27 Commits

Author SHA1 Message Date
jkunz a9c0ced1ca v2.5.4 2026-04-05 03:52:23 +00:00
jkunz c8626a9afd fix(package): bump package version to 2.5.3 2026-04-05 03:52:23 +00:00
jkunz 55a1f66e57 chore: update bundled debug server output 2026-04-05 03:52:21 +00:00
jkunz 5b5f35821f v2.5.3 2026-04-05 03:51:58 +00:00
jkunz e8161e6417 fix(rustdb-commands): restore persisted index initialization before writes to enforce unique constraints after restart 2026-04-05 03:51:58 +00:00
jkunz 1a10c32b12 v2.5.2 2026-04-05 03:26:52 +00:00
jkunz cb8cb87d9f fix(rustdb-indexes): persist created indexes and restore them on server startup 2026-04-05 03:26:52 +00:00
jkunz 96117d54b9 v2.5.1 2026-04-05 02:48:00 +00:00
jkunz 53f58e45c3 fix(docs): update project documentation 2026-04-05 02:48:00 +00:00
jkunz 34d708be7e v2.5.0 2026-04-05 02:46:05 +00:00
jkunz 418e8dc052 feat(storage): add offline data validation and strengthen storage/index integrity checks 2026-04-05 02:46:05 +00:00
jkunz b8567ebe08 v2.4.1 2026-04-05 01:31:44 +00:00
jkunz 827bfa6370 fix(package): update package metadata 2026-04-05 01:31:44 +00:00
jkunz ceba64e34a v2.4.0 2026-04-05 01:30:28 +00:00
jkunz 8646d58f06 feat(rustdb): add restore and periodic persistence support for in-memory storage 2026-04-05 01:30:28 +00:00
jkunz 8ce6ff11c3 v2.3.1 2026-04-04 20:15:58 +00:00
jkunz 5c7aaebaba fix(package): update package metadata 2026-04-04 20:15:58 +00:00
jkunz be7d086c0b v2.3.0 2026-04-04 20:14:51 +00:00
jkunz 91a7b69f1d feat(test): add integration coverage for file storage, compaction, migration, and LocalSmartDb workflows 2026-04-04 20:14:51 +00:00
jkunz 4e078b35d4 v2.2.0 2026-04-04 19:49:47 +00:00
jkunz d8a8259c73 feat(storage): add Bitcask storage migration, binary WAL, and data compaction support 2026-04-04 19:49:47 +00:00
jkunz 9e7ce25b45 v2.1.1 2026-04-02 17:05:07 +00:00
jkunz b634ee50d1 fix(package): update package metadata 2026-04-02 17:05:07 +00:00
jkunz 5a47c516fd v2.1.0 2026-04-02 17:02:03 +00:00
jkunz d34b8673e1 feat(smartdb): add operation log APIs, point-in-time revert support, and a web-based debug dashboard 2026-04-02 17:02:03 +00:00
jkunz 943302f789 v2.0.0 2026-03-26 19:48:27 +00:00
jkunz e23a951dbe BREAKING CHANGE(core): replace the TypeScript database engine with a Rust-backed embedded server and bridge 2026-03-26 19:48:27 +00:00
127 changed files with 19542 additions and 10685 deletions
+3
View File
@@ -3,6 +3,9 @@ node_modules/
dist_ts/
dist_*/
# rust build artifacts
rust/target/
# config
.nogit/
+18 -4
View File
@@ -5,19 +5,19 @@
"githost": "code.foss.global",
"gitscope": "push.rocks",
"gitrepo": "smartdb",
"description": "A pure TypeScript MongoDB wire-protocol-compatible database server with pluggable storage, indexing, transactions, and zero external binary dependencies.",
"description": "A MongoDB-compatible embedded database server with wire protocol support, backed by a high-performance Rust engine.",
"npmPackagename": "@push.rocks/smartdb",
"license": "MIT",
"projectDomain": "push.rocks",
"keywords": [
"mongodb",
"mongodb-compatible",
"wire protocol",
"typescript database",
"embedded database",
"in-memory database",
"testing",
"local database",
"database server",
"typescript"
"rust"
]
},
"release": {
@@ -32,6 +32,20 @@
"@git.zone/tsdoc": {
"legal": "\n## License and Legal Information\n\nThis repository contains open-source code that is licensed under the MIT License. A copy of the MIT License can be found in the [license](license) file within this repository. \n\n**Please note:** The MIT License does not grant permission to use the trade names, trademarks, service marks, or product names of the project, except as required for reasonable and customary use in describing the origin of the work and reproducing the content of the NOTICE file.\n\n### Trademarks\n\nThis project is owned and maintained by Task Venture Capital GmbH. The names and logos associated with Task Venture Capital GmbH and any related products or services are trademarks of Task Venture Capital GmbH and are not included within the scope of the MIT license granted herein. Use of these trademarks must comply with Task Venture Capital GmbH's Trademark Guidelines, and any usage must be approved in writing by Task Venture Capital GmbH.\n\n### Company Information\n\nTask Venture Capital GmbH \nRegistered at District court Bremen HRB 35230 HB, Germany\n\nFor any legal inquiries or if you require further information, please contact us via email at hello@task.vc.\n\nBy using this repository, you acknowledge that you have read this section, agree to comply with its terms, and understand that the licensing of the code does not imply endorsement by Task Venture Capital GmbH of any derivative works.\n"
},
"@git.zone/tsbundle": {
"bundles": [
{
"from": "./ts_debugui/index.ts",
"to": "./ts_debugserver/bundled.ts",
"outputMode": "base64ts",
"bundler": "esbuild",
"includeFiles": ["./html/index.html"]
}
]
},
"@git.zone/tsrust": {
"targets": ["linux_amd64", "linux_arm64"]
},
"@ship.zone/szci": {
"npmGlobalTools": []
}
+87
View File
@@ -1,5 +1,92 @@
# Changelog
## 2026-04-05 - 2.5.4 - fix(package)
bump package version to 2.5.3
- Updates the package metadata version by one patch release.
## 2026-04-05 - 2.5.3 - fix(rustdb-commands)
restore persisted index initialization before writes to enforce unique constraints after restart
- load stored index specifications from storage when creating command context index engines
- rebuild index data from existing documents so custom indexes are active before insert, update, and upsert operations
- add @push.rocks/smartdata as a runtime dependency
## 2026-04-05 - 2.5.2 - fix(rustdb-indexes)
persist created indexes and restore them on server startup
- Save index specifications to storage when indexes are created.
- Remove persisted index metadata when indexes are dropped by name, key spec, or wildcard.
- Rebuild in-memory index engines from stored definitions and existing documents during startup.
## 2026-04-05 - 2.5.1 - fix(docs)
update project documentation
- Modifies a single documentation-related file with a minimal text change.
- No source code, API, or package metadata changes are indicated in the diff summary.
## 2026-04-05 - 2.5.0 - feat(storage)
add offline data validation and strengthen storage/index integrity checks
- adds a `--validate-data <PATH>` CLI mode to run offline integrity checks on storage directories
- introduces storage validation reporting for headers, checksums, duplicate ids, tombstones, and stale or orphaned hint entries
- pre-checks unique index constraints before insert, update, upsert, and findAndModify writes to prevent duplicate-key violations before storage changes
- validates hint files against data files during collection load and rebuilds indexes from data when hints are stale
- ensures new data files always receive a SMARTDB header and persists fresh hint files after successful compaction
- cleans up stale local Unix socket files before starting the TypeScript local server
## 2026-04-05 - 2.4.1 - fix(package)
update package metadata
- Adjusts package manifest content with a minimal one-line change.
## 2026-04-05 - 2.4.0 - feat(rustdb)
add restore and periodic persistence support for in-memory storage
- Restore previously persisted state during startup when a persist path is configured.
- Spawn a background task to periodically persist in-memory data using the configured interval.
- Warn when running purely in-memory without durable persistence configured.
## 2026-04-04 - 2.3.1 - fix(package)
update package metadata
- Adjusts a single package-level metadata entry in the project configuration.
## 2026-04-04 - 2.3.0 - feat(test)
add integration coverage for file storage, compaction, migration, and LocalSmartDb workflows
- adds end-to-end tests for file-backed storage creation, CRUD operations, bulk updates, persistence, and index file generation
- adds compaction stress tests covering repeated updates, tombstones, file shrinking behavior, and restart integrity
- adds migration tests for automatic v0 JSON layout detection, v1 conversion, restart persistence, and post-migration writes
- adds LocalSmartDb lifecycle and unix socket tests, including restart persistence, custom socket paths, and database isolation
## 2026-04-04 - 2.2.0 - feat(storage)
add Bitcask storage migration, binary WAL, and data compaction support
- add TypeScript storage migration from legacy JSON collections to the v1 Bitcask binary format before starting the Rust engine
- replace the legacy JSON WAL with a binary write-ahead log plus shared binary record and KeyDir infrastructure in rustdb-storage
- introduce data file compaction with dead-record reclamation and tests, and add the bson dependency for BSON serialization during migration
## 2026-04-02 - 2.1.1 - fix(package)
update package metadata
- Adjusts a single package metadata entry in package.json.
## 2026-04-02 - 2.1.0 - feat(smartdb)
add operation log APIs, point-in-time revert support, and a web-based debug dashboard
- records insert, update, and delete operations with before/after document snapshots in the Rust oplog
- adds management and TypeScript APIs for metrics, oplog queries, collection browsing, document browsing, and revert-to-sequence operations
- introduces new debugserver and debugui package exports with bundled browser assets served through typedserver
## 2026-03-26 - 2.0.0 - BREAKING CHANGE(core)
replace the TypeScript database engine with a Rust-backed embedded server and bridge
- adds a Rust workspace implementing wire protocol handling, commands, storage, indexing, aggregation, sessions, and transactions
- switches the TypeScript package to lifecycle orchestration via RustDbBridge and @push.rocks/smartrust
- removes previously exported TypeScript internals such as query, update, index, transaction, session, WAL, checksum, and router utilities
- updates build/test tooling and package metadata to compile and ship Rust binaries
## 2026-03-26 - 1.0.1 - fix(repo)
no changes to commit
+13
View File
@@ -0,0 +1,13 @@
<!DOCTYPE html>
<html lang="en">
<head>
<meta charset="UTF-8" />
<meta name="viewport" content="width=device-width, initial-scale=1.0" />
<title>SmartDB Debug</title>
<style>body { margin: 0; background: #09090b; }</style>
<script type="module" src="/bundle.js"></script>
</head>
<body>
<smartdb-debugui></smartdb-debugui>
</body>
</html>
+3 -1
View File
@@ -1,4 +1,6 @@
Copyright (c) 2021 Task Venture Capital GmbH (hello@task.vc)
MIT License
Copyright (c) 2024 Task Venture Capital GmbH
Permission is hereby granted, free of charge, to any person obtaining a copy
of this software and associated documentation files (the "Software"), to deal
+16 -13
View File
@@ -1,34 +1,37 @@
{
"name": "@push.rocks/smartdb",
"version": "1.0.1",
"version": "2.5.4",
"private": false,
"description": "A pure TypeScript MongoDB wire-protocol-compatible database server with pluggable storage, indexing, transactions, and zero external binary dependencies.",
"description": "A MongoDB-compatible embedded database server with wire protocol support, backed by a high-performance Rust engine.",
"exports": {
".": "./dist_ts/index.js"
".": "./dist_ts/index.js",
"./debugui": "./dist_ts_debugui/index.js",
"./debugserver": "./dist_ts_debugserver/index.js"
},
"type": "module",
"author": "Task Venture Capital GmbH",
"license": "MIT",
"scripts": {
"test:before": "(tsrust)",
"test": "(tstest test/. --verbose --logfile --timeout 60)",
"build": "(tsbuild tsfolders)",
"build": "(tsbundle) && (tsbuild tsfolders) && (tsrust)",
"buildDocs": "tsdoc"
},
"devDependencies": {
"@git.zone/tsbuild": "^4.4.0",
"@git.zone/tsbundle": "^2.10.0",
"@git.zone/tsrun": "^2.0.2",
"@git.zone/tsrust": "^1.3.2",
"@git.zone/tstest": "^3.6.1",
"@types/node": "^25.5.0",
"mongodb": "^7.1.1"
},
"dependencies": {
"@push.rocks/smartfs": "^1.5.0",
"@push.rocks/smartpath": "^6.0.0",
"@push.rocks/smartpromise": "^4.2.3",
"@push.rocks/smartrx": "^3.0.10",
"bson": "^7.2.0",
"mingo": "^7.2.0"
"@api.global/typedserver": "^8.0.0",
"@design.estate/dees-element": "^2.0.0",
"@push.rocks/smartdata": "7.1.5",
"@push.rocks/smartrust": "^1.3.2",
"bson": "^7.2.0"
},
"browserslist": [
"last 1 chrome versions"
@@ -46,14 +49,14 @@
"readme.md"
],
"keywords": [
"mongodb",
"mongodb-compatible",
"wire protocol",
"typescript database",
"embedded database",
"in-memory database",
"testing",
"local database",
"database server",
"typescript"
"rust"
],
"homepage": "https://code.foss.global/push.rocks/smartdb#readme",
"repository": {
+1369 -19
View File
File diff suppressed because it is too large Load Diff
+209 -177
View File
@@ -1,6 +1,6 @@
# @push.rocks/smartdb
A pure TypeScript MongoDB wire-protocol-compatible database server. Zero binary dependencies, instant startup, pluggable storage — use the official MongoDB driver and it just works. ⚡
A MongoDB-compatible embedded database server powered by Rust 🦀⚡ — use the official `mongodb` driver and it just works. No binary downloads, instant startup, zero config. Features a built-in **operation log** with **point-in-time revert** and a web-based **debug dashboard**.
## Install
@@ -14,24 +14,74 @@ npm install @push.rocks/smartdb
For reporting bugs, issues, or security vulnerabilities, please visit [community.foss.global/](https://community.foss.global/). This is the central community hub for all issue reporting. Developers who sign and comply with our contribution agreement and go through identification can also get a [code.foss.global/](https://code.foss.global/) account to submit Pull Requests directly.
---
## What It Does
`@push.rocks/smartdb` is a **real database server** written entirely in TypeScript that speaks the MongoDB binary wire protocol. Connect with the official `mongodb` Node.js driver — no mocks, no stubs, no MongoDB binary required.
`@push.rocks/smartdb` is a **real database server** that speaks the wire protocol used by MongoDB drivers. The core engine is written in Rust for high performance, with a thin TypeScript orchestration layer. Connect with the standard `mongodb` Node.js driver — no mocks, no stubs, no external binaries required.
### Why SmartDB?
| | SmartDB | Real MongoDB |
| | SmartDB | External DB Server |
|---|---|---|
| **Startup time** | ~5ms | ~2-5s |
| **Binary download** | None | ~200MB |
| **Node.js only** | ✅ | ❌ |
| **Startup time** | ~30ms | ~2-5s |
| **Binary download** | Bundled (~7MB) | ~200MB+ |
| **Install** | `pnpm add` | System package / Docker |
| **Persistence** | Memory or file-based | Full disk engine |
| **Perfect for** | Unit tests, CI/CD, prototyping, local dev | Production |
| **Debug UI** | Built-in 🖥️ | External tooling |
| **Point-in-time revert** | Built-in ⏪ | Requires oplog tailing |
| **Perfect for** | Unit tests, CI/CD, prototyping, local dev, embedded | Production at scale |
### Two Ways to Use It
### Three Ways to Use It
- 🎯 **`LocalSmartDb`** — Zero-config convenience. Give it a folder path, get a persistent database over a Unix socket. Done.
- 🏗️ **`SmartdbServer`** — Full control. Configure port, host, storage backend, Unix sockets. Great for test fixtures or custom setups.
- 🎯 **`LocalSmartDb`** — Zero-config convenience. Give it a folder path, get a persistent MongoDB-compatible database over a Unix socket. Done.
- 🖥️ **`SmartdbDebugServer`** — Launch a web dashboard to visually browse collections, inspect the operation log, and revert to any point in time.
### Architecture: TypeScript + Rust 🦀
SmartDB uses a **sidecar binary** pattern — TypeScript handles lifecycle, Rust handles all database operations:
```
┌──────────────────────────────────────────────────────────────┐
│ Your Application │
│ (TypeScript / Node.js) │
│ ┌─────────────────┐ ┌───────────────────────────┐ │
│ │ SmartdbServer │────▶│ RustDbBridge (IPC) │ │
│ │ or LocalSmartDb │ │ @push.rocks/smartrust │ │
│ └─────────────────┘ └───────────┬───────────────┘ │
└──────────────────────────────────────┼───────────────────────┘
│ spawn + JSON IPC
┌──────────────────────────────────────────────────────────────┐
│ rustdb binary 🦀 │
│ │
│ ┌──────────────┐ ┌──────────────┐ ┌───────────────┐ │
│ │ Wire Protocol│→ │Command Router│→ │ Handlers │ │
│ │ (OP_MSG) │ │ (40+ cmds) │ │ Find,Insert.. │ │
│ └──────────────┘ └──────────────┘ └───────┬───────┘ │
│ │ │
│ ┌─────────┐ ┌────────┐ ┌───────────┐ ┌──────┴──────┐ │
│ │ Query │ │ Update │ │Aggregation│ │ Index │ │
│ │ Matcher │ │ Engine │ │ Engine │ │ Engine │ │
│ └─────────┘ └────────┘ └───────────┘ └─────────────┘ │
│ │
│ ┌──────────────────┐ ┌──────────────────┐ ┌──────────┐ │
│ │ MemoryStorage │ │ FileStorage │ │ OpLog │ │
│ └──────────────────┘ └──────────────────┘ └──────────┘ │
└──────────────────────────────────────────────────────────────┘
│ TCP / Unix Socket (wire protocol)
┌─────────────┴────────────────────────────────────────────────┐
│ MongoClient (mongodb npm driver) │
│ Connects directly to Rust binary │
└──────────────────────────────────────────────────────────────┘
```
The TypeScript layer handles **lifecycle only** (start/stop/configure via IPC). All database operations flow directly from the `MongoClient` to the Rust binary over TCP or Unix sockets — **zero per-query IPC overhead**.
---
## Quick Start
@@ -47,11 +97,11 @@ import { MongoClient } from 'mongodb';
const db = new LocalSmartDb({ folderPath: './my-data' });
const { connectionUri } = await db.start();
// Connect with the standard MongoDB driver
// Connect with the standard driver
const client = new MongoClient(connectionUri, { directConnection: true });
await client.connect();
// Use exactly like MongoDB
// Use it like any wire-protocol-compatible database
const users = client.db('myapp').collection('users');
await users.insertOne({ name: 'Alice', email: 'alice@example.com' });
const user = await users.findOne({ name: 'Alice' });
@@ -83,13 +133,94 @@ await client.close();
await server.stop();
```
### Option 3: Debug Server (Visual Dashboard) 🖥️
Launch a web-based dashboard to inspect your database in real time:
```typescript
import { SmartdbServer } from '@push.rocks/smartdb';
import { SmartdbDebugServer } from '@push.rocks/smartdb/debugserver';
const server = new SmartdbServer({ storage: 'memory' });
await server.start();
const debugServer = new SmartdbDebugServer(server, { port: 4000 });
await debugServer.start();
// Open http://localhost:4000 in your browser 🚀
```
The debug dashboard gives you:
- 📊 **Dashboard** — server status, uptime, database/collection counts, operation breakdown
- 📁 **Collection Browser** — browse databases, collections, and documents interactively
- 📝 **OpLog Timeline** — every insert, update, and delete with expandable field-level diffs
-**Point-in-Time Revert** — select any oplog sequence, preview what will be undone, and execute
---
## 📝 Operation Log & Point-in-Time Revert
Every write operation (insert, update, delete) is automatically recorded in an in-memory **operation log (OpLog)** with full before/after document snapshots. This enables:
- **Change tracking** — see exactly what changed, when, and in which collection
- **Field-level diffs** — compare previous and new document states
- **Point-in-time revert** — undo operations back to any sequence number
- **Dry-run preview** — see what would be reverted before executing
### Programmatic OpLog API
```typescript
import { SmartdbServer } from '@push.rocks/smartdb';
const server = new SmartdbServer({ port: 27017 });
await server.start();
// ... perform some CRUD operations via MongoClient ...
// Get oplog entries
const oplog = await server.getOpLog({ limit: 50 });
console.log(oplog.entries);
// [{ seq: 1, op: 'insert', db: 'myapp', collection: 'users', document: {...}, previousDocument: null }, ...]
// Get aggregate stats
const stats = await server.getOpLogStats();
console.log(stats);
// { currentSeq: 42, totalEntries: 42, entriesByOp: { insert: 20, update: 15, delete: 7 } }
// Preview a revert (dry run)
const preview = await server.revertToSeq(30, true);
console.log(`Would undo ${preview.reverted} operations`);
// Execute the revert — undoes all operations after seq 30
const result = await server.revertToSeq(30, false);
console.log(`Reverted ${result.reverted} operations`);
// Browse collections programmatically
const collections = await server.getCollections();
const docs = await server.getDocuments('myapp', 'users', 50, 0);
```
### OpLog Entry Structure
Each entry contains:
| Field | Type | Description |
|---|---|---|
| `seq` | `number` | Monotonically increasing sequence number |
| `timestampMs` | `number` | Unix timestamp in milliseconds |
| `op` | `'insert' \| 'update' \| 'delete'` | Operation type |
| `db` | `string` | Database name |
| `collection` | `string` | Collection name |
| `documentId` | `string` | Document `_id` as hex string |
| `document` | `object \| null` | New document state (null for deletes) |
| `previousDocument` | `object \| null` | Previous document state (null for inserts) |
---
## API Reference
### SmartdbServer
The core server class. Speaks MongoDB wire protocol over TCP or Unix sockets.
The core server class. Manages the Rust database engine and exposes connection details.
#### Constructor Options (`ISmartdbServerOptions`)
@@ -123,15 +254,19 @@ const server = new SmartdbServer({
| Method / Property | Type | Description |
|---|---|---|
| `start()` | `Promise<void>` | Start the server |
| `start()` | `Promise<void>` | Start the server (spawns Rust binary) |
| `stop()` | `Promise<void>` | Stop the server and clean up |
| `getConnectionUri()` | `string` | Get the MongoDB connection URI |
| `getConnectionUri()` | `string` | Get the `mongodb://` connection URI |
| `running` | `boolean` | Whether the server is currently running |
| `port` | `number` | Bound port (TCP mode) |
| `host` | `string` | Bound host (TCP mode) |
| `socketPath` | `string` | Socket path (socket mode) |
| `getUptime()` | `number` | Seconds since start |
| `getConnectionCount()` | `number` | Active client connections |
| `port` | `number` | Configured port (TCP mode) |
| `host` | `string` | Configured host (TCP mode) |
| `socketPath` | `string \| undefined` | Socket path (socket mode) |
| `getMetrics()` | `Promise<ISmartDbMetrics>` | Server metrics (db/collection counts, uptime) |
| `getOpLog(params?)` | `Promise<IOpLogResult>` | Query oplog entries with optional filters |
| `getOpLogStats()` | `Promise<IOpLogStats>` | Aggregate oplog statistics |
| `revertToSeq(seq, dryRun?)` | `Promise<IRevertResult>` | Revert to a specific oplog sequence |
| `getCollections(db?)` | `Promise<ICollectionInfo[]>` | List all collections with counts |
| `getDocuments(db, coll, limit?, skip?)` | `Promise<IDocumentsResult>` | Browse documents with pagination |
### LocalSmartDb
@@ -155,24 +290,45 @@ const db = new LocalSmartDb({
| `start()` | `Promise<ILocalSmartDbConnectionInfo>` | Start and return connection info |
| `stop()` | `Promise<void>` | Stop the server |
| `getConnectionInfo()` | `ILocalSmartDbConnectionInfo` | Get current connection info |
| `getConnectionUri()` | `string` | Get the MongoDB URI |
| `getConnectionUri()` | `string` | Get the connection URI |
| `getServer()` | `SmartdbServer` | Access the underlying server |
| `running` | `boolean` | Whether the server is running |
#### Connection Info (`ILocalSmartDbConnectionInfo`)
### SmartdbDebugServer
Web-based debug dashboard served via `@api.global/typedserver`. Import from the `debugserver` subpath:
```typescript
interface ILocalSmartDbConnectionInfo {
socketPath: string; // e.g., /tmp/smartdb-abc123.sock
connectionUri: string; // e.g., mongodb://%2Ftmp%2Fsmartdb-abc123.sock
}
import { SmartdbDebugServer } from '@push.rocks/smartdb/debugserver';
const debugServer = new SmartdbDebugServer(server, { port: 4000 });
await debugServer.start();
// Dashboard at http://localhost:4000
await debugServer.stop();
```
The UI is bundled as base64-encoded content (via `@git.zone/tsbundle`) and served from memory — no static file directory needed.
### SmartdbDebugUi (Web Component)
For embedding the debug UI directly into your own web application, import the `<smartdb-debugui>` web component:
```typescript
import { SmartdbDebugUi } from '@push.rocks/smartdb/debugui';
// In your HTML/lit template:
// <smartdb-debugui .server=${mySmartdbServer}></smartdb-debugui>
//
// Or in HTTP mode (when served by SmartdbDebugServer):
// <smartdb-debugui apiBaseUrl=""></smartdb-debugui>
```
---
## Supported MongoDB Operations
## Supported Operations
SmartDB supports the core MongoDB operations through the wire protocol. Use the standard `mongodb` driver — these all work:
SmartDB supports the core operations through the wire protocol. Use the standard `mongodb` driver — these all work:
### CRUD
@@ -258,7 +414,7 @@ const results = await collection.aggregate([
]).toArray();
```
**Supported stages:** `$match`, `$project`, `$group`, `$sort`, `$limit`, `$skip`, `$unwind`, `$lookup`, `$addFields`, `$count`, `$facet`, `$replaceRoot`, `$set`, `$unset`
**Supported stages:** `$match`, `$project`, `$group`, `$sort`, `$limit`, `$skip`, `$unwind`, `$lookup`, `$addFields`, `$count`, `$facet`, `$replaceRoot`, `$set`, `$unionWith`, `$out`, `$merge`
**Group accumulators:** `$sum`, `$avg`, `$min`, `$max`, `$first`, `$last`, `$push`, `$addToSet`, `$count`
@@ -316,148 +472,34 @@ const names = await collection.distinct('name');
| **CRUD** | `find`, `insert`, `update`, `delete`, `findAndModify`, `getMore`, `killCursors` |
| **Aggregation** | `aggregate`, `count`, `distinct` |
| **Indexes** | `createIndexes`, `dropIndexes`, `listIndexes` |
| **Transactions** | `startTransaction`, `commitTransaction`, `abortTransaction` |
| **Sessions** | `startSession`, `endSessions`, `refreshSessions` |
| **Admin** | `ping`, `listDatabases`, `listCollections`, `drop`, `dropDatabase`, `create`, `serverStatus`, `buildInfo`, `dbStats`, `collStats`, `connectionStatus`, `currentOp`, `collMod`, `renameCollection` |
| **Sessions** | `startSession`, `endSessions` |
| **Transactions** | `commitTransaction`, `abortTransaction` |
| **Admin** | `ping`, `listDatabases`, `listCollections`, `drop`, `dropDatabase`, `create`, `serverStatus`, `buildInfo`, `dbStats`, `collStats`, `connectionStatus`, `currentOp`, `renameCollection` |
Compatible with MongoDB wire protocol versions 021 (MongoDB 3.6 through 7.0 drivers).
Compatible with wire protocol versions 021 (driver versions 3.6 through 7.0).
---
## Architecture
## Rust Crate Architecture 🦀
```
┌─────────────────────────────────────────────────────────────┐
│ Official MongoDB Driver │
│ (mongodb npm) │
└─────────────────────────┬───────────────────────────────────┘
│ TCP / Unix Socket + OP_MSG / BSON
┌─────────────────────────────────────────────────────────────┐
│ SmartdbServer │
│ ┌──────────────┐ ┌──────────────┐ ┌──────────────────┐ │
│ │ WireProtocol │→ │CommandRouter │→ │ Handlers │ │
│ │ (OP_MSG) │ │ │ │ (Find, Insert..) │ │
│ └──────────────┘ └──────────────┘ └──────────────────┘ │
└─────────────────────────┬───────────────────────────────────┘
┌─────────────────────────────────────────────────────────────┐
│ Engines │
│ ┌─────────┐ ┌────────┐ ┌───────────┐ ┌───────┐ ┌───────┐ │
│ │ Query │ │ Update │ │Aggregation│ │ Index │ │Session│ │
│ │ Planner │ │ Engine │ │ Engine │ │Engine │ │Engine │ │
│ └─────────┘ └────────┘ └───────────┘ └───────┘ └───────┘ │
│ ┌──────────────────────┐ │
│ │ Transaction Engine │ │
│ └──────────────────────┘ │
└─────────────────────────┬───────────────────────────────────┘
┌─────────────────────────────────────────────────────────────┐
│ Storage Layer │
│ ┌──────────────────┐ ┌──────────────────┐ ┌──────────┐ │
│ │ MemoryStorage │ │ FileStorage │ │ WAL │ │
│ │ │ │ (+ Checksums) │ │ │ │
│ └──────────────────┘ └──────────────────┘ └──────────┘ │
└─────────────────────────────────────────────────────────────┘
```
The Rust engine is organized as a Cargo workspace with 8 focused crates:
### Key Components
| Component | What It Does |
| Crate | Purpose |
|---|---|
| **WireProtocol** | Parses/encodes MongoDB OP_MSG binary frames |
| **CommandRouter** | Routes parsed commands to the right handler |
| **QueryPlanner** | Picks COLLSCAN vs IXSCAN based on available indexes |
| **QueryEngine** | Filter matching powered by [mingo](https://github.com/kofrasa/mingo) |
| **UpdateEngine** | Processes `$set`, `$inc`, `$push`, and all update operators |
| **AggregationEngine** | Runs aggregation pipelines via mingo |
| **IndexEngine** | B-tree (range) and hash (equality) indexes |
| **TransactionEngine** | ACID transactions with snapshot isolation |
| **SessionEngine** | Client session tracking with automatic timeouts |
| **WAL** | Write-ahead logging with CRC32 checksums for crash recovery |
| `rustdb` | Binary entry point: TCP/Unix listener, management IPC, CLI |
| `rustdb-config` | Server configuration types (serde, camelCase JSON) |
| `rustdb-wire` | Wire protocol parser/encoder (OP_MSG, OP_QUERY, OP_REPLY) |
| `rustdb-query` | Query matcher, update engine, aggregation, sort, projection |
| `rustdb-storage` | Storage backends (memory, file), OpLog with point-in-time replay |
| `rustdb-index` | B-tree/hash indexes, query planner (IXSCAN/COLLSCAN) |
| `rustdb-txn` | Transaction + session management with snapshot isolation |
| `rustdb-commands` | 40+ command handlers wiring everything together |
Cross-compiled for `linux_amd64` and `linux_arm64` via [@git.zone/tsrust](https://www.npmjs.com/package/@git.zone/tsrust).
---
## Advanced Usage
### Storage Adapters
```typescript
import { SmartdbServer } from '@push.rocks/smartdb';
// In-memory (default) — fast, data lost on stop
const server = new SmartdbServer({ storage: 'memory' });
// In-memory with periodic persistence
const server = new SmartdbServer({
storage: 'memory',
persistPath: './data/snapshot.json',
persistIntervalMs: 30000,
});
// File-based — persistent storage with CRC32 checksums
const server = new SmartdbServer({
storage: 'file',
storagePath: './data/smartdb',
});
```
### Query Planner (Debugging)
```typescript
import { QueryPlanner, IndexEngine, MemoryStorageAdapter } from '@push.rocks/smartdb';
const storage = new MemoryStorageAdapter();
await storage.initialize();
const indexEngine = new IndexEngine('mydb', 'mycoll', storage);
const planner = new QueryPlanner(indexEngine);
const plan = await planner.plan({ age: { $gte: 18 } });
console.log(plan);
// { type: 'IXSCAN_RANGE', indexName: 'age_1', selectivity: 0.3, usesRange: true, ... }
const explain = await planner.explain({ age: 18 });
// Returns winning plan, rejected plans, and detailed analysis
```
### Data Integrity Checksums
```typescript
import { calculateDocumentChecksum, addChecksum, verifyChecksum, removeChecksum } from '@push.rocks/smartdb';
const doc = { name: 'Alice', age: 30 };
const protected = addChecksum(doc); // Adds _checksum field
const valid = verifyChecksum(protected); // true
protected.age = 31; // Tamper!
const still = verifyChecksum(protected); // false
const clean = removeChecksum(protected); // Removes _checksum
```
### Write-Ahead Logging
```typescript
import { WAL } from '@push.rocks/smartdb';
const wal = new WAL('./data/wal.log', { checkpointInterval: 100 });
await wal.initialize();
// Entries include: LSN, timestamp, operation, BSON data, CRC32 checksum
const lsn = await wal.logInsert('mydb', 'users', doc);
const entries = wal.getEntriesAfter(lastCheckpoint);
const recovered = wal.recoverDocument(entry);
await wal.checkpoint();
await wal.close();
```
---
## Testing Examples
### Unit Tests with @git.zone/tstest
## Testing Example
```typescript
import { expect, tap } from '@git.zone/tstest/tapbundle';
@@ -481,6 +523,12 @@ tap.test('should insert and find', async () => {
expect(item?.price).toEqual(9.99);
});
tap.test('should track changes in oplog', async () => {
const oplog = await server.getOpLog();
expect(oplog.entries.length).toBeGreaterThan(0);
expect(oplog.entries[0].op).toEqual('insert');
});
tap.test('teardown', async () => {
await client.close();
await server.stop();
@@ -489,23 +537,7 @@ tap.test('teardown', async () => {
export default tap.start();
```
### With LocalSmartDb (Persistent Tests)
```typescript
import { LocalSmartDb } from '@push.rocks/smartdb';
import { MongoClient } from 'mongodb';
const db = new LocalSmartDb({ folderPath: './test-data' });
const { connectionUri } = await db.start();
const client = new MongoClient(connectionUri, { directConnection: true });
await client.connect();
// Tests here — data persists between test runs!
await client.close();
await db.stop();
```
---
## License and Legal Information
+2
View File
@@ -0,0 +1,2 @@
[target.aarch64-unknown-linux-gnu]
linker = "aarch64-linux-gnu-gcc"
+1462
View File
File diff suppressed because it is too large Load Diff
+79
View File
@@ -0,0 +1,79 @@
[workspace]
resolver = "2"
members = [
"crates/rustdb",
"crates/rustdb-config",
"crates/rustdb-wire",
"crates/rustdb-query",
"crates/rustdb-storage",
"crates/rustdb-index",
"crates/rustdb-txn",
"crates/rustdb-commands",
]
[workspace.package]
version = "0.1.0"
edition = "2021"
license = "MIT"
authors = ["Lossless GmbH <hello@lossless.com>"]
[workspace.dependencies]
# Async runtime
tokio = { version = "1", features = ["full"] }
# Serialization
serde = { version = "1", features = ["derive"] }
serde_json = "1"
# BSON serialization (bson crate)
bson = "2"
# Binary buffer manipulation
bytes = "1"
# CLI
clap = { version = "4", features = ["derive"] }
# Structured logging
tracing = "0.1"
tracing-subscriber = { version = "0.3", features = ["env-filter"] }
# Error handling
thiserror = "2"
anyhow = "1"
# Lock-free atomics
arc-swap = "1"
# Concurrent maps
dashmap = "6"
# Cancellation / utility
tokio-util = { version = "0.7", features = ["codec"] }
# mimalloc allocator
mimalloc = "0.1"
# CRC32 checksums
crc32fast = "1"
# Regex for $regex operator
regex = "1"
# UUID for sessions
uuid = { version = "1", features = ["v4", "serde"] }
# Async traits
async-trait = "0.1"
# Test utilities
tempfile = "3"
# Internal crates
rustdb-config = { path = "crates/rustdb-config" }
rustdb-wire = { path = "crates/rustdb-wire" }
rustdb-query = { path = "crates/rustdb-query" }
rustdb-storage = { path = "crates/rustdb-storage" }
rustdb-index = { path = "crates/rustdb-index" }
rustdb-txn = { path = "crates/rustdb-txn" }
rustdb-commands = { path = "crates/rustdb-commands" }
+24
View File
@@ -0,0 +1,24 @@
[package]
name = "rustdb-commands"
version.workspace = true
edition.workspace = true
license.workspace = true
authors.workspace = true
description = "MongoDB-compatible command routing and handlers for RustDb"
[dependencies]
bson = { workspace = true }
serde = { workspace = true }
serde_json = { workspace = true }
dashmap = { workspace = true }
tokio = { workspace = true }
thiserror = { workspace = true }
tracing = { workspace = true }
uuid = { workspace = true }
async-trait = { workspace = true }
rustdb-config = { workspace = true }
rustdb-wire = { workspace = true }
rustdb-query = { workspace = true }
rustdb-storage = { workspace = true }
rustdb-index = { workspace = true }
rustdb-txn = { workspace = true }
@@ -0,0 +1,98 @@
use std::sync::Arc;
use bson::{Bson, Document};
use dashmap::DashMap;
use rustdb_index::{IndexEngine, IndexOptions};
use rustdb_storage::{OpLog, StorageAdapter};
use rustdb_txn::{SessionEngine, TransactionEngine};
/// Shared command execution context, passed to all handlers.
pub struct CommandContext {
/// The storage backend.
pub storage: Arc<dyn StorageAdapter>,
/// Index engines per namespace: "db.collection" -> IndexEngine.
pub indexes: Arc<DashMap<String, IndexEngine>>,
/// Transaction engine for multi-document transactions.
pub transactions: Arc<TransactionEngine>,
/// Session engine for logical sessions.
pub sessions: Arc<SessionEngine>,
/// Active cursors for getMore / killCursors.
pub cursors: Arc<DashMap<i64, CursorState>>,
/// Server start time (for uptime reporting).
pub start_time: std::time::Instant,
/// Operation log for point-in-time replay.
pub oplog: Arc<OpLog>,
}
impl CommandContext {
/// Get or lazily initialize an IndexEngine for a namespace.
///
/// If no IndexEngine exists yet for this namespace, loads persisted index
/// specs from `indexes.json` via the storage adapter, creates the engine
/// with those specs, and rebuilds index data from existing documents.
/// This ensures unique indexes are enforced even on the very first write
/// after a restart.
pub async fn get_or_init_index_engine(&self, db: &str, coll: &str) -> dashmap::mapref::one::RefMut<'_, String, IndexEngine> {
let ns_key = format!("{}.{}", db, coll);
// Fast path: engine already exists.
if self.indexes.contains_key(&ns_key) {
return self.indexes.entry(ns_key).or_insert_with(IndexEngine::new);
}
// Slow path: load from persisted specs.
let mut engine = IndexEngine::new();
let mut has_custom = false;
if let Ok(specs) = self.storage.get_indexes(db, coll).await {
for spec in &specs {
let name = spec.get_str("name").unwrap_or("").to_string();
if name == "_id_" || name.is_empty() {
continue;
}
let key = match spec.get("key") {
Some(Bson::Document(k)) => k.clone(),
_ => continue,
};
let unique = matches!(spec.get("unique"), Some(Bson::Boolean(true)));
let sparse = matches!(spec.get("sparse"), Some(Bson::Boolean(true)));
let expire_after_seconds = match spec.get("expireAfterSeconds") {
Some(Bson::Int32(n)) => Some(*n as u64),
Some(Bson::Int64(n)) => Some(*n as u64),
_ => None,
};
let options = IndexOptions {
name: Some(name),
unique,
sparse,
expire_after_seconds,
};
let _ = engine.create_index(key, options);
has_custom = true;
}
}
if has_custom {
// Rebuild index data from existing documents.
if let Ok(docs) = self.storage.find_all(db, coll).await {
if !docs.is_empty() {
engine.rebuild_from_documents(&docs);
}
}
}
self.indexes.entry(ns_key).or_insert(engine)
}
}
/// State of an open cursor from a find or aggregate command.
pub struct CursorState {
/// Documents remaining to be returned.
pub documents: Vec<Document>,
/// Current read position within `documents`.
pub position: usize,
/// Database the cursor belongs to.
pub database: String,
/// Collection the cursor belongs to.
pub collection: String,
}
+76
View File
@@ -0,0 +1,76 @@
use thiserror::Error;
/// Errors that can occur during command processing.
#[derive(Debug, Error)]
pub enum CommandError {
#[error("command not implemented: {0}")]
NotImplemented(String),
#[error("invalid argument: {0}")]
InvalidArgument(String),
#[error("storage error: {0}")]
StorageError(String),
#[error("index error: {0}")]
IndexError(String),
#[error("transaction error: {0}")]
TransactionError(String),
#[error("namespace not found: {0}")]
NamespaceNotFound(String),
#[error("namespace already exists: {0}")]
NamespaceExists(String),
#[error("duplicate key: {0}")]
DuplicateKey(String),
#[error("internal error: {0}")]
InternalError(String),
}
impl CommandError {
/// Convert a CommandError to a BSON error response document.
pub fn to_error_doc(&self) -> bson::Document {
let (code, code_name) = match self {
CommandError::NotImplemented(_) => (59, "CommandNotFound"),
CommandError::InvalidArgument(_) => (14, "TypeMismatch"),
CommandError::StorageError(_) => (1, "InternalError"),
CommandError::IndexError(_) => (27, "IndexNotFound"),
CommandError::TransactionError(_) => (112, "WriteConflict"),
CommandError::NamespaceNotFound(_) => (26, "NamespaceNotFound"),
CommandError::NamespaceExists(_) => (48, "NamespaceExists"),
CommandError::DuplicateKey(_) => (11000, "DuplicateKey"),
CommandError::InternalError(_) => (1, "InternalError"),
};
bson::doc! {
"ok": 0,
"errmsg": self.to_string(),
"code": code,
"codeName": code_name,
}
}
}
impl From<rustdb_storage::StorageError> for CommandError {
fn from(e: rustdb_storage::StorageError) -> Self {
CommandError::StorageError(e.to_string())
}
}
impl From<rustdb_txn::TransactionError> for CommandError {
fn from(e: rustdb_txn::TransactionError) -> Self {
CommandError::TransactionError(e.to_string())
}
}
impl From<rustdb_index::IndexError> for CommandError {
fn from(e: rustdb_index::IndexError) -> Self {
CommandError::IndexError(e.to_string())
}
}
pub type CommandResult<T> = Result<T, CommandError>;
@@ -0,0 +1,653 @@
use bson::{doc, Bson, Document};
use rustdb_index::IndexEngine;
use tracing::debug;
use crate::context::{CommandContext, CursorState};
use crate::error::{CommandError, CommandResult};
/// Handle various admin / diagnostic / session / auth commands.
pub async fn handle(
cmd: &Document,
db: &str,
ctx: &CommandContext,
command_name: &str,
) -> CommandResult<Document> {
match command_name {
"ping" => Ok(doc! { "ok": 1.0 }),
"buildInfo" | "buildinfo" => Ok(doc! {
"version": "7.0.0",
"gitVersion": "unknown",
"modules": [],
"sysInfo": "rustdb",
"versionArray": [7_i32, 0_i32, 0_i32, 0_i32],
"ok": 1.0,
}),
"serverStatus" => Ok(doc! {
"host": "localhost",
"version": "7.0.0",
"process": "rustdb",
"uptime": ctx.start_time.elapsed().as_secs() as i64,
"ok": 1.0,
}),
"hostInfo" => Ok(doc! {
"system": {
"hostname": "localhost",
},
"ok": 1.0,
}),
"whatsmyuri" => Ok(doc! {
"you": "127.0.0.1:0",
"ok": 1.0,
}),
"getLog" => {
let _log_type = cmd.get_str("getLog").unwrap_or("global");
Ok(doc! {
"totalLinesWritten": 0_i32,
"log": [],
"ok": 1.0,
})
}
"replSetGetStatus" => {
// Not a replica set.
Ok(doc! {
"ok": 0.0,
"errmsg": "not running with --replSet",
"code": 76_i32,
"codeName": "NoReplicationEnabled",
})
}
"getCmdLineOpts" => Ok(doc! {
"argv": ["rustdb"],
"parsed": {},
"ok": 1.0,
}),
"getParameter" => Ok(doc! {
"ok": 1.0,
}),
"getFreeMonitoringStatus" | "setFreeMonitoring" => Ok(doc! {
"state": "disabled",
"ok": 1.0,
}),
"getShardMap" | "shardingState" => Ok(doc! {
"enabled": false,
"ok": 1.0,
}),
"atlasVersion" => Ok(doc! {
"ok": 0.0,
"errmsg": "not supported",
"code": 59_i32,
"codeName": "CommandNotFound",
}),
"connectionStatus" => Ok(doc! {
"authInfo": {
"authenticatedUsers": [],
"authenticatedUserRoles": [],
},
"ok": 1.0,
}),
"listDatabases" => handle_list_databases(cmd, ctx).await,
"listCollections" => handle_list_collections(cmd, db, ctx).await,
"create" => handle_create(cmd, db, ctx).await,
"drop" => handle_drop(cmd, db, ctx).await,
"dropDatabase" => handle_drop_database(db, ctx).await,
"renameCollection" => handle_rename_collection(cmd, ctx).await,
"collStats" | "validate" => handle_coll_stats(cmd, db, ctx, command_name).await,
"dbStats" => handle_db_stats(db, ctx).await,
"explain" => Ok(doc! {
"queryPlanner": {},
"ok": 1.0,
}),
"startSession" => {
let session_id = uuid::Uuid::new_v4().to_string();
ctx.sessions.get_or_create_session(&session_id);
Ok(doc! {
"id": { "id": &session_id },
"timeoutMinutes": 30_i32,
"ok": 1.0,
})
}
"endSessions" | "killSessions" => {
// Attempt to end listed sessions.
if let Ok(sessions) = cmd
.get_array("endSessions")
.or_else(|_| cmd.get_array("killSessions"))
{
for s in sessions {
if let Some(sid) = rustdb_txn::SessionEngine::extract_session_id(s) {
ctx.sessions.end_session(&sid);
}
}
}
Ok(doc! { "ok": 1.0 })
}
"commitTransaction" => {
// Stub: acknowledge.
Ok(doc! { "ok": 1.0 })
}
"abortTransaction" => {
// Stub: acknowledge.
Ok(doc! { "ok": 1.0 })
}
// Auth stubs - accept silently.
"saslStart" => Ok(doc! {
"conversationId": 1_i32,
"done": true,
"payload": bson::Binary { subtype: bson::spec::BinarySubtype::Generic, bytes: vec![] },
"ok": 1.0,
}),
"saslContinue" => Ok(doc! {
"conversationId": 1_i32,
"done": true,
"payload": bson::Binary { subtype: bson::spec::BinarySubtype::Generic, bytes: vec![] },
"ok": 1.0,
}),
"authenticate" | "logout" => Ok(doc! { "ok": 1.0 }),
"currentOp" => Ok(doc! {
"inprog": [],
"ok": 1.0,
}),
"killOp" | "top" | "profile" | "compact" | "reIndex"
| "fsync" | "connPoolSync" => Ok(doc! { "ok": 1.0 }),
other => {
// Catch-all for any admin command we missed.
Ok(doc! {
"ok": 1.0,
"note": format!("stub response for command: {}", other),
})
}
}
}
/// Handle `listDatabases` command.
async fn handle_list_databases(
cmd: &Document,
ctx: &CommandContext,
) -> CommandResult<Document> {
let dbs = ctx.storage.list_databases().await?;
let name_only = match cmd.get("nameOnly") {
Some(Bson::Boolean(true)) => true,
_ => false,
};
let filter = match cmd.get("filter") {
Some(Bson::Document(d)) => Some(d.clone()),
_ => None,
};
let mut db_docs: Vec<Bson> = Vec::new();
let mut total_size: i64 = 0;
for db_name in &dbs {
let mut db_info = doc! { "name": db_name.as_str() };
if !name_only {
// Estimate size by counting documents across collections.
let mut db_size: i64 = 0;
if let Ok(collections) = ctx.storage.list_collections(db_name).await {
for coll in &collections {
if let Ok(count) = ctx.storage.count(db_name, coll).await {
// Rough estimate: 200 bytes per document.
db_size += count as i64 * 200;
}
}
}
db_info.insert("sizeOnDisk", db_size);
db_info.insert("empty", db_size == 0);
total_size += db_size;
}
// Apply filter if specified.
if let Some(ref f) = filter {
if !rustdb_query::QueryMatcher::matches(&db_info, f) {
continue;
}
}
db_docs.push(Bson::Document(db_info));
}
let mut response = doc! {
"databases": db_docs,
"ok": 1.0,
};
if !name_only {
response.insert("totalSize", total_size);
}
Ok(response)
}
/// Handle `listCollections` command.
async fn handle_list_collections(
cmd: &Document,
db: &str,
ctx: &CommandContext,
) -> CommandResult<Document> {
let collections = ctx.storage.list_collections(db).await?;
let filter = match cmd.get("filter") {
Some(Bson::Document(d)) => Some(d.clone()),
_ => None,
};
let name_only = match cmd.get("nameOnly") {
Some(Bson::Boolean(true)) => true,
_ => false,
};
let batch_size = cmd
.get_document("cursor")
.ok()
.and_then(|c| {
c.get_i32("batchSize")
.ok()
.map(|v| v as usize)
.or_else(|| c.get_i64("batchSize").ok().map(|v| v as usize))
})
.unwrap_or(usize::MAX);
let ns = format!("{}.$cmd.listCollections", db);
let mut coll_docs: Vec<Document> = Vec::new();
for coll_name in &collections {
let info_doc = if name_only {
doc! {
"name": coll_name.as_str(),
"type": "collection",
}
} else {
doc! {
"name": coll_name.as_str(),
"type": "collection",
"options": {},
"info": {
"readOnly": false,
},
"idIndex": {
"v": 2_i32,
"key": { "_id": 1_i32 },
"name": "_id_",
},
}
};
// Apply filter if specified.
if let Some(ref f) = filter {
if !rustdb_query::QueryMatcher::matches(&info_doc, f) {
continue;
}
}
coll_docs.push(info_doc);
}
if coll_docs.len() <= batch_size {
let first_batch: Vec<Bson> = coll_docs.into_iter().map(Bson::Document).collect();
Ok(doc! {
"cursor": {
"id": 0_i64,
"ns": &ns,
"firstBatch": first_batch,
},
"ok": 1.0,
})
} else {
let first_batch: Vec<Bson> = coll_docs[..batch_size]
.iter()
.cloned()
.map(Bson::Document)
.collect();
let remaining: Vec<Document> = coll_docs[batch_size..].to_vec();
let cursor_id = generate_cursor_id();
ctx.cursors.insert(
cursor_id,
CursorState {
documents: remaining,
position: 0,
database: db.to_string(),
collection: String::new(),
},
);
Ok(doc! {
"cursor": {
"id": cursor_id,
"ns": &ns,
"firstBatch": first_batch,
},
"ok": 1.0,
})
}
}
/// Handle `create` command.
async fn handle_create(
cmd: &Document,
db: &str,
ctx: &CommandContext,
) -> CommandResult<Document> {
let coll = cmd
.get_str("create")
.map_err(|_| CommandError::InvalidArgument("missing 'create' field".into()))?;
debug!(db = db, collection = coll, "create command");
// Create database (ignore AlreadyExists).
if let Err(e) = ctx.storage.create_database(db).await {
let msg = e.to_string();
if !msg.contains("AlreadyExists") && !msg.contains("already exists") {
return Err(CommandError::StorageError(msg));
}
}
// Create collection.
if let Err(e) = ctx.storage.create_collection(db, coll).await {
let msg = e.to_string();
if msg.contains("AlreadyExists") || msg.contains("already exists") {
return Err(CommandError::NamespaceExists(format!("{}.{}", db, coll)));
}
return Err(CommandError::StorageError(msg));
}
// Initialize index engine for the new collection.
let ns_key = format!("{}.{}", db, coll);
ctx.indexes
.entry(ns_key)
.or_insert_with(IndexEngine::new);
Ok(doc! { "ok": 1.0 })
}
/// Handle `drop` command.
async fn handle_drop(
cmd: &Document,
db: &str,
ctx: &CommandContext,
) -> CommandResult<Document> {
let coll = cmd
.get_str("drop")
.map_err(|_| CommandError::InvalidArgument("missing 'drop' field".into()))?;
let ns_key = format!("{}.{}", db, coll);
debug!(db = db, collection = coll, "drop command");
// Check if collection exists.
match ctx.storage.collection_exists(db, coll).await {
Ok(false) => {
return Err(CommandError::NamespaceNotFound(format!(
"ns not found: {}",
ns_key
)));
}
Err(_) => {}
_ => {}
}
// Drop from storage.
ctx.storage.drop_collection(db, coll).await?;
// Remove from indexes.
ctx.indexes.remove(&ns_key);
// Count of indexes that were on this collection (at least _id_).
Ok(doc! {
"ns": &ns_key,
"nIndexesWas": 1_i32,
"ok": 1.0,
})
}
/// Handle `dropDatabase` command.
async fn handle_drop_database(
db: &str,
ctx: &CommandContext,
) -> CommandResult<Document> {
debug!(db = db, "dropDatabase command");
// Remove all index entries for this database.
let prefix = format!("{}.", db);
let keys_to_remove: Vec<String> = ctx
.indexes
.iter()
.filter(|entry| entry.key().starts_with(&prefix))
.map(|entry| entry.key().clone())
.collect();
for key in keys_to_remove {
ctx.indexes.remove(&key);
}
// Drop from storage.
ctx.storage.drop_database(db).await?;
Ok(doc! {
"dropped": db,
"ok": 1.0,
})
}
/// Handle `renameCollection` command.
async fn handle_rename_collection(
cmd: &Document,
ctx: &CommandContext,
) -> CommandResult<Document> {
let source_ns = cmd
.get_str("renameCollection")
.map_err(|_| CommandError::InvalidArgument("missing 'renameCollection' field".into()))?;
let target_ns = cmd
.get_str("to")
.map_err(|_| CommandError::InvalidArgument("missing 'to' field".into()))?;
let drop_target = match cmd.get("dropTarget") {
Some(Bson::Boolean(b)) => *b,
_ => false,
};
// Parse "db.collection" format.
let (source_db, source_coll) = parse_namespace(source_ns)?;
let (target_db, target_coll) = parse_namespace(target_ns)?;
debug!(
source = source_ns,
target = target_ns,
drop_target = drop_target,
"renameCollection command"
);
// If cross-database rename, that's more complex. For now, support same-db rename.
if source_db != target_db {
return Err(CommandError::InvalidArgument(
"cross-database renameCollection not yet supported".into(),
));
}
// If dropTarget, drop the target collection first.
if drop_target {
let _ = ctx.storage.drop_collection(target_db, target_coll).await;
let target_ns_key = format!("{}.{}", target_db, target_coll);
ctx.indexes.remove(&target_ns_key);
} else {
// Check if target already exists.
if let Ok(true) = ctx.storage.collection_exists(target_db, target_coll).await {
return Err(CommandError::NamespaceExists(target_ns.to_string()));
}
}
// Rename in storage.
ctx.storage
.rename_collection(source_db, source_coll, target_coll)
.await?;
// Update index engine: move from old namespace to new.
let source_ns_key = format!("{}.{}", source_db, source_coll);
let target_ns_key = format!("{}.{}", target_db, target_coll);
if let Some((_, engine)) = ctx.indexes.remove(&source_ns_key) {
ctx.indexes.insert(target_ns_key, engine);
}
Ok(doc! { "ok": 1.0 })
}
/// Handle `collStats` command.
async fn handle_coll_stats(
cmd: &Document,
db: &str,
ctx: &CommandContext,
command_name: &str,
) -> CommandResult<Document> {
let coll = cmd
.get_str(command_name)
.unwrap_or("unknown");
let ns = format!("{}.{}", db, coll);
let count = ctx
.storage
.count(db, coll)
.await
.unwrap_or(0);
let n_indexes = match ctx.indexes.get(&ns) {
Some(engine) => engine.list_indexes().len() as i32,
None => 1_i32,
};
// Rough size estimate.
let data_size = count as i64 * 200;
Ok(doc! {
"ns": &ns,
"count": count as i64,
"size": data_size,
"avgObjSize": if count > 0 { 200_i64 } else { 0_i64 },
"storageSize": data_size,
"nindexes": n_indexes,
"totalIndexSize": 0_i64,
"ok": 1.0,
})
}
/// Handle `dbStats` command.
async fn handle_db_stats(
db: &str,
ctx: &CommandContext,
) -> CommandResult<Document> {
let collections = ctx
.storage
.list_collections(db)
.await
.unwrap_or_default();
let num_collections = collections.len() as i32;
let mut total_objects: i64 = 0;
let mut total_indexes: i32 = 0;
for coll in &collections {
if let Ok(count) = ctx.storage.count(db, coll).await {
total_objects += count as i64;
}
let ns_key = format!("{}.{}", db, coll);
if let Some(engine) = ctx.indexes.get(&ns_key) {
total_indexes += engine.list_indexes().len() as i32;
} else {
total_indexes += 1; // At least _id_.
}
}
let data_size = total_objects * 200;
Ok(doc! {
"db": db,
"collections": num_collections,
"objects": total_objects,
"avgObjSize": if total_objects > 0 { 200_i64 } else { 0_i64 },
"dataSize": data_size,
"storageSize": data_size,
"indexes": total_indexes,
"indexSize": 0_i64,
"ok": 1.0,
})
}
/// Parse a namespace string "db.collection" into (db, collection).
fn parse_namespace(ns: &str) -> CommandResult<(&str, &str)> {
let dot_pos = ns.find('.').ok_or_else(|| {
CommandError::InvalidArgument(format!(
"invalid namespace '{}': expected 'db.collection' format",
ns
))
})?;
let db = &ns[..dot_pos];
let coll = &ns[dot_pos + 1..];
if db.is_empty() || coll.is_empty() {
return Err(CommandError::InvalidArgument(format!(
"invalid namespace '{}': db and collection must not be empty",
ns
)));
}
Ok((db, coll))
}
/// Generate a pseudo-random cursor ID.
fn generate_cursor_id() -> i64 {
use std::collections::hash_map::RandomState;
use std::hash::{BuildHasher, Hasher};
let s = RandomState::new();
let mut hasher = s.build_hasher();
hasher.write_u64(
std::time::SystemTime::now()
.duration_since(std::time::UNIX_EPOCH)
.unwrap_or_default()
.as_nanos() as u64,
);
let id = hasher.finish() as i64;
if id == 0 {
1
} else {
id.abs()
}
}
@@ -0,0 +1,310 @@
use bson::{doc, Bson, Document};
use rustdb_query::AggregationEngine;
use rustdb_query::error::QueryError;
use tracing::debug;
use crate::context::{CommandContext, CursorState};
use crate::error::{CommandError, CommandResult};
/// A CollectionResolver that reads from the storage adapter.
struct StorageResolver<'a> {
storage: &'a dyn rustdb_storage::StorageAdapter,
/// We use a tokio runtime handle to call async methods synchronously,
/// since the CollectionResolver trait is synchronous.
handle: tokio::runtime::Handle,
}
impl<'a> rustdb_query::aggregation::CollectionResolver for StorageResolver<'a> {
fn resolve(&self, db: &str, coll: &str) -> Result<Vec<Document>, QueryError> {
self.handle
.block_on(async { self.storage.find_all(db, coll).await })
.map_err(|e| QueryError::AggregationError(format!("Failed to resolve {}.{}: {}", db, coll, e)))
}
}
/// Handle the `aggregate` command.
pub async fn handle(
cmd: &Document,
db: &str,
ctx: &CommandContext,
) -> CommandResult<Document> {
// The aggregate field can be a string (collection name) or integer 1 (db-level).
let (coll, is_db_level) = match cmd.get("aggregate") {
Some(Bson::String(s)) => (s.as_str().to_string(), false),
Some(Bson::Int32(1)) => (String::new(), true),
Some(Bson::Int64(1)) => (String::new(), true),
_ => {
return Err(CommandError::InvalidArgument(
"missing or invalid 'aggregate' field".into(),
));
}
};
let pipeline_bson = cmd
.get_array("pipeline")
.map_err(|_| CommandError::InvalidArgument("missing 'pipeline' array".into()))?;
// Convert pipeline to Vec<Document>.
let mut pipeline: Vec<Document> = Vec::with_capacity(pipeline_bson.len());
for stage in pipeline_bson {
match stage {
Bson::Document(d) => pipeline.push(d.clone()),
_ => {
return Err(CommandError::InvalidArgument(
"pipeline stage must be a document".into(),
));
}
}
}
// Check for $out and $merge as the last stage (handle after pipeline execution).
let out_stage = if let Some(last) = pipeline.last() {
if last.contains_key("$out") || last.contains_key("$merge") {
Some(pipeline.pop().unwrap())
} else {
None
}
} else {
None
};
let batch_size = cmd
.get_document("cursor")
.ok()
.and_then(|c| {
c.get_i32("batchSize")
.ok()
.map(|v| v as usize)
.or_else(|| c.get_i64("batchSize").ok().map(|v| v as usize))
})
.unwrap_or(101);
debug!(
db = db,
collection = %coll,
stages = pipeline.len(),
"aggregate command"
);
// Load source documents.
let source_docs = if is_db_level {
// Database-level aggregate: start with empty set (useful for $currentOp, etc.)
Vec::new()
} else {
ctx.storage.find_all(db, &coll).await?
};
// Create a resolver for $lookup and similar stages.
let handle = tokio::runtime::Handle::current();
let resolver = StorageResolver {
storage: ctx.storage.as_ref(),
handle,
};
// Run the aggregation pipeline.
let result_docs = AggregationEngine::aggregate(
source_docs,
&pipeline,
Some(&resolver),
db,
)
.map_err(|e| CommandError::InternalError(e.to_string()))?;
// Handle $out stage: write results to target collection.
if let Some(out) = out_stage {
if let Some(out_spec) = out.get("$out") {
handle_out_stage(db, out_spec, &result_docs, ctx).await?;
} else if let Some(merge_spec) = out.get("$merge") {
handle_merge_stage(db, merge_spec, &result_docs, ctx).await?;
}
}
// Build cursor response.
let ns = if is_db_level {
format!("{}.$cmd.aggregate", db)
} else {
format!("{}.{}", db, coll)
};
if result_docs.len() <= batch_size {
// All results fit in first batch.
let first_batch: Vec<Bson> = result_docs
.into_iter()
.map(Bson::Document)
.collect();
Ok(doc! {
"cursor": {
"firstBatch": first_batch,
"id": 0_i64,
"ns": &ns,
},
"ok": 1.0,
})
} else {
// Need to create a cursor for remaining results.
let first_batch: Vec<Bson> = result_docs[..batch_size]
.iter()
.cloned()
.map(Bson::Document)
.collect();
let remaining: Vec<Document> = result_docs[batch_size..].to_vec();
let cursor_id = generate_cursor_id();
ctx.cursors.insert(
cursor_id,
CursorState {
documents: remaining,
position: 0,
database: db.to_string(),
collection: coll.to_string(),
},
);
Ok(doc! {
"cursor": {
"firstBatch": first_batch,
"id": cursor_id,
"ns": &ns,
},
"ok": 1.0,
})
}
}
/// Handle $out stage: drop and replace target collection with pipeline results.
async fn handle_out_stage(
db: &str,
out_spec: &Bson,
docs: &[Document],
ctx: &CommandContext,
) -> CommandResult<()> {
let (target_db, target_coll) = match out_spec {
Bson::String(coll_name) => (db.to_string(), coll_name.clone()),
Bson::Document(d) => {
let tdb = d.get_str("db").unwrap_or(db).to_string();
let tcoll = d
.get_str("coll")
.map_err(|_| CommandError::InvalidArgument("$out requires 'coll'".into()))?
.to_string();
(tdb, tcoll)
}
_ => {
return Err(CommandError::InvalidArgument(
"$out requires a string or document".into(),
));
}
};
// Drop existing target collection (ignore errors).
let _ = ctx.storage.drop_collection(&target_db, &target_coll).await;
// Create target collection.
let _ = ctx.storage.create_database(&target_db).await;
let _ = ctx.storage.create_collection(&target_db, &target_coll).await;
// Insert all result documents.
for doc in docs {
let _ = ctx
.storage
.insert_one(&target_db, &target_coll, doc.clone())
.await;
}
Ok(())
}
/// Handle $merge stage: merge pipeline results into target collection.
async fn handle_merge_stage(
db: &str,
merge_spec: &Bson,
docs: &[Document],
ctx: &CommandContext,
) -> CommandResult<()> {
let (target_db, target_coll) = match merge_spec {
Bson::String(coll_name) => (db.to_string(), coll_name.clone()),
Bson::Document(d) => {
let into_val = d.get("into");
match into_val {
Some(Bson::String(s)) => (db.to_string(), s.clone()),
Some(Bson::Document(into_doc)) => {
let tdb = into_doc.get_str("db").unwrap_or(db).to_string();
let tcoll = into_doc
.get_str("coll")
.map_err(|_| {
CommandError::InvalidArgument("$merge.into requires 'coll'".into())
})?
.to_string();
(tdb, tcoll)
}
_ => {
return Err(CommandError::InvalidArgument(
"$merge requires 'into' field".into(),
));
}
}
}
_ => {
return Err(CommandError::InvalidArgument(
"$merge requires a string or document".into(),
));
}
};
// Ensure target collection exists.
let _ = ctx.storage.create_database(&target_db).await;
let _ = ctx
.storage
.create_collection(&target_db, &target_coll)
.await;
// Simple merge: upsert by _id.
for doc in docs {
let id_str = match doc.get("_id") {
Some(Bson::ObjectId(oid)) => oid.to_hex(),
Some(Bson::String(s)) => s.clone(),
Some(other) => format!("{}", other),
None => {
// No _id, just insert.
let _ = ctx
.storage
.insert_one(&target_db, &target_coll, doc.clone())
.await;
continue;
}
};
// Try update first, insert if it fails.
match ctx
.storage
.update_by_id(&target_db, &target_coll, &id_str, doc.clone())
.await
{
Ok(()) => {}
Err(_) => {
let _ = ctx
.storage
.insert_one(&target_db, &target_coll, doc.clone())
.await;
}
}
}
Ok(())
}
/// Generate a pseudo-random cursor ID.
fn generate_cursor_id() -> i64 {
use std::collections::hash_map::RandomState;
use std::hash::{BuildHasher, Hasher};
let s = RandomState::new();
let mut hasher = s.build_hasher();
hasher.write_u64(std::time::SystemTime::now()
.duration_since(std::time::UNIX_EPOCH)
.unwrap_or_default()
.as_nanos() as u64);
let id = hasher.finish() as i64;
// Ensure positive and non-zero.
if id == 0 { 1 } else { id.abs() }
}
@@ -0,0 +1,207 @@
use std::collections::HashSet;
use bson::{doc, Bson, Document};
use rustdb_query::QueryMatcher;
use rustdb_storage::OpType;
use tracing::debug;
use crate::context::CommandContext;
use crate::error::{CommandError, CommandResult};
/// Handle the `delete` command.
pub async fn handle(
cmd: &Document,
db: &str,
ctx: &CommandContext,
) -> CommandResult<Document> {
let coll = cmd
.get_str("delete")
.map_err(|_| CommandError::InvalidArgument("missing 'delete' field".into()))?;
let deletes = cmd
.get_array("deletes")
.map_err(|_| CommandError::InvalidArgument("missing 'deletes' array".into()))?;
// Ordered flag (default true).
let ordered = match cmd.get("ordered") {
Some(Bson::Boolean(b)) => *b,
_ => true,
};
debug!(
db = db,
collection = coll,
count = deletes.len(),
"delete command"
);
let ns_key = format!("{}.{}", db, coll);
let mut total_deleted: i32 = 0;
let mut write_errors: Vec<Document> = Vec::new();
for (idx, del_spec) in deletes.iter().enumerate() {
let del_doc = match del_spec {
Bson::Document(d) => d,
_ => {
write_errors.push(doc! {
"index": idx as i32,
"code": 14_i32,
"codeName": "TypeMismatch",
"errmsg": "delete spec must be a document",
});
if ordered {
break;
}
continue;
}
};
// Extract filter (q) and limit.
let filter = match del_doc.get_document("q") {
Ok(f) => f.clone(),
Err(_) => Document::new(), // empty filter matches everything
};
let limit = match del_doc.get("limit") {
Some(Bson::Int32(n)) => *n,
Some(Bson::Int64(n)) => *n as i32,
Some(Bson::Double(n)) => *n as i32,
_ => 0, // default: delete all matches
};
match delete_matching(db, coll, &ns_key, &filter, limit, ctx).await {
Ok(count) => {
total_deleted += count;
}
Err(e) => {
write_errors.push(doc! {
"index": idx as i32,
"code": 1_i32,
"codeName": "InternalError",
"errmsg": e.to_string(),
});
if ordered {
break;
}
}
}
}
// Build response.
let mut response = doc! {
"n": total_deleted,
"ok": 1.0,
};
if !write_errors.is_empty() {
response.insert(
"writeErrors",
write_errors
.into_iter()
.map(Bson::Document)
.collect::<Vec<_>>(),
);
}
Ok(response)
}
/// Find and delete documents matching a filter, returning the number deleted.
async fn delete_matching(
db: &str,
coll: &str,
ns_key: &str,
filter: &Document,
limit: i32,
ctx: &CommandContext,
) -> Result<i32, CommandError> {
// Check if the collection exists; if not, nothing to delete.
match ctx.storage.collection_exists(db, coll).await {
Ok(false) => return Ok(0),
Err(_) => return Ok(0),
Ok(true) => {}
}
// Try to use index to narrow candidates.
let candidate_ids: Option<HashSet<String>> = {
if let Some(engine) = ctx.indexes.get(ns_key) {
engine.find_candidate_ids(filter)
} else {
None
}
};
// Load candidate documents.
let docs = if let Some(ids) = candidate_ids {
if ids.is_empty() {
return Ok(0);
}
ctx.storage
.find_by_ids(db, coll, ids)
.await
.map_err(|e| CommandError::StorageError(e.to_string()))?
} else {
ctx.storage
.find_all(db, coll)
.await
.map_err(|e| CommandError::StorageError(e.to_string()))?
};
// Apply filter to get matched documents.
let matched = QueryMatcher::filter(&docs, filter);
// Apply limit: 0 means delete all, 1 means delete only the first match.
let to_delete: &[Document] = if limit == 1 && !matched.is_empty() {
&matched[..1]
} else {
&matched
};
if to_delete.is_empty() {
return Ok(0);
}
let mut deleted_count: i32 = 0;
for doc in to_delete {
// Extract the _id as a hex string for storage deletion.
let id_str = extract_id_string(doc)?;
ctx.storage
.delete_by_id(db, coll, &id_str)
.await
.map_err(|e| CommandError::StorageError(e.to_string()))?;
// Record in oplog.
ctx.oplog.append(
OpType::Delete,
db,
coll,
&id_str,
None,
Some(doc.clone()),
);
// Update index engine.
if let Some(mut engine) = ctx.indexes.get_mut(ns_key) {
engine.on_delete(doc);
}
deleted_count += 1;
}
Ok(deleted_count)
}
/// Extract the `_id` field from a document as a hex string suitable for the
/// storage adapter.
fn extract_id_string(doc: &Document) -> Result<String, CommandError> {
match doc.get("_id") {
Some(Bson::ObjectId(oid)) => Ok(oid.to_hex()),
Some(Bson::String(s)) => Ok(s.clone()),
Some(other) => Ok(format!("{}", other)),
None => Err(CommandError::InvalidArgument(
"document missing _id field".into(),
)),
}
}
@@ -0,0 +1,370 @@
use std::sync::atomic::{AtomicI64, Ordering};
use bson::{doc, Bson, Document};
use tracing::debug;
use rustdb_query::{QueryMatcher, sort_documents, apply_projection, distinct_values};
use crate::context::{CommandContext, CursorState};
use crate::error::{CommandError, CommandResult};
/// Atomic counter for generating unique cursor IDs.
static CURSOR_ID_COUNTER: AtomicI64 = AtomicI64::new(1);
/// Generate a new unique, positive cursor ID.
fn next_cursor_id() -> i64 {
CURSOR_ID_COUNTER.fetch_add(1, Ordering::Relaxed)
}
// ---------------------------------------------------------------------------
// Helpers to defensively extract values from BSON command documents
// ---------------------------------------------------------------------------
fn get_str<'a>(doc: &'a Document, key: &str) -> Option<&'a str> {
match doc.get(key)? {
Bson::String(s) => Some(s.as_str()),
_ => None,
}
}
fn get_i32(doc: &Document, key: &str) -> Option<i32> {
match doc.get(key)? {
Bson::Int32(v) => Some(*v),
Bson::Int64(v) => Some(*v as i32),
Bson::Double(v) => Some(*v as i32),
_ => None,
}
}
fn get_i64(doc: &Document, key: &str) -> Option<i64> {
match doc.get(key)? {
Bson::Int64(v) => Some(*v),
Bson::Int32(v) => Some(*v as i64),
Bson::Double(v) => Some(*v as i64),
_ => None,
}
}
fn get_bool(doc: &Document, key: &str) -> Option<bool> {
match doc.get(key)? {
Bson::Boolean(v) => Some(*v),
_ => None,
}
}
fn get_document<'a>(doc: &'a Document, key: &str) -> Option<&'a Document> {
match doc.get(key)? {
Bson::Document(d) => Some(d),
_ => None,
}
}
// ---------------------------------------------------------------------------
// find
// ---------------------------------------------------------------------------
/// Handle the `find` command.
pub async fn handle(
cmd: &Document,
db: &str,
ctx: &CommandContext,
) -> CommandResult<Document> {
let coll = get_str(cmd, "find").unwrap_or("unknown");
let ns = format!("{}.{}", db, coll);
// Extract optional parameters.
let filter = get_document(cmd, "filter").cloned().unwrap_or_default();
let sort_spec = get_document(cmd, "sort").cloned();
let projection = get_document(cmd, "projection").cloned();
let skip = get_i64(cmd, "skip").unwrap_or(0).max(0) as usize;
let limit = get_i64(cmd, "limit").unwrap_or(0).max(0) as usize;
let batch_size = get_i32(cmd, "batchSize").unwrap_or(101).max(0) as usize;
let single_batch = get_bool(cmd, "singleBatch").unwrap_or(false);
// If the collection does not exist, return an empty cursor.
let exists = ctx.storage.collection_exists(db, coll).await?;
if !exists {
return Ok(doc! {
"cursor": {
"firstBatch": [],
"id": 0_i64,
"ns": &ns,
},
"ok": 1.0,
});
}
// Try index-accelerated lookup.
let index_key = format!("{}.{}", db, coll);
let docs = if let Some(idx_ref) = ctx.indexes.get(&index_key) {
if let Some(candidate_ids) = idx_ref.find_candidate_ids(&filter) {
debug!(
ns = %ns,
candidates = candidate_ids.len(),
"using index acceleration"
);
ctx.storage.find_by_ids(db, coll, candidate_ids).await?
} else {
ctx.storage.find_all(db, coll).await?
}
} else {
ctx.storage.find_all(db, coll).await?
