29 Commits

Author SHA1 Message Date
jkunz 8ebc1bb9e1 v2.5.7 2026-04-05 03:54:13 +00:00
jkunz 3fc21dcd99 fix(repo): no changes to commit 2026-04-05 03:54:13 +00:00
jkunz ad5e0e8a72 chore: gitignore generated bundled.ts to fix release cycle 2026-04-05 03:54:05 +00:00
jkunz c384df20ce v2.5.6 2026-04-05 03:53:29 +00:00
jkunz 4e944f3d05 fix(repo): no changes to commit 2026-04-05 03:53:29 +00:00
jkunz e0455daa2e chore: rebuild bundled debug server with current version 2026-04-05 03:53:22 +00:00
jkunz f3f1afe9af v2.5.5 2026-04-05 03:52:29 +00:00
jkunz 94dc9cfc3f fix(repo): no changes to commit 2026-04-05 03:52:29 +00:00
jkunz a9c0ced1ca v2.5.4 2026-04-05 03:52:23 +00:00
jkunz c8626a9afd fix(package): bump package version to 2.5.3 2026-04-05 03:52:23 +00:00
jkunz 55a1f66e57 chore: update bundled debug server output 2026-04-05 03:52:21 +00:00
jkunz 5b5f35821f v2.5.3 2026-04-05 03:51:58 +00:00
jkunz e8161e6417 fix(rustdb-commands): restore persisted index initialization before writes to enforce unique constraints after restart 2026-04-05 03:51:58 +00:00
jkunz 1a10c32b12 v2.5.2 2026-04-05 03:26:52 +00:00
jkunz cb8cb87d9f fix(rustdb-indexes): persist created indexes and restore them on server startup 2026-04-05 03:26:52 +00:00
jkunz 96117d54b9 v2.5.1 2026-04-05 02:48:00 +00:00
jkunz 53f58e45c3 fix(docs): update project documentation 2026-04-05 02:48:00 +00:00
jkunz 34d708be7e v2.5.0 2026-04-05 02:46:05 +00:00
jkunz 418e8dc052 feat(storage): add offline data validation and strengthen storage/index integrity checks 2026-04-05 02:46:05 +00:00
jkunz b8567ebe08 v2.4.1 2026-04-05 01:31:44 +00:00
jkunz 827bfa6370 fix(package): update package metadata 2026-04-05 01:31:44 +00:00
jkunz ceba64e34a v2.4.0 2026-04-05 01:30:28 +00:00
jkunz 8646d58f06 feat(rustdb): add restore and periodic persistence support for in-memory storage 2026-04-05 01:30:28 +00:00
jkunz 8ce6ff11c3 v2.3.1 2026-04-04 20:15:58 +00:00
jkunz 5c7aaebaba fix(package): update package metadata 2026-04-04 20:15:58 +00:00
jkunz be7d086c0b v2.3.0 2026-04-04 20:14:51 +00:00
jkunz 91a7b69f1d feat(test): add integration coverage for file storage, compaction, migration, and LocalSmartDb workflows 2026-04-04 20:14:51 +00:00
jkunz 4e078b35d4 v2.2.0 2026-04-04 19:49:47 +00:00
jkunz d8a8259c73 feat(storage): add Bitcask storage migration, binary WAL, and data compaction support 2026-04-04 19:49:47 +00:00
35 changed files with 4958 additions and 463 deletions
+3
View File
@@ -13,5 +13,8 @@ rust/target/
package-lock.json
yarn.lock
# generated bundle (rebuilt on every build, embeds version)
ts_debugserver/bundled.ts
# playwright
.playwright-mcp/
+79
View File
@@ -1,5 +1,84 @@
# Changelog
## 2026-04-05 - 2.5.7 - fix(repo)
no changes to commit
## 2026-04-05 - 2.5.6 - fix(repo)
no changes to commit
## 2026-04-05 - 2.5.5 - fix(repo)
no changes to commit
## 2026-04-05 - 2.5.4 - fix(package)
bump package version to 2.5.3
- Updates the package metadata version by one patch release.
