehaviours() {
+    // Use event delegation
+    this.addEventListener('keydown', (event: KeyboardEvent) => {
+      const target = event.target as DeesElement;
+      if (!FORM_INPUT_TYPES.includes(target.constructor as any)) return;
+
+      if (event.key === 'Enter') {
+        const children = this.getFormElements();
+        const currentIndex = children.indexOf(target as any);
+        if (currentIndex < children.length - 1) {
+          children[currentIndex + 1].focus();
+        } else {
+          target.blur();
+          this.getSubmitButton()?.focus();
+        }
+      }
+    });
+  }
 }

ts_web/elements/dees-icon.ts

@@ -1,8 +1,16 @@
-import { LitElement, html, property, customElement } from 'lit-element';
+import {
+  DeesElement,
+  html,
+  property,
+  customElement,
+  cssManager,
+  css,
+  type CSSResult,
+} from '@design.estate/dees-element';
 
-import * as domtools from '@designestate/dees-domtools';
+import * as domtools from '@design.estate/dees-domtools';
 
-import { icon, IconDefinition } from '@fortawesome/fontawesome-svg-core';
+import { icon, type IconDefinition } from '@fortawesome/fontawesome-svg-core';
 import {
   faFacebook,
   faGoogle,
@@ -10,37 +18,112 @@ import {
   faMedium,
   faSlackHash,
   faTwitter,
+  faInstagram,
+  faTiktok,
 } from '@fortawesome/free-brands-svg-icons';
 
-import {} from '@fortawesome/free-regular-svg-icons';
-import { faDesktop, faRss, faUsers } from '@fortawesome/free-solid-svg-icons';
+import {
+  faCopy as faCopyRegular,
+  faCircleCheck as faCircleCheckRegular,
+  faCircleXmark as faCircleXmarkRegular,
+  faMessage as faMessageRegular,
+  faPaste as faPasteRegular,
+  faSun as faSunRegular,
+} from '@fortawesome/free-regular-svg-icons';
+import {
+  faArrowRight as faArrowRightSolid,
+  faArrowUpRightFromSquare as faArrowUpRightFromSquareSolid,
+  faBell as faBellSolid,
+  faBug as faBugSolid,
+  faBuilding as faBuildingSolid,
+  faCaretLeft as faCaretLeftSolid,
+  faCaretRight as faCaretRightSolid,
+  faCheck as faCheckSolid,
+  faCircleInfo as faCircleInfoSolid,
+  faCircleCheck as faCircleCheckSolid,
+  faCircleXmark as faCircleXmarkSolid,
+  faCopy as faCopySolid,
+  faDesktop as faDesktopSolid,
+  faEye as faEyeSolid,
+  faEyeSlash as faEyeSlashSolid,
+  faGrip as faGripSolid,
+  faMessage as faMessageSolid,
+  faMugHot as faMugHotSolid,
+  faMinus as faMinusSolid,
+  faPaste as faPasteSolid,
+  faPenToSquare as faPenToSquareSolid,
+  faRss as faRssSolid,
+  faUsers as faUsersSolid,
+  faShare as faShareSolid,
+  faSun as faSunSolid,
+  faXmark as faXmarkSolid,
+} from '@fortawesome/free-solid-svg-icons';
 
-type TFontAwesomeIcon =
+export const faIcons = {
   // normal
-  | 'desktop'
-  | 'rss'
-  // brands
-  | 'facebook'
-  | 'google'
-  | 'twitter'
-  | 'linkedin'
-  | 'medium'
-  | 'slack'
-  | 'users';
-const faIcons: { [key: string]: IconDefinition } = {
-  // normal
-  desktop: faDesktop,
-  rss: faRss,
+  arrowRight: faArrowRightSolid,
+  arrowUpRightFromSquare: faArrowUpRightFromSquareSolid,
+  arrowUpRightFromSquareSolid: faArrowUpRightFromSquareSolid,
+  bell: faBellSolid,
+  bellSolid: faBellSolid,
+  bug: faBugSolid,
+  bugSolid: faBugSolid,
+  building: faBuildingSolid,
+  buildingSolid: faBuildingSolid,
+  caretLeft: faCaretLeftSolid,
+  caretLeftSolid: faCaretLeftSolid,
+  caretRight: faCaretRightSolid,
+  caretRightSolid: faCaretRightSolid,
+  check: faCheckSolid,
+  checkSolid: faCheckSolid,
+  circleInfo: faCircleInfoSolid,
+  circleInfoSolid: faCircleInfoSolid,
+  circleCheck: faCircleCheckRegular,
+  circleCheckSolid: faCircleCheckSolid,
+  circleXmark: faCircleXmarkRegular,
+  circleXmarkSolid: faCircleXmarkSolid,
+  copy: faCopyRegular,
+  copySolid: faCopySolid,
+  desktop: faDesktopSolid,
+  desktopSolid: faDesktopSolid,
+  eye: faEyeSolid,
+  eyeSolid: faEyeSolid,
+  eyeSlash: faEyeSlashSolid,
+  eyeSlashSolid: faEyeSlashSolid,
+  grip: faGripSolid,
+  gripSolid: faGripSolid,
+  message: faMessageRegular,
+  messageSolid: faMessageSolid,
+  mugHot: faMugHotSolid,
+  faMugHotSolid: faMugHotSolid,
+  minus: faMinusSolid,
+  minusSolid: faMinusSolid,
+  paste: faPasteRegular,
+  pasteSolid: faPasteSolid,
+  penToSquare: faPenToSquareSolid,
+  penToSquareSolid: faPenToSquareSolid,
+  rss: faRssSolid,
+  rssSolid: faRssSolid,
+  share: faShareSolid,
+  shareSolid: faShareSolid,
+  sun: faSunRegular,
+  sunSolid: faSunSolid,
+  xmark: faXmarkSolid,
+  xmarkSolid: faXmarkSolid,
   // brands
   facebook: faFacebook,
   google: faGoogle,
+  instagram: faInstagram,
   linkedin: faLinkedin,
   medium: faMedium,
   slack: faSlackHash,
+  tiktok: faTiktok,
   twitter: faTwitter,
-  users: faUsers,
+  users: faUsersSolid,
 };
 
+export type TIconKey = keyof typeof faIcons;
+
 declare global {
   interface HTMLElementTagNameMap {
     'dees-icon': DeesIcon;
@@ -48,77 +131,76 @@ declare global {
 }
 
 @customElement('dees-icon')
-export class DeesIcon extends LitElement {
+export class DeesIcon extends DeesElement {
   public static demo = () => html`
-    <div style="background: #fff; padding: 10px;">
-      <dees-icon iconName="visibility"></dees-icon>
-      <dees-icon brandName="facebook"></dees-icon>
+    <dees-icon iconName="visibility"></dees-icon>
+    <div style="background: #fff; padding: 10px; font-size: 30px">
+      <style>
+        dees-icon {
+          transition: color 0.05s;
+        }
+        dees-icon:hover {
+          color: #e4002b;
+        }
+      </style>
+      <dees-icon .iconFA=${'messageSolid'}></dees-icon>
+      <dees-icon .iconFA=${'sun'}></dees-icon>
+      <dees-icon .iconFA=${'sunSolid'}></dees-icon>
+      <dees-icon .iconFA=${'facebook'}></dees-icon>
+      <dees-icon .iconFA=${'arrowUpRightFromSquare'}></dees-icon>
     </div>
   `;
 
-  @property()
-  public iconName: string;
+  @property({
+    type: String
+  })
+  public iconFA: keyof typeof faIcons;
 
   @property()
-  public brandName: TFontAwesomeIcon;
-
-  @property()
-  public svgSize: number = 20;
+  public iconSize: number;
 
   constructor() {
     super();
     domtools.elementBasic.setup();
   }
 
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        display: block;
+        white-space: nowrap;
+        display: flex;
+        align-items: center;
+        justify-content: center;
+      }
+      * {
+        transition: inherit !important;
+      }
+    `,
+  ];
+
   public render() {
     return html`
       ${domtools.elementBasic.styles}
       <style>
-        :host {
-          display: block;
-          line-height: inherit;
-          font-size: inherit;
-        }
         #iconContainer svg {
-          display: inline-block;
-          height: ${this.svgSize}px;
-        }
-        .material-icons {
-          font-family: 'Material Icons';
-          font-weight: normal;
-          font-style: normal;
-          line-height: inherit;
-          font-size: inherit;
-          display: inline-block;
-          line-height: inherit;
-          text-transform: none;
-          letter-spacing: normal;
-          word-wrap: normal;
-          white-space: nowrap;
-          direction: ltr;
-
-          /* Support for all WebKit browsers. */
-          -webkit-font-smoothing: antialiased;
-          /* Support for Safari and Chrome. */
-          text-rendering: optimizeLegibility;
-
-          /* Support for Firefox. */
-          -moz-osx-font-smoothing: grayscale;
-
-          /* Support for IE. */
-          font-feature-settings: 'liga';
+          display: block;
+          height: ${this.iconSize}px;
         }
       </style>
-      ${this.iconName ? html`<i class="material-icons">${this.iconName}</i>` : html``}
-      ${this.brandName ? html`<div id="iconContainer"></div>` : html``}
+      <div id="iconContainer"></div>
     `;
   }
 
-  firstUpdated() {
-    if (this.brandName && !this.iconName) {
-      this.shadowRoot.querySelector('#iconContainer').innerHTML = icon(
-        faIcons[this.brandName]
-      ).html[0];
+  public async updated() {
+    if (!this.iconSize) {
+      this.iconSize = parseInt(globalThis.getComputedStyle(this).fontSize.replace(/\D/g,''));
+    }
+    if (this.iconFA) {
+      this.shadowRoot.querySelector('#iconContainer').innerHTML = this.iconFA
+        ? icon(faIcons[this.iconFA]).html[0]
+        : 'icon not found';
     }
   }
 }

ts_web/elements/dees-input-checkbox.ts

@@ -1,13 +1,14 @@
 import {
   customElement,
   DeesElement,
-  TemplateResult,
+  type TemplateResult,
   property,
   html,
   css,
-  cssManager
-} from '@designestate/dees-element';
-import * as domtools from '@designestate/dees-domtools';
+  cssManager,
+  type CSSResult,
+} from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
 
 declare global {
   interface HTMLElementTagNameMap {
@@ -25,6 +26,7 @@ export class DeesInputCheckbox extends DeesElement {
 
   @property({
     type: String,
+    reflect: true,
   })
   public key: string;
 
@@ -143,7 +145,7 @@ export class DeesInputCheckbox extends DeesElement {
         }
       </style>
       <div class="maincontainer" @click="${this.toggleSelected}">
-        <div class="checkbox ${this.value ? 'selected' : ''} ${this.disabled ? 'disabled' : ''}">
+        <div class="checkbox ${this.value ? 'selected' : ''} ${this.disabled ? 'disabled' : ''}" tabindex="0">
           ${this.value
             ? html`
                 <span class="checkmark">
@@ -171,4 +173,11 @@ export class DeesInputCheckbox extends DeesElement {
     );
     this.changeSubject.next(this);
   }
+
+  public focus(): void {
+    const checkboxDiv = this.shadowRoot.querySelector('.checkbox');
+    if (checkboxDiv) {
+      (checkboxDiv as any).focus();
+    }
+  }
 }

ts_web/elements/dees-input-dropdown.ts

@@ -1,5 +1,5 @@
-import { customElement, LitElement, TemplateResult, property, html } from 'lit-element';
-import * as domtools from '@designestate/dees-domtools';
+import { customElement, DeesElement, type TemplateResult, property, html, css, cssManager, type CSSResult, } from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
 
 declare global {
   interface HTMLElementTagNameMap {
@@ -8,13 +8,24 @@ declare global {
 }
 