};
// Apply filter.
let mut docs = QueryMatcher::filter(&docs, &filter);
// Apply sort.
if let Some(ref sort) = sort_spec {
sort_documents(&mut docs, sort);
}
// Apply skip.
if skip > 0 {
if skip >= docs.len() {
docs = Vec::new();
} else {
docs = docs.split_off(skip);
}
}
// Apply limit.
if limit > 0 && docs.len() > limit {
docs.truncate(limit);
}
// Apply projection.
if let Some(ref proj) = projection {
docs = docs.iter().map(|d| apply_projection(d, proj)).collect();
}
// Determine first batch.
if docs.len() <= batch_size || single_batch {
// Everything fits in a single batch.
let batch: Vec<Bson> = docs.into_iter().map(Bson::Document).collect();
Ok(doc! {
"cursor": {
"firstBatch": batch,
"id": 0_i64,
"ns": &ns,
},
"ok": 1.0,
})
} else {
// Split into first batch and remainder, store cursor.
let remaining = docs.split_off(batch_size);
let first_batch: Vec<Bson> = docs.into_iter().map(Bson::Document).collect();
let cursor_id = next_cursor_id();
ctx.cursors.insert(cursor_id, CursorState {
documents: remaining,
position: 0,
database: db.to_string(),
collection: coll.to_string(),
});
Ok(doc! {
"cursor": {
"firstBatch": first_batch,
"id": cursor_id,
"ns": &ns,
},
"ok": 1.0,
})
}
}
// ---------------------------------------------------------------------------
// getMore
// ---------------------------------------------------------------------------
/// Handle the `getMore` command.
pub async fn handle_get_more(
cmd: &Document,
db: &str,
ctx: &CommandContext,
) -> CommandResult<Document> {
// Defensively extract cursor id.
let cursor_id = get_i64(cmd, "getMore").ok_or_else(|| {
CommandError::InvalidArgument("getMore requires a cursor id".into())
})?;
let coll = get_str(cmd, "collection").unwrap_or("unknown");
let ns = format!("{}.{}", db, coll);
let batch_size = get_i64(cmd, "batchSize")
.or_else(|| get_i32(cmd, "batchSize").map(|v| v as i64))
.unwrap_or(101)
.max(0) as usize;
// Look up the cursor.
let mut cursor_entry = ctx.cursors.get_mut(&cursor_id).ok_or_else(|| {
CommandError::InvalidArgument(format!("cursor id {} not found", cursor_id))
})?;
let cursor = cursor_entry.value_mut();
let start = cursor.position;
let end = (start + batch_size).min(cursor.documents.len());
let batch: Vec<Bson> = cursor.documents[start..end]
.iter()
.cloned()
.map(Bson::Document)
.collect();
cursor.position = end;
let exhausted = cursor.position >= cursor.documents.len();
// Must drop the mutable reference before removing.
drop(cursor_entry);
if exhausted {
ctx.cursors.remove(&cursor_id);
Ok(doc! {
"cursor": {
"nextBatch": batch,
"id": 0_i64,
"ns": &ns,
},
"ok": 1.0,
})
} else {
Ok(doc! {
"cursor": {
"nextBatch": batch,
"id": cursor_id,
"ns": &ns,
},
"ok": 1.0,
})
}
}
// ---------------------------------------------------------------------------
// killCursors
// ---------------------------------------------------------------------------
/// Handle the `killCursors` command.
pub async fn handle_kill_cursors(
cmd: &Document,
_db: &str,
ctx: &CommandContext,
) -> CommandResult<Document> {
let cursor_ids = match cmd.get("cursors") {
Some(Bson::Array(arr)) => arr,
_ => {
return Ok(doc! {
"cursorsKilled": [],
"cursorsNotFound": [],
"cursorsAlive": [],
"cursorsUnknown": [],
"ok": 1.0,
});
}
};
let mut killed: Vec<Bson> = Vec::new();
let mut not_found: Vec<Bson> = Vec::new();
for id_bson in cursor_ids {
let id = match id_bson {
Bson::Int64(v) => *v,
Bson::Int32(v) => *v as i64,
_ => continue,
};
if ctx.cursors.remove(&id).is_some() {
killed.push(Bson::Int64(id));
} else {
not_found.push(Bson::Int64(id));
}
}
Ok(doc! {
"cursorsKilled": killed,
"cursorsNotFound": not_found,
"cursorsAlive": [],
"cursorsUnknown": [],
"ok": 1.0,
})
}
// ---------------------------------------------------------------------------
// count
// ---------------------------------------------------------------------------
/// Handle the `count` command.
pub async fn handle_count(
cmd: &Document,
db: &str,
ctx: &CommandContext,
) -> CommandResult<Document> {
let coll = get_str(cmd, "count").unwrap_or("unknown");
// Check collection existence.
let exists = ctx.storage.collection_exists(db, coll).await?;
if !exists {
return Ok(doc! { "n": 0_i64, "ok": 1.0 });
}
let query = get_document(cmd, "query").cloned().unwrap_or_default();
let skip = get_i64(cmd, "skip").unwrap_or(0).max(0) as usize;
let limit = get_i64(cmd, "limit").unwrap_or(0).max(0) as usize;
let count: u64 = if query.is_empty() && skip == 0 && limit == 0 {
// Fast path: use storage-level count.
ctx.storage.count(db, coll).await?
} else if query.is_empty() {
// No filter but skip/limit apply.
let total = ctx.storage.count(db, coll).await? as usize;
let after_skip = total.saturating_sub(skip);
let result = if limit > 0 { after_skip.min(limit) } else { after_skip };
result as u64
} else {
// Need to load and filter.
let docs = ctx.storage.find_all(db, coll).await?;
let filtered = QueryMatcher::filter(&docs, &query);
let mut n = filtered.len();
// Apply skip.
n = n.saturating_sub(skip);
// Apply limit.
if limit > 0 {
n = n.min(limit);
}
n as u64
};
Ok(doc! {
"n": count as i64,
"ok": 1.0,
})
}
// ---------------------------------------------------------------------------
// distinct
// ---------------------------------------------------------------------------
/// Handle the `distinct` command.
pub async fn handle_distinct(
cmd: &Document,
db: &str,
ctx: &CommandContext,
) -> CommandResult<Document> {
let coll = get_str(cmd, "distinct").unwrap_or("unknown");
let key = get_str(cmd, "key").ok_or_else(|| {
CommandError::InvalidArgument("distinct requires a 'key' field".into())
})?;
// Check collection existence.
let exists = ctx.storage.collection_exists(db, coll).await?;
if !exists {
return Ok(doc! { "values": [], "ok": 1.0 });
}
let query = get_document(cmd, "query").cloned();
let docs = ctx.storage.find_all(db, coll).await?;
let values = distinct_values(&docs, key, query.as_ref());
Ok(doc! {
"values": values,
"ok": 1.0,
})
}
@@ -0,0 +1,28 @@
use bson::{doc, Document};
use crate::context::CommandContext;
use crate::error::CommandResult;
/// Handle `hello`, `ismaster`, and `isMaster` commands.
///
/// Returns server capabilities matching wire protocol expectations.
pub async fn handle(
_cmd: &Document,
_db: &str,
_ctx: &CommandContext,
) -> CommandResult<Document> {
Ok(doc! {
"ismaster": true,
"isWritablePrimary": true,
"maxBsonObjectSize": 16_777_216_i32,
"maxMessageSizeBytes": 48_000_000_i32,
"maxWriteBatchSize": 100_000_i32,
"localTime": bson::DateTime::now(),
"logicalSessionTimeoutMinutes": 30_i32,
"connectionId": 1_i32,
"minWireVersion": 0_i32,
"maxWireVersion": 21_i32,
"readOnly": false,
"ok": 1.0,
})
}
@@ -0,0 +1,380 @@
use bson::{doc, Bson, Document};
use rustdb_index::{IndexEngine, IndexOptions};
use tracing::debug;
use crate::context::CommandContext;
use crate::error::{CommandError, CommandResult};
/// Handle `createIndexes`, `dropIndexes`, and `listIndexes` commands.
pub async fn handle(
cmd: &Document,
db: &str,
ctx: &CommandContext,
command_name: &str,
) -> CommandResult<Document> {
match command_name {
"createIndexes" => handle_create_indexes(cmd, db, ctx).await,
"dropIndexes" => handle_drop_indexes(cmd, db, ctx).await,
"listIndexes" => handle_list_indexes(cmd, db, ctx).await,
_ => Ok(doc! { "ok": 1.0 }),
}
}
/// Handle the `createIndexes` command.
async fn handle_create_indexes(
cmd: &Document,
db: &str,
ctx: &CommandContext,
) -> CommandResult<Document> {
let coll = cmd
.get_str("createIndexes")
.map_err(|_| CommandError::InvalidArgument("missing 'createIndexes' field".into()))?;
let indexes = cmd
.get_array("indexes")
.map_err(|_| CommandError::InvalidArgument("missing 'indexes' array".into()))?;
let ns_key = format!("{}.{}", db, coll);
debug!(
db = db,
collection = coll,
count = indexes.len(),
"createIndexes command"
);
// Auto-create collection if needed.
let created_automatically = ensure_collection_exists(db, coll, ctx).await?;
// Get the number of indexes before creating new ones.
let num_before = {
let engine = ctx
.indexes
.entry(ns_key.clone())
.or_insert_with(IndexEngine::new);
engine.list_indexes().len() as i32
};
let mut created_count = 0_i32;
for index_bson in indexes {
let index_spec = match index_bson {
Bson::Document(d) => d,
_ => {
return Err(CommandError::InvalidArgument(
"index spec must be a document".into(),
));
}
};
let key = match index_spec.get("key") {
Some(Bson::Document(k)) => k.clone(),
_ => {
return Err(CommandError::InvalidArgument(
"index spec must have a 'key' document".into(),
));
}
};
let name = index_spec.get_str("name").ok().map(|s| s.to_string());
let unique = match index_spec.get("unique") {
Some(Bson::Boolean(b)) => *b,
_ => false,
};
let sparse = match index_spec.get("sparse") {
Some(Bson::Boolean(b)) => *b,
_ => false,
};
let expire_after_seconds = match index_spec.get("expireAfterSeconds") {
Some(Bson::Int32(n)) => Some(*n as u64),
Some(Bson::Int64(n)) => Some(*n as u64),
_ => None,
};
let options = IndexOptions {
name,
unique,
sparse,
expire_after_seconds,
};
let options_for_persist = IndexOptions {
name: options.name.clone(),
unique: options.unique,
sparse: options.sparse,
expire_after_seconds: options.expire_after_seconds,
};
let key_for_persist = key.clone();
// Create the index in-memory.
let mut engine = ctx
.indexes
.entry(ns_key.clone())
.or_insert_with(IndexEngine::new);
match engine.create_index(key, options) {
Ok(index_name) => {
debug!(index_name = %index_name, "Created index");
// Persist index spec to disk.
let mut spec = doc! { "key": key_for_persist };
if options_for_persist.unique {
spec.insert("unique", true);
}
if options_for_persist.sparse {
spec.insert("sparse", true);
}
if let Some(ttl) = options_for_persist.expire_after_seconds {
spec.insert("expireAfterSeconds", ttl as i64);
}
if let Err(e) = ctx.storage.save_index(db, coll, &index_name, spec).await {
tracing::warn!(index = %index_name, error = %e, "failed to persist index spec");
}
created_count += 1;
}
Err(e) => {
return Err(CommandError::IndexError(e.to_string()));
}
}
}
// If we created indexes on an existing collection, rebuild from documents.
if created_count > 0 && !created_automatically {
// Load all documents and rebuild indexes.
if let Ok(all_docs) = ctx.storage.find_all(db, coll).await {
if !all_docs.is_empty() {
let mut engine = ctx
.indexes
.entry(ns_key.clone())
.or_insert_with(IndexEngine::new);
engine.rebuild_from_documents(&all_docs);
}
}
}
let num_after = {
let engine = ctx
.indexes
.entry(ns_key.clone())
.or_insert_with(IndexEngine::new);
engine.list_indexes().len() as i32
};
Ok(doc! {
"createdCollectionAutomatically": created_automatically,
"numIndexesBefore": num_before,
"numIndexesAfter": num_after,
"ok": 1.0,
})
}
/// Handle the `dropIndexes` command.
async fn handle_drop_indexes(
cmd: &Document,
db: &str,
ctx: &CommandContext,
) -> CommandResult<Document> {
let coll = cmd
.get_str("dropIndexes")
.map_err(|_| CommandError::InvalidArgument("missing 'dropIndexes' field".into()))?;
let ns_key = format!("{}.{}", db, coll);
// Get current index count.
let n_indexes_was = {
match ctx.indexes.get(&ns_key) {
Some(engine) => engine.list_indexes().len() as i32,
None => 1_i32, // At minimum the _id_ index.
}
};
let index_spec = cmd.get("index");
debug!(
db = db,
collection = coll,
index_spec = ?index_spec,
"dropIndexes command"
);
match index_spec {
Some(Bson::String(name)) if name == "*" => {
// Drop all indexes except _id_.
// Collect names to drop from storage first.
let names_to_drop: Vec<String> = if let Some(engine) = ctx.indexes.get(&ns_key) {
engine.list_indexes().iter()
.filter(|info| info.name != "_id_")
.map(|info| info.name.clone())
.collect()
} else {
Vec::new()
};
if let Some(mut engine) = ctx.indexes.get_mut(&ns_key) {
engine.drop_all_indexes();
}
for idx_name in &names_to_drop {
let _ = ctx.storage.drop_index(db, coll, idx_name).await;
}
}
Some(Bson::String(name)) => {
// Drop by name.
if let Some(mut engine) = ctx.indexes.get_mut(&ns_key) {
engine.drop_index(name).map_err(|e| {
CommandError::IndexError(e.to_string())
})?;
} else {
return Err(CommandError::IndexError(format!(
"index not found: {}",
name
)));
}
let _ = ctx.storage.drop_index(db, coll, name).await;
}
Some(Bson::Document(key_spec)) => {
// Drop by key spec: find the index with matching key.
if let Some(mut engine) = ctx.indexes.get_mut(&ns_key) {
let index_name = engine
.list_indexes()
.iter()
.find(|info| info.key == *key_spec)
.map(|info| info.name.clone());
if let Some(name) = index_name {
engine.drop_index(&name).map_err(|e| {
CommandError::IndexError(e.to_string())
})?;
let _ = ctx.storage.drop_index(db, coll, &name).await;
} else {
return Err(CommandError::IndexError(
"index not found with specified key".into(),
));
}
} else {
return Err(CommandError::IndexError(
"no indexes found for collection".into(),
));
}
}
_ => {
return Err(CommandError::InvalidArgument(
"dropIndexes requires 'index' field (string, document, or \"*\")".into(),
));
}
}
Ok(doc! {
"nIndexesWas": n_indexes_was,
"ok": 1.0,
})
}
/// Handle the `listIndexes` command.
async fn handle_list_indexes(
cmd: &Document,
db: &str,
ctx: &CommandContext,
) -> CommandResult<Document> {
let coll = cmd
.get_str("listIndexes")
.map_err(|_| CommandError::InvalidArgument("missing 'listIndexes' field".into()))?;
let ns_key = format!("{}.{}", db, coll);
let ns = format!("{}.{}", db, coll);
// Check if collection exists.
match ctx.storage.collection_exists(db, coll).await {
Ok(false) => {
return Err(CommandError::NamespaceNotFound(format!(
"ns not found: {}",
ns
)));
}
Err(_) => {
// If we can't check, try to proceed anyway.
}
_ => {}
}
let indexes = match ctx.indexes.get(&ns_key) {
Some(engine) => engine.list_indexes(),
None => {
// Return at least the default _id_ index.
let engine = IndexEngine::new();
engine.list_indexes()
}
};
let first_batch: Vec<Bson> = indexes
.into_iter()
.map(|info| {
let mut doc = doc! {
"v": info.v,
"key": info.key,
"name": info.name,
};
if info.unique {
doc.insert("unique", true);
}
if info.sparse {
doc.insert("sparse", true);
}
if let Some(ttl) = info.expire_after_seconds {
doc.insert("expireAfterSeconds", ttl as i64);
}
Bson::Document(doc)
})
.collect();
Ok(doc! {
"cursor": {
"id": 0_i64,
"ns": &ns,
"firstBatch": first_batch,
},
"ok": 1.0,
})
}
/// Ensure the target database and collection exist. Returns true if the collection
/// was newly created (i.e., `createdCollectionAutomatically`).
async fn ensure_collection_exists(
db: &str,
coll: &str,
ctx: &CommandContext,
) -> CommandResult<bool> {
// Create database (ignore AlreadyExists).
if let Err(e) = ctx.storage.create_database(db).await {
let msg = e.to_string();
if !msg.contains("AlreadyExists") && !msg.contains("already exists") {
return Err(CommandError::StorageError(msg));
}
}
// Check if collection exists.
match ctx.storage.collection_exists(db, coll).await {
Ok(true) => Ok(false),
Ok(false) => {
if let Err(e) = ctx.storage.create_collection(db, coll).await {
let msg = e.to_string();
if !msg.contains("AlreadyExists") && !msg.contains("already exists") {
return Err(CommandError::StorageError(msg));
}
}
Ok(true)
}
Err(_) => {
// Try creating anyway.
if let Err(e) = ctx.storage.create_collection(db, coll).await {
let msg = e.to_string();
if !msg.contains("AlreadyExists") && !msg.contains("already exists") {
return Err(CommandError::StorageError(msg));
}
}
Ok(true)
}
}
}
@@ -0,0 +1,216 @@
use std::collections::HashMap;
use bson::{doc, oid::ObjectId, Bson, Document};
use rustdb_storage::OpType;
use tracing::debug;
use crate::context::CommandContext;
use crate::error::{CommandError, CommandResult};
/// Handle the `insert` command.
pub async fn handle(
cmd: &Document,
db: &str,
ctx: &CommandContext,
document_sequences: Option<&HashMap<String, Vec<Document>>>,
) -> CommandResult<Document> {
let coll = cmd
.get_str("insert")
.map_err(|_| CommandError::InvalidArgument("missing 'insert' field".into()))?;
// Determine whether writes are ordered (default: true).
let ordered = match cmd.get("ordered") {
Some(Bson::Boolean(b)) => *b,
_ => true,
};
// Collect documents from either the command body or OP_MSG document sequences.
let docs: Vec<Document> = if let Some(seqs) = document_sequences {
if let Some(seq_docs) = seqs.get("documents") {
seq_docs.clone()
} else {
extract_docs_from_array(cmd)?
}
} else {
extract_docs_from_array(cmd)?
};
if docs.is_empty() {
return Err(CommandError::InvalidArgument(
"no documents to insert".into(),
));
}
debug!(
db = db,
collection = coll,
count = docs.len(),
"insert command"
);
// Auto-create database and collection if they don't exist.
ensure_collection_exists(db, coll, ctx).await?;
let ns_key = format!("{}.{}", db, coll);
let mut inserted_count: i32 = 0;
let mut write_errors: Vec<Document> = Vec::new();
// Ensure the IndexEngine is loaded (with persisted specs from indexes.json).
// This must happen BEFORE any writes, so unique constraints are enforced
// even on the first write after a restart.
drop(ctx.get_or_init_index_engine(db, coll).await);
for (idx, mut doc) in docs.into_iter().enumerate() {
// Auto-generate _id if not present.
if !doc.contains_key("_id") {
doc.insert("_id", ObjectId::new());
}
// Pre-check unique index constraints BEFORE storage write.
// The engine is guaranteed to exist from the get_or_init call above.
if let Some(engine) = ctx.indexes.get(&ns_key) {
if let Err(e) = engine.check_unique_constraints(&doc) {
let err_msg = e.to_string();
write_errors.push(doc! {
"index": idx as i32,
"code": 11000_i32,
"codeName": "DuplicateKey",
"errmsg": &err_msg,
});
if ordered {
break;
}
continue;
}
}
// Attempt storage insert.
match ctx.storage.insert_one(db, coll, doc.clone()).await {
Ok(id_str) => {
// Record in oplog.
ctx.oplog.append(
OpType::Insert,
db,
coll,
&id_str,
Some(doc.clone()),
None,
);
// Update index engine (already initialized above).
if let Some(mut engine) = ctx.indexes.get_mut(&ns_key) {
if let Err(e) = engine.on_insert(&doc) {
tracing::error!(
namespace = %ns_key,
error = %e,
"index update failed after successful insert"
);
}
}
inserted_count += 1;
}
Err(e) => {
let err_msg = e.to_string();
let (code, code_name) = if err_msg.contains("AlreadyExists")
|| err_msg.contains("duplicate")
{
(11000_i32, "DuplicateKey")
} else {
(1_i32, "InternalError")
};
write_errors.push(doc! {
"index": idx as i32,
"code": code,
"codeName": code_name,
"errmsg": &err_msg,
});
if ordered {
// Stop on first error when ordered.
break;
}
}
}
}
// Build response document.
let mut response = doc! {
"n": inserted_count,
"ok": 1.0,
};
if !write_errors.is_empty() {
response.insert(
"writeErrors",
write_errors
.into_iter()
.map(Bson::Document)
.collect::<Vec<_>>(),
);
}
Ok(response)
}
/// Extract documents from the `documents` array field in the command BSON.
fn extract_docs_from_array(cmd: &Document) -> CommandResult<Vec<Document>> {
match cmd.get_array("documents") {
Ok(arr) => {
let mut docs = Vec::with_capacity(arr.len());
for item in arr {
match item {
Bson::Document(d) => docs.push(d.clone()),
_ => {
return Err(CommandError::InvalidArgument(
"documents array contains non-document element".into(),
));
}
}
}
Ok(docs)
}
Err(_) => Ok(Vec::new()),
}
}
/// Ensure the target database and collection exist, creating them if needed.
async fn ensure_collection_exists(
db: &str,
coll: &str,
ctx: &CommandContext,
) -> CommandResult<()> {
// Create database (no-op if it already exists in most backends).
if let Err(e) = ctx.storage.create_database(db).await {
let msg = e.to_string();
if !msg.contains("AlreadyExists") && !msg.contains("already exists") {
return Err(CommandError::StorageError(msg));
}
}
// Create collection if it doesn't exist.
match ctx.storage.collection_exists(db, coll).await {
Ok(true) => {}
Ok(false) => {
if let Err(e) = ctx.storage.create_collection(db, coll).await {
let msg = e.to_string();
if !msg.contains("AlreadyExists") && !msg.contains("already exists") {
return Err(CommandError::StorageError(msg));
}
}
}
Err(e) => {
// Database might not exist yet; try creating collection anyway.
if let Err(e2) = ctx.storage.create_collection(db, coll).await {
let msg = e2.to_string();
if !msg.contains("AlreadyExists") && !msg.contains("already exists") {
return Err(CommandError::StorageError(format!(
"collection_exists failed: {e}; create_collection failed: {msg}"
)));
}
}
}
}
Ok(())
}
@@ -0,0 +1,8 @@
pub mod admin_handler;
pub mod aggregate_handler;
pub mod delete_handler;
pub mod find_handler;
pub mod hello_handler;
pub mod index_handler;
pub mod insert_handler;
pub mod update_handler;
@@ -0,0 +1,724 @@
use std::collections::HashSet;
use bson::{doc, oid::ObjectId, Bson, Document};
use rustdb_query::{QueryMatcher, UpdateEngine, sort_documents, apply_projection};
use rustdb_storage::OpType;
use tracing::debug;
use crate::context::CommandContext;
use crate::error::{CommandError, CommandResult};
/// Handle `update` and `findAndModify` commands.
pub async fn handle(
cmd: &Document,
db: &str,
ctx: &CommandContext,
command_name: &str,
) -> CommandResult<Document> {
match command_name {
"findAndModify" | "findandmodify" => handle_find_and_modify(cmd, db, ctx).await,
_ => handle_update(cmd, db, ctx).await,
}
}
/// Handle the `update` command.
async fn handle_update(
cmd: &Document,
db: &str,
ctx: &CommandContext,
) -> CommandResult<Document> {
let coll = cmd
.get_str("update")
.map_err(|_| CommandError::InvalidArgument("missing 'update' field".into()))?;
let updates = cmd
.get_array("updates")
.map_err(|_| CommandError::InvalidArgument("missing 'updates' array".into()))?;
let ordered = match cmd.get("ordered") {
Some(Bson::Boolean(b)) => *b,
_ => true,
};
debug!(db = db, collection = coll, count = updates.len(), "update command");
// Auto-create database and collection if needed.
ensure_collection_exists(db, coll, ctx).await?;
let ns_key = format!("{}.{}", db, coll);
// Ensure the IndexEngine is loaded with persisted specs from indexes.json.
drop(ctx.get_or_init_index_engine(db, coll).await);
let mut total_n: i32 = 0;
let mut total_n_modified: i32 = 0;
let mut upserted_list: Vec<Document> = Vec::new();
let mut write_errors: Vec<Document> = Vec::new();
for (idx, update_bson) in updates.iter().enumerate() {
let update_spec = match update_bson {
Bson::Document(d) => d,
_ => {
write_errors.push(doc! {
"index": idx as i32,
"code": 14_i32,
"codeName": "TypeMismatch",
"errmsg": "update spec must be a document",
});
if ordered {
break;
}
continue;
}
};
let filter = match update_spec.get("q") {
Some(Bson::Document(d)) => d.clone(),
_ => Document::new(),
};
let update = match update_spec.get("u") {
Some(Bson::Document(d)) => d.clone(),
Some(Bson::Array(_pipeline)) => {
// Aggregation pipeline updates are not yet supported; treat as error.
write_errors.push(doc! {
"index": idx as i32,
"code": 14_i32,
"codeName": "TypeMismatch",
"errmsg": "aggregation pipeline updates not yet supported",
});
if ordered {
break;
}
continue;
}
_ => {
write_errors.push(doc! {
"index": idx as i32,
"code": 14_i32,
"codeName": "TypeMismatch",
"errmsg": "missing or invalid 'u' field in update spec",
});
if ordered {
break;
}
continue;
}
};
let multi = match update_spec.get("multi") {
Some(Bson::Boolean(b)) => *b,
_ => false,
};
let upsert = match update_spec.get("upsert") {
Some(Bson::Boolean(b)) => *b,
_ => false,
};
let array_filters: Option<Vec<Document>> =
update_spec.get_array("arrayFilters").ok().map(|arr| {
arr.iter()
.filter_map(|v| {
if let Bson::Document(d) = v {
Some(d.clone())
} else {
None
}
})
.collect()
});
// Load all documents and filter.
let all_docs = load_filtered_docs(db, coll, &filter, &ns_key, ctx).await?;
if all_docs.is_empty() && upsert {
// Upsert: create a new document.
let new_doc = build_upsert_doc(&filter);
// Apply update operators or replacement.
match UpdateEngine::apply_update(&new_doc, &update, array_filters.as_deref()) {
Ok(mut updated) => {
// Apply $setOnInsert if present.
if let Some(Bson::Document(soi)) = update.get("$setOnInsert") {
UpdateEngine::apply_set_on_insert(&mut updated, soi);
}
// Ensure _id exists.
let new_id = if !updated.contains_key("_id") {
let oid = ObjectId::new();
updated.insert("_id", oid);
Bson::ObjectId(oid)
} else {
updated.get("_id").unwrap().clone()
};
// Pre-check unique index constraints before upsert insert.
if let Some(engine) = ctx.indexes.get(&ns_key) {
if let Err(e) = engine.check_unique_constraints(&updated) {
write_errors.push(doc! {
"index": idx as i32,
"code": 11000_i32,
"codeName": "DuplicateKey",
"errmsg": e.to_string(),
});
if ordered {
break;
}
continue;
}
}
// Insert the new document.
match ctx.storage.insert_one(db, coll, updated.clone()).await {
Ok(id_str) => {
// Record upsert in oplog as an insert.
ctx.oplog.append(
OpType::Insert,
db,
coll,
&id_str,
Some(updated.clone()),
None,
);
// Update index (engine already initialized above).
if let Some(mut engine) = ctx.indexes.get_mut(&ns_key) {
if let Err(e) = engine.on_insert(&updated) {
tracing::error!(namespace = %ns_key, error = %e, "index update failed after upsert insert");
}
}
total_n += 1;
upserted_list.push(doc! {
"index": idx as i32,
"_id": new_id,
});
}
Err(e) => {
write_errors.push(doc! {
"index": idx as i32,
"code": 1_i32,
"codeName": "InternalError",
"errmsg": e.to_string(),
});
if ordered {
break;
}
}
}
}
Err(e) => {
write_errors.push(doc! {
"index": idx as i32,
"code": 14_i32,
"codeName": "TypeMismatch",
"errmsg": e.to_string(),
});
if ordered {
break;
}
}
}
} else {
// Update matched documents.
let docs_to_update = if multi {
all_docs
} else {
all_docs.into_iter().take(1).collect()
};
for matched_doc in &docs_to_update {
match UpdateEngine::apply_update(
matched_doc,
&update,
array_filters.as_deref(),
) {
Ok(updated_doc) => {
// Pre-check unique index constraints before storage write.
if let Some(engine) = ctx.indexes.get(&ns_key) {
if let Err(e) = engine.check_unique_constraints_for_update(matched_doc, &updated_doc) {
write_errors.push(doc! {
"index": idx as i32,
"code": 11000_i32,
"codeName": "DuplicateKey",
"errmsg": e.to_string(),
});
if ordered {
break;
}
continue;
}
}
let id_str = extract_id_string(matched_doc);
match ctx
.storage
.update_by_id(db, coll, &id_str, updated_doc.clone())
.await
{
Ok(()) => {
// Record in oplog.
ctx.oplog.append(
OpType::Update,
db,
coll,
&id_str,
Some(updated_doc.clone()),
Some(matched_doc.clone()),
);
// Update index.
if let Some(mut engine) = ctx.indexes.get_mut(&ns_key) {
if let Err(e) = engine.on_update(matched_doc, &updated_doc) {
tracing::error!(namespace = %ns_key, error = %e, "index update failed after update");
}
}
total_n += 1;
// Check if the document actually changed.
if matched_doc != &updated_doc {
total_n_modified += 1;
}
}
Err(e) => {
write_errors.push(doc! {
"index": idx as i32,
"code": 1_i32,
"codeName": "InternalError",
"errmsg": e.to_string(),
});
if ordered {
break;
}
}
}
}
Err(e) => {
write_errors.push(doc! {
"index": idx as i32,
"code": 14_i32,
"codeName": "TypeMismatch",
"errmsg": e.to_string(),
});
if ordered {
break;
}
}
}
}
}
}
// Build response.
let mut response = doc! {
"n": total_n,
"nModified": total_n_modified,
"ok": 1.0,
};
if !upserted_list.is_empty() {
response.insert(
"upserted",
upserted_list
.into_iter()
.map(Bson::Document)
.collect::<Vec<_>>(),
);
}
if !write_errors.is_empty() {
response.insert(
"writeErrors",
write_errors
.into_iter()
.map(Bson::Document)
.collect::<Vec<_>>(),
);
}
Ok(response)
}
/// Handle the `findAndModify` command.
async fn handle_find_and_modify(
cmd: &Document,
db: &str,
ctx: &CommandContext,
) -> CommandResult<Document> {
let coll = cmd
.get_str("findAndModify")
.or_else(|_| cmd.get_str("findandmodify"))
.map_err(|_| CommandError::InvalidArgument("missing 'findAndModify' field".into()))?;
let query = match cmd.get("query") {
Some(Bson::Document(d)) => d.clone(),
_ => Document::new(),
};
let sort = match cmd.get("sort") {
Some(Bson::Document(d)) => Some(d.clone()),
_ => None,
};
let update_doc = match cmd.get("update") {
Some(Bson::Document(d)) => Some(d.clone()),
_ => None,
};
let remove = match cmd.get("remove") {
Some(Bson::Boolean(b)) => *b,
_ => false,
};
let return_new = match cmd.get("new") {
Some(Bson::Boolean(b)) => *b,
_ => false,
};
let upsert = match cmd.get("upsert") {
Some(Bson::Boolean(b)) => *b,
_ => false,
};
let fields = match cmd.get("fields") {
Some(Bson::Document(d)) => Some(d.clone()),
_ => None,
};
let array_filters: Option<Vec<Document>> =
cmd.get_array("arrayFilters").ok().map(|arr| {
arr.iter()
.filter_map(|v| {
if let Bson::Document(d) = v {
Some(d.clone())
} else {
None
}
})
.collect()
});
// Auto-create database and collection.
ensure_collection_exists(db, coll, ctx).await?;
let ns_key = format!("{}.{}", db, coll);
// Ensure the IndexEngine is loaded with persisted specs.
drop(ctx.get_or_init_index_engine(db, coll).await);
// Load and filter documents.
let mut matched = load_filtered_docs(db, coll, &query, &ns_key, ctx).await?;
// Sort if specified.
if let Some(ref sort_spec) = sort {
sort_documents(&mut matched, sort_spec);
}
// Take the first match.
let target = matched.into_iter().next();
if remove {
// Remove operation.
if let Some(ref doc) = target {
let id_str = extract_id_string(doc);
ctx.storage.delete_by_id(db, coll, &id_str).await?;
// Record in oplog.
ctx.oplog.append(
OpType::Delete,
db,
coll,
&id_str,
None,
Some(doc.clone()),
);
// Update index.
if let Some(mut engine) = ctx.indexes.get_mut(&ns_key) {
engine.on_delete(doc);
}
let value = apply_fields_projection(doc, &fields);
return Ok(doc! {
"value": value,
"lastErrorObject": {
"n": 1_i32,
"updatedExisting": false,
},
"ok": 1.0,
});
} else {
return Ok(doc! {
"value": Bson::Null,
"lastErrorObject": {
"n": 0_i32,
"updatedExisting": false,
},
"ok": 1.0,
});
}
}
// Update operation.
let update = match update_doc {
Some(u) => u,
None => {
return Ok(doc! {
"value": Bson::Null,
"lastErrorObject": {
"n": 0_i32,
"updatedExisting": false,
},
"ok": 1.0,
});
}
};
if let Some(original_doc) = target {
// Update the matched document.
let updated_doc = UpdateEngine::apply_update(
&original_doc,
&update,
array_filters.as_deref(),
)
.map_err(|e| CommandError::InternalError(e.to_string()))?;
// Pre-check unique index constraints before storage write.
if let Some(engine) = ctx.indexes.get(&ns_key) {
if let Err(e) = engine.check_unique_constraints_for_update(&original_doc, &updated_doc) {
return Err(CommandError::StorageError(e.to_string()));
}
}
let id_str = extract_id_string(&original_doc);
ctx.storage
.update_by_id(db, coll, &id_str, updated_doc.clone())
.await?;
// Record in oplog.
ctx.oplog.append(
OpType::Update,
db,
coll,
&id_str,
Some(updated_doc.clone()),
Some(original_doc.clone()),
);
// Update index.
if let Some(mut engine) = ctx.indexes.get_mut(&ns_key) {
if let Err(e) = engine.on_update(&original_doc, &updated_doc) {
tracing::error!(namespace = %ns_key, error = %e, "index update failed after findAndModify update");
}
}
let return_doc = if return_new {
&updated_doc
} else {
&original_doc
};
let value = apply_fields_projection(return_doc, &fields);
Ok(doc! {
"value": value,
"lastErrorObject": {
"n": 1_i32,
"updatedExisting": true,
},
"ok": 1.0,
})
} else if upsert {
// Upsert: create a new document.
let new_doc = build_upsert_doc(&query);
let mut updated_doc = UpdateEngine::apply_update(
&new_doc,
&update,
array_filters.as_deref(),
)
.map_err(|e| CommandError::InternalError(e.to_string()))?;
// Apply $setOnInsert if present.
if let Some(Bson::Document(soi)) = update.get("$setOnInsert") {
UpdateEngine::apply_set_on_insert(&mut updated_doc, soi);
}
// Ensure _id.
let upserted_id = if !updated_doc.contains_key("_id") {
let oid = ObjectId::new();
updated_doc.insert("_id", oid);
Bson::ObjectId(oid)
} else {
updated_doc.get("_id").unwrap().clone()
};
// Pre-check unique index constraints before upsert insert.
if let Some(engine) = ctx.indexes.get(&ns_key) {
if let Err(e) = engine.check_unique_constraints(&updated_doc) {
return Err(CommandError::StorageError(e.to_string()));
}
}
let inserted_id_str = ctx.storage
.insert_one(db, coll, updated_doc.clone())
.await?;
// Record upsert in oplog as an insert.
ctx.oplog.append(
OpType::Insert,
db,
coll,
&inserted_id_str,
Some(updated_doc.clone()),
None,
);
// Update index.
{
if let Some(mut engine) = ctx.indexes.get_mut(&ns_key) {
if let Err(e) = engine.on_insert(&updated_doc) {
tracing::error!(namespace = %ns_key, error = %e, "index update failed after findAndModify upsert");
}
}
}
let value = if return_new {
apply_fields_projection(&updated_doc, &fields)
} else {
Bson::Null
};
Ok(doc! {
"value": value,
"lastErrorObject": {
"n": 1_i32,
"updatedExisting": false,
"upserted": upserted_id,
},
"ok": 1.0,
})
} else {
Ok(doc! {
"value": Bson::Null,
"lastErrorObject": {
"n": 0_i32,
"updatedExisting": false,
},
"ok": 1.0,
})
}
}
// ---- Helpers ----
/// Load documents from storage, optionally using index for candidate narrowing, then filter.
async fn load_filtered_docs(
db: &str,
coll: &str,
filter: &Document,
ns_key: &str,
ctx: &CommandContext,
) -> CommandResult<Vec<Document>> {
// Try to use index to narrow candidates.
let candidate_ids: Option<HashSet<String>> = ctx
.indexes
.get(ns_key)
.and_then(|engine| engine.find_candidate_ids(filter));
let docs = if let Some(ids) = candidate_ids {
if ids.is_empty() {
return Ok(Vec::new());
}
ctx.storage.find_by_ids(db, coll, ids).await?
} else {
ctx.storage.find_all(db, coll).await?
};
// Apply filter.
if filter.is_empty() {
Ok(docs)
} else {
Ok(QueryMatcher::filter(&docs, filter))
}
}
/// Build a base document for an upsert from the filter's equality conditions.
fn build_upsert_doc(filter: &Document) -> Document {
let mut doc = Document::new();
for (key, value) in filter {
if key.starts_with('$') {
// Skip top-level operators like $and, $or.
continue;
}
match value {
Bson::Document(d) if d.keys().any(|k| k.starts_with('$')) => {
// If the value has operators (e.g., $gt), extract $eq if present.
if let Some(eq_val) = d.get("$eq") {
doc.insert(key.clone(), eq_val.clone());
}
}
_ => {
doc.insert(key.clone(), value.clone());
}
}
}
doc
}
/// Extract _id as a string for storage operations.
fn extract_id_string(doc: &Document) -> String {
match doc.get("_id") {
Some(Bson::ObjectId(oid)) => oid.to_hex(),
Some(Bson::String(s)) => s.clone(),
Some(other) => format!("{}", other),
None => String::new(),
}
}
/// Apply fields projection if specified, returning Bson.
fn apply_fields_projection(doc: &Document, fields: &Option<Document>) -> Bson {
match fields {
Some(proj) if !proj.is_empty() => Bson::Document(apply_projection(doc, proj)),
_ => Bson::Document(doc.clone()),
}
}
/// Ensure the target database and collection exist, creating them if needed.
async fn ensure_collection_exists(
db: &str,
coll: &str,
ctx: &CommandContext,
) -> CommandResult<()> {
if let Err(e) = ctx.storage.create_database(db).await {
let msg = e.to_string();
if !msg.contains("AlreadyExists") && !msg.contains("already exists") {
return Err(CommandError::StorageError(msg));
}
}
match ctx.storage.collection_exists(db, coll).await {
Ok(true) => {}
Ok(false) => {
if let Err(e) = ctx.storage.create_collection(db, coll).await {
let msg = e.to_string();
if !msg.contains("AlreadyExists") && !msg.contains("already exists") {
return Err(CommandError::StorageError(msg));
}
}
}
Err(e) => {
if let Err(e2) = ctx.storage.create_collection(db, coll).await {
let msg = e2.to_string();
if !msg.contains("AlreadyExists") && !msg.contains("already exists") {
return Err(CommandError::StorageError(format!(
"collection_exists failed: {e}; create_collection failed: {msg}"
)));
}
}
}
}
Ok(())
}
+8
View File
@@ -0,0 +1,8 @@
mod context;
pub mod error;
pub mod handlers;
mod router;
pub use context::{CommandContext, CursorState};
pub use error::{CommandError, CommandResult};
pub use router::CommandRouter;
+109
View File
@@ -0,0 +1,109 @@
use std::sync::Arc;
use bson::Document;
use tracing::{debug, warn};
use rustdb_wire::ParsedCommand;
use crate::context::CommandContext;
use crate::error::CommandError;
use crate::handlers;
/// Routes parsed wire protocol commands to the appropriate handler.
pub struct CommandRouter {
ctx: Arc<CommandContext>,
}
impl CommandRouter {
/// Create a new command router with the given context.
pub fn new(ctx: Arc<CommandContext>) -> Self {
Self { ctx }
}
/// Route a parsed command to the appropriate handler, returning a BSON response document.
pub async fn route(&self, cmd: &ParsedCommand) -> Document {
let db = &cmd.database;
let command_name = cmd.command_name.as_str();
debug!(command = %command_name, database = %db, "routing command");
// Extract session id if present, and touch the session.
if let Some(lsid) = cmd.command.get("lsid") {
if let Some(session_id) = rustdb_txn::SessionEngine::extract_session_id(lsid) {
self.ctx.sessions.get_or_create_session(&session_id);
}
}
let result = match command_name {
// -- handshake / monitoring --
"hello" | "ismaster" | "isMaster" => {
handlers::hello_handler::handle(&cmd.command, db, &self.ctx).await
}
// -- query commands --
"find" => {
handlers::find_handler::handle(&cmd.command, db, &self.ctx).await
}
"getMore" => {
handlers::find_handler::handle_get_more(&cmd.command, db, &self.ctx).await
}
"killCursors" => {
handlers::find_handler::handle_kill_cursors(&cmd.command, db, &self.ctx).await
}
"count" => {
handlers::find_handler::handle_count(&cmd.command, db, &self.ctx).await
}
"distinct" => {
handlers::find_handler::handle_distinct(&cmd.command, db, &self.ctx).await
}
// -- write commands --
"insert" => {
handlers::insert_handler::handle(&cmd.command, db, &self.ctx, cmd.document_sequences.as_ref()).await
}
"update" | "findAndModify" => {
handlers::update_handler::handle(&cmd.command, db, &self.ctx, command_name).await
}
"delete" => {
handlers::delete_handler::handle(&cmd.command, db, &self.ctx).await
}
// -- aggregation --
"aggregate" => {
handlers::aggregate_handler::handle(&cmd.command, db, &self.ctx).await
}
// -- index management --
"createIndexes" | "dropIndexes" | "listIndexes" => {
handlers::index_handler::handle(&cmd.command, db, &self.ctx, command_name).await
}
// -- admin commands --
"ping" | "buildInfo" | "buildinfo" | "serverStatus" | "hostInfo"
| "whatsmyuri" | "getLog" | "replSetGetStatus" | "getCmdLineOpts"
| "getParameter" | "getFreeMonitoringStatus" | "setFreeMonitoring"
| "getShardMap" | "shardingState" | "atlasVersion"
| "connectionStatus" | "listDatabases" | "listCollections"
| "create" | "drop" | "dropDatabase" | "renameCollection"
| "dbStats" | "collStats" | "validate" | "explain"
| "startSession" | "endSessions" | "killSessions"
| "commitTransaction" | "abortTransaction"
| "saslStart" | "saslContinue" | "authenticate" | "logout"
| "currentOp" | "killOp" | "top" | "profile"
| "compact" | "reIndex" | "fsync" | "connPoolSync" => {
handlers::admin_handler::handle(&cmd.command, db, &self.ctx, command_name).await
}
// -- unknown command --
other => {
warn!(command = %other, "unknown command");
Err(CommandError::NotImplemented(other.to_string()))
}
};
match result {
Ok(doc) => doc,
Err(e) => e.to_error_doc(),
}
}
}
+12
View File
@@ -0,0 +1,12 @@
[package]
name = "rustdb-config"
version.workspace = true
edition.workspace = true
license.workspace = true
authors.workspace = true
description = "Configuration types for RustDb, compatible with SmartDB JSON schema"
[dependencies]
serde = { workspace = true }
serde_json = { workspace = true }
thiserror = { workspace = true }
+181
View File
@@ -0,0 +1,181 @@
use serde::{Deserialize, Serialize};
/// Storage backend type.
#[derive(Debug, Clone, Serialize, Deserialize, PartialEq, Eq)]
#[serde(rename_all = "lowercase")]
pub enum StorageType {
Memory,
File,
}
impl Default for StorageType {
fn default() -> Self {
StorageType::Memory
}
}
/// Top-level configuration for RustDb server.
/// Field names use camelCase to match the TypeScript SmartdbServer options.
#[derive(Debug, Clone, Serialize, Deserialize)]
#[serde(rename_all = "camelCase")]
pub struct RustDbOptions {
/// TCP port to listen on (default: 27017)
#[serde(default = "default_port")]
pub port: u16,
/// Host/IP to bind to (default: "127.0.0.1")
#[serde(default = "default_host")]
pub host: String,
/// Unix socket path (overrides TCP if set)
#[serde(skip_serializing_if = "Option::is_none")]
pub socket_path: Option<String>,
/// Storage backend type
#[serde(default)]
pub storage: StorageType,
/// Base path for file storage (required when storage = "file")
#[serde(skip_serializing_if = "Option::is_none")]
pub storage_path: Option<String>,
/// Path for periodic persistence of in-memory data
#[serde(skip_serializing_if = "Option::is_none")]
pub persist_path: Option<String>,
/// Interval in ms for periodic persistence (default: 60000)
#[serde(default = "default_persist_interval")]
pub persist_interval_ms: u64,
}
fn default_port() -> u16 {
27017
}
fn default_host() -> String {
"127.0.0.1".to_string()
}
fn default_persist_interval() -> u64 {
60000
}
impl Default for RustDbOptions {
fn default() -> Self {
Self {
port: default_port(),
host: default_host(),
socket_path: None,
storage: StorageType::default(),
storage_path: None,
persist_path: None,
persist_interval_ms: default_persist_interval(),
}
}
}
impl RustDbOptions {
/// Load options from a JSON config file.
pub fn from_file(path: &str) -> Result<Self, ConfigError> {
let content = std::fs::read_to_string(path)
.map_err(|e| ConfigError::IoError(e.to_string()))?;
let options: Self = serde_json::from_str(&content)
.map_err(|e| ConfigError::ParseError(e.to_string()))?;
options.validate()?;
Ok(options)
}
/// Validate the configuration.
pub fn validate(&self) -> Result<(), ConfigError> {
if self.storage == StorageType::File && self.storage_path.is_none() {
return Err(ConfigError::ValidationError(
"storagePath is required when storage is 'file'".to_string(),
));
}
Ok(())
}
/// Get the connection URI for this server configuration.
pub fn connection_uri(&self) -> String {
if let Some(ref socket_path) = self.socket_path {
let encoded = urlencoding(socket_path);
format!("mongodb://{}", encoded)
} else {
format!("mongodb://{}:{}", self.host, self.port)
}
}
}
/// Simple URL encoding for socket paths (encode / as %2F, etc.)
fn urlencoding(s: &str) -> String {
s.chars()
.map(|c| match c {
'/' => "%2F".to_string(),
':' => "%3A".to_string(),
' ' => "%20".to_string(),
_ => c.to_string(),
})
.collect()
}
/// Configuration errors.
#[derive(Debug, thiserror::Error)]
pub enum ConfigError {
#[error("IO error: {0}")]
IoError(String),
#[error("Parse error: {0}")]
ParseError(String),
#[error("Validation error: {0}")]
ValidationError(String),
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn test_default_options() {
let opts = RustDbOptions::default();
assert_eq!(opts.port, 27017);
assert_eq!(opts.host, "127.0.0.1");
assert!(opts.socket_path.is_none());
assert_eq!(opts.storage, StorageType::Memory);
}
#[test]
fn test_deserialize_from_json() {
let json = r#"{"port": 27018, "storage": "file", "storagePath": "./data"}"#;
let opts: RustDbOptions = serde_json::from_str(json).unwrap();
assert_eq!(opts.port, 27018);
assert_eq!(opts.storage, StorageType::File);
assert_eq!(opts.storage_path, Some("./data".to_string()));
}
#[test]
fn test_connection_uri_tcp() {
let opts = RustDbOptions::default();
assert_eq!(opts.connection_uri(), "mongodb://127.0.0.1:27017");
}
#[test]
fn test_connection_uri_socket() {
let opts = RustDbOptions {
socket_path: Some("/tmp/smartdb-test.sock".to_string()),
..Default::default()
};
assert_eq!(
opts.connection_uri(),
"mongodb://%2Ftmp%2Fsmartdb-test.sock"
);
}
#[test]
fn test_validation_file_storage_requires_path() {
let opts = RustDbOptions {
storage: StorageType::File,
storage_path: None,
..Default::default()
};
assert!(opts.validate().is_err());
}
}
+15
View File
@@ -0,0 +1,15 @@
[package]
name = "rustdb-index"
version.workspace = true
edition.workspace = true
license.workspace = true
authors.workspace = true
description = "MongoDB-compatible B-tree and hash index engine with query planner for RustDb"
[dependencies]
bson = { workspace = true }
serde = { workspace = true }
serde_json = { workspace = true }
thiserror = { workspace = true }
tracing = { workspace = true }
rustdb-query = { workspace = true }
+740
View File
@@ -0,0 +1,740 @@
use std::collections::{BTreeMap, BTreeSet, HashMap, HashSet};
use bson::{Bson, Document};
use tracing::{debug, trace};
use rustdb_query::get_nested_value;
use crate::error::IndexError;
/// Options for creating an index.
#[derive(Debug, Clone, Default)]
pub struct IndexOptions {
/// Custom name for the index. Auto-generated if None.
pub name: Option<String>,
/// Whether the index enforces unique values.
pub unique: bool,
/// Whether the index skips documents missing the indexed field.
pub sparse: bool,
/// TTL in seconds (for date fields). None means no expiry.
pub expire_after_seconds: Option<u64>,
}
/// Metadata about an existing index.
#[derive(Debug, Clone)]
pub struct IndexInfo {
/// Index version (always 2).
pub v: i32,
/// The key specification document (e.g. {"name": 1}).
pub key: Document,
/// The index name.
pub name: String,
/// Whether the index enforces uniqueness.
pub unique: bool,
/// Whether the index is sparse.
pub sparse: bool,
/// TTL expiry in seconds, if set.
pub expire_after_seconds: Option<u64>,
}
/// Internal data for a single index.
struct IndexData {
/// The key specification (field -> direction).
key: Document,
/// The index name.
name: String,
/// Whether uniqueness is enforced.
unique: bool,
/// Whether the index is sparse.
sparse: bool,
/// TTL in seconds.
expire_after_seconds: Option<u64>,
/// B-tree for range queries: serialized key bytes -> set of document _id hex strings.
btree: BTreeMap<Vec<u8>, BTreeSet<String>>,
/// Hash map for equality lookups: serialized key bytes -> set of document _id hex strings.
hash: HashMap<Vec<u8>, HashSet<String>>,
}
impl IndexData {
fn new(key: Document, name: String, unique: bool, sparse: bool, expire_after_seconds: Option<u64>) -> Self {
Self {
key,
name,
unique,
sparse,
expire_after_seconds,
btree: BTreeMap::new(),
hash: HashMap::new(),
}
}
fn to_info(&self) -> IndexInfo {
IndexInfo {
v: 2,
key: self.key.clone(),
name: self.name.clone(),
unique: self.unique,
sparse: self.sparse,
expire_after_seconds: self.expire_after_seconds,
}
}
}
/// Manages indexes for a single collection.
pub struct IndexEngine {
/// All indexes keyed by name.
indexes: HashMap<String, IndexData>,
}
impl IndexEngine {
/// Create a new IndexEngine with the default `_id_` index.
pub fn new() -> Self {
let mut indexes = HashMap::new();
let id_key = bson::doc! { "_id": 1 };
let id_index = IndexData::new(id_key, "_id_".to_string(), true, false, None);
indexes.insert("_id_".to_string(), id_index);
Self { indexes }
}
/// Create a new index. Returns the index name.
pub fn create_index(&mut self, key: Document, options: IndexOptions) -> Result<String, IndexError> {
if key.is_empty() {
return Err(IndexError::InvalidIndex("Index key must have at least one field".to_string()));
}
let name = options.name.unwrap_or_else(|| Self::generate_index_name(&key));
if self.indexes.contains_key(&name) {
debug!(index_name = %name, "Index already exists, returning existing");
return Ok(name);
}
debug!(index_name = %name, unique = options.unique, sparse = options.sparse, "Creating index");
let index_data = IndexData::new(
key,
name.clone(),
options.unique,
options.sparse,
options.expire_after_seconds,
);
self.indexes.insert(name.clone(), index_data);
Ok(name)
}
/// Drop an index by name. Returns true if the index existed.
/// Cannot drop the `_id_` index.
pub fn drop_index(&mut self, name: &str) -> Result<bool, IndexError> {
if name == "_id_" {
return Err(IndexError::ProtectedIndex("_id_".to_string()));
}
let existed = self.indexes.remove(name).is_some();
if existed {
debug!(index_name = %name, "Dropped index");
}
Ok(existed)
}
/// Drop all indexes except `_id_`.
pub fn drop_all_indexes(&mut self) {
self.indexes.retain(|name, _| name == "_id_");
debug!("Dropped all non-_id indexes");
}
/// List all indexes.
pub fn list_indexes(&self) -> Vec<IndexInfo> {
self.indexes.values().map(|idx| idx.to_info()).collect()
}
/// Check whether an index with the given name exists.
pub fn index_exists(&self, name: &str) -> bool {
self.indexes.contains_key(name)
}
/// Check unique constraints for a document without modifying the index.
/// Returns Ok(()) if no conflict, Err(DuplicateKey) if a unique constraint
/// would be violated. This is a read-only check (immutable &self).
pub fn check_unique_constraints(&self, doc: &Document) -> Result<(), IndexError> {
for idx in self.indexes.values() {
if idx.unique {
let key_bytes = Self::extract_key_bytes(doc, &idx.key, idx.sparse);
if let Some(ref kb) = key_bytes {
if let Some(existing_ids) = idx.hash.get(kb) {
if !existing_ids.is_empty() {
return Err(IndexError::DuplicateKey {
index: idx.name.clone(),
key: format!("{:?}", kb),
});
}
}
}
}
}
Ok(())
}
/// Check unique constraints for an update, excluding the document being updated.
/// Returns Ok(()) if no conflict. This is a read-only check (immutable &self).
pub fn check_unique_constraints_for_update(
&self,
old_doc: &Document,
new_doc: &Document,
) -> Result<(), IndexError> {
let doc_id = Self::extract_id(old_doc);
for idx in self.indexes.values() {
if idx.unique {
let new_key_bytes = Self::extract_key_bytes(new_doc, &idx.key, idx.sparse);
if let Some(ref kb) = new_key_bytes {
if let Some(existing_ids) = idx.hash.get(kb) {
let has_conflict = existing_ids.iter().any(|id| *id != doc_id);
if has_conflict {
return Err(IndexError::DuplicateKey {
index: idx.name.clone(),
key: format!("{:?}", kb),
});
}
}
}
}
}
Ok(())
}
/// Notify the engine that a document has been inserted.
/// Checks unique constraints and updates all index structures.
pub fn on_insert(&mut self, doc: &Document) -> Result<(), IndexError> {
let doc_id = Self::extract_id(doc);
// First pass: check unique constraints
for idx in self.indexes.values() {
if idx.unique {
let key_bytes = Self::extract_key_bytes(doc, &idx.key, idx.sparse);
if let Some(ref kb) = key_bytes {
if let Some(existing_ids) = idx.hash.get(kb) {
if !existing_ids.is_empty() {
return Err(IndexError::DuplicateKey {
index: idx.name.clone(),
key: format!("{:?}", kb),
});
}
}
}
}
}
// Second pass: insert into all indexes
for idx in self.indexes.values_mut() {
let key_bytes = Self::extract_key_bytes(doc, &idx.key, idx.sparse);
if let Some(kb) = key_bytes {
idx.btree.entry(kb.clone()).or_default().insert(doc_id.clone());
idx.hash.entry(kb).or_default().insert(doc_id.clone());
}
}
trace!(doc_id = %doc_id, "Indexed document on insert");
Ok(())
}
/// Notify the engine that a document has been updated.
pub fn on_update(&mut self, old_doc: &Document, new_doc: &Document) -> Result<(), IndexError> {
let doc_id = Self::extract_id(old_doc);
// Check unique constraints for the new document (excluding the document itself)
for idx in self.indexes.values() {
if idx.unique {
let new_key_bytes = Self::extract_key_bytes(new_doc, &idx.key, idx.sparse);
if let Some(ref kb) = new_key_bytes {
if let Some(existing_ids) = idx.hash.get(kb) {
// If there are existing entries that aren't this document, it's a conflict
let other_ids: HashSet<_> = existing_ids.iter()
.filter(|id| **id != doc_id)
.collect();
if !other_ids.is_empty() {
return Err(IndexError::DuplicateKey {
index: idx.name.clone(),
key: format!("{:?}", kb),
});
}
}
}
}
}
// Remove old entries and insert new ones
for idx in self.indexes.values_mut() {
let old_key_bytes = Self::extract_key_bytes(old_doc, &idx.key, idx.sparse);
if let Some(ref kb) = old_key_bytes {
if let Some(set) = idx.btree.get_mut(kb) {
set.remove(&doc_id);
if set.is_empty() {
idx.btree.remove(kb);
}
}
if let Some(set) = idx.hash.get_mut(kb) {
set.remove(&doc_id);
if set.is_empty() {
idx.hash.remove(kb);
}
}
}
let new_key_bytes = Self::extract_key_bytes(new_doc, &idx.key, idx.sparse);
if let Some(kb) = new_key_bytes {
idx.btree.entry(kb.clone()).or_default().insert(doc_id.clone());
idx.hash.entry(kb).or_default().insert(doc_id.clone());
}
}
trace!(doc_id = %doc_id, "Re-indexed document on update");
Ok(())
}
/// Notify the engine that a document has been deleted.
pub fn on_delete(&mut self, doc: &Document) {
let doc_id = Self::extract_id(doc);
for idx in self.indexes.values_mut() {
let key_bytes = Self::extract_key_bytes(doc, &idx.key, idx.sparse);
if let Some(ref kb) = key_bytes {
if let Some(set) = idx.btree.get_mut(kb) {
set.remove(&doc_id);
if set.is_empty() {
idx.btree.remove(kb);
}
}
if let Some(set) = idx.hash.get_mut(kb) {
set.remove(&doc_id);
if set.is_empty() {
idx.hash.remove(kb);
}
}
}
}
trace!(doc_id = %doc_id, "Removed document from indexes");
}
/// Attempt to find candidate document IDs using indexes for the given filter.
/// Returns `None` if no suitable index is found (meaning a COLLSCAN is needed).
/// Returns `Some(set)` with candidate IDs that should be checked against the full filter.
pub fn find_candidate_ids(&self, filter: &Document) -> Option<HashSet<String>> {
if filter.is_empty() {
return None;
}
// Try each index to see which can serve this query
let mut best_candidates: Option<HashSet<String>> = None;
let mut best_score: f64 = 0.0;
for idx in self.indexes.values() {
if let Some((candidates, score)) = self.try_index_lookup(idx, filter) {
if score > best_score {
best_score = score;
best_candidates = Some(candidates);
}
}
}
best_candidates
}
/// Rebuild all indexes from a full set of documents.
pub fn rebuild_from_documents(&mut self, docs: &[Document]) {
// Clear all index data
for idx in self.indexes.values_mut() {
idx.btree.clear();
idx.hash.clear();
}
// Re-index all documents
for doc in docs {
let doc_id = Self::extract_id(doc);
for idx in self.indexes.values_mut() {
let key_bytes = Self::extract_key_bytes(doc, &idx.key, idx.sparse);
if let Some(kb) = key_bytes {
idx.btree.entry(kb.clone()).or_default().insert(doc_id.clone());
idx.hash.entry(kb).or_default().insert(doc_id.clone());
}
}
}
debug!(num_docs = docs.len(), num_indexes = self.indexes.len(), "Rebuilt all indexes");
}
// ---- Internal helpers ----
/// Try to use an index for the given filter. Returns candidate IDs and a score.
fn try_index_lookup(&self, idx: &IndexData, filter: &Document) -> Option<(HashSet<String>, f64)> {
let index_fields: Vec<String> = idx.key.keys().map(|k| k.to_string()).collect();
// Check if the filter uses fields covered by this index
let mut matched_any = false;
let mut result_set: Option<HashSet<String>> = None;
let mut total_score: f64 = 0.0;
for field in &index_fields {
if let Some(condition) = filter.get(field) {
matched_any = true;
let (candidates, score) = self.lookup_field(idx, field, condition);
total_score += score;
// Add unique bonus
if idx.unique {
total_score += 0.5;
}
result_set = Some(match result_set {
Some(existing) => existing.intersection(&candidates).cloned().collect(),
None => candidates,
});
}
}
if !matched_any {
return None;
}
result_set.map(|rs| (rs, total_score))
}
/// Look up candidates for a single field condition in an index.
fn lookup_field(&self, idx: &IndexData, field: &str, condition: &Bson) -> (HashSet<String>, f64) {
match condition {
// Equality match
Bson::Document(cond_doc) if Self::has_operators(cond_doc) => {
self.lookup_operator(idx, field, cond_doc)
}
// Direct equality
_ => {
let key_bytes = Self::bson_to_key_bytes(condition);
let candidates = idx.hash
.get(&key_bytes)
.cloned()
.unwrap_or_default();
(candidates, 2.0) // equality score
}
}
}
/// Handle operator-based lookups ($eq, $in, $gt, $lt, etc.).
fn lookup_operator(&self, idx: &IndexData, field: &str, operators: &Document) -> (HashSet<String>, f64) {
let mut candidates = HashSet::new();
let mut score: f64 = 0.0;
let mut has_range = false;
for (op, value) in operators {
match op.as_str() {
"$eq" => {
let key_bytes = Self::bson_to_key_bytes(value);
if let Some(ids) = idx.hash.get(&key_bytes) {
candidates = if candidates.is_empty() {
ids.clone()
} else {
candidates.intersection(ids).cloned().collect()
};
}
score += 2.0;
}
"$in" => {
if let Bson::Array(arr) = value {
let mut in_candidates = HashSet::new();
for v in arr {
let key_bytes = Self::bson_to_key_bytes(v);
if let Some(ids) = idx.hash.get(&key_bytes) {
in_candidates.extend(ids.iter().cloned());
}
}
candidates = if candidates.is_empty() {
in_candidates
} else {
candidates.intersection(&in_candidates).cloned().collect()
};
score += 1.5;
}
}
"$gt" | "$gte" | "$lt" | "$lte" => {
let range_candidates = self.range_scan(idx, field, op.as_str(), value);
candidates = if candidates.is_empty() && !has_range {
range_candidates
} else {
candidates.intersection(&range_candidates).cloned().collect()
};
has_range = true;
score += 1.0;
}
_ => {
// Operators like $ne, $nin, $exists, $regex are not efficiently indexable
// Return all indexed IDs for this index
}
}
}
// If we only had non-indexable operators, return empty with 0 score
if score == 0.0 {
return (HashSet::new(), 0.0);
}
(candidates, score)
}
/// Perform a range scan on the B-tree index.
fn range_scan(&self, idx: &IndexData, _field: &str, op: &str, bound: &Bson) -> HashSet<String> {
let bound_bytes = Self::bson_to_key_bytes(bound);
let mut result = HashSet::new();
match op {
"$gt" => {
use std::ops::Bound;
for (_key, ids) in idx.btree.range((Bound::Excluded(bound_bytes), Bound::Unbounded)) {
result.extend(ids.iter().cloned());
}
}
"$gte" => {
for (_key, ids) in idx.btree.range(bound_bytes..) {
result.extend(ids.iter().cloned());
}
}
"$lt" => {
for (_key, ids) in idx.btree.range(..bound_bytes) {
result.extend(ids.iter().cloned());
}
}
"$lte" => {
for (_key, ids) in idx.btree.range(..=bound_bytes) {
result.extend(ids.iter().cloned());
}
}
_ => {}
}
result
}
/// Generate an index name from the key spec (e.g. {"name": 1, "age": -1} -> "name_1_age_-1").
fn generate_index_name(key: &Document) -> String {
key.iter()
.map(|(field, dir)| {
let dir_val = match dir {
Bson::Int32(n) => n.to_string(),
Bson::Int64(n) => n.to_string(),
Bson::String(s) => s.clone(),
_ => "1".to_string(),
};
format!("{}_{}", field, dir_val)
})
.collect::<Vec<_>>()
.join("_")
}
/// Extract the `_id` field from a document as a hex string.
fn extract_id(doc: &Document) -> String {
match doc.get("_id") {
Some(Bson::ObjectId(oid)) => oid.to_hex(),
Some(Bson::String(s)) => s.clone(),
Some(other) => format!("{}", other),
None => String::new(),
}
}
/// Extract the index key bytes from a document for a given key specification.
/// Returns `None` if the document should be skipped (sparse index with missing fields).
fn extract_key_bytes(doc: &Document, key_spec: &Document, sparse: bool) -> Option<Vec<u8>> {
let fields: Vec<(&str, &Bson)> = key_spec.iter().map(|(k, v)| (k.as_str(), v)).collect();
if fields.len() == 1 {
// Single-field index
let field = fields[0].0;
let value = Self::resolve_field_value(doc, field);
if sparse && value.is_none() {
return None;
}
let val = value.unwrap_or(Bson::Null);
Some(Self::bson_to_key_bytes(&val))
} else {
// Compound index: concatenate field values
let mut all_null = true;
let mut compound_bytes = Vec::new();
for (field, _dir) in &fields {
let value = Self::resolve_field_value(doc, field);
if value.is_some() {
all_null = false;
}
let val = value.unwrap_or(Bson::Null);
let field_bytes = Self::bson_to_key_bytes(&val);
// Length-prefix each field for unambiguous concatenation
compound_bytes.extend_from_slice(&(field_bytes.len() as u32).to_be_bytes());
compound_bytes.extend_from_slice(&field_bytes);
}
if sparse && all_null {
return None;
}
Some(compound_bytes)
}
}
/// Resolve a field value from a document, supporting dot notation.
fn resolve_field_value(doc: &Document, field: &str) -> Option<Bson> {
if field.contains('.') {
get_nested_value(doc, field)
} else {
doc.get(field).cloned()
}
}
/// Serialize a BSON value to bytes for use as an index key.
fn bson_to_key_bytes(value: &Bson) -> Vec<u8> {
// Use BSON raw serialization for consistent byte representation.
// We wrap in a document since raw BSON requires a top-level document.
let wrapper = bson::doc! { "k": value.clone() };
let raw = bson::to_vec(&wrapper).unwrap_or_default();
raw
}
fn has_operators(doc: &Document) -> bool {
doc.keys().any(|k| k.starts_with('$'))
}
}
impl Default for IndexEngine {
fn default() -> Self {
Self::new()
}
}
#[cfg(test)]
mod tests {
use super::*;
use bson::oid::ObjectId;
fn make_doc(name: &str, age: i32) -> Document {
bson::doc! {
"_id": ObjectId::new(),
"name": name,
"age": age,
}
}
#[test]
fn test_default_id_index() {
let engine = IndexEngine::new();
assert!(engine.index_exists("_id_"));
assert_eq!(engine.list_indexes().len(), 1);
}
#[test]
fn test_create_and_drop_index() {
let mut engine = IndexEngine::new();
let name = engine.create_index(
bson::doc! { "name": 1 },
IndexOptions::default(),
).unwrap();
assert_eq!(name, "name_1");
assert!(engine.index_exists("name_1"));
assert!(engine.drop_index("name_1").unwrap());
assert!(!engine.index_exists("name_1"));
}
#[test]
fn test_cannot_drop_id_index() {
let mut engine = IndexEngine::new();
let result = engine.drop_index("_id_");
assert!(result.is_err());
}
#[test]
fn test_unique_constraint() {
let mut engine = IndexEngine::new();
engine.create_index(
bson::doc! { "email": 1 },
IndexOptions { unique: true, ..Default::default() },
).unwrap();
let doc1 = bson::doc! { "_id": ObjectId::new(), "email": "a@b.com" };
let doc2 = bson::doc! { "_id": ObjectId::new(), "email": "a@b.com" };
engine.on_insert(&doc1).unwrap();
let result = engine.on_insert(&doc2);
assert!(result.is_err());
}
#[test]
fn test_find_candidates_equality() {
let mut engine = IndexEngine::new();
engine.create_index(
bson::doc! { "name": 1 },
IndexOptions::default(),
).unwrap();
let doc1 = make_doc("Alice", 30);
let doc2 = make_doc("Bob", 25);
let doc3 = make_doc("Alice", 35);
engine.on_insert(&doc1).unwrap();
engine.on_insert(&doc2).unwrap();
engine.on_insert(&doc3).unwrap();
let filter = bson::doc! { "name": "Alice" };
let candidates = engine.find_candidate_ids(&filter);
assert!(candidates.is_some());
assert_eq!(candidates.unwrap().len(), 2);
}
#[test]
fn test_on_delete() {
let mut engine = IndexEngine::new();
engine.create_index(
bson::doc! { "name": 1 },
IndexOptions::default(),
).unwrap();
let doc = make_doc("Alice", 30);
engine.on_insert(&doc).unwrap();
let filter = bson::doc! { "name": "Alice" };
assert!(engine.find_candidate_ids(&filter).is_some());
engine.on_delete(&doc);
let candidates = engine.find_candidate_ids(&filter);
assert!(candidates.is_some());
assert!(candidates.unwrap().is_empty());
}
#[test]
fn test_rebuild_from_documents() {
let mut engine = IndexEngine::new();
engine.create_index(
bson::doc! { "name": 1 },
IndexOptions::default(),
).unwrap();
let docs = vec![
make_doc("Alice", 30),
make_doc("Bob", 25),
];
engine.rebuild_from_documents(&docs);
let filter = bson::doc! { "name": "Alice" };
let candidates = engine.find_candidate_ids(&filter);
assert!(candidates.is_some());
assert_eq!(candidates.unwrap().len(), 1);
}
#[test]
fn test_drop_all_indexes() {
let mut engine = IndexEngine::new();
engine.create_index(bson::doc! { "a": 1 }, IndexOptions::default()).unwrap();
engine.create_index(bson::doc! { "b": 1 }, IndexOptions::default()).unwrap();
assert_eq!(engine.list_indexes().len(), 3);
engine.drop_all_indexes();
assert_eq!(engine.list_indexes().len(), 1);
assert!(engine.index_exists("_id_"));
}
}
+15
View File
@@ -0,0 +1,15 @@
/// Errors from index operations.
#[derive(Debug, thiserror::Error)]
pub enum IndexError {
#[error("Duplicate key error: index '{index}' has duplicate value for key {key}")]
DuplicateKey { index: String, key: String },
#[error("Index not found: {0}")]
IndexNotFound(String),
#[error("Invalid index specification: {0}")]
InvalidIndex(String),
#[error("Cannot drop protected index: {0}")]
ProtectedIndex(String),
}
+7
View File
@@ -0,0 +1,7 @@
mod engine;
mod planner;
pub mod error;
pub use engine::{IndexEngine, IndexInfo, IndexOptions};
pub use planner::{QueryPlan, QueryPlanner};
pub use error::IndexError;
+239
View File
@@ -0,0 +1,239 @@
use std::collections::HashSet;
use bson::{Bson, Document};
use tracing::debug;
use crate::engine::IndexEngine;
/// The execution plan for a query.
#[derive(Debug, Clone)]
pub enum QueryPlan {
/// Full collection scan - no suitable index found.
CollScan,
/// Index scan with exact/equality matches.
IxScan {
/// Name of the index used.
index_name: String,
/// Candidate document IDs from the index.
candidate_ids: HashSet<String>,
},
/// Index scan with range-based matches.
IxScanRange {
/// Name of the index used.
index_name: String,
/// Candidate document IDs from the range scan.
candidate_ids: HashSet<String>,
},
}
/// Plans query execution by selecting the best available index.
pub struct QueryPlanner;
impl QueryPlanner {
/// Analyze a filter and the available indexes to produce a query plan.
pub fn plan(filter: &Document, engine: &IndexEngine) -> QueryPlan {
if filter.is_empty() {
debug!("Empty filter -> CollScan");
return QueryPlan::CollScan;
}
let indexes = engine.list_indexes();
let mut best_plan: Option<QueryPlan> = None;
let mut best_score: f64 = 0.0;
for idx_info in &indexes {
let index_fields: Vec<String> = idx_info.key.keys().map(|k| k.to_string()).collect();
let mut matched = false;
let mut score: f64 = 0.0;
let mut is_range = false;
for field in &index_fields {
if let Some(condition) = filter.get(field) {
matched = true;
let field_score = Self::score_condition(condition);
score += field_score;
if Self::is_range_condition(condition) {
is_range = true;
}
}
}
if !matched {
continue;
}
// Unique index bonus
if idx_info.unique {
score += 0.5;
}
if score > best_score {
best_score = score;
// Try to get candidates from the engine
// We build a sub-filter with only the fields this index covers
let mut sub_filter = Document::new();
for field in &index_fields {
if let Some(val) = filter.get(field) {
sub_filter.insert(field.clone(), val.clone());
}
}
if let Some(candidates) = engine.find_candidate_ids(&sub_filter) {
if is_range {
best_plan = Some(QueryPlan::IxScanRange {
index_name: idx_info.name.clone(),
candidate_ids: candidates,
});
} else {
best_plan = Some(QueryPlan::IxScan {
index_name: idx_info.name.clone(),
candidate_ids: candidates,
});
}
}
}
}
match best_plan {
Some(plan) => {
debug!(score = best_score, "Selected index plan");
plan
}
None => {
debug!("No suitable index found -> CollScan");
QueryPlan::CollScan
}
}
}
/// Score a filter condition for index selectivity.