## 2026-04-05 - 2.5.3 - fix(rustdb-commands)
restore persisted index initialization before writes to enforce unique constraints after restart
- load stored index specifications from storage when creating command context index engines
- rebuild index data from existing documents so custom indexes are active before insert, update, and upsert operations
- add @push.rocks/smartdata as a runtime dependency
## 2026-04-05 - 2.5.2 - fix(rustdb-indexes)
persist created indexes and restore them on server startup
- Save index specifications to storage when indexes are created.
- Remove persisted index metadata when indexes are dropped by name, key spec, or wildcard.
- Rebuild in-memory index engines from stored definitions and existing documents during startup.
## 2026-04-05 - 2.5.1 - fix(docs)
update project documentation
- Modifies a single documentation-related file with a minimal text change.
- No source code, API, or package metadata changes are indicated in the diff summary.
## 2026-04-05 - 2.5.0 - feat(storage)
add offline data validation and strengthen storage/index integrity checks
- adds a `--validate-data <PATH>` CLI mode to run offline integrity checks on storage directories
- introduces storage validation reporting for headers, checksums, duplicate ids, tombstones, and stale or orphaned hint entries
- pre-checks unique index constraints before insert, update, upsert, and findAndModify writes to prevent duplicate-key violations before storage changes
- validates hint files against data files during collection load and rebuilds indexes from data when hints are stale
- ensures new data files always receive a SMARTDB header and persists fresh hint files after successful compaction
- cleans up stale local Unix socket files before starting the TypeScript local server
## 2026-04-05 - 2.4.1 - fix(package)
update package metadata
- Adjusts package manifest content with a minimal one-line change.
## 2026-04-05 - 2.4.0 - feat(rustdb)
add restore and periodic persistence support for in-memory storage
- Restore previously persisted state during startup when a persist path is configured.
- Spawn a background task to periodically persist in-memory data using the configured interval.
- Warn when running purely in-memory without durable persistence configured.
## 2026-04-04 - 2.3.1 - fix(package)
update package metadata
- Adjusts a single package-level metadata entry in the project configuration.
## 2026-04-04 - 2.3.0 - feat(test)
add integration coverage for file storage, compaction, migration, and LocalSmartDb workflows
- adds end-to-end tests for file-backed storage creation, CRUD operations, bulk updates, persistence, and index file generation
- adds compaction stress tests covering repeated updates, tombstones, file shrinking behavior, and restart integrity
- adds migration tests for automatic v0 JSON layout detection, v1 conversion, restart persistence, and post-migration writes
- adds LocalSmartDb lifecycle and unix socket tests, including restart persistence, custom socket paths, and database isolation
## 2026-04-04 - 2.2.0 - feat(storage)
add Bitcask storage migration, binary WAL, and data compaction support
- add TypeScript storage migration from legacy JSON collections to the v1 Bitcask binary format before starting the Rust engine
- replace the legacy JSON WAL with a binary write-ahead log plus shared binary record and KeyDir infrastructure in rustdb-storage
- introduce data file compaction with dead-record reclamation and tests, and add the bson dependency for BSON serialization during migration
## 2026-04-02 - 2.1.1 - fix(package)
update package metadata
+4 -2
View File
@@ -1,6 +1,6 @@
{
"name": "@push.rocks/smartdb",
"version": "2.1.1",
"version": "2.5.7",
"private": false,
"description": "A MongoDB-compatible embedded database server with wire protocol support, backed by a high-performance Rust engine.",
"exports": {
@@ -29,7 +29,9 @@
"dependencies": {
"@api.global/typedserver": "^8.0.0",