 @customElement('dees-input-dropdown')
-export class DeesInputDropdown extends LitElement {
-  public static demo = () => html`<dees-input-dropdown></dees-input-dropdown>`
+export class DeesInputDropdown extends DeesElement {
+  public static demo = () => html`
+    <dees-input-dropdown
+      .options=${[
+        {option: 'option 1', key: 'option1'},
+        {option: 'option 2', key: 'option2'},
+        {option: 'option 3', key: 'option3'}
+      ]}
+    ></dees-input-dropdown>
+  `
 
   // INSTANCE
   public changeSubject = new domtools.rxjs.Subject();
 
-  @property()
+  @property({
+    type: String,
+    reflect: true,
+  })
   public label: string = 'Label';
 
   @property()
@@ -40,11 +51,10 @@ export class DeesInputDropdown extends LitElement {
   })
   public disabled: boolean = false;
 
-  public render(): TemplateResult {
-    return html`
-      ${domtools.elementBasic.styles}
-      <style>
-        * {
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      * {
           box-sizing: border-box;
         }
 
@@ -52,6 +62,7 @@ export class DeesInputDropdown extends LitElement {
           position: relative;
           display: block;
           height: 40px;
+          color: ${cssManager.bdTheme('#222', '#fff')};
         }
 
         .maincontainer {
@@ -68,41 +79,68 @@ export class DeesInputDropdown extends LitElement {
           position: relative;
           max-width: 420px;
           height: 40px;
-          border: 1px solid #CCC;
-          padding: 12px;
+          line-height: 40px;
+          padding: 0px 8px;
           z-index: 0px;
+          background: ${cssManager.bdTheme('#ffffff', '#333333')};
+          box-shadow: ${cssManager.bdTheme('0px 1px 4px rgba(0,0,0,0.3)', 'none')};
+          border-radius: 3px;
+          border-top: 1px solid #CCCCCC00;
+          border-bottom: 1px solid #66666600;
+        }
+
+        .selectedBox.show {
+          border-top: 1px solid ${cssManager.bdTheme('#ffffff', '#666666')};
+          border-bottom: 1px solid ${cssManager.bdTheme('#fafafa', '#222222')};
         }
 
         .selectionBox {
+          will-change:transform;
           pointer-events: none;
           cursor: pointer;
           transition: all 0.2s ease;
           opacity: 0;
           position: relative;
-          background: #ffffff;
+          background: ${cssManager.bdTheme('#ffffff', '#222222')};
           max-width: 420px;
           box-shadow: 0px 0px 5px  rgba(0,0,0,0.2);
-          height: 40px;
+          min-height: 40px;
           margin-top: -40px;
           z-index: 100;
+          border-radius: 3px;
+          padding: 4px;
+          transform: scale(0.99,0.99);
         }
 
         .selectionBox.show {
           pointer-events: all;
           opacity: 1;
-          min-height: 160px;
+          transform: scale(1,1);
         }
 
         .option {
-          padding: 12px;
+          transition: all 0.1s;
+          line-height: 40px;
+          padding: 0px 4px;
+          border-radius: 3px;
         }
 
         .option:hover {
-          background: #fafafa;
+          color: #fff;
+          padding-left: 8px;
+          background: #0277bd;
         }
+    `
+  ]
+
+  public render(): TemplateResult {
+    return html`
+      ${domtools.elementBasic.styles}
+      <style>
+        
       </style>
       <div class="maincontainer">
-        <div class="selectedBox" @click="${event => {this.toggleSelectionBox();}}">
+        <div class="selectedBox show" @click="${event => {this.toggleSelectionBox();}}">
           ${this.selectedOption?.option}
         </div>
         <div class="selectionBox">
@@ -132,6 +170,7 @@ export class DeesInputDropdown extends LitElement {
   }
 
   public toggleSelectionBox() {
+    this.shadowRoot.querySelector('.selectedBox').classList.toggle('show');
     this.shadowRoot.querySelector('.selectionBox').classList.toggle('show');
   }
 }

ts_web/elements/dees-input-fileupload.ts

@@ -1,15 +1,16 @@
 import {
   customElement,
   DeesElement,
-  TemplateResult,
+  type TemplateResult,
   property,
   html,
   css,
   unsafeCSS,
   cssManager,
-} from '@designestate/dees-element';
+  type CSSResult,
+} from '@design.estate/dees-element';
 
-import * as domtools from '@designestate/dees-domtools';
+import * as domtools from '@design.estate/dees-domtools';
 
 declare global {
   interface HTMLElementTagNameMap {
@@ -19,7 +20,7 @@ declare global {
 
 @customElement('dees-input-fileupload')
 export class DeesInputFileupload extends DeesElement {
-  public static demo = () => html`<dees-input-fileupload></dees-input-fileupload>`;
+  public static demo = () => html`<dees-input-fileupload .label=${'Attachments'}></dees-input-fileupload>`;
 
   // INSTANCE
   public changeSubject = new domtools.rxjs.Subject();
@@ -31,6 +32,7 @@ export class DeesInputFileupload extends DeesElement {
 
   @property({
     type: String,
+    reflect: true,
   })
   public key: string;
 
@@ -48,12 +50,17 @@ export class DeesInputFileupload extends DeesElement {
   public required: boolean = false;
 
   @property({
-    type: Boolean
+    type: Boolean,
   })
   public disabled: boolean = false;
 
+  @property({
+    type: String,
+  })
+  public buttonText: string = 'Upload File...';
+
   constructor() {
-    super()
+    super();
   }
 
   public static styles = [
@@ -66,8 +73,13 @@ export class DeesInputFileupload extends DeesElement {
         margin-bottom: 24px;
       }
 
+      .hidden {
+        display: none;
+      }
+
       .maincontainer {
         color: ${cssManager.bdTheme('#333', '#ccc')};
+        
       }
 
       .label {
@@ -78,40 +90,77 @@ export class DeesInputFileupload extends DeesElement {
       .uploadButton {
         position: relative;
         cursor: pointer;
-        padding: 20px 20px;
-        max-width: 200px;
+        padding: 8px;
+        max-width: 600px;
         background: ${cssManager.bdTheme('#fafafa', '#333333')};
         border-radius: 3px;
         text-align: center;
       }
+
+      .uploadButton:hover {
+        color: #fff;
+        background: rgb(3, 155, 229);
+      }
+
       .uploadButton::after {
-        top: 7px;
-        right: 7px;
-        left: 7px;
-        bottom: 7px;
-        transform: scale3d(0.9, 0.9, 1);
+        top: 2px;
+        right: 2px;
+        left: 2px;
+        bottom: 2px;
+        transform: scale3d(0.98, 0.9, 1);
         position: absolute;
         content: '';
         display: block;
-        border: 4px dashed rgba(255, 255, 255, 0);
+        border: 2px dashed rgba(255, 255, 255, 0);
         transition: all 0.2s;
       }
       .uploadButton.dragOver::after {
         transform: scale3d(1, 1, 1);
-        border: 4px dashed rgba(255, 255, 255, 0.3);
+        border: 2px dashed rgba(255, 255, 255, 0.3);
+      }
+
+      .uploadCandidate {
+        text-align: left;
+        border-bottom: 1px dashed #444;
+        color: ${cssManager.bdTheme('#666', '#ccc')};
+        padding: 8px;
+        font-family: 'Mona Sans', 'Inter', sans-serif;
+      }
+
+      .uploadButton:hover .uploadCandidate {
+        color: ${cssManager.bdTheme('#fff', '#fff')};
+        border-bottom: 1px dashed #fff;
+      }
+
+      .uploadCandidate:last-child {
+        margin-bottom: 8px;
       }
     `,
   ];
 
   public render(): TemplateResult {
     return html`
+      <div class="hidden">
+        <input type="file"></div>
+      </div>
       <div class="maincontainer">
         ${this.label ? html`<div class="label">${this.label}</div>` : null}
-        <div class="uploadButton ${this.state === 'dragOver' ? 'dragOver' : ''}">Upload File! (Drag/Drop enabled)</div>
+        ${this.value.map((fileArg) => html` <div class="uploadCandidate">${fileArg.name} | ${fileArg.size}</div> `)}
+        <div class="uploadButton ${this.state === 'dragOver' ? 'dragOver' : ''}" @click=${this.openFileSelector}>
+          ${this.buttonText}
+        </div>
       </div>
     `;
   }
 
+  public async openFileSelector() {
+    const inputFile: HTMLInputElement = this.shadowRoot.querySelector('input[type="file"]');
+    inputFile.click();
+    this.state = 'idle';
+    this.buttonText = 'Upload more files...';
+  }
+  
+
   public async updateValue(eventArg: Event) {
     const target: any = eventArg.target;
     this.value = target.value;
@@ -119,21 +168,41 @@ export class DeesInputFileupload extends DeesElement {
   }
 
   public firstUpdated() {
+    const inputFile: HTMLInputElement = this.shadowRoot.querySelector('input[type="file"]');
+    inputFile.addEventListener('change', (event: Event) => {
+      const target = event.target as HTMLInputElement;
+      for (const file of Array.from(target.files)) {
+        this.value.push(file);
+      }
+      this.requestUpdate();
+      console.log(`Got ${this.value.length} files!`);
+      // Reset the input value to allow selecting the same file again if needed
+      target.value = '';
+    });
+
+
+    // lets handle drag and drop
     const dropArea = this.shadowRoot.querySelector('.uploadButton');
     const handlerFunction = (eventArg: DragEvent) => {
       eventArg.preventDefault();
-      switch(eventArg.type) {
+      switch (eventArg.type) {
         case 'dragover':
           this.state = 'dragOver';
+          this.buttonText = 'release to upload file...';
           break;
         case 'dragleave':
           this.state = 'idle';
+          this.buttonText = 'Upload File...';
           break;
+        case 'drop':
+          this.state = 'idle';
+          this.buttonText = 'Upload more files...';
       }
       console.log(eventArg);
       for (const file of Array.from(eventArg.dataTransfer.files)) {
         this.value.push(file);
-      };
+        this.requestUpdate();
+      }
       console.log(`Got ${this.value.length} files!`);
     };
     dropArea.addEventListener('dragenter', handlerFunction, false);

ts_web/elements/dees-input-quantityselector.ts

@@ -1,5 +1,5 @@
-import { customElement, property, html, TemplateResult, DeesElement } from '@designestate/dees-element';
-import * as domtools from '@designestate/dees-domtools';
+import { customElement, property, html, type TemplateResult, DeesElement, type CSSResult, } from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
 
 declare global {
   interface HTMLElementTagNameMap {
@@ -15,6 +15,12 @@ export class DeesInputQuantitySelector extends DeesElement {
   public changeSubject = new domtools.rxjs.Subject();
 
   @property()
+  public label: string = 'Label';
+
+  @property({
+    type: String,
+    reflect: true,
+  })
   public key: string;
 