/// Higher scores indicate more selective (better) index usage.
fn score_condition(condition: &Bson) -> f64 {
match condition {
Bson::Document(doc) if Self::has_operators(doc) => {
let mut score: f64 = 0.0;
for (op, _) in doc {
score += match op.as_str() {
"$eq" => 2.0,
"$in" => 1.5,
"$gt" | "$gte" | "$lt" | "$lte" => 1.0,
_ => 0.0,
};
}
score
}
// Direct equality
_ => 2.0,
}
}
/// Check if a condition involves range operators.
fn is_range_condition(condition: &Bson) -> bool {
match condition {
Bson::Document(doc) => {
doc.keys().any(|k| matches!(k.as_str(), "$gt" | "$gte" | "$lt" | "$lte"))
}
_ => false,
}
}
fn has_operators(doc: &Document) -> bool {
doc.keys().any(|k| k.starts_with('$'))
}
}
#[cfg(test)]
mod tests {
use super::*;
use crate::engine::IndexOptions;
use bson::oid::ObjectId;
#[test]
fn test_empty_filter_collscan() {
let engine = IndexEngine::new();
let plan = QueryPlanner::plan(&bson::doc! {}, &engine);
assert!(matches!(plan, QueryPlan::CollScan));
}
#[test]
fn test_id_equality_ixscan() {
let mut engine = IndexEngine::new();
let oid = ObjectId::new();
let doc = bson::doc! { "_id": oid.clone(), "name": "Alice" };
engine.on_insert(&doc).unwrap();
let filter = bson::doc! { "_id": oid };
let plan = QueryPlanner::plan(&filter, &engine);
assert!(matches!(plan, QueryPlan::IxScan { .. }));
}
#[test]
fn test_indexed_field_ixscan() {
let mut engine = IndexEngine::new();
engine.create_index(
bson::doc! { "status": 1 },
IndexOptions::default(),
).unwrap();
let doc = bson::doc! { "_id": ObjectId::new(), "status": "active" };
engine.on_insert(&doc).unwrap();
let filter = bson::doc! { "status": "active" };
let plan = QueryPlanner::plan(&filter, &engine);
assert!(matches!(plan, QueryPlan::IxScan { .. }));
}
#[test]
fn test_unindexed_field_collscan() {
let engine = IndexEngine::new();
let filter = bson::doc! { "unindexed_field": "value" };
let plan = QueryPlanner::plan(&filter, &engine);
assert!(matches!(plan, QueryPlan::CollScan));
}
#[test]
fn test_range_query_ixscan_range() {
let mut engine = IndexEngine::new();
engine.create_index(
bson::doc! { "age": 1 },
IndexOptions::default(),
).unwrap();
let doc = bson::doc! { "_id": ObjectId::new(), "age": 30 };
engine.on_insert(&doc).unwrap();
let filter = bson::doc! { "age": { "$gte": 25, "$lt": 35 } };
let plan = QueryPlanner::plan(&filter, &engine);
assert!(matches!(plan, QueryPlan::IxScanRange { .. }));
}
#[test]
fn test_unique_index_preferred() {
let mut engine = IndexEngine::new();
engine.create_index(
bson::doc! { "email": 1 },
IndexOptions { unique: true, ..Default::default() },
).unwrap();
engine.create_index(
bson::doc! { "email": 1, "name": 1 },
IndexOptions { name: Some("email_name".to_string()), ..Default::default() },
).unwrap();
let doc = bson::doc! { "_id": ObjectId::new(), "email": "a@b.com", "name": "Alice" };
engine.on_insert(&doc).unwrap();
let filter = bson::doc! { "email": "a@b.com" };
let plan = QueryPlanner::plan(&filter, &engine);
// The unique index on email should be preferred (higher score)
match plan {
QueryPlan::IxScan { index_name, .. } => {
assert_eq!(index_name, "email_1");
}
_ => panic!("Expected IxScan"),
}
}
}
+15
View File
@@ -0,0 +1,15 @@
[package]
name = "rustdb-query"
version.workspace = true
edition.workspace = true
license.workspace = true
authors.workspace = true
description = "MongoDB-compatible query matching, update operators, aggregation, sort, and projection engine"
[dependencies]
bson = { workspace = true }
serde = { workspace = true }
serde_json = { workspace = true }
regex = { workspace = true }
thiserror = { workspace = true }
tracing = { workspace = true }
+614
View File
@@ -0,0 +1,614 @@
use bson::{Bson, Document};
use std::collections::HashMap;
use crate::error::QueryError;
use crate::matcher::QueryMatcher;
use crate::sort::sort_documents;
use crate::projection::apply_projection;
use crate::field_path::get_nested_value;
/// Aggregation pipeline engine.
pub struct AggregationEngine;
/// Trait for resolving cross-collection data (for $lookup, $graphLookup, etc.).
pub trait CollectionResolver {
fn resolve(&self, db: &str, coll: &str) -> Result<Vec<Document>, QueryError>;
}
impl AggregationEngine {
/// Execute an aggregation pipeline on a set of documents.
pub fn aggregate(
docs: Vec<Document>,
pipeline: &[Document],
resolver: Option<&dyn CollectionResolver>,
db: &str,
) -> Result<Vec<Document>, QueryError> {
let mut current = docs;
for stage in pipeline {
let (stage_name, stage_spec) = stage
.iter()
.next()
.ok_or_else(|| QueryError::AggregationError("Empty pipeline stage".into()))?;
current = match stage_name.as_str() {
"$match" => Self::stage_match(current, stage_spec)?,
"$project" => Self::stage_project(current, stage_spec)?,
"$sort" => Self::stage_sort(current, stage_spec)?,
"$limit" => Self::stage_limit(current, stage_spec)?,
"$skip" => Self::stage_skip(current, stage_spec)?,
"$group" => Self::stage_group(current, stage_spec)?,
"$unwind" => Self::stage_unwind(current, stage_spec)?,
"$count" => Self::stage_count(current, stage_spec)?,
"$addFields" | "$set" => Self::stage_add_fields(current, stage_spec)?,
"$replaceRoot" | "$replaceWith" => Self::stage_replace_root(current, stage_spec)?,
"$lookup" => Self::stage_lookup(current, stage_spec, resolver, db)?,
"$facet" => Self::stage_facet(current, stage_spec, resolver, db)?,
"$unionWith" => Self::stage_union_with(current, stage_spec, resolver, db)?,
other => {
return Err(QueryError::AggregationError(format!(
"Unsupported aggregation stage: {}",
other
)));
}
};
}
Ok(current)
}
fn stage_match(docs: Vec<Document>, spec: &Bson) -> Result<Vec<Document>, QueryError> {
let filter = match spec {
Bson::Document(d) => d,
_ => return Err(QueryError::AggregationError("$match requires a document".into())),
};
Ok(QueryMatcher::filter(&docs, filter))
}
fn stage_project(docs: Vec<Document>, spec: &Bson) -> Result<Vec<Document>, QueryError> {
let projection = match spec {
Bson::Document(d) => d,
_ => return Err(QueryError::AggregationError("$project requires a document".into())),
};
Ok(docs.into_iter().map(|doc| apply_projection(&doc, projection)).collect())
}
fn stage_sort(mut docs: Vec<Document>, spec: &Bson) -> Result<Vec<Document>, QueryError> {
let sort_spec = match spec {
Bson::Document(d) => d,
_ => return Err(QueryError::AggregationError("$sort requires a document".into())),
};
sort_documents(&mut docs, sort_spec);
Ok(docs)
}
fn stage_limit(docs: Vec<Document>, spec: &Bson) -> Result<Vec<Document>, QueryError> {
let n = bson_to_usize(spec)
.ok_or_else(|| QueryError::AggregationError("$limit requires a number".into()))?;
Ok(docs.into_iter().take(n).collect())
}
fn stage_skip(docs: Vec<Document>, spec: &Bson) -> Result<Vec<Document>, QueryError> {
let n = bson_to_usize(spec)
.ok_or_else(|| QueryError::AggregationError("$skip requires a number".into()))?;
Ok(docs.into_iter().skip(n).collect())
}
fn stage_group(docs: Vec<Document>, spec: &Bson) -> Result<Vec<Document>, QueryError> {
let group_spec = match spec {
Bson::Document(d) => d,
_ => return Err(QueryError::AggregationError("$group requires a document".into())),
};
let id_expr = group_spec.get("_id").cloned().unwrap_or(Bson::Null);
// Group documents by _id
let mut groups: HashMap<String, (Bson, Vec<Document>)> = HashMap::new();
for doc in &docs {
let group_key = resolve_expression(&id_expr, doc);
let key_str = format!("{:?}", group_key);
groups
.entry(key_str)
.or_insert_with(|| (group_key.clone(), Vec::new()))
.1
.push(doc.clone());
}
let mut result = Vec::new();
for (_key_str, (group_id, group_docs)) in groups {
let mut output = bson::doc! { "_id": group_id };
for (field, accumulator) in group_spec {
if field == "_id" {
continue;
}
let acc_doc = match accumulator {
Bson::Document(d) => d,
_ => continue,
};
let (acc_op, acc_expr) = acc_doc.iter().next().unwrap();
let value = match acc_op.as_str() {
"$sum" => accumulate_sum(&group_docs, acc_expr),
"$avg" => accumulate_avg(&group_docs, acc_expr),
"$min" => accumulate_min(&group_docs, acc_expr),
"$max" => accumulate_max(&group_docs, acc_expr),
"$first" => accumulate_first(&group_docs, acc_expr),
"$last" => accumulate_last(&group_docs, acc_expr),
"$push" => accumulate_push(&group_docs, acc_expr),
"$addToSet" => accumulate_add_to_set(&group_docs, acc_expr),
"$count" => Bson::Int64(group_docs.len() as i64),
_ => Bson::Null,
};
output.insert(field.clone(), value);
}
result.push(output);
}
Ok(result)
}
fn stage_unwind(docs: Vec<Document>, spec: &Bson) -> Result<Vec<Document>, QueryError> {
let (path, preserve_null) = match spec {
Bson::String(s) => (s.trim_start_matches('$').to_string(), false),
Bson::Document(d) => {
let path = d.get_str("path")
.map(|s| s.trim_start_matches('$').to_string())
.map_err(|_| QueryError::AggregationError("$unwind requires 'path'".into()))?;
let preserve = d.get_bool("preserveNullAndEmptyArrays").unwrap_or(false);
(path, preserve)
}
_ => return Err(QueryError::AggregationError("$unwind requires a string or document".into())),
};
let mut result = Vec::new();
for doc in docs {
let value = doc.get(&path).cloned();
match value {
Some(Bson::Array(arr)) => {
if arr.is_empty() && preserve_null {
let mut new_doc = doc.clone();
new_doc.remove(&path);
result.push(new_doc);
} else {
for elem in arr {
let mut new_doc = doc.clone();
new_doc.insert(path.clone(), elem);
result.push(new_doc);
}
}
}
Some(Bson::Null) | None => {
if preserve_null {
result.push(doc);
}
}
Some(val) => {
// Non-array: keep as-is
let mut new_doc = doc;
new_doc.insert(path.clone(), val);
result.push(new_doc);
}
}
}
Ok(result)
}
fn stage_count(docs: Vec<Document>, spec: &Bson) -> Result<Vec<Document>, QueryError> {
let field = match spec {
Bson::String(s) => s.clone(),
_ => return Err(QueryError::AggregationError("$count requires a string".into())),
};
Ok(vec![bson::doc! { field: docs.len() as i64 }])
}
fn stage_add_fields(docs: Vec<Document>, spec: &Bson) -> Result<Vec<Document>, QueryError> {
let fields = match spec {
Bson::Document(d) => d,
_ => return Err(QueryError::AggregationError("$addFields requires a document".into())),
};
Ok(docs
.into_iter()
.map(|mut doc| {
for (key, expr) in fields {
let value = resolve_expression(expr, &doc);
doc.insert(key.clone(), value);
}
doc
})
.collect())
}
fn stage_replace_root(docs: Vec<Document>, spec: &Bson) -> Result<Vec<Document>, QueryError> {
let new_root_expr = match spec {
Bson::Document(d) => d.get("newRoot").cloned().unwrap_or(Bson::Document(d.clone())),
Bson::String(s) => Bson::String(s.clone()),
_ => return Err(QueryError::AggregationError("$replaceRoot requires a document".into())),
};
let mut result = Vec::new();
for doc in docs {
let new_root = resolve_expression(&new_root_expr, &doc);
if let Bson::Document(d) = new_root {
result.push(d);
}
}
Ok(result)
}
fn stage_lookup(
docs: Vec<Document>,
spec: &Bson,
resolver: Option<&dyn CollectionResolver>,
db: &str,
) -> Result<Vec<Document>, QueryError> {
let lookup = match spec {
Bson::Document(d) => d,
_ => return Err(QueryError::AggregationError("$lookup requires a document".into())),
};
let from = lookup.get_str("from")
.map_err(|_| QueryError::AggregationError("$lookup requires 'from'".into()))?;
let local_field = lookup.get_str("localField")
.map_err(|_| QueryError::AggregationError("$lookup requires 'localField'".into()))?;
let foreign_field = lookup.get_str("foreignField")
.map_err(|_| QueryError::AggregationError("$lookup requires 'foreignField'".into()))?;
let as_field = lookup.get_str("as")
.map_err(|_| QueryError::AggregationError("$lookup requires 'as'".into()))?;
let resolver = resolver
.ok_or_else(|| QueryError::AggregationError("$lookup requires a collection resolver".into()))?;
let foreign_docs = resolver.resolve(db, from)?;
Ok(docs
.into_iter()
.map(|mut doc| {
let local_val = get_nested_value(&doc, local_field);
let matches: Vec<Bson> = foreign_docs
.iter()
.filter(|fd| {
let foreign_val = get_nested_value(fd, foreign_field);
match (&local_val, &foreign_val) {
(Some(a), Some(b)) => bson_loose_eq(a, b),
_ => false,
}
})
.map(|fd| Bson::Document(fd.clone()))
.collect();
doc.insert(as_field.to_string(), Bson::Array(matches));
doc
})
.collect())
}
fn stage_facet(
docs: Vec<Document>,
spec: &Bson,
resolver: Option<&dyn CollectionResolver>,
db: &str,
) -> Result<Vec<Document>, QueryError> {
let facets = match spec {
Bson::Document(d) => d,
_ => return Err(QueryError::AggregationError("$facet requires a document".into())),
};
let mut result = Document::new();
for (facet_name, pipeline_bson) in facets {
let pipeline = match pipeline_bson {
Bson::Array(arr) => {
let mut stages = Vec::new();
for stage in arr {
if let Bson::Document(d) = stage {
stages.push(d.clone());
}
}
stages
}
_ => continue,
};
let facet_result = Self::aggregate(docs.clone(), &pipeline, resolver, db)?;
result.insert(
facet_name.clone(),
Bson::Array(facet_result.into_iter().map(Bson::Document).collect()),
);
}
Ok(vec![result])
}
fn stage_union_with(
mut docs: Vec<Document>,
spec: &Bson,
resolver: Option<&dyn CollectionResolver>,
db: &str,
) -> Result<Vec<Document>, QueryError> {
let (coll, pipeline) = match spec {
Bson::String(s) => (s.as_str(), None),
Bson::Document(d) => {
let coll = d.get_str("coll")
.map_err(|_| QueryError::AggregationError("$unionWith requires 'coll'".into()))?;
let pipeline = d.get_array("pipeline").ok().map(|arr| {
arr.iter()
.filter_map(|s| {
if let Bson::Document(d) = s { Some(d.clone()) } else { None }
})
.collect::<Vec<Document>>()
});
(coll, pipeline)
}
_ => return Err(QueryError::AggregationError("$unionWith requires a string or document".into())),
};
let resolver = resolver
.ok_or_else(|| QueryError::AggregationError("$unionWith requires a collection resolver".into()))?;
let mut other_docs = resolver.resolve(db, coll)?;
if let Some(p) = pipeline {
other_docs = Self::aggregate(other_docs, &p, Some(resolver), db)?;
}
docs.extend(other_docs);
Ok(docs)
}
}
// --- Helper functions ---
fn resolve_expression(expr: &Bson, doc: &Document) -> Bson {
match expr {
Bson::String(s) if s.starts_with('$') => {
let field = &s[1..];
get_nested_value(doc, field).unwrap_or(Bson::Null)
}
_ => expr.clone(),
}
}
fn bson_to_usize(v: &Bson) -> Option<usize> {
match v {
Bson::Int32(n) => Some(*n as usize),
Bson::Int64(n) => Some(*n as usize),
Bson::Double(n) => Some(*n as usize),
_ => None,
}
}
fn bson_to_f64(v: &Bson) -> Option<f64> {
match v {
Bson::Int32(n) => Some(*n as f64),
Bson::Int64(n) => Some(*n as f64),
Bson::Double(n) => Some(*n),
_ => None,
}
}
fn bson_loose_eq(a: &Bson, b: &Bson) -> bool {
match (a, b) {
(Bson::Int32(x), Bson::Int64(y)) => (*x as i64) == *y,
(Bson::Int64(x), Bson::Int32(y)) => *x == (*y as i64),
(Bson::Int32(x), Bson::Double(y)) => (*x as f64) == *y,
(Bson::Double(x), Bson::Int32(y)) => *x == (*y as f64),
_ => a == b,
}
}
// --- Accumulators ---
fn accumulate_sum(docs: &[Document], expr: &Bson) -> Bson {
match expr {
Bson::Int32(n) => Bson::Int64(*n as i64 * docs.len() as i64),
Bson::Int64(n) => Bson::Int64(*n * docs.len() as i64),
Bson::String(s) if s.starts_with('$') => {
let field = &s[1..];
let mut sum = 0.0f64;
let mut is_int = true;
let mut int_sum = 0i64;
for doc in docs {
if let Some(val) = get_nested_value(doc, field) {
if let Some(n) = bson_to_f64(&val) {
sum += n;
if is_int {
match &val {
Bson::Int32(i) => int_sum += *i as i64,
Bson::Int64(i) => int_sum += i,
_ => is_int = false,
}
}
}
}
}
if is_int {
Bson::Int64(int_sum)
} else {
Bson::Double(sum)
}
}
_ => Bson::Int32(0),
}
}
fn accumulate_avg(docs: &[Document], expr: &Bson) -> Bson {
if docs.is_empty() {
return Bson::Null;
}
let field = match expr {
Bson::String(s) if s.starts_with('$') => &s[1..],
_ => return Bson::Null,
};
let mut sum = 0.0f64;
let mut count = 0usize;
for doc in docs {
if let Some(val) = get_nested_value(doc, field) {
if let Some(n) = bson_to_f64(&val) {
sum += n;
count += 1;
}
}
}
if count == 0 {
Bson::Null
} else {
Bson::Double(sum / count as f64)
}
}
fn accumulate_min(docs: &[Document], expr: &Bson) -> Bson {
let field = match expr {
Bson::String(s) if s.starts_with('$') => &s[1..],
_ => return Bson::Null,
};
let mut min: Option<Bson> = None;
for doc in docs {
if let Some(val) = get_nested_value(doc, field) {
min = Some(match min {
None => val,
Some(current) => {
if let (Some(cv), Some(vv)) = (bson_to_f64(&current), bson_to_f64(&val)) {
if vv < cv { val } else { current }
} else {
current
}
}
});
}
}
min.unwrap_or(Bson::Null)
}
fn accumulate_max(docs: &[Document], expr: &Bson) -> Bson {
let field = match expr {
Bson::String(s) if s.starts_with('$') => &s[1..],
_ => return Bson::Null,
};
let mut max: Option<Bson> = None;
for doc in docs {
if let Some(val) = get_nested_value(doc, field) {
max = Some(match max {
None => val,
Some(current) => {
if let (Some(cv), Some(vv)) = (bson_to_f64(&current), bson_to_f64(&val)) {
if vv > cv { val } else { current }
} else {
current
}
}
});
}
}
max.unwrap_or(Bson::Null)
}
fn accumulate_first(docs: &[Document], expr: &Bson) -> Bson {
let field = match expr {
Bson::String(s) if s.starts_with('$') => &s[1..],
_ => return Bson::Null,
};
docs.first()
.and_then(|doc| get_nested_value(doc, field))
.unwrap_or(Bson::Null)
}
fn accumulate_last(docs: &[Document], expr: &Bson) -> Bson {
let field = match expr {
Bson::String(s) if s.starts_with('$') => &s[1..],
_ => return Bson::Null,
};
docs.last()
.and_then(|doc| get_nested_value(doc, field))
.unwrap_or(Bson::Null)
}
fn accumulate_push(docs: &[Document], expr: &Bson) -> Bson {
let field = match expr {
Bson::String(s) if s.starts_with('$') => &s[1..],
_ => return Bson::Array(vec![]),
};
let values: Vec<Bson> = docs
.iter()
.filter_map(|doc| get_nested_value(doc, field))
.collect();
Bson::Array(values)
}
fn accumulate_add_to_set(docs: &[Document], expr: &Bson) -> Bson {
let field = match expr {
Bson::String(s) if s.starts_with('$') => &s[1..],
_ => return Bson::Array(vec![]),
};
let mut seen = std::collections::HashSet::new();
let mut values = Vec::new();
for doc in docs {
if let Some(val) = get_nested_value(doc, field) {
let key = format!("{:?}", val);
if seen.insert(key) {
values.push(val);
}
}
}
Bson::Array(values)
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn test_match_stage() {
let docs = vec![
bson::doc! { "x": 1 },
bson::doc! { "x": 2 },
bson::doc! { "x": 3 },
];
let pipeline = vec![bson::doc! { "$match": { "x": { "$gt": 1 } } }];
let result = AggregationEngine::aggregate(docs, &pipeline, None, "test").unwrap();
assert_eq!(result.len(), 2);
}
#[test]
fn test_group_stage() {
let docs = vec![
bson::doc! { "category": "a", "value": 10 },
bson::doc! { "category": "b", "value": 20 },
bson::doc! { "category": "a", "value": 30 },
];
let pipeline = vec![bson::doc! {
"$group": {
"_id": "$category",
"total": { "$sum": "$value" }
}
}];
let result = AggregationEngine::aggregate(docs, &pipeline, None, "test").unwrap();
assert_eq!(result.len(), 2);
}
#[test]
fn test_sort_limit_skip() {
let docs = vec![
bson::doc! { "x": 3 },
bson::doc! { "x": 1 },
bson::doc! { "x": 2 },
bson::doc! { "x": 4 },
];
let pipeline = vec![
bson::doc! { "$sort": { "x": 1 } },
bson::doc! { "$skip": 1_i64 },
bson::doc! { "$limit": 2_i64 },
];
let result = AggregationEngine::aggregate(docs, &pipeline, None, "test").unwrap();
assert_eq!(result.len(), 2);
assert_eq!(result[0].get_i32("x").unwrap(), 2);
assert_eq!(result[1].get_i32("x").unwrap(), 3);
}
}
+80
View File
@@ -0,0 +1,80 @@
use bson::{Bson, Document};
use std::collections::HashSet;
use crate::field_path::get_nested_value;
use crate::matcher::QueryMatcher;
/// Get distinct values for a field across documents, with optional filter.
/// Handles array flattening (each array element counted separately).
pub fn distinct_values(
docs: &[Document],
field: &str,
filter: Option<&Document>,
) -> Vec<Bson> {
let filtered: Vec<&Document> = if let Some(f) = filter {
docs.iter().filter(|d| QueryMatcher::matches(d, f)).collect()
} else {
docs.iter().collect()
};
let mut seen = HashSet::new();
let mut result = Vec::new();
for doc in &filtered {
let value = if field.contains('.') {
get_nested_value(doc, field)
} else {
doc.get(field).cloned()
};
if let Some(val) = value {
collect_distinct_values(&val, &mut seen, &mut result);
}
}
result
}
fn collect_distinct_values(value: &Bson, seen: &mut HashSet<String>, result: &mut Vec<Bson>) {
match value {
Bson::Array(arr) => {
// Flatten: each array element is a separate value
for elem in arr {
collect_distinct_values(elem, seen, result);
}
}
_ => {
let key = format!("{:?}", value);
if seen.insert(key) {
result.push(value.clone());
}
}
}
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn test_distinct_simple() {
let docs = vec![
bson::doc! { "x": 1 },
bson::doc! { "x": 2 },
bson::doc! { "x": 1 },
bson::doc! { "x": 3 },
];
let result = distinct_values(&docs, "x", None);
assert_eq!(result.len(), 3);
}
#[test]
fn test_distinct_array_flattening() {
let docs = vec![
bson::doc! { "tags": ["a", "b"] },
bson::doc! { "tags": ["b", "c"] },
];
let result = distinct_values(&docs, "tags", None);
assert_eq!(result.len(), 3); // a, b, c
}
}
+18
View File
@@ -0,0 +1,18 @@
/// Errors from query operations.
#[derive(Debug, thiserror::Error)]
pub enum QueryError {
#[error("Invalid query operator: {0}")]
InvalidOperator(String),
#[error("Type mismatch: {0}")]
TypeMismatch(String),
#[error("Invalid update: {0}")]
InvalidUpdate(String),
#[error("Aggregation error: {0}")]
AggregationError(String),
#[error("Invalid regex: {0}")]
InvalidRegex(String),
}
+115
View File
@@ -0,0 +1,115 @@
use bson::{Bson, Document};
/// Get a nested value from a document using dot-notation path (e.g., "a.b.c").
/// Handles both nested documents and array traversal.
pub fn get_nested_value(doc: &Document, path: &str) -> Option<Bson> {
let parts: Vec<&str> = path.split('.').collect();
get_nested_recursive(&Bson::Document(doc.clone()), &parts)
}
fn get_nested_recursive(value: &Bson, parts: &[&str]) -> Option<Bson> {
if parts.is_empty() {
return Some(value.clone());
}
let key = parts[0];
let rest = &parts[1..];
match value {
Bson::Document(doc) => {
let child = doc.get(key)?;
get_nested_recursive(child, rest)
}
Bson::Array(arr) => {
// Try numeric index first
if let Ok(idx) = key.parse::<usize>() {
if let Some(elem) = arr.get(idx) {
return get_nested_recursive(elem, rest);
}
}
// Otherwise, collect from all elements
let results: Vec<Bson> = arr
.iter()
.filter_map(|elem| get_nested_recursive(elem, parts))
.collect();
if results.is_empty() {
None
} else if results.len() == 1 {
Some(results.into_iter().next().unwrap())
} else {
Some(Bson::Array(results))
}
}
_ => None,
}
}
/// Set a nested value in a document using dot-notation path.
pub fn set_nested_value(doc: &mut Document, path: &str, value: Bson) {
let parts: Vec<&str> = path.split('.').collect();
set_nested_recursive(doc, &parts, value);
}
fn set_nested_recursive(doc: &mut Document, parts: &[&str], value: Bson) {
if parts.len() == 1 {
doc.insert(parts[0].to_string(), value);
return;
}
let key = parts[0];
let rest = &parts[1..];
// Get or create nested document
if !doc.contains_key(key) {
doc.insert(key.to_string(), Bson::Document(Document::new()));
}
if let Some(Bson::Document(ref mut nested)) = doc.get_mut(key) {
set_nested_recursive(nested, rest, value);
}
}
/// Remove a nested value from a document using dot-notation path.
pub fn remove_nested_value(doc: &mut Document, path: &str) -> Option<Bson> {
let parts: Vec<&str> = path.split('.').collect();
remove_nested_recursive(doc, &parts)
}
fn remove_nested_recursive(doc: &mut Document, parts: &[&str]) -> Option<Bson> {
if parts.len() == 1 {
return doc.remove(parts[0]);
}
let key = parts[0];
let rest = &parts[1..];
if let Some(Bson::Document(ref mut nested)) = doc.get_mut(key) {
remove_nested_recursive(nested, rest)
} else {
None
}
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn test_get_nested_simple() {
let doc = bson::doc! { "a": { "b": { "c": 42 } } };
assert_eq!(get_nested_value(&doc, "a.b.c"), Some(Bson::Int32(42)));
}
#[test]
fn test_get_nested_missing() {
let doc = bson::doc! { "a": { "b": 1 } };
assert_eq!(get_nested_value(&doc, "a.c"), None);
}
#[test]
fn test_set_nested() {
let mut doc = bson::doc! {};
set_nested_value(&mut doc, "a.b.c", Bson::Int32(42));
assert_eq!(get_nested_value(&doc, "a.b.c"), Some(Bson::Int32(42)));
}
}
+16
View File
@@ -0,0 +1,16 @@
mod matcher;
mod update;
mod sort;
mod projection;
mod distinct;
pub mod aggregation;
mod field_path;
pub mod error;
pub use matcher::QueryMatcher;
pub use update::UpdateEngine;
pub use sort::sort_documents;
pub use projection::apply_projection;
pub use distinct::distinct_values;
pub use aggregation::AggregationEngine;
pub use field_path::{get_nested_value, set_nested_value};
+574
View File
@@ -0,0 +1,574 @@
use bson::{Bson, Document};
use regex::Regex;
use crate::field_path::get_nested_value;
/// Query matching engine.
/// Evaluates filter documents against BSON documents.
pub struct QueryMatcher;
impl QueryMatcher {
/// Test whether a single document matches a filter.
pub fn matches(doc: &Document, filter: &Document) -> bool {
Self::matches_filter(doc, filter)
}
/// Filter a slice of documents, returning those that match.
pub fn filter(docs: &[Document], filter: &Document) -> Vec<Document> {
if filter.is_empty() {
return docs.to_vec();
}
docs.iter()
.filter(|doc| Self::matches_filter(doc, filter))
.cloned()
.collect()
}
/// Find the first document matching a filter.
pub fn find_one(docs: &[Document], filter: &Document) -> Option<Document> {
docs.iter()
.find(|doc| Self::matches_filter(doc, filter))
.cloned()
}
fn matches_filter(doc: &Document, filter: &Document) -> bool {
for (key, value) in filter {
if !Self::matches_condition(doc, key, value) {
return false;
}
}
true
}
fn matches_condition(doc: &Document, key: &str, condition: &Bson) -> bool {
match key {
"$and" => Self::match_logical_and(doc, condition),
"$or" => Self::match_logical_or(doc, condition),
"$nor" => Self::match_logical_nor(doc, condition),
"$not" => Self::match_logical_not(doc, condition),
"$expr" => {
// Basic $expr support - just return true for now
true
}
_ => {
// Field condition
match condition {
Bson::Document(cond_doc) if Self::has_operators(cond_doc) => {
Self::match_field_operators(doc, key, cond_doc)
}
// Implicit equality
_ => Self::match_equality(doc, key, condition),
}
}
}
}
fn has_operators(doc: &Document) -> bool {
doc.keys().any(|k| k.starts_with('$'))
}
/// Public accessor for has_operators (used by update engine).
pub fn has_operators_pub(doc: &Document) -> bool {
Self::has_operators(doc)
}
/// Public accessor for bson_compare (used by update engine).
pub fn bson_compare_pub(a: &Bson, b: &Bson) -> Option<std::cmp::Ordering> {
Self::bson_compare(a, b)
}
fn match_equality(doc: &Document, field: &str, expected: &Bson) -> bool {
let actual = Self::resolve_field(doc, field);
match actual {
Some(val) => Self::bson_equals(&val, expected),
None => matches!(expected, Bson::Null),
}
}
fn match_field_operators(doc: &Document, field: &str, operators: &Document) -> bool {
let actual = Self::resolve_field(doc, field);
for (op, op_value) in operators {
let result = match op.as_str() {
"$eq" => Self::op_eq(&actual, op_value),
"$ne" => Self::op_ne(&actual, op_value),
"$gt" => Self::op_cmp(&actual, op_value, CmpOp::Gt),
"$gte" => Self::op_cmp(&actual, op_value, CmpOp::Gte),
"$lt" => Self::op_cmp(&actual, op_value, CmpOp::Lt),
"$lte" => Self::op_cmp(&actual, op_value, CmpOp::Lte),
"$in" => Self::op_in(&actual, op_value),
"$nin" => Self::op_nin(&actual, op_value),
"$exists" => Self::op_exists(&actual, op_value),
"$type" => Self::op_type(&actual, op_value),
"$regex" => Self::op_regex(&actual, op_value, operators.get("$options")),
"$not" => Self::op_not(doc, field, op_value),
"$elemMatch" => Self::op_elem_match(&actual, op_value),
"$size" => Self::op_size(&actual, op_value),
"$all" => Self::op_all(&actual, op_value),
"$mod" => Self::op_mod(&actual, op_value),
"$options" => continue, // handled by $regex
_ => true, // unknown operator, skip
};
if !result {
return false;
}
}
true
}
fn resolve_field(doc: &Document, field: &str) -> Option<Bson> {
if field.contains('.') {
get_nested_value(doc, field)
} else {
doc.get(field).cloned()
}
}
fn bson_equals(a: &Bson, b: &Bson) -> bool {
match (a, b) {
(Bson::Int32(x), Bson::Int64(y)) => (*x as i64) == *y,
(Bson::Int64(x), Bson::Int32(y)) => *x == (*y as i64),
(Bson::Int32(x), Bson::Double(y)) => (*x as f64) == *y,
(Bson::Double(x), Bson::Int32(y)) => *x == (*y as f64),
(Bson::Int64(x), Bson::Double(y)) => (*x as f64) == *y,
(Bson::Double(x), Bson::Int64(y)) => *x == (*y as f64),
// For arrays, check if any element matches (implicit $elemMatch)
(Bson::Array(arr), _) if !matches!(b, Bson::Array(_)) => {
arr.iter().any(|elem| Self::bson_equals(elem, b))
}
_ => a == b,
}
}
fn bson_compare(a: &Bson, b: &Bson) -> Option<std::cmp::Ordering> {
use std::cmp::Ordering;
match (a, b) {
// Numeric comparisons (cross-type)
(Bson::Int32(x), Bson::Int32(y)) => Some(x.cmp(y)),
(Bson::Int64(x), Bson::Int64(y)) => Some(x.cmp(y)),
(Bson::Double(x), Bson::Double(y)) => x.partial_cmp(y),
(Bson::Int32(x), Bson::Int64(y)) => Some((*x as i64).cmp(y)),
(Bson::Int64(x), Bson::Int32(y)) => Some(x.cmp(&(*y as i64))),
(Bson::Int32(x), Bson::Double(y)) => (*x as f64).partial_cmp(y),
(Bson::Double(x), Bson::Int32(y)) => x.partial_cmp(&(*y as f64)),
(Bson::Int64(x), Bson::Double(y)) => (*x as f64).partial_cmp(y),
(Bson::Double(x), Bson::Int64(y)) => x.partial_cmp(&(*y as f64)),
// String comparisons
(Bson::String(x), Bson::String(y)) => Some(x.cmp(y)),
// DateTime comparisons
(Bson::DateTime(x), Bson::DateTime(y)) => Some(x.cmp(y)),
// Boolean comparisons
(Bson::Boolean(x), Bson::Boolean(y)) => Some(x.cmp(y)),
// ObjectId comparisons
(Bson::ObjectId(x), Bson::ObjectId(y)) => Some(x.cmp(y)),
// Null comparisons
(Bson::Null, Bson::Null) => Some(Ordering::Equal),
_ => None,
}
}
// --- Operator implementations ---
fn op_eq(actual: &Option<Bson>, expected: &Bson) -> bool {
match actual {
Some(val) => Self::bson_equals(val, expected),
None => matches!(expected, Bson::Null),
}
}
fn op_ne(actual: &Option<Bson>, expected: &Bson) -> bool {
!Self::op_eq(actual, expected)
}
fn op_cmp(actual: &Option<Bson>, expected: &Bson, op: CmpOp) -> bool {
let val = match actual {
Some(v) => v,
None => return false,
};
// For arrays, check if any element satisfies the comparison
if let Bson::Array(arr) = val {
return arr.iter().any(|elem| {
if let Some(ord) = Self::bson_compare(elem, expected) {
op.check(ord)
} else {
false
}
});
}
if let Some(ord) = Self::bson_compare(val, expected) {
op.check(ord)
} else {
false
}
}
fn op_in(actual: &Option<Bson>, values: &Bson) -> bool {
let arr = match values {
Bson::Array(a) => a,
_ => return false,
};
match actual {
Some(val) => {
// For array values, check if any element is in the list
if let Bson::Array(actual_arr) = val {
actual_arr.iter().any(|elem| {
arr.iter().any(|v| Self::bson_equals(elem, v))
}) || arr.iter().any(|v| Self::bson_equals(val, v))
} else {
arr.iter().any(|v| Self::bson_equals(val, v))
}
}
None => arr.iter().any(|v| matches!(v, Bson::Null)),
}
}
fn op_nin(actual: &Option<Bson>, values: &Bson) -> bool {
!Self::op_in(actual, values)
}
fn op_exists(actual: &Option<Bson>, expected: &Bson) -> bool {
let should_exist = match expected {
Bson::Boolean(b) => *b,
Bson::Int32(n) => *n != 0,
Bson::Int64(n) => *n != 0,
_ => true,
};
actual.is_some() == should_exist
}
fn op_type(actual: &Option<Bson>, expected: &Bson) -> bool {
let val = match actual {
Some(v) => v,
None => return false,
};
let type_num = match expected {
Bson::Int32(n) => *n,
Bson::String(s) => match s.as_str() {
"double" => 1,
"string" => 2,
"object" => 3,
"array" => 4,
"binData" => 5,
"objectId" => 7,
"bool" => 8,
"date" => 9,
"null" => 10,
"regex" => 11,
"int" => 16,
"long" => 18,
"decimal" => 19,
"number" => -1, // special: any numeric type
_ => return false,
},
_ => return false,
};
if type_num == -1 {
return matches!(val, Bson::Int32(_) | Bson::Int64(_) | Bson::Double(_));
}
let actual_type = match val {
Bson::Double(_) => 1,
Bson::String(_) => 2,
Bson::Document(_) => 3,
Bson::Array(_) => 4,
Bson::Binary(_) => 5,
Bson::ObjectId(_) => 7,
Bson::Boolean(_) => 8,
Bson::DateTime(_) => 9,
Bson::Null => 10,
Bson::RegularExpression(_) => 11,
Bson::Int32(_) => 16,
Bson::Int64(_) => 18,
Bson::Decimal128(_) => 19,
_ => 0,
};
actual_type == type_num
}
fn op_regex(actual: &Option<Bson>, pattern: &Bson, options: Option<&Bson>) -> bool {
let val = match actual {
Some(Bson::String(s)) => s.as_str(),
_ => return false,
};
let pattern_str = match pattern {
Bson::String(s) => s.as_str(),
Bson::RegularExpression(re) => re.pattern.as_str(),
_ => return false,
};
let opts = match options {
Some(Bson::String(s)) => s.as_str(),
_ => match pattern {
Bson::RegularExpression(re) => re.options.as_str(),
_ => "",
},
};
let mut regex_pattern = String::new();
if opts.contains('i') {
regex_pattern.push_str("(?i)");
}
if opts.contains('m') {
regex_pattern.push_str("(?m)");
}
if opts.contains('s') {
regex_pattern.push_str("(?s)");
}
regex_pattern.push_str(pattern_str);
match Regex::new(&regex_pattern) {
Ok(re) => re.is_match(val),
Err(_) => false,
}
}
fn op_not(doc: &Document, field: &str, condition: &Bson) -> bool {
match condition {
Bson::Document(cond_doc) => !Self::match_field_operators(doc, field, cond_doc),
_ => true,
}
}
fn op_elem_match(actual: &Option<Bson>, condition: &Bson) -> bool {
let arr = match actual {
Some(Bson::Array(a)) => a,
_ => return false,
};
let cond_doc = match condition {
Bson::Document(d) => d,
_ => return false,
};
arr.iter().any(|elem| {
if let Bson::Document(elem_doc) = elem {
Self::matches_filter(elem_doc, cond_doc)
} else {
false
}
})
}
fn op_size(actual: &Option<Bson>, expected: &Bson) -> bool {
let arr = match actual {
Some(Bson::Array(a)) => a,
_ => return false,
};
let expected_size = match expected {
Bson::Int32(n) => *n as usize,
Bson::Int64(n) => *n as usize,
_ => return false,
};
arr.len() == expected_size
}
fn op_all(actual: &Option<Bson>, expected: &Bson) -> bool {
let arr = match actual {
Some(Bson::Array(a)) => a,
_ => return false,
};
let expected_arr = match expected {
Bson::Array(a) => a,
_ => return false,
};
expected_arr.iter().all(|expected_val| {
arr.iter().any(|elem| Self::bson_equals(elem, expected_val))
})
}
fn op_mod(actual: &Option<Bson>, expected: &Bson) -> bool {
let val = match actual {
Some(v) => match v {
Bson::Int32(n) => *n as i64,
Bson::Int64(n) => *n,
Bson::Double(n) => *n as i64,
_ => return false,
},
None => return false,
};
let arr = match expected {
Bson::Array(a) if a.len() == 2 => a,
_ => return false,
};
let divisor = match &arr[0] {
Bson::Int32(n) => *n as i64,
Bson::Int64(n) => *n,
_ => return false,
};
let remainder = match &arr[1] {
Bson::Int32(n) => *n as i64,
Bson::Int64(n) => *n,
_ => return false,
};
if divisor == 0 {
return false;
}
val % divisor == remainder
}
// --- Logical operators ---
fn match_logical_and(doc: &Document, conditions: &Bson) -> bool {
match conditions {
Bson::Array(arr) => arr.iter().all(|cond| {
if let Bson::Document(cond_doc) = cond {
Self::matches_filter(doc, cond_doc)
} else {
false
}
}),
_ => false,
}
}
fn match_logical_or(doc: &Document, conditions: &Bson) -> bool {
match conditions {
Bson::Array(arr) => arr.iter().any(|cond| {
if let Bson::Document(cond_doc) = cond {
Self::matches_filter(doc, cond_doc)
} else {
false
}
}),
_ => false,
}
}
fn match_logical_nor(doc: &Document, conditions: &Bson) -> bool {
!Self::match_logical_or(doc, conditions)
}
fn match_logical_not(doc: &Document, condition: &Bson) -> bool {
match condition {
Bson::Document(cond_doc) => !Self::matches_filter(doc, cond_doc),
_ => true,
}
}
}
#[derive(Debug, Clone, Copy)]
enum CmpOp {
Gt,
Gte,
Lt,
Lte,
}
impl CmpOp {
fn check(self, ord: std::cmp::Ordering) -> bool {
use std::cmp::Ordering;
match self {
CmpOp::Gt => ord == Ordering::Greater,
CmpOp::Gte => ord == Ordering::Greater || ord == Ordering::Equal,
CmpOp::Lt => ord == Ordering::Less,
CmpOp::Lte => ord == Ordering::Less || ord == Ordering::Equal,
}
}
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn test_simple_equality() {
let doc = bson::doc! { "name": "Alice", "age": 30 };
assert!(QueryMatcher::matches(&doc, &bson::doc! { "name": "Alice" }));
assert!(!QueryMatcher::matches(&doc, &bson::doc! { "name": "Bob" }));
}
#[test]
fn test_comparison_operators() {
let doc = bson::doc! { "age": 30 };
assert!(QueryMatcher::matches(&doc, &bson::doc! { "age": { "$gt": 25 } }));
assert!(QueryMatcher::matches(&doc, &bson::doc! { "age": { "$gte": 30 } }));
assert!(QueryMatcher::matches(&doc, &bson::doc! { "age": { "$lt": 35 } }));
assert!(QueryMatcher::matches(&doc, &bson::doc! { "age": { "$lte": 30 } }));
assert!(!QueryMatcher::matches(&doc, &bson::doc! { "age": { "$gt": 30 } }));
}
#[test]
fn test_in_operator() {
let doc = bson::doc! { "status": "active" };
assert!(QueryMatcher::matches(&doc, &bson::doc! { "status": { "$in": ["active", "pending"] } }));
assert!(!QueryMatcher::matches(&doc, &bson::doc! { "status": { "$in": ["closed"] } }));
}
#[test]
fn test_exists_operator() {
let doc = bson::doc! { "name": "Alice" };
assert!(QueryMatcher::matches(&doc, &bson::doc! { "name": { "$exists": true } }));
assert!(!QueryMatcher::matches(&doc, &bson::doc! { "age": { "$exists": true } }));
assert!(QueryMatcher::matches(&doc, &bson::doc! { "age": { "$exists": false } }));
}
#[test]
fn test_logical_or() {
let doc = bson::doc! { "age": 30 };
assert!(QueryMatcher::matches(&doc, &bson::doc! {
"$or": [{ "age": 30 }, { "age": 40 }]
}));
assert!(!QueryMatcher::matches(&doc, &bson::doc! {
"$or": [{ "age": 20 }, { "age": 40 }]
}));
}
#[test]
fn test_logical_and() {
let doc = bson::doc! { "age": 30, "name": "Alice" };
assert!(QueryMatcher::matches(&doc, &bson::doc! {
"$and": [{ "age": 30 }, { "name": "Alice" }]
}));
assert!(!QueryMatcher::matches(&doc, &bson::doc! {
"$and": [{ "age": 30 }, { "name": "Bob" }]
}));
}
#[test]
fn test_dot_notation() {
let doc = bson::doc! { "address": { "city": "NYC" } };
assert!(QueryMatcher::matches(&doc, &bson::doc! { "address.city": "NYC" }));
}
#[test]
fn test_ne_operator() {
let doc = bson::doc! { "status": "active" };
assert!(QueryMatcher::matches(&doc, &bson::doc! { "status": { "$ne": "closed" } }));
assert!(!QueryMatcher::matches(&doc, &bson::doc! { "status": { "$ne": "active" } }));
}
#[test]
fn test_cross_type_numeric_equality() {
let doc = bson::doc! { "count": 5_i32 };
assert!(QueryMatcher::matches(&doc, &bson::doc! { "count": 5_i64 }));
}
#[test]
fn test_empty_filter_matches_all() {
let doc = bson::doc! { "x": 1 };
assert!(QueryMatcher::matches(&doc, &bson::doc! {}));
}
}
+168
View File
@@ -0,0 +1,168 @@
use bson::{Bson, Document};
use crate::field_path::get_nested_value;
/// Apply a projection to a document.
/// Inclusion mode: only specified fields + _id.
/// Exclusion mode: all fields except specified ones.
/// _id can be explicitly excluded in either mode.
pub fn apply_projection(doc: &Document, projection: &Document) -> Document {
if projection.is_empty() {
return doc.clone();
}
// Determine mode: inclusion or exclusion
let mut has_inclusion = false;
let mut id_explicitly_set = false;
for (key, value) in projection {
if key == "_id" {
id_explicitly_set = true;
continue;
}
match value {
Bson::Int32(0) | Bson::Int64(0) | Bson::Boolean(false) => {}
_ => has_inclusion = true,
}
}
if has_inclusion {
apply_inclusion(doc, projection, id_explicitly_set)
} else {
apply_exclusion(doc, projection)
}
}
fn apply_inclusion(doc: &Document, projection: &Document, id_explicitly_set: bool) -> Document {
let mut result = Document::new();
// Include _id by default unless explicitly excluded
let include_id = if id_explicitly_set {
is_truthy(projection.get("_id"))
} else {
true
};
if include_id {
if let Some(id) = doc.get("_id") {
result.insert("_id", id.clone());
}
}
for (key, value) in projection {
if key == "_id" {
continue;
}
if !is_truthy(Some(value)) {
continue;
}
if key.contains('.') {
if let Some(val) = get_nested_value(doc, key) {
// Rebuild nested structure
set_nested_in_result(&mut result, key, val);
}
} else if let Some(val) = doc.get(key) {
result.insert(key.clone(), val.clone());
}
}
result
}
fn apply_exclusion(doc: &Document, projection: &Document) -> Document {
let mut result = doc.clone();
for (key, value) in projection {
if !is_truthy(Some(value)) {
if key.contains('.') {
// Remove nested field
remove_nested_from_result(&mut result, key);
} else {
result.remove(key);
}
}
}
result
}
fn is_truthy(value: Option<&Bson>) -> bool {
match value {
None => false,
Some(Bson::Int32(0)) | Some(Bson::Int64(0)) | Some(Bson::Boolean(false)) => false,
_ => true,
}
}
fn set_nested_in_result(doc: &mut Document, path: &str, value: Bson) {
let parts: Vec<&str> = path.split('.').collect();
set_nested_recursive(doc, &parts, value);
}
fn set_nested_recursive(doc: &mut Document, parts: &[&str], value: Bson) {
if parts.len() == 1 {
doc.insert(parts[0].to_string(), value);
return;
}
let key = parts[0];
if !doc.contains_key(key) {
doc.insert(key.to_string(), Bson::Document(Document::new()));
}
if let Some(Bson::Document(ref mut nested)) = doc.get_mut(key) {
set_nested_recursive(nested, &parts[1..], value);
}
}
fn remove_nested_from_result(doc: &mut Document, path: &str) {
let parts: Vec<&str> = path.split('.').collect();
remove_nested_recursive(doc, &parts);
}
fn remove_nested_recursive(doc: &mut Document, parts: &[&str]) {
if parts.len() == 1 {
doc.remove(parts[0]);
return;
}
let key = parts[0];
if let Some(Bson::Document(ref mut nested)) = doc.get_mut(key) {
remove_nested_recursive(nested, &parts[1..]);
}
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn test_inclusion_projection() {
let doc = bson::doc! { "_id": 1, "name": "Alice", "age": 30, "email": "a@b.c" };
let proj = bson::doc! { "name": 1, "age": 1 };
let result = apply_projection(&doc, &proj);
assert!(result.contains_key("_id"));
assert!(result.contains_key("name"));
assert!(result.contains_key("age"));
assert!(!result.contains_key("email"));
}
#[test]
fn test_exclusion_projection() {
let doc = bson::doc! { "_id": 1, "name": "Alice", "age": 30 };
let proj = bson::doc! { "age": 0 };
let result = apply_projection(&doc, &proj);
assert!(result.contains_key("_id"));
assert!(result.contains_key("name"));
assert!(!result.contains_key("age"));
}
#[test]
fn test_exclude_id() {
let doc = bson::doc! { "_id": 1, "name": "Alice" };
let proj = bson::doc! { "name": 1, "_id": 0 };
let result = apply_projection(&doc, &proj);
assert!(!result.contains_key("_id"));
assert!(result.contains_key("name"));
}
}
+137
View File
@@ -0,0 +1,137 @@
use bson::{Bson, Document};
use crate::field_path::get_nested_value;
/// Sort documents according to a sort specification.
/// Sort spec: `{ field1: 1, field2: -1 }` where 1 = ascending, -1 = descending.
pub fn sort_documents(docs: &mut [Document], sort_spec: &Document) {
if sort_spec.is_empty() {
return;
}
docs.sort_by(|a, b| {
for (field, direction) in sort_spec {
let ascending = match direction {
Bson::Int32(n) => *n > 0,
Bson::Int64(n) => *n > 0,
Bson::String(s) => !s.eq_ignore_ascii_case("desc") && !s.eq_ignore_ascii_case("descending"),
_ => true,
};
let a_val = get_value(a, field);
let b_val = get_value(b, field);
let ord = compare_bson_values(&a_val, &b_val);
let ord = if ascending { ord } else { ord.reverse() };
if ord != std::cmp::Ordering::Equal {
return ord;
}
}
std::cmp::Ordering::Equal
});
}
fn get_value(doc: &Document, field: &str) -> Option<Bson> {
if field.contains('.') {
get_nested_value(doc, field)
} else {
doc.get(field).cloned()
}
}
/// Compare two BSON values for sorting purposes.
/// BSON type sort order: null < numbers < strings < objects < arrays < binData < ObjectId < bool < date
fn compare_bson_values(a: &Option<Bson>, b: &Option<Bson>) -> std::cmp::Ordering {
use std::cmp::Ordering;
match (a, b) {
(None, None) => Ordering::Equal,
(None, Some(Bson::Null)) => Ordering::Equal,
(Some(Bson::Null), None) => Ordering::Equal,
(None, Some(_)) => Ordering::Less,
(Some(_), None) => Ordering::Greater,
(Some(Bson::Null), Some(Bson::Null)) => Ordering::Equal,
(Some(Bson::Null), Some(_)) => Ordering::Less,
(Some(_), Some(Bson::Null)) => Ordering::Greater,
(Some(av), Some(bv)) => compare_typed(av, bv),
}
}
fn compare_typed(a: &Bson, b: &Bson) -> std::cmp::Ordering {
use std::cmp::Ordering;
// Cross-type numeric comparison
let a_num = to_f64(a);
let b_num = to_f64(b);
if let (Some(an), Some(bn)) = (a_num, b_num) {
return an.partial_cmp(&bn).unwrap_or(Ordering::Equal);
}
match (a, b) {
(Bson::String(x), Bson::String(y)) => x.cmp(y),
(Bson::Boolean(x), Bson::Boolean(y)) => x.cmp(y),
(Bson::DateTime(x), Bson::DateTime(y)) => x.cmp(y),
(Bson::ObjectId(x), Bson::ObjectId(y)) => x.cmp(y),
_ => {
let ta = type_order(a);
let tb = type_order(b);
ta.cmp(&tb)
}
}
}
fn to_f64(v: &Bson) -> Option<f64> {
match v {
Bson::Int32(n) => Some(*n as f64),
Bson::Int64(n) => Some(*n as f64),
Bson::Double(n) => Some(*n),
_ => None,
}
}
fn type_order(v: &Bson) -> u8 {
match v {
Bson::Null => 0,
Bson::Int32(_) | Bson::Int64(_) | Bson::Double(_) | Bson::Decimal128(_) => 1,
Bson::String(_) => 2,
Bson::Document(_) => 3,
Bson::Array(_) => 4,
Bson::Binary(_) => 5,
Bson::ObjectId(_) => 7,
Bson::Boolean(_) => 8,
Bson::DateTime(_) => 9,
_ => 10,
}
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn test_sort_ascending() {
let mut docs = vec![
bson::doc! { "x": 3 },
bson::doc! { "x": 1 },
bson::doc! { "x": 2 },
];
sort_documents(&mut docs, &bson::doc! { "x": 1 });
assert_eq!(docs[0].get_i32("x").unwrap(), 1);
assert_eq!(docs[1].get_i32("x").unwrap(), 2);
assert_eq!(docs[2].get_i32("x").unwrap(), 3);
}
#[test]
fn test_sort_descending() {
let mut docs = vec![
bson::doc! { "x": 1 },
bson::doc! { "x": 3 },
bson::doc! { "x": 2 },
];
sort_documents(&mut docs, &bson::doc! { "x": -1 });
assert_eq!(docs[0].get_i32("x").unwrap(), 3);
assert_eq!(docs[1].get_i32("x").unwrap(), 2);
assert_eq!(docs[2].get_i32("x").unwrap(), 1);
}
}
+575
View File
@@ -0,0 +1,575 @@
use bson::{Bson, Document, doc};
use crate::error::QueryError;
use crate::field_path::{get_nested_value, set_nested_value, remove_nested_value};
use crate::matcher::QueryMatcher;
/// Update engine — applies update operators to documents.
pub struct UpdateEngine;
impl UpdateEngine {
/// Apply an update specification to a document.
/// Returns the updated document.
pub fn apply_update(
doc: &Document,
update: &Document,
_array_filters: Option<&[Document]>,
) -> Result<Document, QueryError> {
// Check if this is a replacement (no $ operators)
if !update.keys().any(|k| k.starts_with('$')) {
return Self::apply_replacement(doc, update);
}
let mut result = doc.clone();
for (op, value) in update {
let fields = match value {
Bson::Document(d) => d,
_ => continue,
};
match op.as_str() {
"$set" => Self::apply_set(&mut result, fields)?,
"$unset" => Self::apply_unset(&mut result, fields)?,
"$inc" => Self::apply_inc(&mut result, fields)?,
"$mul" => Self::apply_mul(&mut result, fields)?,
"$min" => Self::apply_min(&mut result, fields)?,
"$max" => Self::apply_max(&mut result, fields)?,
"$rename" => Self::apply_rename(&mut result, fields)?,
"$currentDate" => Self::apply_current_date(&mut result, fields)?,
"$setOnInsert" => {} // handled separately during upsert
"$push" => Self::apply_push(&mut result, fields)?,
"$pop" => Self::apply_pop(&mut result, fields)?,
"$pull" => Self::apply_pull(&mut result, fields)?,
"$pullAll" => Self::apply_pull_all(&mut result, fields)?,
"$addToSet" => Self::apply_add_to_set(&mut result, fields)?,
"$bit" => Self::apply_bit(&mut result, fields)?,
other => {
return Err(QueryError::InvalidUpdate(format!(
"Unknown update operator: {}",
other
)));
}
}
}
Ok(result)
}
/// Apply $setOnInsert fields (used during upsert only).
pub fn apply_set_on_insert(doc: &mut Document, fields: &Document) {
for (key, value) in fields {
if key.contains('.') {
set_nested_value(doc, key, value.clone());
} else {
doc.insert(key.clone(), value.clone());
}
}
}
/// Deep clone a BSON document.
pub fn deep_clone(doc: &Document) -> Document {
doc.clone()
}
fn apply_replacement(doc: &Document, replacement: &Document) -> Result<Document, QueryError> {
let mut result = replacement.clone();
// Preserve _id
if let Some(id) = doc.get("_id") {
result.insert("_id", id.clone());
}
Ok(result)
}
fn apply_set(doc: &mut Document, fields: &Document) -> Result<(), QueryError> {
for (key, value) in fields {
if key.contains('.') {
set_nested_value(doc, key, value.clone());
} else {
doc.insert(key.clone(), value.clone());
}
}
Ok(())
}
fn apply_unset(doc: &mut Document, fields: &Document) -> Result<(), QueryError> {
for (key, _) in fields {
if key.contains('.') {
remove_nested_value(doc, key);
} else {
doc.remove(key);
}
}
Ok(())
}
fn apply_inc(doc: &mut Document, fields: &Document) -> Result<(), QueryError> {
for (key, inc_value) in fields {
let current = if key.contains('.') {
get_nested_value(doc, key)
} else {
doc.get(key).cloned()
};
let new_value = match (&current, inc_value) {
(Some(Bson::Int32(a)), Bson::Int32(b)) => Bson::Int32(a + b),
(Some(Bson::Int64(a)), Bson::Int64(b)) => Bson::Int64(a + b),
(Some(Bson::Int32(a)), Bson::Int64(b)) => Bson::Int64(*a as i64 + b),
(Some(Bson::Int64(a)), Bson::Int32(b)) => Bson::Int64(a + *b as i64),
(Some(Bson::Double(a)), Bson::Double(b)) => Bson::Double(a + b),
(Some(Bson::Int32(a)), Bson::Double(b)) => Bson::Double(*a as f64 + b),
(Some(Bson::Double(a)), Bson::Int32(b)) => Bson::Double(a + *b as f64),
(Some(Bson::Int64(a)), Bson::Double(b)) => Bson::Double(*a as f64 + b),
(Some(Bson::Double(a)), Bson::Int64(b)) => Bson::Double(a + *b as f64),
(None, v) => v.clone(), // treat missing as 0
_ => {
return Err(QueryError::TypeMismatch(format!(
"Cannot apply $inc to non-numeric field: {}",
key
)));
}
};
if key.contains('.') {
set_nested_value(doc, key, new_value);
} else {
doc.insert(key.clone(), new_value);
}
}
Ok(())
}
fn apply_mul(doc: &mut Document, fields: &Document) -> Result<(), QueryError> {
for (key, mul_value) in fields {
let current = if key.contains('.') {
get_nested_value(doc, key)
} else {
doc.get(key).cloned()
};
let new_value = match (&current, mul_value) {
(Some(Bson::Int32(a)), Bson::Int32(b)) => Bson::Int32(a * b),
(Some(Bson::Int64(a)), Bson::Int64(b)) => Bson::Int64(a * b),
(Some(Bson::Int32(a)), Bson::Int64(b)) => Bson::Int64(*a as i64 * b),
(Some(Bson::Int64(a)), Bson::Int32(b)) => Bson::Int64(a * *b as i64),
(Some(Bson::Double(a)), Bson::Double(b)) => Bson::Double(a * b),
(Some(Bson::Int32(a)), Bson::Double(b)) => Bson::Double(*a as f64 * b),
(Some(Bson::Double(a)), Bson::Int32(b)) => Bson::Double(a * *b as f64),
(None, _) => Bson::Int32(0), // missing field * anything = 0
_ => {
return Err(QueryError::TypeMismatch(format!(
"Cannot apply $mul to non-numeric field: {}",
key
)));
}
};
if key.contains('.') {
set_nested_value(doc, key, new_value);
} else {
doc.insert(key.clone(), new_value);
}
}
Ok(())
}
fn apply_min(doc: &mut Document, fields: &Document) -> Result<(), QueryError> {
for (key, min_value) in fields {
let current = if key.contains('.') {
get_nested_value(doc, key)
} else {
doc.get(key).cloned()
};
let should_update = match &current {
None => true,
Some(cur) => {
if let Some(ord) = QueryMatcher::bson_compare_pub(min_value, cur) {
ord == std::cmp::Ordering::Less
} else {
false
}
}
};
if should_update {
if key.contains('.') {
set_nested_value(doc, key, min_value.clone());
} else {
doc.insert(key.clone(), min_value.clone());
}
}
}
Ok(())
}
fn apply_max(doc: &mut Document, fields: &Document) -> Result<(), QueryError> {
for (key, max_value) in fields {
let current = if key.contains('.') {
get_nested_value(doc, key)
} else {
doc.get(key).cloned()
};
let should_update = match &current {
None => true,
Some(cur) => {
if let Some(ord) = QueryMatcher::bson_compare_pub(max_value, cur) {
ord == std::cmp::Ordering::Greater
} else {
false
}
}
};
if should_update {
if key.contains('.') {
set_nested_value(doc, key, max_value.clone());
} else {
doc.insert(key.clone(), max_value.clone());
}
}
}
Ok(())
}
fn apply_rename(doc: &mut Document, fields: &Document) -> Result<(), QueryError> {
for (old_name, new_name_bson) in fields {
let new_name = match new_name_bson {
Bson::String(s) => s.clone(),
_ => continue,
};
if let Some(value) = doc.remove(old_name) {
doc.insert(new_name, value);
}
}
Ok(())
}
fn apply_current_date(doc: &mut Document, fields: &Document) -> Result<(), QueryError> {
let now = bson::DateTime::now();
for (key, spec) in fields {
let value = match spec {
Bson::Boolean(true) => Bson::DateTime(now),
Bson::Document(d) => {
match d.get_str("$type").unwrap_or("date") {
"date" => Bson::DateTime(now),
"timestamp" => Bson::Timestamp(bson::Timestamp {
time: (now.timestamp_millis() / 1000) as u32,
increment: 0,
}),
_ => Bson::DateTime(now),
}
}
_ => continue,
};
if key.contains('.') {
set_nested_value(doc, key, value);
} else {
doc.insert(key.clone(), value);
}
}
Ok(())
}
fn apply_push(doc: &mut Document, fields: &Document) -> Result<(), QueryError> {
for (key, value) in fields {
let arr = Self::get_or_create_array(doc, key);
match value {
Bson::Document(d) if d.contains_key("$each") => {
let each = match d.get("$each") {
Some(Bson::Array(a)) => a.clone(),
_ => return Err(QueryError::InvalidUpdate("$each must be an array".into())),
};
let position = d.get("$position").and_then(|v| match v {
Bson::Int32(n) => Some(*n as usize),
Bson::Int64(n) => Some(*n as usize),
_ => None,
});
if let Some(pos) = position {
let pos = pos.min(arr.len());
for (i, item) in each.into_iter().enumerate() {
arr.insert(pos + i, item);
}
} else {
arr.extend(each);
}
// Apply $sort if present
if let Some(sort_spec) = d.get("$sort") {
Self::sort_array(arr, sort_spec);
}
// Apply $slice if present
if let Some(slice) = d.get("$slice") {
Self::slice_array(arr, slice);
}
}
_ => {
arr.push(value.clone());
}
}
}
Ok(())
}
fn apply_pop(doc: &mut Document, fields: &Document) -> Result<(), QueryError> {
for (key, direction) in fields {
if let Some(Bson::Array(arr)) = doc.get_mut(key) {
if arr.is_empty() {
continue;
}
match direction {
Bson::Int32(-1) | Bson::Int64(-1) => { arr.remove(0); }
Bson::Int32(1) | Bson::Int64(1) => { arr.pop(); }
Bson::Double(f) if *f == 1.0 => { arr.pop(); }
Bson::Double(f) if *f == -1.0 => { arr.remove(0); }
_ => { arr.pop(); }
}
}
}
Ok(())
}
fn apply_pull(doc: &mut Document, fields: &Document) -> Result<(), QueryError> {
for (key, condition) in fields {
if let Some(Bson::Array(arr)) = doc.get_mut(key) {
match condition {
Bson::Document(cond_doc) if QueryMatcher::has_operators_pub(cond_doc) => {
arr.retain(|elem| {
if let Bson::Document(elem_doc) = elem {
!QueryMatcher::matches(elem_doc, cond_doc)
} else {
// For primitive matching with operators
let wrapper = doc! { "v": elem.clone() };
let cond_wrapper = doc! { "v": condition.clone() };
!QueryMatcher::matches(&wrapper, &cond_wrapper)
}
});
}
_ => {
arr.retain(|elem| elem != condition);
}
}
}
}
Ok(())
}
fn apply_pull_all(doc: &mut Document, fields: &Document) -> Result<(), QueryError> {
for (key, values) in fields {
if let (Some(Bson::Array(arr)), Bson::Array(to_remove)) = (doc.get_mut(key), values) {
arr.retain(|elem| !to_remove.contains(elem));
}
}
Ok(())
}
fn apply_add_to_set(doc: &mut Document, fields: &Document) -> Result<(), QueryError> {
for (key, value) in fields {
let arr = Self::get_or_create_array(doc, key);
match value {
Bson::Document(d) if d.contains_key("$each") => {
if let Some(Bson::Array(each)) = d.get("$each") {
for item in each {
if !arr.contains(item) {
arr.push(item.clone());
}
}
}
}
_ => {
if !arr.contains(value) {
arr.push(value.clone());
}
}
}
}
Ok(())
}
fn apply_bit(doc: &mut Document, fields: &Document) -> Result<(), QueryError> {
for (key, ops) in fields {
let ops_doc = match ops {
Bson::Document(d) => d,
_ => continue,
};
let current = doc.get(key).cloned().unwrap_or(Bson::Int32(0));
let mut val = match &current {
Bson::Int32(n) => *n as i64,
Bson::Int64(n) => *n,
_ => continue,
};
for (bit_op, operand) in ops_doc {
let operand_val = match operand {
Bson::Int32(n) => *n as i64,
Bson::Int64(n) => *n,
_ => continue,
};
match bit_op.as_str() {
"and" => val &= operand_val,
"or" => val |= operand_val,
"xor" => val ^= operand_val,
_ => {}
}
}
let new_value = match &current {
Bson::Int32(_) => Bson::Int32(val as i32),
_ => Bson::Int64(val),
};
doc.insert(key.clone(), new_value);
}
Ok(())
}
// --- Helpers ---
fn get_or_create_array<'a>(doc: &'a mut Document, key: &str) -> &'a mut Vec<Bson> {
// Ensure an array exists at this key
let needs_init = match doc.get(key) {
Some(Bson::Array(_)) => false,
_ => true,
};
if needs_init {
doc.insert(key.to_string(), Bson::Array(Vec::new()));
}
match doc.get_mut(key).unwrap() {
Bson::Array(arr) => arr,
_ => unreachable!(),
}
}
fn sort_array(arr: &mut Vec<Bson>, sort_spec: &Bson) {
match sort_spec {
Bson::Int32(dir) => {
let ascending = *dir > 0;
arr.sort_by(|a, b| {
let ord = partial_cmp_bson(a, b);
if ascending { ord } else { ord.reverse() }
});
}
Bson::Document(spec) => {
arr.sort_by(|a, b| {
for (field, dir) in spec {
let ascending = match dir {
Bson::Int32(n) => *n > 0,
_ => true,
};
let a_val = if let Bson::Document(d) = a { d.get(field) } else { None };
let b_val = if let Bson::Document(d) = b { d.get(field) } else { None };
let ord = match (a_val, b_val) {
(Some(av), Some(bv)) => partial_cmp_bson(av, bv),
(Some(_), None) => std::cmp::Ordering::Greater,
(None, Some(_)) => std::cmp::Ordering::Less,
(None, None) => std::cmp::Ordering::Equal,
};
let ord = if ascending { ord } else { ord.reverse() };
if ord != std::cmp::Ordering::Equal {
return ord;
}
}
std::cmp::Ordering::Equal
});
}
_ => {}
}
}
fn slice_array(arr: &mut Vec<Bson>, slice: &Bson) {
let n = match slice {
Bson::Int32(n) => *n as i64,
Bson::Int64(n) => *n,
_ => return,
};
if n >= 0 {
arr.truncate(n as usize);
} else {
let keep = (-n) as usize;
if keep < arr.len() {
let start = arr.len() - keep;
*arr = arr[start..].to_vec();
}
}
}
}
fn partial_cmp_bson(a: &Bson, b: &Bson) -> std::cmp::Ordering {
use std::cmp::Ordering;
match (a, b) {
(Bson::Int32(x), Bson::Int32(y)) => x.cmp(y),
(Bson::Int64(x), Bson::Int64(y)) => x.cmp(y),
(Bson::Double(x), Bson::Double(y)) => x.partial_cmp(y).unwrap_or(Ordering::Equal),
(Bson::String(x), Bson::String(y)) => x.cmp(y),
(Bson::Boolean(x), Bson::Boolean(y)) => x.cmp(y),
_ => Ordering::Equal,
}
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn test_set() {
let doc = doc! { "_id": 1, "name": "Alice" };
let update = doc! { "$set": { "name": "Bob", "age": 30 } };
let result = UpdateEngine::apply_update(&doc, &update, None).unwrap();
assert_eq!(result.get_str("name").unwrap(), "Bob");
assert_eq!(result.get_i32("age").unwrap(), 30);
}
#[test]
fn test_inc() {
let doc = doc! { "_id": 1, "count": 5 };
let update = doc! { "$inc": { "count": 3 } };
let result = UpdateEngine::apply_update(&doc, &update, None).unwrap();
assert_eq!(result.get_i32("count").unwrap(), 8);
}
#[test]
fn test_unset() {
let doc = doc! { "_id": 1, "name": "Alice", "age": 30 };
let update = doc! { "$unset": { "age": "" } };
let result = UpdateEngine::apply_update(&doc, &update, None).unwrap();
assert!(result.get("age").is_none());
}
#[test]
fn test_replacement() {
let doc = doc! { "_id": 1, "name": "Alice", "age": 30 };
let update = doc! { "name": "Bob" };
let result = UpdateEngine::apply_update(&doc, &update, None).unwrap();
assert_eq!(result.get_i32("_id").unwrap(), 1); // preserved
assert_eq!(result.get_str("name").unwrap(), "Bob");
assert!(result.get("age").is_none()); // removed
}
#[test]
fn test_push() {
let doc = doc! { "_id": 1, "tags": ["a"] };
let update = doc! { "$push": { "tags": "b" } };
let result = UpdateEngine::apply_update(&doc, &update, None).unwrap();
let tags = result.get_array("tags").unwrap();
assert_eq!(tags.len(), 2);
}
#[test]
fn test_add_to_set() {
let doc = doc! { "_id": 1, "tags": ["a", "b"] };
let update = doc! { "$addToSet": { "tags": "a" } };
let result = UpdateEngine::apply_update(&doc, &update, None).unwrap();
let tags = result.get_array("tags").unwrap();
assert_eq!(tags.len(), 2); // no duplicate
}
}
+22
View File
@@ -0,0 +1,22 @@
[package]
name = "rustdb-storage"
version.workspace = true
edition.workspace = true
license.workspace = true
authors.workspace = true
description = "Storage adapters (memory, file) with WAL and OpLog for RustDb"
[dependencies]
bson = { workspace = true }
serde = { workspace = true }
serde_json = { workspace = true }
dashmap = { workspace = true }
tokio = { workspace = true }
thiserror = { workspace = true }
tracing = { workspace = true }
crc32fast = { workspace = true }
uuid = { workspace = true }
async-trait = { workspace = true }
[dev-dependencies]
tempfile = { workspace = true }
+185
View File
@@ -0,0 +1,185 @@
use std::collections::HashSet;
use async_trait::async_trait;
use bson::Document;
use crate::error::StorageResult;
/// Core storage adapter trait that all backends must implement.
#[async_trait]
pub trait StorageAdapter: Send + Sync {
// ---- lifecycle ----
/// Initialize the storage backend (create directories, open files, etc.).
async fn initialize(&self) -> StorageResult<()>;
/// Gracefully shut down the storage backend.
async fn close(&self) -> StorageResult<()>;
// ---- database operations ----
/// List all database names.
async fn list_databases(&self) -> StorageResult<Vec<String>>;
/// Create a new database.
async fn create_database(&self, db: &str) -> StorageResult<()>;
/// Drop a database and all its collections.
async fn drop_database(&self, db: &str) -> StorageResult<()>;
/// Check whether a database exists.
async fn database_exists(&self, db: &str) -> StorageResult<bool>;
// ---- collection operations ----
/// List all collection names in a database.
async fn list_collections(&self, db: &str) -> StorageResult<Vec<String>>;
/// Create a new collection inside a database.
async fn create_collection(&self, db: &str, coll: &str) -> StorageResult<()>;
/// Drop a collection.
async fn drop_collection(&self, db: &str, coll: &str) -> StorageResult<()>;
/// Check whether a collection exists.
async fn collection_exists(&self, db: &str, coll: &str) -> StorageResult<bool>;
/// Rename a collection within the same database.
async fn rename_collection(
&self,
db: &str,
old_name: &str,
new_name: &str,
) -> StorageResult<()>;
// ---- document write operations ----
/// Insert a single document. Returns the `_id` as hex string.
async fn insert_one(
&self,
db: &str,
coll: &str,
doc: Document,
) -> StorageResult<String>;
/// Insert many documents. Returns the `_id` hex strings.
async fn insert_many(
&self,
db: &str,
coll: &str,
docs: Vec<Document>,
) -> StorageResult<Vec<String>>;
/// Replace a document by its `_id` hex string.
async fn update_by_id(
&self,
db: &str,
coll: &str,
id: &str,
doc: Document,
) -> StorageResult<()>;
/// Delete a single document by `_id` hex string.
async fn delete_by_id(
&self,
db: &str,
coll: &str,
id: &str,
) -> StorageResult<()>;
/// Delete multiple documents by `_id` hex strings.
async fn delete_by_ids(
&self,
db: &str,
coll: &str,
ids: &[String],
) -> StorageResult<()>;
// ---- document read operations ----
/// Return all documents in a collection.
async fn find_all(
&self,
db: &str,
coll: &str,
) -> StorageResult<Vec<Document>>;
/// Return documents whose `_id` hex is in the given set.
async fn find_by_ids(
&self,
db: &str,
coll: &str,
ids: HashSet<String>,
) -> StorageResult<Vec<Document>>;
/// Return a single document by `_id` hex.
async fn find_by_id(
&self,
db: &str,
coll: &str,
id: &str,
) -> StorageResult<Option<Document>>;
/// Count documents in a collection.
async fn count(
&self,
db: &str,
coll: &str,
) -> StorageResult<u64>;
// ---- index operations ----
/// Persist an index specification for a collection.
async fn save_index(
&self,
db: &str,
coll: &str,
name: &str,
spec: Document,
) -> StorageResult<()>;
/// Return all saved index specs for a collection.
async fn get_indexes(
&self,
db: &str,
coll: &str,
) -> StorageResult<Vec<Document>>;
/// Drop a named index.
async fn drop_index(
&self,
db: &str,
coll: &str,
name: &str,
) -> StorageResult<()>;
// ---- snapshot / conflict detection ----
/// Create a logical snapshot timestamp for a collection. Returns a timestamp (ms).
async fn create_snapshot(
&self,
db: &str,
coll: &str,
) -> StorageResult<i64>;
/// Check if any of the given document ids have been modified after `snapshot_time`.
async fn has_conflicts(
&self,
db: &str,
coll: &str,
ids: &HashSet<String>,
snapshot_time: i64,
) -> StorageResult<bool>;
// ---- optional persistence (for in-memory backends) ----
/// Persist current state to durable storage. Default: no-op.
async fn persist(&self) -> StorageResult<()> {
Ok(())
}
/// Restore state from durable storage. Default: no-op.
async fn restore(&self) -> StorageResult<()> {
Ok(())
}
}
@@ -0,0 +1,499 @@
//! Binary Write-Ahead Log for crash recovery.
//!
//! # Protocol
//!
//! Every mutation follows this sequence:
//! 1. Append WAL record → fsync
//! 2. Perform the actual data write
//! 3. Append WAL commit marker → fsync
//!
//! On recovery, uncommitted entries (those without a matching commit marker)
//! are replayed or verified.
//!
//! # Record format
//!
//! ```text
//! ┌──────────┬──────────┬──────────┬──────────┬──────────┬──────────┬────────────┐
//! │ magic │ seq │ op │ key_len │ val_len │ crc32 │ payload │
//! │ u16 LE │ u64 LE │ u8 │ u32 LE │ u32 LE │ u32 LE │ [key][val] │
//! │ 0xWA01 │ │ │ │ │ │ │
//! └──────────┴──────────┴──────────┴──────────┴──────────┴──────────┴────────────┘
//! ```
//!
//! # Commit marker
//!