"@design.estate/dees-element": "^2.0.0",
"@push.rocks/smartrust": "^1.3.2"
"@push.rocks/smartdata": "7.1.5",
"@push.rocks/smartrust": "^1.3.2",
"bson": "^7.2.0"
},
"browserslist": [
"last 1 chrome versions"
+10 -4
View File
@@ -14,9 +14,15 @@ importers:
'@design.estate/dees-element':
specifier: ^2.0.0
version: 2.2.3
'@push.rocks/smartdata':
specifier: 7.1.5
version: 7.1.5(socks@2.8.7)
'@push.rocks/smartrust':
specifier: ^1.3.2
version: 1.3.2
bson:
specifier: ^7.2.0
version: 7.2.0
devDependencies:
'@git.zone/tsbuild':
specifier: ^4.4.0
@@ -1023,8 +1029,8 @@ packages:
'@push.rocks/smartcrypto@2.0.4':
resolution: {integrity: sha512-1+/5bsjyataf5uUkUNnnVXGRAt+gHVk1KDzozjTqgqJxHvQk1d9fVDohL6CxUhUucTPtu5VR5xNBiV8YCDuGyw==}
'@push.rocks/smartdata@7.1.3':
resolution: {integrity: sha512-7vQJ9pdRk450yn2m9tmGPdSRlQVmxFPZjHD4sGYsfqCQPg+GLFusu+H16zpf+jKzAq4F2ZBMPaYymJHXvXiVcw==}
'@push.rocks/smartdata@7.1.5':
resolution: {integrity: sha512-7x7VedEg6RocWndqUPuTbY2Bh85Q/x0LOVHL4o/NVXyh3IGNtiVQ8ple4WR0qYqlHRAojX4eDSBPMiYzIasqAg==}
'@push.rocks/smartdelay@3.0.5':
resolution: {integrity: sha512-mUuI7kj2f7ztjpic96FvRIlf2RsKBa5arw81AHNsndbxO6asRcxuWL8dTVxouEIK8YsBUlj0AsrCkHhMbLQdHw==}
@@ -5662,7 +5668,7 @@ snapshots:
'@types/node-forge': 1.3.14
node-forge: 1.4.0
'@push.rocks/smartdata@7.1.3(socks@2.8.7)':
'@push.rocks/smartdata@7.1.5(socks@2.8.7)':
dependencies:
'@push.rocks/lik': 6.4.0
'@push.rocks/smartdelay': 3.0.5
@@ -5896,7 +5902,7 @@ snapshots:
'@push.rocks/smartmongo@5.1.1(socks@2.8.7)':
dependencies:
'@push.rocks/mongodump': 1.1.0(socks@2.8.7)
'@push.rocks/smartdata': 7.1.3(socks@2.8.7)
'@push.rocks/smartdata': 7.1.5(socks@2.8.7)
'@push.rocks/smartfs': 1.5.0
'@push.rocks/smartpath': 6.0.0
'@push.rocks/smartpromise': 4.2.3
+39
View File
@@ -275,6 +275,12 @@ dependencies = [
"windows-sys",
]
[[package]]
name = "fastrand"
version = "2.4.0"
source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "a043dc74da1e37d6afe657061213aa6f425f855399a11d3463c6ecccc4dfda1f"
[[package]]
name = "find-msvc-tools"
version = "0.1.9"
@@ -477,6 +483,12 @@ dependencies = [
"libc",
]
[[package]]
name = "linux-raw-sys"
version = "0.12.1"
source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "32a66949e030da00e8c7d4434b251670a91556f4144941d37452769c25d58a53"
[[package]]
name = "lock_api"
version = "0.4.14"
@@ -802,6 +814,7 @@ dependencies = [
"dashmap",
"serde",
"serde_json",
"tempfile",
"thiserror",
"tokio",
"tracing",
@@ -835,6 +848,19 @@ dependencies = [
"tracing",
]
[[package]]
name = "rustix"
version = "1.1.4"
source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "b6fe4565b9518b83ef4f91bb47ce29620ca828bd32cb7e408f0062e9930ba190"
dependencies = [
"bitflags",
"errno",
"libc",
"linux-raw-sys",
"windows-sys",
]
[[package]]
name = "rustversion"
version = "1.0.22"
@@ -977,6 +1003,19 @@ version = "1.0.1"
source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "55937e1799185b12863d447f42597ed69d9928686b8d88a1df17376a097d8369"
[[package]]
name = "tempfile"
version = "3.27.0"
source = "registry+https://github.com/rust-lang/crates.io-index"
checksum = "32497e9a4c7b38532efcdebeef879707aa9f794296a4f0244f6f69e9bc8574bd"
dependencies = [
"fastrand",
"getrandom 0.4.2",
"once_cell",
"rustix",
"windows-sys",
]
[[package]]
name = "thiserror"
version = "2.0.18"
+3
View File
@@ -66,6 +66,9 @@ uuid = { version = "1", features = ["v4", "serde"] }
# Async traits
async-trait = "0.1"
# Test utilities
tempfile = "3"
# Internal crates
rustdb-config = { path = "crates/rustdb-config" }
rustdb-wire = { path = "crates/rustdb-wire" }
+63 -2
View File
@@ -1,8 +1,8 @@
use std::sync::Arc;
use bson::Document;
use bson::{Bson, Document};
use dashmap::DashMap;
use rustdb_index::IndexEngine;
use rustdb_index::{IndexEngine, IndexOptions};
use rustdb_storage::{OpLog, StorageAdapter};
use rustdb_txn::{SessionEngine, TransactionEngine};
@@ -24,6 +24,67 @@ pub struct CommandContext {
pub oplog: Arc<OpLog>,
}
impl CommandContext {
/// Get or lazily initialize an IndexEngine for a namespace.