   @property({
@@ -57,6 +63,7 @@ export class DeesInputQuantitySelector extends DeesElement {
           min-width: 100px;
           color: ${this.goBright ? '#666' : '#CCC'};
           border: ${this.goBright ? '1px solid #333' : '1px solid #CCC'};
+          border-radius: 4px;
         }
 
         .mainContainer:hover {

ts_web/elements/dees-input-radio.ts

@@ -1,5 +1,5 @@
-import {customElement, LitElement, TemplateResult, property, html} from 'lit-element';
-import * as domtools from '@designestate/dees-domtools';
+import {customElement, DeesElement, type TemplateResult, property, html, type CSSResult,} from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
 
 declare global {
   interface HTMLElementTagNameMap {
@@ -8,13 +8,16 @@ declare global {
 }
 
 @customElement('dees-input-radio')
-export class DeesInputRadio extends LitElement {
+export class DeesInputRadio extends DeesElement {
   public static demo = () => html`<dees-input-radio></dees-input-radio>`;
 
   // INSTANCE
   public changeSubject = new domtools.rxjs.Subject();
 
-  @property()
+  @property({
+    type: String,
+    reflect: true,
+  })
   public key: string;
 
   @property()

ts_web/elements/dees-input-text.ts

@@ -1,5 +1,5 @@
-import {customElement, DeesElement, TemplateResult, property, html, cssManager} from '@designestate/dees-element';
-import * as domtools from '@designestate/dees-domtools';
+import {customElement, DeesElement, type TemplateResult, property, html, cssManager, type CSSResult,} from '@design.estate/dees-element';
+import * as domtools from '@design.estate/dees-domtools';
 
 declare global {
   interface HTMLElementTagNameMap {
@@ -9,23 +9,29 @@ declare global {
 
 @customElement('dees-input-text')
 export class DeesInputText extends DeesElement {
-  public static demo = () => html`<dees-input-text></dees-input-text>`;
+  public static demo = () => html`
+    <dees-input-text .label=${'this is a label'} .value=${'test'}></dees-input-text>
+    <dees-input-text .isPasswordBool=${true}></dees-input-text>
+  `;
 
   // INSTANCE
-  public changeSubject = new domtools.rxjs.Subject();
+  public changeSubject = new domtools.rxjs.Subject<DeesInputText>();
+  public valueChangeSubject = new domtools.rxjs.Subject<string>();
 
   @property({
     type: String
   })
-  public label: string = 'Label';
+  public label: string;
 
   @property({
-    type: String
+    type: String,
+    reflect: true,
   })
   public key: string;
 
   @property({
-    type: String
+    type: String,
+    reflect: true,
   })
   public value: string = '';
 
@@ -39,6 +45,18 @@ export class DeesInputText extends DeesElement {
   })
   public disabled: boolean = false;
 
+  @property({
+    type: Boolean,
+    reflect: true,
+  })
+  public isPasswordBool = false;
+
+  @property({
+    type: Boolean,
+    reflect: true,
+  })
+  public showPasswordBool = false;
+
   public render(): TemplateResult {
     return html `
       <style>
@@ -77,6 +95,8 @@ export class DeesInputText extends DeesElement {
           transition: all 0.2s;
           outline: none;
           font-size: 16px;
+          font-family: ${this.isPasswordBool ? 'monospace': 'Inter'};
+          letter-spacing: ${this.isPasswordBool ? '1px': 'normal'};
           color: ${this.goBright ? '#333' : '#ccc'};
         }
 
@@ -91,10 +111,30 @@ export class DeesInputText extends DeesElement {
           outline: none;
           border-bottom: 1px solid #e4002b;
         }
+
+        .showPassword {
+          position: absolute;
+          bottom: 8px;
+          right: 10px;
+          border: 1px dashed #444;
+          border-radius: 7px;
+          padding: 8px 0px;
+          width: 40px;
+        }
+
+        .showPassword:hover {
+          cursor: pointer;
+          background: #333;
+        }
       </style>
       <div class="maincontainer">
-        <div class="label">${this.label}</div>
-        <input type="text" value=${this.value} @input="${this.updateValue}" .disabled=${this.disabled} />
+        ${this.label ? html`<div class="label">${this.label}</div>` : html``}
+        <input type="${this.isPasswordBool && !this.showPasswordBool ? 'password' : 'text'}" .value=${this.value} @input="${this.updateValue}" .disabled=${this.disabled} />
+        ${this.isPasswordBool ? html`
+          <div class="showPassword" @click=${this.togglePasswordView}>
+            <dees-icon .iconFA=${this.showPasswordBool ? 'eye' : 'eyeSlash'}></dees-icon>
+          </div>
+        ` : html``}
       </div>
     `;
   }
@@ -103,6 +143,7 @@ export class DeesInputText extends DeesElement {
     const target: any = eventArg.target;
     this.value = target.value;
     this.changeSubject.next(this);
+    this.valueChangeSubject.next(this.value);
   }
 
   public async freeze() {
@@ -112,4 +153,20 @@ export class DeesInputText extends DeesElement {
   public async unfreeze() {
     this.disabled = false;
   }
+
+  public async togglePasswordView () {
+    const domtools = await this.domtoolsPromise;
+    this.showPasswordBool = !this.showPasswordBool;
+    console.log(`this.showPasswordBool is: ${this.showPasswordBool}`)
+  }
+
+  public async focus() {
+    const textInput = this.shadowRoot.querySelector('input');
+    textInput.focus();
+  }
+
+  public async blur() {
+    const textInput = this.shadowRoot.querySelector('input');
+    textInput.blur();
+  }
 }

ts_web/elements/dees-mobilenavigation.ts

@@ -0,0 +1,184 @@
+import * as plugins from './plugins.js';
+import {
+  cssManager,
+  css,
+  type CSSResult,
+  customElement,
+  DeesElement,
+  domtools,
+  html,
+  property,
+} from '@design.estate/dees-element';
+import { DeesWindowLayer } from './dees-windowlayer.js';
+
+@customElement('dees-mobilenavigation')
+export class DeesMobilenavigation extends DeesElement {
+  // STATIC
+  public static demo = () => html`
+    <dees-button @click=${() => {
+      DeesMobilenavigation.createAndShow([
+        {
+          name: 'Test',
+          action: async (deesMobileNav) => {
+            alert('test');
+            return null;
+          },
+        },
+      ]);
+    }}></dees-button>
+  `;
+
+  private static singletonRef: DeesMobilenavigation;
+  public static async createAndShow(menuItemsArg: plugins.tsclass.website.IMenuItem<DeesMobilenavigation>[]) {
+    if (!this.singletonRef) {
+      this.singletonRef = new DeesMobilenavigation();
+      document.body.append(this.singletonRef);
+      await this.singletonRef.init();
+    }
+    this.singletonRef.menuItems = menuItemsArg;
+    await this.singletonRef.readyDeferred.promise;
+    this.singletonRef.show();
+    return this.singletonRef;
+  }
+
+  // INSTANCE
+  @property({
+    type: Array,
+  })
+  public heading: string = `MENU`;
+
+  @property({
+    type: Array,
+  })
+  public menuItems: plugins.tsclass.website.IMenuItem[] = [];
+
+  readyDeferred: plugins.smartpromise.Deferred<any> = domtools.plugins.smartpromise.defer();
+
+  constructor() {
+    super();
+    /* this.init().then(() => {
+      this.show();
+    }); */
+  }
+
+  /**
+   * inits the mobile navigation
+   */
+  public async init() {
+    await this.updateComplete;
+    this.readyDeferred.resolve();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+      }
+
+      .main {
+        transition: all 0.3s cubic-bezier(0.22, 1, 0.36, 1);
+        will-change: transform;
+        position: fixed;
+        height: 100vh;
+        min-width: 280px;
+        transform: translateX(200px);
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        z-index: 250;
+        opacity: 0;
+        padding: 16px 32px;
+        right: 0px;
+        top: 0px;
+        bottom: 0px;
+        background: ${cssManager.bdTheme('#eeeeeb', '#000')};;
+        border-left: 1px dashed #444;
+        pointer-events: none;
+      }
+
+      .main.show {
+        pointer-events: all;
+        transform: translateX(0px);
+        opacity: 1;
+      }
+
+      .menuItem {
+        text-align: left;
+        padding: 8px;
+        margin-left: -8px;
+        margin-right: -8px;
+        cursor: pointer;
+        border-radius: 3px;
+      }
+      .menuItem:hover {
+        background: ${cssManager.bdTheme('#CCC', '#333')};;
+      }
+
+      .heading {
+        text-align: left;
+        font-size: 24px;
+        padding: 8px 0px;
+        font-family: 'Mona Sans', 'Inter', sans-serif;
+        font-weight: 300;
+        border-bottom: 1px dashed #444;
+        margin-top: 16px;
+        margin-bottom: 16px;
+      }
+    `,
+  ];
+
+  public render() {
+    return html`
+      <div class="main">
+        <div class="heading">${this.heading}</div>
+        ${this.menuItems.map((menuItem) => {
+          return html`
+            <div
+              class="menuItem"
+              @click="${() => {
+                this.hide();
+                menuItem.action(this);
+              }}"
+            >
+              ${menuItem.name}
+            </div>
+          `;
+        })}
+      </div>
+    `;
+  }
+
+  private windowLayer: DeesWindowLayer;
+
+  /**
+   * inits the show
+   */
+  public async show() {
+    const domtools = await this.domtoolsPromise;
+    const main = this.shadowRoot.querySelector('.main');
+    if (!this.windowLayer) {
+      this.windowLayer = new DeesWindowLayer();
+      this.windowLayer.addEventListener('click', () => {
+        this.hide();
+      });
+    }
+    document.body.append(this.windowLayer);
+    await domtools.convenience.smartdelay.delayFor(0);
+    this.windowLayer.show();
+
+    await domtools.convenience.smartdelay.delayFor(0);
+    main.classList.add('show');
+  }
+
+  /**
+   * inits the hide function
+   */
+  public async hide() {
+    const domtools = await this.domtoolsPromise;
+    const main = this.shadowRoot.querySelector('.main');
+    main.classList.remove('show');
+    this.windowLayer.hide();
+  }
+
+  async disconnectedCallback() {
+    document.body.removeChild(this.windowLayer);
+  }
+}

ts_web/elements/dees-modal.demo.ts

@@ -0,0 +1,37 @@
+import { html } from '@design.estate/dees-element';
+import { DeesModal } from './dees-modal.js';
+
+export const demoFunc = () => html`
+  <dees-button @click=${() => {
+    DeesModal.createAndShow({
+      heading: 'This is a heading',
+      content: html`
+        <dees-form>
+          <dees-input-text
+            .label=${'Username'}
+          >
+          </dees-input-text>
+          <dees-input-text
+            .label=${'Password'}
+          >
+          </dees-input-text>
+        </dees-form>
+      `,
+      menuOptions: [{
+        name: 'Cancel',
+        iconName: null,
+        action: async (deesModalArg) => {
+          deesModalArg.destroy();
+          return null;
+        }
+      }, {
+        name: 'Ok',
+        iconName: null,
+        action: async (deesModalArg) => {
+          deesModalArg.destroy();
+          return null;
+        }
+      }],
+    });
+  }}>open modal</dees-button>
+`