//! ```text
//! ┌──────────┬──────────┬──────────┐
//! │ magic │ seq │ crc32 │
//! │ u16 LE │ u64 LE │ u32 LE │
//! │ 0xCA01 │ │ │
//! └──────────┴──────────┴──────────┘
//! ```
use std::io::{self, BufReader, Read, Write};
use std::path::{Path, PathBuf};
use std::sync::atomic::{AtomicU64, Ordering};
use crate::error::{StorageError, StorageResult};
use crate::record::{FileHeader, FileType, FILE_HEADER_SIZE};
// ---------------------------------------------------------------------------
// Constants
// ---------------------------------------------------------------------------
const WAL_RECORD_MAGIC: u16 = 0xAA01;
const WAL_COMMIT_MAGIC: u16 = 0xCC01;
/// WAL record header: magic(2) + seq(8) + op(1) + key_len(4) + val_len(4) + crc(4) = 23
const WAL_RECORD_HEADER: usize = 23;
/// Commit marker size: magic(2) + seq(8) + crc(4) = 14
const WAL_COMMIT_SIZE: usize = 14;
// ---------------------------------------------------------------------------
// WAL operation type
// ---------------------------------------------------------------------------
#[derive(Debug, Clone, Copy, PartialEq, Eq)]
#[repr(u8)]
pub enum WalOpType {
Insert = 1,
Update = 2,
Delete = 3,
}
impl WalOpType {
fn from_u8(v: u8) -> StorageResult<Self> {
match v {
1 => Ok(WalOpType::Insert),
2 => Ok(WalOpType::Update),
3 => Ok(WalOpType::Delete),
_ => Err(StorageError::WalError(format!("unknown WAL op: {v}"))),
}
}
}
// ---------------------------------------------------------------------------
// WAL entry (parsed from file)
// ---------------------------------------------------------------------------
#[derive(Debug, Clone)]
pub struct WalEntry {
pub seq: u64,
pub op: WalOpType,
pub key: Vec<u8>,
pub value: Vec<u8>,
}
// ---------------------------------------------------------------------------
// Internal: what we read from the WAL file
// ---------------------------------------------------------------------------
#[derive(Debug)]
enum WalItem {
Record(WalEntry),
Commit(u64), // seq that was committed
}
// ---------------------------------------------------------------------------
// BinaryWal
// ---------------------------------------------------------------------------
/// Binary write-ahead log backed by a single file.
pub struct BinaryWal {
path: PathBuf,
next_seq: AtomicU64,
}
impl BinaryWal {
/// Create a new WAL. Does not touch the filesystem until `initialize()`.
pub fn new(path: PathBuf) -> Self {
Self {
path,
next_seq: AtomicU64::new(1),
}
}
/// Initialize: create parent dirs, recover sequence counter from existing file.
pub fn initialize(&self) -> StorageResult<()> {
if let Some(parent) = self.path.parent() {
std::fs::create_dir_all(parent)?;
}
if self.path.exists() {
// Scan to find highest seq
let items = self.read_all_items()?;
let max_seq = items
.iter()
.map(|item| match item {
WalItem::Record(e) => e.seq,
WalItem::Commit(s) => *s,
})
.max()
.unwrap_or(0);
self.next_seq.store(max_seq + 1, Ordering::SeqCst);
} else {
// Create the file with a header
let mut f = std::fs::File::create(&self.path)?;
let hdr = FileHeader::new(FileType::Wal);
f.write_all(&hdr.encode())?;
f.flush()?;
f.sync_all()?;
}
Ok(())
}
/// Append a WAL record. Returns the sequence number. Fsyncs.
pub fn append(
&self,
op: WalOpType,
key: &[u8],
value: &[u8],
) -> StorageResult<u64> {
let seq = self.next_seq.fetch_add(1, Ordering::SeqCst);
let key_len = key.len() as u32;
let val_len = value.len() as u32;
// Build header bytes (without CRC)
let mut hdr = Vec::with_capacity(WAL_RECORD_HEADER);
hdr.extend_from_slice(&WAL_RECORD_MAGIC.to_le_bytes());
hdr.extend_from_slice(&seq.to_le_bytes());
hdr.push(op as u8);
hdr.extend_from_slice(&key_len.to_le_bytes());
hdr.extend_from_slice(&val_len.to_le_bytes());
// CRC placeholder
hdr.extend_from_slice(&0u32.to_le_bytes());
// Compute CRC over header (without crc field) + payload
let mut hasher = crc32fast::Hasher::new();
hasher.update(&hdr[0..19]); // magic + seq + op + key_len + val_len
hasher.update(key);
hasher.update(value);
let crc = hasher.finalize();
hdr[19..23].copy_from_slice(&crc.to_le_bytes());
// Append to file
let mut f = std::fs::OpenOptions::new()
.create(true)
.append(true)
.open(&self.path)?;
f.write_all(&hdr)?;
f.write_all(key)?;
f.write_all(value)?;
f.sync_all()?;
Ok(seq)
}
/// Append a commit marker for the given sequence. Fsyncs.
pub fn append_commit(&self, seq: u64) -> StorageResult<()> {
let mut buf = Vec::with_capacity(WAL_COMMIT_SIZE);
buf.extend_from_slice(&WAL_COMMIT_MAGIC.to_le_bytes());
buf.extend_from_slice(&seq.to_le_bytes());
// CRC over magic + seq
let mut hasher = crc32fast::Hasher::new();
hasher.update(&buf[0..10]);
let crc = hasher.finalize();
buf.extend_from_slice(&crc.to_le_bytes());
let mut f = std::fs::OpenOptions::new()
.create(true)
.append(true)
.open(&self.path)?;
f.write_all(&buf)?;
f.sync_all()?;
Ok(())
}
/// Recover: return all WAL entries that were NOT committed.
pub fn recover(&self) -> StorageResult<Vec<WalEntry>> {
let items = self.read_all_items()?;
// Collect committed seq numbers
let committed: std::collections::HashSet<u64> = items
.iter()
.filter_map(|item| {
if let WalItem::Commit(s) = item {
Some(*s)
} else {
None
}
})
.collect();
// Return records without a commit marker
let uncommitted: Vec<WalEntry> = items
.into_iter()
.filter_map(|item| {
if let WalItem::Record(entry) = item {
if !committed.contains(&entry.seq) {
return Some(entry);
}
}
None
})
.collect();
Ok(uncommitted)
}
/// Truncate the WAL: rewrite with just the file header (clears all entries).
pub fn truncate(&self) -> StorageResult<()> {
let mut f = std::fs::File::create(&self.path)?;
let hdr = FileHeader::new(FileType::Wal);
f.write_all(&hdr.encode())?;
f.flush()?;
f.sync_all()?;
// Don't reset next_seq — it should keep incrementing
Ok(())
}
/// Path to the WAL file.
pub fn path(&self) -> &Path {
&self.path
}
// -----------------------------------------------------------------------
// Internal: read all items from the WAL file
// -----------------------------------------------------------------------
fn read_all_items(&self) -> StorageResult<Vec<WalItem>> {
if !self.path.exists() {
return Ok(vec![]);
}
let file = std::fs::File::open(&self.path)?;
let mut reader = BufReader::new(file);
// Skip file header (if present)
let file_len = std::fs::metadata(&self.path)?.len();
if file_len >= FILE_HEADER_SIZE as u64 {
let mut hdr_buf = [0u8; FILE_HEADER_SIZE];
reader.read_exact(&mut hdr_buf)?;
// Validate but don't fail hard — allow reading even slightly off headers
let _ = FileHeader::decode(&hdr_buf);
}
let mut items = Vec::new();
loop {
// Peek at the magic to determine if this is a record or commit marker
let mut magic_buf = [0u8; 2];
match reader.read_exact(&mut magic_buf) {
Ok(()) => {}
Err(e) if e.kind() == io::ErrorKind::UnexpectedEof => break,
Err(e) => return Err(e.into()),
}
let magic = u16::from_le_bytes(magic_buf);
match magic {
WAL_RECORD_MAGIC => {
// Read rest of header: seq(8) + op(1) + key_len(4) + val_len(4) + crc(4) = 21
let mut rest = [0u8; 21];
match reader.read_exact(&mut rest) {
Ok(()) => {}
Err(e) if e.kind() == io::ErrorKind::UnexpectedEof => break,
Err(e) => return Err(e.into()),
}
let seq = u64::from_le_bytes(rest[0..8].try_into().unwrap());
let op = WalOpType::from_u8(rest[8])?;
let key_len = u32::from_le_bytes(rest[9..13].try_into().unwrap()) as usize;
let val_len = u32::from_le_bytes(rest[13..17].try_into().unwrap()) as usize;
let stored_crc = u32::from_le_bytes(rest[17..21].try_into().unwrap());
let mut payload = vec![0u8; key_len + val_len];
match reader.read_exact(&mut payload) {
Ok(()) => {}
Err(e) if e.kind() == io::ErrorKind::UnexpectedEof => break,
Err(e) => return Err(e.into()),
}
// Verify CRC
let mut hasher = crc32fast::Hasher::new();
hasher.update(&magic_buf);
hasher.update(&rest[0..17]); // seq + op + key_len + val_len
hasher.update(&payload);
let computed = hasher.finalize();
if computed != stored_crc {
// Corrupt WAL entry — skip it (best-effort recovery)
tracing::warn!(
seq,
"skipping corrupt WAL record: CRC mismatch (expected 0x{stored_crc:08X}, got 0x{computed:08X})"
);
continue;
}
let key = payload[..key_len].to_vec();
let value = payload[key_len..].to_vec();
items.push(WalItem::Record(WalEntry {
seq,
op,
key,
value,
}));
}
WAL_COMMIT_MAGIC => {
// Read rest: seq(8) + crc(4) = 12
let mut rest = [0u8; 12];
match reader.read_exact(&mut rest) {
Ok(()) => {}
Err(e) if e.kind() == io::ErrorKind::UnexpectedEof => break,
Err(e) => return Err(e.into()),
}
let seq = u64::from_le_bytes(rest[0..8].try_into().unwrap());
let stored_crc = u32::from_le_bytes(rest[8..12].try_into().unwrap());
let mut hasher = crc32fast::Hasher::new();
hasher.update(&magic_buf);
hasher.update(&rest[0..8]);
let computed = hasher.finalize();
if computed != stored_crc {
tracing::warn!(
seq,
"skipping corrupt WAL commit marker: CRC mismatch"
);
continue;
}
items.push(WalItem::Commit(seq));
}
_ => {
// Unknown magic — file is corrupt past this point
tracing::warn!("unknown WAL magic 0x{magic:04X}, stopping scan");
break;
}
}
}
Ok(items)
}
}
// ---------------------------------------------------------------------------
// Tests
// ---------------------------------------------------------------------------
#[cfg(test)]
mod tests {
use super::*;
fn make_wal(dir: &tempfile::TempDir) -> BinaryWal {
let path = dir.path().join("test.wal");
let wal = BinaryWal::new(path);
wal.initialize().unwrap();
wal
}
#[test]
fn append_and_commit() {
let dir = tempfile::tempdir().unwrap();
let wal = make_wal(&dir);
let seq = wal
.append(WalOpType::Insert, b"key1", b"value1")
.unwrap();
assert_eq!(seq, 1);
wal.append_commit(seq).unwrap();
// All committed — recover should return empty
let uncommitted = wal.recover().unwrap();
assert!(uncommitted.is_empty());
}
#[test]
fn uncommitted_entries_recovered() {
let dir = tempfile::tempdir().unwrap();
let wal = make_wal(&dir);
let s1 = wal
.append(WalOpType::Insert, b"k1", b"v1")
.unwrap();
wal.append_commit(s1).unwrap();
// s2 is NOT committed
let s2 = wal
.append(WalOpType::Update, b"k2", b"v2")
.unwrap();
let uncommitted = wal.recover().unwrap();
assert_eq!(uncommitted.len(), 1);
assert_eq!(uncommitted[0].seq, s2);
assert_eq!(uncommitted[0].op, WalOpType::Update);
assert_eq!(uncommitted[0].key, b"k2");
assert_eq!(uncommitted[0].value, b"v2");
}
#[test]
fn truncate_clears_wal() {
let dir = tempfile::tempdir().unwrap();
let wal = make_wal(&dir);
wal.append(WalOpType::Insert, b"k", b"v").unwrap();
wal.truncate().unwrap();
let uncommitted = wal.recover().unwrap();
assert!(uncommitted.is_empty());
}
#[test]
fn multiple_operations() {
let dir = tempfile::tempdir().unwrap();
let wal = make_wal(&dir);
let s1 = wal.append(WalOpType::Insert, b"a", b"1").unwrap();
let s2 = wal.append(WalOpType::Update, b"b", b"2").unwrap();
let s3 = wal.append(WalOpType::Delete, b"c", b"").unwrap();
// Commit only s1 and s3
wal.append_commit(s1).unwrap();
wal.append_commit(s3).unwrap();
let uncommitted = wal.recover().unwrap();
assert_eq!(uncommitted.len(), 1);
assert_eq!(uncommitted[0].seq, s2);
}
#[test]
fn sequence_numbers_persist_across_reinit() {
let dir = tempfile::tempdir().unwrap();
let path = dir.path().join("persist.wal");
{
let wal = BinaryWal::new(path.clone());
wal.initialize().unwrap();
let s1 = wal.append(WalOpType::Insert, b"k", b"v").unwrap();
assert_eq!(s1, 1);
wal.append_commit(s1).unwrap();
}
// Re-open — seq should continue from 2+ (since max committed was 1)
{
let wal = BinaryWal::new(path);
wal.initialize().unwrap();
let s2 = wal.append(WalOpType::Insert, b"k2", b"v2").unwrap();
assert!(s2 >= 2, "seq should continue: got {s2}");
}
}
#[test]
fn delete_has_empty_value() {
let dir = tempfile::tempdir().unwrap();
let wal = make_wal(&dir);
let seq = wal.append(WalOpType::Delete, b"key", b"").unwrap();
let uncommitted = wal.recover().unwrap();
assert_eq!(uncommitted.len(), 1);
assert_eq!(uncommitted[0].seq, seq);
assert_eq!(uncommitted[0].op, WalOpType::Delete);
assert!(uncommitted[0].value.is_empty());
}
}
@@ -0,0 +1,270 @@
//! Compaction for the Bitcask-style storage engine.
//!
//! Over time, the data file accumulates dead records (superseded by updates,
//! tombstones from deletes). Compaction rewrites the data file with only live
//! records, reclaiming disk space.
//!
//! The process is:
//! 1. Create a new `data.rdb.compact` file with a fresh file header.
//! 2. Iterate all live entries from the KeyDir.
//! 3. Read each live document from the old data file, write to the new file.
//! 4. Atomically rename `data.rdb.compact` → `data.rdb`.
//! 5. Update KeyDir entries with new offsets.
//! 6. Reset dead_bytes counter.
use std::io::{Seek, SeekFrom, Write};
use std::path::Path;
use std::sync::atomic::Ordering;
use tracing::info;
use crate::error::StorageResult;
use crate::keydir::{KeyDir, KeyDirEntry};
use crate::record::{DataRecord, FileHeader, FileType, FILE_HEADER_SIZE};
/// Result of a compaction operation.
#[derive(Debug)]
pub struct CompactionResult {
/// Number of live records written.
pub records_written: u64,
/// Bytes reclaimed (old file size - new file size).
pub bytes_reclaimed: u64,
/// New data file size.
pub new_file_size: u64,
}
/// Compact a collection's data file.
///
/// This function:
/// - Reads all live documents (entries present in the KeyDir) from the old data file
/// - Writes them sequentially to a new file
/// - Atomically renames the new file over the old one
/// - Updates all KeyDir entries with their new offsets
///
/// The caller must hold the collection's write lock during this operation.
pub fn compact_data_file(
data_path: &Path,
keydir: &KeyDir,
dead_bytes: &std::sync::atomic::AtomicU64,
data_file_size: &std::sync::atomic::AtomicU64,
) -> StorageResult<CompactionResult> {
let compact_path = data_path.with_extension("rdb.compact");
let old_file_size = std::fs::metadata(data_path)
.map(|m| m.len())
.unwrap_or(0);
// Collect all live entries with their keys
let mut live_entries: Vec<(String, KeyDirEntry)> = Vec::with_capacity(keydir.len() as usize);
keydir.for_each(|key, entry| {
live_entries.push((key.to_string(), *entry));
});
// Sort by offset for sequential reads (cache-friendly)
live_entries.sort_by_key(|(_, e)| e.offset);
// Create compact file with header
let mut compact_file = std::fs::File::create(&compact_path)?;
let hdr = FileHeader::new(FileType::Data);
compact_file.write_all(&hdr.encode())?;
let mut current_offset = FILE_HEADER_SIZE as u64;
let mut new_entries: Vec<(String, KeyDirEntry)> = Vec::with_capacity(live_entries.len());
let mut old_data_file = std::fs::File::open(data_path)?;
for (key, entry) in &live_entries {
// Read the record from the old file
old_data_file.seek(SeekFrom::Start(entry.offset))?;
let (record, _disk_size) = DataRecord::decode_from(&mut old_data_file)?
.ok_or_else(|| {
crate::error::StorageError::CorruptRecord(format!(
"compaction: unexpected EOF reading doc '{key}' at offset {}",
entry.offset
))
})?;
// Write to compact file
let encoded = record.encode();
let new_disk_size = encoded.len() as u32;
compact_file.write_all(&encoded)?;
new_entries.push((
key.clone(),
KeyDirEntry {
offset: current_offset,
record_len: new_disk_size,
value_len: entry.value_len,
timestamp: entry.timestamp,
},
));
current_offset += new_disk_size as u64;
}
compact_file.sync_all()?;
drop(compact_file);
drop(old_data_file);
// Atomic rename
std::fs::rename(&compact_path, data_path)?;
// Update KeyDir with new offsets
for (key, new_entry) in new_entries {
keydir.insert(key, new_entry);
}
// Reset counters
dead_bytes.store(0, Ordering::Relaxed);
data_file_size.store(current_offset, Ordering::Relaxed);
let bytes_reclaimed = old_file_size.saturating_sub(current_offset);
info!(
records = live_entries.len(),
old_size = old_file_size,
new_size = current_offset,
reclaimed = bytes_reclaimed,
"compaction complete"
);
Ok(CompactionResult {
records_written: live_entries.len() as u64,
bytes_reclaimed,
new_file_size: current_offset,
})
}
/// Check if compaction is warranted for a collection.
/// Returns true if dead bytes exceed 50% of live data.
pub fn should_compact(dead_bytes: u64, data_file_size: u64) -> bool {
if data_file_size <= FILE_HEADER_SIZE as u64 {
return false;
}
let useful_bytes = data_file_size - FILE_HEADER_SIZE as u64;
// Trigger when dead > 50% of total useful data
dead_bytes > useful_bytes / 2
}
// ---------------------------------------------------------------------------
// Tests
// ---------------------------------------------------------------------------
#[cfg(test)]
mod tests {
use super::*;
use crate::keydir::KeyDir;
use crate::record::{now_ms, DataRecord, FileHeader, FileType};
use std::io::Write;
use std::sync::atomic::AtomicU64;
#[test]
fn compact_removes_dead_records() {
let dir = tempfile::tempdir().unwrap();
let data_path = dir.path().join("data.rdb");
// Write a data file: insert A, update A (new version), insert B
let mut f = std::fs::File::create(&data_path).unwrap();
let hdr = FileHeader::new(FileType::Data);
f.write_all(&hdr.encode()).unwrap();
let ts = now_ms();
// Record 1: A v1 (will be superseded)
let r1 = DataRecord {
timestamp: ts,
key: b"aaa".to_vec(),
value: b"old_value".to_vec(),
};
let r1_enc = r1.encode();
let r1_offset = FILE_HEADER_SIZE as u64;
let r1_size = r1_enc.len();
f.write_all(&r1_enc).unwrap();
// Record 2: A v2 (current)
let r2 = DataRecord {
timestamp: ts + 1,
key: b"aaa".to_vec(),
value: b"new_value".to_vec(),
};
let r2_enc = r2.encode();
let r2_offset = r1_offset + r1_size as u64;
let r2_size = r2_enc.len();
f.write_all(&r2_enc).unwrap();
// Record 3: B (live)
let r3 = DataRecord {
timestamp: ts + 2,
key: b"bbb".to_vec(),
value: b"bbb_value".to_vec(),
};
let r3_enc = r3.encode();
let r3_offset = r2_offset + r2_size as u64;
f.write_all(&r3_enc).unwrap();
f.sync_all().unwrap();
drop(f);
let total_size = std::fs::metadata(&data_path).unwrap().len();
// Build KeyDir — only points to latest versions
let keydir = KeyDir::new();
keydir.insert(
"aaa".into(),
KeyDirEntry {
offset: r2_offset,
record_len: r2_size as u32,
value_len: r2.value.len() as u32,
timestamp: ts + 1,
},
);
keydir.insert(
"bbb".into(),
KeyDirEntry {
offset: r3_offset,
record_len: r3.encode().len() as u32,
value_len: r3.value.len() as u32,
timestamp: ts + 2,
},
);
let dead_bytes_counter = AtomicU64::new(r1_size as u64);
let data_file_size_counter = AtomicU64::new(total_size);
let result = compact_data_file(
&data_path,
&keydir,
&dead_bytes_counter,
&data_file_size_counter,
)
.unwrap();
assert_eq!(result.records_written, 2);
assert!(result.bytes_reclaimed > 0);
assert!(result.new_file_size < total_size);
// Verify dead_bytes was reset
assert_eq!(dead_bytes_counter.load(Ordering::Relaxed), 0);
// Verify KeyDir was updated with new offsets
let a_entry = keydir.get("aaa").unwrap();
assert_eq!(a_entry.offset, FILE_HEADER_SIZE as u64); // first record after header
assert_eq!(a_entry.value_len, b"new_value".len() as u32);
let b_entry = keydir.get("bbb").unwrap();
assert!(b_entry.offset > a_entry.offset);
// Verify the compacted file can be used to rebuild KeyDir
let (rebuilt, dead, _stats) = KeyDir::build_from_data_file(&data_path).unwrap();
assert_eq!(rebuilt.len(), 2);
assert_eq!(dead, 0); // no dead records in compacted file
}
#[test]
fn should_compact_thresholds() {
// Under threshold
assert!(!should_compact(10, 100 + FILE_HEADER_SIZE as u64));
// Over threshold (dead > 50% of useful)
assert!(should_compact(60, 100 + FILE_HEADER_SIZE as u64));
// Empty file
assert!(!should_compact(0, FILE_HEADER_SIZE as u64));
}
}
+49
View File
@@ -0,0 +1,49 @@
use thiserror::Error;
/// Errors that can occur in storage operations.
#[derive(Debug, Error)]
pub enum StorageError {
#[error("not found: {0}")]
NotFound(String),
#[error("already exists: {0}")]
AlreadyExists(String),
#[error("I/O error: {0}")]
IoError(#[from] std::io::Error),
#[error("serialization error: {0}")]
SerializationError(String),
#[error("conflict detected: {0}")]
ConflictError(String),
#[error("corrupt record: {0}")]
CorruptRecord(String),
#[error("checksum mismatch: expected 0x{expected:08X}, got 0x{actual:08X}")]
ChecksumMismatch { expected: u32, actual: u32 },
#[error("WAL error: {0}")]
WalError(String),
}
impl From<serde_json::Error> for StorageError {
fn from(e: serde_json::Error) -> Self {
StorageError::SerializationError(e.to_string())
}
}
impl From<bson::de::Error> for StorageError {
fn from(e: bson::de::Error) -> Self {
StorageError::SerializationError(e.to_string())
}
}
impl From<bson::ser::Error> for StorageError {
fn from(e: bson::ser::Error) -> Self {
StorageError::SerializationError(e.to_string())
}
}
pub type StorageResult<T> = Result<T, StorageError>;
+996
View File
@@ -0,0 +1,996 @@
//! Bitcask-style file storage adapter.
//!
//! Each collection is stored as a directory:
//! ```text
//! {base_path}/{db}/{coll}/
//! data.rdb — append-only binary record log
//! wal.rdb — binary write-ahead log
//! keydir.hint — persisted KeyDir for fast restart
//! indexes.json — index metadata
//! ```
//!
//! Point operations (insert, update, delete, find_by_id) are O(1).
//! Full scans (find_all) are O(n) in live document count.
use std::collections::HashSet;
use std::io::{Seek, SeekFrom, Write};
use std::path::PathBuf;
use std::sync::atomic::{AtomicU64, Ordering};
use std::sync::Arc;
use async_trait::async_trait;
use bson::{doc, oid::ObjectId, Document};
use dashmap::DashMap;
use tracing::{debug, info};
use crate::adapter::StorageAdapter;
use crate::binary_wal::{BinaryWal, WalOpType};
use crate::error::{StorageError, StorageResult};
use crate::keydir::{KeyDir, KeyDirEntry};
use crate::record::{now_ms, DataRecord, FileHeader, FileType, FILE_HEADER_SIZE};
// ---------------------------------------------------------------------------
// Per-collection state
// ---------------------------------------------------------------------------
struct CollectionState {
/// In-memory document location index.
keydir: KeyDir,
/// Path to the collection directory.
coll_dir: PathBuf,
/// Write-ahead log.
wal: std::sync::Mutex<BinaryWal>,
/// Serializes append writes to the data file.
write_lock: std::sync::Mutex<()>,
/// Live document count.
doc_count: AtomicU64,
/// Bytes occupied by dead (superseded/tombstone) records. For compaction.
dead_bytes: AtomicU64,
/// Total size of the data file.
data_file_size: AtomicU64,
}
impl CollectionState {
fn data_path(&self) -> PathBuf {
self.coll_dir.join("data.rdb")
}
fn hint_path(&self) -> PathBuf {
self.coll_dir.join("keydir.hint")
}
fn index_path(&self) -> PathBuf {
self.coll_dir.join("indexes.json")
}
/// Read a single document from the data file at the given KeyDir entry.
fn read_document(&self, entry: &KeyDirEntry) -> StorageResult<Document> {
let data_path = self.data_path();
let mut file = std::fs::File::open(&data_path)?;
file.seek(SeekFrom::Start(entry.offset))?;
let (record, _) = DataRecord::decode_from(&mut file)?
.ok_or_else(|| StorageError::CorruptRecord("unexpected EOF reading document".into()))?;
if record.is_tombstone() {
return Err(StorageError::CorruptRecord(
"KeyDir pointed to a tombstone record".into(),
));
}
// Parse BSON from raw bytes
bson::from_slice(&record.value)
.map_err(|e| StorageError::SerializationError(format!("BSON decode: {e}")))
}
/// Ensure a data file has the 64-byte SMARTDB header.
/// If the file was just created (empty), writes the header and updates
/// the data_file_size counter. Must be called under write_lock.
fn ensure_data_header(&self, file: &mut std::fs::File) -> StorageResult<()> {
let pos = file.seek(SeekFrom::End(0))?;
if pos == 0 {
let hdr = FileHeader::new(FileType::Data);
file.write_all(&hdr.encode())?;
self.data_file_size
.fetch_add(FILE_HEADER_SIZE as u64, Ordering::Relaxed);
}
Ok(())
}
/// Append a data record and update the KeyDir. Must be called under write_lock.
fn append_record(
&self,
key: &str,
bson_bytes: &[u8],
timestamp: u64,
) -> StorageResult<KeyDirEntry> {
let record = DataRecord {
timestamp,
key: key.as_bytes().to_vec(),
value: bson_bytes.to_vec(),
};
let encoded = record.encode();
let disk_size = encoded.len() as u32;
let data_path = self.data_path();
let mut file = std::fs::OpenOptions::new()
.create(true)
.append(true)
.open(&data_path)?;
self.ensure_data_header(&mut file)?;
let offset = file.seek(SeekFrom::End(0))?;
file.write_all(&encoded)?;
file.sync_all()?;
let entry = KeyDirEntry {
offset,
record_len: disk_size,
value_len: bson_bytes.len() as u32,
timestamp,
};
self.data_file_size
.fetch_add(disk_size as u64, Ordering::Relaxed);
Ok(entry)
}
/// Append a tombstone record. Must be called under write_lock.
fn append_tombstone(&self, key: &str, timestamp: u64) -> StorageResult<u32> {
let record = DataRecord {
timestamp,
key: key.as_bytes().to_vec(),
value: vec![],
};
let encoded = record.encode();
let disk_size = encoded.len() as u32;
let data_path = self.data_path();
let mut file = std::fs::OpenOptions::new()
.create(true)
.append(true)
.open(&data_path)?;
self.ensure_data_header(&mut file)?;
file.write_all(&encoded)?;
file.sync_all()?;
self.data_file_size
.fetch_add(disk_size as u64, Ordering::Relaxed);
Ok(disk_size)
}
/// Try compaction if dead bytes exceed the threshold.
/// Must be called while holding the write_lock.
fn try_compact(&self) {
let dead = self.dead_bytes.load(Ordering::Relaxed);
let total = self.data_file_size.load(Ordering::Relaxed);
if crate::compaction::should_compact(dead, total) {
debug!("triggering compaction for {:?} (dead={dead}, total={total})", self.coll_dir);
if let Err(e) = crate::compaction::compact_data_file(
&self.data_path(),
&self.keydir,
&self.dead_bytes,
&self.data_file_size,
) {
tracing::warn!("compaction failed for {:?}: {e}", self.coll_dir);
} else {
// Persist hint file after successful compaction to prevent stale hints
if let Err(e) = self.keydir.persist_to_hint_file(&self.hint_path()) {
tracing::warn!("failed to persist hint after compaction for {:?}: {e}", self.coll_dir);
}
}
}
}
}
// ---------------------------------------------------------------------------
// Collection cache key: "db\0coll"
// ---------------------------------------------------------------------------
fn coll_cache_key(db: &str, coll: &str) -> String {
format!("{db}\0{coll}")
}
// ---------------------------------------------------------------------------
// FileStorageAdapter
// ---------------------------------------------------------------------------
/// Bitcask-style file storage adapter.
pub struct FileStorageAdapter {
base_path: PathBuf,
/// Cache of initialized collection states, keyed by "db\0coll".
collections: DashMap<String, Arc<CollectionState>>,
/// Handle to the periodic compaction task. Dropped on close.
compaction_handle: std::sync::Mutex<Option<tokio::task::JoinHandle<()>>>,
}
impl FileStorageAdapter {
pub fn new(base_path: impl Into<PathBuf>) -> Self {
Self {
base_path: base_path.into(),
collections: DashMap::new(),
compaction_handle: std::sync::Mutex::new(None),
}
}
fn db_dir(&self, db: &str) -> PathBuf {
self.base_path.join(db)
}
fn coll_dir(&self, db: &str, coll: &str) -> PathBuf {
self.db_dir(db).join(coll)
}
/// Get or initialize the CollectionState for a given db/coll.
fn get_or_init_collection(
&self,
db: &str,
coll: &str,
) -> StorageResult<Arc<CollectionState>> {
let key = coll_cache_key(db, coll);
if let Some(state) = self.collections.get(&key) {
return Ok(Arc::clone(state.value()));
}
let coll_dir = self.coll_dir(db, coll);
if !coll_dir.exists() {
return Err(StorageError::NotFound(format!(
"collection '{db}.{coll}'"
)));
}
let state = self.init_collection_state(&coll_dir)?;
let state = Arc::new(state);
self.collections.insert(key, Arc::clone(&state));
Ok(state)
}
/// Initialize a CollectionState from disk.
fn init_collection_state(&self, coll_dir: &PathBuf) -> StorageResult<CollectionState> {
let data_path = coll_dir.join("data.rdb");
let wal_path = coll_dir.join("wal.rdb");
let hint_path = coll_dir.join("keydir.hint");
// Try loading from hint file first, fall back to data file scan
let (keydir, dead_bytes, loaded_from_hint) = if hint_path.exists() && data_path.exists() {
match KeyDir::load_from_hint_file(&hint_path) {
Ok(Some(kd)) => {
// Validate hint against actual data file
let hint_valid = kd.validate_against_data_file(&data_path, 16)
.unwrap_or(false);
if hint_valid {
debug!("loaded KeyDir from hint file: {:?}", hint_path);
let file_size = std::fs::metadata(&data_path)
.map(|m| m.len())
.unwrap_or(FILE_HEADER_SIZE as u64);
let live_bytes: u64 = {
let mut total = 0u64;
kd.for_each(|_, e| total += e.record_len as u64);
total
};
let dead = file_size.saturating_sub(FILE_HEADER_SIZE as u64).saturating_sub(live_bytes);
(kd, dead, true)
} else {
tracing::warn!("hint file {:?} is stale, rebuilding from data file", hint_path);
let (kd, dead, _stats) = KeyDir::build_from_data_file(&data_path)?;
(kd, dead, false)
}
}
_ => {
debug!("hint file invalid, rebuilding KeyDir from data file");
let (kd, dead, _stats) = KeyDir::build_from_data_file(&data_path)?;
(kd, dead, false)
}
}
} else if data_path.exists() {
let (kd, dead, _stats) = KeyDir::build_from_data_file(&data_path)?;
(kd, dead, false)
} else {
(KeyDir::new(), 0, false)
};
let doc_count = keydir.len();
let data_file_size = if data_path.exists() {
std::fs::metadata(&data_path)?.len()
} else {
FILE_HEADER_SIZE as u64
};
info!(
collection = %coll_dir.display(),
documents = doc_count,
data_bytes = data_file_size,
dead_bytes = dead_bytes,
source = if loaded_from_hint { "hint" } else { "scan" },
"loaded collection"
);
// Initialize WAL and recover
let wal = BinaryWal::new(wal_path);
wal.initialize()?;
// Recover uncommitted WAL entries
let uncommitted = wal.recover()?;
if !uncommitted.is_empty() {
info!(
collection = %coll_dir.display(),
entries = uncommitted.len(),
"recovering uncommitted WAL entries"
);
}
let state = CollectionState {
keydir,
coll_dir: coll_dir.clone(),
wal: std::sync::Mutex::new(wal),
write_lock: std::sync::Mutex::new(()),
doc_count: AtomicU64::new(doc_count),
dead_bytes: AtomicU64::new(dead_bytes),
data_file_size: AtomicU64::new(data_file_size),
};
// Replay uncommitted entries
for entry in uncommitted {
let key_str = String::from_utf8(entry.key.clone())
.map_err(|e| StorageError::CorruptRecord(format!("invalid UTF-8 key in WAL: {e}")))?;
match entry.op {
WalOpType::Insert | WalOpType::Update => {
if !entry.value.is_empty() {
let ts = now_ms();
let new_entry = state.append_record(&key_str, &entry.value, ts)?;
if entry.op == WalOpType::Insert {
if state.keydir.insert(key_str, new_entry).is_none() {
state.doc_count.fetch_add(1, Ordering::Relaxed);
}
} else {
if let Some(prev) = state.keydir.insert(key_str, new_entry) {
state.dead_bytes.fetch_add(prev.record_len as u64, Ordering::Relaxed);
}
}
}
}
WalOpType::Delete => {
let ts = now_ms();
let tombstone_size = state.append_tombstone(&key_str, ts)?;
if let Some(prev) = state.keydir.remove(&key_str) {
state.dead_bytes.fetch_add(prev.record_len as u64 + tombstone_size as u64, Ordering::Relaxed);
state.doc_count.fetch_sub(1, Ordering::Relaxed);
}
}
}
}
// Truncate WAL after successful recovery
if let Ok(wal) = state.wal.lock() {
wal.truncate()?;
}
Ok(state)
}
/// Create a fresh, empty collection on disk. Returns the new CollectionState.
fn create_empty_collection(&self, db: &str, coll: &str) -> StorageResult<Arc<CollectionState>> {
let coll_dir = self.coll_dir(db, coll);
std::fs::create_dir_all(&coll_dir)?;
// Write empty data file with header
let data_path = coll_dir.join("data.rdb");
{
let mut f = std::fs::File::create(&data_path)?;
let hdr = FileHeader::new(FileType::Data);
f.write_all(&hdr.encode())?;
f.sync_all()?;
}
// Write default _id index
let idx_spec = vec![doc! { "name": "_id_", "key": { "_id": 1 } }];
let idx_json = serde_json::to_string_pretty(&idx_spec)?;
let idx_path = coll_dir.join("indexes.json");
std::fs::write(&idx_path, idx_json)?;
// Initialize WAL
let wal_path = coll_dir.join("wal.rdb");
let wal = BinaryWal::new(wal_path);
wal.initialize()?;
let state = Arc::new(CollectionState {
keydir: KeyDir::new(),
coll_dir,
wal: std::sync::Mutex::new(wal),
write_lock: std::sync::Mutex::new(()),
doc_count: AtomicU64::new(0),
dead_bytes: AtomicU64::new(0),
data_file_size: AtomicU64::new(FILE_HEADER_SIZE as u64),
});
let key = coll_cache_key(db, coll);
self.collections.insert(key, Arc::clone(&state));
Ok(state)
}
fn extract_id_hex(doc: &Document) -> StorageResult<String> {
match doc.get("_id") {
Some(bson::Bson::ObjectId(oid)) => Ok(oid.to_hex()),
Some(bson::Bson::String(s)) => Ok(s.clone()),
Some(other) => Ok(format!("{other}")),
None => Err(StorageError::NotFound("document missing _id".into())),
}
}
/// Scan database directory for collection subdirectories.
fn list_collection_dirs(&self, db: &str) -> StorageResult<Vec<String>> {
let db_dir = self.db_dir(db);
if !db_dir.exists() {
return Err(StorageError::NotFound(format!("database '{db}'")));
}
let mut colls = Vec::new();
let entries = std::fs::read_dir(&db_dir)?;
for entry in entries {
let entry = entry?;
if entry.file_type()?.is_dir() {
if let Some(name) = entry.file_name().to_str() {
// Only consider directories that contain data.rdb
let data_path = entry.path().join("data.rdb");
if data_path.exists() {
colls.push(name.to_string());
}
}
}
}
Ok(colls)
}
}
// ---------------------------------------------------------------------------
// StorageAdapter implementation
// ---------------------------------------------------------------------------
#[async_trait]
impl StorageAdapter for FileStorageAdapter {
async fn initialize(&self) -> StorageResult<()> {
std::fs::create_dir_all(&self.base_path)?;
// Pre-load all existing collections
let mut db_count: usize = 0;
if let Ok(entries) = std::fs::read_dir(&self.base_path) {
for entry in entries.flatten() {
if entry.file_type().map(|ft| ft.is_dir()).unwrap_or(false) {
if let Some(db_name) = entry.file_name().to_str() {
let db_name = db_name.to_string();
if let Ok(colls) = self.list_collection_dirs(&db_name) {
if !colls.is_empty() {
db_count += 1;
}
for coll_name in colls {
let _ = self.get_or_init_collection(&db_name, &coll_name);
}
}
}
}
}
}
info!(
databases = db_count,
collections = self.collections.len(),
path = %self.base_path.display(),
"FileStorageAdapter initialization complete"
);
// Start periodic compaction task (runs every 24 hours)
{
let collections = self.collections.clone();
let handle = tokio::spawn(async move {
let mut interval = tokio::time::interval(std::time::Duration::from_secs(24 * 60 * 60));
interval.tick().await; // first tick is immediate — skip it
loop {
interval.tick().await;
debug!("running periodic compaction sweep");
for entry in collections.iter() {
let state = entry.value();
let _guard = state.write_lock.lock().unwrap();
state.try_compact();
}
}
});
*self.compaction_handle.lock().unwrap() = Some(handle);
}
Ok(())
}
async fn close(&self) -> StorageResult<()> {
// Stop the periodic compaction task
if let Some(handle) = self.compaction_handle.lock().unwrap().take() {
handle.abort();
}
// Persist all KeyDir hint files
for entry in self.collections.iter() {
let state = entry.value();
let _ = state.keydir.persist_to_hint_file(&state.hint_path());
}
debug!("FileStorageAdapter closed");
Ok(())
}
// ---- database ----
async fn list_databases(&self) -> StorageResult<Vec<String>> {
let mut dbs = Vec::new();
let entries = std::fs::read_dir(&self.base_path)?;
for entry in entries {
let entry = entry?;
if entry.file_type()?.is_dir() {
if let Some(name) = entry.file_name().to_str() {
dbs.push(name.to_string());
}
}
}
Ok(dbs)
}
async fn create_database(&self, db: &str) -> StorageResult<()> {
let dir = self.db_dir(db);
if dir.exists() {
return Err(StorageError::AlreadyExists(format!("database '{db}'")));
}
std::fs::create_dir_all(&dir)?;
Ok(())
}
async fn drop_database(&self, db: &str) -> StorageResult<()> {
// Remove cached states for all collections in this db
let prefix = format!("{db}\0");
self.collections.retain(|k, _| !k.starts_with(&prefix));
let dir = self.db_dir(db);
if dir.exists() {
std::fs::remove_dir_all(&dir)?;
}
Ok(())
}
async fn database_exists(&self, db: &str) -> StorageResult<bool> {
Ok(self.db_dir(db).exists())
}
// ---- collection ----
async fn list_collections(&self, db: &str) -> StorageResult<Vec<String>> {
self.list_collection_dirs(db)
}
async fn create_collection(&self, db: &str, coll: &str) -> StorageResult<()> {
let coll_dir = self.coll_dir(db, coll);
if coll_dir.exists() {
return Err(StorageError::AlreadyExists(format!(
"collection '{db}.{coll}'"
)));
}
std::fs::create_dir_all(self.db_dir(db))?;
self.create_empty_collection(db, coll)?;
Ok(())
}
async fn drop_collection(&self, db: &str, coll: &str) -> StorageResult<()> {
let key = coll_cache_key(db, coll);
self.collections.remove(&key);
let coll_dir = self.coll_dir(db, coll);
if coll_dir.exists() {
std::fs::remove_dir_all(&coll_dir)?;
}
Ok(())
}
async fn collection_exists(&self, db: &str, coll: &str) -> StorageResult<bool> {
let coll_dir = self.coll_dir(db, coll);
Ok(coll_dir.exists() && coll_dir.join("data.rdb").exists())
}
async fn rename_collection(
&self,
db: &str,
old_name: &str,
new_name: &str,
) -> StorageResult<()> {
let old_dir = self.coll_dir(db, old_name);
let new_dir = self.coll_dir(db, new_name);
if !old_dir.exists() {
return Err(StorageError::NotFound(format!(
"collection '{db}.{old_name}'"
)));
}
if new_dir.exists() {
return Err(StorageError::AlreadyExists(format!(
"collection '{db}.{new_name}'"
)));
}
// Remove old cache entry
let old_key = coll_cache_key(db, old_name);
self.collections.remove(&old_key);
// Rename directory
std::fs::rename(&old_dir, &new_dir)?;
// Re-init under new name
let _ = self.get_or_init_collection(db, new_name);
Ok(())
}
// ---- document writes ----
async fn insert_one(
&self,
db: &str,
coll: &str,
mut doc: Document,
) -> StorageResult<String> {
if !doc.contains_key("_id") {
doc.insert("_id", ObjectId::new());
}
let id = Self::extract_id_hex(&doc)?;
let state = self.get_or_init_collection(db, coll)?;
// Check for duplicate
if state.keydir.contains(&id) {
return Err(StorageError::AlreadyExists(format!("document '{id}'")));
}
let bson_bytes = bson::to_vec(&doc)
.map_err(|e| StorageError::SerializationError(e.to_string()))?;
let ts = now_ms();
let _guard = state.write_lock.lock().unwrap();
// WAL → data → KeyDir → WAL commit
{
let wal = state.wal.lock().unwrap();
let seq = wal.append(WalOpType::Insert, id.as_bytes(), &bson_bytes)?;
let entry = state.append_record(&id, &bson_bytes, ts)?;
state.keydir.insert(id.clone(), entry);
state.doc_count.fetch_add(1, Ordering::Relaxed);
wal.append_commit(seq)?;
}
// Insert doesn't create dead bytes, but check anyway for consistency
state.try_compact();
Ok(id)
}
async fn insert_many(
&self,
db: &str,
coll: &str,
mut docs: Vec<Document>,
) -> StorageResult<Vec<String>> {
let state = self.get_or_init_collection(db, coll)?;
let mut ids = Vec::with_capacity(docs.len());
let _guard = state.write_lock.lock().unwrap();
for doc in &mut docs {
if !doc.contains_key("_id") {
doc.insert("_id", ObjectId::new());
}
let id = Self::extract_id_hex(doc)?;
let bson_bytes = bson::to_vec(doc)
.map_err(|e| StorageError::SerializationError(e.to_string()))?;
let ts = now_ms();
let wal = state.wal.lock().unwrap();
let seq = wal.append(WalOpType::Insert, id.as_bytes(), &bson_bytes)?;
let entry = state.append_record(&id, &bson_bytes, ts)?;
state.keydir.insert(id.clone(), entry);
state.doc_count.fetch_add(1, Ordering::Relaxed);
wal.append_commit(seq)?;
ids.push(id);
}
state.try_compact();
Ok(ids)
}
async fn update_by_id(
&self,
db: &str,
coll: &str,
id: &str,
doc: Document,
) -> StorageResult<()> {
let state = self.get_or_init_collection(db, coll)?;
if !state.keydir.contains(id) {
return Err(StorageError::NotFound(format!("document '{id}'")));
}
let bson_bytes = bson::to_vec(&doc)
.map_err(|e| StorageError::SerializationError(e.to_string()))?;
let ts = now_ms();
let _guard = state.write_lock.lock().unwrap();
let wal = state.wal.lock().unwrap();
let seq = wal.append(WalOpType::Update, id.as_bytes(), &bson_bytes)?;
let new_entry = state.append_record(id, &bson_bytes, ts)?;
if let Some(prev) = state.keydir.insert(id.to_string(), new_entry) {
state
.dead_bytes
.fetch_add(prev.record_len as u64, Ordering::Relaxed);
}
wal.append_commit(seq)?;
state.try_compact();
Ok(())
}
async fn delete_by_id(
&self,
db: &str,
coll: &str,
id: &str,
) -> StorageResult<()> {
let state = self.get_or_init_collection(db, coll)?;
if !state.keydir.contains(id) {
return Err(StorageError::NotFound(format!("document '{id}'")));
}
let ts = now_ms();
let _guard = state.write_lock.lock().unwrap();
let wal = state.wal.lock().unwrap();
let seq = wal.append(WalOpType::Delete, id.as_bytes(), &[])?;
let tombstone_size = state.append_tombstone(id, ts)?;
if let Some(prev) = state.keydir.remove(id) {
state.dead_bytes.fetch_add(
prev.record_len as u64 + tombstone_size as u64,
Ordering::Relaxed,
);
state.doc_count.fetch_sub(1, Ordering::Relaxed);
}
wal.append_commit(seq)?;
state.try_compact();
Ok(())
}
async fn delete_by_ids(
&self,
db: &str,
coll: &str,
ids: &[String],
) -> StorageResult<()> {
let state = self.get_or_init_collection(db, coll)?;
let _guard = state.write_lock.lock().unwrap();
for id in ids {
if !state.keydir.contains(id) {
continue; // skip non-existent
}
let ts = now_ms();
let wal = state.wal.lock().unwrap();
let seq = wal.append(WalOpType::Delete, id.as_bytes(), &[])?;
let tombstone_size = state.append_tombstone(id, ts)?;
if let Some(prev) = state.keydir.remove(id) {
state.dead_bytes.fetch_add(
prev.record_len as u64 + tombstone_size as u64,
Ordering::Relaxed,
);
state.doc_count.fetch_sub(1, Ordering::Relaxed);
}
wal.append_commit(seq)?;
}
state.try_compact();
Ok(())
}
// ---- document reads ----
async fn find_all(&self, db: &str, coll: &str) -> StorageResult<Vec<Document>> {
let state = self.get_or_init_collection(db, coll)?;
let mut docs = Vec::with_capacity(state.doc_count.load(Ordering::Relaxed) as usize);
state.keydir.for_each(|_key, entry| {
// We collect entries first, then read. This avoids holding DashMap refs during I/O.
docs.push(*entry);
});
let mut result = Vec::with_capacity(docs.len());
for entry in &docs {
match state.read_document(entry) {
Ok(doc) => result.push(doc),
Err(e) => {
tracing::warn!("skipping unreadable document: {e}");
}
}
}
Ok(result)
}
async fn find_by_ids(
&self,
db: &str,
coll: &str,
ids: HashSet<String>,
) -> StorageResult<Vec<Document>> {
let state = self.get_or_init_collection(db, coll)?;
let mut docs = Vec::with_capacity(ids.len());
for id in &ids {
if let Some(entry) = state.keydir.get(id) {
match state.read_document(&entry) {
Ok(doc) => docs.push(doc),
Err(e) => {
tracing::warn!("skipping unreadable document {id}: {e}");
}
}
}
}
Ok(docs)
}
async fn find_by_id(
&self,
db: &str,
coll: &str,
id: &str,
) -> StorageResult<Option<Document>> {
let state = self.get_or_init_collection(db, coll)?;
match state.keydir.get(id) {
Some(entry) => {
let doc = state.read_document(&entry)?;
Ok(Some(doc))
}
None => Ok(None),
}
}
async fn count(&self, db: &str, coll: &str) -> StorageResult<u64> {
let state = self.get_or_init_collection(db, coll)?;
Ok(state.doc_count.load(Ordering::Relaxed))
}
// ---- indexes ----
async fn save_index(
&self,
db: &str,
coll: &str,
name: &str,
spec: Document,
) -> StorageResult<()> {
let state = self.get_or_init_collection(db, coll)?;
let path = state.index_path();
let mut indexes = self.read_index_file(&path)?;
indexes.retain(|s| {
s.get_str("name").unwrap_or("") != name
});
let mut full_spec = spec;
full_spec.insert("name", name);
indexes.push(full_spec);
self.write_index_file(&path, &indexes)?;
Ok(())
}
async fn get_indexes(
&self,
db: &str,
coll: &str,
) -> StorageResult<Vec<Document>> {
let state = self.get_or_init_collection(db, coll)?;
self.read_index_file(&state.index_path())
}
async fn drop_index(
&self,
db: &str,
coll: &str,
name: &str,
) -> StorageResult<()> {
let state = self.get_or_init_collection(db, coll)?;
let path = state.index_path();
let mut indexes = self.read_index_file(&path)?;
let before = indexes.len();
indexes.retain(|s| {
s.get_str("name").unwrap_or("") != name
});
if indexes.len() == before {
return Err(StorageError::NotFound(format!("index '{name}'")));
}
self.write_index_file(&path, &indexes)?;
Ok(())
}
// ---- snapshot / conflict detection ----
async fn create_snapshot(&self, _db: &str, _coll: &str) -> StorageResult<i64> {
Ok(now_ms() as i64)
}
async fn has_conflicts(
&self,
db: &str,
coll: &str,
ids: &HashSet<String>,
snapshot_time: i64,
) -> StorageResult<bool> {
let state = self.get_or_init_collection(db, coll)?;
let snapshot_ts = snapshot_time as u64;
for id in ids {
if let Some(entry) = state.keydir.get(id) {
if entry.timestamp > snapshot_ts {
return Ok(true);
}
}
}
Ok(false)
}
}
// ---------------------------------------------------------------------------
// Index file helpers (JSON — kept simple, rarely written)
// ---------------------------------------------------------------------------
impl FileStorageAdapter {
fn read_index_file(&self, path: &PathBuf) -> StorageResult<Vec<Document>> {
if !path.exists() {
return Ok(vec![]);
}
let data = std::fs::read_to_string(path)?;
let json_docs: Vec<serde_json::Value> = serde_json::from_str(&data)?;
let mut docs = Vec::with_capacity(json_docs.len());
for jv in json_docs {
let bson_val: bson::Bson = serde_json::from_value(jv)
.map_err(|e| StorageError::SerializationError(e.to_string()))?;
let doc = bson_val
.as_document()
.ok_or_else(|| StorageError::SerializationError("expected document".into()))?
.clone();
docs.push(doc);
}
Ok(docs)
}
fn write_index_file(&self, path: &PathBuf, specs: &[Document]) -> StorageResult<()> {
let json_vals: Vec<serde_json::Value> = specs
.iter()
.map(|d| {
let b = bson::to_bson(d)
.map_err(|e| StorageError::SerializationError(e.to_string()))?;
serde_json::to_value(&b)
.map_err(|e| StorageError::SerializationError(e.to_string()))
})
.collect::<StorageResult<Vec<_>>>()?;
let json = serde_json::to_string_pretty(&json_vals)?;
std::fs::write(path, json)?;
Ok(())
}
}
+562
View File
@@ -0,0 +1,562 @@
//! KeyDir — in-memory document location index for the Bitcask storage engine.
//!
//! Maps document `_id` (hex string) to its location in the append-only data file.
//! Backed by `DashMap` for lock-free concurrent reads and fine-grained write locking.
//!
//! The KeyDir can be rebuilt from a data file scan, or loaded quickly from a
//! persisted hint file for fast restart.
use std::io::{self, BufReader, BufWriter, Read, Seek, SeekFrom, Write};
use std::path::Path;
use std::sync::atomic::{AtomicU64, Ordering};
use dashmap::DashMap;
use crate::error::{StorageError, StorageResult};
use crate::record::{
DataRecord, FileHeader, FileType, RecordScanner, FILE_HEADER_SIZE, FORMAT_VERSION,
};
// ---------------------------------------------------------------------------
// KeyDirEntry
// ---------------------------------------------------------------------------
/// Location of a single document in the data file.
#[derive(Debug, Clone, Copy)]
pub struct KeyDirEntry {
/// Byte offset of the record in `data.rdb`.
pub offset: u64,
/// Total record size on disk (header + payload).
pub record_len: u32,
/// BSON value length. 0 means tombstone (used during compaction accounting).
pub value_len: u32,
/// Timestamp (epoch ms) from the record. Used for conflict detection.
pub timestamp: u64,
}
// ---------------------------------------------------------------------------
// BuildStats — statistics from building KeyDir from a data file scan
// ---------------------------------------------------------------------------
/// Statistics collected while building a KeyDir from a data file scan.
#[derive(Debug, Clone, Default)]
pub struct BuildStats {
/// Total records scanned (live + tombstones + superseded).
pub total_records_scanned: u64,
/// Number of live documents in the final KeyDir.
pub live_documents: u64,
/// Number of tombstone records encountered.
pub tombstones: u64,
/// Number of records superseded by a later write for the same key.
pub superseded_records: u64,
}
// ---------------------------------------------------------------------------
// KeyDir
// ---------------------------------------------------------------------------
/// In-memory index mapping document ID → data file location.
pub struct KeyDir {
map: DashMap<String, KeyDirEntry>,
/// Running count of live documents.
doc_count: AtomicU64,
}
impl KeyDir {
/// Create an empty KeyDir.
pub fn new() -> Self {
Self {
map: DashMap::new(),
doc_count: AtomicU64::new(0),
}
}
/// Insert or update an entry. Returns the previous entry if one existed.
pub fn insert(&self, key: String, entry: KeyDirEntry) -> Option<KeyDirEntry> {
let prev = self.map.insert(key, entry);
if prev.is_none() {
self.doc_count.fetch_add(1, Ordering::Relaxed);
}
prev
}
/// Look up an entry by key.
pub fn get(&self, key: &str) -> Option<KeyDirEntry> {
self.map.get(key).map(|r| *r.value())
}
/// Remove an entry. Returns the removed entry if it existed.
pub fn remove(&self, key: &str) -> Option<KeyDirEntry> {
let removed = self.map.remove(key).map(|(_, v)| v);
if removed.is_some() {
self.doc_count.fetch_sub(1, Ordering::Relaxed);
}
removed
}
/// Number of live documents.
pub fn len(&self) -> u64 {
self.doc_count.load(Ordering::Relaxed)
}
/// Whether the index is empty.
pub fn is_empty(&self) -> bool {
self.len() == 0
}
/// Check if a key exists.
pub fn contains(&self, key: &str) -> bool {
self.map.contains_key(key)
}
/// Iterate over all entries. The closure receives (key, entry).
pub fn for_each(&self, mut f: impl FnMut(&str, &KeyDirEntry)) {
for entry in self.map.iter() {
f(entry.key(), entry.value());
}
}
/// Collect all keys.
pub fn keys(&self) -> Vec<String> {
self.map.iter().map(|e| e.key().clone()).collect()
}
/// Clear all entries.
pub fn clear(&self) {
self.map.clear();
self.doc_count.store(0, Ordering::Relaxed);
}
// -----------------------------------------------------------------------
// Build from data file
// -----------------------------------------------------------------------
/// Rebuild the KeyDir by scanning an entire data file.
/// The file must start with a valid `FileHeader`.
/// Returns `(keydir, dead_bytes, stats)` where `dead_bytes` is the total size of
/// stale records (superseded by later writes or tombstoned).
pub fn build_from_data_file(path: &Path) -> StorageResult<(Self, u64, BuildStats)> {
let file = std::fs::File::open(path)?;
let mut reader = BufReader::new(file);
// Read and validate file header
let mut hdr_buf = [0u8; FILE_HEADER_SIZE];
reader.read_exact(&mut hdr_buf)?;
let hdr = FileHeader::decode(&hdr_buf)?;
if hdr.file_type != FileType::Data {
return Err(StorageError::CorruptRecord(format!(
"expected data file (type 1), got type {:?}",
hdr.file_type
)));
}
let keydir = KeyDir::new();
let mut dead_bytes: u64 = 0;
let mut stats = BuildStats::default();
let scanner = RecordScanner::new(reader, FILE_HEADER_SIZE as u64);
for result in scanner {
let (offset, record) = result?;
let is_tombstone = record.is_tombstone();
let disk_size = record.disk_size() as u32;
let value_len = record.value.len() as u32;
let timestamp = record.timestamp;
let key = String::from_utf8(record.key)
.map_err(|e| StorageError::CorruptRecord(format!("invalid UTF-8 key: {e}")))?;
stats.total_records_scanned += 1;
if is_tombstone {
stats.tombstones += 1;
// Remove from index; the tombstone itself is dead weight
if let Some(prev) = keydir.remove(&key) {
dead_bytes += prev.record_len as u64;
}
dead_bytes += disk_size as u64;
} else {
let entry = KeyDirEntry {
offset,
record_len: disk_size,
value_len,
timestamp,
};
if let Some(prev) = keydir.insert(key, entry) {
// Previous version of same key is now dead
dead_bytes += prev.record_len as u64;
stats.superseded_records += 1;
}
}
}
stats.live_documents = keydir.len();
Ok((keydir, dead_bytes, stats))
}
// -----------------------------------------------------------------------
// Hint file persistence (for fast startup)
// -----------------------------------------------------------------------
/// Persist the KeyDir to a hint file for fast restart.
///
/// Hint file format (after the 64-byte file header):
/// For each entry: [key_len:u32 LE][key bytes][offset:u64 LE][record_len:u32 LE][value_len:u32 LE][timestamp:u64 LE]
pub fn persist_to_hint_file(&self, path: &Path) -> StorageResult<()> {
let file = std::fs::File::create(path)?;
let mut writer = BufWriter::new(file);
// Write file header
let hdr = FileHeader::new(FileType::Hint);
writer.write_all(&hdr.encode())?;
// Write entries
for entry in self.map.iter() {
let key_bytes = entry.key().as_bytes();
let key_len = key_bytes.len() as u32;
writer.write_all(&key_len.to_le_bytes())?;
writer.write_all(key_bytes)?;
writer.write_all(&entry.value().offset.to_le_bytes())?;
writer.write_all(&entry.value().record_len.to_le_bytes())?;
writer.write_all(&entry.value().value_len.to_le_bytes())?;
writer.write_all(&entry.value().timestamp.to_le_bytes())?;
}
writer.flush()?;
Ok(())
}
/// Load a KeyDir from a hint file. Returns None if the file doesn't exist.
pub fn load_from_hint_file(path: &Path) -> StorageResult<Option<Self>> {
if !path.exists() {
return Ok(None);
}
let file = std::fs::File::open(path)?;
let mut reader = BufReader::new(file);
// Read and validate header
let mut hdr_buf = [0u8; FILE_HEADER_SIZE];
match reader.read_exact(&mut hdr_buf) {
Ok(()) => {}
Err(e) if e.kind() == io::ErrorKind::UnexpectedEof => return Ok(None),
Err(e) => return Err(e.into()),
}
let hdr = FileHeader::decode(&hdr_buf)?;
if hdr.file_type != FileType::Hint {
return Err(StorageError::CorruptRecord(format!(
"expected hint file (type 3), got type {:?}",
hdr.file_type
)));
}
if hdr.version > FORMAT_VERSION {
return Err(StorageError::CorruptRecord(format!(
"hint file version {} is newer than supported {}",
hdr.version, FORMAT_VERSION
)));
}
let keydir = KeyDir::new();
loop {
// Read key_len
let mut key_len_buf = [0u8; 4];
match reader.read_exact(&mut key_len_buf) {
Ok(()) => {}
Err(e) if e.kind() == io::ErrorKind::UnexpectedEof => break,
Err(e) => return Err(e.into()),
}
let key_len = u32::from_le_bytes(key_len_buf) as usize;
// Read key
let mut key_buf = vec![0u8; key_len];
reader.read_exact(&mut key_buf)?;
let key = String::from_utf8(key_buf)
.map_err(|e| StorageError::CorruptRecord(format!("invalid UTF-8 key: {e}")))?;
// Read entry fields
let mut fields = [0u8; 8 + 4 + 4 + 8]; // offset + record_len + value_len + timestamp = 24
reader.read_exact(&mut fields)?;
let offset = u64::from_le_bytes(fields[0..8].try_into().unwrap());
let record_len = u32::from_le_bytes(fields[8..12].try_into().unwrap());
let value_len = u32::from_le_bytes(fields[12..16].try_into().unwrap());
let timestamp = u64::from_le_bytes(fields[16..24].try_into().unwrap());
keydir.insert(
key,
KeyDirEntry {
offset,
record_len,
value_len,
timestamp,
},
);
}
Ok(Some(keydir))
}
// -----------------------------------------------------------------------
// Hint file validation
// -----------------------------------------------------------------------
/// Validate this KeyDir (loaded from a hint file) against the actual data file.
/// Returns `Ok(true)` if the hint appears consistent, `Ok(false)` if a rebuild
/// from the data file is recommended.
///
/// Checks:
/// 1. All entry offsets + record_len fit within the data file size.
/// 2. All entry offsets are >= FILE_HEADER_SIZE.
/// 3. A random sample of entries is spot-checked by reading the record at
/// the offset and verifying the key matches.
pub fn validate_against_data_file(&self, data_path: &Path, sample_size: usize) -> StorageResult<bool> {
let file_size = std::fs::metadata(data_path)
.map(|m| m.len())
.unwrap_or(0);
if file_size < FILE_HEADER_SIZE as u64 {
// Data file is too small to even contain a header
return Ok(self.is_empty());
}
// Pass 1: bounds check all entries
let mut all_keys: Vec<(String, KeyDirEntry)> = Vec::with_capacity(self.len() as usize);
let mut bounds_ok = true;
self.for_each(|key, entry| {
if entry.offset < FILE_HEADER_SIZE as u64
|| entry.offset + entry.record_len as u64 > file_size
{
bounds_ok = false;
}
all_keys.push((key.to_string(), *entry));
});
if !bounds_ok {
return Ok(false);
}
// Pass 2: spot-check a sample of entries by reading records from data.rdb
if all_keys.is_empty() {
return Ok(true);
}
// Sort by offset for sequential I/O, take first `sample_size` entries
all_keys.sort_by_key(|(_, e)| e.offset);
let step = if all_keys.len() <= sample_size {
1
} else {
all_keys.len() / sample_size
};
let mut file = std::fs::File::open(data_path)?;
let mut checked = 0usize;
for (i, (expected_key, entry)) in all_keys.iter().enumerate() {
if checked >= sample_size {
break;
}
if i % step != 0 {
continue;
}
// Seek to the entry's offset and try to decode the record
file.seek(SeekFrom::Start(entry.offset))?;
match DataRecord::decode_from(&mut file) {
Ok(Some((record, _disk_size))) => {
let record_key = String::from_utf8_lossy(&record.key);
if record_key != *expected_key {
return Ok(false);
}
}
Ok(None) | Err(_) => {
return Ok(false);
}
}
checked += 1;
}
Ok(true)
}
}
impl Default for KeyDir {
fn default() -> Self {
Self::new()
}
}
// ---------------------------------------------------------------------------
// Tests
// ---------------------------------------------------------------------------
#[cfg(test)]
mod tests {
use super::*;
use crate::record::DataRecord;
use std::io::Write;
#[test]
fn basic_insert_get_remove() {
let kd = KeyDir::new();
assert!(kd.is_empty());
let entry = KeyDirEntry {
offset: 100,
record_len: 50,
value_len: 30,
timestamp: 1700000000000,
};
assert!(kd.insert("abc".into(), entry).is_none());
assert_eq!(kd.len(), 1);
assert!(kd.contains("abc"));
let got = kd.get("abc").unwrap();
assert_eq!(got.offset, 100);
assert_eq!(got.value_len, 30);
let removed = kd.remove("abc").unwrap();
assert_eq!(removed.offset, 100);
assert_eq!(kd.len(), 0);
assert!(!kd.contains("abc"));
}
#[test]
fn insert_overwrites_returns_previous() {
let kd = KeyDir::new();
let e1 = KeyDirEntry {
offset: 100,
record_len: 50,
value_len: 30,
timestamp: 1,
};
let e2 = KeyDirEntry {
offset: 200,
record_len: 60,
value_len: 40,
timestamp: 2,
};
kd.insert("k".into(), e1);
assert_eq!(kd.len(), 1);
let prev = kd.insert("k".into(), e2).unwrap();
assert_eq!(prev.offset, 100);
// Count stays at 1 (overwrite, not new)
assert_eq!(kd.len(), 1);
assert_eq!(kd.get("k").unwrap().offset, 200);
}
#[test]
fn build_from_data_file() {
let dir = tempfile::tempdir().unwrap();
let data_path = dir.path().join("data.rdb");
// Write a data file with 3 records: insert A, insert B, delete A
{
let mut f = std::fs::File::create(&data_path).unwrap();
let hdr = FileHeader::new(FileType::Data);
f.write_all(&hdr.encode()).unwrap();
let r1 = DataRecord {
timestamp: 1,
key: b"aaa".to_vec(),
value: b"val_a".to_vec(),
};
let r2 = DataRecord {
timestamp: 2,
key: b"bbb".to_vec(),
value: b"val_b".to_vec(),
};
let r3 = DataRecord {
timestamp: 3,
key: b"aaa".to_vec(),
value: vec![], // tombstone
};
f.write_all(&r1.encode()).unwrap();
f.write_all(&r2.encode()).unwrap();
f.write_all(&r3.encode()).unwrap();
}
let (kd, dead_bytes, stats) = KeyDir::build_from_data_file(&data_path).unwrap();
// Only B should be live
assert_eq!(kd.len(), 1);
assert!(kd.contains("bbb"));
assert!(!kd.contains("aaa"));
// Dead bytes: r1 (aaa live, then superseded by tombstone) + r3 (tombstone itself)
assert!(dead_bytes > 0);
// Stats
assert_eq!(stats.total_records_scanned, 3);
assert_eq!(stats.live_documents, 1);
assert_eq!(stats.tombstones, 1);
assert_eq!(stats.superseded_records, 0); // aaa was removed by tombstone, not superseded
}
#[test]
fn hint_file_roundtrip() {
let dir = tempfile::tempdir().unwrap();
let hint_path = dir.path().join("keydir.hint");
let kd = KeyDir::new();
kd.insert(
"doc1".into(),
KeyDirEntry {
offset: 64,
record_len: 100,
value_len: 80,
timestamp: 1000,
},
);
kd.insert(
"doc2".into(),
KeyDirEntry {
offset: 164,
record_len: 200,
value_len: 150,
timestamp: 2000,
},
);
kd.persist_to_hint_file(&hint_path).unwrap();
let loaded = KeyDir::load_from_hint_file(&hint_path).unwrap().unwrap();
assert_eq!(loaded.len(), 2);
let e1 = loaded.get("doc1").unwrap();
assert_eq!(e1.offset, 64);
assert_eq!(e1.record_len, 100);
assert_eq!(e1.value_len, 80);
assert_eq!(e1.timestamp, 1000);
let e2 = loaded.get("doc2").unwrap();
assert_eq!(e2.offset, 164);
assert_eq!(e2.timestamp, 2000);
}
#[test]
fn hint_file_nonexistent_returns_none() {
let result = KeyDir::load_from_hint_file(Path::new("/tmp/nonexistent_hint_file.hint"));
assert!(result.unwrap().is_none());
}
#[test]
fn for_each_and_keys() {
let kd = KeyDir::new();
let e = KeyDirEntry {
offset: 0,
record_len: 10,
value_len: 5,
timestamp: 1,
};
kd.insert("x".into(), e);
kd.insert("y".into(), e);
let mut collected = Vec::new();
kd.for_each(|k, _| collected.push(k.to_string()));
collected.sort();
assert_eq!(collected, vec!["x", "y"]);
let mut keys = kd.keys();
keys.sort();
assert_eq!(keys, vec!["x", "y"]);
}
}
+32
View File
@@ -0,0 +1,32 @@
//! `rustdb-storage` -- Storage adapters for RustDb.
//!
//! Provides the [`StorageAdapter`] trait and two concrete implementations:
//! - [`MemoryStorageAdapter`] -- fast in-memory store backed by `DashMap`
//! - [`FileStorageAdapter`] -- Bitcask-style append-only log with crash recovery
//!
//! Also includes an [`OpLog`] for operation logging, a [`BinaryWal`] for
//! write-ahead logging, and [`compaction`] for dead record reclamation.
pub mod adapter;
pub mod binary_wal;
pub mod compaction;
pub mod error;
pub mod file;
pub mod keydir;
pub mod memory;
pub mod oplog;
pub mod record;
pub mod validate;
pub use adapter::StorageAdapter;
pub use binary_wal::{BinaryWal, WalEntry, WalOpType};
pub use compaction::{compact_data_file, should_compact, CompactionResult};
pub use error::{StorageError, StorageResult};
pub use file::FileStorageAdapter;
pub use keydir::{BuildStats, KeyDir, KeyDirEntry};
pub use memory::MemoryStorageAdapter;
pub use oplog::{OpLog, OpLogEntry, OpLogStats, OpType};
pub use record::{
DataRecord, FileHeader, FileType, RecordScanner, FILE_HEADER_SIZE, FILE_MAGIC, FORMAT_VERSION,
RECORD_HEADER_SIZE, RECORD_MAGIC,
};
+613
View File
@@ -0,0 +1,613 @@
use std::collections::HashSet;
use std::path::PathBuf;
use std::time::{SystemTime, UNIX_EPOCH};
use async_trait::async_trait;
use bson::{doc, oid::ObjectId, Document};
use dashmap::DashMap;
use tracing::{debug, warn};
use crate::adapter::StorageAdapter;
use crate::error::{StorageError, StorageResult};
/// Per-document timestamp tracking for conflict detection.
type TimestampMap = DashMap<String, i64>;
/// db -> coll -> id_hex -> Document
type DataStore = DashMap<String, DashMap<String, DashMap<String, Document>>>;
/// db -> coll -> Vec<index spec Document>
type IndexStore = DashMap<String, DashMap<String, Vec<Document>>>;
/// db -> coll -> id_hex -> last_modified_ms
type ModificationStore = DashMap<String, DashMap<String, TimestampMap>>;
fn now_ms() -> i64 {
SystemTime::now()
.duration_since(UNIX_EPOCH)
.unwrap()
.as_millis() as i64
}
/// In-memory storage adapter backed by `DashMap`.
///
/// Optionally persists to a JSON file at a configured path.
pub struct MemoryStorageAdapter {
data: DataStore,
indexes: IndexStore,
modifications: ModificationStore,
persist_path: Option<PathBuf>,
}
impl MemoryStorageAdapter {
/// Create a new purely in-memory adapter.
pub fn new() -> Self {
Self {
data: DashMap::new(),
indexes: DashMap::new(),
modifications: DashMap::new(),
persist_path: None,
}
}
/// Create a new adapter that will persist state to the given JSON file.
pub fn with_persist_path(path: PathBuf) -> Self {
Self {
data: DashMap::new(),
indexes: DashMap::new(),
modifications: DashMap::new(),
persist_path: Some(path),
}
}
/// Get or create the database entry in the data store.
fn ensure_db(&self, db: &str) {
self.data.entry(db.to_string()).or_insert_with(DashMap::new);
self.indexes
.entry(db.to_string())
.or_insert_with(DashMap::new);
self.modifications
.entry(db.to_string())
.or_insert_with(DashMap::new);
}
fn extract_id(doc: &Document) -> StorageResult<String> {
match doc.get("_id") {
Some(bson::Bson::ObjectId(oid)) => Ok(oid.to_hex()),
_ => Err(StorageError::NotFound("document missing _id".into())),
}
}
fn record_modification(&self, db: &str, coll: &str, id: &str) {
if let Some(db_mods) = self.modifications.get(db) {
if let Some(coll_mods) = db_mods.get(coll) {
coll_mods.insert(id.to_string(), now_ms());
}
}
}
}
#[async_trait]
impl StorageAdapter for MemoryStorageAdapter {
async fn initialize(&self) -> StorageResult<()> {
debug!("MemoryStorageAdapter initialized");
Ok(())
}
async fn close(&self) -> StorageResult<()> {
// Persist if configured.
self.persist().await?;
debug!("MemoryStorageAdapter closed");
Ok(())
}
// ---- database ----
async fn list_databases(&self) -> StorageResult<Vec<String>> {
Ok(self.data.iter().map(|e| e.key().clone()).collect())
}
async fn create_database(&self, db: &str) -> StorageResult<()> {
if self.data.contains_key(db) {
return Err(StorageError::AlreadyExists(format!("database '{db}'")));
}
self.ensure_db(db);
Ok(())
}
async fn drop_database(&self, db: &str) -> StorageResult<()> {
self.data.remove(db);
self.indexes.remove(db);
self.modifications.remove(db);
Ok(())
}
async fn database_exists(&self, db: &str) -> StorageResult<bool> {
Ok(self.data.contains_key(db))
}
// ---- collection ----
async fn list_collections(&self, db: &str) -> StorageResult<Vec<String>> {
let db_ref = self
.data
.get(db)
.ok_or_else(|| StorageError::NotFound(format!("database '{db}'")))?;
Ok(db_ref.iter().map(|e| e.key().clone()).collect())
}
async fn create_collection(&self, db: &str, coll: &str) -> StorageResult<()> {
self.ensure_db(db);
let db_ref = self.data.get(db).unwrap();
if db_ref.contains_key(coll) {
return Err(StorageError::AlreadyExists(format!(
"collection '{db}.{coll}'"
)));
}
db_ref.insert(coll.to_string(), DashMap::new());
drop(db_ref);
// Create modification tracker for this collection.
if let Some(db_mods) = self.modifications.get(db) {
db_mods.insert(coll.to_string(), DashMap::new());
}
// Auto-create _id index spec.
let idx_spec = doc! { "name": "_id_", "key": { "_id": 1 } };
if let Some(db_idx) = self.indexes.get(db) {
db_idx.insert(coll.to_string(), vec![idx_spec]);
}
Ok(())
}
async fn drop_collection(&self, db: &str, coll: &str) -> StorageResult<()> {
if let Some(db_ref) = self.data.get(db) {
db_ref.remove(coll);
}
if let Some(db_idx) = self.indexes.get(db) {
db_idx.remove(coll);
}
if let Some(db_mods) = self.modifications.get(db) {
db_mods.remove(coll);
}
Ok(())
}
async fn collection_exists(&self, db: &str, coll: &str) -> StorageResult<bool> {
Ok(self
.data
.get(db)
.map(|db_ref| db_ref.contains_key(coll))
.unwrap_or(false))
}
async fn rename_collection(
&self,
db: &str,
old_name: &str,
new_name: &str,
) -> StorageResult<()> {
let db_ref = self
.data
.get(db)
.ok_or_else(|| StorageError::NotFound(format!("database '{db}'")))?;
if db_ref.contains_key(new_name) {
return Err(StorageError::AlreadyExists(format!(
"collection '{db}.{new_name}'"
)));
}
let (_, coll_data) = db_ref
.remove(old_name)
.ok_or_else(|| StorageError::NotFound(format!("collection '{db}.{old_name}'")))?;
db_ref.insert(new_name.to_string(), coll_data);
drop(db_ref);
// Rename in indexes.
if let Some(db_idx) = self.indexes.get(db) {
if let Some((_, idx_data)) = db_idx.remove(old_name) {
db_idx.insert(new_name.to_string(), idx_data);
}
}
// Rename in modifications.
if let Some(db_mods) = self.modifications.get(db) {
if let Some((_, mod_data)) = db_mods.remove(old_name) {
db_mods.insert(new_name.to_string(), mod_data);
}
}
Ok(())
}
// ---- document writes ----
async fn insert_one(
&self,
db: &str,
coll: &str,
mut doc: Document,
) -> StorageResult<String> {
// Ensure _id exists.
if !doc.contains_key("_id") {
doc.insert("_id", ObjectId::new());
}
let id = Self::extract_id(&doc)?;
let db_ref = self
.data
.get(db)
.ok_or_else(|| StorageError::NotFound(format!("database '{db}'")))?;
let coll_ref = db_ref
.get(coll)
.ok_or_else(|| StorageError::NotFound(format!("collection '{db}.{coll}'")))?;
if coll_ref.contains_key(&id) {
return Err(StorageError::AlreadyExists(format!("document '{id}'")));
}
coll_ref.insert(id.clone(), doc);
drop(coll_ref);
drop(db_ref);
self.record_modification(db, coll, &id);
Ok(id)
}
async fn insert_many(
&self,
db: &str,
coll: &str,
docs: Vec<Document>,
) -> StorageResult<Vec<String>> {
let mut ids = Vec::with_capacity(docs.len());
for doc in docs {
let id = self.insert_one(db, coll, doc).await?;
ids.push(id);
}
Ok(ids)
}
async fn update_by_id(
&self,
db: &str,
coll: &str,
id: &str,
doc: Document,
) -> StorageResult<()> {
let db_ref = self
.data
.get(db)
.ok_or_else(|| StorageError::NotFound(format!("database '{db}'")))?;
let coll_ref = db_ref
.get(coll)
.ok_or_else(|| StorageError::NotFound(format!("collection '{db}.{coll}'")))?;
if !coll_ref.contains_key(id) {
return Err(StorageError::NotFound(format!("document '{id}'")));
}
coll_ref.insert(id.to_string(), doc);
drop(coll_ref);
drop(db_ref);
self.record_modification(db, coll, id);
Ok(())
}
async fn delete_by_id(
&self,
db: &str,
coll: &str,
id: &str,
) -> StorageResult<()> {
let db_ref = self
.data
.get(db)
.ok_or_else(|| StorageError::NotFound(format!("database '{db}'")))?;
let coll_ref = db_ref
.get(coll)
.ok_or_else(|| StorageError::NotFound(format!("collection '{db}.{coll}'")))?;
coll_ref
.remove(id)
.ok_or_else(|| StorageError::NotFound(format!("document '{id}'")))?;
drop(coll_ref);
drop(db_ref);
self.record_modification(db, coll, id);
Ok(())
}
async fn delete_by_ids(
&self,
db: &str,
coll: &str,
ids: &[String],
) -> StorageResult<()> {
for id in ids {
self.delete_by_id(db, coll, id).await?;
}
Ok(())
}
// ---- document reads ----
async fn find_all(
&self,
db: &str,
coll: &str,
) -> StorageResult<Vec<Document>> {
let db_ref = self
.data
.get(db)
.ok_or_else(|| StorageError::NotFound(format!("database '{db}'")))?;
let coll_ref = db_ref
.get(coll)
.ok_or_else(|| StorageError::NotFound(format!("collection '{db}.{coll}'")))?;
Ok(coll_ref.iter().map(|e| e.value().clone()).collect())
}
async fn find_by_ids(
&self,
db: &str,
coll: &str,
ids: HashSet<String>,
) -> StorageResult<Vec<Document>> {
let db_ref = self
.data
.get(db)
.ok_or_else(|| StorageError::NotFound(format!("database '{db}'")))?;
let coll_ref = db_ref
.get(coll)
.ok_or_else(|| StorageError::NotFound(format!("collection '{db}.{coll}'")))?;
let mut results = Vec::with_capacity(ids.len());
for id in &ids {
if let Some(doc) = coll_ref.get(id) {
results.push(doc.value().clone());
}
}
Ok(results)
}
async fn find_by_id(
&self,
db: &str,
coll: &str,
id: &str,
) -> StorageResult<Option<Document>> {
let db_ref = self
.data
.get(db)
.ok_or_else(|| StorageError::NotFound(format!("database '{db}'")))?;
let coll_ref = db_ref
.get(coll)
.ok_or_else(|| StorageError::NotFound(format!("collection '{db}.{coll}'")))?;
Ok(coll_ref.get(id).map(|e| e.value().clone()))
}
async fn count(
&self,
db: &str,
coll: &str,
) -> StorageResult<u64> {
let db_ref = self
.data
.get(db)
.ok_or_else(|| StorageError::NotFound(format!("database '{db}'")))?;
let coll_ref = db_ref
.get(coll)
.ok_or_else(|| StorageError::NotFound(format!("collection '{db}.{coll}'")))?;
Ok(coll_ref.len() as u64)
}
// ---- indexes ----
async fn save_index(
&self,
db: &str,
coll: &str,
name: &str,
spec: Document,
) -> StorageResult<()> {
let db_idx = self
.indexes
.get(db)
.ok_or_else(|| StorageError::NotFound(format!("database '{db}'")))?;
let mut specs = db_idx
.get_mut(coll)
.ok_or_else(|| StorageError::NotFound(format!("collection '{db}.{coll}'")))?;
// Remove existing index with same name, then add.
specs.retain(|s| s.get_str("name").unwrap_or("") != name);
let mut full_spec = spec;
full_spec.insert("name", name);
specs.push(full_spec);
Ok(())
}
async fn get_indexes(
&self,
db: &str,
coll: &str,
) -> StorageResult<Vec<Document>> {
let db_idx = self
.indexes
.get(db)
.ok_or_else(|| StorageError::NotFound(format!("database '{db}'")))?;
let specs = db_idx
.get(coll)
.ok_or_else(|| StorageError::NotFound(format!("collection '{db}.{coll}'")))?;
Ok(specs.clone())
}
async fn drop_index(
&self,
db: &str,
coll: &str,
name: &str,
) -> StorageResult<()> {
let db_idx = self
.indexes
.get(db)
.ok_or_else(|| StorageError::NotFound(format!("database '{db}'")))?;
let mut specs = db_idx
.get_mut(coll)
.ok_or_else(|| StorageError::NotFound(format!("collection '{db}.{coll}'")))?;
let before = specs.len();
specs.retain(|s| s.get_str("name").unwrap_or("") != name);
if specs.len() == before {
return Err(StorageError::NotFound(format!("index '{name}'")));
}
Ok(())
}
// ---- snapshot / conflict detection ----
async fn create_snapshot(
&self,
_db: &str,
_coll: &str,
) -> StorageResult<i64> {
Ok(now_ms())
}
async fn has_conflicts(
&self,
db: &str,
coll: &str,
ids: &HashSet<String>,
snapshot_time: i64,
) -> StorageResult<bool> {
if let Some(db_mods) = self.modifications.get(db) {
if let Some(coll_mods) = db_mods.get(coll) {
for id in ids {
if let Some(ts) = coll_mods.get(id) {
if *ts.value() > snapshot_time {
return Ok(true);
}
}
}
}
}
Ok(false)
}
// ---- persistence ----
async fn persist(&self) -> StorageResult<()> {
let path = match &self.persist_path {
Some(p) => p,
None => return Ok(()),
};
// Serialize the entire data store to JSON.
let mut db_map = serde_json::Map::new();
for db_entry in self.data.iter() {
let db_name = db_entry.key().clone();
let mut coll_map = serde_json::Map::new();
for coll_entry in db_entry.value().iter() {
let coll_name = coll_entry.key().clone();
let mut docs_map = serde_json::Map::new();
for doc_entry in coll_entry.value().iter() {
let id = doc_entry.key().clone();
// Convert bson::Document -> serde_json::Value via bson's
// built-in extended-JSON serialization.
let json_val: serde_json::Value =
bson::to_bson(doc_entry.value())
.map_err(|e| StorageError::SerializationError(e.to_string()))
.and_then(|b| {
serde_json::to_value(&b)
.map_err(|e| StorageError::SerializationError(e.to_string()))
})?;
docs_map.insert(id, json_val);
}
coll_map.insert(coll_name, serde_json::Value::Object(docs_map));
}
db_map.insert(db_name, serde_json::Value::Object(coll_map));
}
let json = serde_json::to_string_pretty(&serde_json::Value::Object(db_map))?;
if let Some(parent) = path.parent() {
tokio::fs::create_dir_all(parent).await?;
}
tokio::fs::write(path, json).await?;
debug!("MemoryStorageAdapter persisted to {:?}", path);
Ok(())
}
async fn restore(&self) -> StorageResult<()> {
let path = match &self.persist_path {
Some(p) => p,
None => return Ok(()),
};
if !path.exists() {
warn!("persist file not found at {:?}, skipping restore", path);
return Ok(());
}
let json = tokio::fs::read_to_string(path).await?;
let root: serde_json::Value = serde_json::from_str(&json)?;
let root_obj = root
.as_object()
.ok_or_else(|| StorageError::SerializationError("expected object".into()))?;
self.data.clear();
self.indexes.clear();
self.modifications.clear();
for (db_name, colls_val) in root_obj {
self.ensure_db(db_name);
let db_ref = self.data.get(db_name).unwrap();
let colls = colls_val
.as_object()
.ok_or_else(|| StorageError::SerializationError("expected object".into()))?;
for (coll_name, docs_val) in colls {
let coll_map: DashMap<String, Document> = DashMap::new();
let docs = docs_val
.as_object()
.ok_or_else(|| StorageError::SerializationError("expected object".into()))?;
for (id, doc_val) in docs {
let bson_val: bson::Bson = serde_json::from_value(doc_val.clone())
.map_err(|e| StorageError::SerializationError(e.to_string()))?;
let doc = bson_val
.as_document()
.ok_or_else(|| {
StorageError::SerializationError("expected document".into())
})?