///
/// If no IndexEngine exists yet for this namespace, loads persisted index
/// specs from `indexes.json` via the storage adapter, creates the engine
/// with those specs, and rebuilds index data from existing documents.
/// This ensures unique indexes are enforced even on the very first write
/// after a restart.
pub async fn get_or_init_index_engine(&self, db: &str, coll: &str) -> dashmap::mapref::one::RefMut<'_, String, IndexEngine> {
let ns_key = format!("{}.{}", db, coll);
// Fast path: engine already exists.
if self.indexes.contains_key(&ns_key) {
return self.indexes.entry(ns_key).or_insert_with(IndexEngine::new);
}
// Slow path: load from persisted specs.
let mut engine = IndexEngine::new();
let mut has_custom = false;
if let Ok(specs) = self.storage.get_indexes(db, coll).await {
for spec in &specs {
let name = spec.get_str("name").unwrap_or("").to_string();
if name == "_id_" || name.is_empty() {
continue;
}
let key = match spec.get("key") {
Some(Bson::Document(k)) => k.clone(),
_ => continue,
};
let unique = matches!(spec.get("unique"), Some(Bson::Boolean(true)));
let sparse = matches!(spec.get("sparse"), Some(Bson::Boolean(true)));
let expire_after_seconds = match spec.get("expireAfterSeconds") {
Some(Bson::Int32(n)) => Some(*n as u64),
Some(Bson::Int64(n)) => Some(*n as u64),
_ => None,
};
let options = IndexOptions {
name: Some(name),
unique,
sparse,
expire_after_seconds,
};
let _ = engine.create_index(key, options);
has_custom = true;
}
}
if has_custom {
// Rebuild index data from existing documents.
if let Ok(docs) = self.storage.find_all(db, coll).await {
if !docs.is_empty() {
engine.rebuild_from_documents(&docs);
}
}
}
self.indexes.entry(ns_key).or_insert(engine)
}
}
/// State of an open cursor from a find or aggregate command.
pub struct CursorState {
/// Documents remaining to be returned.
@@ -101,7 +101,15 @@ async fn handle_create_indexes(
expire_after_seconds,
};
// Create the index.
let options_for_persist = IndexOptions {
name: options.name.clone(),
unique: options.unique,
sparse: options.sparse,
expire_after_seconds: options.expire_after_seconds,
};
let key_for_persist = key.clone();
// Create the index in-memory.
let mut engine = ctx
.indexes
.entry(ns_key.clone())
@@ -110,6 +118,22 @@ async fn handle_create_indexes(
match engine.create_index(key, options) {
Ok(index_name) => {
debug!(index_name = %index_name, "Created index");
// Persist index spec to disk.
let mut spec = doc! { "key": key_for_persist };
if options_for_persist.unique {
spec.insert("unique", true);
}
if options_for_persist.sparse {
spec.insert("sparse", true);
}
if let Some(ttl) = options_for_persist.expire_after_seconds {
spec.insert("expireAfterSeconds", ttl as i64);
}
if let Err(e) = ctx.storage.save_index(db, coll, &index_name, spec).await {
tracing::warn!(index = %index_name, error = %e, "failed to persist index spec");
}
created_count += 1;
}
Err(e) => {
@@ -180,9 +204,21 @@ async fn handle_drop_indexes(
match index_spec {
Some(Bson::String(name)) if name == "*" => {
// Drop all indexes except _id_.