ts_web/elements/dees-modal.ts

@@ -0,0 +1,190 @@
+import * as plugins from './plugins.js';
+import { demoFunc } from './dees-modal.demo.js';
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+  unsafeHTML,
+  state,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { DeesWindowLayer } from './dees-windowlayer.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-modal': DeesModal;
+  }
+}
+
+@customElement('dees-modal')
+export class DeesModal extends DeesElement {
+  // STATIC
+  public static demo = demoFunc;
+
+  public static async createAndShow(optionsArg: {
+    heading: string;
+    content: TemplateResult;
+    menuOptions: plugins.tsclass.website.IMenuItem<DeesModal>[];
+  }) {
+    const body = document.body;
+    const modal = new DeesModal();
+    modal.heading = optionsArg.heading;
+    modal.content = optionsArg.content;
+    modal.menuOptions = optionsArg.menuOptions;
+    modal.windowLayer = await DeesWindowLayer.createAndShow({
+      blur: true,
+    });
+    modal.windowLayer.addEventListener('click', async () => {
+      await modal.destroy();
+    });
+    body.append(modal.windowLayer);
+    body.append(modal);
+  }
+
+  // INSTANCE
+
+  @property({
+    type: String,
+  })
+  public heading = '';
+
+  @state({})
+  public content: TemplateResult;
+
+  @state({})
+  public menuOptions: plugins.tsclass.website.IMenuItem<DeesModal>[] = [];
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        font-family: 'Mona Sans', 'Inter', sans-serif;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+      }
+      .modalContainer {
+        display: flex;
+        position: fixed;
+        top: 0px;
+        left: 0px;
+        width: 100vw;
+        height: 100vh;
+        box-sizing: border-box;
+        align-items: center;
+        justify-content: center;
+        z-index: 2000;
+      }
+      .modal {
+        will-change: transform;
+        transform: translateY(10px);
+        opacity: 0;
+        width: 480px;
+        min-height: 120px;
+        background: #111;
+        border-radius: 8px;
+        border: 1px solid #222;
+        transition: all 0.2s;
+        overflow: hidden;
+      }
+
+      .modal.show {
+        opacity: 1;
+        transform: translateY(0px);
+      }
+
+      .modal .heading {
+        height: 32px;
+        font-family: 'Hubot Sans', 'Inter', sans-serif;
+        line-height: 32px;
+        text-align: center;
+        font-weight: 600;
+        font-size: 12px;
+        border-bottom: 1px solid #222;
+      }
+
+      .modal .content {
+        padding: 16px;
+      }
+      .modal .bottomButtons {
+        display: grid;
+        border-top: 1px solid #222;
+      }
+
+      .modal .bottomButtons .bottomButton {
+        height: 40px;
+        line-height: 40px;
+        text-align: center;
+        font-size: 14px;
+        border-right: 1px solid #222;
+        cursor: pointer;
+      }
+      .modal .bottomButtons .bottomButton:hover {
+        background: #222;
+      }
+      .modal .bottomButtons .bottomButton:last-child {
+        border-right: none;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <style>
+        .modal .bottomButtons {
+          grid-template-columns: ${cssManager.cssGridColumns(this.menuOptions.length, 0)};
+        }
+      </style>
+      <div class="modalContainer" @click=${this.handleOutsideClick}>
+        <div class="modal">
+          <div class="heading">${this.heading}</div>
+          <div class="content">${this.content}</div>
+          <div class="bottomButtons">
+            ${this.menuOptions.map(
+              (actionArg) => html`
+                <div class="bottomButton" @click=${() => {
+                  actionArg.action(this);
+                }}>${actionArg.name}</div>
+              `
+            )}
+          </div>
+        </div>
+      </div>
+    `;
+  }
+
+  private windowLayer: DeesWindowLayer;
+  public async firstUpdated(_changedProperties: Map<string | number | symbol, unknown>) {
+    super.firstUpdated(_changedProperties);
+    const domtools = await this.domtoolsPromise;
+    await domtools.convenience.smartdelay.delayFor(30);
+    const modal = this.shadowRoot.querySelector('.modal');
+    modal.classList.add('show');
+  }
+
+  public async handleOutsideClick(eventArg: MouseEvent) {
+    eventArg.stopPropagation();
+    const modalContainer = this.shadowRoot.querySelector('.modalContainer');
+    if (eventArg.target === modalContainer) {
+      await this.destroy();
+    }
+  }
+
+  public async destroy() {
+    const domtools = await this.domtoolsPromise;
+    const modal = this.shadowRoot.querySelector('.modal');
+    modal.classList.remove('show');
+    await domtools.convenience.smartdelay.delayFor(200);
+    document.body.removeChild(this);
+    await this.windowLayer.destroy();
+  }
+}

ts_web/elements/dees-pdf.ts

@@ -0,0 +1,119 @@
+import { DeesElement, property, html, customElement, domtools, type TemplateResult, type CSSResult, } from '@design.estate/dees-element';
+
+import { Deferred } from '@push.rocks/smartpromise';
+
+// import type pdfjsTypes from 'pdfjs-dist';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-pdf': DeesPdf;
+  }
+}
+
+@customElement('dees-pdf')
+export class DeesPdf extends DeesElement {
+  // DEMO
+  public static demo = () => html` <dees-pdf></dees-pdf> `;
+
+  // INSTANCE
+
+  @property()
+  public pdfUrl: string =
+    'https://raw.githubusercontent.com/mozilla/pdf.js/ba2edeae/examples/learning/helloworld.pdf';
+
+  constructor() {
+    super();
+
+    // you have access to all kinds of things through this.
+    // this.setAttribute('gotIt','true');
+  }
+
+  public render(): TemplateResult {
+    return html`
+      <style>
+        :host {
+          font-family: 'Mona Sans', 'Inter', sans-serif;
+          display: block;
+          box-sizing: border-box;
+          max-width: 800px;
+        }
+        :host([hidden]) {
+          display: none;
+        }
+
+        #pdfcanvas {
+          box-shadow: 0px 0px 5px #ccc;
+          width: 100%;
+        }
+      </style>
+      <canvas id="pdfcanvas" .height=${0} .width=${0}></canvas>
+    `;
+  }
+
+  public static pdfJsReady: Promise<any>;
+  public static pdfjsLib: any // typeof pdfjsTypes;
+  public async connectedCallback() {
+    super.connectedCallback();
+    if (!DeesPdf.pdfJsReady) {
+      const pdfJsReadyDeferred = domtools.plugins.smartpromise.defer();
+      DeesPdf.pdfJsReady = pdfJsReadyDeferred.promise;
+      const loadDeferred = domtools.plugins.smartpromise.defer();
+      const script = document.createElement('script');
+      script.addEventListener('load', () => {
+        console.log('pdf.js loaded!');
+        loadDeferred.resolve();
+      });
+      script.src = 'https:////mozilla.github.io/pdf.js/build/pdf.js';
+      document.getElementsByTagName('head')[0].appendChild(script);
+      // The workerSrc property shall be specified.
+      await loadDeferred.promise;
+      DeesPdf.pdfjsLib = window['pdfjs-dist/build/pdf'];
+      DeesPdf.pdfjsLib.GlobalWorkerOptions.workerSrc = '//mozilla.github.io/pdf.js/build/pdf.worker.js';
+      pdfJsReadyDeferred.resolve();
+    }
+    await DeesPdf.pdfJsReady;
+    this.displayContent();
+  }
+
+  public async displayContent() {
+    await DeesPdf.pdfJsReady;
+
+    // Asynchronous download of PDF
+    const loadingTask = DeesPdf.pdfjsLib.getDocument(this.pdfUrl);
+    loadingTask.promise.then(
+      (pdf) => {
+        console.log('PDF loaded');
+
+        // Fetch the first page
+        const pageNumber = 1;
+        pdf.getPage(pageNumber).then((page) => {
+          console.log('Page loaded');
+
+          const scale = 10;
+          const viewport = page.getViewport({ scale: scale });
+
+          // Prepare canvas using PDF page dimensions
+          const canvas: any = this.shadowRoot.querySelector('#pdfcanvas');
+          const context = canvas.getContext('2d');
+          canvas.height = viewport.height;
+          canvas.width = viewport.width;
+
+          // Render PDF page into canvas context
+          const renderContext = {
+            canvasContext: context,
+            viewport: viewport,
+          };
+
+          const renderTask = page.render(renderContext);
+          renderTask.promise.then(function () {
+            console.log('Page rendered');
+          });
+        });
+      },
+      (reason) => {
+        // PDF loading error
+        console.error(reason);
+      }
+    );
+  }
+}

ts_web/elements/dees-simple-appdash.demo.ts

@@ -0,0 +1,5 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+  <dees-simple-appdash>Hello there</dees-simple-appdash>
+`;

ts_web/elements/dees-simple-appdash.ts

@@ -0,0 +1,74 @@
+import { demoFunc } from './dees-simple-appdash.demo.js';
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  unsafeCSS,
+  type CSSResult,
+  state,
+} from '@design.estate/dees-element';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-simple-appdash': DeesSimpleAppDash;
+  }
+}
+
+@customElement('dees-simple-appdash')
+export class DeesSimpleAppDash extends DeesElement {
+  // STATIC
+  public static demo = demoFunc;
+  // INSTANCE
+
+  @property()
+  public name = 'Dees Simple Login';
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        user-select: none;
+      }
+      .appbar {
+        position: absolute;
+        top: 0;
+        height: 40px;
+        width: 100%;
+        background: ${cssManager.bdTheme('#eeeeeb', '#000')};
+        border-bottom: 1px solid ${cssManager.bdTheme('#ccc', '#333')};
+        font-size: 14px;
+        line-height: 40px;
+        font-family: 'Hubot Sans', 'Inter', sans-serif;
+        padding: 0px 16px;
+      }
+      .appcontent {
+        position: absolute;
+        top: 40px;
+        bottom: 0;
+        width: 100%;
+        background: ${cssManager.bdTheme('#eeeeeb', '#000')};
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="appbar">
+        configvault v1.2.3
+      </div>
+      <div class="appcontent">
+        <slot></slot>
+      </div>
+    `;
+  }
+
+  public async firstUpdated(_changedProperties): Promise<void> {
+    const domtools = await this.domtoolsPromise;
+    super.firstUpdated(_changedProperties);
+  }
+}

ts_web/elements/dees-simple-login.demo.ts

@@ -0,0 +1,3 @@
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html` <dees-simple-login name="someapp"> Hello there </dees-simple-login> `;