.clone();
coll_map.insert(id.clone(), doc);
}
db_ref.insert(coll_name.clone(), coll_map);
// Restore modification tracker and default _id index.
if let Some(db_mods) = self.modifications.get(db_name) {
db_mods.insert(coll_name.clone(), DashMap::new());
}
if let Some(db_idx) = self.indexes.get(db_name) {
let idx_spec = doc! { "name": "_id_", "key": { "_id": 1 } };
db_idx.insert(coll_name.clone(), vec![idx_spec]);
}
}
}
debug!("MemoryStorageAdapter restored from {:?}", path);
Ok(())
}
}
impl Default for MemoryStorageAdapter {
fn default() -> Self {
Self::new()
}
}
+203
View File
@@ -0,0 +1,203 @@
//! Operation log (OpLog) for tracking mutations.
//!
//! The OpLog records every write operation so that changes can be replayed,
//! replicated, or used for change-stream style notifications.
//! Each entry stores both the new and previous document state, enabling
//! point-in-time replay and revert.
use std::sync::atomic::{AtomicU64, Ordering};
use std::time::{SystemTime, UNIX_EPOCH};
use bson::Document;
use dashmap::DashMap;
use serde::{Deserialize, Serialize};
/// The type of operation recorded in the oplog.
#[derive(Debug, Clone, Serialize, Deserialize, PartialEq, Eq)]
pub enum OpType {
Insert,
Update,
Delete,
}
/// A single oplog entry.
#[derive(Debug, Clone, Serialize, Deserialize)]
pub struct OpLogEntry {
/// Monotonically increasing sequence number.
pub seq: u64,
/// Timestamp in milliseconds since UNIX epoch.
pub timestamp_ms: i64,
/// Operation type.
pub op: OpType,
/// Database name.
pub db: String,
/// Collection name.
pub collection: String,
/// Document id (hex string).
pub document_id: String,
/// The new document snapshot (for insert/update; None for delete).
pub document: Option<Document>,
/// The previous document snapshot (for update/delete; None for insert).
pub previous_document: Option<Document>,
}
/// Aggregate statistics about the oplog.
#[derive(Debug, Clone, Serialize, Deserialize)]
pub struct OpLogStats {
pub current_seq: u64,
pub total_entries: usize,
pub oldest_seq: u64,
pub inserts: usize,
pub updates: usize,
pub deletes: usize,
}
/// In-memory operation log.
pub struct OpLog {
/// All entries keyed by sequence number.
entries: DashMap<u64, OpLogEntry>,
/// Next sequence number.
next_seq: AtomicU64,
}
impl OpLog {
pub fn new() -> Self {
Self {
entries: DashMap::new(),
next_seq: AtomicU64::new(1),
}
}
/// Append an operation to the log and return its sequence number.
pub fn append(
&self,
op: OpType,
db: &str,
collection: &str,
document_id: &str,
document: Option<Document>,
previous_document: Option<Document>,
) -> u64 {
let seq = self.next_seq.fetch_add(1, Ordering::SeqCst);
let entry = OpLogEntry {
seq,
timestamp_ms: SystemTime::now()
.duration_since(UNIX_EPOCH)
.unwrap()
.as_millis() as i64,
op,
db: db.to_string(),
collection: collection.to_string(),
document_id: document_id.to_string(),
document,
previous_document,
};
self.entries.insert(seq, entry);
seq
}
/// Get a single entry by sequence number.
pub fn get_entry(&self, seq: u64) -> Option<OpLogEntry> {
self.entries.get(&seq).map(|e| e.value().clone())
}
/// Get all entries with sequence number >= `since`.
pub fn entries_since(&self, since: u64) -> Vec<OpLogEntry> {
let mut result: Vec<_> = self
.entries
.iter()
.filter(|e| *e.key() >= since)
.map(|e| e.value().clone())
.collect();
result.sort_by_key(|e| e.seq);
result
}
/// Get entries in range [from_seq, to_seq] inclusive, sorted by seq.
pub fn entries_range(&self, from_seq: u64, to_seq: u64) -> Vec<OpLogEntry> {
let mut result: Vec<_> = self
.entries
.iter()
.filter(|e| {
let k = *e.key();
k >= from_seq && k <= to_seq
})
.map(|e| e.value().clone())
.collect();
result.sort_by_key(|e| e.seq);
result
}
/// Remove all entries with seq > `after_seq` and reset the next_seq counter.
pub fn truncate_after(&self, after_seq: u64) {
let keys_to_remove: Vec<u64> = self
.entries
.iter()
.filter(|e| *e.key() > after_seq)
.map(|e| *e.key())
.collect();
for key in keys_to_remove {
self.entries.remove(&key);
}
self.next_seq.store(after_seq + 1, Ordering::SeqCst);
}
/// Get the current (latest) sequence number. Returns 0 if empty.
pub fn current_seq(&self) -> u64 {
self.next_seq.load(Ordering::SeqCst).saturating_sub(1)
}
/// Get aggregate statistics.
pub fn stats(&self) -> OpLogStats {
let mut inserts = 0usize;
let mut updates = 0usize;
let mut deletes = 0usize;
let mut oldest_seq = u64::MAX;
for entry in self.entries.iter() {
match entry.value().op {
OpType::Insert => inserts += 1,
OpType::Update => updates += 1,
OpType::Delete => deletes += 1,
}
if entry.value().seq < oldest_seq {
oldest_seq = entry.value().seq;
}
}
if oldest_seq == u64::MAX {
oldest_seq = 0;
}
OpLogStats {
current_seq: self.current_seq(),
total_entries: self.entries.len(),
oldest_seq,
inserts,
updates,
deletes,
}
}
/// Clear all entries.
pub fn clear(&self) {
self.entries.clear();
self.next_seq.store(1, Ordering::SeqCst);
}
/// Number of entries in the log.
pub fn len(&self) -> usize {
self.entries.len()
}
/// Whether the log is empty.
pub fn is_empty(&self) -> bool {
self.entries.is_empty()
}
}
impl Default for OpLog {
fn default() -> Self {
Self::new()
}
}
+452
View File
@@ -0,0 +1,452 @@
//! Binary data record format for the Bitcask-style storage engine.
//!
//! # File Version Header (64 bytes, at offset 0 of every .rdb / .hint file)
//!
//! ```text
//! ┌──────────────┬──────────┬──────────┬──────────┬──────────┬───────────────┐
//! │ magic │ version │ file_type│ flags │ created │ reserved │
//! │ 8 bytes │ u16 LE │ u8 │ u32 LE │ u64 LE │ 41 bytes │
//! │ "SMARTDB\0" │ │ │ │ epoch_ms │ (zeros) │
//! └──────────────┴──────────┴──────────┴──────────┴──────────┴───────────────┘
//! ```
//!
//! # Data Record (appended after the header)
//!
//! ```text
//! ┌──────────┬──────────┬──────────┬──────────┬──────────┬──────────────────┐
//! │ magic │ timestamp│ key_len │ val_len │ crc32 │ payload │
//! │ u16 LE │ u64 LE │ u32 LE │ u32 LE │ u32 LE │ [key][value] │
//! │ 0xDB01 │ epoch_ms │ │ 0=delete │ │ │
//! └──────────┴──────────┴──────────┴──────────┴──────────┴──────────────────┘
//! ```
use std::io::{self, Read};
use std::time::{SystemTime, UNIX_EPOCH};
use crate::error::{StorageError, StorageResult};
// ---------------------------------------------------------------------------
// Constants
// ---------------------------------------------------------------------------
/// File-level magic: b"SMARTDB\0"
pub const FILE_MAGIC: &[u8; 8] = b"SMARTDB\0";
/// Current storage format version.
pub const FORMAT_VERSION: u16 = 1;
/// File version header size.
pub const FILE_HEADER_SIZE: usize = 64;
/// Per-record magic.
pub const RECORD_MAGIC: u16 = 0xDB01;
/// Per-record header size (before payload).
pub const RECORD_HEADER_SIZE: usize = 2 + 8 + 4 + 4 + 4; // 22 bytes
// ---------------------------------------------------------------------------
// File type tag stored in the version header
// ---------------------------------------------------------------------------
#[derive(Debug, Clone, Copy, PartialEq, Eq)]
#[repr(u8)]
pub enum FileType {
Data = 1,
Wal = 2,
Hint = 3,
}
impl FileType {
pub fn from_u8(v: u8) -> StorageResult<Self> {
match v {
1 => Ok(FileType::Data),
2 => Ok(FileType::Wal),
3 => Ok(FileType::Hint),
_ => Err(StorageError::CorruptRecord(format!(
"unknown file type tag: {v}"
))),
}
}
}
// ---------------------------------------------------------------------------
// File Version Header
// ---------------------------------------------------------------------------
#[derive(Debug, Clone)]
pub struct FileHeader {
pub version: u16,
pub file_type: FileType,
pub flags: u32,
pub created_ms: u64,
}
impl FileHeader {
/// Create a new header for the current format version.
pub fn new(file_type: FileType) -> Self {
Self {
version: FORMAT_VERSION,
file_type,
flags: 0,
created_ms: now_ms(),
}
}
/// Encode the header to a 64-byte buffer.
pub fn encode(&self) -> [u8; FILE_HEADER_SIZE] {
let mut buf = [0u8; FILE_HEADER_SIZE];
buf[0..8].copy_from_slice(FILE_MAGIC);
buf[8..10].copy_from_slice(&self.version.to_le_bytes());
buf[10] = self.file_type as u8;
buf[11..15].copy_from_slice(&self.flags.to_le_bytes());
buf[15..23].copy_from_slice(&self.created_ms.to_le_bytes());
// bytes 23..64 are reserved (zeros)
buf
}
/// Decode a 64-byte header. Validates magic and version.
pub fn decode(buf: &[u8; FILE_HEADER_SIZE]) -> StorageResult<Self> {
if &buf[0..8] != FILE_MAGIC {
return Err(StorageError::CorruptRecord(
"invalid file magic — not a SmartDB file".into(),
));
}
let version = u16::from_le_bytes([buf[8], buf[9]]);
if version > FORMAT_VERSION {
return Err(StorageError::CorruptRecord(format!(
"file format version {version} is newer than supported version {FORMAT_VERSION} — please upgrade"
)));
}
if version == 0 {
return Err(StorageError::CorruptRecord(
"file format version 0 is invalid".into(),
));
}
let file_type = FileType::from_u8(buf[10])?;
let flags = u32::from_le_bytes([buf[11], buf[12], buf[13], buf[14]]);
let created_ms = u64::from_le_bytes([
buf[15], buf[16], buf[17], buf[18], buf[19], buf[20], buf[21], buf[22],
]);
Ok(Self {
version,
file_type,
flags,
created_ms,
})
}
}
// ---------------------------------------------------------------------------
// Data Record
// ---------------------------------------------------------------------------
/// A single data record (live document or tombstone).
#[derive(Debug, Clone)]
pub struct DataRecord {
pub timestamp: u64,
pub key: Vec<u8>,
/// BSON value bytes. Empty for tombstones.
pub value: Vec<u8>,
}
impl DataRecord {
/// Whether this record is a tombstone (delete marker).
pub fn is_tombstone(&self) -> bool {
self.value.is_empty()
}
/// Total size on disk (header + payload).
pub fn disk_size(&self) -> usize {
RECORD_HEADER_SIZE + self.key.len() + self.value.len()
}
/// Encode to bytes. CRC32 covers magic + timestamp + key_len + val_len + payload.
pub fn encode(&self) -> Vec<u8> {
let key_len = self.key.len() as u32;
let val_len = self.value.len() as u32;
let total = RECORD_HEADER_SIZE + self.key.len() + self.value.len();
let mut buf = Vec::with_capacity(total);
// Write fields WITHOUT crc first to compute checksum.
buf.extend_from_slice(&RECORD_MAGIC.to_le_bytes()); // 2
buf.extend_from_slice(&self.timestamp.to_le_bytes()); // 8
buf.extend_from_slice(&key_len.to_le_bytes()); // 4
buf.extend_from_slice(&val_len.to_le_bytes()); // 4
// placeholder for crc32 — we'll fill it after computing
buf.extend_from_slice(&0u32.to_le_bytes()); // 4
buf.extend_from_slice(&self.key); // key_len
buf.extend_from_slice(&self.value); // val_len
// CRC covers everything except the crc32 field itself:
// bytes [0..18] (magic+ts+key_len+val_len) + bytes [22..] (payload)
let mut hasher = crc32fast::Hasher::new();
hasher.update(&buf[0..18]);
hasher.update(&buf[22..]);
let crc = hasher.finalize();
buf[18..22].copy_from_slice(&crc.to_le_bytes());
buf
}
/// Decode a record from a reader. Returns the record and its total disk size.
/// On EOF at the very start (no bytes to read), returns Ok(None).
pub fn decode_from<R: Read>(reader: &mut R) -> StorageResult<Option<(Self, usize)>> {
// Read header
let mut hdr = [0u8; RECORD_HEADER_SIZE];
match reader.read_exact(&mut hdr) {
Ok(()) => {}
Err(e) if e.kind() == io::ErrorKind::UnexpectedEof => return Ok(None),
Err(e) => return Err(e.into()),
}
let magic = u16::from_le_bytes([hdr[0], hdr[1]]);
if magic != RECORD_MAGIC {
return Err(StorageError::CorruptRecord(format!(
"invalid record magic: 0x{magic:04X}, expected 0x{RECORD_MAGIC:04X}"
)));
}
let timestamp = u64::from_le_bytes(hdr[2..10].try_into().unwrap());
let key_len = u32::from_le_bytes(hdr[10..14].try_into().unwrap()) as usize;
let val_len = u32::from_le_bytes(hdr[14..18].try_into().unwrap()) as usize;
let stored_crc = u32::from_le_bytes(hdr[18..22].try_into().unwrap());
// Read payload
let payload_len = key_len + val_len;
let mut payload = vec![0u8; payload_len];
reader.read_exact(&mut payload)?;
// Verify CRC: covers header bytes [0..18] + payload
let mut hasher = crc32fast::Hasher::new();
hasher.update(&hdr[0..18]);
hasher.update(&payload);
let computed_crc = hasher.finalize();
if computed_crc != stored_crc {
return Err(StorageError::ChecksumMismatch {
expected: stored_crc,
actual: computed_crc,
});
}
let key = payload[..key_len].to_vec();
let value = payload[key_len..].to_vec();
let disk_size = RECORD_HEADER_SIZE + payload_len;
Ok(Some((
DataRecord {
timestamp,
key,
value,
},
disk_size,
)))
}
}
// ---------------------------------------------------------------------------
// Record Scanner — iterate records from a byte slice or reader
// ---------------------------------------------------------------------------
/// Scans records sequentially from a reader, yielding (offset, record) pairs.
/// Starts reading from the current reader position. The `base_offset` parameter
/// indicates the byte offset in the file where reading begins (typically
/// `FILE_HEADER_SIZE` for a data file).
pub struct RecordScanner<R> {
reader: R,
offset: u64,
}
impl<R: Read> RecordScanner<R> {
pub fn new(reader: R, base_offset: u64) -> Self {
Self {
reader,
offset: base_offset,
}
}
}
impl<R: Read> Iterator for RecordScanner<R> {
/// (file_offset, record) or an error. Iteration stops on EOF or error.
type Item = StorageResult<(u64, DataRecord)>;
fn next(&mut self) -> Option<Self::Item> {
match DataRecord::decode_from(&mut self.reader) {
Ok(Some((record, disk_size))) => {
let offset = self.offset;
self.offset += disk_size as u64;
Some(Ok((offset, record)))
}
Ok(None) => None, // clean EOF
Err(e) => Some(Err(e)),
}
}
}
// ---------------------------------------------------------------------------
// Helpers
// ---------------------------------------------------------------------------
/// Current time in milliseconds since UNIX epoch.
pub fn now_ms() -> u64 {
SystemTime::now()
.duration_since(UNIX_EPOCH)
.unwrap()
.as_millis() as u64
}
// ---------------------------------------------------------------------------
// Tests
// ---------------------------------------------------------------------------
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn file_header_roundtrip() {
let hdr = FileHeader::new(FileType::Data);
let buf = hdr.encode();
assert_eq!(buf.len(), FILE_HEADER_SIZE);
let decoded = FileHeader::decode(&buf).unwrap();
assert_eq!(decoded.version, FORMAT_VERSION);
assert_eq!(decoded.file_type, FileType::Data);
assert_eq!(decoded.flags, 0);
assert_eq!(decoded.created_ms, hdr.created_ms);
}
#[test]
fn file_header_rejects_bad_magic() {
let mut buf = [0u8; FILE_HEADER_SIZE];
buf[0..8].copy_from_slice(b"BADMAGIC");
assert!(FileHeader::decode(&buf).is_err());
}
#[test]
fn file_header_rejects_future_version() {
let mut hdr = FileHeader::new(FileType::Data);
hdr.version = FORMAT_VERSION + 1;
let buf = hdr.encode();
// Manually patch the version in the buffer
let mut buf2 = buf;
buf2[8..10].copy_from_slice(&(FORMAT_VERSION + 1).to_le_bytes());
assert!(FileHeader::decode(&buf2).is_err());
}
#[test]
fn record_roundtrip_live() {
let rec = DataRecord {
timestamp: 1700000000000,
key: b"abc123".to_vec(),
value: b"\x10\x00\x00\x00\x02hi\x00\x03\x00\x00\x00ok\x00\x00".to_vec(),
};
let encoded = rec.encode();
assert_eq!(encoded.len(), rec.disk_size());
let mut cursor = std::io::Cursor::new(&encoded);
let (decoded, size) = DataRecord::decode_from(&mut cursor).unwrap().unwrap();
assert_eq!(size, encoded.len());
assert_eq!(decoded.timestamp, rec.timestamp);
assert_eq!(decoded.key, rec.key);
assert_eq!(decoded.value, rec.value);
assert!(!decoded.is_tombstone());
}
#[test]
fn record_roundtrip_tombstone() {
let rec = DataRecord {
timestamp: 1700000000000,
key: b"def456".to_vec(),
value: vec![],
};
assert!(rec.is_tombstone());
let encoded = rec.encode();
let mut cursor = std::io::Cursor::new(&encoded);
let (decoded, _) = DataRecord::decode_from(&mut cursor).unwrap().unwrap();
assert!(decoded.is_tombstone());
assert_eq!(decoded.key, b"def456");
}
#[test]
fn record_detects_corruption() {
let rec = DataRecord {
timestamp: 42,
key: b"key".to_vec(),
value: b"value".to_vec(),
};
let mut encoded = rec.encode();
// Flip a bit in the payload
let last = encoded.len() - 1;
encoded[last] ^= 0xFF;
let mut cursor = std::io::Cursor::new(&encoded);
let result = DataRecord::decode_from(&mut cursor);
assert!(matches!(result, Err(StorageError::ChecksumMismatch { .. })));
}
#[test]
fn record_detects_bad_magic() {
let rec = DataRecord {
timestamp: 42,
key: b"key".to_vec(),
value: b"value".to_vec(),
};
let mut encoded = rec.encode();
encoded[0] = 0xFF;
encoded[1] = 0xFF;
let mut cursor = std::io::Cursor::new(&encoded);
let result = DataRecord::decode_from(&mut cursor);
assert!(matches!(result, Err(StorageError::CorruptRecord(_))));
}
#[test]
fn eof_returns_none() {
let empty: &[u8] = &[];
let mut cursor = std::io::Cursor::new(empty);
let result = DataRecord::decode_from(&mut cursor).unwrap();
assert!(result.is_none());
}
#[test]
fn scanner_iterates_multiple_records() {
let records = vec![
DataRecord {
timestamp: 1,
key: b"a".to_vec(),
value: b"v1".to_vec(),
},
DataRecord {
timestamp: 2,
key: b"b".to_vec(),
value: b"v2".to_vec(),
},
DataRecord {
timestamp: 3,
key: b"c".to_vec(),
value: vec![],
},
];
let mut buf = Vec::new();
for r in &records {
buf.extend_from_slice(&r.encode());
}
let scanner = RecordScanner::new(std::io::Cursor::new(&buf), 0);
let results: Vec<_> = scanner.collect::<Result<Vec<_>, _>>().unwrap();
assert_eq!(results.len(), 3);
assert_eq!(results[0].1.key, b"a");
assert_eq!(results[1].1.key, b"b");
assert!(results[2].1.is_tombstone());
// Verify offsets are correct
assert_eq!(results[0].0, 0);
assert_eq!(results[1].0, records[0].disk_size() as u64);
assert_eq!(
results[2].0,
(records[0].disk_size() + records[1].disk_size()) as u64
);
}
}
+324
View File
@@ -0,0 +1,324 @@
//! Data integrity validation for RustDb storage directories.
//!
//! Provides offline validation of data files without starting the server.
//! Checks header magic, record CRC32 checksums, duplicate IDs, and
//! keydir.hint consistency.
use std::collections::HashMap;
use std::io::{BufReader, Read};
use std::path::Path;
use crate::error::{StorageError, StorageResult};
use crate::keydir::KeyDir;
use crate::record::{FileHeader, FileType, RecordScanner, FILE_HEADER_SIZE};
/// Result of validating an entire data directory.
pub struct ValidationReport {
pub collections: Vec<CollectionReport>,
}
/// Result of validating a single collection.
pub struct CollectionReport {
pub db: String,
pub collection: String,
pub header_valid: bool,
pub total_records: u64,
pub live_documents: u64,
pub tombstones: u64,
pub duplicate_ids: Vec<String>,
pub checksum_errors: u64,
pub decode_errors: u64,
pub data_file_size: u64,
pub hint_file_exists: bool,
pub orphaned_hint_entries: u64,
pub errors: Vec<String>,
}
impl ValidationReport {
/// Whether any errors were found across all collections.
pub fn has_errors(&self) -> bool {
self.collections.iter().any(|c| {
!c.header_valid
|| !c.duplicate_ids.is_empty()
|| c.checksum_errors > 0
|| c.decode_errors > 0
|| c.orphaned_hint_entries > 0
|| !c.errors.is_empty()
})
}
/// Print a human-readable summary to stdout.
pub fn print_summary(&self) {
println!("=== SmartDB Data Integrity Report ===");
println!();
let mut total_errors = 0u64;
for report in &self.collections {
println!("Database: {}", report.db);
println!(" Collection: {}", report.collection);
println!(
" Header: {}",
if report.header_valid { "OK" } else { "INVALID" }
);
println!(
" Records: {} ({} live, {} tombstones)",
report.total_records, report.live_documents, report.tombstones
);
println!(" Data size: {} bytes", report.data_file_size);
if report.duplicate_ids.is_empty() {
println!(" Duplicates: 0");
} else {
let ids_preview: Vec<&str> = report.duplicate_ids.iter().take(5).map(|s| s.as_str()).collect();
let suffix = if report.duplicate_ids.len() > 5 {
format!(", ... and {} more", report.duplicate_ids.len() - 5)
} else {
String::new()
};
println!(
" Duplicates: {} (ids: {}{})",
report.duplicate_ids.len(),
ids_preview.join(", "),
suffix
);
}
if report.checksum_errors > 0 {
println!(" CRC errors: {}", report.checksum_errors);
} else {
println!(" CRC errors: 0");
}
if report.decode_errors > 0 {
println!(" Decode errors: {}", report.decode_errors);
}
if report.hint_file_exists {
if report.orphaned_hint_entries > 0 {
println!(
" Hint file: STALE ({} orphaned entries)",
report.orphaned_hint_entries
);
} else {
println!(" Hint file: OK");
}
} else {
println!(" Hint file: absent");
}
for err in &report.errors {
println!(" ERROR: {}", err);
}
println!();
if !report.header_valid { total_errors += 1; }
total_errors += report.duplicate_ids.len() as u64;
total_errors += report.checksum_errors;
total_errors += report.decode_errors;
total_errors += report.orphaned_hint_entries;
total_errors += report.errors.len() as u64;
}
println!(
"Summary: {} collection(s) checked, {} error(s) found.",
self.collections.len(),
total_errors
);
}
}
/// Validate all collections in a data directory.
///
/// The directory structure is expected to be:
/// ```text
/// {base_path}/{db}/{collection}/data.rdb
/// ```
pub fn validate_data_directory(base_path: &str) -> StorageResult<ValidationReport> {
let base = Path::new(base_path);
if !base.exists() {
return Err(StorageError::IoError(std::io::Error::new(
std::io::ErrorKind::NotFound,
format!("data directory not found: {base_path}"),
)));
}
let mut collections = Vec::new();
// Iterate database directories
let entries = std::fs::read_dir(base)?;
for entry in entries {
let entry = entry?;
if !entry.file_type()?.is_dir() {
continue;
}
let db_name = match entry.file_name().to_str() {
Some(s) => s.to_string(),
None => continue,
};
// Iterate collection directories
let db_entries = std::fs::read_dir(entry.path())?;
for coll_entry in db_entries {
let coll_entry = coll_entry?;
if !coll_entry.file_type()?.is_dir() {
continue;
}
let coll_name = match coll_entry.file_name().to_str() {
Some(s) => s.to_string(),
None => continue,
};
let data_path = coll_entry.path().join("data.rdb");
if !data_path.exists() {
continue;
}
let report = validate_collection(&db_name, &coll_name, &coll_entry.path());
collections.push(report);
}
}
// Sort for deterministic output
collections.sort_by(|a, b| (&a.db, &a.collection).cmp(&(&b.db, &b.collection)));
Ok(ValidationReport { collections })
}
/// Validate a single collection directory.
fn validate_collection(db: &str, coll: &str, coll_dir: &Path) -> CollectionReport {
let data_path = coll_dir.join("data.rdb");
let hint_path = coll_dir.join("keydir.hint");
let mut report = CollectionReport {
db: db.to_string(),
collection: coll.to_string(),
header_valid: false,
total_records: 0,
live_documents: 0,
tombstones: 0,
duplicate_ids: Vec::new(),
checksum_errors: 0,
decode_errors: 0,
data_file_size: 0,
hint_file_exists: hint_path.exists(),
orphaned_hint_entries: 0,
errors: Vec::new(),
};
// Get file size
match std::fs::metadata(&data_path) {
Ok(m) => report.data_file_size = m.len(),
Err(e) => {
report.errors.push(format!("cannot stat data.rdb: {e}"));
return report;
}
}
// Open and validate header
let file = match std::fs::File::open(&data_path) {
Ok(f) => f,
Err(e) => {
report.errors.push(format!("cannot open data.rdb: {e}"));
return report;
}
};
let mut reader = BufReader::new(file);
let mut hdr_buf = [0u8; FILE_HEADER_SIZE];
if let Err(e) = reader.read_exact(&mut hdr_buf) {
report.errors.push(format!("cannot read header: {e}"));
return report;
}
match FileHeader::decode(&hdr_buf) {
Ok(hdr) => {
if hdr.file_type != FileType::Data {
report.errors.push(format!(
"wrong file type: expected Data, got {:?}",
hdr.file_type
));
} else {
report.header_valid = true;
}
}
Err(e) => {
report.errors.push(format!("invalid header: {e}"));
return report;
}
}
// Scan all records
let mut id_counts: HashMap<String, u64> = HashMap::new();
let mut live_ids: std::collections::HashSet<String> = std::collections::HashSet::new();
let scanner = RecordScanner::new(reader, FILE_HEADER_SIZE as u64);
for result in scanner {
match result {
Ok((_offset, record)) => {
report.total_records += 1;
let key = String::from_utf8_lossy(&record.key).to_string();
if record.is_tombstone() {
report.tombstones += 1;
live_ids.remove(&key);
} else {
*id_counts.entry(key.clone()).or_insert(0) += 1;
live_ids.insert(key);
}
}
Err(e) => {
let err_str = e.to_string();
if err_str.contains("checksum") || err_str.contains("Checksum") {
report.checksum_errors += 1;
} else {
report.decode_errors += 1;
}
// Cannot continue scanning after a decode error — the stream position is lost
report.errors.push(format!("record decode error: {e}"));
break;
}
}
}
report.live_documents = live_ids.len() as u64;
// Find duplicates (keys that appeared more than once as live inserts)
for (id, count) in &id_counts {
if *count > 1 {
report.duplicate_ids.push(id.clone());
}
}
report.duplicate_ids.sort();
// Validate hint file if present
if hint_path.exists() {
match KeyDir::load_from_hint_file(&hint_path) {
Ok(Some(hint_kd)) => {
// Check for orphaned entries: keys in hint but not live in data
hint_kd.for_each(|key, _entry| {
if !live_ids.contains(key) {
report.orphaned_hint_entries += 1;
}
});
// Also check if hint references offsets beyond file size
hint_kd.for_each(|_key, entry| {
if entry.offset + entry.record_len as u64 > report.data_file_size {
report.orphaned_hint_entries += 1;
}
});
}
Ok(None) => {
// File existed but was empty or unreadable
report.errors.push("hint file exists but is empty".into());
}
Err(e) => {
report.errors.push(format!("hint file decode error: {e}"));
}
}
}
report
}
+17
View File
@@ -0,0 +1,17 @@
[package]
name = "rustdb-txn"
version.workspace = true
edition.workspace = true
license.workspace = true
authors.workspace = true
description = "MongoDB-compatible transaction and session management with snapshot isolation for RustDb"
[dependencies]
bson = { workspace = true }
dashmap = { workspace = true }
tokio = { workspace = true }
thiserror = { workspace = true }
tracing = { workspace = true }
uuid = { workspace = true }
rustdb-storage = { workspace = true }
async-trait = { workspace = true }
+35
View File
@@ -0,0 +1,35 @@
use thiserror::Error;
/// Errors that can occur during transaction or session operations.
#[derive(Debug, Error)]
pub enum TransactionError {
#[error("not found: {0}")]
NotFound(String),
#[error("transaction already active for session: {0}")]
AlreadyActive(String),
#[error("write conflict detected (code 112): {0}")]
WriteConflict(String),
#[error("session expired: {0}")]
SessionExpired(String),
#[error("invalid transaction state: {0}")]
InvalidState(String),
}
impl TransactionError {
/// Returns the error code.
pub fn code(&self) -> i32 {
match self {
TransactionError::NotFound(_) => 251,
TransactionError::AlreadyActive(_) => 256,
TransactionError::WriteConflict(_) => 112,
TransactionError::SessionExpired(_) => 6100,
TransactionError::InvalidState(_) => 263,
}
}
}
pub type TransactionResult<T> = Result<T, TransactionError>;
+9
View File
@@ -0,0 +1,9 @@
pub mod error;
mod session;
mod transaction;
pub use error::{TransactionError, TransactionResult};
pub use session::{Session, SessionEngine};
pub use transaction::{
TransactionEngine, TransactionState, TransactionStatus, WriteEntry, WriteOp,
};
+205
View File
@@ -0,0 +1,205 @@
use std::time::{Duration, Instant};
use bson::Bson;
use dashmap::DashMap;
use tracing::{debug, warn};
use crate::error::{TransactionError, TransactionResult};
/// Represents a logical session.
#[derive(Debug, Clone)]
pub struct Session {
pub id: String,
pub created_at: Instant,
pub last_activity_at: Instant,
pub txn_id: Option<String>,
pub in_transaction: bool,
}
/// Engine that manages logical sessions with timeout and cleanup.
pub struct SessionEngine {
sessions: DashMap<String, Session>,
timeout: Duration,
_cleanup_interval: Duration,
}
impl SessionEngine {
/// Create a new session engine.
///
/// * `timeout_ms` - Session timeout in milliseconds (default: 30 minutes = 1_800_000).
/// * `cleanup_interval_ms` - How often to run the cleanup task in milliseconds (default: 60_000).
pub fn new(timeout_ms: u64, cleanup_interval_ms: u64) -> Self {
Self {
sessions: DashMap::new(),
timeout: Duration::from_millis(timeout_ms),
_cleanup_interval: Duration::from_millis(cleanup_interval_ms),
}
}
/// Get an existing session or create a new one. Returns the session id.
pub fn get_or_create_session(&self, id: &str) -> String {
if let Some(mut session) = self.sessions.get_mut(id) {
session.last_activity_at = Instant::now();
return session.id.clone();
}
let now = Instant::now();
let session = Session {
id: id.to_string(),
created_at: now,
last_activity_at: now,
txn_id: None,
in_transaction: false,
};
self.sessions.insert(id.to_string(), session);
debug!(session_id = %id, "created new session");
id.to_string()
}
/// Update the last activity timestamp for a session.
pub fn touch_session(&self, id: &str) {
if let Some(mut session) = self.sessions.get_mut(id) {
session.last_activity_at = Instant::now();
}
}
/// End a session. If a transaction is active, it will be marked for abort.
pub fn end_session(&self, id: &str) {
if let Some((_, session)) = self.sessions.remove(id) {
if session.in_transaction {
warn!(
session_id = %id,
txn_id = ?session.txn_id,
"ending session with active transaction, transaction should be aborted"
);
}
debug!(session_id = %id, "session ended");
}
}
/// Associate a transaction with a session.
pub fn start_transaction(&self, session_id: &str, txn_id: &str) -> TransactionResult<()> {
let mut session = self
.sessions
.get_mut(session_id)
.ok_or_else(|| TransactionError::NotFound(format!("session {}", session_id)))?;
if session.in_transaction {
return Err(TransactionError::AlreadyActive(session_id.to_string()));
}
session.txn_id = Some(txn_id.to_string());
session.in_transaction = true;
session.last_activity_at = Instant::now();
Ok(())
}
/// Disassociate the transaction from a session (after commit or abort).
pub fn end_transaction(&self, session_id: &str) {
if let Some(mut session) = self.sessions.get_mut(session_id) {
session.txn_id = None;
session.in_transaction = false;
session.last_activity_at = Instant::now();
}
}
/// Check whether a session is currently in a transaction.
pub fn is_in_transaction(&self, session_id: &str) -> bool {
self.sessions
.get(session_id)
.map(|s| s.in_transaction)
.unwrap_or(false)
}
/// Get the active transaction id for a session, if any.
pub fn get_transaction_id(&self, session_id: &str) -> Option<String> {
self.sessions
.get(session_id)
.and_then(|s| s.txn_id.clone())
}
/// Extract a session id from a BSON `lsid` value.
///
/// Handles the following formats:
/// - `{ "id": UUID }` (standard driver format)
/// - `{ "id": "string" }` (string shorthand)
/// - `{ "id": Binary(base64) }` (binary UUID)
pub fn extract_session_id(lsid: &Bson) -> Option<String> {
match lsid {
Bson::Document(doc) => {
if let Some(id_val) = doc.get("id") {
match id_val {
Bson::Binary(bin) => {
// UUID stored as Binary subtype 4.
let bytes = &bin.bytes;
if bytes.len() == 16 {
let uuid = uuid::Uuid::from_slice(bytes).ok()?;
Some(uuid.to_string())
} else {
// Fall back to base64 representation.
Some(base64_encode(bytes))
}
}
Bson::String(s) => Some(s.clone()),
_ => Some(format!("{}", id_val)),
}
} else {
None
}
}
Bson::String(s) => Some(s.clone()),
_ => None,
}
}
/// Clean up expired sessions. Returns the number of sessions removed.
pub fn cleanup_expired(&self) -> usize {
let now = Instant::now();
let timeout = self.timeout;
let expired: Vec<String> = self
.sessions
.iter()
.filter(|entry| now.duration_since(entry.last_activity_at) > timeout)
.map(|entry| entry.id.clone())
.collect();
let count = expired.len();
for id in &expired {
debug!(session_id = %id, "cleaning up expired session");
self.sessions.remove(id);
}
count
}
}
impl Default for SessionEngine {
fn default() -> Self {
// 30 minutes timeout, 60 seconds cleanup interval.
Self::new(1_800_000, 60_000)
}
}
/// Simple base64 encoding for binary data (no external dependency needed).
fn base64_encode(data: &[u8]) -> String {
const CHARS: &[u8] = b"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/";
let mut result = String::with_capacity((data.len() + 2) / 3 * 4);
for chunk in data.chunks(3) {
let b0 = chunk[0] as u32;
let b1 = if chunk.len() > 1 { chunk[1] as u32 } else { 0 };
let b2 = if chunk.len() > 2 { chunk[2] as u32 } else { 0 };
let triple = (b0 << 16) | (b1 << 8) | b2;
result.push(CHARS[((triple >> 18) & 0x3F) as usize] as char);
result.push(CHARS[((triple >> 12) & 0x3F) as usize] as char);
if chunk.len() > 1 {
result.push(CHARS[((triple >> 6) & 0x3F) as usize] as char);
} else {
result.push('=');
}
if chunk.len() > 2 {
result.push(CHARS[(triple & 0x3F) as usize] as char);
} else {
result.push('=');
}
}
result
}
+279
View File
@@ -0,0 +1,279 @@
use std::collections::{HashMap, HashSet};
use bson::Document;
use dashmap::DashMap;
use tracing::{debug, warn};
use uuid::Uuid;
use rustdb_storage::StorageAdapter;
use crate::error::{TransactionError, TransactionResult};
/// The status of a transaction.
#[derive(Debug, Clone, PartialEq, Eq)]
pub enum TransactionStatus {
Active,
Committed,
Aborted,
}
/// Describes a write operation within a transaction.
#[derive(Debug, Clone, PartialEq, Eq)]
pub enum WriteOp {
Insert,
Update,
Delete,
}
/// A single write entry recorded within a transaction.
#[derive(Debug, Clone)]
pub struct WriteEntry {
pub op: WriteOp,
pub doc: Option<Document>,
pub original_doc: Option<Document>,
}
/// Full state of an in-flight transaction.
#[derive(Debug)]
pub struct TransactionState {
pub id: String,
pub session_id: String,
pub status: TransactionStatus,
/// Tracks which documents were read: namespace -> set of doc ids.
pub read_set: HashMap<String, HashSet<String>>,
/// Tracks writes: namespace -> (doc_id -> WriteEntry).
pub write_set: HashMap<String, HashMap<String, WriteEntry>>,
/// Snapshot of collections at transaction start: namespace -> documents.
pub snapshots: HashMap<String, Vec<Document>>,
}
/// Engine that manages transaction lifecycle and conflict detection.
pub struct TransactionEngine {
transactions: DashMap<String, TransactionState>,
}
impl TransactionEngine {
/// Create a new transaction engine.
pub fn new() -> Self {
Self {
transactions: DashMap::new(),
}
}
/// Start a new transaction for the given session.
/// Returns a unique transaction id (UUID v4).
pub fn start_transaction(&self, session_id: &str) -> TransactionResult<String> {
let txn_id = Uuid::new_v4().to_string();
debug!(txn_id = %txn_id, session_id = %session_id, "starting transaction");
let state = TransactionState {
id: txn_id.clone(),
session_id: session_id.to_string(),
status: TransactionStatus::Active,
read_set: HashMap::new(),
write_set: HashMap::new(),
snapshots: HashMap::new(),
};
self.transactions.insert(txn_id.clone(), state);
Ok(txn_id)
}
/// Commit a transaction: check for conflicts, then apply buffered writes
/// to the underlying storage adapter.
pub async fn commit_transaction(
&self,
txn_id: &str,
storage: &dyn StorageAdapter,
) -> TransactionResult<()> {
// Remove the transaction so we own it exclusively.
let mut state = self
.transactions
.remove(txn_id)
.map(|(_, s)| s)
.ok_or_else(|| TransactionError::NotFound(txn_id.to_string()))?;
if state.status != TransactionStatus::Active {
return Err(TransactionError::InvalidState(format!(
"transaction {} is {:?}, cannot commit",
txn_id, state.status
)));
}
// Conflict detection: check if any documents in the read set have
// been modified since the snapshot was taken.
// (Simplified: we skip real snapshot timestamps for now.)
// Apply buffered writes to storage.
for (ns, writes) in &state.write_set {
let parts: Vec<&str> = ns.splitn(2, '.').collect();
if parts.len() != 2 {
warn!(namespace = %ns, "invalid namespace format, skipping");
continue;
}
let (db, coll) = (parts[0], parts[1]);
for (doc_id, entry) in writes {
match entry.op {
WriteOp::Insert => {
if let Some(ref doc) = entry.doc {
let _ = storage.insert_one(db, coll, doc.clone()).await;
}
}
WriteOp::Update => {
if let Some(ref doc) = entry.doc {
let _ = storage.update_by_id(db, coll, doc_id, doc.clone()).await;
}
}
WriteOp::Delete => {
let _ = storage.delete_by_id(db, coll, doc_id).await;
}
}
}
}
state.status = TransactionStatus::Committed;
debug!(txn_id = %txn_id, "transaction committed");
Ok(())
}
/// Abort a transaction, discarding all buffered writes.
pub fn abort_transaction(&self, txn_id: &str) -> TransactionResult<()> {
let mut state = self
.transactions
.get_mut(txn_id)
.ok_or_else(|| TransactionError::NotFound(txn_id.to_string()))?;
if state.status != TransactionStatus::Active {
return Err(TransactionError::InvalidState(format!(
"transaction {} is {:?}, cannot abort",
txn_id, state.status
)));
}
state.status = TransactionStatus::Aborted;
debug!(txn_id = %txn_id, "transaction aborted");
// Drop the mutable ref before removing.
drop(state);
self.transactions.remove(txn_id);
Ok(())
}
/// Check whether a transaction is currently active.
pub fn is_active(&self, txn_id: &str) -> bool {
self.transactions
.get(txn_id)
.map(|s| s.status == TransactionStatus::Active)
.unwrap_or(false)
}
/// Record a document read within a transaction (for conflict detection).
pub fn record_read(&self, txn_id: &str, ns: &str, doc_id: &str) {
if let Some(mut state) = self.transactions.get_mut(txn_id) {
state
.read_set
.entry(ns.to_string())
.or_default()
.insert(doc_id.to_string());
}
}
/// Record a document write within a transaction (buffered until commit).
pub fn record_write(
&self,
txn_id: &str,
ns: &str,
doc_id: &str,
op: WriteOp,
doc: Option<Document>,
original: Option<Document>,
) {
if let Some(mut state) = self.transactions.get_mut(txn_id) {
let entry = WriteEntry {
op,
doc,
original_doc: original,
};
state
.write_set
.entry(ns.to_string())
.or_default()
.insert(doc_id.to_string(), entry);
}
}
/// Get a snapshot of documents for a namespace within a transaction,
/// applying the write overlay (inserts, updates, deletes) on top.
pub fn get_snapshot(&self, txn_id: &str, ns: &str) -> Option<Vec<Document>> {
let state = self.transactions.get(txn_id)?;
// Start with the base snapshot.
let mut docs: Vec<Document> = state
.snapshots
.get(ns)
.cloned()
.unwrap_or_default();
// Apply write overlay.
if let Some(writes) = state.write_set.get(ns) {
// Collect ids to delete.
let delete_ids: HashSet<&String> = writes
.iter()
.filter(|(_, e)| e.op == WriteOp::Delete)
.map(|(id, _)| id)
.collect();
// Remove deleted docs.
docs.retain(|d| {
if let Some(id) = d.get_object_id("_id").ok().map(|oid| oid.to_hex()) {
!delete_ids.contains(&id)
} else {
true
}
});
// Apply updates.
for (doc_id, entry) in writes {
if entry.op == WriteOp::Update {
if let Some(ref new_doc) = entry.doc {
// Replace existing doc with updated version.
let hex_id = doc_id.clone();
if let Some(pos) = docs.iter().position(|d| {
d.get_object_id("_id")
.ok()
.map(|oid| oid.to_hex()) == Some(hex_id.clone())
}) {
docs[pos] = new_doc.clone();
}
}
}
}
// Apply inserts.
for (_doc_id, entry) in writes {
if entry.op == WriteOp::Insert {
if let Some(ref doc) = entry.doc {
docs.push(doc.clone());
}
}
}
}
Some(docs)
}
/// Store a base snapshot for a namespace within a transaction.
pub fn set_snapshot(&self, txn_id: &str, ns: &str, docs: Vec<Document>) {
if let Some(mut state) = self.transactions.get_mut(txn_id) {
state.snapshots.insert(ns.to_string(), docs);
}
}
}
impl Default for TransactionEngine {
fn default() -> Self {
Self::new()
}
}
+18
View File
@@ -0,0 +1,18 @@
[package]
name = "rustdb-wire"
version.workspace = true
edition.workspace = true
license.workspace = true
authors.workspace = true
description = "MongoDB-compatible wire protocol parser and encoder for RustDb"
[dependencies]
bson = { workspace = true }
bytes = { workspace = true }
tokio-util = { workspace = true }
thiserror = { workspace = true }
tracing = { workspace = true }
crc32fast = { workspace = true }
[dev-dependencies]
tokio = { workspace = true }
+49
View File
@@ -0,0 +1,49 @@
use bytes::{Buf, BytesMut};
use tokio_util::codec::{Decoder, Encoder};
use crate::error::WireError;
use crate::parser::{parse_message, ParsedCommand};
/// Tokio codec for framing wire protocol messages on a TCP stream.
///
/// The wire protocol is naturally length-prefixed:
/// the first 4 bytes of each message contain the total message length.
pub struct WireCodec;
impl Decoder for WireCodec {
type Item = ParsedCommand;
type Error = WireError;
fn decode(&mut self, src: &mut BytesMut) -> Result<Option<Self::Item>, Self::Error> {
if src.len() < 4 {
return Ok(None);
}
// Peek at message length
let msg_len = i32::from_le_bytes([src[0], src[1], src[2], src[3]]) as usize;
if src.len() < msg_len {
// Reserve space for the rest of the message
src.reserve(msg_len - src.len());
return Ok(None);
}
match parse_message(src)? {
Some((cmd, bytes_consumed)) => {
src.advance(bytes_consumed);
Ok(Some(cmd))
}
None => Ok(None),
}
}
}
/// Encoder for raw byte responses (already serialized by the command handlers).
impl Encoder<Vec<u8>> for WireCodec {
type Error = WireError;
fn encode(&mut self, item: Vec<u8>, dst: &mut BytesMut) -> Result<(), Self::Error> {
dst.extend_from_slice(&item);
Ok(())
}
}
+142
View File
@@ -0,0 +1,142 @@
use bson::Document;
use crate::opcodes::*;
/// Encode an OP_MSG response.
pub fn encode_op_msg_response(
response_to: i32,
response: &Document,
request_id: i32,
) -> Vec<u8> {
let body_bson = bson::to_vec(response).expect("failed to serialize BSON response");
// Header (16) + flagBits (4) + section type (1) + body BSON
let message_length = 16 + 4 + 1 + body_bson.len();
let mut buf = Vec::with_capacity(message_length);
// Header
buf.extend_from_slice(&(message_length as i32).to_le_bytes());
buf.extend_from_slice(&request_id.to_le_bytes());
buf.extend_from_slice(&response_to.to_le_bytes());
buf.extend_from_slice(&OP_MSG.to_le_bytes());
// Flag bits (0 = no flags)
buf.extend_from_slice(&0u32.to_le_bytes());
// Section type 0 (body)
buf.push(SECTION_BODY);
// Body BSON
buf.extend_from_slice(&body_bson);
buf
}
/// Encode an OP_REPLY response (legacy, for OP_QUERY responses).
pub fn encode_op_reply_response(
response_to: i32,
documents: &[Document],
request_id: i32,
cursor_id: i64,
) -> Vec<u8> {
let doc_buffers: Vec<Vec<u8>> = documents
.iter()
.map(|doc| bson::to_vec(doc).expect("failed to serialize BSON document"))
.collect();
let total_docs_size: usize = doc_buffers.iter().map(|b| b.len()).sum();
// Header (16) + responseFlags (4) + cursorID (8) + startingFrom (4) + numberReturned (4) + docs
let message_length = 16 + 4 + 8 + 4 + 4 + total_docs_size;
let mut buf = Vec::with_capacity(message_length);
// Header
buf.extend_from_slice(&(message_length as i32).to_le_bytes());
buf.extend_from_slice(&request_id.to_le_bytes());
buf.extend_from_slice(&response_to.to_le_bytes());
buf.extend_from_slice(&OP_REPLY.to_le_bytes());
// OP_REPLY fields
buf.extend_from_slice(&0i32.to_le_bytes()); // responseFlags
buf.extend_from_slice(&cursor_id.to_le_bytes()); // cursorID
buf.extend_from_slice(&0i32.to_le_bytes()); // startingFrom
buf.extend_from_slice(&(documents.len() as i32).to_le_bytes()); // numberReturned
// Documents
for doc_buf in &doc_buffers {
buf.extend_from_slice(doc_buf);
}
buf
}
/// Encode an error response as OP_MSG.
pub fn encode_error_response(
response_to: i32,
error_code: i32,
error_message: &str,
request_id: i32,
) -> Vec<u8> {
let response = bson::doc! {
"ok": 0,
"errmsg": error_message,
"code": error_code,
"codeName": error_code_name(error_code),
};
encode_op_msg_response(response_to, &response, request_id)
}
/// Map error codes to their code names.
pub fn error_code_name(code: i32) -> &'static str {
match code {
0 => "OK",
1 => "InternalError",
2 => "BadValue",
13 => "Unauthorized",
26 => "NamespaceNotFound",
27 => "IndexNotFound",
48 => "NamespaceExists",
59 => "CommandNotFound",
66 => "ImmutableField",
73 => "InvalidNamespace",
85 => "IndexOptionsConflict",
112 => "WriteConflict",
121 => "DocumentValidationFailure",
211 => "KeyNotFound",
251 => "NoSuchTransaction",
11000 => "DuplicateKey",
11001 => "DuplicateKeyValue",
_ => "UnknownError",
}
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn test_encode_op_msg_roundtrip() {
let doc = bson::doc! { "ok": 1 };
let encoded = encode_op_msg_response(1, &doc, 2);
// Verify header
let msg_len = i32::from_le_bytes([encoded[0], encoded[1], encoded[2], encoded[3]]);
assert_eq!(msg_len as usize, encoded.len());
let op_code = i32::from_le_bytes([encoded[12], encoded[13], encoded[14], encoded[15]]);
assert_eq!(op_code, OP_MSG);
}
#[test]
fn test_encode_op_reply() {
let docs = vec![bson::doc! { "ok": 1 }];
let encoded = encode_op_reply_response(1, &docs, 2, 0);
let msg_len = i32::from_le_bytes([encoded[0], encoded[1], encoded[2], encoded[3]]);
assert_eq!(msg_len as usize, encoded.len());
let op_code = i32::from_le_bytes([encoded[12], encoded[13], encoded[14], encoded[15]]);
assert_eq!(op_code, OP_REPLY);
}
}
+27
View File
@@ -0,0 +1,27 @@
/// Errors from wire protocol parsing/encoding.
#[derive(Debug, thiserror::Error)]
pub enum WireError {
#[error("Incomplete message: need {needed} bytes, have {have}")]
Incomplete { needed: usize, have: usize },
#[error("Unsupported opCode: {0}")]
UnsupportedOpCode(i32),
#[error("Missing command body section in OP_MSG")]
MissingBody,
#[error("Unknown section type: {0}")]
UnknownSectionType(u8),
#[error("BSON deserialization error: {0}")]
BsonError(#[from] bson::de::Error),
#[error("BSON serialization error: {0}")]
BsonSerError(#[from] bson::ser::Error),
#[error("IO error: {0}")]
IoError(#[from] std::io::Error),
#[error("Checksum mismatch: expected {expected}, got {actual}")]
ChecksumMismatch { expected: u32, actual: u32 },
}
+11
View File
@@ -0,0 +1,11 @@
mod codec;
mod error;
mod opcodes;
mod parser;
mod encoder;
pub use codec::WireCodec;
pub use error::WireError;
pub use opcodes::*;
pub use parser::*;
pub use encoder::*;
+19
View File
@@ -0,0 +1,19 @@
/// Wire protocol op codes
pub const OP_REPLY: i32 = 1;
pub const OP_UPDATE: i32 = 2001;
pub const OP_INSERT: i32 = 2002;
pub const OP_QUERY: i32 = 2004;
pub const OP_GET_MORE: i32 = 2005;
pub const OP_DELETE: i32 = 2006;
pub const OP_KILL_CURSORS: i32 = 2007;
pub const OP_COMPRESSED: i32 = 2012;
pub const OP_MSG: i32 = 2013;
/// OP_MSG section types
pub const SECTION_BODY: u8 = 0;
pub const SECTION_DOCUMENT_SEQUENCE: u8 = 1;
/// OP_MSG flag bits
pub const MSG_FLAG_CHECKSUM_PRESENT: u32 = 1 << 0;
pub const MSG_FLAG_MORE_TO_COME: u32 = 1 << 1;
pub const MSG_FLAG_EXHAUST_ALLOWED: u32 = 1 << 16;
+236
View File
@@ -0,0 +1,236 @@
use bson::Document;
use std::collections::HashMap;
use crate::error::WireError;
use crate::opcodes::*;
/// Parsed wire protocol message header (16 bytes).
#[derive(Debug, Clone)]
pub struct MessageHeader {
pub message_length: i32,
pub request_id: i32,
pub response_to: i32,
pub op_code: i32,
}
/// A parsed OP_MSG section.
#[derive(Debug, Clone)]
pub enum OpMsgSection {
/// Section type 0: single BSON document body.
Body(Document),
/// Section type 1: named document sequence for bulk operations.
DocumentSequence {
identifier: String,
documents: Vec<Document>,
},
}
/// A fully parsed command extracted from any message type.
#[derive(Debug, Clone)]
pub struct ParsedCommand {
pub command_name: String,
pub command: Document,
pub database: String,
pub request_id: i32,
pub op_code: i32,
/// Document sequences from OP_MSG section type 1 (e.g., "documents" for insert).
pub document_sequences: Option<HashMap<String, Vec<Document>>>,
}
/// Parse a message header from a byte slice (must be >= 16 bytes).
pub fn parse_header(buf: &[u8]) -> MessageHeader {
MessageHeader {
message_length: i32::from_le_bytes([buf[0], buf[1], buf[2], buf[3]]),
request_id: i32::from_le_bytes([buf[4], buf[5], buf[6], buf[7]]),
response_to: i32::from_le_bytes([buf[8], buf[9], buf[10], buf[11]]),
op_code: i32::from_le_bytes([buf[12], buf[13], buf[14], buf[15]]),
}
}
/// Parse a complete message from a buffer.
/// Returns the parsed command and bytes consumed, or None if not enough data.
pub fn parse_message(buf: &[u8]) -> Result<Option<(ParsedCommand, usize)>, WireError> {
if buf.len() < 16 {
return Ok(None);
}
let header = parse_header(buf);
let msg_len = header.message_length as usize;
if buf.len() < msg_len {
return Ok(None);
}
let message_buf = &buf[..msg_len];
match header.op_code {
OP_MSG => parse_op_msg(message_buf, &header).map(|cmd| Some((cmd, msg_len))),
OP_QUERY => parse_op_query(message_buf, &header).map(|cmd| Some((cmd, msg_len))),
other => Err(WireError::UnsupportedOpCode(other)),
}
}
/// Parse an OP_MSG message.
fn parse_op_msg(buf: &[u8], header: &MessageHeader) -> Result<ParsedCommand, WireError> {
let mut offset = 16; // skip header
let flag_bits = u32::from_le_bytes([buf[offset], buf[offset + 1], buf[offset + 2], buf[offset + 3]]);
offset += 4;
let mut body: Option<Document> = None;
let mut document_sequences: HashMap<String, Vec<Document>> = HashMap::new();
// Parse sections until end (or checksum)
let message_end = if flag_bits & MSG_FLAG_CHECKSUM_PRESENT != 0 {
header.message_length as usize - 4
} else {
header.message_length as usize
};
while offset < message_end {
let section_type = buf[offset];
offset += 1;
match section_type {
SECTION_BODY => {
let doc_size = i32::from_le_bytes([
buf[offset], buf[offset + 1], buf[offset + 2], buf[offset + 3],
]) as usize;
let doc = bson::from_slice(&buf[offset..offset + doc_size])?;
body = Some(doc);
offset += doc_size;
}
SECTION_DOCUMENT_SEQUENCE => {
let section_size = i32::from_le_bytes([
buf[offset], buf[offset + 1], buf[offset + 2], buf[offset + 3],
]) as usize;
let section_end = offset + section_size;
offset += 4;
// Read identifier (C string, null-terminated)
let id_start = offset;
while offset < section_end && buf[offset] != 0 {
offset += 1;
}
let identifier = std::str::from_utf8(&buf[id_start..offset])
.unwrap_or("")
.to_string();
offset += 1; // skip null terminator
// Read documents
let mut documents = Vec::new();
while offset < section_end {
let doc_size = i32::from_le_bytes([
buf[offset], buf[offset + 1], buf[offset + 2], buf[offset + 3],
]) as usize;
let doc = bson::from_slice(&buf[offset..offset + doc_size])?;
documents.push(doc);
offset += doc_size;
}
document_sequences.insert(identifier, documents);
}
other => return Err(WireError::UnknownSectionType(other)),
}
}
let command = body.ok_or(WireError::MissingBody)?;
let command_name = command
.keys()
.next()
.map(|s| s.to_string())
.unwrap_or_default();
let database = command
.get_str("$db")
.unwrap_or("admin")
.to_string();
Ok(ParsedCommand {
command_name,
command,
database,
request_id: header.request_id,
op_code: header.op_code,
document_sequences: if document_sequences.is_empty() {
None
} else {
Some(document_sequences)
},
})
}
/// Parse an OP_QUERY message (legacy, used for initial driver handshake).
fn parse_op_query(buf: &[u8], header: &MessageHeader) -> Result<ParsedCommand, WireError> {
let mut offset = 16; // skip header
let _flags = i32::from_le_bytes([buf[offset], buf[offset + 1], buf[offset + 2], buf[offset + 3]]);
offset += 4;
// Read full collection name (C string)
let name_start = offset;
while offset < buf.len() && buf[offset] != 0 {
offset += 1;
}
let full_collection_name = std::str::from_utf8(&buf[name_start..offset])
.unwrap_or("")
.to_string();
offset += 1; // skip null terminator
let _number_to_skip = i32::from_le_bytes([buf[offset], buf[offset + 1], buf[offset + 2], buf[offset + 3]]);
offset += 4;
let _number_to_return = i32::from_le_bytes([buf[offset], buf[offset + 1], buf[offset + 2], buf[offset + 3]]);
offset += 4;
// Read query document
let doc_size = i32::from_le_bytes([buf[offset], buf[offset + 1], buf[offset + 2], buf[offset + 3]]) as usize;
let query: Document = bson::from_slice(&buf[offset..offset + doc_size])?;
// Extract database from collection name (format: "dbname.$cmd")
let parts: Vec<&str> = full_collection_name.splitn(2, '.').collect();
let database = parts.first().unwrap_or(&"admin").to_string();
let mut command_name = query
.keys()
.next()
.map(|s| s.to_string())
.unwrap_or_else(|| "find".to_string());
// Map legacy isMaster/ismaster to hello
if parts.get(1) == Some(&"$cmd") {
if command_name == "isMaster" || command_name == "ismaster" {
command_name = "hello".to_string();
}
} else {
command_name = "find".to_string();
}
Ok(ParsedCommand {
command_name,
command: query,
database,
request_id: header.request_id,
op_code: header.op_code,
document_sequences: None,
})
}
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn test_parse_header() {
let mut buf = [0u8; 16];
buf[0..4].copy_from_slice(&100i32.to_le_bytes()); // messageLength
buf[4..8].copy_from_slice(&42i32.to_le_bytes()); // requestID
buf[8..12].copy_from_slice(&0i32.to_le_bytes()); // responseTo
buf[12..16].copy_from_slice(&OP_MSG.to_le_bytes()); // opCode
let header = parse_header(&buf);
assert_eq!(header.message_length, 100);
assert_eq!(header.request_id, 42);
assert_eq!(header.response_to, 0);
assert_eq!(header.op_code, OP_MSG);
}
}
+38
View File
@@ -0,0 +1,38 @@
[package]
name = "rustdb"
version.workspace = true
edition.workspace = true
license.workspace = true
authors.workspace = true
description = "MongoDB-compatible embedded database server with wire protocol support"
[[bin]]
name = "rustdb"
path = "src/main.rs"
[lib]
name = "rustdb"
path = "src/lib.rs"
[dependencies]
rustdb-config = { workspace = true }
rustdb-wire = { workspace = true }
rustdb-query = { workspace = true }
rustdb-storage = { workspace = true }
rustdb-index = { workspace = true }
rustdb-txn = { workspace = true }
rustdb-commands = { workspace = true }
tokio = { workspace = true }
tokio-util = { workspace = true }
tracing = { workspace = true }
tracing-subscriber = { workspace = true }
clap = { workspace = true }
anyhow = { workspace = true }
arc-swap = { workspace = true }
serde = { workspace = true }
serde_json = { workspace = true }
bson = { workspace = true }
bytes = { workspace = true }
dashmap = { workspace = true }
mimalloc = { workspace = true }
futures-util = { version = "0.3", features = ["sink"] }
+320
View File
@@ -0,0 +1,320 @@
pub mod management;
use std::path::PathBuf;
use std::sync::Arc;
use std::time::Duration;
use anyhow::Result;
use dashmap::DashMap;
use tokio::net::TcpListener;
#[cfg(unix)]
use tokio::net::UnixListener;
use tokio_util::codec::Framed;
use tokio_util::sync::CancellationToken;
use rustdb_config::{RustDbOptions, StorageType};
use rustdb_wire::{WireCodec, OP_QUERY};
use rustdb_wire::{encode_op_msg_response, encode_op_reply_response};
use rustdb_storage::{StorageAdapter, MemoryStorageAdapter, FileStorageAdapter, OpLog};
use rustdb_index::{IndexEngine, IndexOptions};
use rustdb_txn::{TransactionEngine, SessionEngine};
use rustdb_commands::{CommandRouter, CommandContext};
/// The main RustDb server.
pub struct RustDb {
options: RustDbOptions,
ctx: Arc<CommandContext>,
router: Arc<CommandRouter>,
cancel_token: CancellationToken,
listener_handle: Option<tokio::task::JoinHandle<()>>,
}
impl RustDb {
/// Create a new RustDb server with the given options.
pub async fn new(options: RustDbOptions) -> Result<Self> {
// Create storage adapter
let storage: Arc<dyn StorageAdapter> = match options.storage {
StorageType::Memory => {
let adapter = if let Some(ref pp) = options.persist_path {
tracing::info!("MemoryStorageAdapter with periodic persistence to {}", pp);
MemoryStorageAdapter::with_persist_path(PathBuf::from(pp))
} else {
tracing::warn!(
"SmartDB is using in-memory storage — data will NOT survive a restart. \
Set storage to 'file' for durable persistence."
);
MemoryStorageAdapter::new()
};
Arc::new(adapter)
}
StorageType::File => {
let path = options
.storage_path
.clone()
.unwrap_or_else(|| "./data".to_string());
let adapter = FileStorageAdapter::new(&path);
Arc::new(adapter)
}
};
// Initialize storage
storage.initialize().await?;
// Restore any previously persisted state (no-op for file storage and
// memory storage without a persist_path).
storage.restore().await?;
// Spawn periodic persistence task for memory storage with persist_path.
if options.storage == StorageType::Memory && options.persist_path.is_some() {
let persist_storage = storage.clone();
let interval_ms = options.persist_interval_ms;
tokio::spawn(async move {
let mut interval = tokio::time::interval(Duration::from_millis(interval_ms));
interval.tick().await; // skip the immediate first tick
loop {
interval.tick().await;
if let Err(e) = persist_storage.persist().await {
tracing::error!("Periodic persist failed: {}", e);
}
}
});
}
let indexes: Arc<DashMap<String, IndexEngine>> = Arc::new(DashMap::new());
// Restore persisted indexes from storage.
if let Ok(databases) = storage.list_databases().await {
for db_name in &databases {
if let Ok(collections) = storage.list_collections(db_name).await {
for coll_name in &collections {
if let Ok(specs) = storage.get_indexes(db_name, coll_name).await {
let has_custom = specs.iter().any(|s| {
s.get_str("name").unwrap_or("_id_") != "_id_"
});
if !has_custom {
continue;
}
let ns_key = format!("{}.{}", db_name, coll_name);
let mut engine = IndexEngine::new();
for spec in &specs {
let name = spec.get_str("name").unwrap_or("").to_string();
if name == "_id_" {
continue; // already created by IndexEngine::new()
}
let key = match spec.get("key") {
Some(bson::Bson::Document(k)) => k.clone(),
_ => continue,
};
let unique = matches!(spec.get("unique"), Some(bson::Bson::Boolean(true)));
let sparse = matches!(spec.get("sparse"), Some(bson::Bson::Boolean(true)));
let expire_after_seconds = match spec.get("expireAfterSeconds") {
Some(bson::Bson::Int32(n)) => Some(*n as u64),
Some(bson::Bson::Int64(n)) => Some(*n as u64),
_ => None,
};
let options = IndexOptions {
name: Some(name.clone()),
unique,
sparse,
expire_after_seconds,
};
if let Err(e) = engine.create_index(key, options) {
tracing::warn!(
namespace = %ns_key,
index = %name,
error = %e,
"failed to restore index"
);
}
}
// Rebuild index data from existing documents.
if let Ok(docs) = storage.find_all(db_name, coll_name).await {
if !docs.is_empty() {
engine.rebuild_from_documents(&docs);
}
}
tracing::info!(
namespace = %ns_key,
indexes = engine.list_indexes().len(),
"restored indexes"
);
indexes.insert(ns_key, engine);
}
}
}
}
}
let ctx = Arc::new(CommandContext {
storage,
indexes,
transactions: Arc::new(TransactionEngine::new()),
sessions: Arc::new(SessionEngine::new(30 * 60 * 1000, 60 * 1000)),
cursors: Arc::new(DashMap::new()),
start_time: std::time::Instant::now(),
oplog: Arc::new(OpLog::new()),
});
let router = Arc::new(CommandRouter::new(ctx.clone()));
Ok(Self {
options,
ctx,
router,
cancel_token: CancellationToken::new(),
listener_handle: None,
})
}
/// Start listening for connections.
pub async fn start(&mut self) -> Result<()> {
let cancel = self.cancel_token.clone();
let router = self.router.clone();
if let Some(ref socket_path) = self.options.socket_path {
#[cfg(unix)]
{
// Remove stale socket file
let _ = tokio::fs::remove_file(socket_path).await;
let listener = UnixListener::bind(socket_path)?;
let socket_path_clone = socket_path.clone();
tracing::info!("RustDb listening on unix:{}", socket_path_clone);
let handle = tokio::spawn(async move {
loop {
tokio::select! {
_ = cancel.cancelled() => break,
result = listener.accept() => {
match result {
Ok((stream, _addr)) => {
let router = router.clone();
tokio::spawn(async move {
handle_connection(stream, router).await;
});
}
Err(e) => {
tracing::error!("Accept error: {}", e);
}
}
}
}
}
});
self.listener_handle = Some(handle);
}
#[cfg(not(unix))]
{
anyhow::bail!("Unix sockets are not supported on this platform");
}
} else {
let addr = format!("{}:{}", self.options.host, self.options.port);
let listener = TcpListener::bind(&addr).await?;
tracing::info!("RustDb listening on {}", addr);
let handle = tokio::spawn(async move {
loop {
tokio::select! {
_ = cancel.cancelled() => break,
result = listener.accept() => {
match result {
Ok((stream, _addr)) => {
let _ = stream.set_nodelay(true);
let router = router.clone();
tokio::spawn(async move {
handle_connection(stream, router).await;
});
}
Err(e) => {
tracing::error!("Accept error: {}", e);
}
}
}
}
}
});
self.listener_handle = Some(handle);
}
Ok(())
}
/// Stop the server.
pub async fn stop(&mut self) -> Result<()> {
self.cancel_token.cancel();
if let Some(handle) = self.listener_handle.take() {
handle.abort();
let _ = handle.await;
}
// Close storage (persists if configured)
self.ctx.storage.close().await?;
// Clean up Unix socket file
if let Some(ref socket_path) = self.options.socket_path {
let _ = tokio::fs::remove_file(socket_path).await;
}
Ok(())
}
/// Get the connection URI.
pub fn connection_uri(&self) -> String {
self.options.connection_uri()
}
/// Get a reference to the shared command context (for management IPC access to oplog, storage, etc.).
pub fn ctx(&self) -> &Arc<CommandContext> {
&self.ctx
}
}
/// Handle a single client connection using the wire protocol codec.
async fn handle_connection<S>(stream: S, router: Arc<CommandRouter>)
where
S: tokio::io::AsyncRead + tokio::io::AsyncWrite + Unpin,
{
use futures_util::{SinkExt, StreamExt};
let mut framed = Framed::new(stream, WireCodec);
while let Some(result) = framed.next().await {
match result {
Ok(parsed_cmd) => {
let request_id = parsed_cmd.request_id;
let op_code = parsed_cmd.op_code;
let response_doc = router.route(&parsed_cmd).await;
let response_id = next_request_id();
let response_bytes = if op_code == OP_QUERY {
encode_op_reply_response(request_id, &[response_doc], response_id, 0)
} else {
encode_op_msg_response(request_id, &response_doc, response_id)
};
if let Err(e) = framed.send(response_bytes).await {
tracing::debug!("Failed to send response: {}", e);
break;
}
}
Err(e) => {
tracing::debug!("Wire protocol error: {}", e);
break;
}
}
}
}
fn next_request_id() -> i32 {
use std::sync::atomic::{AtomicI32, Ordering};
static COUNTER: AtomicI32 = AtomicI32::new(1);
COUNTER.fetch_add(1, Ordering::Relaxed)
}
+101
View File
@@ -0,0 +1,101 @@
#[global_allocator]
static GLOBAL: mimalloc::MiMalloc = mimalloc::MiMalloc;
use clap::Parser;
use tracing_subscriber::EnvFilter;
use anyhow::Result;
use rustdb::RustDb;
use rustdb::management;
use rustdb_config::RustDbOptions;
/// RustDb - MongoDB-compatible embedded database server
#[derive(Parser, Debug)]
#[command(name = "rustdb", version, about)]
struct Cli {
/// Path to JSON configuration file
#[arg(short, long, default_value = "config.json")]
config: String,
/// Log level (trace, debug, info, warn, error)
#[arg(short, long, default_value = "info")]
log_level: String,
/// Validate configuration without starting
#[arg(long)]
validate: bool,
/// Validate data integrity of a storage directory (offline check)
#[arg(long, value_name = "PATH")]
validate_data: Option<String>,
/// Run in management mode (JSON-over-stdin IPC for TypeScript wrapper)
#[arg(long)]
management: bool,
}
#[tokio::main]
async fn main() -> Result<()> {
let cli = Cli::parse();
// Initialize tracing - write to stderr so stdout is reserved for management IPC
tracing_subscriber::fmt()
.with_writer(std::io::stderr)
.with_env_filter(
EnvFilter::try_from_default_env()
.unwrap_or_else(|_| EnvFilter::new(&cli.log_level)),
)
.init();
// Management mode: JSON IPC over stdin/stdout
if cli.management {
tracing::info!("RustDb starting in management mode...");
return management::management_loop().await;
}
tracing::info!("RustDb starting...");
// Load configuration
let options = RustDbOptions::from_file(&cli.config)
.map_err(|e| anyhow::anyhow!("Failed to load config '{}': {}", cli.config, e))?;
// Validate-only mode (config)
if cli.validate {
match options.validate() {
Ok(()) => {
tracing::info!("Configuration is valid");
return Ok(());
}
Err(e) => {
tracing::error!("Validation error: {}", e);
anyhow::bail!("Configuration validation failed: {}", e);
}
}
}
// Validate data integrity mode
if let Some(ref data_path) = cli.validate_data {
tracing::info!("Validating data integrity at {}", data_path);
let report = rustdb_storage::validate::validate_data_directory(data_path)
.map_err(|e| anyhow::anyhow!("Validation failed: {}", e))?;
report.print_summary();
if report.has_errors() {
std::process::exit(1);
}
return Ok(());
}
// Create and start server
let mut db = RustDb::new(options).await?;
db.start().await?;
// Wait for shutdown signal
tracing::info!("RustDb is running. Press Ctrl+C to stop.");
tokio::signal::ctrl_c().await?;
tracing::info!("Shutdown signal received");
db.stop().await?;
tracing::info!("RustDb shutdown complete");
Ok(())
}
+560
View File
@@ -0,0 +1,560 @@
use anyhow::Result;
use serde::{Deserialize, Serialize};
use tokio::io::{AsyncBufReadExt, BufReader};
use tracing::{info, error};
use crate::RustDb;
use rustdb_config::RustDbOptions;
/// A management request from the TypeScript wrapper.