// Collect names to drop from storage first.
let names_to_drop: Vec<String> = if let Some(engine) = ctx.indexes.get(&ns_key) {
engine.list_indexes().iter()
.filter(|info| info.name != "_id_")
.map(|info| info.name.clone())
.collect()
} else {
Vec::new()
};
if let Some(mut engine) = ctx.indexes.get_mut(&ns_key) {
engine.drop_all_indexes();
}
for idx_name in &names_to_drop {
let _ = ctx.storage.drop_index(db, coll, idx_name).await;
}
}
Some(Bson::String(name)) => {
// Drop by name.
@@ -196,6 +232,7 @@ async fn handle_drop_indexes(
name
)));
}
let _ = ctx.storage.drop_index(db, coll, name).await;
}
Some(Bson::Document(key_spec)) => {
// Drop by key spec: find the index with matching key.
@@ -210,6 +247,7 @@ async fn handle_drop_indexes(
engine.drop_index(&name).map_err(|e| {
CommandError::IndexError(e.to_string())
})?;
let _ = ctx.storage.drop_index(db, coll, &name).await;
} else {
return Err(CommandError::IndexError(
"index not found with specified key".into(),
@@ -1,9 +1,8 @@
use std::collections::HashMap;
use bson::{doc, oid::ObjectId, Bson, Document};
use rustdb_index::IndexEngine;
use rustdb_storage::OpType;
use tracing::{debug, warn};
use tracing::debug;
use crate::context::CommandContext;
use crate::error::{CommandError, CommandResult};
@@ -56,12 +55,35 @@ pub async fn handle(
let mut inserted_count: i32 = 0;
let mut write_errors: Vec<Document> = Vec::new();
// Ensure the IndexEngine is loaded (with persisted specs from indexes.json).
// This must happen BEFORE any writes, so unique constraints are enforced
// even on the first write after a restart.
drop(ctx.get_or_init_index_engine(db, coll).await);
for (idx, mut doc) in docs.into_iter().enumerate() {
// Auto-generate _id if not present.
if !doc.contains_key("_id") {
doc.insert("_id", ObjectId::new());
}
// Pre-check unique index constraints BEFORE storage write.
// The engine is guaranteed to exist from the get_or_init call above.
if let Some(engine) = ctx.indexes.get(&ns_key) {
if let Err(e) = engine.check_unique_constraints(&doc) {
let err_msg = e.to_string();
write_errors.push(doc! {
"index": idx as i32,
"code": 11000_i32,
"codeName": "DuplicateKey",
"errmsg": &err_msg,
});
if ordered {
break;
}
continue;
}
}
// Attempt storage insert.
match ctx.storage.insert_one(db, coll, doc.clone()).await {
Ok(id_str) => {
@@ -75,18 +97,16 @@ pub async fn handle(
None,
);
// Update index engine.
let mut engine = ctx
.indexes
.entry(ns_key.clone())
.or_insert_with(IndexEngine::new);
// Update index engine (already initialized above).
if let Some(mut engine) = ctx.indexes.get_mut(&ns_key) {
if let Err(e) = engine.on_insert(&doc) {
warn!(
tracing::error!(
namespace = %ns_key,
error = %e,
"index update failed after successful insert"
);
}
}
inserted_count += 1;
}
Err(e) => {
@@ -1,7 +1,6 @@
use std::collections::HashSet;
use bson::{doc, oid::ObjectId, Bson, Document};
use rustdb_index::IndexEngine;
use rustdb_query::{QueryMatcher, UpdateEngine, sort_documents, apply_projection};
use rustdb_storage::OpType;
use tracing::debug;
@@ -47,6 +46,10 @@ async fn handle_update(
ensure_collection_exists(db, coll, ctx).await?;
let ns_key = format!("{}.{}", db, coll);
// Ensure the IndexEngine is loaded with persisted specs from indexes.json.