ts_web/elements/dees-simple-login.ts

@@ -0,0 +1,120 @@
+import { demoFunc } from './dees-simple-login.demo.js';
+
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  unsafeCSS,
+  type CSSResult,
+  state,
+} from '@design.estate/dees-element';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-simple-login': DeesSimpleLogin;
+  }
+}
+
+@customElement('dees-simple-login')
+export class DeesSimpleLogin extends DeesElement {
+  // STATIC
+  public static demo = demoFunc
+  // INSTANCE
+
+  @property()
+  public name = 'Dees Simple Login';
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        user-select: none;
+      }
+      .loginContainer {
+        position: absolute;
+        display: flex;
+        justify-content: center; /* aligns horizontally */
+        align-items: center; /* aligns vertically */
+        width: 100%;
+        height: 100%;
+      }
+      .login {
+        min-width: 320px;
+        min-height: 100px;
+        background: ${cssManager.bdTheme('#eeeeeb', '#111')};
+        box-shadow: ${cssManager.bdTheme('0px 1px 4px rgba(0,0,0,0.3)', 'none')};
+        border-radius: 3px;
+        padding: 24px;
+        transition: opacity 0.3s, transform 0.3s;
+      }
+
+      .header {
+        text-align: center;
+      }
+      .slotContainer {
+        opacity:0;
+        transition: opacity 0.3s, transform 0.3s;
+        pointer-events: none;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="loginContainer">
+        <div class="login">
+          <dees-form>
+            <div class="header">Login to ${this.name}</div>
+            <dees-input-text key="username" label="username" required></dees-input-text>
+            <dees-input-text key="password" label="password" isPasswordBool required></dees-input-text>
+            <dees-form-submit disabled>login</dees-form-submit>
+          </dees-form>
+        </div>
+      </div>
+      <div class="slotContainer">
+        <slot></slot>
+      </div>
+    `;
+  }
+
+  public async firstUpdated(_changedProperties): Promise<void> {
+    const domtools = await this.domtoolsPromise;
+    super.firstUpdated(_changedProperties);
+    const form = this.shadowRoot.querySelector('dees-form');
+    await form.readyDeferred.promise;
+    const username = this.shadowRoot.querySelector('dees-input-text[label="username"]');
+    const password = this.shadowRoot.querySelector('dees-input-text[label="password"]');
+    const submit = this.shadowRoot.querySelector('dees-form-submit');
+    form.addEventListener('formData', (event: CustomEvent) => {
+      this.dispatchEvent(new CustomEvent('login', { detail: event.detail }));
+      // this.switchToSlottedContent();
+    });
+  }
+
+  /**
+   * allows switching to slotted content
+   */
+  public async switchToSlottedContent() {
+    const domtools = await this.domtoolsPromise;
+    const loginDiv: HTMLDivElement = this.shadowRoot.querySelector('.login');
+    const loginContainerDiv: HTMLDivElement = this.shadowRoot.querySelector('.loginContainer');
+    const slotContainerDiv: HTMLDivElement = this.shadowRoot.querySelector('.slotContainer');
+    loginDiv.style.opacity = '0';
+    loginDiv.style.transform = 'translateY(20px)';
+    loginContainerDiv.style.pointerEvents = 'none';
+    slotContainerDiv.style.transform = 'translateY(20px)';
+    await domtools.convenience.smartdelay.delayFor(300);
+    slotContainerDiv.style.opacity = '1';
+    slotContainerDiv.style.transform = 'translateY(0px)';
+    await domtools.convenience.smartdelay.delayFor(300);
+    slotContainerDiv.style.pointerEvents = 'all';
+
+
+    
+  }
+}

ts_web/elements/dees-speechbubble.ts

@@ -0,0 +1,157 @@
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  type CSSResult,
+  unsafeCSS,
+} from '@design.estate/dees-element';
+
+import * as domtools from '@design.estate/dees-domtools';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-speechbubble': DeesSpeechbubble;
+  }
+}
+
+@customElement('dees-speechbubble')
+export class DeesSpeechbubble extends DeesElement {
+  public static demo = () => html` <dees-speechbubble></dees-speechbubble> `;
+
+  @property()
+  public text: string;
+
+  @property({
+    type: Boolean,
+  })
+  public disabled = false;
+
+  @property({
+    type: Boolean,
+  })
+  public isHidden = false;
+
+  @property({
+    type: String,
+  })
+  public status: 'normal' | 'pending' | 'success' | 'error' = 'normal';
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      :host {
+        position: relative;
+        display: block;
+        box-sizing: border-box;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        cursor: pointer;
+        user-select: none;
+      }
+      :host([hidden]) {
+        display: none;
+      }
+
+      .maincontainer {
+        will-change: transform;
+        transition: transform 0.2s;
+        transform: translateX(0px);
+        position: relative;
+        transition: all 0.2s;
+        margin-left: 0px;
+      }
+
+      .maincontainer:hover {
+        transform: translateX(3px);
+      }
+
+      .arrow {
+        position: absolute;
+        transform: rotate(45deg);
+        background: ${cssManager.bdTheme('#fff', '#333')};
+        height: 15px;
+        width: 15px;
+        left: 4px;
+        top: 5px;
+        border-radius: 2px;
+      }
+
+      .speechbubble {
+        background: ${cssManager.bdTheme('#fff', '#333')};
+        padding: 0px 10px;
+        border-radius: 3px;
+        position: absolute;
+        line-height: 25px;
+        font-size: 12px;
+        top: 0px;
+        left: 8px;
+      }
+
+      .wave {
+        animation-name: wave-animation; /* Refers to the name of your @keyframes element below */
+        animation-duration: 2.5s; /* Change to speed up or slow down */
+        animation-iteration-count: infinite; /* Never stop waving :) */
+        transform-origin: 70% 70%; /* Pivot around the bottom-left palm */
+        display: inline-block;
+      }
+
+      @keyframes wave-animation {
+        0% {
+          transform: rotate(0deg);
+        }
+        10% {
+          transform: rotate(14deg);
+        } /* The following five values can be played with to make the waving more or less extreme */
+        20% {
+          transform: rotate(-8deg);
+        }
+        30% {
+          transform: rotate(14deg);
+        }
+        40% {
+          transform: rotate(-4deg);
+        }
+        50% {
+          transform: rotate(10deg);
+        }
+        60% {
+          transform: rotate(0deg);
+        } /* Reset for the last half to pause */
+        100% {
+          transform: rotate(0deg);
+        }
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="maincontainer" @click=${this.handleClick}>
+        <div class="arrow"></div>
+        <div class="speechbubble"><span class="wave">👋</span> We build with launch.sh, and you can too.</div>
+      </div>
+    `;
+  }
+
+  public async handleClick() {
+    if (this.disabled) {
+      return;
+    }
+
+    globalThis.location.href = "https://launch.sh"
+  }
+
+  public async firstUpdated() {
+    if (!this.textContent) {
+      this.textContent = 'Button';
+      this.performUpdate();
+    }
+  }
+}

ts_web/elements/dees-spinner.ts

@@ -3,13 +3,14 @@ import {
   html,
   DeesElement,
   property,
-  TemplateResult,
+  type TemplateResult,
   cssManager,
   css,
+  type CSSResult,
   unsafeCSS,
-} from '@designestate/dees-element';
+} from '@design.estate/dees-element';
 
-import * as domtools from '@designestate/dees-domtools';
+import * as domtools from '@design.estate/dees-domtools';
 
 declare global {
   interface HTMLElementTagNameMap {
@@ -23,6 +24,8 @@ export class DeesSpinner extends DeesElement {
     <dees-spinner></dees-spinner>
     <dees-spinner status="success"></dees-spinner>
     <dees-spinner status="error"></dees-spinner>
+    <dees-spinner size=${64} status="success"></dees-spinner>
+    <dees-spinner .size=${64} status="error"></dees-spinner>
   `;
 
   @property({
@@ -30,6 +33,11 @@ export class DeesSpinner extends DeesElement {
   })
   public size = 20;
 
+  @property({
+    type: String,
+  })
+  public bnw: boolean = false;
+
   @property()
   public status: 'normal' | 'pending' | 'success' | 'error' = 'normal';
 
@@ -45,6 +53,7 @@ export class DeesSpinner extends DeesElement {
       }
 
       #loading {
+        position: relative;
         transition: none;
         display: flex;
         justify-content: center;
@@ -58,16 +67,14 @@ export class DeesSpinner extends DeesElement {
       }
 
       #loading.success {
-        border: 0px solid rgba(255, 255, 255, 0);
-        background: #8bc34a;
+        border: none;
         border-radius: 50%;
         animation: none;
         -webkit-animation: none;
       }
 
       #loading.error {
-        border: 0px solid rgba(255, 255, 255, 0);
-        background: #e64a19;
+        border: none;
         border-radius: 50%;
         animation: none;
         -webkit-animation: none;
@@ -84,36 +91,10 @@ export class DeesSpinner extends DeesElement {
         }
       }
 
-      #loading .checkmark {
-        display: inline-block;
-        width: 22px;
-        height: 22px;
-        -ms-transform: rotate(45deg); /* IE 9 */
-        -webkit-transform: rotate(45deg); /* Chrome, Safari, Opera */
-        transform: rotate(45deg);
-      }
-
-      #loading .checkmark_stem {
+      dees-icon {
         position: absolute;
-        width: 3px;
-        height: 9px;
-        background-color: #fff;
-        left: 9px;
-        top: 5px;
-      }
-
-      #loading .checkmark_kick {
-        position: absolute;
-        width: 3px;
-        height: 3px;
-        background-color: #fff;
-        left: 6px;
-        top: 11px;
-      }
-
-      #loading.disabled .checkmark_stem,
-      #loading.disabled .checkmark_kick {
-        background-color: ${cssManager.bdTheme('#333', '#fff')};
+        height: 100%;
+        width: 100%;
       }
     `,
   ];
@@ -125,16 +106,25 @@ export class DeesSpinner extends DeesElement {
           width: ${this.size}px;
           height: ${this.size}px;
         }
+        #loading.success {
+          color: ${cssManager.bdTheme(this.bnw ? '#333': `#8bc34a`, this.bnw ? '#fff' : `#8bc34a`)};
+          
+        }
+        #loading.error {
+          color: ${cssManager.bdTheme(this.bnw ? '#333': `#e64a19`, this.bnw ? '#fff' : `#e64a19`)};
+        }
+        dees-icon {
+          font-size: ${this.size}px;
+        }
       </style>
       <div class="${this.status}" id="loading">
-        ${this.status === 'success' || this.status === 'error'
-          ? html`
-              <span class="checkmark">
-                <div class="checkmark_stem"></div>
-                <div class="checkmark_kick"></div>
-              </span>
-            `
-          : null}
+        ${(() => {
+          if (this.status === 'success') {
+            return html`<dees-icon style="transform: translateX(1%) translateY(3%);" .iconFA=${'circleCheck' as any}></dees-icon>`;
+          } else if (this.status === 'error') {
+            return  html`<dees-icon .iconFA=${'circleXmark' as any}></dees-icon>`;
+          }
+        })()}
       </div>
     `;
   }

ts_web/elements/dees-stepper.ts

@@ -4,16 +4,20 @@ import {
   html,
   css,
   unsafeCSS,
+  type CSSResult,
   cssManager,
   property,
-  TemplateResult,
-} from '@designestate/dees-element';
+  type TemplateResult,
+} from '@design.estate/dees-element';
 