#[derive(Debug, Deserialize)]
pub struct ManagementRequest {
pub id: String,
pub method: String,
#[serde(default)]
pub params: serde_json::Value,
}
/// A management response back to the TypeScript wrapper.
#[derive(Debug, Serialize)]
pub struct ManagementResponse {
pub id: String,
pub success: bool,
#[serde(skip_serializing_if = "Option::is_none")]
pub result: Option<serde_json::Value>,
#[serde(skip_serializing_if = "Option::is_none")]
pub error: Option<String>,
}
/// An unsolicited event from the server to the TypeScript wrapper.
#[derive(Debug, Serialize)]
pub struct ManagementEvent {
pub event: String,
pub data: serde_json::Value,
}
impl ManagementResponse {
fn ok(id: String, result: serde_json::Value) -> Self {
Self {
id,
success: true,
result: Some(result),
error: None,
}
}
fn err(id: String, message: String) -> Self {
Self {
id,
success: false,
result: None,
error: Some(message),
}
}
}
fn send_line(line: &str) {
use std::io::Write;
let stdout = std::io::stdout();
let mut handle = stdout.lock();
let _ = handle.write_all(line.as_bytes());
let _ = handle.write_all(b"\n");
let _ = handle.flush();
}
fn send_response(response: &ManagementResponse) {
match serde_json::to_string(response) {
Ok(json) => send_line(&json),
Err(e) => error!("Failed to serialize management response: {}", e),
}
}
fn send_event(event: &str, data: serde_json::Value) {
let evt = ManagementEvent {
event: event.to_string(),
data,
};
match serde_json::to_string(&evt) {
Ok(json) => send_line(&json),
Err(e) => error!("Failed to serialize management event: {}", e),
}
}
/// Run the management loop, reading JSON commands from stdin and writing responses to stdout.
pub async fn management_loop() -> Result<()> {
let stdin = BufReader::new(tokio::io::stdin());
let mut lines = stdin.lines();
let mut db: Option<RustDb> = None;
send_event("ready", serde_json::json!({}));
loop {
let line = match lines.next_line().await {
Ok(Some(line)) => line,
Ok(None) => {
// stdin closed - parent process exited
info!("Management stdin closed, shutting down");
if let Some(ref mut d) = db {
let _ = d.stop().await;
}
break;
}
Err(e) => {
error!("Error reading management stdin: {}", e);
break;
}
};
let line = line.trim().to_string();
if line.is_empty() {
continue;
}
let request: ManagementRequest = match serde_json::from_str(&line) {
Ok(r) => r,
Err(e) => {
error!("Failed to parse management request: {}", e);
send_response(&ManagementResponse::err(
"unknown".to_string(),
format!("Failed to parse request: {}", e),
));
continue;
}
};
let response = handle_request(&request, &mut db).await;
send_response(&response);
}
Ok(())
}
async fn handle_request(
request: &ManagementRequest,
db: &mut Option<RustDb>,
) -> ManagementResponse {
let id = request.id.clone();
match request.method.as_str() {
"start" => handle_start(&id, &request.params, db).await,
"stop" => handle_stop(&id, db).await,
"getStatus" => handle_get_status(&id, db),
"getMetrics" => handle_get_metrics(&id, db).await,
"getOpLog" => handle_get_oplog(&id, &request.params, db),
"getOpLogStats" => handle_get_oplog_stats(&id, db),
"revertToSeq" => handle_revert_to_seq(&id, &request.params, db).await,
"getCollections" => handle_get_collections(&id, &request.params, db).await,
"getDocuments" => handle_get_documents(&id, &request.params, db).await,
_ => ManagementResponse::err(id, format!("Unknown method: {}", request.method)),
}
}
async fn handle_start(
id: &str,
params: &serde_json::Value,
db: &mut Option<RustDb>,
) -> ManagementResponse {
if db.is_some() {
return ManagementResponse::err(id.to_string(), "Server is already running".to_string());
}
let config = match params.get("config") {
Some(config) => config,
None => return ManagementResponse::err(id.to_string(), "Missing 'config' parameter".to_string()),
};
let options: RustDbOptions = match serde_json::from_value(config.clone()) {
Ok(o) => o,
Err(e) => return ManagementResponse::err(id.to_string(), format!("Invalid config: {}", e)),
};
let connection_uri = options.connection_uri();
match RustDb::new(options).await {
Ok(mut d) => {
match d.start().await {
Ok(()) => {
send_event("started", serde_json::json!({}));
*db = Some(d);
ManagementResponse::ok(
id.to_string(),
serde_json::json!({ "connectionUri": connection_uri }),
)
}
Err(e) => {
send_event("error", serde_json::json!({"message": format!("{}", e)}));
ManagementResponse::err(id.to_string(), format!("Failed to start: {}", e))
}
}
}
Err(e) => ManagementResponse::err(id.to_string(), format!("Failed to create server: {}", e)),
}
}
async fn handle_stop(
id: &str,
db: &mut Option<RustDb>,
) -> ManagementResponse {
match db.as_mut() {
Some(d) => {
match d.stop().await {
Ok(()) => {
*db = None;
send_event("stopped", serde_json::json!({}));
ManagementResponse::ok(id.to_string(), serde_json::json!({}))
}
Err(e) => ManagementResponse::err(id.to_string(), format!("Failed to stop: {}", e)),
}
}
None => ManagementResponse::ok(id.to_string(), serde_json::json!({})),
}
}
fn handle_get_status(
id: &str,
db: &Option<RustDb>,
) -> ManagementResponse {
match db.as_ref() {
Some(_d) => ManagementResponse::ok(
id.to_string(),
serde_json::json!({
"running": true,
}),
),
None => ManagementResponse::ok(
id.to_string(),
serde_json::json!({ "running": false }),
),
}
}
async fn handle_get_metrics(
id: &str,
db: &Option<RustDb>,
) -> ManagementResponse {
match db.as_ref() {
Some(d) => {
let ctx = d.ctx();
let db_list = ctx.storage.list_databases().await.unwrap_or_default();
let mut total_collections = 0u64;
for db_name in &db_list {
if let Ok(colls) = ctx.storage.list_collections(db_name).await {
total_collections += colls.len() as u64;
}
}
let oplog_stats = ctx.oplog.stats();
let uptime_secs = ctx.start_time.elapsed().as_secs();
ManagementResponse::ok(
id.to_string(),
serde_json::json!({
"databases": db_list.len(),
"collections": total_collections,
"oplogEntries": oplog_stats.total_entries,
"oplogCurrentSeq": oplog_stats.current_seq,
"uptimeSeconds": uptime_secs,
}),
)
}
None => ManagementResponse::err(id.to_string(), "Server is not running".to_string()),
}
}
fn handle_get_oplog(
id: &str,
params: &serde_json::Value,
db: &Option<RustDb>,
) -> ManagementResponse {
let d = match db.as_ref() {
Some(d) => d,
None => return ManagementResponse::err(id.to_string(), "Server is not running".to_string()),
};
let ctx = d.ctx();
let since_seq = params.get("sinceSeq").and_then(|v| v.as_u64()).unwrap_or(1);
let limit = params.get("limit").and_then(|v| v.as_u64()).unwrap_or(100) as usize;
let filter_db = params.get("db").and_then(|v| v.as_str());
let filter_coll = params.get("collection").and_then(|v| v.as_str());
let mut entries = ctx.oplog.entries_since(since_seq);
// Apply filters.
if let Some(fdb) = filter_db {
entries.retain(|e| e.db == fdb);
}
if let Some(fcoll) = filter_coll {
entries.retain(|e| e.collection == fcoll);
}
let total = entries.len();
entries.truncate(limit);
// Serialize entries to JSON.
let entries_json: Vec<serde_json::Value> = entries
.iter()
.map(|e| {
let doc_json = e.document.as_ref().map(|d| bson_doc_to_json(d));
let prev_json = e.previous_document.as_ref().map(|d| bson_doc_to_json(d));
serde_json::json!({
"seq": e.seq,
"timestampMs": e.timestamp_ms,
"op": match e.op {
rustdb_storage::OpType::Insert => "insert",
rustdb_storage::OpType::Update => "update",
rustdb_storage::OpType::Delete => "delete",
},
"db": e.db,
"collection": e.collection,
"documentId": e.document_id,
"document": doc_json,
"previousDocument": prev_json,
})
})
.collect();
ManagementResponse::ok(
id.to_string(),
serde_json::json!({
"entries": entries_json,
"currentSeq": ctx.oplog.current_seq(),
"totalEntries": total,
}),
)
}
fn handle_get_oplog_stats(
id: &str,
db: &Option<RustDb>,
) -> ManagementResponse {
let d = match db.as_ref() {
Some(d) => d,
None => return ManagementResponse::err(id.to_string(), "Server is not running".to_string()),
};
let stats = d.ctx().oplog.stats();
ManagementResponse::ok(
id.to_string(),
serde_json::json!({
"currentSeq": stats.current_seq,
"totalEntries": stats.total_entries,
"oldestSeq": stats.oldest_seq,
"entriesByOp": {
"insert": stats.inserts,
"update": stats.updates,
"delete": stats.deletes,
},
}),
)
}
async fn handle_revert_to_seq(
id: &str,
params: &serde_json::Value,
db: &Option<RustDb>,
) -> ManagementResponse {
let d = match db.as_ref() {
Some(d) => d,
None => return ManagementResponse::err(id.to_string(), "Server is not running".to_string()),
};
let target_seq = match params.get("seq").and_then(|v| v.as_u64()) {
Some(s) => s,
None => return ManagementResponse::err(id.to_string(), "Missing 'seq' parameter".to_string()),
};
let dry_run = params.get("dryRun").and_then(|v| v.as_bool()).unwrap_or(false);
let ctx = d.ctx();
let current = ctx.oplog.current_seq();
if target_seq > current {
return ManagementResponse::err(
id.to_string(),
format!("Target seq {} is beyond current seq {}", target_seq, current),
);
}
// Collect entries to revert (from target+1 to current), sorted descending for reverse processing.
let mut entries_to_revert = ctx.oplog.entries_range(target_seq + 1, current);
entries_to_revert.reverse();
if dry_run {
let entries_json: Vec<serde_json::Value> = entries_to_revert
.iter()
.map(|e| {
serde_json::json!({
"seq": e.seq,
"op": match e.op {
rustdb_storage::OpType::Insert => "insert",
rustdb_storage::OpType::Update => "update",
rustdb_storage::OpType::Delete => "delete",
},
"db": e.db,
"collection": e.collection,
"documentId": e.document_id,
})
})
.collect();
return ManagementResponse::ok(
id.to_string(),
serde_json::json!({
"dryRun": true,
"reverted": entries_to_revert.len(),
"entries": entries_json,
}),
);
}
// Execute revert: process each entry in reverse, using storage directly.
let mut reverted = 0u64;
let mut errors: Vec<String> = Vec::new();
for entry in &entries_to_revert {
let result = match entry.op {
rustdb_storage::OpType::Insert => {
// Undo insert -> delete the document.
ctx.storage.delete_by_id(&entry.db, &entry.collection, &entry.document_id).await
}
rustdb_storage::OpType::Update => {
// Undo update -> restore the previous document.
if let Some(ref prev_doc) = entry.previous_document {
ctx.storage
.update_by_id(&entry.db, &entry.collection, &entry.document_id, prev_doc.clone())
.await
} else {
errors.push(format!("seq {}: update entry missing previous_document", entry.seq));
continue;
}
}
rustdb_storage::OpType::Delete => {
// Undo delete -> re-insert the previous document.
if let Some(ref prev_doc) = entry.previous_document {
ctx.storage
.insert_one(&entry.db, &entry.collection, prev_doc.clone())
.await
.map(|_| ())
} else {
errors.push(format!("seq {}: delete entry missing previous_document", entry.seq));
continue;
}
}
};
match result {
Ok(()) => reverted += 1,
Err(e) => errors.push(format!("seq {}: {}", entry.seq, e)),
}
}
// Truncate the oplog to the target sequence.
ctx.oplog.truncate_after(target_seq);
let mut response = serde_json::json!({
"dryRun": false,
"reverted": reverted,
"targetSeq": target_seq,
});
if !errors.is_empty() {
response["errors"] = serde_json::json!(errors);
}
ManagementResponse::ok(id.to_string(), response)
}
async fn handle_get_collections(
id: &str,
params: &serde_json::Value,
db: &Option<RustDb>,
) -> ManagementResponse {
let d = match db.as_ref() {
Some(d) => d,
None => return ManagementResponse::err(id.to_string(), "Server is not running".to_string()),
};
let ctx = d.ctx();
let filter_db = params.get("db").and_then(|v| v.as_str());
let databases = match ctx.storage.list_databases().await {
Ok(dbs) => dbs,
Err(e) => return ManagementResponse::err(id.to_string(), format!("Failed to list databases: {}", e)),
};
let mut collections: Vec<serde_json::Value> = Vec::new();
for db_name in &databases {
if let Some(fdb) = filter_db {
if db_name != fdb {
continue;
}
}
if let Ok(colls) = ctx.storage.list_collections(db_name).await {
for coll_name in colls {
let count = ctx.storage.count(db_name, &coll_name).await.unwrap_or(0);
collections.push(serde_json::json!({
"db": db_name,
"name": coll_name,
"count": count,
}));
}
}
}
ManagementResponse::ok(
id.to_string(),
serde_json::json!({ "collections": collections }),
)
}
async fn handle_get_documents(
id: &str,
params: &serde_json::Value,
db: &Option<RustDb>,
) -> ManagementResponse {
let d = match db.as_ref() {
Some(d) => d,
None => return ManagementResponse::err(id.to_string(), "Server is not running".to_string()),
};
let db_name = match params.get("db").and_then(|v| v.as_str()) {
Some(s) => s,
None => return ManagementResponse::err(id.to_string(), "Missing 'db' parameter".to_string()),
};
let coll_name = match params.get("collection").and_then(|v| v.as_str()) {
Some(s) => s,
None => return ManagementResponse::err(id.to_string(), "Missing 'collection' parameter".to_string()),
};
let limit = params.get("limit").and_then(|v| v.as_u64()).unwrap_or(50) as usize;
let skip = params.get("skip").and_then(|v| v.as_u64()).unwrap_or(0) as usize;
let ctx = d.ctx();
let all_docs = match ctx.storage.find_all(db_name, coll_name).await {
Ok(docs) => docs,
Err(e) => return ManagementResponse::err(id.to_string(), format!("Failed to find documents: {}", e)),
};
let total = all_docs.len();
let docs: Vec<serde_json::Value> = all_docs
.into_iter()
.skip(skip)
.take(limit)
.map(|d| bson_doc_to_json(&d))
.collect();
ManagementResponse::ok(
id.to_string(),
serde_json::json!({
"documents": docs,
"total": total,
}),
)
}
/// Convert a BSON Document to a serde_json::Value.
fn bson_doc_to_json(doc: &bson::Document) -> serde_json::Value {
// Use bson's built-in relaxed extended JSON serialization.
let bson_val = bson::Bson::Document(doc.clone());
bson_val.into_relaxed_extjson()
}
+256
View File
@@ -0,0 +1,256 @@
import { expect, tap } from '@git.zone/tstest/tapbundle';
import * as smartdb from '../ts/index.js';
import { MongoClient, Db } from 'mongodb';
import * as fs from 'fs';
import * as path from 'path';
import * as os from 'os';
// ---------------------------------------------------------------------------
// Helpers
// ---------------------------------------------------------------------------
let tmpDir: string;
let server: smartdb.SmartdbServer;
let client: MongoClient;
let db: Db;
function makeTmpDir(): string {
return fs.mkdtempSync(path.join(os.tmpdir(), 'smartdb-compact-test-'));
}
function cleanTmpDir(dir: string): void {
if (fs.existsSync(dir)) {
fs.rmSync(dir, { recursive: true, force: true });
}
}
function getDataFileSize(storagePath: string, dbName: string, collName: string): number {
const dataPath = path.join(storagePath, dbName, collName, 'data.rdb');
if (!fs.existsSync(dataPath)) return 0;
return fs.statSync(dataPath).size;
}
// ============================================================================
// Compaction: Setup
// ============================================================================
tap.test('compaction: start server with file storage', async () => {
tmpDir = makeTmpDir();
server = new smartdb.SmartdbServer({
socketPath: path.join(os.tmpdir(), `smartdb-compact-${Date.now()}-${Math.random().toString(36).slice(2)}.sock`),
storage: 'file',
storagePath: tmpDir,
});
await server.start();
client = new MongoClient(server.getConnectionUri(), {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
db = client.db('compactdb');
});
// ============================================================================
// Compaction: Updates grow the data file
// ============================================================================
tap.test('compaction: repeated updates grow the data file', async () => {
const coll = db.collection('growing');
// Insert a document
await coll.insertOne({ key: 'target', counter: 0, payload: 'x'.repeat(200) });
const sizeAfterInsert = getDataFileSize(tmpDir, 'compactdb', 'growing');
expect(sizeAfterInsert).toBeGreaterThan(0);
// Update the same document 50 times — each update appends a new record
for (let i = 1; i <= 50; i++) {
await coll.updateOne(
{ key: 'target' },
{ $set: { counter: i, payload: 'y'.repeat(200) } }
);
}
const sizeAfterUpdates = getDataFileSize(tmpDir, 'compactdb', 'growing');
// Compaction may have run during updates, so we can't assert the file is
// much larger. What matters is the data is correct.
// The collection still has just 1 document
const count = await coll.countDocuments();
expect(count).toEqual(1);
const doc = await coll.findOne({ key: 'target' });
expect(doc!.counter).toEqual(50);
});
// ============================================================================
// Compaction: Deletes create tombstones
// ============================================================================
tap.test('compaction: insert-then-delete creates dead space', async () => {
const coll = db.collection('tombstones');
// Insert 100 documents
const docs = [];
for (let i = 0; i < 100; i++) {
docs.push({ idx: i, data: 'delete-me-' + 'z'.repeat(100) });
}
await coll.insertMany(docs);
const sizeAfterInsert = getDataFileSize(tmpDir, 'compactdb', 'tombstones');
// Delete all 100
await coll.deleteMany({});
const sizeAfterDelete = getDataFileSize(tmpDir, 'compactdb', 'tombstones');
// File may have been compacted during deletes (dead > 50% threshold),
// but the operation itself should succeed regardless of file size.
// After deleting all docs, the file might be very small (just header + compacted).
// But count is 0
const count = await coll.countDocuments();
expect(count).toEqual(0);
});
// ============================================================================
// Compaction: Data integrity after compaction trigger
// ============================================================================
tap.test('compaction: data file shrinks after heavy updates trigger compaction', async () => {
const coll = db.collection('shrinktest');
// Insert 10 documents with large payloads
const docs = [];
for (let i = 0; i < 10; i++) {
docs.push({ idx: i, data: 'a'.repeat(500) });
}
await coll.insertMany(docs);
const sizeAfterInsert = getDataFileSize(tmpDir, 'compactdb', 'shrinktest');
// Update each document 20 times (creates 200 dead records vs 10 live)
// This should trigger compaction (dead > 50% threshold)
for (let round = 0; round < 20; round++) {
for (let i = 0; i < 10; i++) {
await coll.updateOne(
{ idx: i },
{ $set: { data: `round-${round}-` + 'b'.repeat(500) } }
);
}
}
// After compaction, file should be smaller than the pre-compaction peak
// (We can't measure the peak exactly, but the final size should be reasonable)
const sizeAfterCompaction = getDataFileSize(tmpDir, 'compactdb', 'shrinktest');
// The file should not be 20x the insert size since compaction should have run
// With 10 live records of ~530 bytes each, the file should be roughly that
// plus header overhead. Without compaction it would be 210 * ~530 bytes.
const maxExpectedSize = sizeAfterInsert * 5; // generous upper bound
expect(sizeAfterCompaction).toBeLessThanOrEqual(maxExpectedSize);
// All documents should still be readable and correct
const count = await coll.countDocuments();
expect(count).toEqual(10);
for (let i = 0; i < 10; i++) {
const doc = await coll.findOne({ idx: i });
expect(doc).toBeTruthy();
expect(doc!.data.startsWith('round-19-')).toBeTrue();
}
});
// ============================================================================
// Compaction: Persistence after compaction + restart
// ============================================================================
tap.test('compaction: data survives compaction + restart', async () => {
await client.close();
await server.stop();
server = new smartdb.SmartdbServer({
socketPath: path.join(os.tmpdir(), `smartdb-compact-${Date.now()}-${Math.random().toString(36).slice(2)}.sock`),
storage: 'file',
storagePath: tmpDir,
});
await server.start();
client = new MongoClient(server.getConnectionUri(), {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
db = client.db('compactdb');
// Verify shrinktest data
const coll = db.collection('shrinktest');
const count = await coll.countDocuments();
expect(count).toEqual(10);
for (let i = 0; i < 10; i++) {
const doc = await coll.findOne({ idx: i });
expect(doc).toBeTruthy();
expect(doc!.data.startsWith('round-19-')).toBeTrue();
}
// Verify growing collection
const growing = db.collection('growing');
const growDoc = await growing.findOne({ key: 'target' });
expect(growDoc).toBeTruthy();
expect(growDoc!.counter).toEqual(50);
// Verify tombstones collection is empty
const tombCount = await db.collection('tombstones').countDocuments();
expect(tombCount).toEqual(0);
});
// ============================================================================
// Compaction: Mixed operations stress test
// ============================================================================
tap.test('compaction: mixed insert-update-delete stress test', async () => {
const coll = db.collection('stress');
// Phase 1: Insert 200 documents
const batch = [];
for (let i = 0; i < 200; i++) {
batch.push({ idx: i, value: `initial-${i}`, alive: true });
}
await coll.insertMany(batch);
// Phase 2: Update every even-indexed document
for (let i = 0; i < 200; i += 2) {
await coll.updateOne({ idx: i }, { $set: { value: `updated-${i}` } });
}
// Phase 3: Delete every document where idx % 3 === 0
await coll.deleteMany({ idx: { $in: Array.from({ length: 67 }, (_, k) => k * 3) } });
// Verify: documents where idx % 3 !== 0 should remain
const remaining = await coll.find({}).toArray();
for (const doc of remaining) {
expect(doc.idx % 3).not.toEqual(0);
if (doc.idx % 2 === 0) {
expect(doc.value).toEqual(`updated-${doc.idx}`);
} else {
expect(doc.value).toEqual(`initial-${doc.idx}`);
}
}
// Count should be 200 - 67 = 133
const count = await coll.countDocuments();
expect(count).toEqual(133);
});
// ============================================================================
// Cleanup
// ============================================================================
tap.test('compaction: cleanup', async () => {
await client.close();
await server.stop();
cleanTmpDir(tmpDir);
});
export default tap.start();
+394
View File
@@ -0,0 +1,394 @@
import { expect, tap } from '@git.zone/tstest/tapbundle';
import * as smartdb from '../ts/index.js';
import { MongoClient, Db } from 'mongodb';
import * as fs from 'fs';
import * as path from 'path';
import * as os from 'os';
// ---------------------------------------------------------------------------
// Helpers
// ---------------------------------------------------------------------------
let tmpDir: string;
let server: smartdb.SmartdbServer;
let client: MongoClient;
let db: Db;
function makeTmpDir(): string {
return fs.mkdtempSync(path.join(os.tmpdir(), 'smartdb-test-'));
}
function cleanTmpDir(dir: string): void {
if (fs.existsSync(dir)) {
fs.rmSync(dir, { recursive: true, force: true });
}
}
// ============================================================================
// File Storage: Startup
// ============================================================================
tap.test('file-storage: should start server with file storage', async () => {
tmpDir = makeTmpDir();
server = new smartdb.SmartdbServer({
port: 27118,
storage: 'file',
storagePath: tmpDir,
});
await server.start();
expect(server.running).toBeTrue();
});
tap.test('file-storage: should connect MongoClient', async () => {
client = new MongoClient('mongodb://127.0.0.1:27118', {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
db = client.db('filetest');
expect(db).toBeTruthy();
});
// ============================================================================
// File Storage: Data files are created on disk
// ============================================================================
tap.test('file-storage: inserting creates data files on disk', async () => {
const coll = db.collection('diskcheck');
await coll.insertOne({ name: 'disk-test', value: 42 });
// The storage directory should now contain a database directory
const dbDir = path.join(tmpDir, 'filetest');
expect(fs.existsSync(dbDir)).toBeTrue();
// Collection directory with data.rdb should exist
const collDir = path.join(dbDir, 'diskcheck');
expect(fs.existsSync(collDir)).toBeTrue();
const dataFile = path.join(collDir, 'data.rdb');
expect(fs.existsSync(dataFile)).toBeTrue();
// data.rdb should have the SMARTDB magic header
const header = Buffer.alloc(8);
const fd = fs.openSync(dataFile, 'r');
fs.readSync(fd, header, 0, 8, 0);
fs.closeSync(fd);
expect(header.toString('ascii')).toEqual('SMARTDB\0');
});
// ============================================================================
// File Storage: Full CRUD cycle
// ============================================================================
tap.test('file-storage: insertOne returns valid id', async () => {
const coll = db.collection('crud');
const result = await coll.insertOne({ name: 'Alice', age: 30 });
expect(result.acknowledged).toBeTrue();
expect(result.insertedId).toBeTruthy();
});
tap.test('file-storage: insertMany returns all ids', async () => {
const coll = db.collection('crud');
const result = await coll.insertMany([
{ name: 'Bob', age: 25 },
{ name: 'Charlie', age: 35 },
{ name: 'Diana', age: 28 },
{ name: 'Eve', age: 32 },
]);
expect(result.insertedCount).toEqual(4);
});
tap.test('file-storage: findOne retrieves correct document', async () => {
const coll = db.collection('crud');
const doc = await coll.findOne({ name: 'Alice' });
expect(doc).toBeTruthy();
expect(doc!.name).toEqual('Alice');
expect(doc!.age).toEqual(30);
});
tap.test('file-storage: find with filter returns correct subset', async () => {
const coll = db.collection('crud');
const docs = await coll.find({ age: { $gte: 30 } }).toArray();
expect(docs.length).toEqual(3); // Alice(30), Charlie(35), Eve(32)
expect(docs.every(d => d.age >= 30)).toBeTrue();
});
tap.test('file-storage: updateOne modifies document', async () => {
const coll = db.collection('crud');
const result = await coll.updateOne(
{ name: 'Alice' },
{ $set: { age: 31, updated: true } }
);
expect(result.modifiedCount).toEqual(1);
const doc = await coll.findOne({ name: 'Alice' });
expect(doc!.age).toEqual(31);
expect(doc!.updated).toBeTrue();
});
tap.test('file-storage: deleteOne removes document', async () => {
const coll = db.collection('crud');
const result = await coll.deleteOne({ name: 'Eve' });
expect(result.deletedCount).toEqual(1);
const doc = await coll.findOne({ name: 'Eve' });
expect(doc).toBeNull();
});
tap.test('file-storage: count reflects current state', async () => {
const coll = db.collection('crud');
const count = await coll.countDocuments();
expect(count).toEqual(4); // 5 inserted - 1 deleted = 4
});
// ============================================================================
// File Storage: Persistence across server restart
// ============================================================================
tap.test('file-storage: stop server for restart test', async () => {
await client.close();
await server.stop();
expect(server.running).toBeFalse();
});
tap.test('file-storage: restart server with same data path', async () => {
server = new smartdb.SmartdbServer({
port: 27118,
storage: 'file',
storagePath: tmpDir,
});
await server.start();
expect(server.running).toBeTrue();
client = new MongoClient('mongodb://127.0.0.1:27118', {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
db = client.db('filetest');
});
tap.test('file-storage: data persists after restart', async () => {
const coll = db.collection('crud');
// Alice should still be there with updated age
const alice = await coll.findOne({ name: 'Alice' });
expect(alice).toBeTruthy();
expect(alice!.age).toEqual(31);
expect(alice!.updated).toBeTrue();
// Bob, Charlie, Diana should be there
const bob = await coll.findOne({ name: 'Bob' });
expect(bob).toBeTruthy();
expect(bob!.age).toEqual(25);
const charlie = await coll.findOne({ name: 'Charlie' });
expect(charlie).toBeTruthy();
const diana = await coll.findOne({ name: 'Diana' });
expect(diana).toBeTruthy();
// Eve should still be deleted
const eve = await coll.findOne({ name: 'Eve' });
expect(eve).toBeNull();
});
tap.test('file-storage: count is correct after restart', async () => {
const coll = db.collection('crud');
const count = await coll.countDocuments();
expect(count).toEqual(4);
});
tap.test('file-storage: can write new data after restart', async () => {
const coll = db.collection('crud');
const result = await coll.insertOne({ name: 'Frank', age: 45 });
expect(result.acknowledged).toBeTrue();
const doc = await coll.findOne({ name: 'Frank' });
expect(doc).toBeTruthy();
expect(doc!.age).toEqual(45);
const count = await coll.countDocuments();
expect(count).toEqual(5);
});
// ============================================================================
// File Storage: Multiple collections in same database
// ============================================================================
tap.test('file-storage: multiple collections are independent', async () => {
const products = db.collection('products');
const orders = db.collection('orders');
await products.insertMany([
{ sku: 'A001', name: 'Widget', price: 9.99 },
{ sku: 'A002', name: 'Gadget', price: 19.99 },
]);
await orders.insertMany([
{ orderId: 1, sku: 'A001', qty: 3 },
{ orderId: 2, sku: 'A002', qty: 1 },
{ orderId: 3, sku: 'A001', qty: 2 },
]);
const productCount = await products.countDocuments();
const orderCount = await orders.countDocuments();
expect(productCount).toEqual(2);
expect(orderCount).toEqual(3);
// Deleting from one collection doesn't affect the other
await products.deleteOne({ sku: 'A001' });
expect(await products.countDocuments()).toEqual(1);
expect(await orders.countDocuments()).toEqual(3);
});
// ============================================================================
// File Storage: Multiple databases
// ============================================================================
tap.test('file-storage: multiple databases are independent', async () => {
const db2 = client.db('filetest2');
const coll2 = db2.collection('items');
await coll2.insertOne({ name: 'cross-db-test', source: 'db2' });
// db2 has 1 doc
const count2 = await coll2.countDocuments();
expect(count2).toEqual(1);
// original db is unaffected
const crudCount = await db.collection('crud').countDocuments();
expect(crudCount).toEqual(5);
await db2.dropDatabase();
});
// ============================================================================
// File Storage: Large batch insert and retrieval
// ============================================================================
tap.test('file-storage: bulk insert 1000 documents', async () => {
const coll = db.collection('bulk');
const docs = [];
for (let i = 0; i < 1000; i++) {
docs.push({ index: i, data: `value-${i}`, timestamp: Date.now() });
}
const result = await coll.insertMany(docs);
expect(result.insertedCount).toEqual(1000);
});
tap.test('file-storage: find all 1000 documents', async () => {
const coll = db.collection('bulk');
const docs = await coll.find({}).toArray();
expect(docs.length).toEqual(1000);
});
tap.test('file-storage: range query on 1000 documents', async () => {
const coll = db.collection('bulk');
const docs = await coll.find({ index: { $gte: 500, $lt: 600 } }).toArray();
expect(docs.length).toEqual(100);
expect(docs.every(d => d.index >= 500 && d.index < 600)).toBeTrue();
});
tap.test('file-storage: sorted retrieval with limit', async () => {
const coll = db.collection('bulk');
const docs = await coll.find({}).sort({ index: -1 }).limit(10).toArray();
expect(docs.length).toEqual(10);
expect(docs[0].index).toEqual(999);
expect(docs[9].index).toEqual(990);
});
// ============================================================================
// File Storage: Update many and verify persistence
// ============================================================================
tap.test('file-storage: updateMany on bulk collection', async () => {
const coll = db.collection('bulk');
const result = await coll.updateMany(
{ index: { $lt: 100 } },
{ $set: { batch: 'first-hundred' } }
);
expect(result.modifiedCount).toEqual(100);
const updated = await coll.find({ batch: 'first-hundred' }).toArray();
expect(updated.length).toEqual(100);
});
// ============================================================================
// File Storage: Delete many and verify
// ============================================================================
tap.test('file-storage: deleteMany removes correct documents', async () => {
const coll = db.collection('bulk');
const result = await coll.deleteMany({ index: { $gte: 900 } });
expect(result.deletedCount).toEqual(100);
const remaining = await coll.countDocuments();
expect(remaining).toEqual(900);
});
// ============================================================================
// File Storage: Persistence of bulk data across restart
// ============================================================================
tap.test('file-storage: stop server for bulk restart test', async () => {
await client.close();
await server.stop();
expect(server.running).toBeFalse();
});
tap.test('file-storage: restart and verify bulk data', async () => {
server = new smartdb.SmartdbServer({
port: 27118,
storage: 'file',
storagePath: tmpDir,
});
await server.start();
client = new MongoClient('mongodb://127.0.0.1:27118', {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
db = client.db('filetest');
const coll = db.collection('bulk');
const count = await coll.countDocuments();
expect(count).toEqual(900);
// Verify the updateMany persisted
const firstHundred = await coll.find({ batch: 'first-hundred' }).toArray();
expect(firstHundred.length).toEqual(100);
// Verify deleted docs are gone
const over900 = await coll.find({ index: { $gte: 900 } }).toArray();
expect(over900.length).toEqual(0);
});
// ============================================================================
// File Storage: Index persistence
// ============================================================================
tap.test('file-storage: default indexes.json exists on disk', async () => {
// The indexes.json is created when the collection is first created,
// containing the default _id_ index spec.
const indexFile = path.join(tmpDir, 'filetest', 'crud', 'indexes.json');
expect(fs.existsSync(indexFile)).toBeTrue();
const indexData = JSON.parse(fs.readFileSync(indexFile, 'utf-8'));
const names = indexData.map((i: any) => i.name);
expect(names).toContain('_id_');
});
// ============================================================================
// Cleanup
// ============================================================================
tap.test('file-storage: cleanup', async () => {
await client.close();
await server.stop();
expect(server.running).toBeFalse();
cleanTmpDir(tmpDir);
});
export default tap.start();
+235
View File
@@ -0,0 +1,235 @@
import { expect, tap } from '@git.zone/tstest/tapbundle';
import * as smartdb from '../ts/index.js';
import { MongoClient, Db } from 'mongodb';
import * as fs from 'fs';
import * as path from 'path';
import * as os from 'os';
// ---------------------------------------------------------------------------
// Helpers
// ---------------------------------------------------------------------------
let tmpDir: string;
let localDb: smartdb.LocalSmartDb;
let client: MongoClient;
let db: Db;
function makeTmpDir(): string {
return fs.mkdtempSync(path.join(os.tmpdir(), 'smartdb-local-test-'));
}
function cleanTmpDir(dir: string): void {
if (fs.existsSync(dir)) {
fs.rmSync(dir, { recursive: true, force: true });
}
}
// ============================================================================
// LocalSmartDb: Lifecycle
// ============================================================================
tap.test('localsmartdb: should start with just a folder path', async () => {
tmpDir = makeTmpDir();
localDb = new smartdb.LocalSmartDb({ folderPath: tmpDir });
const info = await localDb.start();
expect(localDb.running).toBeTrue();
expect(info.socketPath).toBeTruthy();
expect(info.connectionUri).toBeTruthy();
expect(info.connectionUri.startsWith('mongodb://')).toBeTrue();
});
tap.test('localsmartdb: should connect via returned connectionUri', async () => {
const info = localDb.getConnectionInfo();
client = new MongoClient(info.connectionUri, {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
db = client.db('localtest');
expect(db).toBeTruthy();
});
tap.test('localsmartdb: should reject double start', async () => {
let threw = false;
try {
await localDb.start();
} catch {
threw = true;
}
expect(threw).toBeTrue();
});
// ============================================================================
// LocalSmartDb: CRUD via Unix socket
// ============================================================================
tap.test('localsmartdb: insert and find documents', async () => {
const coll = db.collection('notes');
await coll.insertMany([
{ title: 'Note 1', body: 'First note', priority: 1 },
{ title: 'Note 2', body: 'Second note', priority: 2 },
{ title: 'Note 3', body: 'Third note', priority: 3 },
]);
const all = await coll.find({}).toArray();
expect(all.length).toEqual(3);
const high = await coll.findOne({ priority: 3 });
expect(high).toBeTruthy();
expect(high!.title).toEqual('Note 3');
});
tap.test('localsmartdb: update and verify', async () => {
const coll = db.collection('notes');
await coll.updateOne(
{ title: 'Note 2' },
{ $set: { body: 'Updated second note', edited: true } }
);
const doc = await coll.findOne({ title: 'Note 2' });
expect(doc!.body).toEqual('Updated second note');
expect(doc!.edited).toBeTrue();
});
tap.test('localsmartdb: delete and verify', async () => {
const coll = db.collection('notes');
await coll.deleteOne({ title: 'Note 1' });
const count = await coll.countDocuments();
expect(count).toEqual(2);
const deleted = await coll.findOne({ title: 'Note 1' });
expect(deleted).toBeNull();
});
// ============================================================================
// LocalSmartDb: Persistence across restart
// ============================================================================
tap.test('localsmartdb: stop for restart', async () => {
await client.close();
await localDb.stop();
expect(localDb.running).toBeFalse();
});
tap.test('localsmartdb: restart with same folder', async () => {
localDb = new smartdb.LocalSmartDb({ folderPath: tmpDir });
const info = await localDb.start();
expect(localDb.running).toBeTrue();
client = new MongoClient(info.connectionUri, {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
db = client.db('localtest');
});
tap.test('localsmartdb: data persists after restart', async () => {
const coll = db.collection('notes');
const count = await coll.countDocuments();
expect(count).toEqual(2); // 3 inserted - 1 deleted
const note2 = await coll.findOne({ title: 'Note 2' });
expect(note2!.body).toEqual('Updated second note');
expect(note2!.edited).toBeTrue();
const note3 = await coll.findOne({ title: 'Note 3' });
expect(note3!.priority).toEqual(3);
});
// ============================================================================
// LocalSmartDb: Custom socket path
// ============================================================================
tap.test('localsmartdb: works with custom socket path', async () => {
await client.close();
await localDb.stop();
const customSocket = path.join(os.tmpdir(), `smartdb-custom-${Date.now()}.sock`);
const tmpDir2 = makeTmpDir();
const localDb2 = new smartdb.LocalSmartDb({
folderPath: tmpDir2,
socketPath: customSocket,
});
const info = await localDb2.start();
expect(info.socketPath).toEqual(customSocket);
const client2 = new MongoClient(info.connectionUri, {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client2.connect();
const testDb = client2.db('customsock');
await testDb.collection('test').insertOne({ x: 1 });
const doc = await testDb.collection('test').findOne({ x: 1 });
expect(doc).toBeTruthy();
await client2.close();
await localDb2.stop();
cleanTmpDir(tmpDir2);
// Reconnect original for remaining tests
localDb = new smartdb.LocalSmartDb({ folderPath: tmpDir });
const origInfo = await localDb.start();
client = new MongoClient(origInfo.connectionUri, {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
db = client.db('localtest');
});
// ============================================================================
// LocalSmartDb: getConnectionUri and getServer helpers
// ============================================================================
tap.test('localsmartdb: getConnectionUri returns valid uri', async () => {
const uri = localDb.getConnectionUri();
expect(uri.startsWith('mongodb://')).toBeTrue();
});
tap.test('localsmartdb: getServer returns the SmartdbServer', async () => {
const srv = localDb.getServer();
expect(srv).toBeTruthy();
expect(srv.running).toBeTrue();
});
// ============================================================================
// LocalSmartDb: Data isolation between databases
// ============================================================================
tap.test('localsmartdb: databases are isolated', async () => {
const dbA = client.db('isoA');
const dbB = client.db('isoB');
await dbA.collection('shared').insertOne({ source: 'A', val: 1 });
await dbB.collection('shared').insertOne({ source: 'B', val: 2 });
const docsA = await dbA.collection('shared').find({}).toArray();
const docsB = await dbB.collection('shared').find({}).toArray();
expect(docsA.length).toEqual(1);
expect(docsA[0].source).toEqual('A');
expect(docsB.length).toEqual(1);
expect(docsB[0].source).toEqual('B');
await dbA.dropDatabase();
await dbB.dropDatabase();
});
// ============================================================================
// Cleanup
// ============================================================================
tap.test('localsmartdb: cleanup', async () => {
await client.close();
await localDb.stop();
expect(localDb.running).toBeFalse();
cleanTmpDir(tmpDir);
});
export default tap.start();
+269
View File
@@ -0,0 +1,269 @@
import { expect, tap } from '@git.zone/tstest/tapbundle';
import * as smartdb from '../ts/index.js';
import { MongoClient, Db } from 'mongodb';
import * as fs from 'fs';
import * as path from 'path';
import * as os from 'os';
// ---------------------------------------------------------------------------
// Helpers
// ---------------------------------------------------------------------------
let tmpDir: string;
function makeTmpDir(): string {
return fs.mkdtempSync(path.join(os.tmpdir(), 'smartdb-migration-test-'));
}
function cleanTmpDir(dir: string): void {
if (fs.existsSync(dir)) {
fs.rmSync(dir, { recursive: true, force: true });
}
}
/**
* Create a v0 (legacy JSON) storage layout:
* {base}/{db}/{coll}.json
* {base}/{db}/{coll}.indexes.json
*/
function createV0Layout(basePath: string, dbName: string, collName: string, docs: any[]): void {
const dbDir = path.join(basePath, dbName);
fs.mkdirSync(dbDir, { recursive: true });
// Convert docs to the extended JSON format that the old Rust engine wrote:
// ObjectId is stored as { "$oid": "hex" }
const jsonDocs = docs.map(doc => {
const clone = { ...doc };
if (!clone._id) {
// Generate a fake ObjectId-like hex string
const hex = [...Array(24)].map(() => Math.floor(Math.random() * 16).toString(16)).join('');
clone._id = { '$oid': hex };
}
return clone;
});
const collPath = path.join(dbDir, `${collName}.json`);
fs.writeFileSync(collPath, JSON.stringify(jsonDocs, null, 2));
const indexPath = path.join(dbDir, `${collName}.indexes.json`);
fs.writeFileSync(indexPath, JSON.stringify([
{ name: '_id_', key: { _id: 1 } },
], null, 2));
}
// ============================================================================
// Migration: v0 → v1 basic
// ============================================================================
tap.test('migration: detects v0 format and migrates on startup', async () => {
tmpDir = makeTmpDir();
// Create v0 layout with test data
createV0Layout(tmpDir, 'mydb', 'users', [
{ name: 'Alice', age: 30, email: 'alice@test.com' },
{ name: 'Bob', age: 25, email: 'bob@test.com' },
{ name: 'Charlie', age: 35, email: 'charlie@test.com' },
]);
createV0Layout(tmpDir, 'mydb', 'products', [
{ sku: 'W001', name: 'Widget', price: 9.99 },
{ sku: 'G001', name: 'Gadget', price: 19.99 },
]);
// Verify v0 files exist
expect(fs.existsSync(path.join(tmpDir, 'mydb', 'users.json'))).toBeTrue();
expect(fs.existsSync(path.join(tmpDir, 'mydb', 'products.json'))).toBeTrue();
// Start server — migration should run automatically
const server = new smartdb.SmartdbServer({
socketPath: path.join(os.tmpdir(), `smartdb-mig-${Date.now()}-${Math.random().toString(36).slice(2)}.sock`),
storage: 'file',
storagePath: tmpDir,
});
await server.start();
// v1 directories should now exist
expect(fs.existsSync(path.join(tmpDir, 'mydb', 'users', 'data.rdb'))).toBeTrue();
expect(fs.existsSync(path.join(tmpDir, 'mydb', 'products', 'data.rdb'))).toBeTrue();
// v0 files should still exist (not deleted)
expect(fs.existsSync(path.join(tmpDir, 'mydb', 'users.json'))).toBeTrue();
expect(fs.existsSync(path.join(tmpDir, 'mydb', 'products.json'))).toBeTrue();
// Connect and verify data is accessible
const client = new MongoClient(server.getConnectionUri(), {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
const db = client.db('mydb');
// Users collection
const users = await db.collection('users').find({}).toArray();
expect(users.length).toEqual(3);
const alice = users.find(u => u.name === 'Alice');
expect(alice).toBeTruthy();
expect(alice!.age).toEqual(30);
expect(alice!.email).toEqual('alice@test.com');
// Products collection
const products = await db.collection('products').find({}).toArray();
expect(products.length).toEqual(2);
const widget = products.find(p => p.sku === 'W001');
expect(widget).toBeTruthy();
expect(widget!.price).toEqual(9.99);
await client.close();
await server.stop();
});
// ============================================================================
// Migration: migrated data survives another restart
// ============================================================================
tap.test('migration: migrated data persists across restart', async () => {
const server = new smartdb.SmartdbServer({
socketPath: path.join(os.tmpdir(), `smartdb-mig-${Date.now()}-${Math.random().toString(36).slice(2)}.sock`),
storage: 'file',
storagePath: tmpDir,
});
await server.start();
const client = new MongoClient(server.getConnectionUri(), {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
const db = client.db('mydb');
const users = await db.collection('users').find({}).toArray();
expect(users.length).toEqual(3);
const products = await db.collection('products').find({}).toArray();
expect(products.length).toEqual(2);
await client.close();
await server.stop();
});
// ============================================================================
// Migration: can write new data after migration
// ============================================================================
tap.test('migration: new writes work after migration', async () => {
const server = new smartdb.SmartdbServer({
socketPath: path.join(os.tmpdir(), `smartdb-mig-${Date.now()}-${Math.random().toString(36).slice(2)}.sock`),
storage: 'file',
storagePath: tmpDir,
});
await server.start();
const client = new MongoClient(server.getConnectionUri(), {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
const db = client.db('mydb');
// Insert new documents
await db.collection('users').insertOne({ name: 'Diana', age: 28 });
const count = await db.collection('users').countDocuments();
expect(count).toEqual(4);
// Update existing migrated document
await db.collection('users').updateOne(
{ name: 'Alice' },
{ $set: { age: 31 } }
);
const alice = await db.collection('users').findOne({ name: 'Alice' });
expect(alice!.age).toEqual(31);
// Delete a migrated document
await db.collection('products').deleteOne({ sku: 'G001' });
const prodCount = await db.collection('products').countDocuments();
expect(prodCount).toEqual(1);
await client.close();
await server.stop();
cleanTmpDir(tmpDir);
});
// ============================================================================
// Migration: skips already-migrated data
// ============================================================================
tap.test('migration: no-op for v1 format', async () => {
tmpDir = makeTmpDir();
// Start fresh to create v1 layout
const server = new smartdb.SmartdbServer({
socketPath: path.join(os.tmpdir(), `smartdb-mig-${Date.now()}-${Math.random().toString(36).slice(2)}.sock`),
storage: 'file',
storagePath: tmpDir,
});
await server.start();
const client = new MongoClient(server.getConnectionUri(), {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
const db = client.db('v1test');
await db.collection('items').insertOne({ x: 1 });
await client.close();
await server.stop();
// Restart — migration should detect v1 and skip
const server2 = new smartdb.SmartdbServer({
socketPath: path.join(os.tmpdir(), `smartdb-mig-${Date.now()}-${Math.random().toString(36).slice(2)}.sock`),
storage: 'file',
storagePath: tmpDir,
});
await server2.start();
const client2 = new MongoClient(server2.getConnectionUri(), {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client2.connect();
const db2 = client2.db('v1test');
const doc = await db2.collection('items').findOne({ x: 1 });
expect(doc).toBeTruthy();
await client2.close();
await server2.stop();
cleanTmpDir(tmpDir);
});
// ============================================================================
// Migration: empty storage is handled gracefully
// ============================================================================
tap.test('migration: empty storage directory works', async () => {
tmpDir = makeTmpDir();
const server = new smartdb.SmartdbServer({
socketPath: path.join(os.tmpdir(), `smartdb-mig-${Date.now()}-${Math.random().toString(36).slice(2)}.sock`),
storage: 'file',
storagePath: tmpDir,
});
await server.start();
const client = new MongoClient(server.getConnectionUri(), {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
// Should work fine with empty storage
const db = client.db('emptytest');
await db.collection('first').insertOne({ hello: 'world' });
const doc = await db.collection('first').findOne({ hello: 'world' });
expect(doc).toBeTruthy();
await client.close();
await server.stop();
cleanTmpDir(tmpDir);
});
export default tap.start();
-232
View File
@@ -1,232 +0,0 @@
import { expect, tap } from '@git.zone/tstest/tapbundle';
import * as smartdb from '../ts/index.js';
const {
calculateCRC32,
calculateCRC32Buffer,
calculateDocumentChecksum,
addChecksum,
verifyChecksum,
removeChecksum,
} = smartdb;
// ============================================================================
// CRC32 String Tests
// ============================================================================
tap.test('checksum: calculateCRC32 should return consistent value for same input', async () => {
const result1 = calculateCRC32('hello world');
const result2 = calculateCRC32('hello world');
expect(result1).toEqual(result2);
});
tap.test('checksum: calculateCRC32 should return different values for different inputs', async () => {
const result1 = calculateCRC32('hello');
const result2 = calculateCRC32('world');
expect(result1).not.toEqual(result2);
});
tap.test('checksum: calculateCRC32 should return a 32-bit unsigned integer', async () => {
const result = calculateCRC32('test string');
expect(result).toBeGreaterThanOrEqual(0);
expect(result).toBeLessThanOrEqual(0xFFFFFFFF);
});
tap.test('checksum: calculateCRC32 should handle empty string', async () => {
const result = calculateCRC32('');
expect(typeof result).toEqual('number');
expect(result).toBeGreaterThanOrEqual(0);
});
tap.test('checksum: calculateCRC32 should handle special characters', async () => {
const result = calculateCRC32('hello\nworld\t!"#$%&\'()');
expect(typeof result).toEqual('number');
expect(result).toBeGreaterThanOrEqual(0);
});
tap.test('checksum: calculateCRC32 should handle unicode characters', async () => {
const result = calculateCRC32('hello 世界 🌍');
expect(typeof result).toEqual('number');
expect(result).toBeGreaterThanOrEqual(0);
});
// ============================================================================
// CRC32 Buffer Tests
// ============================================================================
tap.test('checksum: calculateCRC32Buffer should return consistent value for same input', async () => {
const buffer = Buffer.from('hello world');
const result1 = calculateCRC32Buffer(buffer);
const result2 = calculateCRC32Buffer(buffer);
expect(result1).toEqual(result2);
});
tap.test('checksum: calculateCRC32Buffer should return different values for different inputs', async () => {
const buffer1 = Buffer.from('hello');
const buffer2 = Buffer.from('world');
const result1 = calculateCRC32Buffer(buffer1);
const result2 = calculateCRC32Buffer(buffer2);
expect(result1).not.toEqual(result2);
});
tap.test('checksum: calculateCRC32Buffer should handle empty buffer', async () => {
const result = calculateCRC32Buffer(Buffer.from(''));
expect(typeof result).toEqual('number');
expect(result).toBeGreaterThanOrEqual(0);
});
tap.test('checksum: calculateCRC32Buffer should handle binary data', async () => {
const buffer = Buffer.from([0x00, 0xFF, 0x7F, 0x80, 0x01]);
const result = calculateCRC32Buffer(buffer);
expect(typeof result).toEqual('number');
expect(result).toBeGreaterThanOrEqual(0);
});
// ============================================================================
// Document Checksum Tests
// ============================================================================
tap.test('checksum: calculateDocumentChecksum should return consistent value', async () => {
const doc = { name: 'John', age: 30 };
const result1 = calculateDocumentChecksum(doc);
const result2 = calculateDocumentChecksum(doc);
expect(result1).toEqual(result2);
});
tap.test('checksum: calculateDocumentChecksum should exclude _checksum field', async () => {
const doc1 = { name: 'John', age: 30 };
const doc2 = { name: 'John', age: 30, _checksum: 12345 };
const result1 = calculateDocumentChecksum(doc1);
const result2 = calculateDocumentChecksum(doc2);
expect(result1).toEqual(result2);
});
tap.test('checksum: calculateDocumentChecksum should handle empty document', async () => {
const result = calculateDocumentChecksum({});
expect(typeof result).toEqual('number');
expect(result).toBeGreaterThanOrEqual(0);
});
tap.test('checksum: calculateDocumentChecksum should handle nested objects', async () => {
const doc = {
name: 'John',
address: {
street: '123 Main St',
city: 'Springfield',
zip: {
code: '12345',
plus4: '6789',
},
},
};
const result = calculateDocumentChecksum(doc);
expect(typeof result).toEqual('number');
expect(result).toBeGreaterThanOrEqual(0);
});
tap.test('checksum: calculateDocumentChecksum should handle arrays', async () => {
const doc = {
name: 'John',
tags: ['developer', 'tester', 'admin'],
scores: [95, 87, 92],
};
const result = calculateDocumentChecksum(doc);
expect(typeof result).toEqual('number');
expect(result).toBeGreaterThanOrEqual(0);
});
// ============================================================================
// Add/Verify/Remove Checksum Tests
// ============================================================================
tap.test('checksum: addChecksum should add _checksum field to document', async () => {
const doc = { name: 'John', age: 30 };
const docWithChecksum = addChecksum(doc);
expect('_checksum' in docWithChecksum).toBeTrue();
expect(typeof docWithChecksum._checksum).toEqual('number');
expect(docWithChecksum.name).toEqual('John');
expect(docWithChecksum.age).toEqual(30);
});
tap.test('checksum: addChecksum should not modify the original document', async () => {
const doc = { name: 'John', age: 30 };
addChecksum(doc);
expect('_checksum' in doc).toBeFalse();
});
tap.test('checksum: verifyChecksum should return true for valid checksum', async () => {
const doc = { name: 'John', age: 30 };
const docWithChecksum = addChecksum(doc);
const isValid = verifyChecksum(docWithChecksum);
expect(isValid).toBeTrue();
});
tap.test('checksum: verifyChecksum should return false for tampered document', async () => {
const doc = { name: 'John', age: 30 };
const docWithChecksum = addChecksum(doc);
// Tamper with the document
docWithChecksum.age = 31;
const isValid = verifyChecksum(docWithChecksum);
expect(isValid).toBeFalse();
});
tap.test('checksum: verifyChecksum should return false for wrong checksum', async () => {
const doc = { name: 'John', age: 30, _checksum: 12345 };
const isValid = verifyChecksum(doc);
expect(isValid).toBeFalse();
});
tap.test('checksum: verifyChecksum should return true for document without checksum', async () => {
const doc = { name: 'John', age: 30 };
const isValid = verifyChecksum(doc);
expect(isValid).toBeTrue();
});
tap.test('checksum: removeChecksum should remove _checksum field', async () => {
const doc = { name: 'John', age: 30 };
const docWithChecksum = addChecksum(doc);
const docWithoutChecksum = removeChecksum(docWithChecksum);
expect('_checksum' in docWithoutChecksum).toBeFalse();
expect(docWithoutChecksum.name).toEqual('John');
expect(docWithoutChecksum.age).toEqual(30);
});
tap.test('checksum: removeChecksum should handle document without checksum', async () => {
const doc = { name: 'John', age: 30 };
const result = removeChecksum(doc);
expect('_checksum' in result).toBeFalse();
expect(result.name).toEqual('John');
expect(result.age).toEqual(30);
});
// ============================================================================
// Round-trip Tests
// ============================================================================
tap.test('checksum: full round-trip - add, verify, remove', async () => {
const original = { name: 'Test', value: 42, nested: { a: 1, b: 2 } };
// Add checksum
const withChecksum = addChecksum(original);
expect('_checksum' in withChecksum).toBeTrue();
// Verify checksum
expect(verifyChecksum(withChecksum)).toBeTrue();
// Remove checksum
const restored = removeChecksum(withChecksum);
expect('_checksum' in restored).toBeFalse();
// Original data should be intact
expect(restored.name).toEqual('Test');
expect(restored.value).toEqual(42);
expect(restored.nested.a).toEqual(1);
expect(restored.nested.b).toEqual(2);
});
export default tap.start();
-417
View File
@@ -1,417 +0,0 @@
import { expect, tap } from '@git.zone/tstest/tapbundle';
import * as smartdb from '../ts/index.js';
const { IndexEngine, MemoryStorageAdapter, ObjectId } = smartdb;
let storage: InstanceType<typeof MemoryStorageAdapter>;
let indexEngine: InstanceType<typeof IndexEngine>;
const TEST_DB = 'testdb';
const TEST_COLL = 'indextest';
// ============================================================================
// Setup
// ============================================================================
tap.test('indexengine: should create IndexEngine instance', async () => {
storage = new MemoryStorageAdapter();
await storage.initialize();
await storage.createCollection(TEST_DB, TEST_COLL);
indexEngine = new IndexEngine(TEST_DB, TEST_COLL, storage);
expect(indexEngine).toBeTruthy();
});
// ============================================================================
// Index Creation Tests
// ============================================================================
tap.test('indexengine: createIndex should create single-field index', async () => {
const indexName = await indexEngine.createIndex({ name: 1 });
expect(indexName).toEqual('name_1');
const exists = await indexEngine.indexExists('name_1');
expect(exists).toBeTrue();
});
tap.test('indexengine: createIndex should create compound index', async () => {
const indexName = await indexEngine.createIndex({ city: 1, state: -1 });
expect(indexName).toEqual('city_1_state_-1');
const exists = await indexEngine.indexExists('city_1_state_-1');
expect(exists).toBeTrue();
});
tap.test('indexengine: createIndex should use custom name if provided', async () => {
const indexName = await indexEngine.createIndex({ email: 1 }, { name: 'custom_email_index' });
expect(indexName).toEqual('custom_email_index');
const exists = await indexEngine.indexExists('custom_email_index');
expect(exists).toBeTrue();
});
tap.test('indexengine: createIndex should handle unique option', async () => {
const indexName = await indexEngine.createIndex({ uniqueField: 1 }, { unique: true });
expect(indexName).toEqual('uniqueField_1');
const indexes = await indexEngine.listIndexes();
const uniqueIndex = indexes.find(i => i.name === 'uniqueField_1');
expect(uniqueIndex!.unique).toBeTrue();
});
tap.test('indexengine: createIndex should handle sparse option', async () => {
const indexName = await indexEngine.createIndex({ sparseField: 1 }, { sparse: true });
expect(indexName).toEqual('sparseField_1');
const indexes = await indexEngine.listIndexes();
const sparseIndex = indexes.find(i => i.name === 'sparseField_1');
expect(sparseIndex!.sparse).toBeTrue();
});
tap.test('indexengine: createIndex should return existing index name if already exists', async () => {
const indexName1 = await indexEngine.createIndex({ existingField: 1 }, { name: 'existing_idx' });
const indexName2 = await indexEngine.createIndex({ existingField: 1 }, { name: 'existing_idx' });
expect(indexName1).toEqual(indexName2);
});
// ============================================================================
// Index Listing and Existence Tests
// ============================================================================
tap.test('indexengine: listIndexes should return all indexes', async () => {
const indexes = await indexEngine.listIndexes();
expect(indexes.length).toBeGreaterThanOrEqual(5); // _id_ + created indexes
expect(indexes.some(i => i.name === '_id_')).toBeTrue();
expect(indexes.some(i => i.name === 'name_1')).toBeTrue();
});
tap.test('indexengine: indexExists should return true for existing index', async () => {
const exists = await indexEngine.indexExists('name_1');
expect(exists).toBeTrue();
});
tap.test('indexengine: indexExists should return false for non-existent index', async () => {
const exists = await indexEngine.indexExists('nonexistent_index');
expect(exists).toBeFalse();
});
// ============================================================================
// Document Operations and Index Updates
// ============================================================================
tap.test('indexengine: should insert documents for index testing', async () => {
// Create a fresh index engine for document operations
await storage.dropCollection(TEST_DB, TEST_COLL);
await storage.createCollection(TEST_DB, TEST_COLL);
indexEngine = new IndexEngine(TEST_DB, TEST_COLL, storage);
// Create indexes first
await indexEngine.createIndex({ age: 1 });
await indexEngine.createIndex({ category: 1 });
// Insert test documents
const docs = [
{ _id: new ObjectId(), name: 'Alice', age: 25, category: 'A' },
{ _id: new ObjectId(), name: 'Bob', age: 30, category: 'B' },
{ _id: new ObjectId(), name: 'Charlie', age: 35, category: 'A' },
{ _id: new ObjectId(), name: 'Diana', age: 28, category: 'C' },
{ _id: new ObjectId(), name: 'Eve', age: 30, category: 'B' },
];
for (const doc of docs) {
const stored = await storage.insertOne(TEST_DB, TEST_COLL, doc);
await indexEngine.onInsert(stored);
}
});
tap.test('indexengine: onInsert should update indexes', async () => {
const newDoc = {
_id: new ObjectId(),
name: 'Frank',
age: 40,
category: 'D',
};
const stored = await storage.insertOne(TEST_DB, TEST_COLL, newDoc);
await indexEngine.onInsert(stored);
// Find by the indexed field
const candidates = await indexEngine.findCandidateIds({ age: 40 });
expect(candidates).toBeTruthy();
expect(candidates!.size).toEqual(1);
});
tap.test('indexengine: onUpdate should update indexes correctly', async () => {
// Get an existing document
const docs = await storage.findAll(TEST_DB, TEST_COLL);
const oldDoc = docs.find(d => d.name === 'Alice')!;
// Update the document
const newDoc = { ...oldDoc, age: 26 };
await storage.updateById(TEST_DB, TEST_COLL, oldDoc._id, newDoc);
await indexEngine.onUpdate(oldDoc, newDoc);
// Old value should not be in index
const oldCandidates = await indexEngine.findCandidateIds({ age: 25 });
expect(oldCandidates).toBeTruthy();
expect(oldCandidates!.has(oldDoc._id.toHexString())).toBeFalse();
// New value should be in index
const newCandidates = await indexEngine.findCandidateIds({ age: 26 });
expect(newCandidates).toBeTruthy();
expect(newCandidates!.has(oldDoc._id.toHexString())).toBeTrue();
});
tap.test('indexengine: onDelete should remove from indexes', async () => {
const docs = await storage.findAll(TEST_DB, TEST_COLL);
const docToDelete = docs.find(d => d.name === 'Frank')!;
await storage.deleteById(TEST_DB, TEST_COLL, docToDelete._id);
await indexEngine.onDelete(docToDelete);
const candidates = await indexEngine.findCandidateIds({ age: 40 });
expect(candidates).toBeTruthy();
expect(candidates!.has(docToDelete._id.toHexString())).toBeFalse();
});
// ============================================================================
// findCandidateIds Tests
// ============================================================================
tap.test('indexengine: findCandidateIds with equality filter', async () => {
const candidates = await indexEngine.findCandidateIds({ age: 30 });
expect(candidates).toBeTruthy();
expect(candidates!.size).toEqual(2); // Bob and Eve both have age 30
});
tap.test('indexengine: findCandidateIds with $in filter', async () => {
const candidates = await indexEngine.findCandidateIds({ age: { $in: [28, 30] } });
expect(candidates).toBeTruthy();
expect(candidates!.size).toEqual(3); // Diana (28), Bob (30), Eve (30)
});
tap.test('indexengine: findCandidateIds with no matching index', async () => {
const candidates = await indexEngine.findCandidateIds({ nonIndexedField: 'value' });
// Should return null when no index can be used
expect(candidates).toBeNull();
});
tap.test('indexengine: findCandidateIds with empty filter', async () => {
const candidates = await indexEngine.findCandidateIds({});
// Empty filter = no index can be used
expect(candidates).toBeNull();
});
// ============================================================================
// Range Query Tests (B-Tree)
// ============================================================================
tap.test('indexengine: findCandidateIds with $gt', async () => {
const candidates = await indexEngine.findCandidateIds({ age: { $gt: 30 } });
expect(candidates).toBeTruthy();
// Charlie (35) is > 30
expect(candidates!.size).toBeGreaterThanOrEqual(1);
});
tap.test('indexengine: findCandidateIds with $lt', async () => {
const candidates = await indexEngine.findCandidateIds({ age: { $lt: 28 } });
expect(candidates).toBeTruthy();
// Alice (26) is < 28
expect(candidates!.size).toBeGreaterThanOrEqual(1);
});
tap.test('indexengine: findCandidateIds with $gte', async () => {
const candidates = await indexEngine.findCandidateIds({ age: { $gte: 30 } });
expect(candidates).toBeTruthy();
// Bob (30), Eve (30), Charlie (35)
expect(candidates!.size).toBeGreaterThanOrEqual(3);
});
tap.test('indexengine: findCandidateIds with $lte', async () => {
const candidates = await indexEngine.findCandidateIds({ age: { $lte: 28 } });
expect(candidates).toBeTruthy();
// Alice (26), Diana (28)
expect(candidates!.size).toBeGreaterThanOrEqual(2);
});
tap.test('indexengine: findCandidateIds with range $gt and $lt', async () => {
const candidates = await indexEngine.findCandidateIds({ age: { $gt: 26, $lt: 35 } });
expect(candidates).toBeTruthy();
// Diana (28), Bob (30), Eve (30) are between 26 and 35 exclusive
expect(candidates!.size).toBeGreaterThanOrEqual(3);
});
// ============================================================================
// Index Selection Tests
// ============================================================================
tap.test('indexengine: selectIndex should return best index for equality', async () => {
const result = indexEngine.selectIndex({ age: 30 });
expect(result).toBeTruthy();
expect(result!.name).toEqual('age_1');
});
tap.test('indexengine: selectIndex should return best index for range query', async () => {
const result = indexEngine.selectIndex({ age: { $gt: 25 } });
expect(result).toBeTruthy();
expect(result!.name).toEqual('age_1');
});
tap.test('indexengine: selectIndex should return null for no matching filter', async () => {
const result = indexEngine.selectIndex({ nonIndexedField: 'value' });
expect(result).toBeNull();
});
tap.test('indexengine: selectIndex should return null for empty filter', async () => {
const result = indexEngine.selectIndex({});
expect(result).toBeNull();
});
tap.test('indexengine: selectIndex should prefer more specific indexes', async () => {
// Create a compound index
await indexEngine.createIndex({ age: 1, category: 1 }, { name: 'age_category_compound' });
// Query that matches compound index
const result = indexEngine.selectIndex({ age: 30, category: 'B' });
expect(result).toBeTruthy();
// Should prefer the compound index since it covers more fields
expect(result!.name).toEqual('age_category_compound');
});
// ============================================================================
// Drop Index Tests
// ============================================================================
tap.test('indexengine: dropIndex should remove the index', async () => {
await indexEngine.createIndex({ dropTest: 1 }, { name: 'drop_test_idx' });
expect(await indexEngine.indexExists('drop_test_idx')).toBeTrue();
await indexEngine.dropIndex('drop_test_idx');
expect(await indexEngine.indexExists('drop_test_idx')).toBeFalse();
});
tap.test('indexengine: dropIndex should throw for _id index', async () => {
let threw = false;
try {
await indexEngine.dropIndex('_id_');
} catch (e) {
threw = true;
}
expect(threw).toBeTrue();
});
tap.test('indexengine: dropIndex should throw for non-existent index', async () => {
let threw = false;
try {
await indexEngine.dropIndex('nonexistent_index');
} catch (e) {
threw = true;
}
expect(threw).toBeTrue();
});
tap.test('indexengine: dropAllIndexes should remove all indexes except _id', async () => {
// Create some indexes to drop
await indexEngine.createIndex({ toDrop1: 1 });
await indexEngine.createIndex({ toDrop2: 1 });
await indexEngine.dropAllIndexes();
const indexes = await indexEngine.listIndexes();
expect(indexes.length).toEqual(1);
expect(indexes[0].name).toEqual('_id_');
});
// ============================================================================
// Unique Index Constraint Tests
// ============================================================================
tap.test('indexengine: unique index should prevent duplicate inserts', async () => {
// Create fresh collection
await storage.dropCollection(TEST_DB, 'uniquetest');
await storage.createCollection(TEST_DB, 'uniquetest');
const uniqueIndexEngine = new IndexEngine(TEST_DB, 'uniquetest', storage);
await uniqueIndexEngine.createIndex({ email: 1 }, { unique: true });
// Insert first document
const doc1 = { _id: new ObjectId(), email: 'test@example.com', name: 'Test' };
const stored1 = await storage.insertOne(TEST_DB, 'uniquetest', doc1);
await uniqueIndexEngine.onInsert(stored1);
// Try to insert duplicate
const doc2 = { _id: new ObjectId(), email: 'test@example.com', name: 'Test2' };
const stored2 = await storage.insertOne(TEST_DB, 'uniquetest', doc2);
let threw = false;
try {
await uniqueIndexEngine.onInsert(stored2);
} catch (e: any) {
threw = true;
expect(e.message).toContain('duplicate key');
}
expect(threw).toBeTrue();
});
// ============================================================================
// Sparse Index Tests
// ============================================================================
tap.test('indexengine: sparse index should not include documents without the field', async () => {
// Create fresh collection
await storage.dropCollection(TEST_DB, 'sparsetest');
await storage.createCollection(TEST_DB, 'sparsetest');
const sparseIndexEngine = new IndexEngine(TEST_DB, 'sparsetest', storage);
await sparseIndexEngine.createIndex({ optionalField: 1 }, { sparse: true });
// Insert doc with the field
const doc1 = { _id: new ObjectId(), optionalField: 'hasValue', name: 'HasField' };
const stored1 = await storage.insertOne(TEST_DB, 'sparsetest', doc1);
await sparseIndexEngine.onInsert(stored1);
// Insert doc without the field
const doc2 = { _id: new ObjectId(), name: 'NoField' };
const stored2 = await storage.insertOne(TEST_DB, 'sparsetest', doc2);
await sparseIndexEngine.onInsert(stored2);
// Search for documents with the field
const candidates = await sparseIndexEngine.findCandidateIds({ optionalField: 'hasValue' });
expect(candidates).toBeTruthy();
expect(candidates!.size).toEqual(1);
expect(candidates!.has(stored1._id.toHexString())).toBeTrue();
});
// ============================================================================
// Cleanup
// ============================================================================
tap.test('indexengine: cleanup', async () => {
await storage.close();
expect(true).toBeTrue();
});
export default tap.start();
-273
View File
@@ -1,273 +0,0 @@
import { expect, tap } from '@git.zone/tstest/tapbundle';
import * as smartdb from '../ts/index.js';
const { QueryPlanner, IndexEngine, MemoryStorageAdapter, ObjectId } = smartdb;
let storage: InstanceType<typeof MemoryStorageAdapter>;
let indexEngine: InstanceType<typeof IndexEngine>;
let queryPlanner: InstanceType<typeof QueryPlanner>;
const TEST_DB = 'testdb';
const TEST_COLL = 'testcoll';
// ============================================================================
// Setup
// ============================================================================
tap.test('queryplanner: should create QueryPlanner instance', async () => {
storage = new MemoryStorageAdapter();
await storage.initialize();
await storage.createCollection(TEST_DB, TEST_COLL);
indexEngine = new IndexEngine(TEST_DB, TEST_COLL, storage);
queryPlanner = new QueryPlanner(indexEngine);
expect(queryPlanner).toBeTruthy();
});
tap.test('queryplanner: should insert test documents', async () => {
// Insert test documents
const docs = [
{ _id: new ObjectId(), name: 'Alice', age: 25, city: 'NYC', category: 'A' },
{ _id: new ObjectId(), name: 'Bob', age: 30, city: 'LA', category: 'B' },
{ _id: new ObjectId(), name: 'Charlie', age: 35, city: 'NYC', category: 'A' },
{ _id: new ObjectId(), name: 'Diana', age: 28, city: 'Chicago', category: 'C' },
{ _id: new ObjectId(), name: 'Eve', age: 32, city: 'LA', category: 'B' },
];
for (const doc of docs) {
await storage.insertOne(TEST_DB, TEST_COLL, doc);
}
});
// ============================================================================
// Basic Plan Tests
// ============================================================================
tap.test('queryplanner: empty filter should result in COLLSCAN', async () => {
const plan = await queryPlanner.plan({});
expect(plan.type).toEqual('COLLSCAN');
expect(plan.indexCovering).toBeFalse();
expect(plan.selectivity).toEqual(1.0);
expect(plan.explanation).toContain('No filter');
});
tap.test('queryplanner: null filter should result in COLLSCAN', async () => {
const plan = await queryPlanner.plan(null as any);
expect(plan.type).toEqual('COLLSCAN');
});
tap.test('queryplanner: filter with no matching index should result in COLLSCAN', async () => {
const plan = await queryPlanner.plan({ nonExistentField: 'value' });
expect(plan.type).toEqual('COLLSCAN');
expect(plan.explanation).toContain('No suitable index');
});
// ============================================================================
// Index Scan Tests (with indexes)
// ============================================================================
tap.test('queryplanner: should create test indexes', async () => {
await indexEngine.createIndex({ age: 1 }, { name: 'age_1' });
await indexEngine.createIndex({ name: 1 }, { name: 'name_1' });
await indexEngine.createIndex({ city: 1, category: 1 }, { name: 'city_category_1' });
const indexes = await indexEngine.listIndexes();