drop(ctx.get_or_init_index_engine(db, coll).await);
let mut total_n: i32 = 0;
let mut total_n_modified: i32 = 0;
let mut upserted_list: Vec<Document> = Vec::new();
@@ -150,6 +153,22 @@ async fn handle_update(
updated.get("_id").unwrap().clone()
};
// Pre-check unique index constraints before upsert insert.
if let Some(engine) = ctx.indexes.get(&ns_key) {
if let Err(e) = engine.check_unique_constraints(&updated) {
write_errors.push(doc! {
"index": idx as i32,
"code": 11000_i32,
"codeName": "DuplicateKey",
"errmsg": e.to_string(),
});
if ordered {
break;
}
continue;
}
}
// Insert the new document.
match ctx.storage.insert_one(db, coll, updated.clone()).await {
Ok(id_str) => {
@@ -163,12 +182,12 @@ async fn handle_update(
None,
);
// Update index.
let mut engine = ctx
.indexes
.entry(ns_key.clone())
.or_insert_with(IndexEngine::new);
let _ = engine.on_insert(&updated);
// Update index (engine already initialized above).
if let Some(mut engine) = ctx.indexes.get_mut(&ns_key) {
if let Err(e) = engine.on_insert(&updated) {
tracing::error!(namespace = %ns_key, error = %e, "index update failed after upsert insert");
}
}
total_n += 1;
upserted_list.push(doc! {
@@ -216,6 +235,22 @@ async fn handle_update(
array_filters.as_deref(),
) {
Ok(updated_doc) => {
// Pre-check unique index constraints before storage write.
if let Some(engine) = ctx.indexes.get(&ns_key) {
if let Err(e) = engine.check_unique_constraints_for_update(matched_doc, &updated_doc) {
write_errors.push(doc! {
"index": idx as i32,
"code": 11000_i32,
"codeName": "DuplicateKey",
"errmsg": e.to_string(),
});
if ordered {
break;
}
continue;
}
}
let id_str = extract_id_string(matched_doc);
match ctx
.storage
@@ -235,7 +270,9 @@ async fn handle_update(
// Update index.
if let Some(mut engine) = ctx.indexes.get_mut(&ns_key) {
let _ = engine.on_update(matched_doc, &updated_doc);
if let Err(e) = engine.on_update(matched_doc, &updated_doc) {
tracing::error!(namespace = %ns_key, error = %e, "index update failed after update");
}
}
total_n += 1;
// Check if the document actually changed.
@@ -366,6 +403,9 @@ async fn handle_find_and_modify(
let ns_key = format!("{}.{}", db, coll);
// Ensure the IndexEngine is loaded with persisted specs.
drop(ctx.get_or_init_index_engine(db, coll).await);
// Load and filter documents.
let mut matched = load_filtered_docs(db, coll, &query, &ns_key, ctx).await?;
@@ -444,6 +484,13 @@ async fn handle_find_and_modify(
)
.map_err(|e| CommandError::InternalError(e.to_string()))?;
// Pre-check unique index constraints before storage write.
if let Some(engine) = ctx.indexes.get(&ns_key) {
if let Err(e) = engine.check_unique_constraints_for_update(&original_doc, &updated_doc) {
return Err(CommandError::StorageError(e.to_string()));
}
}
let id_str = extract_id_string(&original_doc);
ctx.storage
.update_by_id(db, coll, &id_str, updated_doc.clone())
@@ -461,7 +508,9 @@ async fn handle_find_and_modify(
// Update index.
if let Some(mut engine) = ctx.indexes.get_mut(&ns_key) {
let _ = engine.on_update(&original_doc, &updated_doc);
if let Err(e) = engine.on_update(&original_doc, &updated_doc) {
tracing::error!(namespace = %ns_key, error = %e, "index update failed after findAndModify update");
}
}
let return_doc = if return_new {
@@ -505,6 +554,13 @@ async fn handle_find_and_modify(
updated_doc.get("_id").unwrap().clone()
};
// Pre-check unique index constraints before upsert insert.
if let Some(engine) = ctx.indexes.get(&ns_key) {
if let Err(e) = engine.check_unique_constraints(&updated_doc) {
return Err(CommandError::StorageError(e.to_string()));
}
}
let inserted_id_str = ctx.storage
.insert_one(db, coll, updated_doc.clone())
.await?;
@@ -521,11 +577,11 @@ async fn handle_find_and_modify(
// Update index.