-import * as domtools from '@designestate/dees-domtools';
+import * as domtools from '@design.estate/dees-domtools';
 
 export interface IStep {
   title: string;
   content: TemplateResult;
+  validationFunc?: (stepper: DeesStepper, htmlElement: HTMLElement) => Promise<any>;
+  onReturnToStepFunc?: (stepper: DeesStepper, htmlElement: HTMLElement) => Promise<any>;
+  validationFuncCalled?: boolean;
 }
 
 declare global {
@@ -24,40 +28,44 @@ declare global {
 
 @customElement('dees-stepper')
 export class DeesStepper extends DeesElement {
-  public static demo = () => html` <dees-stepper></dees-stepper> `;
+  public static demo = () =>
+    html`
+      <dees-stepper
+        .steps=${[
+          {
+            title: 'Whats your name?',
+            content: html`
+              <dees-form>
+                <dees-input-text
+                  key="email"
+                  label="Your Email"
+                  value="hello@something.com"
+                  disabled
+                ></dees-input-text>
+                <dees-input-text key="firstName" required label="Vorname"></dees-input-text>
+                <dees-input-text key="lastName" required label="Nachname"></dees-input-text>
+                <dees-form-submit>Next</dees-form-submit>
+              </dees-form>
+            `,
+            validationFunc: async (stepperArg, elementArg) => {
+              const deesForm = elementArg.querySelector('dees-form');
+              deesForm.addEventListener('formData', (eventArg) => {
+                stepperArg.goNext();
+              });
+            },
+          },
+          {
+            title: 'Whats your mobile number?',
+            content: html``,
+          },
+        ] as IStep[]}
+      ></dees-stepper>
+    `;
 
   @property({
     type: Array,
   })
-  public steps: IStep[] = [
-    {
-      title: 'Whats your name?',
-      content: html`
-        <dees-form>
-          <dees-input-text key="email" label="Your Email" value="hello@something.com" disabled></dees-input-text>
-          <dees-input-text key="firstName" required label="Vorname"></dees-input-text>
-          <dees-input-text key="lastName" required label="Nachname"></dees-input-text>
-          <dees-form-submit>Next</dees-form-submit>
-        </dees-form>
-      `,
-    },
-    {
-      title: 'Whats your mobile number?',
-      content: html``,
-    },
-    {
-      title: 'Whats the verification code?',
-      content: html``,
-    },
-    {
-      title: 'Whats your new password?',
-      content: html``,
-    },
-    {
-      title: 'Verification:',
-      content: html``,
-    },
-  ];
+  public steps: IStep[] = [];
 
   @property({
     type: Object,
@@ -93,23 +101,31 @@ export class DeesStepper extends DeesElement {
         min-height: 300px;
         border-radius: 3px;
         background: ${cssManager.bdTheme('#ffffff', '#181818')};
+        border-top: 1px solid ${cssManager.bdTheme('#ffffff', '#181818')};
         color: ${cssManager.bdTheme('#333', '#fff')};
         margin: auto;
         margin-bottom: 20px;
-        filter: opacity(0.5);
+        filter: opacity(0.5) grayscale(1);
         box-shadow: 0px 0px 3px #00000010;
+        user-select: none;
       }
 
       .step.selected {
+        border-top: 1px solid #e4002b;
         pointer-events: all;
-        filter: opacity(1);
+        filter: opacity(1) grayscale(0);
         box-shadow: 0px 0px 5px #00000010;
+        user-select: auto;
       }
 
       .step.hiddenStep {
         filter: opacity(0);
       }
 
+      .step:last-child {
+        margin-bottom: 100vh;
+      }
+
       .step .stepCounter {
         position: absolute;
         top: 0px;
@@ -138,7 +154,7 @@ export class DeesStepper extends DeesElement {
       .step .title {
         text-align: center;
         padding-top: 50px;
-        font-family: Roboto;
+        font-family: 'Mona Sans', 'Inter', sans-serif;
         font-size: 25px;
         font-weight: 300;
       }
@@ -154,9 +170,20 @@ export class DeesStepper extends DeesElement {
       <div class="stepperContainer">
         ${this.steps.map(
           (stepArg) =>
-            html`<div class="step ${stepArg === this.selectedStep ? 'selected' : null} ${this.getIndexOfStep(stepArg) > this.getIndexOfStep(this.selectedStep) ? 'hiddenStep' : ''}">
-              ${this.getIndexOfStep(stepArg) > 0 ? html`<div class="goBack" @click=${this.goBack}><- go to previous step</div>` : ``}
-              <div class="stepCounter">Step ${this.steps.findIndex(elementArg => elementArg === stepArg) + 1} of ${this.steps.length} </div>
+            html`<div
+              class="step ${stepArg === this.selectedStep
+                ? 'selected'
+                : null} ${this.getIndexOfStep(stepArg) > this.getIndexOfStep(this.selectedStep)
+                ? 'hiddenStep'
+                : ''}"
+            >
+              ${this.getIndexOfStep(stepArg) > 0
+                ? html`<div class="goBack" @click=${this.goBack}><- go to previous step</div>`
+                : ``}
+              <div class="stepCounter">
+                Step ${this.steps.findIndex((elementArg) => elementArg === stepArg) + 1} of
+                ${this.steps.length}
+              </div>
               <div class="title">${stepArg.title}</div>
               <div class="content">${stepArg.content}</div>
             </div> `
@@ -166,50 +193,70 @@ export class DeesStepper extends DeesElement {
   }
 
   public getIndexOfStep = (stepArg: IStep): number => {
-    return this.steps.findIndex(stepArg2 => stepArg === stepArg2 )
-  }
+    return this.steps.findIndex((stepArg2) => stepArg === stepArg2);
+  };
 
-  public firstUpdated() {
+  public async firstUpdated() {
+    await this.domtoolsPromise;
+    await this.domtools.convenience.smartdelay.delayFor(0);
     this.selectedStep = this.steps[0];
     this.setScrollStatus();
   }
 
-  public updated() {
+  public async updated() {
     this.setScrollStatus();
   }
 
   public scroller: typeof domtools.plugins.SweetScroll.prototype;
 
   public async setScrollStatus() {
-    await domtools.plugins.smartdelay.delayFor(50);
     const stepperContainer: HTMLElement = this.shadowRoot.querySelector('.stepperContainer');
     const firstStepElement: HTMLElement = this.shadowRoot.querySelector('.step');
     const selectedStepElement: HTMLElement = this.shadowRoot.querySelector('.selected');
+    if (!selectedStepElement) {
+      return;
+    }
     if (!stepperContainer.style.paddingTop) {
-      stepperContainer.style.paddingTop = `${(stepperContainer.offsetHeight / 2) - (selectedStepElement.offsetHeight / 2)}px`;
+      stepperContainer.style.paddingTop = `${
+        stepperContainer.offsetHeight / 2 - selectedStepElement.offsetHeight / 2
+      }px`;
     }
     console.log('Setting scroll status');
     console.log(selectedStepElement);
-    const scrollPosition = selectedStepElement.offsetTop - (stepperContainer.offsetHeight / 2) + (selectedStepElement.offsetHeight / 2) ;
+    const scrollPosition =
+      selectedStepElement.offsetTop -
+      stepperContainer.offsetHeight / 2 +
+      selectedStepElement.offsetHeight / 2;
     console.log(scrollPosition);
-    const domtoolsInstance = await domtools.DomTools.setupDomTools()
+    const domtoolsInstance = await domtools.DomTools.setupDomTools();
     if (!this.scroller) {
-      this.scroller = new domtools.plugins.SweetScroll({
-        vertical: true,
-        horizontal: false,
-        easing: 'easeInOutQuint'
-      }, stepperContainer);
+      this.scroller = new domtools.plugins.SweetScroll(
+        {
+          vertical: true,
+          horizontal: false,
+          easing: 'easeInOutExpo',
+          duration: 700,
+        },
+        stepperContainer
+      );
+    }
+    if (!this.selectedStep.validationFuncCalled && this.selectedStep.validationFunc) {
+      this.selectedStep.validationFuncCalled = true;
+      await this.selectedStep.validationFunc(this, selectedStepElement);
     }
     this.scroller.to(scrollPosition);
   }
 
-  public goBack() {
-    const currentIndex = this.steps.findIndex(stepArg => stepArg === this.selectedStep);
+  public async goBack() {
+    const currentIndex = this.steps.findIndex((stepArg) => stepArg === this.selectedStep);
     this.selectedStep = this.steps[currentIndex - 1];
+    await this.domtoolsPromise;
+    await this.domtools.convenience.smartdelay.delayFor(100);
+    this.selectedStep.onReturnToStepFunc?.(this, this.shadowRoot.querySelector('.selected'));
   }
 
   public goNext() {
-    const currentIndex = this.steps.findIndex(stepArg => stepArg === this.selectedStep);
+    const currentIndex = this.steps.findIndex((stepArg) => stepArg === this.selectedStep);
     this.selectedStep = this.steps[currentIndex + 1];
   }
 }

ts_web/elements/dees-table.demo.ts

@@ -0,0 +1,113 @@
+import { type ITableAction } from './dees-table.js';
+import * as plugins from './plugins.js';
+import { html } from '@design.estate/dees-element';
+
+export const demoFunc = () => html`
+  <style>
+    .demoWrapper {
+      box-sizing: border-box;
+      position: absolute;
+      width: 100%;
+      height: 100%;
+      padding: 20px;
+      background: #000000;
+    }
+  </style>
+  <div class="demoWrapper">
+    <dees-table
+      heading1="Current Account Statement"
+      heading2="Bunq - Payment Account 2 - April 2021"
+      .data=${[
+        {
+          date: '2021-04-01',
+          amount: '2464.65 €',
+          description: 'Printing Paper (Office Supplies) - STAPLES BREMEN',
+        },
+        {
+          date: '2021-04-02',
+          amount: '165.65 €',
+          description: 'Logitech Mouse (Hardware) - logi.com OnlineShop',
+        },
+        {
+          date: '2021-04-03',
+          amount: '2999,00 €',
+          description: 'Macbook Pro 16inch (Hardware) - Apple.de OnlineShop',
+        },
+        {
+          date: '2021-04-01',
+          amount: '2464.65 €',
+          description: 'Office-Supplies - STAPLES BREMEN',
+        },
+        {
+          date: '2021-04-01',
+          amount: '2464.65 €',
+          description: 'Office-Supplies - STAPLES BREMEN',
+        },
+      ]}
+      dataName="transactions"
+      .dataActions="${[
+        {
+          name: 'upload',
+          iconName: 'bell',
+          useTableBehaviour: 'upload',
+          type: ['inRow'],
+          actionFunc: async (itemArg: any) => {
+            alert(itemArg.amount);
+          },
+        },
+        {
+          name: 'visibility',
+          iconName: 'copy',
+          type: ['inRow'],
+          useTableBehaviour: 'preview',
+          actionFunc: async (itemArg: any) => {},
+        },
+        {
+          name: 'create new',
+          iconName: 'instagram',
+          type: ['header'],
+          useTableBehaviour: 'preview',
+          actionFunc: async (itemArg: any) => {},
+        },
+        {
+          name: 'to gallery',
+          iconName: 'message',
+          type: ['footer'],
+          useTableBehaviour: 'preview',
+          actionFunc: async (itemArg: any) => {},
+        },
+        {
+          name: 'copy',
+          iconName: 'copySolid',
+          type: ['contextmenu', 'inRow'],
+          action: async () => {
+            return null;
+          },
+        },
+        {
+          name: 'edit (from demo)',
+          iconName: 'penToSquare',
+          type: ['contextmenu'],
+          action: async () => {
+            return null;
+          },
+        },
+        {
+          name: 'paste',
+          iconName: 'pasteSolid',
+          type: ['contextmenu'],
+          action: async () => {
+            return null;
+          },
+        },
+      ] as ITableAction[]}"
+      .displayFunction=${(itemArg) => {
+        return {
+          ...itemArg,
+          onlyDisplayProp: 'onlyDisplay',
+        };
+      }}
+      >This is a slotted Text</dees-table
+    >
+  </div>
+`;