expect(indexes.length).toBeGreaterThanOrEqual(4); // _id_ + 3 created
});
tap.test('queryplanner: simple equality filter should use IXSCAN', async () => {
const plan = await queryPlanner.plan({ age: 30 });
expect(plan.type).toEqual('IXSCAN');
expect(plan.indexName).toEqual('age_1');
expect(plan.indexFieldsUsed).toContain('age');
expect(plan.usesRange).toBeFalse();
});
tap.test('queryplanner: $eq operator should use IXSCAN', async () => {
const plan = await queryPlanner.plan({ name: { $eq: 'Alice' } });
expect(plan.type).toEqual('IXSCAN');
expect(plan.indexName).toEqual('name_1');
expect(plan.indexFieldsUsed).toContain('name');
});
tap.test('queryplanner: range filter ($gt) should use IXSCAN_RANGE', async () => {
const plan = await queryPlanner.plan({ age: { $gt: 25 } });
expect(plan.type).toEqual('IXSCAN_RANGE');
expect(plan.indexName).toEqual('age_1');
expect(plan.usesRange).toBeTrue();
});
tap.test('queryplanner: range filter ($lt) should use IXSCAN_RANGE', async () => {
const plan = await queryPlanner.plan({ age: { $lt: 35 } });
expect(plan.type).toEqual('IXSCAN_RANGE');
expect(plan.usesRange).toBeTrue();
});
tap.test('queryplanner: range filter ($gte, $lte) should use IXSCAN_RANGE', async () => {
const plan = await queryPlanner.plan({ age: { $gte: 25, $lte: 35 } });
expect(plan.type).toEqual('IXSCAN_RANGE');
expect(plan.usesRange).toBeTrue();
});
tap.test('queryplanner: $in operator should use IXSCAN', async () => {
const plan = await queryPlanner.plan({ age: { $in: [25, 30, 35] } });
expect(plan.type).toEqual('IXSCAN');
expect(plan.indexName).toEqual('age_1');
});
// ============================================================================
// Compound Index Tests
// ============================================================================
tap.test('queryplanner: compound index - first field equality should use index', async () => {
const plan = await queryPlanner.plan({ city: 'NYC' });
expect(plan.type).toEqual('IXSCAN');
expect(plan.indexName).toEqual('city_category_1');
expect(plan.indexFieldsUsed).toContain('city');
});
tap.test('queryplanner: compound index - both fields should use full index', async () => {
const plan = await queryPlanner.plan({ city: 'NYC', category: 'A' });
expect(plan.type).toEqual('IXSCAN');
expect(plan.indexName).toEqual('city_category_1');
expect(plan.indexFieldsUsed).toContain('city');
expect(plan.indexFieldsUsed).toContain('category');
expect(plan.indexFieldsUsed.length).toEqual(2);
});
// ============================================================================
// Selectivity Tests
// ============================================================================
tap.test('queryplanner: equality query should have low selectivity', async () => {
const plan = await queryPlanner.plan({ age: 30 });
expect(plan.selectivity).toBeLessThan(0.1);
});
tap.test('queryplanner: range query should have moderate selectivity', async () => {
const plan = await queryPlanner.plan({ age: { $gt: 25 } });
expect(plan.selectivity).toBeGreaterThan(0);
expect(plan.selectivity).toBeLessThan(1);
});
tap.test('queryplanner: $in query selectivity depends on array size', async () => {
const smallInPlan = await queryPlanner.plan({ age: { $in: [25] } });
const largeInPlan = await queryPlanner.plan({ age: { $in: [25, 26, 27, 28, 29, 30] } });
// Larger $in should have higher selectivity (less selective = more documents)
expect(largeInPlan.selectivity).toBeGreaterThanOrEqual(smallInPlan.selectivity);
});
// ============================================================================
// Index Covering Tests
// ============================================================================
tap.test('queryplanner: query covering all filter fields should be index covering', async () => {
const plan = await queryPlanner.plan({ age: 30 });
// All filter fields are covered by the index
expect(plan.indexCovering).toBeTrue();
});
tap.test('queryplanner: query with residual filter should not be index covering', async () => {
const plan = await queryPlanner.plan({ city: 'NYC', name: 'Alice' });
// 'name' is not in the compound index city_category, so it's residual
expect(plan.indexCovering).toBeFalse();
expect(plan.residualFilter).toBeTruthy();
});
// ============================================================================
// Explain Tests
// ============================================================================
tap.test('queryplanner: explain should return detailed plan info', async () => {
const explanation = await queryPlanner.explain({ age: 30 });
expect(explanation.queryPlanner).toBeTruthy();
expect(explanation.queryPlanner.plannerVersion).toEqual(1);
expect(explanation.queryPlanner.winningPlan).toBeTruthy();
expect(explanation.queryPlanner.rejectedPlans).toBeArray();
});
tap.test('queryplanner: explain should include winning and rejected plans', async () => {
const explanation = await queryPlanner.explain({ age: 30 });
expect(explanation.queryPlanner.winningPlan.type).toBeTruthy();
expect(explanation.queryPlanner.rejectedPlans.length).toBeGreaterThan(0);
});
tap.test('queryplanner: explain winning plan should be the best plan', async () => {
const explanation = await queryPlanner.explain({ age: 30 });
// Winning plan should use an index, not collection scan (if index exists)
expect(explanation.queryPlanner.winningPlan.type).toEqual('IXSCAN');
// There should be a COLLSCAN in rejected plans
const hasCOLLSCAN = explanation.queryPlanner.rejectedPlans.some(p => p.type === 'COLLSCAN');
expect(hasCOLLSCAN).toBeTrue();
});
// ============================================================================
// $and Operator Tests
// ============================================================================
tap.test('queryplanner: $and conditions should be analyzed', async () => {
const plan = await queryPlanner.plan({
$and: [
{ age: { $gte: 25 } },
{ age: { $lte: 35 } },
],
});
expect(plan.type).toEqual('IXSCAN_RANGE');
expect(plan.indexName).toEqual('age_1');
});
// ============================================================================
// Edge Cases
// ============================================================================
tap.test('queryplanner: should handle complex nested operators', async () => {
const plan = await queryPlanner.plan({
age: { $gte: 20, $lte: 40 },
city: 'NYC',
});
expect(plan).toBeTruthy();
expect(plan.type).not.toBeUndefined();
});
tap.test('queryplanner: should handle $exists operator', async () => {
await indexEngine.createIndex({ email: 1 }, { name: 'email_1', sparse: true });
const plan = await queryPlanner.plan({ email: { $exists: true } });
// $exists can use sparse indexes
expect(plan).toBeTruthy();
});
// ============================================================================
// Cleanup
// ============================================================================
tap.test('queryplanner: cleanup', async () => {
await storage.close();
expect(true).toBeTrue();
});
export default tap.start();
-361
View File
@@ -1,361 +0,0 @@
import { expect, tap } from '@git.zone/tstest/tapbundle';
import * as smartdb from '../ts/index.js';
const { SessionEngine } = smartdb;
let sessionEngine: InstanceType<typeof SessionEngine>;
// ============================================================================
// Setup
// ============================================================================
tap.test('session: should create SessionEngine instance', async () => {
sessionEngine = new SessionEngine({
sessionTimeoutMs: 1000, // 1 second for testing
cleanupIntervalMs: 10000, // 10 seconds to avoid cleanup during tests
});
expect(sessionEngine).toBeTruthy();
});
// ============================================================================
// Session Lifecycle Tests
// ============================================================================
tap.test('session: startSession should create session with auto-generated ID', async () => {
const session = sessionEngine.startSession();
expect(session).toBeTruthy();
expect(session.id).toBeTruthy();
expect(session.id.length).toBeGreaterThanOrEqual(32); // UUID hex string (32 or 36 with hyphens)
expect(session.createdAt).toBeGreaterThan(0);
expect(session.lastActivityAt).toBeGreaterThan(0);
expect(session.inTransaction).toBeFalse();
});
tap.test('session: startSession should create session with specified ID', async () => {
const customId = 'custom-session-id-12345';
const session = sessionEngine.startSession(customId);
expect(session.id).toEqual(customId);
});
tap.test('session: startSession should create session with metadata', async () => {
const metadata = { client: 'test-client', version: '1.0' };
const session = sessionEngine.startSession(undefined, metadata);
expect(session.metadata).toBeTruthy();
expect(session.metadata!.client).toEqual('test-client');
expect(session.metadata!.version).toEqual('1.0');
});
tap.test('session: getSession should return session by ID', async () => {
const created = sessionEngine.startSession('get-session-test');
const retrieved = sessionEngine.getSession('get-session-test');
expect(retrieved).toBeTruthy();
expect(retrieved!.id).toEqual('get-session-test');
expect(retrieved!.id).toEqual(created.id);
});
tap.test('session: getSession should return undefined for non-existent session', async () => {
const session = sessionEngine.getSession('non-existent-session-id');
expect(session).toBeUndefined();
});
tap.test('session: touchSession should update lastActivityAt', async () => {
const session = sessionEngine.startSession('touch-test-session');
const originalLastActivity = session.lastActivityAt;
// Wait a bit to ensure time difference
await new Promise(resolve => setTimeout(resolve, 10));
const touched = sessionEngine.touchSession('touch-test-session');
expect(touched).toBeTrue();
const updated = sessionEngine.getSession('touch-test-session');
expect(updated!.lastActivityAt).toBeGreaterThanOrEqual(originalLastActivity);
});
tap.test('session: touchSession should return false for non-existent session', async () => {
const touched = sessionEngine.touchSession('non-existent-touch-session');
expect(touched).toBeFalse();
});
tap.test('session: endSession should remove the session', async () => {
sessionEngine.startSession('end-session-test');
expect(sessionEngine.getSession('end-session-test')).toBeTruthy();
const ended = await sessionEngine.endSession('end-session-test');
expect(ended).toBeTrue();
expect(sessionEngine.getSession('end-session-test')).toBeUndefined();
});
tap.test('session: endSession should return false for non-existent session', async () => {
const ended = await sessionEngine.endSession('non-existent-end-session');
expect(ended).toBeFalse();
});
// ============================================================================
// Session Expiry Tests
// ============================================================================
tap.test('session: isSessionExpired should return false for fresh session', async () => {
const session = sessionEngine.startSession('fresh-session');
const isExpired = sessionEngine.isSessionExpired(session);
expect(isExpired).toBeFalse();
});
tap.test('session: isSessionExpired should return true for old session', async () => {
// Create a session with old lastActivityAt
const session = sessionEngine.startSession('old-session');
// Manually set lastActivityAt to old value (sessionTimeoutMs is 1000ms)
(session as any).lastActivityAt = Date.now() - 2000;
const isExpired = sessionEngine.isSessionExpired(session);
expect(isExpired).toBeTrue();
});
tap.test('session: getSession should return undefined for expired session', async () => {
const session = sessionEngine.startSession('expiring-session');
// Manually expire the session
(session as any).lastActivityAt = Date.now() - 2000;
const retrieved = sessionEngine.getSession('expiring-session');
expect(retrieved).toBeUndefined();
});
// ============================================================================
// Transaction Integration Tests
// ============================================================================
tap.test('session: startTransaction should mark session as in transaction', async () => {
sessionEngine.startSession('txn-session-1');
const started = sessionEngine.startTransaction('txn-session-1', 'txn-id-1', 1);
expect(started).toBeTrue();
const session = sessionEngine.getSession('txn-session-1');
expect(session!.inTransaction).toBeTrue();
expect(session!.txnId).toEqual('txn-id-1');
expect(session!.txnNumber).toEqual(1);
});
tap.test('session: startTransaction should return false for non-existent session', async () => {
const started = sessionEngine.startTransaction('non-existent-txn-session', 'txn-id');
expect(started).toBeFalse();
});
tap.test('session: endTransaction should clear transaction state', async () => {
sessionEngine.startSession('txn-session-2');
sessionEngine.startTransaction('txn-session-2', 'txn-id-2');
const ended = sessionEngine.endTransaction('txn-session-2');
expect(ended).toBeTrue();
const session = sessionEngine.getSession('txn-session-2');
expect(session!.inTransaction).toBeFalse();
expect(session!.txnId).toBeUndefined();
expect(session!.txnNumber).toBeUndefined();
});
tap.test('session: endTransaction should return false for non-existent session', async () => {
const ended = sessionEngine.endTransaction('non-existent-end-txn-session');
expect(ended).toBeFalse();
});
tap.test('session: getTransactionId should return transaction ID', async () => {
sessionEngine.startSession('txn-id-session');
sessionEngine.startTransaction('txn-id-session', 'my-txn-id');
const txnId = sessionEngine.getTransactionId('txn-id-session');
expect(txnId).toEqual('my-txn-id');
});
tap.test('session: getTransactionId should return undefined for session without transaction', async () => {
sessionEngine.startSession('no-txn-session');
const txnId = sessionEngine.getTransactionId('no-txn-session');
expect(txnId).toBeUndefined();
});
tap.test('session: getTransactionId should return undefined for non-existent session', async () => {
const txnId = sessionEngine.getTransactionId('non-existent-txn-id-session');
expect(txnId).toBeUndefined();
});
tap.test('session: isInTransaction should return correct state', async () => {
sessionEngine.startSession('in-txn-check-session');
expect(sessionEngine.isInTransaction('in-txn-check-session')).toBeFalse();
sessionEngine.startTransaction('in-txn-check-session', 'txn-check');
expect(sessionEngine.isInTransaction('in-txn-check-session')).toBeTrue();
sessionEngine.endTransaction('in-txn-check-session');
expect(sessionEngine.isInTransaction('in-txn-check-session')).toBeFalse();
});
tap.test('session: isInTransaction should return false for non-existent session', async () => {
expect(sessionEngine.isInTransaction('non-existent-in-txn-session')).toBeFalse();
});
// ============================================================================
// Session Listing Tests
// ============================================================================
tap.test('session: listSessions should return all active sessions', async () => {
// Close and recreate to have a clean slate
sessionEngine.close();
sessionEngine = new SessionEngine({
sessionTimeoutMs: 10000,
cleanupIntervalMs: 60000,
});
sessionEngine.startSession('list-session-1');
sessionEngine.startSession('list-session-2');
sessionEngine.startSession('list-session-3');
const sessions = sessionEngine.listSessions();
expect(sessions.length).toEqual(3);
});
tap.test('session: listSessions should not include expired sessions', async () => {
const session = sessionEngine.startSession('expired-list-session');
// Expire the session
(session as any).lastActivityAt = Date.now() - 20000;
const sessions = sessionEngine.listSessions();
const found = sessions.find(s => s.id === 'expired-list-session');
expect(found).toBeUndefined();
});
tap.test('session: getSessionCount should return correct count', async () => {
const count = sessionEngine.getSessionCount();
expect(count).toBeGreaterThanOrEqual(3); // We created 3 sessions above
});
tap.test('session: getSessionsWithTransactions should filter correctly', async () => {
// Clean slate
sessionEngine.close();
sessionEngine = new SessionEngine({
sessionTimeoutMs: 10000,
cleanupIntervalMs: 60000,
});
sessionEngine.startSession('no-txn-1');
sessionEngine.startSession('no-txn-2');
sessionEngine.startSession('with-txn-1');
sessionEngine.startSession('with-txn-2');
sessionEngine.startTransaction('with-txn-1', 'txn-a');
sessionEngine.startTransaction('with-txn-2', 'txn-b');
const txnSessions = sessionEngine.getSessionsWithTransactions();
expect(txnSessions.length).toEqual(2);
expect(txnSessions.every(s => s.inTransaction)).toBeTrue();
});
// ============================================================================
// getOrCreateSession Tests
// ============================================================================
tap.test('session: getOrCreateSession should create if missing', async () => {
const session = sessionEngine.getOrCreateSession('get-or-create-new');
expect(session).toBeTruthy();
expect(session.id).toEqual('get-or-create-new');
});
tap.test('session: getOrCreateSession should return existing session', async () => {
const created = sessionEngine.startSession('get-or-create-existing');
const retrieved = sessionEngine.getOrCreateSession('get-or-create-existing');
expect(retrieved.id).toEqual(created.id);
expect(retrieved.createdAt).toEqual(created.createdAt);
});
tap.test('session: getOrCreateSession should touch existing session', async () => {
const session = sessionEngine.startSession('get-or-create-touch');
const originalLastActivity = session.lastActivityAt;
await new Promise(resolve => setTimeout(resolve, 10));
sessionEngine.getOrCreateSession('get-or-create-touch');
const updated = sessionEngine.getSession('get-or-create-touch');
expect(updated!.lastActivityAt).toBeGreaterThanOrEqual(originalLastActivity);
});
// ============================================================================
// extractSessionId Static Method Tests
// ============================================================================
tap.test('session: extractSessionId should handle UUID object', async () => {
const { ObjectId } = smartdb;
const uuid = new smartdb.plugins.bson.UUID();
const lsid = { id: uuid };
const extracted = SessionEngine.extractSessionId(lsid);
expect(extracted).toEqual(uuid.toHexString());
});
tap.test('session: extractSessionId should handle string ID', async () => {
const lsid = { id: 'string-session-id' };
const extracted = SessionEngine.extractSessionId(lsid);
expect(extracted).toEqual('string-session-id');
});
tap.test('session: extractSessionId should handle binary format', async () => {
const binaryData = Buffer.from('test-binary-uuid', 'utf8').toString('base64');
const lsid = { id: { $binary: { base64: binaryData } } };
const extracted = SessionEngine.extractSessionId(lsid);
expect(extracted).toBeTruthy();
expect(typeof extracted).toEqual('string');
});
tap.test('session: extractSessionId should return undefined for null/undefined', async () => {
expect(SessionEngine.extractSessionId(null)).toBeUndefined();
expect(SessionEngine.extractSessionId(undefined)).toBeUndefined();
});
tap.test('session: extractSessionId should return undefined for empty object', async () => {
expect(SessionEngine.extractSessionId({})).toBeUndefined();
});
// ============================================================================
// refreshSession Tests
// ============================================================================
tap.test('session: refreshSession should update lastActivityAt', async () => {
const session = sessionEngine.startSession('refresh-session-test');
const originalLastActivity = session.lastActivityAt;
await new Promise(resolve => setTimeout(resolve, 10));
const refreshed = sessionEngine.refreshSession('refresh-session-test');
expect(refreshed).toBeTrue();
const updated = sessionEngine.getSession('refresh-session-test');
expect(updated!.lastActivityAt).toBeGreaterThanOrEqual(originalLastActivity);
});
tap.test('session: refreshSession should return false for non-existent session', async () => {
const refreshed = sessionEngine.refreshSession('non-existent-refresh-session');
expect(refreshed).toBeFalse();
});
// ============================================================================
// Cleanup
// ============================================================================
tap.test('session: close should clear all sessions', async () => {
sessionEngine.startSession('close-test-session');
expect(sessionEngine.getSessionCount()).toBeGreaterThan(0);
sessionEngine.close();
expect(sessionEngine.getSessionCount()).toEqual(0);
});
export default tap.start();
-411
View File
@@ -1,411 +0,0 @@
import { expect, tap } from '@git.zone/tstest/tapbundle';
import * as smartdb from '../ts/index.js';
import * as path from 'path';
import * as fs from 'fs/promises';
const { WAL, ObjectId } = smartdb;
let wal: InstanceType<typeof WAL>;
const TEST_WAL_PATH = '/tmp/smartdb-test-wal/test.wal';
// Helper to clean up test files
async function cleanupTestFiles() {
try {
await fs.rm('/tmp/smartdb-test-wal', { recursive: true, force: true });
} catch {
// Ignore if doesn't exist
}
}
// ============================================================================
// Setup
// ============================================================================
tap.test('wal: cleanup before tests', async () => {
await cleanupTestFiles();
});
tap.test('wal: should create WAL instance', async () => {
wal = new WAL(TEST_WAL_PATH, { checkpointInterval: 100 });
expect(wal).toBeTruthy();
});
tap.test('wal: should initialize WAL', async () => {
const result = await wal.initialize();
expect(result).toBeTruthy();
expect(result.recoveredEntries).toBeArray();
expect(result.recoveredEntries.length).toEqual(0);
});
// ============================================================================
// LSN Tests
// ============================================================================
tap.test('wal: getCurrentLsn should return 0 initially', async () => {
const lsn = wal.getCurrentLsn();
expect(lsn).toEqual(0);
});
tap.test('wal: LSN should increment after logging', async () => {
const doc = { _id: new ObjectId(), name: 'Test' };
const lsn = await wal.logInsert('testdb', 'testcoll', doc as any);
expect(lsn).toEqual(1);
expect(wal.getCurrentLsn()).toEqual(1);
});
// ============================================================================
// Insert Logging Tests
// ============================================================================
tap.test('wal: logInsert should create entry with correct structure', async () => {
const doc = { _id: new ObjectId(), name: 'InsertTest', value: 42 };
const lsn = await wal.logInsert('testdb', 'insertcoll', doc as any);
expect(lsn).toBeGreaterThan(0);
const entries = wal.getEntriesAfter(lsn - 1);
const entry = entries.find(e => e.lsn === lsn);
expect(entry).toBeTruthy();
expect(entry!.operation).toEqual('insert');
expect(entry!.dbName).toEqual('testdb');
expect(entry!.collName).toEqual('insertcoll');
expect(entry!.documentId).toEqual(doc._id.toHexString());
expect(entry!.data).toBeTruthy();
expect(entry!.timestamp).toBeGreaterThan(0);
expect(entry!.checksum).toBeGreaterThan(0);
});
tap.test('wal: logInsert with transaction ID', async () => {
const doc = { _id: new ObjectId(), name: 'TxnInsertTest' };
const lsn = await wal.logInsert('testdb', 'insertcoll', doc as any, 'txn-123');
const entries = wal.getEntriesAfter(lsn - 1);
const entry = entries.find(e => e.lsn === lsn);
expect(entry!.txnId).toEqual('txn-123');
});
// ============================================================================
// Update Logging Tests
// ============================================================================
tap.test('wal: logUpdate should store old and new document', async () => {
const oldDoc = { _id: new ObjectId(), name: 'OldName', value: 1 };
const newDoc = { ...oldDoc, name: 'NewName', value: 2 };
const lsn = await wal.logUpdate('testdb', 'updatecoll', oldDoc as any, newDoc as any);
const entries = wal.getEntriesAfter(lsn - 1);
const entry = entries.find(e => e.lsn === lsn);
expect(entry).toBeTruthy();
expect(entry!.operation).toEqual('update');
expect(entry!.data).toBeTruthy();
expect(entry!.previousData).toBeTruthy();
expect(entry!.documentId).toEqual(oldDoc._id.toHexString());
});
// ============================================================================
// Delete Logging Tests
// ============================================================================
tap.test('wal: logDelete should record deleted document', async () => {
const doc = { _id: new ObjectId(), name: 'ToDelete' };
const lsn = await wal.logDelete('testdb', 'deletecoll', doc as any);
const entries = wal.getEntriesAfter(lsn - 1);
const entry = entries.find(e => e.lsn === lsn);
expect(entry).toBeTruthy();
expect(entry!.operation).toEqual('delete');
expect(entry!.previousData).toBeTruthy();
expect(entry!.data).toBeUndefined();
});
// ============================================================================
// Transaction Logging Tests
// ============================================================================
tap.test('wal: logBeginTransaction should create begin entry', async () => {
const lsn = await wal.logBeginTransaction('txn-begin-test');
const entries = wal.getEntriesAfter(lsn - 1);
const entry = entries.find(e => e.lsn === lsn);
expect(entry).toBeTruthy();
expect(entry!.operation).toEqual('begin');
expect(entry!.txnId).toEqual('txn-begin-test');
});
tap.test('wal: logCommitTransaction should create commit entry', async () => {
const lsn = await wal.logCommitTransaction('txn-commit-test');
const entries = wal.getEntriesAfter(lsn - 1);
const entry = entries.find(e => e.lsn === lsn);
expect(entry).toBeTruthy();
expect(entry!.operation).toEqual('commit');
expect(entry!.txnId).toEqual('txn-commit-test');
});
tap.test('wal: logAbortTransaction should create abort entry', async () => {
const lsn = await wal.logAbortTransaction('txn-abort-test');
const entries = wal.getEntriesAfter(lsn - 1);
const entry = entries.find(e => e.lsn === lsn);
expect(entry).toBeTruthy();
expect(entry!.operation).toEqual('abort');
expect(entry!.txnId).toEqual('txn-abort-test');
});
// ============================================================================
// getTransactionEntries Tests
// ============================================================================
tap.test('wal: getTransactionEntries should return entries for transaction', async () => {
// Log a complete transaction
const txnId = 'txn-entries-test';
await wal.logBeginTransaction(txnId);
const doc1 = { _id: new ObjectId(), name: 'TxnDoc1' };
await wal.logInsert('testdb', 'txncoll', doc1 as any, txnId);
const doc2 = { _id: new ObjectId(), name: 'TxnDoc2' };
await wal.logInsert('testdb', 'txncoll', doc2 as any, txnId);
await wal.logCommitTransaction(txnId);
const entries = wal.getTransactionEntries(txnId);
expect(entries.length).toEqual(4); // begin + 2 inserts + commit
expect(entries.every(e => e.txnId === txnId)).toBeTrue();
});
tap.test('wal: getTransactionEntries should return empty for unknown transaction', async () => {
const entries = wal.getTransactionEntries('unknown-txn-id');
expect(entries.length).toEqual(0);
});
// ============================================================================
// getEntriesAfter Tests
// ============================================================================
tap.test('wal: getEntriesAfter should filter by LSN', async () => {
const currentLsn = wal.getCurrentLsn();
// Add more entries
const doc = { _id: new ObjectId(), name: 'AfterTest' };
await wal.logInsert('testdb', 'aftercoll', doc as any);
const entries = wal.getEntriesAfter(currentLsn);
expect(entries.length).toEqual(1);
expect(entries[0].lsn).toBeGreaterThan(currentLsn);
});
tap.test('wal: getEntriesAfter with LSN 0 should return all entries', async () => {
const entries = wal.getEntriesAfter(0);
expect(entries.length).toBeGreaterThan(0);
expect(entries.length).toEqual(wal.getCurrentLsn());
});
// ============================================================================
// Checkpoint Tests
// ============================================================================
tap.test('wal: checkpoint should create checkpoint entry', async () => {
const lsn = await wal.checkpoint();
expect(lsn).toBeGreaterThan(0);
// After checkpoint, getEntriesAfter(checkpoint) should be limited
const entries = wal.getEntriesAfter(0);
expect(entries.some(e => e.operation === 'checkpoint')).toBeTrue();
});
// ============================================================================
// Document Recovery Tests
// ============================================================================
tap.test('wal: recoverDocument should deserialize document from entry', async () => {
const originalDoc = { _id: new ObjectId(), name: 'RecoverTest', nested: { a: 1, b: 2 } };
const lsn = await wal.logInsert('testdb', 'recovercoll', originalDoc as any);
const entries = wal.getEntriesAfter(lsn - 1);
const entry = entries.find(e => e.lsn === lsn);
const recovered = wal.recoverDocument(entry!);
expect(recovered).toBeTruthy();
expect(recovered!.name).toEqual('RecoverTest');
expect(recovered!.nested.a).toEqual(1);
expect(recovered!.nested.b).toEqual(2);
});
tap.test('wal: recoverDocument should return null for entry without data', async () => {
const lsn = await wal.logBeginTransaction('recover-no-data');
const entries = wal.getEntriesAfter(lsn - 1);
const entry = entries.find(e => e.lsn === lsn);
const recovered = wal.recoverDocument(entry!);
expect(recovered).toBeNull();
});
tap.test('wal: recoverPreviousDocument should deserialize previous state', async () => {
const oldDoc = { _id: new ObjectId(), name: 'Old', value: 100 };
const newDoc = { ...oldDoc, name: 'New', value: 200 };
const lsn = await wal.logUpdate('testdb', 'recovercoll', oldDoc as any, newDoc as any);
const entries = wal.getEntriesAfter(lsn - 1);
const entry = entries.find(e => e.lsn === lsn);
const previous = wal.recoverPreviousDocument(entry!);
expect(previous).toBeTruthy();
expect(previous!.name).toEqual('Old');
expect(previous!.value).toEqual(100);
});
tap.test('wal: recoverPreviousDocument should return null for insert entry', async () => {
const doc = { _id: new ObjectId(), name: 'NoPrevious' };
const lsn = await wal.logInsert('testdb', 'recovercoll', doc as any);
const entries = wal.getEntriesAfter(lsn - 1);
const entry = entries.find(e => e.lsn === lsn);
const previous = wal.recoverPreviousDocument(entry!);
expect(previous).toBeNull();
});
// ============================================================================
// WAL Persistence and Recovery Tests
// ============================================================================
tap.test('wal: should persist and recover entries', async () => {
// Close current WAL
await wal.close();
// Create new WAL instance and initialize (should recover)
const wal2 = new WAL(TEST_WAL_PATH, { checkpointInterval: 100 });
const result = await wal2.initialize();
// Should have recovered entries
expect(result.recoveredEntries).toBeArray();
// After checkpoint, there might not be many recoverable entries
// but getCurrentLsn should be preserved or reset
await wal2.close();
});
// ============================================================================
// Entry Checksum Tests
// ============================================================================
tap.test('wal: entries should have valid checksums', async () => {
wal = new WAL(TEST_WAL_PATH + '.checksum', { checkpointInterval: 100 });
await wal.initialize();
const doc = { _id: new ObjectId(), name: 'ChecksumTest' };
const lsn = await wal.logInsert('testdb', 'checksumcoll', doc as any);
const entries = wal.getEntriesAfter(lsn - 1);
const entry = entries.find(e => e.lsn === lsn);
expect(entry!.checksum).toBeGreaterThan(0);
expect(typeof entry!.checksum).toEqual('number');
});
// ============================================================================
// Edge Cases
// ============================================================================
tap.test('wal: should handle special characters in document', async () => {
const doc = {
_id: new ObjectId(),
name: 'Test\nWith\tSpecial\r\nChars',
emoji: '🎉',
unicode: '日本語',
};
const lsn = await wal.logInsert('testdb', 'specialcoll', doc as any);
const entries = wal.getEntriesAfter(lsn - 1);
const entry = entries.find(e => e.lsn === lsn);
const recovered = wal.recoverDocument(entry!);
expect(recovered!.name).toEqual('Test\nWith\tSpecial\r\nChars');
expect(recovered!.emoji).toEqual('🎉');
expect(recovered!.unicode).toEqual('日本語');
});
tap.test('wal: should handle binary data in documents', async () => {
const doc = {
_id: new ObjectId(),
binaryField: Buffer.from([0x00, 0xFF, 0x7F, 0x80]),
};
const lsn = await wal.logInsert('testdb', 'binarycoll', doc as any);
const entries = wal.getEntriesAfter(lsn - 1);
const entry = entries.find(e => e.lsn === lsn);
const recovered = wal.recoverDocument(entry!);
expect(recovered).toBeTruthy();
});
tap.test('wal: should handle nested documents', async () => {
const doc = {
_id: new ObjectId(),
level1: {
level2: {
level3: {
value: 'deep',
},
},
},
};
const lsn = await wal.logInsert('testdb', 'nestedcoll', doc as any);
const entries = wal.getEntriesAfter(lsn - 1);
const entry = entries.find(e => e.lsn === lsn);
const recovered = wal.recoverDocument(entry!);
expect(recovered!.level1.level2.level3.value).toEqual('deep');
});
tap.test('wal: should handle arrays in documents', async () => {
const doc = {
_id: new ObjectId(),
tags: ['a', 'b', 'c'],
numbers: [1, 2, 3],
mixed: [1, 'two', { three: 3 }],
};
const lsn = await wal.logInsert('testdb', 'arraycoll', doc as any);
const entries = wal.getEntriesAfter(lsn - 1);
const entry = entries.find(e => e.lsn === lsn);
const recovered = wal.recoverDocument(entry!);
expect(recovered!.tags).toEqual(['a', 'b', 'c']);
expect(recovered!.numbers).toEqual([1, 2, 3]);
expect(recovered!.mixed[2].three).toEqual(3);
});
// ============================================================================
// Cleanup
// ============================================================================
tap.test('wal: cleanup', async () => {
await wal.close();
await cleanupTestFiles();
expect(true).toBeTrue();
});
export default tap.start();
+2 -2
View File
@@ -3,6 +3,6 @@
*/
export const commitinfo = {
name: '@push.rocks/smartdb',
version: '1.0.1',
description: 'A pure TypeScript MongoDB wire-protocol-compatible database server with pluggable storage, indexing, transactions, and zero external binary dependencies.'
version: '2.5.4',
description: 'A MongoDB-compatible embedded database server with wire protocol support, backed by a high-performance Rust engine.'
}
+14
View File
@@ -7,5 +7,19 @@ export * from './ts_smartdb/index.js';
export { LocalSmartDb } from './ts_local/index.js';
export type { ILocalSmartDbOptions, ILocalSmartDbConnectionInfo } from './ts_local/index.js';
// Export migration
export { StorageMigrator } from './ts_migration/index.js';
// Export commitinfo
export { commitinfo };
// Re-export oplog / debug types for convenience
export type {
IOpLogEntry,
IOpLogResult,
IOpLogStats,
IRevertResult,
ICollectionInfo,
IDocumentsResult,
ISmartDbMetrics,
} from './ts_smartdb/index.js';
+64 -6
View File
@@ -1,8 +1,10 @@
import * as plugins from './plugins.js';
import * as crypto from 'crypto';
import * as fs from 'fs/promises';
import * as net from 'net';
import * as path from 'path';
import * as os from 'os';
import { SmartdbServer } from '../ts_smartdb/index.js';
import { StorageMigrator } from '../ts_migration/index.js';
/**
* Connection information returned by LocalSmartDb.start()
@@ -10,7 +12,7 @@ import { SmartdbServer } from '../ts_smartdb/index.js';
export interface ILocalSmartDbConnectionInfo {
/** The Unix socket file path */
socketPath: string;
/** MongoDB connection URI ready for MongoClient */
/** Connection URI (mongodb:// scheme) ready for MongoClient */
connectionUri: string;
}
@@ -25,8 +27,8 @@ export interface ILocalSmartDbOptions {
* LocalSmartDb - Lightweight local MongoDB-compatible database using Unix sockets
*
* This class wraps SmartdbServer and provides a simple interface for
* starting a local file-based MongoDB-compatible server. Returns connection
* info that you can use with your own MongoDB driver instance.
* starting a local file-based database server. Returns connection
* info that you can use with any compatible driver instance.
*
* @example
* ```typescript
@@ -36,11 +38,11 @@ export interface ILocalSmartDbOptions {
* const db = new LocalSmartDb({ folderPath: './data' });
* const { connectionUri } = await db.start();
*
* // Connect with your own MongoDB client
* // Connect with the driver
* const client = new MongoClient(connectionUri, { directConnection: true });
* await client.connect();
*
* // Use the MongoDB client
* // Use the client
* const collection = client.db('mydb').collection('users');
* await collection.insertOne({ name: 'Alice' });
*
@@ -66,6 +68,55 @@ export class LocalSmartDb {
return path.join(os.tmpdir(), `smartdb-${randomId}.sock`);
}
/**
* Check if a Unix socket is alive by attempting to connect.
*/
private static isSocketAlive(socketPath: string): Promise<boolean> {
return new Promise((resolve) => {
const client = net.createConnection({ path: socketPath }, () => {
client.destroy();
resolve(true);
});
client.on('error', () => {
resolve(false);
});
client.setTimeout(500, () => {
client.destroy();
resolve(false);
});
});
}
/**
* Remove stale smartdb-*.sock files from /tmp.
* A socket is considered stale if connecting to it fails.
*/
private static async cleanStaleSockets(): Promise<void> {
const tmpDir = os.tmpdir();
let entries: string[];
try {
entries = await fs.readdir(tmpDir);
} catch {
return;
}
const socketFiles = entries.filter(
(f) => f.startsWith('smartdb-') && f.endsWith('.sock')
);
for (const name of socketFiles) {
const fullPath = path.join(tmpDir, name);
try {
const stat = await fs.stat(fullPath);
if (!stat.isSocket()) continue;
const alive = await LocalSmartDb.isSocketAlive(fullPath);
if (!alive) {
await fs.unlink(fullPath);
}
} catch {
// File may have been removed already; ignore
}
}
}
/**
* Start the local SmartDB server and return connection info
*/
@@ -74,6 +125,13 @@ export class LocalSmartDb {
throw new Error('LocalSmartDb is already running');
}
// Clean up stale sockets from previous crashed instances
await LocalSmartDb.cleanStaleSockets();
// Run storage migration before starting the Rust engine
const migrator = new StorageMigrator(this.options.folderPath);
await migrator.run();
// Use provided socket path or generate one
this.generatedSocketPath = this.options.socketPath ?? this.generateSocketPath();
+1 -3
View File
@@ -1,3 +1 @@
import * as smartpromise from '@push.rocks/smartpromise';
export { smartpromise };
// Local module plugins - currently no external dependencies needed
@@ -0,0 +1,93 @@
import * as fs from 'fs';
import * as path from 'path';
import { migrateV0ToV1 } from './migrators/v0_to_v1.js';
/**
* Detected storage format version.
* - v0: Legacy JSON format ({db}/{coll}.json files)
* - v1: Bitcask binary format ({db}/{coll}/data.rdb directories)
*/
type TStorageVersion = 0 | 1;
/**
* StorageMigrator — runs before the Rust engine starts.
*
* Detects the current storage format version and runs the appropriate
* migration chain. The Rust engine only knows the current format (v1).
*
* Migration is safe: original files are never modified or deleted.
* On success, a console hint is printed about which old files can be removed.
*/
export class StorageMigrator {
private storagePath: string;
constructor(storagePath: string) {
this.storagePath = storagePath;
}
/**
* Run any needed migrations. Safe to call even if storage is already current.
*/
async run(): Promise<void> {
if (!fs.existsSync(this.storagePath)) {
return; // No data yet — nothing to migrate
}
const version = this.detectVersion();
if (version === 1) {
return; // Already current
}
if (version === 0) {
console.log(`[smartdb] Detected v0 (JSON) storage format at ${this.storagePath}`);
console.log(`[smartdb] Running migration v0 → v1 (Bitcask binary format)...`);
const deletableFiles = await migrateV0ToV1(this.storagePath);
if (deletableFiles.length > 0) {
console.log(`[smartdb] Migration v0 → v1 complete.`);
console.log(`[smartdb] The following old files can be safely deleted:`);
for (const f of deletableFiles) {
console.log(`[smartdb] ${f}`);
}
} else {
console.log(`[smartdb] Migration v0 → v1 complete. No old files to clean up.`);
}
}
}
/**
* Detect the storage format version by inspecting the directory structure.
*
* v0: {db}/{coll}.json files exist
* v1: {db}/{coll}/data.rdb directories exist
*/
private detectVersion(): TStorageVersion {
const entries = fs.readdirSync(this.storagePath, { withFileTypes: true });
for (const entry of entries) {
if (!entry.isDirectory()) continue;
const dbDir = path.join(this.storagePath, entry.name);
const dbEntries = fs.readdirSync(dbDir, { withFileTypes: true });
for (const dbEntry of dbEntries) {
// v1: subdirectory with data.rdb
if (dbEntry.isDirectory()) {
const dataRdb = path.join(dbDir, dbEntry.name, 'data.rdb');
if (fs.existsSync(dataRdb)) {
return 1;
}
}
// v0: .json file (not .indexes.json)
if (dbEntry.isFile() && dbEntry.name.endsWith('.json') && !dbEntry.name.endsWith('.indexes.json')) {
return 0;
}
}
}
// Empty or unrecognized — treat as v1 (fresh start)
return 1;
}
}
+1
View File
@@ -0,0 +1 @@
export { StorageMigrator } from './classes.storagemigrator.js';
+253
View File
@@ -0,0 +1,253 @@
import * as fs from 'fs';
import * as path from 'path';
import * as crypto from 'crypto';
import { BSON } from 'bson';
// ---------------------------------------------------------------------------
// Binary format constants (must match Rust: record.rs)
// ---------------------------------------------------------------------------
/** File-level magic: "SMARTDB\0" */
const FILE_MAGIC = Buffer.from('SMARTDB\0', 'ascii');
/** Current format version */
const FORMAT_VERSION = 1;
/** File type tags */
const FILE_TYPE_DATA = 1;
const FILE_TYPE_HINT = 3;
/** File header total size */
const FILE_HEADER_SIZE = 64;
/** Per-record magic */
const RECORD_MAGIC = 0xDB01;
/** Per-record header size */
const RECORD_HEADER_SIZE = 22; // 2 + 8 + 4 + 4 + 4
// ---------------------------------------------------------------------------
// Binary encoding helpers
// ---------------------------------------------------------------------------
function writeFileHeader(fileType: number): Buffer {
const buf = Buffer.alloc(FILE_HEADER_SIZE, 0);
FILE_MAGIC.copy(buf, 0);
buf.writeUInt16LE(FORMAT_VERSION, 8);
buf.writeUInt8(fileType, 10);
buf.writeUInt32LE(0, 11); // flags
const now = BigInt(Date.now());
buf.writeBigUInt64LE(now, 15);
// bytes 23..64 are reserved (zeros)
return buf;
}
function encodeDataRecord(timestamp: bigint, key: Buffer, value: Buffer): Buffer {
const keyLen = key.length;
const valLen = value.length;
const totalSize = RECORD_HEADER_SIZE + keyLen + valLen;
const buf = Buffer.alloc(totalSize);
// Write header fields (without CRC)
buf.writeUInt16LE(RECORD_MAGIC, 0);
buf.writeBigUInt64LE(timestamp, 2);
buf.writeUInt32LE(keyLen, 10);
buf.writeUInt32LE(valLen, 14);
// CRC placeholder at offset 18..22 (will fill below)
key.copy(buf, RECORD_HEADER_SIZE);
value.copy(buf, RECORD_HEADER_SIZE + keyLen);
// CRC32 covers everything except the CRC field itself:
// bytes [0..18] + bytes [22..]
const crc = crc32(Buffer.concat([
buf.subarray(0, 18),
buf.subarray(22),
]));
buf.writeUInt32LE(crc, 18);
return buf;
}
function encodeHintEntry(key: string, offset: bigint, recordLen: number, valueLen: number, timestamp: bigint): Buffer {
const keyBuf = Buffer.from(key, 'utf-8');
const buf = Buffer.alloc(4 + keyBuf.length + 8 + 4 + 4 + 8);
let pos = 0;
buf.writeUInt32LE(keyBuf.length, pos); pos += 4;
keyBuf.copy(buf, pos); pos += keyBuf.length;
buf.writeBigUInt64LE(offset, pos); pos += 8;
buf.writeUInt32LE(recordLen, pos); pos += 4;
buf.writeUInt32LE(valueLen, pos); pos += 4;
buf.writeBigUInt64LE(timestamp, pos);
return buf;
}
// ---------------------------------------------------------------------------
// CRC32 (matching crc32fast in Rust)
// ---------------------------------------------------------------------------
const CRC32_TABLE = (() => {
const table = new Uint32Array(256);
for (let i = 0; i < 256; i++) {
let crc = i;
for (let j = 0; j < 8; j++) {
crc = (crc & 1) ? (0xEDB88320 ^ (crc >>> 1)) : (crc >>> 1);
}
table[i] = crc;
}
return table;
})();
function crc32(data: Buffer): number {
let crc = 0xFFFFFFFF;
for (let i = 0; i < data.length; i++) {
crc = CRC32_TABLE[(crc ^ data[i]) & 0xFF] ^ (crc >>> 8);
}
return (crc ^ 0xFFFFFFFF) >>> 0;
}
// ---------------------------------------------------------------------------
// Migration: v0 (JSON) → v1 (Bitcask binary)
// ---------------------------------------------------------------------------
interface IKeyDirEntry {
offset: bigint;
recordLen: number;
valueLen: number;
timestamp: bigint;
}
/**
* Migrate a storage directory from v0 (JSON-per-collection) to v1 (Bitcask binary).
*
* - Original .json files are NOT modified or deleted.
* - New v1 files are written into {db}/{coll}/ subdirectories.
* - Returns a list of old files that can be safely deleted.
* - On failure, cleans up any partial new files and throws.
*/
export async function migrateV0ToV1(storagePath: string): Promise<string[]> {
const deletableFiles: string[] = [];
const createdDirs: string[] = [];
try {
const dbEntries = fs.readdirSync(storagePath, { withFileTypes: true });
for (const dbEntry of dbEntries) {
if (!dbEntry.isDirectory()) continue;
const dbDir = path.join(storagePath, dbEntry.name);
const collFiles = fs.readdirSync(dbDir, { withFileTypes: true });
for (const collFile of collFiles) {
if (!collFile.isFile()) continue;
if (!collFile.name.endsWith('.json')) continue;
if (collFile.name.endsWith('.indexes.json')) continue;
const collName = collFile.name.replace(/\.json$/, '');
const jsonPath = path.join(dbDir, collFile.name);
const indexJsonPath = path.join(dbDir, `${collName}.indexes.json`);
// Target directory
const collDir = path.join(dbDir, collName);
if (fs.existsSync(collDir)) {
// Already migrated
continue;
}
console.log(`[smartdb] Migrating ${dbEntry.name}.${collName}...`);
// Read the JSON collection
const jsonData = fs.readFileSync(jsonPath, 'utf-8');
const docs: any[] = JSON.parse(jsonData);
// Create collection directory
fs.mkdirSync(collDir, { recursive: true });
createdDirs.push(collDir);
// Write data.rdb
const dataPath = path.join(collDir, 'data.rdb');
const fd = fs.openSync(dataPath, 'w');
try {
// File header
const headerBuf = writeFileHeader(FILE_TYPE_DATA);
fs.writeSync(fd, headerBuf);
let currentOffset = BigInt(FILE_HEADER_SIZE);
const keydir: Map<string, IKeyDirEntry> = new Map();
const ts = BigInt(Date.now());
for (const doc of docs) {
// Extract _id
let idHex: string;
if (doc._id && doc._id.$oid) {
idHex = doc._id.$oid;
} else if (typeof doc._id === 'string') {
idHex = doc._id;
} else if (doc._id) {
idHex = String(doc._id);
} else {
// Generate a new ObjectId
idHex = crypto.randomBytes(12).toString('hex');
doc._id = { $oid: idHex };
}
// Serialize to BSON
const bsonBytes = BSON.serialize(doc);
const keyBuf = Buffer.from(idHex, 'utf-8');
const valueBuf = Buffer.from(bsonBytes);
const record = encodeDataRecord(ts, keyBuf, valueBuf);
fs.writeSync(fd, record);
keydir.set(idHex, {
offset: currentOffset,
recordLen: record.length,
valueLen: valueBuf.length,
timestamp: ts,
});
currentOffset += BigInt(record.length);
}
fs.fsyncSync(fd);
fs.closeSync(fd);
// Write keydir.hint
const hintPath = path.join(collDir, 'keydir.hint');
const hintFd = fs.openSync(hintPath, 'w');
fs.writeSync(hintFd, writeFileHeader(FILE_TYPE_HINT));
for (const [key, entry] of keydir) {
fs.writeSync(hintFd, encodeHintEntry(key, entry.offset, entry.recordLen, entry.valueLen, entry.timestamp));
}
fs.fsyncSync(hintFd);
fs.closeSync(hintFd);
} catch (writeErr) {
// Clean up on write failure
try { fs.closeSync(fd); } catch {}
throw writeErr;
}
// Copy indexes.json if it exists
if (fs.existsSync(indexJsonPath)) {
const destIndexPath = path.join(collDir, 'indexes.json');
fs.copyFileSync(indexJsonPath, destIndexPath);
deletableFiles.push(indexJsonPath);
} else {
// Write default _id index
const destIndexPath = path.join(collDir, 'indexes.json');
fs.writeFileSync(destIndexPath, JSON.stringify([{ name: '_id_', key: { _id: 1 } }], null, 2));
}
deletableFiles.push(jsonPath);
console.log(`[smartdb] Migrated ${dbEntry.name}.${collName}: ${docs.length} documents`);
}
}
} catch (err) {
// Clean up any partially created directories
for (const dir of createdDirs) {
try {
fs.rmSync(dir, { recursive: true, force: true });
} catch {}
}
throw err;
}
return deletableFiles;
}
-283
View File
@@ -1,283 +0,0 @@
import * as plugins from '../plugins.js';
import type { Document, IStoredDocument, IAggregateOptions } from '../types/interfaces.js';
// Import mingo Aggregator
import { Aggregator } from 'mingo';
/**
* Aggregation engine using mingo for MongoDB-compatible aggregation pipeline execution
*/
export class AggregationEngine {
/**
* Execute an aggregation pipeline on a collection of documents
*/
static aggregate(
documents: IStoredDocument[],
pipeline: Document[],
options?: IAggregateOptions
): Document[] {
if (!pipeline || pipeline.length === 0) {
return documents;
}
// Create mingo aggregator with the pipeline
const aggregator = new Aggregator(pipeline, {
collation: options?.collation as any,
});
// Run the aggregation
const result = aggregator.run(documents);
return Array.isArray(result) ? result : [];
}
/**
* Execute aggregation and return an iterator for lazy evaluation
*/
static *aggregateIterator(
documents: IStoredDocument[],
pipeline: Document[],
options?: IAggregateOptions
): Generator<Document> {
const aggregator = new Aggregator(pipeline, {
collation: options?.collation as any,
});
// Get the cursor from mingo
const cursor = aggregator.stream(documents);
for (const doc of cursor) {
yield doc as Document;
}
}
/**
* Execute a $lookup stage manually (for cross-collection lookups)
* This is used when the lookup references another collection in the same database
*/
static executeLookup(
documents: IStoredDocument[],
lookupSpec: {
from: string;
localField: string;
foreignField: string;
as: string;
},
foreignCollection: IStoredDocument[]
): Document[] {
const { localField, foreignField, as } = lookupSpec;
return documents.map(doc => {
const localValue = this.getNestedValue(doc, localField);
const matches = foreignCollection.filter(foreignDoc => {
const foreignValue = this.getNestedValue(foreignDoc, foreignField);
return this.valuesMatch(localValue, foreignValue);
});
return {
...doc,
[as]: matches,
};
});
}
/**
* Execute a $graphLookup stage manually
*/
static executeGraphLookup(
documents: IStoredDocument[],
graphLookupSpec: {
from: string;
startWith: string | Document;
connectFromField: string;
connectToField: string;
as: string;
maxDepth?: number;
depthField?: string;
restrictSearchWithMatch?: Document;
},
foreignCollection: IStoredDocument[]
): Document[] {
const {
startWith,
connectFromField,
connectToField,
as,
maxDepth = 10,
depthField,
restrictSearchWithMatch,
} = graphLookupSpec;
return documents.map(doc => {
const startValue = typeof startWith === 'string' && startWith.startsWith('$')
? this.getNestedValue(doc, startWith.slice(1))
: startWith;
const results: Document[] = [];
const visited = new Set<string>();
const queue: Array<{ value: any; depth: number }> = [];
// Initialize with start value(s)
const startValues = Array.isArray(startValue) ? startValue : [startValue];
for (const val of startValues) {
queue.push({ value: val, depth: 0 });
}
while (queue.length > 0) {
const { value, depth } = queue.shift()!;
if (depth > maxDepth) continue;
const valueKey = JSON.stringify(value);
if (visited.has(valueKey)) continue;
visited.add(valueKey);
// Find matching documents
for (const foreignDoc of foreignCollection) {
const foreignValue = this.getNestedValue(foreignDoc, connectToField);
if (this.valuesMatch(value, foreignValue)) {
// Check restrictSearchWithMatch
if (restrictSearchWithMatch) {
const matchQuery = new plugins.mingo.Query(restrictSearchWithMatch);
if (!matchQuery.test(foreignDoc)) continue;
}
const resultDoc = depthField
? { ...foreignDoc, [depthField]: depth }
: { ...foreignDoc };
// Avoid duplicates in results
const docKey = foreignDoc._id.toHexString();
if (!results.some(r => r._id?.toHexString?.() === docKey)) {
results.push(resultDoc);
// Add connected values to queue
const nextValue = this.getNestedValue(foreignDoc, connectFromField);
if (nextValue !== undefined) {
const nextValues = Array.isArray(nextValue) ? nextValue : [nextValue];
for (const nv of nextValues) {
queue.push({ value: nv, depth: depth + 1 });
}
}
}
}
}
}
return {
...doc,
[as]: results,
};
});
}
/**
* Execute a $facet stage manually
*/
static executeFacet(
documents: IStoredDocument[],
facetSpec: Record<string, Document[]>
): Document {
const result: Document = {};
for (const [facetName, pipeline] of Object.entries(facetSpec)) {
result[facetName] = this.aggregate(documents, pipeline);
}
return result;
}
/**
* Execute a $unionWith stage
*/
static executeUnionWith(
documents: IStoredDocument[],
otherDocuments: IStoredDocument[],
pipeline?: Document[]
): Document[] {
let unionDocs: Document[] = otherDocuments;
if (pipeline && pipeline.length > 0) {
unionDocs = this.aggregate(otherDocuments, pipeline);
}
return [...documents, ...unionDocs];
}
/**
* Execute a $merge stage (output to another collection)
* Returns the documents that would be inserted/updated
*/
static prepareMerge(
documents: Document[],
mergeSpec: {
into: string;
on?: string | string[];
whenMatched?: 'replace' | 'keepExisting' | 'merge' | 'fail' | Document[];
whenNotMatched?: 'insert' | 'discard' | 'fail';
}
): {
toInsert: Document[];
toUpdate: Array<{ filter: Document; update: Document }>;
onField: string | string[];
whenMatched: string | Document[];
whenNotMatched: string;
} {
const onField = mergeSpec.on || '_id';
const whenMatched = mergeSpec.whenMatched || 'merge';
const whenNotMatched = mergeSpec.whenNotMatched || 'insert';
return {
toInsert: [],
toUpdate: [],
onField,
whenMatched,
whenNotMatched,
};
}
// ============================================================================
// Helper Methods
// ============================================================================
private static getNestedValue(obj: any, path: string): any {
const parts = path.split('.');
let current = obj;
for (const part of parts) {
if (current === null || current === undefined) {
return undefined;
}
current = current[part];
}
return current;
}
private static valuesMatch(a: any, b: any): boolean {
if (a === b) return true;
// Handle ObjectId comparison
if (a instanceof plugins.bson.ObjectId && b instanceof plugins.bson.ObjectId) {
return a.equals(b);
}
// Handle array contains check
if (Array.isArray(a)) {
return a.some(item => this.valuesMatch(item, b));
}
if (Array.isArray(b)) {
return b.some(item => this.valuesMatch(a, item));
}
// Handle Date comparison
if (a instanceof Date && b instanceof Date) {
return a.getTime() === b.getTime();
}
// Handle object comparison
if (typeof a === 'object' && typeof b === 'object' && a !== null && b !== null) {
return JSON.stringify(a) === JSON.stringify(b);
}
return false;
}
}
-798
View File
@@ -1,798 +0,0 @@
import * as plugins from '../plugins.js';
import type { IStorageAdapter } from '../storage/IStorageAdapter.js';
// Simple B-Tree implementation for range queries
// Since sorted-btree has ESM/CJS interop issues, we use a simple custom implementation
class SimpleBTree<K, V> {
private entries: Map<string, { key: K; value: V }> = new Map();
private sortedKeys: K[] = [];
private comparator: (a: K, b: K) => number;
constructor(_unused?: undefined, comparator?: (a: K, b: K) => number) {
this.comparator = comparator || ((a: K, b: K) => {
if (a < b) return -1;
if (a > b) return 1;
return 0;
});
}
private keyToString(key: K): string {
return JSON.stringify(key);
}
set(key: K, value: V): boolean {
const keyStr = this.keyToString(key);
const existed = this.entries.has(keyStr);
this.entries.set(keyStr, { key, value });
if (!existed) {
// Insert in sorted order
const idx = this.sortedKeys.findIndex(k => this.comparator(k, key) > 0);
if (idx === -1) {
this.sortedKeys.push(key);
} else {
this.sortedKeys.splice(idx, 0, key);
}
}
return !existed;
}
get(key: K): V | undefined {
const entry = this.entries.get(this.keyToString(key));
return entry?.value;
}
delete(key: K): boolean {
const keyStr = this.keyToString(key);
if (this.entries.has(keyStr)) {
this.entries.delete(keyStr);
const idx = this.sortedKeys.findIndex(k => this.comparator(k, key) === 0);
if (idx !== -1) {
this.sortedKeys.splice(idx, 1);
}
return true;
}
return false;
}
forRange(
lowKey: K | undefined,
highKey: K | undefined,
lowInclusive: boolean,
highInclusive: boolean,
callback: (value: V, key: K) => void
): void {
for (const key of this.sortedKeys) {
// Check low bound
if (lowKey !== undefined) {
const cmp = this.comparator(key, lowKey);
if (cmp < 0) continue;
if (cmp === 0 && !lowInclusive) continue;
}
// Check high bound
if (highKey !== undefined) {
const cmp = this.comparator(key, highKey);
if (cmp > 0) break;
if (cmp === 0 && !highInclusive) break;
}
const entry = this.entries.get(this.keyToString(key));
if (entry) {
callback(entry.value, key);
}
}
}
}
import type {
Document,
IStoredDocument,
IIndexSpecification,
IIndexInfo,
ICreateIndexOptions,
} from '../types/interfaces.js';
import { SmartdbDuplicateKeyError, SmartdbIndexError } from '../errors/SmartdbErrors.js';
import { QueryEngine } from './QueryEngine.js';
/**
* Comparator for B-Tree that handles mixed types consistently
*/
function indexKeyComparator(a: any, b: any): number {
// Handle null/undefined
if (a === null || a === undefined) {
if (b === null || b === undefined) return 0;
return -1;
}
if (b === null || b === undefined) return 1;
// Handle arrays (compound keys)
if (Array.isArray(a) && Array.isArray(b)) {
for (let i = 0; i < Math.max(a.length, b.length); i++) {
const cmp = indexKeyComparator(a[i], b[i]);
if (cmp !== 0) return cmp;
}
return 0;
}
// Handle ObjectId
if (a instanceof plugins.bson.ObjectId && b instanceof plugins.bson.ObjectId) {
return a.toHexString().localeCompare(b.toHexString());
}
// Handle Date
if (a instanceof Date && b instanceof Date) {
return a.getTime() - b.getTime();
}
// Handle different types - use type ordering (null < number < string < object)
const typeOrder = (v: any): number => {
if (v === null || v === undefined) return 0;
if (typeof v === 'number') return 1;
if (typeof v === 'string') return 2;
if (typeof v === 'boolean') return 3;
if (v instanceof Date) return 4;
if (v instanceof plugins.bson.ObjectId) return 5;
return 6;
};
const typeA = typeOrder(a);
const typeB = typeOrder(b);
if (typeA !== typeB) return typeA - typeB;
// Same type comparison
if (typeof a === 'number') return a - b;
if (typeof a === 'string') return a.localeCompare(b);
if (typeof a === 'boolean') return (a ? 1 : 0) - (b ? 1 : 0);
// Fallback to string comparison
return String(a).localeCompare(String(b));
}
/**
* Index data structure using B-Tree for range queries
*/
interface IIndexData {
name: string;
key: Record<string, 1 | -1 | string>;
unique: boolean;
sparse: boolean;
expireAfterSeconds?: number;
// B-Tree for ordered index lookups (supports range queries)
btree: SimpleBTree<any, Set<string>>;
// Hash map for fast equality lookups
hashMap: Map<string, Set<string>>;
}
/**
* Index engine for managing indexes and query optimization
*/
export class IndexEngine {
private dbName: string;
private collName: string;
private storage: IStorageAdapter;
private indexes: Map<string, IIndexData> = new Map();
private initialized = false;
constructor(dbName: string, collName: string, storage: IStorageAdapter) {
this.dbName = dbName;
this.collName = collName;
this.storage = storage;
}
/**
* Initialize indexes from storage
*/
async initialize(): Promise<void> {
if (this.initialized) return;
const storedIndexes = await this.storage.getIndexes(this.dbName, this.collName);
const documents = await this.storage.findAll(this.dbName, this.collName);
for (const indexSpec of storedIndexes) {
const indexData: IIndexData = {
name: indexSpec.name,
key: indexSpec.key,
unique: indexSpec.unique || false,
sparse: indexSpec.sparse || false,
expireAfterSeconds: indexSpec.expireAfterSeconds,
btree: new SimpleBTree<any, Set<string>>(undefined, indexKeyComparator),
hashMap: new Map(),
};
// Build index entries
for (const doc of documents) {
const keyValue = this.extractKeyValue(doc, indexSpec.key);
if (keyValue !== null || !indexData.sparse) {
const keyStr = JSON.stringify(keyValue);
// Add to hash map
if (!indexData.hashMap.has(keyStr)) {
indexData.hashMap.set(keyStr, new Set());
}
indexData.hashMap.get(keyStr)!.add(doc._id.toHexString());
// Add to B-tree
const existing = indexData.btree.get(keyValue);
if (existing) {
existing.add(doc._id.toHexString());
} else {
indexData.btree.set(keyValue, new Set([doc._id.toHexString()]));
}
}
}
this.indexes.set(indexSpec.name, indexData);
}
this.initialized = true;
}
/**
* Create a new index
*/
async createIndex(
key: Record<string, 1 | -1 | 'text' | '2dsphere'>,
options?: ICreateIndexOptions
): Promise<string> {
await this.initialize();
// Generate index name if not provided
const name = options?.name || this.generateIndexName(key);
// Check if index already exists
if (this.indexes.has(name)) {
return name;
}
// Create index data structure
const indexData: IIndexData = {
name,
key: key as Record<string, 1 | -1 | string>,
unique: options?.unique || false,
sparse: options?.sparse || false,
expireAfterSeconds: options?.expireAfterSeconds,
btree: new SimpleBTree<any, Set<string>>(undefined, indexKeyComparator),
hashMap: new Map(),
};
// Build index from existing documents
const documents = await this.storage.findAll(this.dbName, this.collName);
for (const doc of documents) {
const keyValue = this.extractKeyValue(doc, key);
if (keyValue === null && indexData.sparse) {
continue;
}
const keyStr = JSON.stringify(keyValue);
if (indexData.unique && indexData.hashMap.has(keyStr)) {
throw new SmartdbDuplicateKeyError(
`E11000 duplicate key error index: ${this.dbName}.${this.collName}.$${name}`,
key as Record<string, 1>,
keyValue
);
}
// Add to hash map
if (!indexData.hashMap.has(keyStr)) {
indexData.hashMap.set(keyStr, new Set());
}
indexData.hashMap.get(keyStr)!.add(doc._id.toHexString());
// Add to B-tree
const existing = indexData.btree.get(keyValue);
if (existing) {
existing.add(doc._id.toHexString());
} else {
indexData.btree.set(keyValue, new Set([doc._id.toHexString()]));
}
}
// Store index
this.indexes.set(name, indexData);
await this.storage.saveIndex(this.dbName, this.collName, name, {
key,
unique: options?.unique,
sparse: options?.sparse,
expireAfterSeconds: options?.expireAfterSeconds,
});
return name;
}
/**
* Drop an index
*/
async dropIndex(name: string): Promise<void> {
await this.initialize();
if (name === '_id_') {
throw new SmartdbIndexError('cannot drop _id index');
}
if (!this.indexes.has(name)) {
throw new SmartdbIndexError(`index not found: ${name}`);
}
this.indexes.delete(name);
await this.storage.dropIndex(this.dbName, this.collName, name);
}
/**
* Drop all indexes except _id
*/
async dropAllIndexes(): Promise<void> {
await this.initialize();
const names = Array.from(this.indexes.keys()).filter(n => n !== '_id_');
for (const name of names) {
this.indexes.delete(name);
await this.storage.dropIndex(this.dbName, this.collName, name);
}
}
/**
* List all indexes
*/
async listIndexes(): Promise<IIndexInfo[]> {
await this.initialize();
return Array.from(this.indexes.values()).map(idx => ({
v: 2,
key: idx.key,
name: idx.name,
unique: idx.unique || undefined,
sparse: idx.sparse || undefined,
expireAfterSeconds: idx.expireAfterSeconds,
}));
}
/**
* Check if an index exists
*/
async indexExists(name: string): Promise<boolean> {
await this.initialize();
return this.indexes.has(name);
}
/**
* Update index entries after document insert
*/
async onInsert(doc: IStoredDocument): Promise<void> {
await this.initialize();
for (const [name, indexData] of this.indexes) {
const keyValue = this.extractKeyValue(doc, indexData.key);
if (keyValue === null && indexData.sparse) {
continue;
}
const keyStr = JSON.stringify(keyValue);
// Check unique constraint
if (indexData.unique) {
const existing = indexData.hashMap.get(keyStr);
if (existing && existing.size > 0) {
throw new SmartdbDuplicateKeyError(
`E11000 duplicate key error collection: ${this.dbName}.${this.collName} index: ${name}`,
indexData.key as Record<string, 1>,
keyValue
);
}
}
// Add to hash map
if (!indexData.hashMap.has(keyStr)) {
indexData.hashMap.set(keyStr, new Set());
}
indexData.hashMap.get(keyStr)!.add(doc._id.toHexString());
// Add to B-tree
const btreeSet = indexData.btree.get(keyValue);
if (btreeSet) {
btreeSet.add(doc._id.toHexString());
} else {
indexData.btree.set(keyValue, new Set([doc._id.toHexString()]));
}
}
}
/**
* Update index entries after document update
*/
async onUpdate(oldDoc: IStoredDocument, newDoc: IStoredDocument): Promise<void> {
await this.initialize();
for (const [name, indexData] of this.indexes) {
const oldKeyValue = this.extractKeyValue(oldDoc, indexData.key);
const newKeyValue = this.extractKeyValue(newDoc, indexData.key);
const oldKeyStr = JSON.stringify(oldKeyValue);
const newKeyStr = JSON.stringify(newKeyValue);
// Remove old entry if key changed
if (oldKeyStr !== newKeyStr) {
if (oldKeyValue !== null || !indexData.sparse) {
// Remove from hash map
const oldHashSet = indexData.hashMap.get(oldKeyStr);
if (oldHashSet) {
oldHashSet.delete(oldDoc._id.toHexString());
if (oldHashSet.size === 0) {
indexData.hashMap.delete(oldKeyStr);
}
}
// Remove from B-tree
const oldBtreeSet = indexData.btree.get(oldKeyValue);
if (oldBtreeSet) {
oldBtreeSet.delete(oldDoc._id.toHexString());
if (oldBtreeSet.size === 0) {
indexData.btree.delete(oldKeyValue);
}
}
}
// Add new entry
if (newKeyValue !== null || !indexData.sparse) {
// Check unique constraint
if (indexData.unique) {
const existing = indexData.hashMap.get(newKeyStr);
if (existing && existing.size > 0) {
throw new SmartdbDuplicateKeyError(
`E11000 duplicate key error collection: ${this.dbName}.${this.collName} index: ${name}`,
indexData.key as Record<string, 1>,
newKeyValue
);
}
}
// Add to hash map
if (!indexData.hashMap.has(newKeyStr)) {
indexData.hashMap.set(newKeyStr, new Set());
}
indexData.hashMap.get(newKeyStr)!.add(newDoc._id.toHexString());
// Add to B-tree
const newBtreeSet = indexData.btree.get(newKeyValue);
if (newBtreeSet) {
newBtreeSet.add(newDoc._id.toHexString());
} else {
indexData.btree.set(newKeyValue, new Set([newDoc._id.toHexString()]));
}
}
}
}
}
/**
* Update index entries after document delete
*/
async onDelete(doc: IStoredDocument): Promise<void> {
await this.initialize();
for (const indexData of this.indexes.values()) {
const keyValue = this.extractKeyValue(doc, indexData.key);
if (keyValue === null && indexData.sparse) {
continue;
}
const keyStr = JSON.stringify(keyValue);
// Remove from hash map
const hashSet = indexData.hashMap.get(keyStr);
if (hashSet) {
hashSet.delete(doc._id.toHexString());
if (hashSet.size === 0) {
indexData.hashMap.delete(keyStr);
}
}
// Remove from B-tree
const btreeSet = indexData.btree.get(keyValue);
if (btreeSet) {
btreeSet.delete(doc._id.toHexString());
if (btreeSet.size === 0) {
indexData.btree.delete(keyValue);
}
}
}
}
/**
* Find the best index for a query
*/
selectIndex(filter: Document): { name: string; data: IIndexData } | null {
if (!filter || Object.keys(filter).length === 0) {
return null;
}
// Get filter fields and operators
const filterInfo = this.analyzeFilter(filter);
// Score each index
let bestIndex: { name: string; data: IIndexData } | null = null;
let bestScore = 0;
for (const [name, indexData] of this.indexes) {
const indexFields = Object.keys(indexData.key);
let score = 0;
// Count how many index fields can be used
for (const field of indexFields) {
const info = filterInfo.get(field);
if (!info) break;
// Equality is best
if (info.equality) {
score += 2;
} else if (info.range) {
// Range queries can use B-tree
score += 1;
} else if (info.in) {
score += 1.5;
} else {
break;
}
}
// Prefer unique indexes
if (indexData.unique && score > 0) {
score += 0.5;
}
if (score > bestScore) {
bestScore = score;
bestIndex = { name, data: indexData };
}
}
return bestIndex;
}
/**
* Analyze filter to extract field operators
*/
private analyzeFilter(filter: Document): Map<string, { equality: boolean; range: boolean; in: boolean; ops: Record<string, any> }> {
const result = new Map<string, { equality: boolean; range: boolean; in: boolean; ops: Record<string, any> }>();
for (const [key, value] of Object.entries(filter)) {
if (key.startsWith('$')) continue;
const info = { equality: false, range: false, in: false, ops: {} as Record<string, any> };
if (typeof value !== 'object' || value === null || value instanceof plugins.bson.ObjectId || value instanceof Date) {
info.equality = true;
info.ops['$eq'] = value;
} else {
const ops = value as Record<string, any>;
if (ops.$eq !== undefined) {
info.equality = true;
info.ops['$eq'] = ops.$eq;
}
if (ops.$in !== undefined) {
info.in = true;
info.ops['$in'] = ops.$in;
}
if (ops.$gt !== undefined || ops.$gte !== undefined || ops.$lt !== undefined || ops.$lte !== undefined) {
info.range = true;
if (ops.$gt !== undefined) info.ops['$gt'] = ops.$gt;
if (ops.$gte !== undefined) info.ops['$gte'] = ops.$gte;
if (ops.$lt !== undefined) info.ops['$lt'] = ops.$lt;
if (ops.$lte !== undefined) info.ops['$lte'] = ops.$lte;
}
}
result.set(key, info);
}
return result;
}
/**
* Use index to find candidate document IDs (supports range queries with B-tree)
*/
async findCandidateIds(filter: Document): Promise<Set<string> | null> {
await this.initialize();
const index = this.selectIndex(filter);
if (!index) return null;
const filterInfo = this.analyzeFilter(filter);
const indexFields = Object.keys(index.data.key);
// For single-field indexes with range queries, use B-tree
if (indexFields.length === 1) {
const field = indexFields[0];
const info = filterInfo.get(field);
if (info) {
// Handle equality using hash map (faster)
if (info.equality) {
const keyStr = JSON.stringify(info.ops['$eq']);
return index.data.hashMap.get(keyStr) || new Set();
}
// Handle $in using hash map
if (info.in) {
const results = new Set<string>();
for (const val of info.ops['$in']) {
const keyStr = JSON.stringify(val);
const ids = index.data.hashMap.get(keyStr);
if (ids) {
for (const id of ids) {
results.add(id);
}
}
}
return results;
}
// Handle range queries using B-tree
if (info.range) {
return this.findRangeCandidates(index.data, info.ops);
}
}
} else {
// For compound indexes, use hash map with partial key matching
const equalityValues: Record<string, any> = {};
for (const field of indexFields) {
const info = filterInfo.get(field);
if (!info) break;
if (info.equality) {
equalityValues[field] = info.ops['$eq'];
} else if (info.in) {
// Handle $in with multiple lookups
const results = new Set<string>();
for (const val of info.ops['$in']) {
equalityValues[field] = val;
const keyStr = JSON.stringify(this.buildKeyValue(equalityValues, index.data.key));
const ids = index.data.hashMap.get(keyStr);
if (ids) {
for (const id of ids) {
results.add(id);
}
}
}
return results;
} else {
break; // Non-equality/in operator, stop here
}
}
if (Object.keys(equalityValues).length > 0) {
const keyStr = JSON.stringify(this.buildKeyValue(equalityValues, index.data.key));
return index.data.hashMap.get(keyStr) || new Set();
}
}
return null;
}
/**
* Find candidates using B-tree range scan
*/
private findRangeCandidates(indexData: IIndexData, ops: Record<string, any>): Set<string> {
const results = new Set<string>();
let lowKey: any = undefined;
let highKey: any = undefined;
let lowInclusive = true;
let highInclusive = true;
if (ops['$gt'] !== undefined) {
lowKey = ops['$gt'];
lowInclusive = false;
}
if (ops['$gte'] !== undefined) {
lowKey = ops['$gte'];
lowInclusive = true;
}
if (ops['$lt'] !== undefined) {
highKey = ops['$lt'];
highInclusive = false;
}
if (ops['$lte'] !== undefined) {
highKey = ops['$lte'];
highInclusive = true;
}
// Use B-tree range iteration
indexData.btree.forRange(lowKey, highKey, lowInclusive, highInclusive, (value, key) => {
if (value) {
for (const id of value) {
results.add(id);
}
}
});
return results;
}
// ============================================================================
// Helper Methods
// ============================================================================
private generateIndexName(key: Record<string, any>): string {
return Object.entries(key)
.map(([field, dir]) => `${field}_${dir}`)
.join('_');
}
private extractKeyValue(doc: Document, key: Record<string, any>): any {
const values: any[] = [];
for (const field of Object.keys(key)) {
const value = QueryEngine.getNestedValue(doc, field);
values.push(value === undefined ? null : value);
}
// For single-field index, return the value directly
if (values.length === 1) {
return values[0];
}
return values;
}
private buildKeyValue(values: Record<string, any>, key: Record<string, any>): any {
const result: any[] = [];
for (const field of Object.keys(key)) {
result.push(values[field] !== undefined ? values[field] : null);
}
if (result.length === 1) {
return result[0];
}
return result;
}
private getFilterFields(filter: Document, prefix = ''): string[] {
const fields: string[] = [];
for (const [key, value] of Object.entries(filter)) {
if (key.startsWith('$')) {
// Logical operator
if (key === '$and' || key === '$or' || key === '$nor') {
for (const subFilter of value as Document[]) {
fields.push(...this.getFilterFields(subFilter, prefix));
}
}
} else {
const fullKey = prefix ? `${prefix}.${key}` : key;
fields.push(fullKey);
// Check for nested filters
if (typeof value === 'object' && value !== null && !Array.isArray(value)) {
const subKeys = Object.keys(value);
if (subKeys.length > 0 && !subKeys[0].startsWith('$')) {
fields.push(...this.getFilterFields(value, fullKey));
}
}
}
}
return fields;
}
private getFilterValue(filter: Document, field: string): any {
// Handle dot notation
const parts = field.split('.');
let current: any = filter;
for (const part of parts) {
if (current === null || current === undefined) {
return undefined;
}
current = current[part];
}
return current;
}
}
-301
View File
@@ -1,301 +0,0 @@
import * as plugins from '../plugins.js';
import type { Document, IStoredDocument, ISortSpecification, ISortDirection } from '../types/interfaces.js';
// Import mingo Query class
import { Query } from 'mingo';
/**
* Query engine using mingo for MongoDB-compatible query matching
*/
export class QueryEngine {
/**
* Filter documents by a MongoDB query filter
*/
static filter(documents: IStoredDocument[], filter: Document): IStoredDocument[] {
if (!filter || Object.keys(filter).length === 0) {
return documents;
}
const query = new Query(filter);
return documents.filter(doc => query.test(doc));
}
/**
* Test if a single document matches a filter
*/
static matches(document: Document, filter: Document): boolean {
if (!filter || Object.keys(filter).length === 0) {
return true;
}
const query = new Query(filter);
return query.test(document);
}
/**
* Find a single document matching the filter
*/
static findOne(documents: IStoredDocument[], filter: Document): IStoredDocument | null {
if (!filter || Object.keys(filter).length === 0) {
return documents[0] || null;
}
const query = new Query(filter);
for (const doc of documents) {
if (query.test(doc)) {
return doc;
}
}
return null;
}
/**
* Sort documents by a sort specification