{
let mut engine = ctx
.indexes
.entry(ns_key.clone())
.or_insert_with(IndexEngine::new);
let _ = engine.on_insert(&updated_doc);
if let Some(mut engine) = ctx.indexes.get_mut(&ns_key) {
if let Err(e) = engine.on_insert(&updated_doc) {
tracing::error!(namespace = %ns_key, error = %e, "index update failed after findAndModify upsert");
}
}
}
let value = if return_new {
+49
View File
@@ -153,6 +153,55 @@ impl IndexEngine {
self.indexes.contains_key(name)
}
/// Check unique constraints for a document without modifying the index.
/// Returns Ok(()) if no conflict, Err(DuplicateKey) if a unique constraint
/// would be violated. This is a read-only check (immutable &self).
pub fn check_unique_constraints(&self, doc: &Document) -> Result<(), IndexError> {
for idx in self.indexes.values() {
if idx.unique {
let key_bytes = Self::extract_key_bytes(doc, &idx.key, idx.sparse);
if let Some(ref kb) = key_bytes {
if let Some(existing_ids) = idx.hash.get(kb) {
if !existing_ids.is_empty() {
return Err(IndexError::DuplicateKey {
index: idx.name.clone(),
key: format!("{:?}", kb),
});
}
}
}
}
}
Ok(())
}
/// Check unique constraints for an update, excluding the document being updated.
/// Returns Ok(()) if no conflict. This is a read-only check (immutable &self).
pub fn check_unique_constraints_for_update(
&self,
old_doc: &Document,
new_doc: &Document,
) -> Result<(), IndexError> {
let doc_id = Self::extract_id(old_doc);
for idx in self.indexes.values() {
if idx.unique {
let new_key_bytes = Self::extract_key_bytes(new_doc, &idx.key, idx.sparse);
if let Some(ref kb) = new_key_bytes {
if let Some(existing_ids) = idx.hash.get(kb) {
let has_conflict = existing_ids.iter().any(|id| *id != doc_id);
if has_conflict {
return Err(IndexError::DuplicateKey {
index: idx.name.clone(),
key: format!("{:?}", kb),
});
}
}
}
}
}
Ok(())
}
/// Notify the engine that a document has been inserted.
/// Checks unique constraints and updates all index structures.
pub fn on_insert(&mut self, doc: &Document) -> Result<(), IndexError> {
+3
View File
@@ -17,3 +17,6 @@ tracing = { workspace = true }
crc32fast = { workspace = true }
uuid = { workspace = true }
async-trait = { workspace = true }
[dev-dependencies]
tempfile = { workspace = true }
@@ -0,0 +1,499 @@
//! Binary Write-Ahead Log for crash recovery.
//!
//! # Protocol
//!
//! Every mutation follows this sequence:
//! 1. Append WAL record → fsync
//! 2. Perform the actual data write
//! 3. Append WAL commit marker → fsync
//!
//! On recovery, uncommitted entries (those without a matching commit marker)
//! are replayed or verified.
//!
//! # Record format
//!
//! ```text
//! ┌──────────┬──────────┬──────────┬──────────┬──────────┬──────────┬────────────┐
//! │ magic │ seq │ op │ key_len │ val_len │ crc32 │ payload │
//! │ u16 LE │ u64 LE │ u8 │ u32 LE │ u32 LE │ u32 LE │ [key][val] │
//! │ 0xWA01 │ │ │ │ │ │ │
//! └──────────┴──────────┴──────────┴──────────┴──────────┴──────────┴────────────┘
//! ```
//!
//! # Commit marker
//!