ts_web/elements/dees-table.ts

@@ -0,0 +1,479 @@
+import * as plugins from './plugins.js';
+import { demoFunc } from './dees-table.demo.js';
+import {
+  customElement,
+  html,
+  DeesElement,
+  property,
+  type TemplateResult,
+  cssManager,
+  css,
+  unsafeCSS,
+  type CSSResult,
+  state,
+  resolveExec,
+} from '@design.estate/dees-element';
+
+import { DeesContextmenu } from './dees-contextmenu.js';
+
+import * as domtools from '@design.estate/dees-domtools';
+import { type TIconKey } from './dees-icon.js';
+
+declare global {
+  interface HTMLElementTagNameMap {
+    'dees-table': DeesTable<any>;
+  }
+}
+
+// interfaces
+export interface ITableAction<T = any> {
+  name: string;
+  iconName: TIconKey;
+  /**
+   * the table behaviour to use for this action
+   * e.g. upload: allows to upload files to the table
+   */
+  useTableBehaviour?: 'upload' | 'cancelUpload' | 'none';
+  /**
+   * the type of the action
+   */
+  type: ('inRow' | 'contextmenu' | 'footer' | 'header' | 'preview' | 'keyCombination')[];
+  /**
+   * allows to check if the action is relevant for the given item
+   * @param itemArg
+   * @returns
+   */
+  actionRelevancyCheckFunc?: (itemArg: T) => boolean;
+  /**
+   * the actual action function implementation
+   * @param itemArg
+   * @returns
+   */
+  actionFunc: (itemArg: T) => Promise<any>;
+}
+
+export type TDisplayFunction<T = any> = (itemArg: T) => object;
+
+// the table implementation
+@customElement('dees-table')
+export class DeesTable<T> extends DeesElement {
+  public static demo = demoFunc;
+
+  // INSTANCE
+  @property({
+    type: String,
+  })
+  public heading1: string = 'heading 1';
+
+  @property({
+    type: String,
+  })
+  public heading2: string = 'heading 2';
+
+  @property({
+    type: Array,
+  })
+  public data: T[] = [];
+
+  @property({
+    type: String,
+    reflect: true,
+  })
+  public dataName: string;
+
+  @property({
+    type: Array,
+  })
+  public dataActions: ITableAction[] = [];
+
+  @property({
+    attribute: false,
+  })
+  public displayFunction: TDisplayFunction = (itemArg: T) => itemArg as any;
+
+  @property({
+    type: Object,
+  })
+  public selectedDataRow: T;
+
+  public files: File[] = [];
+  public fileWeakMap = new WeakMap();
+
+  constructor() {
+    super();
+  }
+
+  public static styles = [
+    cssManager.defaultStyles,
+    css`
+      .mainbox {
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        font-family: 'Mona Sans', 'Inter', sans-serif;
+        font-weight: 400;
+        font-size: 14px;
+        padding: 16px;
+        display: block;
+        width: 100%;
+        min-height: 50px;
+        background: ${cssManager.bdTheme('#ffffff', '#333333')};
+        border-radius: 3px;
+        border-top: 1px solid ${cssManager.bdTheme('#fff', '#444')};
+        box-shadow: 0px 1px 4px rgba(0, 0, 0, 0.3);
+        overflow-x: auto;
+      }
+
+      .header {
+        display: flex;
+        justify-content: flex-end;
+        align-items: center;
+      }
+
+      .headingContainer {
+      }
+
+      .heading {
+        font-family: 'Hubot Sans', 'Inter', sans-serif;
+      }
+
+      .heading1 {
+        font-weight: 600;
+      }
+      .heading2 {
+        opacity: 0.6;
+      }
+
+      .headingSeparation {
+        margin-top: 7px;
+        border-bottom: 1px solid ${cssManager.bdTheme('#bcbcbc', '#bcbcbc')};
+      }
+
+      .headerActions {
+        margin-left: auto;
+        cursor: pointer;
+      }
+      .headerAction {
+        display: flex;
+        color: ${cssManager.bdTheme('#333', '#ccc')};
+      }
+
+      .headerAction:hover {
+        color: ${cssManager.bdTheme('#555', '#fff')};
+      }
+
+      .headerAction dees-icon {
+        margin-right: 8px;
+      }
+
+      table,
+      .noDataSet {
+        margin-top: 16px;
+        color: ${cssManager.bdTheme('#333', '#fff')};
+        border-collapse: collapse;
+        width: 100%;
+      }
+      .noDataSet {
+        text-align: center;
+      }
+      tr {
+        border-bottom: 1px dashed ${cssManager.bdTheme('#999', '#808080')};
+        text-align: left;
+      }
+      tr:last-child {
+        border-bottom: none;
+        text-align: left;
+      }
+      tr:hover {
+        cursor: pointer;
+      }
+      tr:hover .innerCellContainer {
+        background: ${cssManager.bdTheme('#22222210', '#ffffff20')};
+      }
+      tr:first-child:hover {
+        cursor: auto;
+      }
+      tr:first-child:hover .innerCellContainer {
+        background: none;
+      }
+      tr.selected .innerCellContainer {
+        background: ${cssManager.bdTheme('#22222220', '#ffffff40')};
+      }
+      th {
+        text-transform: uppercase;
+      }
+      th,
+      td {
+        padding: 3px 0px;
+        border-right: 1px dashed ${cssManager.bdTheme('#999', '#808080')};
+      }
+      .innerCellContainer {
+        padding: 6px 8px;
+      }
+      th:first-child .innerCellContainer,
+      td:first-child .innerCellContainer {
+        padding-left: 0px;
+      }
+      th:last-child .innerCellContainer,
+      td:last-child .innerCellContainer {
+        padding-right: 0px;
+      }
+      th:last-child,
+      td:last-child {
+        border-right: none;
+      }
+
+      .action {
+        margin: -8px 0px;
+        padding: 8px;
+        line-height: 16px;
+        display: inline-block;
+      }
+
+      .action:first-child {
+        margin-left: -8px;
+        width: min-content;
+      }
+
+      .action:hover {
+        background: ${cssManager.bdTheme('#CCC', '#111')};
+      }
+
+      .footer {
+        font-size: 14px;
+        color: ${cssManager.bdTheme('#111', '#ffffff90')};
+        background: ${cssManager.bdTheme('#eeeeeb', '#00000050')};
+        margin: 16px -16px -16px -16px;
+        border-bottom-left-radius: 3px;
+        border-bottom-right-radius: 3px;
+        display: flex;
+      }
+
+      .tableStatistics {
+        padding: 8px 16px;
+      }
+
+      .footerActions {
+        margin-left: auto;
+      }
+
+      .footerActions .footerAction {
+        cursor: pointer;
+        padding: 8px 16px;
+        display: flex;
+      }
+
+      .footerActions .footerAction:hover {
+        background: ${cssManager.bdTheme('#CCC', '#111')};
+      }
+
+      .footerActions dees-icon {
+        display: flex;
+        margin-right: 8px;
+      }
+    `,
+  ];
+
+  public render(): TemplateResult {
+    return html`
+      <div class="mainbox">
+        <!-- the heading part -->
+        <div class="header">
+          <div class="headingContainer">
+            <div class="heading heading1">${this.heading1}</div>
+            <div class="heading heading2">${this.heading2}</div>
+          </div>
+          <div class="headerActions">
+            ${resolveExec(async () => {
+              const resultArray: TemplateResult[] = [];
+              for (const action of this.dataActions) {
+                if (!action.type.includes('header')) continue;
+                resultArray.push(
+                  html`<div
+                    class="headerAction"
+                    @click=${() => {
+                      action.actionFunc(this.selectedDataRow);
+                    }}
+                  >
+                    ${action.iconName
+                      ? html`<dees-icon .iconSize=${14} .iconFA=${action.iconName}></dees-icon>
+                          ${action.name}`
+                      : action.name}
+                  </div>`
+                );
+              }
+              return resultArray;
+            })}
+          </div>
+        </div>
+        <div class="headingSeparation"></div>
+
+        <!-- the actual table -->
+        <style></style>
+        ${this.data.length > 0
+          ? (() => {
+              // Only pick up the keys from the first transformed data object
+              // as all data objects are assumed to have the same structure
+              const firstTransformedItem = this.displayFunction(this.data[0]);
+              const headings: string[] = Object.keys(firstTransformedItem);
+              return html`
+                <table>
+                  <tr>
+                    ${headings.map(
+                      (headingArg) => html`
+                        <th>
+                          <div class="innerCellContainer">${headingArg}</div>
+                        </th>
+                      `
+                    )}
+                    ${(() => {
+                      if (this.dataActions && this.dataActions.length > 0) {
+                        return html`
+                          <th>
+                            <div class="innerCellContainer">Actions</div>
+                          </th>
+                        `;
+                      }
+                    })()}
+                  </tr>
+                  ${this.data.map((itemArg) => {
+                    const transformedItem = this.displayFunction(itemArg);
+                    const getTr = (elementArg: HTMLElement): HTMLElement => {
+                      if (elementArg.tagName === 'TR') {
+                        return elementArg;
+                      } else {
+                        return getTr(elementArg.parentElement);
+                      }
+                    };
+                    return html`
+                      <tr
+                        @click=${() => {
+                          this.selectedDataRow = itemArg;
+                        }}
+                        @dragenter=${async (eventArg: DragEvent) => {
+                          eventArg.preventDefault();
+                          eventArg.stopPropagation();
+                          const realTarget = getTr(eventArg.target as HTMLElement);
+                          console.log('dragenter');
+                          console.log(realTarget);
+                          setTimeout(() => {
+                            realTarget.style.background = 'green';
+                          }, 0);
+                        }}
+                        @dragleave=${async (eventArg: DragEvent) => {
+                          eventArg.preventDefault();
+                          eventArg.stopPropagation();
+                          const realTarget = getTr(eventArg.target as HTMLElement);
+                          realTarget.style.background = 'none';
+                        }}
+                        @dragover=${async (eventArg: DragEvent) => {
+                          eventArg.preventDefault();
+                        }}
+                        @drop=${async (eventArg: DragEvent) => {
+                          eventArg.preventDefault();
+                          const newFiles = [];
+                          for (const file of Array.from(eventArg.dataTransfer.files)) {
+                            this.files.push(file);
+                            newFiles.push(file);
+                            this.requestUpdate();
+                          }
+                          const result: File[] = this.fileWeakMap.get(itemArg as object);
+                          if (!result) {
+                            this.fileWeakMap.set(itemArg as object, newFiles);
+                          } else {
+                            result.push(...newFiles);
+                          }
+                        }}
+                        @contextmenu=${async (eventArg: MouseEvent) => {
+                          DeesContextmenu.openContextMenuWithOptions(eventArg, this.getActionsForType('contextmenu').map(action => {
+                            const menuItem: plugins.tsclass.website.IMenuItem = {
+                              name: action.name,
+                              iconName: action.iconName as any,
+                              action: async () => {
+                                await action.actionFunc(itemArg);
+                                return null;
+                              }
+                            }
+                            return menuItem;
+                          }));
+                        }}
+                        class="${itemArg === this.selectedDataRow ? 'selected' : ''}"
+                      >
+                        ${headings.map(
+                          (headingArg) => html`
+                            <td>
+                              <div class="innerCellContainer">${transformedItem[headingArg]}</div>
+                            </td>
+                          `
+                        )}
+                        ${(() => {
+                          if (this.dataActions && this.dataActions.length > 0) {
+                            return html`
+                              <td>
+                                <div class="innerCellContainer">
+                                  ${this.getActionsForType('inRow').map(
+                                    (actionArg) => html`<div
+                                      class="action"
+                                      @click=${() => actionArg.actionFunc(itemArg)}
+                                    >
+                                      ${actionArg.iconName
+                                        ? html`
+                                            <dees-icon .iconFA=${actionArg.iconName}></dees-icon>
+                                          `
+                                        : actionArg.name}
+                                    </div>`
+                                  )}
+                                </div>
+                              </td>
+                            `;
+                          }
+                        })()}
+                      </tr>
+                    `;
+                  })}
+                </table>
+              `;
+            })()
+          : html` <div class="noDataSet">No data set!</div> `}
+        <div class="footer">
+          <div class="tableStatistics">
+            ${this.data.length} ${this.dataName || 'data rows'} (total) |
+            ${this.selectedDataRow ? '# ' + `${this.data.indexOf(this.selectedDataRow) + 1}` : `No`}
+            selected
+          </div>
+          <div class="footerActions">
+            ${resolveExec(async () => {
+              const resultArray: TemplateResult[] = [];
+              for (const action of this.dataActions) {
+                if (!action.type.includes('footer')) continue;
+                resultArray.push(
+                  html`<div
+                    class="footerAction"
+                    @click=${() => {
+                      action.actionFunc(this.selectedDataRow);
+                    }}
+                  >
+                    ${action.iconName
+                      ? html`<dees-icon .iconSize=${14} .iconFA=${action.iconName}></dees-icon>
+                          ${action.name}`
+                      : action.name}
+                  </div>`
+                );
+              }
+              return resultArray;
+            })}
+          </div>
+        </div>
+      </div>
+    `;
+  }
+
+  public async firstUpdated() {}
+
+  getActionsForType(typeArg: ITableAction['type'][0]) {
+    const actions: ITableAction[] = [];
+    for (const action of this.dataActions) {
+      if (!action.type.includes(typeArg)) continue;
+      actions.push(action);
+    }
+    return actions;
+  }
+}