*/
static sort(documents: IStoredDocument[], sort: ISortSpecification): IStoredDocument[] {
if (!sort) {
return documents;
}
// Normalize sort specification to array of [field, direction] pairs
const sortFields: Array<[string, number]> = [];
if (Array.isArray(sort)) {
for (const [field, direction] of sort) {
sortFields.push([field, this.normalizeDirection(direction)]);
}
} else {
for (const [field, direction] of Object.entries(sort)) {
sortFields.push([field, this.normalizeDirection(direction)]);
}
}
return [...documents].sort((a, b) => {
for (const [field, direction] of sortFields) {
const aVal = this.getNestedValue(a, field);
const bVal = this.getNestedValue(b, field);
const comparison = this.compareValues(aVal, bVal);
if (comparison !== 0) {
return comparison * direction;
}
}
return 0;
});
}
/**
* Apply projection to documents
*/
static project(documents: IStoredDocument[], projection: Document): Document[] {
if (!projection || Object.keys(projection).length === 0) {
return documents;
}
// Determine if this is inclusion or exclusion projection
const keys = Object.keys(projection);
const hasInclusion = keys.some(k => k !== '_id' && projection[k] === 1);
const hasExclusion = keys.some(k => k !== '_id' && projection[k] === 0);
// Can't mix inclusion and exclusion (except for _id)
if (hasInclusion && hasExclusion) {
throw new Error('Cannot mix inclusion and exclusion in projection');
}
return documents.map(doc => {
if (hasInclusion) {
// Inclusion projection
const result: Document = {};
// Handle _id
if (projection._id !== 0 && projection._id !== false) {
result._id = doc._id;
}
for (const key of keys) {
if (key === '_id') continue;
if (projection[key] === 1 || projection[key] === true) {
const value = this.getNestedValue(doc, key);
if (value !== undefined) {
this.setNestedValue(result, key, value);
}
}
}
return result;
} else {
// Exclusion projection - start with copy and remove fields
const result = { ...doc };
for (const key of keys) {
if (projection[key] === 0 || projection[key] === false) {
this.deleteNestedValue(result, key);
}
}
return result;
}
});
}
/**
* Get distinct values for a field
*/
static distinct(documents: IStoredDocument[], field: string, filter?: Document): any[] {
let docs = documents;
if (filter && Object.keys(filter).length > 0) {
docs = this.filter(documents, filter);
}
const values = new Set<any>();
for (const doc of docs) {
const value = this.getNestedValue(doc, field);
if (value !== undefined) {
if (Array.isArray(value)) {
// For arrays, add each element
for (const v of value) {
values.add(this.toComparable(v));
}
} else {
values.add(this.toComparable(value));
}
}
}
return Array.from(values);
}
/**
* Normalize sort direction to 1 or -1
*/
private static normalizeDirection(direction: ISortDirection): number {
if (typeof direction === 'number') {
return direction > 0 ? 1 : -1;
}
if (direction === 'asc' || direction === 'ascending') {
return 1;
}
return -1;
}
/**
* Get a nested value from an object using dot notation
*/
static getNestedValue(obj: any, path: string): any {
const parts = path.split('.');
let current = obj;
for (const part of parts) {
if (current === null || current === undefined) {
return undefined;
}
if (Array.isArray(current)) {
// Handle array access
const index = parseInt(part, 10);
if (!isNaN(index)) {
current = current[index];
} else {
// Get the field from all array elements
return current.map(item => this.getNestedValue(item, part)).flat();
}
} else {
current = current[part];
}
}
return current;
}
/**
* Set a nested value in an object using dot notation
*/
private static setNestedValue(obj: any, path: string, value: any): void {
const parts = path.split('.');
let current = obj;
for (let i = 0; i < parts.length - 1; i++) {
const part = parts[i];
if (!(part in current)) {
current[part] = {};
}
current = current[part];
}
current[parts[parts.length - 1]] = value;
}
/**
* Delete a nested value from an object using dot notation
*/
private static deleteNestedValue(obj: any, path: string): void {
const parts = path.split('.');
let current = obj;
for (let i = 0; i < parts.length - 1; i++) {
const part = parts[i];
if (!(part in current)) {
return;
}
current = current[part];
}
delete current[parts[parts.length - 1]];
}
/**
* Compare two values for sorting
*/
private static compareValues(a: any, b: any): number {
// Handle undefined/null
if (a === undefined && b === undefined) return 0;
if (a === undefined) return -1;
if (b === undefined) return 1;
if (a === null && b === null) return 0;
if (a === null) return -1;
if (b === null) return 1;
// Handle ObjectId
if (a instanceof plugins.bson.ObjectId && b instanceof plugins.bson.ObjectId) {
return a.toHexString().localeCompare(b.toHexString());
}
// Handle dates
if (a instanceof Date && b instanceof Date) {
return a.getTime() - b.getTime();
}
// Handle numbers
if (typeof a === 'number' && typeof b === 'number') {
return a - b;
}
// Handle strings
if (typeof a === 'string' && typeof b === 'string') {
return a.localeCompare(b);
}
// Handle booleans
if (typeof a === 'boolean' && typeof b === 'boolean') {
return (a ? 1 : 0) - (b ? 1 : 0);
}
// Fall back to string comparison
return String(a).localeCompare(String(b));
}
/**
* Convert a value to a comparable form (for distinct)
*/
private static toComparable(value: any): any {
if (value instanceof plugins.bson.ObjectId) {
return value.toHexString();
}
if (value instanceof Date) {
return value.toISOString();
}
if (typeof value === 'object' && value !== null) {
return JSON.stringify(value);
}
return value;
}
}
-393
View File
@@ -1,393 +0,0 @@
import * as plugins from '../plugins.js';
import type { Document, IStoredDocument } from '../types/interfaces.js';
import { IndexEngine } from './IndexEngine.js';
/**
* Query execution plan types
*/
export type TQueryPlanType = 'IXSCAN' | 'COLLSCAN' | 'FETCH' | 'IXSCAN_RANGE';
/**
* Represents a query execution plan
*/
export interface IQueryPlan {
/** The type of scan used */
type: TQueryPlanType;
/** Index name if using an index */
indexName?: string;
/** Index key specification */
indexKey?: Record<string, 1 | -1 | string>;
/** Whether the query can be fully satisfied by the index */
indexCovering: boolean;
/** Estimated selectivity (0-1, lower is more selective) */
selectivity: number;
/** Whether range operators are used */
usesRange: boolean;
/** Fields used from the index */
indexFieldsUsed: string[];
/** Filter conditions that must be applied post-index lookup */
residualFilter?: Document;
/** Explanation for debugging */
explanation: string;
}
/**
* Filter operator analysis
*/
interface IFilterOperatorInfo {
field: string;
operators: string[];
equality: boolean;
range: boolean;
in: boolean;
exists: boolean;
regex: boolean;
values: Record<string, any>;
}
/**
* QueryPlanner - Analyzes queries and selects optimal execution plans
*/
export class QueryPlanner {
private indexEngine: IndexEngine;
constructor(indexEngine: IndexEngine) {
this.indexEngine = indexEngine;
}
/**
* Generate an execution plan for a query filter
*/
async plan(filter: Document): Promise<IQueryPlan> {
await this.indexEngine['initialize']();
// Empty filter = full collection scan
if (!filter || Object.keys(filter).length === 0) {
return {
type: 'COLLSCAN',
indexCovering: false,
selectivity: 1.0,
usesRange: false,
indexFieldsUsed: [],
explanation: 'No filter specified, full collection scan required',
};
}
// Analyze the filter
const operatorInfo = this.analyzeFilter(filter);
// Get available indexes
const indexes = await this.indexEngine.listIndexes();
// Score each index
let bestPlan: IQueryPlan | null = null;
let bestScore = -1;
for (const index of indexes) {
const plan = this.scoreIndex(index, operatorInfo, filter);
if (plan.selectivity < 1.0) {
const score = this.calculateScore(plan);
if (score > bestScore) {
bestScore = score;
bestPlan = plan;
}
}
}
// If no suitable index found, fall back to collection scan
if (!bestPlan || bestScore <= 0) {
return {
type: 'COLLSCAN',
indexCovering: false,
selectivity: 1.0,
usesRange: false,
indexFieldsUsed: [],
explanation: 'No suitable index found for this query',
};
}
return bestPlan;
}
/**
* Analyze filter to extract operator information per field
*/
private analyzeFilter(filter: Document, prefix = ''): Map<string, IFilterOperatorInfo> {
const result = new Map<string, IFilterOperatorInfo>();
for (const [key, value] of Object.entries(filter)) {
// Skip logical operators at the top level
if (key.startsWith('$')) {
if (key === '$and' && Array.isArray(value)) {
// Merge $and conditions
for (const subFilter of value) {
const subInfo = this.analyzeFilter(subFilter, prefix);
for (const [field, info] of subInfo) {
if (result.has(field)) {
// Merge operators
const existing = result.get(field)!;
existing.operators.push(...info.operators);
existing.equality = existing.equality || info.equality;
existing.range = existing.range || info.range;
existing.in = existing.in || info.in;
Object.assign(existing.values, info.values);
} else {
result.set(field, info);
}
}
}
}
continue;
}
const fullKey = prefix ? `${prefix}.${key}` : key;
const info: IFilterOperatorInfo = {
field: fullKey,
operators: [],
equality: false,
range: false,
in: false,
exists: false,
regex: false,
values: {},
};
if (typeof value !== 'object' || value === null || value instanceof plugins.bson.ObjectId || value instanceof Date) {
// Direct equality
info.equality = true;
info.operators.push('$eq');
info.values['$eq'] = value;
} else if (Array.isArray(value)) {
// Array equality (rare, but possible)
info.equality = true;
info.operators.push('$eq');
info.values['$eq'] = value;
} else {
// Operator object
for (const [op, opValue] of Object.entries(value)) {
if (op.startsWith('$')) {
info.operators.push(op);
info.values[op] = opValue;
switch (op) {
case '$eq':
info.equality = true;
break;
case '$ne':
case '$not':
// These can use indexes but with low selectivity
break;
case '$in':
info.in = true;
break;
case '$nin':
// Can't efficiently use indexes
break;
case '$gt':
case '$gte':
case '$lt':
case '$lte':
info.range = true;
break;
case '$exists':
info.exists = true;
break;
case '$regex':
info.regex = true;
break;
}
} else {
// Nested object - recurse
const nestedInfo = this.analyzeFilter({ [op]: opValue }, fullKey);
for (const [nestedField, nestedFieldInfo] of nestedInfo) {
result.set(nestedField, nestedFieldInfo);
}
}
}
}
if (info.operators.length > 0) {
result.set(fullKey, info);
}
}
return result;
}
/**
* Score an index for the given filter
*/
private scoreIndex(
index: { name: string; key: Record<string, any>; unique?: boolean; sparse?: boolean },
operatorInfo: Map<string, IFilterOperatorInfo>,
filter: Document
): IQueryPlan {
const indexFields = Object.keys(index.key);
const usedFields: string[] = [];
let usesRange = false;
let canUseIndex = true;
let selectivity = 1.0;
let residualFilter: Document | undefined;
// Check each index field in order
for (const field of indexFields) {
const info = operatorInfo.get(field);
if (!info) {
// Index field not in filter - stop here
break;
}
usedFields.push(field);
// Calculate selectivity based on operator
if (info.equality) {
// Equality has high selectivity
selectivity *= 0.01; // Assume 1% match
} else if (info.in) {
// $in selectivity depends on array size
const inValues = info.values['$in'];
if (Array.isArray(inValues)) {
selectivity *= Math.min(0.5, inValues.length * 0.01);
} else {
selectivity *= 0.1;
}
} else if (info.range) {
// Range queries have moderate selectivity
selectivity *= 0.25;
usesRange = true;
// After range, can't use more index fields efficiently
break;
} else if (info.exists) {
// $exists can use sparse indexes
selectivity *= 0.5;
} else {
// Other operators may not be indexable
canUseIndex = false;
break;
}
}
if (!canUseIndex || usedFields.length === 0) {
return {
type: 'COLLSCAN',
indexCovering: false,
selectivity: 1.0,
usesRange: false,
indexFieldsUsed: [],
explanation: `Index ${index.name} cannot be used for this query`,
};
}
// Build residual filter for conditions not covered by index
const coveredFields = new Set(usedFields);
const residualConditions: Record<string, any> = {};
for (const [field, info] of operatorInfo) {
if (!coveredFields.has(field)) {
// This field isn't covered by the index
if (info.equality) {
residualConditions[field] = info.values['$eq'];
} else {
residualConditions[field] = info.values;
}
}
}
if (Object.keys(residualConditions).length > 0) {
residualFilter = residualConditions;
}
// Unique indexes have better selectivity for equality
if (index.unique && usedFields.length === indexFields.length) {
selectivity = Math.min(selectivity, 0.001); // At most 1 document
}
return {
type: usesRange ? 'IXSCAN_RANGE' : 'IXSCAN',
indexName: index.name,
indexKey: index.key,
indexCovering: Object.keys(residualConditions).length === 0,
selectivity,
usesRange,
indexFieldsUsed: usedFields,
residualFilter,
explanation: `Using index ${index.name} on fields [${usedFields.join(', ')}]`,
};
}
/**
* Calculate overall score for a plan (higher is better)
*/
private calculateScore(plan: IQueryPlan): number {
let score = 0;
// Lower selectivity is better (fewer documents to fetch)
score += (1 - plan.selectivity) * 100;
// Index covering queries are best
if (plan.indexCovering) {
score += 50;
}
// More index fields used is better
score += plan.indexFieldsUsed.length * 10;
// Equality scans are better than range scans
if (!plan.usesRange) {
score += 20;
}
return score;
}
/**
* Explain a query - returns detailed plan information
*/
async explain(filter: Document): Promise<{
queryPlanner: {
plannerVersion: number;
namespace: string;
indexFilterSet: boolean;
winningPlan: IQueryPlan;
rejectedPlans: IQueryPlan[];
};
}> {
await this.indexEngine['initialize']();
// Analyze the filter
const operatorInfo = this.analyzeFilter(filter);
// Get available indexes
const indexes = await this.indexEngine.listIndexes();
// Score all indexes
const plans: IQueryPlan[] = [];
for (const index of indexes) {
const plan = this.scoreIndex(index, operatorInfo, filter);
plans.push(plan);
}
// Add collection scan as fallback
plans.push({
type: 'COLLSCAN',
indexCovering: false,
selectivity: 1.0,
usesRange: false,
indexFieldsUsed: [],
explanation: 'Full collection scan',
});
// Sort by score (best first)
plans.sort((a, b) => this.calculateScore(b) - this.calculateScore(a));
return {
queryPlanner: {
plannerVersion: 1,
namespace: `${this.indexEngine['dbName']}.${this.indexEngine['collName']}`,
indexFilterSet: false,
winningPlan: plans[0],
rejectedPlans: plans.slice(1),
},
};
}
}
-292
View File
@@ -1,292 +0,0 @@
import * as plugins from '../plugins.js';
import type { TransactionEngine } from './TransactionEngine.js';
/**
* Session state
*/
export interface ISession {
/** Session ID (UUID) */
id: string;
/** Timestamp when the session was created */
createdAt: number;
/** Timestamp of the last activity */
lastActivityAt: number;
/** Current transaction ID if any */
txnId?: string;
/** Transaction number for ordering */
txnNumber?: number;
/** Whether the session is in a transaction */
inTransaction: boolean;
/** Session metadata */
metadata?: Record<string, any>;
}
/**
* Session engine options
*/
export interface ISessionEngineOptions {
/** Session timeout in milliseconds (default: 30 minutes) */
sessionTimeoutMs?: number;
/** Interval to check for expired sessions in ms (default: 60 seconds) */
cleanupIntervalMs?: number;
}
/**
* Session engine for managing client sessions
* - Tracks session lifecycle (create, touch, end)
* - Links sessions to transactions
* - Auto-aborts transactions on session expiry
*/
export class SessionEngine {
private sessions: Map<string, ISession> = new Map();
private sessionTimeoutMs: number;
private cleanupInterval?: ReturnType<typeof setInterval>;
private transactionEngine?: TransactionEngine;
constructor(options?: ISessionEngineOptions) {
this.sessionTimeoutMs = options?.sessionTimeoutMs ?? 30 * 60 * 1000; // 30 minutes default
const cleanupIntervalMs = options?.cleanupIntervalMs ?? 60 * 1000; // 1 minute default
// Start cleanup interval
this.cleanupInterval = setInterval(() => {
this.cleanupExpiredSessions();
}, cleanupIntervalMs);
}
/**
* Set the transaction engine to use for auto-abort
*/
setTransactionEngine(engine: TransactionEngine): void {
this.transactionEngine = engine;
}
/**
* Start a new session
*/
startSession(sessionId?: string, metadata?: Record<string, any>): ISession {
const id = sessionId ?? new plugins.bson.UUID().toHexString();
const now = Date.now();
const session: ISession = {
id,
createdAt: now,
lastActivityAt: now,
inTransaction: false,
metadata,
};
this.sessions.set(id, session);
return session;
}
/**
* Get a session by ID
*/
getSession(sessionId: string): ISession | undefined {
const session = this.sessions.get(sessionId);
if (session && this.isSessionExpired(session)) {
// Session expired, clean it up
this.endSession(sessionId);
return undefined;
}
return session;
}
/**
* Touch a session to update last activity time
*/
touchSession(sessionId: string): boolean {
const session = this.sessions.get(sessionId);
if (!session) return false;
if (this.isSessionExpired(session)) {
this.endSession(sessionId);
return false;
}
session.lastActivityAt = Date.now();
return true;
}
/**
* End a session explicitly
* This will also abort any active transaction
*/
async endSession(sessionId: string): Promise<boolean> {
const session = this.sessions.get(sessionId);
if (!session) return false;
// If session has an active transaction, abort it
if (session.inTransaction && session.txnId && this.transactionEngine) {
try {
await this.transactionEngine.abortTransaction(session.txnId);
} catch (e) {
// Ignore abort errors during cleanup
}
}
this.sessions.delete(sessionId);
return true;
}
/**
* Start a transaction in a session
*/
startTransaction(sessionId: string, txnId: string, txnNumber?: number): boolean {
const session = this.sessions.get(sessionId);
if (!session) return false;
if (this.isSessionExpired(session)) {
this.endSession(sessionId);
return false;
}
session.txnId = txnId;
session.txnNumber = txnNumber;
session.inTransaction = true;
session.lastActivityAt = Date.now();
return true;
}
/**
* End a transaction in a session (commit or abort)
*/
endTransaction(sessionId: string): boolean {
const session = this.sessions.get(sessionId);
if (!session) return false;
session.txnId = undefined;
session.txnNumber = undefined;
session.inTransaction = false;
session.lastActivityAt = Date.now();
return true;
}
/**
* Get transaction ID for a session
*/
getTransactionId(sessionId: string): string | undefined {
const session = this.sessions.get(sessionId);
return session?.txnId;
}
/**
* Check if session is in a transaction
*/
isInTransaction(sessionId: string): boolean {
const session = this.sessions.get(sessionId);
return session?.inTransaction ?? false;
}
/**
* Check if a session is expired
*/
isSessionExpired(session: ISession): boolean {
return Date.now() - session.lastActivityAt > this.sessionTimeoutMs;
}
/**
* Cleanup expired sessions
* This is called periodically by the cleanup interval
*/
private async cleanupExpiredSessions(): Promise<void> {
const expiredSessions: string[] = [];
for (const [id, session] of this.sessions) {
if (this.isSessionExpired(session)) {
expiredSessions.push(id);
}
}
// End all expired sessions (this will also abort their transactions)
for (const sessionId of expiredSessions) {
await this.endSession(sessionId);
}
}
/**
* Get all active sessions
*/
listSessions(): ISession[] {
const activeSessions: ISession[] = [];
for (const session of this.sessions.values()) {
if (!this.isSessionExpired(session)) {
activeSessions.push(session);
}
}
return activeSessions;
}
/**
* Get session count
*/
getSessionCount(): number {
return this.sessions.size;
}
/**
* Get sessions with active transactions
*/
getSessionsWithTransactions(): ISession[] {
return this.listSessions().filter(s => s.inTransaction);
}
/**
* Refresh session timeout
*/
refreshSession(sessionId: string): boolean {
return this.touchSession(sessionId);
}
/**
* Close the session engine and cleanup
*/
close(): void {
if (this.cleanupInterval) {
clearInterval(this.cleanupInterval);
this.cleanupInterval = undefined;
}
// Clear all sessions
this.sessions.clear();
}
/**
* Get or create a session for a given session ID
* Useful for handling MongoDB driver session requests
*/
getOrCreateSession(sessionId: string): ISession {
let session = this.getSession(sessionId);
if (!session) {
session = this.startSession(sessionId);
} else {
this.touchSession(sessionId);
}
return session;
}
/**
* Extract session ID from MongoDB lsid (logical session ID)
*/
static extractSessionId(lsid: any): string | undefined {
if (!lsid) return undefined;
// MongoDB session ID format: { id: UUID }
if (lsid.id) {
if (lsid.id instanceof plugins.bson.UUID) {
return lsid.id.toHexString();
}
if (typeof lsid.id === 'string') {
return lsid.id;
}
if (lsid.id.$binary?.base64) {
// Binary UUID format
return Buffer.from(lsid.id.$binary.base64, 'base64').toString('hex');
}
}
return undefined;
}
}
-351
View File
@@ -1,351 +0,0 @@
import * as plugins from '../plugins.js';
import type { IStorageAdapter } from '../storage/IStorageAdapter.js';
import type { Document, IStoredDocument, ITransactionOptions } from '../types/interfaces.js';
import { SmartdbTransactionError, SmartdbWriteConflictError } from '../errors/SmartdbErrors.js';
/**
* Transaction state
*/
export interface ITransactionState {
id: string;
sessionId: string;
startTime: plugins.bson.Timestamp;
status: 'active' | 'committed' | 'aborted';
readSet: Map<string, Set<string>>; // ns -> document _ids read
writeSet: Map<string, Map<string, { op: 'insert' | 'update' | 'delete'; doc?: IStoredDocument; originalDoc?: IStoredDocument }>>; // ns -> _id -> operation
snapshots: Map<string, IStoredDocument[]>; // ns -> snapshot of documents
}
/**
* Transaction engine for ACID transaction support
*/
export class TransactionEngine {
private storage: IStorageAdapter;
private transactions: Map<string, ITransactionState> = new Map();
private txnCounter = 0;
constructor(storage: IStorageAdapter) {
this.storage = storage;
}
/**
* Start a new transaction
*/
startTransaction(sessionId: string, options?: ITransactionOptions): string {
this.txnCounter++;
const txnId = `txn_${sessionId}_${this.txnCounter}`;
const transaction: ITransactionState = {
id: txnId,
sessionId,
startTime: new plugins.bson.Timestamp({ t: Math.floor(Date.now() / 1000), i: this.txnCounter }),
status: 'active',
readSet: new Map(),
writeSet: new Map(),
snapshots: new Map(),
};
this.transactions.set(txnId, transaction);
return txnId;
}
/**
* Get a transaction by ID
*/
getTransaction(txnId: string): ITransactionState | undefined {
return this.transactions.get(txnId);
}
/**
* Check if a transaction is active
*/
isActive(txnId: string): boolean {
const txn = this.transactions.get(txnId);
return txn?.status === 'active';
}
/**
* Get or create a snapshot for a namespace
*/
async getSnapshot(txnId: string, dbName: string, collName: string): Promise<IStoredDocument[]> {
const txn = this.transactions.get(txnId);
if (!txn || txn.status !== 'active') {
throw new SmartdbTransactionError('Transaction is not active');
}
const ns = `${dbName}.${collName}`;
if (!txn.snapshots.has(ns)) {
const snapshot = await this.storage.createSnapshot(dbName, collName);
txn.snapshots.set(ns, snapshot);
}
// Apply transaction writes to snapshot
const snapshot = txn.snapshots.get(ns)!;
const writes = txn.writeSet.get(ns);
if (!writes) {
return snapshot;
}
// Create a modified view of the snapshot
const result: IStoredDocument[] = [];
const deletedIds = new Set<string>();
const modifiedDocs = new Map<string, IStoredDocument>();
for (const [idStr, write] of writes) {
if (write.op === 'delete') {
deletedIds.add(idStr);
} else if (write.op === 'update' || write.op === 'insert') {
if (write.doc) {
modifiedDocs.set(idStr, write.doc);
}
}
}
// Add existing documents (not deleted, possibly modified)
for (const doc of snapshot) {
const idStr = doc._id.toHexString();
if (deletedIds.has(idStr)) {
continue;
}
if (modifiedDocs.has(idStr)) {
result.push(modifiedDocs.get(idStr)!);
modifiedDocs.delete(idStr);
} else {
result.push(doc);
}
}
// Add new documents (inserts)
for (const doc of modifiedDocs.values()) {
result.push(doc);
}
return result;
}
/**
* Record a read operation
*/
recordRead(txnId: string, dbName: string, collName: string, docIds: string[]): void {
const txn = this.transactions.get(txnId);
if (!txn || txn.status !== 'active') return;
const ns = `${dbName}.${collName}`;
if (!txn.readSet.has(ns)) {
txn.readSet.set(ns, new Set());
}
const readSet = txn.readSet.get(ns)!;
for (const id of docIds) {
readSet.add(id);
}
}
/**
* Record a write operation (insert)
*/
recordInsert(txnId: string, dbName: string, collName: string, doc: IStoredDocument): void {
const txn = this.transactions.get(txnId);
if (!txn || txn.status !== 'active') {
throw new SmartdbTransactionError('Transaction is not active');
}
const ns = `${dbName}.${collName}`;
if (!txn.writeSet.has(ns)) {
txn.writeSet.set(ns, new Map());
}
txn.writeSet.get(ns)!.set(doc._id.toHexString(), {
op: 'insert',
doc,
});
}
/**
* Record a write operation (update)
*/
recordUpdate(
txnId: string,
dbName: string,
collName: string,
originalDoc: IStoredDocument,
updatedDoc: IStoredDocument
): void {
const txn = this.transactions.get(txnId);
if (!txn || txn.status !== 'active') {
throw new SmartdbTransactionError('Transaction is not active');
}
const ns = `${dbName}.${collName}`;
if (!txn.writeSet.has(ns)) {
txn.writeSet.set(ns, new Map());
}
const idStr = originalDoc._id.toHexString();
const existing = txn.writeSet.get(ns)!.get(idStr);
// If we already have a write for this document, update it
if (existing) {
existing.doc = updatedDoc;
} else {
txn.writeSet.get(ns)!.set(idStr, {
op: 'update',
doc: updatedDoc,
originalDoc,
});
}
}
/**
* Record a write operation (delete)
*/
recordDelete(txnId: string, dbName: string, collName: string, doc: IStoredDocument): void {
const txn = this.transactions.get(txnId);
if (!txn || txn.status !== 'active') {
throw new SmartdbTransactionError('Transaction is not active');
}
const ns = `${dbName}.${collName}`;
if (!txn.writeSet.has(ns)) {
txn.writeSet.set(ns, new Map());
}
const idStr = doc._id.toHexString();
const existing = txn.writeSet.get(ns)!.get(idStr);
if (existing && existing.op === 'insert') {
// If we inserted and then deleted, just remove the write
txn.writeSet.get(ns)!.delete(idStr);
} else {
txn.writeSet.get(ns)!.set(idStr, {
op: 'delete',
originalDoc: doc,
});
}
}
/**
* Commit a transaction
*/
async commitTransaction(txnId: string): Promise<void> {
const txn = this.transactions.get(txnId);
if (!txn) {
throw new SmartdbTransactionError('Transaction not found');
}
if (txn.status !== 'active') {
throw new SmartdbTransactionError(`Cannot commit transaction in state: ${txn.status}`);
}
// Check for write conflicts
for (const [ns, writes] of txn.writeSet) {
const [dbName, collName] = ns.split('.');
const ids = Array.from(writes.keys()).map(id => new plugins.bson.ObjectId(id));
const hasConflicts = await this.storage.hasConflicts(dbName, collName, ids, txn.startTime);
if (hasConflicts) {
txn.status = 'aborted';
throw new SmartdbWriteConflictError();
}
}
// Apply all writes
for (const [ns, writes] of txn.writeSet) {
const [dbName, collName] = ns.split('.');
for (const [idStr, write] of writes) {
switch (write.op) {
case 'insert':
if (write.doc) {
await this.storage.insertOne(dbName, collName, write.doc);
}
break;
case 'update':
if (write.doc) {
await this.storage.updateById(dbName, collName, new plugins.bson.ObjectId(idStr), write.doc);
}
break;
case 'delete':
await this.storage.deleteById(dbName, collName, new plugins.bson.ObjectId(idStr));
break;
}
}
}
txn.status = 'committed';
}
/**
* Abort a transaction
*/
async abortTransaction(txnId: string): Promise<void> {
const txn = this.transactions.get(txnId);
if (!txn) {
throw new SmartdbTransactionError('Transaction not found');
}
if (txn.status !== 'active') {
// Already committed or aborted, just return
return;
}
// Simply discard all buffered writes
txn.writeSet.clear();
txn.readSet.clear();
txn.snapshots.clear();
txn.status = 'aborted';
}
/**
* End a transaction (cleanup)
*/
endTransaction(txnId: string): void {
this.transactions.delete(txnId);
}
/**
* Get all pending writes for a namespace
*/
getPendingWrites(txnId: string, dbName: string, collName: string): Map<string, { op: 'insert' | 'update' | 'delete'; doc?: IStoredDocument }> | undefined {
const txn = this.transactions.get(txnId);
if (!txn) return undefined;
const ns = `${dbName}.${collName}`;
return txn.writeSet.get(ns);
}
/**
* Execute a callback within a transaction, with automatic retry on conflict
*/
async withTransaction<T>(
sessionId: string,
callback: (txnId: string) => Promise<T>,
options?: ITransactionOptions & { maxRetries?: number }
): Promise<T> {
const maxRetries = options?.maxRetries ?? 3;
let lastError: Error | undefined;
for (let attempt = 0; attempt < maxRetries; attempt++) {
const txnId = this.startTransaction(sessionId, options);
try {
const result = await callback(txnId);
await this.commitTransaction(txnId);
this.endTransaction(txnId);
return result;
} catch (error: any) {
await this.abortTransaction(txnId);
this.endTransaction(txnId);
if (error instanceof SmartdbWriteConflictError && attempt < maxRetries - 1) {
// Retry on write conflict
lastError = error;
continue;
}
throw error;
}
}
throw lastError || new SmartdbTransactionError('Transaction failed after max retries');
}
}
-506
View File
@@ -1,506 +0,0 @@
import * as plugins from '../plugins.js';
import type { Document, IStoredDocument } from '../types/interfaces.js';
import { QueryEngine } from './QueryEngine.js';
/**
* Update engine for MongoDB-compatible update operations
*/
export class UpdateEngine {
/**
* Apply an update specification to a document
* Returns the updated document or null if no update was applied
*/
static applyUpdate(document: IStoredDocument, update: Document, arrayFilters?: Document[]): IStoredDocument {
// Check if this is an aggregation pipeline update
if (Array.isArray(update)) {
// Aggregation pipeline updates are not yet supported
throw new Error('Aggregation pipeline updates are not yet supported');
}
// Check if this is a replacement (no $ operators at top level)
const hasOperators = Object.keys(update).some(k => k.startsWith('$'));
if (!hasOperators) {
// This is a replacement - preserve _id
return {
_id: document._id,
...update,
};
}
// Apply update operators
const result = this.deepClone(document);
for (const [operator, operand] of Object.entries(update)) {
switch (operator) {
case '$set':
this.applySet(result, operand);
break;
case '$unset':
this.applyUnset(result, operand);
break;
case '$inc':
this.applyInc(result, operand);
break;
case '$mul':
this.applyMul(result, operand);
break;
case '$min':
this.applyMin(result, operand);
break;
case '$max':
this.applyMax(result, operand);
break;
case '$rename':
this.applyRename(result, operand);
break;
case '$currentDate':
this.applyCurrentDate(result, operand);
break;
case '$setOnInsert':
// Only applied during upsert insert, handled elsewhere
break;
case '$push':
this.applyPush(result, operand, arrayFilters);
break;
case '$pop':
this.applyPop(result, operand);
break;
case '$pull':
this.applyPull(result, operand, arrayFilters);
break;
case '$pullAll':
this.applyPullAll(result, operand);
break;
case '$addToSet':
this.applyAddToSet(result, operand);
break;
case '$bit':
this.applyBit(result, operand);
break;
default:
throw new Error(`Unknown update operator: ${operator}`);
}
}
return result;
}
/**
* Apply $setOnInsert for upsert operations
*/
static applySetOnInsert(document: IStoredDocument, setOnInsert: Document): IStoredDocument {
const result = this.deepClone(document);
this.applySet(result, setOnInsert);
return result;
}
/**
* Deep clone a document
*/
private static deepClone(obj: any): any {
if (obj === null || typeof obj !== 'object') {
return obj;
}
if (obj instanceof plugins.bson.ObjectId) {
return new plugins.bson.ObjectId(obj.toHexString());
}
if (obj instanceof Date) {
return new Date(obj.getTime());
}
if (obj instanceof plugins.bson.Timestamp) {
return new plugins.bson.Timestamp({ t: obj.high, i: obj.low });
}
if (Array.isArray(obj)) {
return obj.map(item => this.deepClone(item));
}
const cloned: any = {};
for (const key of Object.keys(obj)) {
cloned[key] = this.deepClone(obj[key]);
}
return cloned;
}
/**
* Set a nested value
*/
private static setNestedValue(obj: any, path: string, value: any): void {
const parts = path.split('.');
let current = obj;
for (let i = 0; i < parts.length - 1; i++) {
const part = parts[i];
// Handle array index notation
const arrayMatch = part.match(/^(\w+)\[(\d+)\]$/);
if (arrayMatch) {
const [, fieldName, indexStr] = arrayMatch;
const index = parseInt(indexStr, 10);
if (!(fieldName in current)) {
current[fieldName] = [];
}
if (!current[fieldName][index]) {
current[fieldName][index] = {};
}
current = current[fieldName][index];
continue;
}
// Handle numeric index (array positional)
const numIndex = parseInt(part, 10);
if (!isNaN(numIndex) && Array.isArray(current)) {
if (!current[numIndex]) {
current[numIndex] = {};
}
current = current[numIndex];
continue;
}
if (!(part in current) || current[part] === null) {
current[part] = {};
}
current = current[part];
}
const lastPart = parts[parts.length - 1];
const numIndex = parseInt(lastPart, 10);
if (!isNaN(numIndex) && Array.isArray(current)) {
current[numIndex] = value;
} else {
current[lastPart] = value;
}
}
/**
* Get a nested value
*/
private static getNestedValue(obj: any, path: string): any {
return QueryEngine.getNestedValue(obj, path);
}
/**
* Delete a nested value
*/
private static deleteNestedValue(obj: any, path: string): void {
const parts = path.split('.');
let current = obj;
for (let i = 0; i < parts.length - 1; i++) {
const part = parts[i];
if (!(part in current)) {
return;
}
current = current[part];
}
delete current[parts[parts.length - 1]];
}
// ============================================================================
// Field Update Operators
// ============================================================================
private static applySet(doc: any, fields: Document): void {
for (const [path, value] of Object.entries(fields)) {
this.setNestedValue(doc, path, this.deepClone(value));
}
}
private static applyUnset(doc: any, fields: Document): void {
for (const path of Object.keys(fields)) {
this.deleteNestedValue(doc, path);
}
}
private static applyInc(doc: any, fields: Document): void {
for (const [path, value] of Object.entries(fields)) {
const current = this.getNestedValue(doc, path) || 0;
if (typeof current !== 'number') {
throw new Error(`Cannot apply $inc to non-numeric field: ${path}`);
}
this.setNestedValue(doc, path, current + (value as number));
}
}
private static applyMul(doc: any, fields: Document): void {
for (const [path, value] of Object.entries(fields)) {
const current = this.getNestedValue(doc, path) || 0;
if (typeof current !== 'number') {
throw new Error(`Cannot apply $mul to non-numeric field: ${path}`);
}
this.setNestedValue(doc, path, current * (value as number));
}
}
private static applyMin(doc: any, fields: Document): void {
for (const [path, value] of Object.entries(fields)) {
const current = this.getNestedValue(doc, path);
if (current === undefined || this.compareValues(value, current) < 0) {
this.setNestedValue(doc, path, this.deepClone(value));
}
}
}
private static applyMax(doc: any, fields: Document): void {
for (const [path, value] of Object.entries(fields)) {
const current = this.getNestedValue(doc, path);
if (current === undefined || this.compareValues(value, current) > 0) {
this.setNestedValue(doc, path, this.deepClone(value));
}
}
}
private static applyRename(doc: any, fields: Document): void {
for (const [oldPath, newPath] of Object.entries(fields)) {
const value = this.getNestedValue(doc, oldPath);
if (value !== undefined) {
this.deleteNestedValue(doc, oldPath);
this.setNestedValue(doc, newPath as string, value);
}
}
}
private static applyCurrentDate(doc: any, fields: Document): void {
for (const [path, spec] of Object.entries(fields)) {
if (spec === true) {
this.setNestedValue(doc, path, new Date());
} else if (typeof spec === 'object' && spec.$type === 'date') {
this.setNestedValue(doc, path, new Date());
} else if (typeof spec === 'object' && spec.$type === 'timestamp') {
this.setNestedValue(doc, path, new plugins.bson.Timestamp({ t: Math.floor(Date.now() / 1000), i: 0 }));
}
}
}
// ============================================================================
// Array Update Operators
// ============================================================================
private static applyPush(doc: any, fields: Document, arrayFilters?: Document[]): void {
for (const [path, spec] of Object.entries(fields)) {
let arr = this.getNestedValue(doc, path);
if (arr === undefined) {
arr = [];
this.setNestedValue(doc, path, arr);
}
if (!Array.isArray(arr)) {
throw new Error(`Cannot apply $push to non-array field: ${path}`);
}
if (spec && typeof spec === 'object' && '$each' in spec) {
// $push with modifiers
let elements = (spec.$each as any[]).map(e => this.deepClone(e));
const position = spec.$position as number | undefined;
const slice = spec.$slice as number | undefined;
const sortSpec = spec.$sort;
if (position !== undefined) {
arr.splice(position, 0, ...elements);
} else {
arr.push(...elements);
}
if (sortSpec !== undefined) {
if (typeof sortSpec === 'number') {
arr.sort((a, b) => (a - b) * sortSpec);
} else {
// Sort by field(s)
const entries = Object.entries(sortSpec as Document);
arr.sort((a, b) => {
for (const [field, dir] of entries) {
const av = this.getNestedValue(a, field);
const bv = this.getNestedValue(b, field);
const cmp = this.compareValues(av, bv) * (dir as number);
if (cmp !== 0) return cmp;
}
return 0;
});
}
}
if (slice !== undefined) {
if (slice >= 0) {
arr.splice(slice);
} else {
arr.splice(0, arr.length + slice);
}
}
} else {
// Simple push
arr.push(this.deepClone(spec));
}
}
}
private static applyPop(doc: any, fields: Document): void {
for (const [path, direction] of Object.entries(fields)) {
const arr = this.getNestedValue(doc, path);
if (!Array.isArray(arr)) {
throw new Error(`Cannot apply $pop to non-array field: ${path}`);
}
if ((direction as number) === 1) {
arr.pop();
} else {
arr.shift();
}
}
}
private static applyPull(doc: any, fields: Document, arrayFilters?: Document[]): void {
for (const [path, condition] of Object.entries(fields)) {
const arr = this.getNestedValue(doc, path);
if (!Array.isArray(arr)) {
continue; // Skip if not an array
}
if (typeof condition === 'object' && condition !== null && !Array.isArray(condition)) {
// Condition is a query filter
const hasOperators = Object.keys(condition).some(k => k.startsWith('$'));
if (hasOperators) {
// Filter using query operators
const remaining = arr.filter(item => !QueryEngine.matches(item, condition));
arr.length = 0;
arr.push(...remaining);
} else {
// Match documents with all specified fields
const remaining = arr.filter(item => {
if (typeof item !== 'object' || item === null) {
return true;
}
return !Object.entries(condition).every(([k, v]) => {
const itemVal = this.getNestedValue(item, k);
return this.valuesEqual(itemVal, v);
});
});
arr.length = 0;
arr.push(...remaining);
}
} else {
// Direct value match
const remaining = arr.filter(item => !this.valuesEqual(item, condition));
arr.length = 0;
arr.push(...remaining);
}
}
}
private static applyPullAll(doc: any, fields: Document): void {
for (const [path, values] of Object.entries(fields)) {
const arr = this.getNestedValue(doc, path);
if (!Array.isArray(arr)) {
continue;
}
if (!Array.isArray(values)) {
throw new Error(`$pullAll requires an array argument`);
}
const valueSet = new Set(values.map(v => JSON.stringify(v)));
const remaining = arr.filter(item => !valueSet.has(JSON.stringify(item)));
arr.length = 0;
arr.push(...remaining);
}
}
private static applyAddToSet(doc: any, fields: Document): void {
for (const [path, spec] of Object.entries(fields)) {
let arr = this.getNestedValue(doc, path);
if (arr === undefined) {
arr = [];
this.setNestedValue(doc, path, arr);
}
if (!Array.isArray(arr)) {
throw new Error(`Cannot apply $addToSet to non-array field: ${path}`);
}
const existingSet = new Set(arr.map(v => JSON.stringify(v)));
if (spec && typeof spec === 'object' && '$each' in spec) {
for (const item of spec.$each as any[]) {
const key = JSON.stringify(item);
if (!existingSet.has(key)) {
arr.push(this.deepClone(item));
existingSet.add(key);
}
}
} else {
const key = JSON.stringify(spec);
if (!existingSet.has(key)) {
arr.push(this.deepClone(spec));
}
}
}
}
private static applyBit(doc: any, fields: Document): void {
for (const [path, operations] of Object.entries(fields)) {
let current = this.getNestedValue(doc, path) || 0;
if (typeof current !== 'number') {
throw new Error(`Cannot apply $bit to non-numeric field: ${path}`);
}
for (const [op, value] of Object.entries(operations as Document)) {
switch (op) {
case 'and':
current = current & (value as number);
break;
case 'or':
current = current | (value as number);
break;
case 'xor':
current = current ^ (value as number);
break;
}
}
this.setNestedValue(doc, path, current);
}
}
// ============================================================================
// Helper Methods
// ============================================================================
private static compareValues(a: any, b: any): number {
if (a === b) return 0;
if (a === null || a === undefined) return -1;
if (b === null || b === undefined) return 1;
if (typeof a === 'number' && typeof b === 'number') {
return a - b;
}
if (a instanceof Date && b instanceof Date) {
return a.getTime() - b.getTime();
}
if (typeof a === 'string' && typeof b === 'string') {
return a.localeCompare(b);
}
return String(a).localeCompare(String(b));
}
private static valuesEqual(a: any, b: any): boolean {
if (a === b) return true;
if (a instanceof plugins.bson.ObjectId && b instanceof plugins.bson.ObjectId) {
return a.equals(b);
}
if (a instanceof Date && b instanceof Date) {
return a.getTime() === b.getTime();
}
if (typeof a === 'object' && typeof b === 'object' && a !== null && b !== null) {
return JSON.stringify(a) === JSON.stringify(b);
}
return false;
}
}
-181
View File
@@ -1,181 +0,0 @@
/**
* Base error class for all SmartDB errors
* Mirrors MongoDB driver error hierarchy
*/
export class SmartdbError extends Error {
public code?: number;
public codeName?: string;
constructor(message: string, code?: number, codeName?: string) {
super(message);
this.name = 'SmartdbError';
this.code = code;
this.codeName = codeName;
Object.setPrototypeOf(this, new.target.prototype);
}
}
/**
* Error thrown during connection issues
*/
export class SmartdbConnectionError extends SmartdbError {
constructor(message: string) {
super(message);
this.name = 'SmartdbConnectionError';
}
}
/**
* Error thrown when an operation times out
*/
export class SmartdbTimeoutError extends SmartdbError {
constructor(message: string) {
super(message, 50, 'MaxTimeMSExpired');
this.name = 'SmartdbTimeoutError';
}
}
/**
* Error thrown during write operations
*/
export class SmartdbWriteError extends SmartdbError {
public writeErrors?: IWriteError[];
public result?: any;
constructor(message: string, code?: number, writeErrors?: IWriteError[]) {
super(message, code);
this.name = 'SmartdbWriteError';
this.writeErrors = writeErrors;
}
}
/**
* Error thrown for duplicate key violations
*/
export class SmartdbDuplicateKeyError extends SmartdbWriteError {
public keyPattern?: Record<string, 1>;
public keyValue?: Record<string, any>;
constructor(message: string, keyPattern?: Record<string, 1>, keyValue?: Record<string, any>) {
super(message, 11000);
this.name = 'SmartdbDuplicateKeyError';
this.codeName = 'DuplicateKey';
this.keyPattern = keyPattern;
this.keyValue = keyValue;
}
}
/**
* Error thrown for bulk write failures
*/
export class SmartdbBulkWriteError extends SmartdbError {
public writeErrors: IWriteError[];
public result: any;
constructor(message: string, writeErrors: IWriteError[], result: any) {
super(message, 65);
this.name = 'SmartdbBulkWriteError';
this.writeErrors = writeErrors;
this.result = result;
}
}
/**
* Error thrown during transaction operations
*/
export class SmartdbTransactionError extends SmartdbError {
constructor(message: string, code?: number) {
super(message, code);
this.name = 'SmartdbTransactionError';
}
}
/**
* Error thrown when a transaction is aborted due to conflict
*/
export class SmartdbWriteConflictError extends SmartdbTransactionError {
constructor(message: string = 'Write conflict during transaction') {
super(message, 112);
this.name = 'SmartdbWriteConflictError';
this.codeName = 'WriteConflict';
}
}
/**
* Error thrown for invalid arguments
*/
export class SmartdbArgumentError extends SmartdbError {
constructor(message: string) {
super(message);
this.name = 'SmartdbArgumentError';
}
}
/**
* Error thrown when an operation is not supported
*/
export class SmartdbNotSupportedError extends SmartdbError {
constructor(message: string) {
super(message, 115);
this.name = 'SmartdbNotSupportedError';
this.codeName = 'CommandNotSupported';
}
}
/**
* Error thrown when cursor is exhausted or closed
*/
export class SmartdbCursorError extends SmartdbError {
constructor(message: string) {
super(message);
this.name = 'SmartdbCursorError';
}
}
/**
* Error thrown when a namespace (database.collection) is invalid
*/
export class SmartdbNamespaceError extends SmartdbError {
constructor(message: string) {
super(message, 73);
this.name = 'SmartdbNamespaceError';
this.codeName = 'InvalidNamespace';
}
}
/**
* Error thrown when an index operation fails
*/
export class SmartdbIndexError extends SmartdbError {
constructor(message: string, code?: number) {
super(message, code || 86);
this.name = 'SmartdbIndexError';
}
}
/**
* Write error detail for bulk operations
*/
export interface IWriteError {
index: number;
code: number;
errmsg: string;
op: any;
}
/**
* Convert any error to a SmartdbError
*/
export function toSmartdbError(error: any): SmartdbError {
if (error instanceof SmartdbError) {
return error;
}
const smartdbError = new SmartdbError(error.message || String(error));
if (error.code) {
smartdbError.code = error.code;
}
if (error.codeName) {
smartdbError.codeName = error.codeName;
}
return smartdbError;
}
+13 -40
View File
@@ -1,46 +1,19 @@
// SmartDB - MongoDB Wire Protocol compatible in-memory database server
// Use the official MongoDB driver to connect to SmartdbServer
// Re-export plugins for external use
import * as plugins from './plugins.js';
export { plugins };
// Export BSON types for convenience
export { ObjectId, Binary, Timestamp, Long, Decimal128, UUID } from 'bson';
// Export all types
export * from './types/interfaces.js';
// Export errors
export * from './errors/SmartdbErrors.js';
// Export storage adapters
export type { IStorageAdapter } from './storage/IStorageAdapter.js';
export { MemoryStorageAdapter } from './storage/MemoryStorageAdapter.js';
export { FileStorageAdapter } from './storage/FileStorageAdapter.js';
export { OpLog } from './storage/OpLog.js';
export { WAL } from './storage/WAL.js';
export type { IWalEntry, TWalOperation } from './storage/WAL.js';
// Export engines
export { QueryEngine } from './engine/QueryEngine.js';
export { UpdateEngine } from './engine/UpdateEngine.js';
export { AggregationEngine } from './engine/AggregationEngine.js';
export { IndexEngine } from './engine/IndexEngine.js';
export { TransactionEngine } from './engine/TransactionEngine.js';
export { QueryPlanner } from './engine/QueryPlanner.js';
export type { IQueryPlan, TQueryPlanType } from './engine/QueryPlanner.js';
export { SessionEngine } from './engine/SessionEngine.js';
export type { ISession, ISessionEngineOptions } from './engine/SessionEngine.js';
// SmartDB - Wire protocol compatible embedded database server
// Export server (the main entry point for using SmartDB)
export { SmartdbServer } from './server/SmartdbServer.js';
export type { ISmartdbServerOptions } from './server/SmartdbServer.js';
// Export wire protocol utilities (for advanced usage)
export { WireProtocol } from './server/WireProtocol.js';
export { CommandRouter } from './server/CommandRouter.js';
export type { ICommandHandler, IHandlerContext, ICursorState } from './server/CommandRouter.js';
// Export bridge for advanced usage
export { RustDbBridge } from './rust-db-bridge.js';
// Export utilities
export * from './utils/checksum.js';
// Export oplog / debug types
export type {
IOpLogEntry,
IOpLogResult,
IOpLogStats,
IRevertResult,
ICollectionInfo,
IDocumentsResult,
ISmartDbMetrics,
} from './rust-db-bridge.js';
+2 -15
View File
@@ -1,17 +1,4 @@
// @push.rocks scope
import * as smartfs from '@push.rocks/smartfs';
import * as smartpath from '@push.rocks/smartpath';
import * as smartpromise from '@push.rocks/smartpromise';
import * as smartrx from '@push.rocks/smartrx';
import * as smartrust from '@push.rocks/smartrust';
export { smartfs, smartpath, smartpromise, smartrx };
// thirdparty
import * as bson from 'bson';
import * as mingo from 'mingo';
export { bson, mingo };
// Re-export commonly used mingo classes
export { Query } from 'mingo';
export { Aggregator } from 'mingo';
export { smartrust };
+262
View File
@@ -0,0 +1,262 @@
import * as plugins from './plugins.js';
import * as path from 'path';
import * as url from 'url';
import { EventEmitter } from 'events';
/**
* A single oplog entry returned from the Rust engine.
*/
export interface IOpLogEntry {
seq: number;
timestampMs: number;
op: 'insert' | 'update' | 'delete';
db: string;
collection: string;
documentId: string;
document: Record<string, any> | null;
previousDocument: Record<string, any> | null;
}
/**
* Aggregate oplog statistics.
*/
export interface IOpLogStats {
currentSeq: number;
totalEntries: number;
oldestSeq: number;
entriesByOp: {
insert: number;
update: number;
delete: number;
};
}
/**
* Result of a getOpLog query.
*/
export interface IOpLogResult {
entries: IOpLogEntry[];
currentSeq: number;
totalEntries: number;
}
/**
* Result of a revertToSeq command.
*/
export interface IRevertResult {
dryRun: boolean;
reverted: number;
targetSeq?: number;
entries?: IOpLogEntry[];
errors?: string[];
}
/**
* A collection info entry.
*/
export interface ICollectionInfo {
db: string;
name: string;
count: number;
}
/**
* Result of a getDocuments query.
*/
export interface IDocumentsResult {
documents: Record<string, any>[];
total: number;
}
/**
* Server metrics.
*/
export interface ISmartDbMetrics {
databases: number;
collections: number;
oplogEntries: number;
oplogCurrentSeq: number;
uptimeSeconds: number;
}
/**
* Type-safe command definitions for the RustDb IPC protocol.
*/
type TSmartDbCommands = {
start: { params: { config: ISmartDbRustConfig }; result: { connectionUri: string } };
stop: { params: Record<string, never>; result: void };
getStatus: { params: Record<string, never>; result: { running: boolean } };
getMetrics: { params: Record<string, never>; result: ISmartDbMetrics };
getOpLog: {
params: { sinceSeq?: number; limit?: number; db?: string; collection?: string };
result: IOpLogResult;
};
getOpLogStats: { params: Record<string, never>; result: IOpLogStats };
revertToSeq: {
params: { seq: number; dryRun?: boolean };
result: IRevertResult;
};
getCollections: {
params: { db?: string };
result: { collections: ICollectionInfo[] };
};
getDocuments: {
params: { db: string; collection: string; limit?: number; skip?: number };
result: IDocumentsResult;
};
};
/**
* Configuration sent to the Rust binary on start.
*/
interface ISmartDbRustConfig {
port?: number;
host?: string;
socketPath?: string;
storage: 'memory' | 'file';
storagePath?: string;
persistPath?: string;
persistIntervalMs?: number;
}
/**
* Get the package root directory using import.meta.url.
* This file is at ts/ts_smartdb/, so package root is 2 levels up.
*/
function getPackageRoot(): string {
const thisDir = path.dirname(url.fileURLToPath(import.meta.url));
return path.resolve(thisDir, '..', '..');
}
/**
* Map Node.js process.platform/process.arch to tsrust's friendly name suffix.
* tsrust names cross-compiled binaries as: rustdb_linux_amd64, rustdb_linux_arm64, etc.
*/
function getTsrustPlatformSuffix(): string | null {
const archMap: Record<string, string> = { x64: 'amd64', arm64: 'arm64' };
const osMap: Record<string, string> = { linux: 'linux', darwin: 'macos' };
const os = osMap[process.platform];
const arch = archMap[process.arch];
if (os && arch) {
return `${os}_${arch}`;
}
return null;
}
/**
* Build local search paths for the Rust binary, including dist_rust/ candidates
* (built by tsrust) and local development build paths.
*/
function buildLocalPaths(): string[] {
const packageRoot = getPackageRoot();
const suffix = getTsrustPlatformSuffix();
const paths: string[] = [];
// dist_rust/ candidates (tsrust cross-compiled output)
if (suffix) {
paths.push(path.join(packageRoot, 'dist_rust', `rustdb_${suffix}`));
}
paths.push(path.join(packageRoot, 'dist_rust', 'rustdb'));
// Local dev build paths
paths.push(path.resolve(process.cwd(), 'rust', 'target', 'release', 'rustdb'));
paths.push(path.resolve(process.cwd(), 'rust', 'target', 'debug', 'rustdb'));
return paths;
}
/**
* Bridge between TypeScript SmartdbServer and the Rust binary.
* Wraps @push.rocks/smartrust's RustBridge with type-safe command definitions.
*/
export class RustDbBridge extends EventEmitter {
private bridge: plugins.smartrust.RustBridge<TSmartDbCommands>;
constructor() {
super();
this.bridge = new plugins.smartrust.RustBridge<TSmartDbCommands>({
binaryName: 'rustdb',
envVarName: 'SMARTDB_RUST_BINARY',
platformPackagePrefix: '@push.rocks/smartdb',
localPaths: buildLocalPaths(),
maxPayloadSize: 10 * 1024 * 1024, // 10 MB
});
// Forward events from the inner bridge
this.bridge.on('exit', (code: number | null, signal: string | null) => {
this.emit('exit', code, signal);
});
}
/**
* Spawn the Rust binary in management mode.
* Returns true if the binary was found and spawned successfully.
*/
public async spawn(): Promise<boolean> {
return this.bridge.spawn();
}
/**
* Kill the Rust process and clean up.
*/
public kill(): void {
this.bridge.kill();
}
/**
* Whether the bridge is currently running.
*/
public get running(): boolean {
return this.bridge.running;
}
// --- Convenience methods for each management command ---
public async startDb(config: ISmartDbRustConfig): Promise<{ connectionUri: string }> {
return await this.bridge.sendCommand('start', { config }) as { connectionUri: string };
}
public async stopDb(): Promise<void> {
await this.bridge.sendCommand('stop', {} as Record<string, never>);
}
public async getStatus(): Promise<{ running: boolean }> {
return await this.bridge.sendCommand('getStatus', {} as Record<string, never>) as { running: boolean };
}
public async getMetrics(): Promise<ISmartDbMetrics> {
return this.bridge.sendCommand('getMetrics', {} as Record<string, never>) as Promise<ISmartDbMetrics>;
}
public async getOpLog(params: {
sinceSeq?: number;
limit?: number;
db?: string;
collection?: string;
} = {}): Promise<IOpLogResult> {
return this.bridge.sendCommand('getOpLog', params) as Promise<IOpLogResult>;
}
public async getOpLogStats(): Promise<IOpLogStats> {
return this.bridge.sendCommand('getOpLogStats', {} as Record<string, never>) as Promise<IOpLogStats>;
}
public async revertToSeq(seq: number, dryRun = false): Promise<IRevertResult> {
return this.bridge.sendCommand('revertToSeq', { seq, dryRun }) as Promise<IRevertResult>;
}
public async getCollections(db?: string): Promise<ICollectionInfo[]> {
const result = await this.bridge.sendCommand('getCollections', db ? { db } : {}) as { collections: ICollectionInfo[] };
return result.collections;
}
public async getDocuments(
db: string,
collection: string,
limit = 50,
skip = 0,
): Promise<IDocumentsResult> {
return this.bridge.sendCommand('getDocuments', { db, collection, limit, skip }) as Promise<IDocumentsResult>;
}
}
-289
View File
@@ -1,289 +0,0 @@
import * as plugins from '../plugins.js';
import type { IStorageAdapter } from '../storage/IStorageAdapter.js';
import type { IParsedCommand } from './WireProtocol.js';
import type { SmartdbServer } from './SmartdbServer.js';
import { IndexEngine } from '../engine/IndexEngine.js';
import { TransactionEngine } from '../engine/TransactionEngine.js';
import { SessionEngine } from '../engine/SessionEngine.js';
// Import handlers
import { HelloHandler } from './handlers/HelloHandler.js';
import { InsertHandler } from './handlers/InsertHandler.js';
import { FindHandler } from './handlers/FindHandler.js';
import { UpdateHandler } from './handlers/UpdateHandler.js';
import { DeleteHandler } from './handlers/DeleteHandler.js';
import { AggregateHandler } from './handlers/AggregateHandler.js';
import { IndexHandler } from './handlers/IndexHandler.js';
import { AdminHandler } from './handlers/AdminHandler.js';
/**
* Handler context passed to command handlers
*/
export interface IHandlerContext {
storage: IStorageAdapter;
server: SmartdbServer;
database: string;
command: plugins.bson.Document;
documentSequences?: Map<string, plugins.bson.Document[]>;
/** Get or create an IndexEngine for a collection */
getIndexEngine: (collName: string) => IndexEngine;
/** Transaction engine instance */
transactionEngine: TransactionEngine;
/** Current transaction ID (if in a transaction) */
txnId?: string;
/** Session ID (from lsid) */
sessionId?: string;
/** Session engine instance */
sessionEngine: SessionEngine;
}
/**
* Command handler interface
*/
export interface ICommandHandler {
handle(context: IHandlerContext): Promise<plugins.bson.Document>;
}
/**
* CommandRouter - Routes incoming commands to appropriate handlers
*/
export class CommandRouter {
private storage: IStorageAdapter;
private server: SmartdbServer;
private handlers: Map<string, ICommandHandler> = new Map();
// Cursor state for getMore operations
private cursors: Map<bigint, ICursorState> = new Map();
private cursorIdCounter: bigint = BigInt(1);
// Index engine cache: db.collection -> IndexEngine
private indexEngines: Map<string, IndexEngine> = new Map();
// Transaction engine (shared across all handlers)
private transactionEngine: TransactionEngine;
// Session engine (shared across all handlers)
private sessionEngine: SessionEngine;
constructor(storage: IStorageAdapter, server: SmartdbServer) {
this.storage = storage;
this.server = server;
this.transactionEngine = new TransactionEngine(storage);
this.sessionEngine = new SessionEngine();
// Link session engine to transaction engine for auto-abort on session expiry
this.sessionEngine.setTransactionEngine(this.transactionEngine);
this.registerHandlers();
}
/**
* Get or create an IndexEngine for a database.collection
*/
getIndexEngine(dbName: string, collName: string): IndexEngine {
const key = `${dbName}.${collName}`;
let engine = this.indexEngines.get(key);
if (!engine) {
engine = new IndexEngine(dbName, collName, this.storage);
this.indexEngines.set(key, engine);
}
return engine;
}
/**
* Clear index engine cache for a collection (used when collection is dropped)
*/
clearIndexEngineCache(dbName: string, collName?: string): void {
if (collName) {
this.indexEngines.delete(`${dbName}.${collName}`);
} else {
// Clear all engines for the database
for (const key of this.indexEngines.keys()) {
if (key.startsWith(`${dbName}.`)) {
this.indexEngines.delete(key);
}
}
}
}
/**
* Register all command handlers
*/
private registerHandlers(): void {
// Create handler instances with shared state
const helloHandler = new HelloHandler();
const findHandler = new FindHandler(this.cursors, () => this.cursorIdCounter++);
const insertHandler = new InsertHandler();
const updateHandler = new UpdateHandler();
const deleteHandler = new DeleteHandler();
const aggregateHandler = new AggregateHandler(this.cursors, () => this.cursorIdCounter++);
const indexHandler = new IndexHandler();
const adminHandler = new AdminHandler();
// Handshake commands
this.handlers.set('hello', helloHandler);
this.handlers.set('ismaster', helloHandler);
this.handlers.set('isMaster', helloHandler);
// CRUD commands
this.handlers.set('find', findHandler);
this.handlers.set('insert', insertHandler);
this.handlers.set('update', updateHandler);
this.handlers.set('delete', deleteHandler);
this.handlers.set('findAndModify', updateHandler);
this.handlers.set('getMore', findHandler);
this.handlers.set('killCursors', findHandler);
// Aggregation
this.handlers.set('aggregate', aggregateHandler);
this.handlers.set('count', findHandler);
this.handlers.set('distinct', findHandler);
// Index operations
this.handlers.set('createIndexes', indexHandler);
this.handlers.set('dropIndexes', indexHandler);
this.handlers.set('listIndexes', indexHandler);
// Admin/Database operations
this.handlers.set('ping', adminHandler);
this.handlers.set('listDatabases', adminHandler);
this.handlers.set('listCollections', adminHandler);
this.handlers.set('drop', adminHandler);
this.handlers.set('dropDatabase', adminHandler);
this.handlers.set('create', adminHandler);
this.handlers.set('serverStatus', adminHandler);
this.handlers.set('buildInfo', adminHandler);
this.handlers.set('whatsmyuri', adminHandler);
this.handlers.set('getLog', adminHandler);
this.handlers.set('hostInfo', adminHandler);
this.handlers.set('replSetGetStatus', adminHandler);
this.handlers.set('isMaster', helloHandler);
this.handlers.set('saslStart', adminHandler);
this.handlers.set('saslContinue', adminHandler);
this.handlers.set('endSessions', adminHandler);
this.handlers.set('abortTransaction', adminHandler);
this.handlers.set('commitTransaction', adminHandler);
this.handlers.set('collStats', adminHandler);
this.handlers.set('dbStats', adminHandler);
this.handlers.set('connectionStatus', adminHandler);
this.handlers.set('currentOp', adminHandler);
this.handlers.set('collMod', adminHandler);
this.handlers.set('renameCollection', adminHandler);
}
/**
* Route a command to its handler
*/
async route(parsedCommand: IParsedCommand): Promise<plugins.bson.Document> {
const { commandName, command, database, documentSequences } = parsedCommand;
// Extract session ID from lsid using SessionEngine helper
let sessionId = SessionEngine.extractSessionId(command.lsid);
let txnId: string | undefined;
// If we have a session ID, register/touch the session
if (sessionId) {
this.sessionEngine.getOrCreateSession(sessionId);
}
// Check if this starts a new transaction
if (command.startTransaction && sessionId) {
txnId = this.transactionEngine.startTransaction(sessionId);
this.sessionEngine.startTransaction(sessionId, txnId, command.txnNumber);
} else if (sessionId && this.sessionEngine.isInTransaction(sessionId)) {
// Continue existing transaction
txnId = this.sessionEngine.getTransactionId(sessionId);
// Verify transaction is still active
if (txnId && !this.transactionEngine.isActive(txnId)) {
this.sessionEngine.endTransaction(sessionId);
txnId = undefined;
}
}
// Create handler context
const context: IHandlerContext = {
storage: this.storage,
server: this.server,
database,
command,
documentSequences,
getIndexEngine: (collName: string) => this.getIndexEngine(database, collName),
transactionEngine: this.transactionEngine,
sessionEngine: this.sessionEngine,
txnId,
sessionId,
};
// Find handler
const handler = this.handlers.get(commandName);
if (!handler) {
// Unknown command
return {
ok: 0,
errmsg: `no such command: '${commandName}'`,
code: 59,
codeName: 'CommandNotFound',
};
}
try {
return await handler.handle(context);
} catch (error: any) {
// Handle known error types
if (error.code) {
return {
ok: 0,
errmsg: error.message,
code: error.code,
codeName: error.codeName || 'UnknownError',
};
}
// Generic error
return {
ok: 0,
errmsg: error.message || 'Internal error',
code: 1,
codeName: 'InternalError',
};
}
}
/**
* Close the command router and cleanup resources
*/
close(): void {
// Close session engine (stops cleanup interval, clears sessions)
this.sessionEngine.close();
// Clear cursors
this.cursors.clear();
// Clear index engine cache
this.indexEngines.clear();
}
/**
* Get session engine (for administrative purposes)
*/
getSessionEngine(): SessionEngine {
return this.sessionEngine;
}
/**
* Get transaction engine (for administrative purposes)
*/
getTransactionEngine(): TransactionEngine {
return this.transactionEngine;
}
}
/**
* Cursor state for multi-batch queries
*/
export interface ICursorState {
id: bigint;
database: string;
collection: string;
documents: plugins.bson.Document[];
position: number;
batchSize: number;
createdAt: Date;
}
+120 -244
View File
@@ -1,11 +1,14 @@
import * as net from 'net';
import * as fs from 'fs/promises';
import * as plugins from '../plugins.js';
import { WireProtocol, OP_QUERY } from './WireProtocol.js';
import { CommandRouter } from './CommandRouter.js';
import { MemoryStorageAdapter } from '../storage/MemoryStorageAdapter.js';
import { FileStorageAdapter } from '../storage/FileStorageAdapter.js';
import type { IStorageAdapter } from '../storage/IStorageAdapter.js';
import { RustDbBridge } from '../rust-db-bridge.js';
import { StorageMigrator } from '../../ts_migration/index.js';
import type {
IOpLogEntry,
IOpLogResult,
IOpLogStats,
IRevertResult,
ICollectionInfo,
IDocumentsResult,
ISmartDbMetrics,
} from '../rust-db-bridge.js';
/**
* Server configuration options
@@ -28,90 +31,41 @@ export interface ISmartdbServerOptions {
}
/**
* Connection state for each client
*/
interface IConnectionState {
id: number;
socket: net.Socket;
buffer: Buffer;
authenticated: boolean;
database: string;
}
/**
* SmartdbServer - MongoDB Wire Protocol compatible server
* SmartdbServer - Wire protocol compatible database server backed by Rust
*
* This server implements the MongoDB wire protocol (OP_MSG) to allow
* official MongoDB drivers to connect and perform operations.
* This server implements the wire protocol to allow official drivers to
* connect and perform operations. The core engine runs as a Rust sidecar
* binary managed via @push.rocks/smartrust IPC.
*
* @example
* ```typescript
* import { SmartdbServer } from '@push.rocks/smartmongo/smartdb';
* import { SmartdbServer } from '@push.rocks/smartdb';
* import { MongoClient } from 'mongodb';
*
* const server = new SmartdbServer({ port: 27017 });
* await server.start();
*
* const client = new MongoClient('mongodb://127.0.0.1:27017');
* const client = new MongoClient(server.getConnectionUri());
* await client.connect();
* ```
*/
export class SmartdbServer {
private options: Required<Omit<ISmartdbServerOptions, 'socketPath'>> & { socketPath: string };
private server: net.Server | null = null;
private storage: IStorageAdapter;
private commandRouter: CommandRouter;
private connections: Map<number, IConnectionState> = new Map();
private connectionIdCounter = 0;
private options: ISmartdbServerOptions;
private bridge: RustDbBridge;
private isRunning = false;
private startTime: Date = new Date();
private useSocket: boolean;
private resolvedConnectionUri = '';
constructor(options: ISmartdbServerOptions = {}) {
this.useSocket = !!options.socketPath;
this.options = {
port: options.port ?? 27017,
host: options.host ?? '127.0.0.1',
socketPath: options.socketPath ?? '',
socketPath: options.socketPath,
storage: options.storage ?? 'memory',
storagePath: options.storagePath ?? './data',
persistPath: options.persistPath ?? '',
persistPath: options.persistPath,
persistIntervalMs: options.persistIntervalMs ?? 60000,
};
// Create storage adapter
if (this.options.storage === 'file') {
this.storage = new FileStorageAdapter(this.options.storagePath);
} else {
this.storage = new MemoryStorageAdapter({
persistPath: this.options.persistPath || undefined,
persistIntervalMs: this.options.persistPath ? this.options.persistIntervalMs : undefined,
});
}
// Create command router
this.commandRouter = new CommandRouter(this.storage, this);
}
/**
* Get the storage adapter (for testing/debugging)
*/
getStorage(): IStorageAdapter {
return this.storage;
}
/**
* Get server uptime in seconds
*/
getUptime(): number {
return Math.floor((Date.now() - this.startTime.getTime()) / 1000);
}
/**
* Get current connection count
*/
getConnectionCount(): number {
return this.connections.size;
this.bridge = new RustDbBridge();
}
/**
@@ -122,213 +76,80 @@ export class SmartdbServer {
throw new Error('Server is already running');
}
// Initialize storage
await this.storage.initialize();
// Clean up stale socket file if using Unix socket
if (this.useSocket && this.options.socketPath) {
try {
await fs.unlink(this.options.socketPath);
} catch (err: any) {
// Ignore ENOENT (file doesn't exist)
if (err.code !== 'ENOENT') {
throw err;
}
}
// Run storage migration for file-based storage before starting Rust engine
if (this.options.storage === 'file' && this.options.storagePath) {
const migrator = new StorageMigrator(this.options.storagePath);
await migrator.run();
}
return new Promise((resolve, reject) => {
this.server = net.createServer((socket) => {
this.handleConnection(socket);
});
const spawned = await this.bridge.spawn();
if (!spawned) {
throw new Error(
'smartdb Rust binary not found. Set SMARTDB_RUST_BINARY env var, ' +
'install the platform package, or build locally with `tsrust`.'
);
}
this.server.on('error', (err) => {
if (!this.isRunning) {
reject(err);
} else {
console.error('Server error:', err);
// Forward unexpected exit
this.bridge.on('exit', (code: number | null, signal: string | null) => {
if (this.isRunning) {
console.error(`smartdb Rust process exited unexpectedly (code=${code}, signal=${signal})`);
}
});
if (this.useSocket && this.options.socketPath) {
// Listen on Unix socket
this.server.listen(this.options.socketPath, () => {
// Send config, get back connectionUri
const result = await this.bridge.startDb({
port: this.options.port,
host: this.options.host,
socketPath: this.options.socketPath,
storage: this.options.storage ?? 'memory',
storagePath: this.options.storagePath,
persistPath: this.options.persistPath,
persistIntervalMs: this.options.persistIntervalMs,
});
this.resolvedConnectionUri = result.connectionUri;
this.isRunning = true;
this.startTime = new Date();
resolve();
});
} else {
// Listen on TCP
this.server.listen(this.options.port, this.options.host, () => {
this.isRunning = true;
this.startTime = new Date();
resolve();
});
}
});
}
/**
* Stop the server
*/
async stop(): Promise<void> {
if (!this.isRunning || !this.server) {
if (!this.isRunning) {
return;
}
// Close all connections
for (const conn of this.connections.values()) {
conn.socket.destroy();
try {
await this.bridge.stopDb();
} catch {
// Bridge may already be dead
}
this.connections.clear();
// Close command router (cleans up session engine, cursors, etc.)
this.commandRouter.close();
// Close storage
await this.storage.close();
return new Promise((resolve) => {
this.server!.close(async () => {
this.bridge.kill();
this.isRunning = false;
this.server = null;
// Clean up socket file if using Unix socket
if (this.useSocket && this.options.socketPath) {
try {
await fs.unlink(this.options.socketPath);
} catch (err: any) {
// Ignore ENOENT (file doesn't exist)
if (err.code !== 'ENOENT') {
console.error('Failed to remove socket file:', err);
}
}
}
resolve();
});
});
}
/**
* Handle a new client connection
*/
private handleConnection(socket: net.Socket): void {
const connectionId = ++this.connectionIdCounter;
const state: IConnectionState = {
id: connectionId,
socket,
buffer: Buffer.alloc(0),
authenticated: true, // No auth required for now
database: 'test',
};
this.connections.set(connectionId, state);
socket.on('data', (data) => {
this.handleData(state, Buffer.isBuffer(data) ? data : Buffer.from(data));
});
socket.on('close', () => {
this.connections.delete(connectionId);
});
socket.on('error', (err) => {
// Connection errors are expected when clients disconnect
this.connections.delete(connectionId);
});
}
/**
* Handle incoming data from a client
*/
private handleData(state: IConnectionState, data: Buffer): void {
// Append new data to buffer
state.buffer = Buffer.concat([state.buffer, data]);
// Process messages from buffer
this.processMessages(state);
}
/**
* Process complete messages from the buffer
*/
private async processMessages(state: IConnectionState): Promise<void> {
while (state.buffer.length >= 16) {
try {
const result = WireProtocol.parseMessage(state.buffer);
if (!result) {
// Not enough data for a complete message
break;
}
const { command, bytesConsumed } = result;
// Remove processed bytes from buffer
state.buffer = state.buffer.subarray(bytesConsumed);
// Process the command
const response = await this.commandRouter.route(command);
// Encode and send response
let responseBuffer: Buffer;
if (command.opCode === OP_QUERY) {
// Legacy OP_QUERY gets OP_REPLY response
responseBuffer = WireProtocol.encodeOpReplyResponse(
command.requestID,
[response]
);
} else {
// OP_MSG gets OP_MSG response
responseBuffer = WireProtocol.encodeOpMsgResponse(
command.requestID,
response
);
}
if (!state.socket.destroyed) {
state.socket.write(responseBuffer);
}
} catch (error: any) {
// Send error response
const errorResponse = WireProtocol.encodeErrorResponse(
0, // We don't have the requestID at this point
1,
error.message || 'Internal error'
);
if (!state.socket.destroyed) {
state.socket.write(errorResponse);
}
// Clear buffer on parse errors to avoid infinite loops
if (error.message?.includes('opCode') || error.message?.includes('section')) {
state.buffer = Buffer.alloc(0);
}
break;
}
}
}
/**
* Get the connection URI for this server
*/
getConnectionUri(): string {
if (this.useSocket && this.options.socketPath) {
// URL-encode the socket path (replace / with %2F)
if (this.resolvedConnectionUri) {
return this.resolvedConnectionUri;
}
// Fallback: compute from options
if (this.options.socketPath) {
const encodedPath = encodeURIComponent(this.options.socketPath);
return `mongodb://${encodedPath}`;
}
return `mongodb://${this.options.host}:${this.options.port}`;
return `mongodb://${this.options.host ?? '127.0.0.1'}:${this.options.port ?? 27017}`;
}
/**
* Get the socket path (if using Unix socket mode)
*/
get socketPath(): string | undefined {
return this.useSocket ? this.options.socketPath : undefined;
return this.options.socketPath;
}
/**
@@ -342,13 +163,68 @@ export class SmartdbServer {
* Get the port the server is listening on
*/
get port(): number {
return this.options.port;
return this.options.port ?? 27017;
}
/**
* Get the host the server is bound to
*/
get host(): string {
return this.options.host;
return this.options.host ?? '127.0.0.1';
}
// --- OpLog / Debug API ---
/**
* Get oplog entries, optionally filtered.
*/
async getOpLog(params: {
sinceSeq?: number;
limit?: number;
db?: string;
collection?: string;
} = {}): Promise<IOpLogResult> {
return this.bridge.getOpLog(params);
}
/**
* Get aggregate oplog statistics.
*/
async getOpLogStats(): Promise<IOpLogStats> {
return this.bridge.getOpLogStats();
}
/**
* Revert database state to a specific oplog sequence number.
* Use dryRun=true to preview which entries would be reverted.
*/
async revertToSeq(seq: number, dryRun = false): Promise<IRevertResult> {
return this.bridge.revertToSeq(seq, dryRun);
}
/**
* List all collections across all databases, with document counts.
*/
async getCollections(db?: string): Promise<ICollectionInfo[]> {
return this.bridge.getCollections(db);
}
/**
* Get documents from a collection with pagination.
*/
async getDocuments(
db: string,
collection: string,
limit = 50,
skip = 0,
): Promise<IDocumentsResult> {
return this.bridge.getDocuments(db, collection, limit, skip);
}
/**
* Get server metrics including database/collection counts and oplog info.
*/
async getMetrics(): Promise<ISmartDbMetrics> {
return this.bridge.getMetrics();
}
}

Some files were not shown because too many files have changed in this diff Show More