ts_web/elements/dees-toast.ts

@@ -1,6 +1,6 @@
-import { customElement, LitElement, TemplateResult, html } from 'lit-element';
+import { customElement, DeesElement, type TemplateResult, html, type CSSResult, } from '@design.estate/dees-element';
 
-import * as domtools from '@designestate/dees-domtools';
+import * as domtools from '@design.estate/dees-domtools';
 
 declare global {
   interface HTMLElementTagNameMap {
@@ -9,7 +9,7 @@ declare global {
 }
 
 @customElement('dees-toast')
-export class DeesToast extends LitElement {
+export class DeesToast extends DeesElement {
 
   constructor() {
     super();

ts_web/elements/dees-tooltip.ts

@@ -0,0 +1 @@
+import {} from '@design.estate/dees-element';

ts_web/elements/dees-updater.ts

@@ -1,10 +1,10 @@
-import { customElement, LitElement, TemplateResult, html, property } from 'lit-element';
+import { customElement, DeesElement, type TemplateResult, html, property, type CSSResult, } from '@design.estate/dees-element';
 
-import * as domtools from '@designestate/dees-domtools';
+import * as domtools from '@design.estate/dees-domtools';
 
 
 import './dees-windowlayer';
-import { css, cssManager } from '@designestate/dees-element';
+import { css, cssManager } from '@design.estate/dees-element';
 
 declare global {
   interface HTMLElementTagNameMap {
@@ -13,13 +13,17 @@ declare global {
 }
 
 @customElement('dees-updater')
-export class DeesUpdater extends LitElement {
-  public static demo = () => html`<dees-updater ></dees-updater>`;
+export class DeesUpdater extends DeesElement {
+  public static demo = () => html`<dees-updater></dees-updater>`;
 
-  @property()
+  @property({
+    type: String,
+  })
   currentVersion: string;
 
-  @property()
+  @property({
+    type: String,
+  })
   updatedVersion: string;
 
   constructor() {

ts_web/elements/dees-windowlayer.ts

@@ -1,6 +1,6 @@
-import { customElement, LitElement, TemplateResult, html, property } from 'lit-element';
+import { customElement, DeesElement, type TemplateResult, html, property, type CSSResult, state, } from '@design.estate/dees-element';
 
-import * as domtools from '@designestate/dees-domtools';
+import * as domtools from '@design.estate/dees-domtools';
 
 declare global {
   interface HTMLElementTagNameMap {
@@ -8,11 +8,33 @@ declare global {
   }
 }
 
+export interface IOptions_DeesWindowLayer {
+  blur: boolean;
+}
+
 @customElement('dees-windowlayer')
-export class DeesWindowLayer extends LitElement {
+export class DeesWindowLayer extends DeesElement {
   // STATIC
   public static demo = () => html`<dees-windowlayer></dees-windowlayer>`;
 
+  public static async createAndShow(optionsArg?: IOptions_DeesWindowLayer) {
+    const domtoolsInstance = domtools.DomTools.getGlobalDomToolsSync();
+    const windowLayer = new DeesWindowLayer();
+    windowLayer.options = {
+      ...windowLayer.options,
+      ...optionsArg,
+    }
+    document.body.append(windowLayer);
+    await domtoolsInstance.convenience.smartdelay.delayFor(0);
+    windowLayer.show();
+    return windowLayer;
+  }
+
+  @state()
+  public options: IOptions_DeesWindowLayer = {
+    blur: false
+  };
+
   // INSTANCE
   @property({
     type: Boolean
@@ -29,7 +51,7 @@ export class DeesWindowLayer extends LitElement {
       ${domtools.elementBasic.styles}
       <style>
         .windowOverlay {
-          transition: all 0.3s;
+          transition: all 0.2s;
           will-change: transform;
           position: fixed;
           top: 0px;
@@ -40,13 +62,14 @@ export class DeesWindowLayer extends LitElement {
           justify-content: center;
           align-items: center;
           background: rgba(0, 0, 0, 0.0);
-          backdrop-filter: brightness(1);
+          backdrop-filter: brightness(1) ${this.options.blur ? 'blur(0px)' : ''};
           pointer-events: none;
+          z-index: 200;
         }
         
         .visible {
           background: rgba(0, 0, 0, 0.2);
-          backdrop-filter: brightness(0.3);
+          backdrop-filter: brightness(0.9) ${this.options.blur ? 'blur(2px)' : ''};
           pointer-events: all;
         }
       </style>
@@ -63,10 +86,29 @@ export class DeesWindowLayer extends LitElement {
   }
 
   dispatchClicked() {
-    this.dispatchEvent(new CustomEvent('clicked'))
+    this.dispatchEvent(new CustomEvent('clicked'));
   }
 
   public toggleVisibility () {
     this.visible = !this.visible;
   }
+
+  public async show() {
+    const domtools = await this.domtoolsPromise;
+    await domtools.convenience.smartdelay.delayFor(0);
+    this.visible = true;
+  }
+
+  public async hide() {
+    const domtools = await this.domtoolsPromise;
+    await domtools.convenience.smartdelay.delayFor(0);
+    this.visible = false;
+  }
+
+  public async destroy() {
+    const domtools = await this.domtoolsPromise;
+    await this.hide();
+    await domtools.convenience.smartdelay.delayFor(300);
+    this.remove();
+  }
 }

ts_web/elements/helperclasses/formcontroller.ts

@@ -0,0 +1,3 @@
+export class FormController {
+  
+}

ts_web/elements/index.ts

@@ -1,15 +1,27 @@
-export * from './dees-button';
-export * from './dees-form';
-export * from './dees-form-submit';
-export * from './dees-icon';
-export * from './dees-input-checkbox';
-export * from './dees-input-dropdown';
-export * from './dees-input-fileupload';
-export * from './dees-input-quantityselector';
-export * from './dees-input-radio';
-export * from './dees-input-text';
-export * from './dees-spinner';
-export * from './dees-stepper';
-export * from './dees-toast';
-export * from './dees-updater';
-export * from './dees-windowlayer';
+export * from './dees-button-exit.js';
+export * from './dees-button.js';
+export * from './dees-chips.js';
+export * from './dees-contextmenu.js';
+export * from './dees-dataview-codebox.js';
+export * from './dees-dataview-statusobject.js';
+export * from './dees-form-submit.js';
+export * from './dees-form.js';
+export * from './dees-icon.js';
+export * from './dees-input-checkbox.js';
+export * from './dees-input-dropdown.js';
+export * from './dees-input-fileupload.js';
+export * from './dees-input-quantityselector.js';
+export * from './dees-input-radio.js';
+export * from './dees-input-text.js';
+export * from './dees-mobilenavigation.js';
+export * from './dees-modal.js';
+export * from './dees-pdf.js';
+export * from './dees-simple-appdash.js';
+export * from './dees-simple-login.js';
+export * from './dees-speechbubble.js';
+export * from './dees-spinner.js';
+export * from './dees-stepper.js';
+export * from './dees-table.js';
+export * from './dees-toast.js';
+export * from './dees-updater.js';
+export * from './dees-windowlayer.js';

ts_web/elements/plugins.ts

@@ -0,0 +1,13 @@
+// @push.rocks scope
+import * as smartpromise from '@push.rocks/smartpromise';
+
+export {
+  smartpromise,
+}
+
+// @tsclass scope
+import * as tsclass from '@tsclass/tsclass';
+
+export {
+  tsclass
+}

ts_web/index.ts

@@ -1 +1,2 @@
-export * from './elements/index';
+export * from './elements/index.js';
+export { commitinfo } from './00_commitinfo_data.js';

ts_web/tsconfig.json

@@ -1,16 +0,0 @@
-{
-  "compilerOptions": {
-    "target": "es2017",
-    "module": "es2015",
-    "moduleResolution": "node",
-    "lib": ["es2017", "dom"],
-    "declaration": true,
-    "inlineSources": true,
-    "inlineSourceMap": true,
-    "noUnusedLocals": true,
-    "noFallthroughCasesInSwitch": true,
-    "outDir": "dist/",
-    "skipLibCheck": true,
-    "experimentalDecorators": true
-  }
-}

tsconfig.json

@@ -1,7 +1,14 @@
 {
   "compilerOptions": {
     "experimentalDecorators": true,
-    "target": "ES2017",
-    "moduleResolution": "Node"
-  }
+    "useDefineForClassFields": false,
+    "target": "ES2022",
+    "module": "ES2022",
+    "moduleResolution": "nodenext",
+    "esModuleInterop": true,
+    "verbatimModuleSyntax": true
+  },
+  "exclude": [
+    "dist_*/**/*.d.ts"
+  ]
 }

tslint.json

@@ -1,17 +0,0 @@
-{
-  "extends": ["tslint:latest", "tslint-config-prettier"],
-  "rules": {
-    "semicolon": [true, "always"],
-    "no-console": false,
-    "ordered-imports": false,
-    "object-literal-sort-keys": false,
-    "member-ordering": {
-      "options":{
-        "order": [
-          "static-method"
-        ]
-      }
-    }
-  },
-  "defaultSeverity": "warning"
-}