//! ```text
//! ┌──────────┬──────────┬──────────┐
//! │ magic │ seq │ crc32 │
//! │ u16 LE │ u64 LE │ u32 LE │
//! │ 0xCA01 │ │ │
//! └──────────┴──────────┴──────────┘
//! ```
use std::io::{self, BufReader, Read, Write};
use std::path::{Path, PathBuf};
use std::sync::atomic::{AtomicU64, Ordering};
use crate::error::{StorageError, StorageResult};
use crate::record::{FileHeader, FileType, FILE_HEADER_SIZE};
// ---------------------------------------------------------------------------
// Constants
// ---------------------------------------------------------------------------
const WAL_RECORD_MAGIC: u16 = 0xAA01;
const WAL_COMMIT_MAGIC: u16 = 0xCC01;
/// WAL record header: magic(2) + seq(8) + op(1) + key_len(4) + val_len(4) + crc(4) = 23
const WAL_RECORD_HEADER: usize = 23;
/// Commit marker size: magic(2) + seq(8) + crc(4) = 14
const WAL_COMMIT_SIZE: usize = 14;
// ---------------------------------------------------------------------------
// WAL operation type
// ---------------------------------------------------------------------------
#[derive(Debug, Clone, Copy, PartialEq, Eq)]
#[repr(u8)]
pub enum WalOpType {
Insert = 1,
Update = 2,
Delete = 3,
}
impl WalOpType {
fn from_u8(v: u8) -> StorageResult<Self> {
match v {
1 => Ok(WalOpType::Insert),
2 => Ok(WalOpType::Update),
3 => Ok(WalOpType::Delete),
_ => Err(StorageError::WalError(format!("unknown WAL op: {v}"))),
}
}
}
// ---------------------------------------------------------------------------
// WAL entry (parsed from file)
// ---------------------------------------------------------------------------
#[derive(Debug, Clone)]
pub struct WalEntry {
pub seq: u64,
pub op: WalOpType,
pub key: Vec<u8>,
pub value: Vec<u8>,
}
// ---------------------------------------------------------------------------
// Internal: what we read from the WAL file
// ---------------------------------------------------------------------------
#[derive(Debug)]
enum WalItem {
Record(WalEntry),
Commit(u64), // seq that was committed
}
// ---------------------------------------------------------------------------
// BinaryWal
// ---------------------------------------------------------------------------
/// Binary write-ahead log backed by a single file.
pub struct BinaryWal {
path: PathBuf,
next_seq: AtomicU64,
}
impl BinaryWal {
/// Create a new WAL. Does not touch the filesystem until `initialize()`.
pub fn new(path: PathBuf) -> Self {
Self {
path,
next_seq: AtomicU64::new(1),
}
}
/// Initialize: create parent dirs, recover sequence counter from existing file.
pub fn initialize(&self) -> StorageResult<()> {
if let Some(parent) = self.path.parent() {
std::fs::create_dir_all(parent)?;
}
if self.path.exists() {
// Scan to find highest seq
let items = self.read_all_items()?;
let max_seq = items
.iter()
.map(|item| match item {
WalItem::Record(e) => e.seq,
WalItem::Commit(s) => *s,
})
.max()
.unwrap_or(0);
self.next_seq.store(max_seq + 1, Ordering::SeqCst);
} else {
// Create the file with a header
let mut f = std::fs::File::create(&self.path)?;
let hdr = FileHeader::new(FileType::Wal);
f.write_all(&hdr.encode())?;
f.flush()?;
f.sync_all()?;
}
Ok(())
}
/// Append a WAL record. Returns the sequence number. Fsyncs.
pub fn append(
&self,
op: WalOpType,
key: &[u8],
value: &[u8],
) -> StorageResult<u64> {
let seq = self.next_seq.fetch_add(1, Ordering::SeqCst);
let key_len = key.len() as u32;
let val_len = value.len() as u32;
// Build header bytes (without CRC)
let mut hdr = Vec::with_capacity(WAL_RECORD_HEADER);
hdr.extend_from_slice(&WAL_RECORD_MAGIC.to_le_bytes());
hdr.extend_from_slice(&seq.to_le_bytes());
hdr.push(op as u8);
hdr.extend_from_slice(&key_len.to_le_bytes());
hdr.extend_from_slice(&val_len.to_le_bytes());
// CRC placeholder
hdr.extend_from_slice(&0u32.to_le_bytes());
// Compute CRC over header (without crc field) + payload
let mut hasher = crc32fast::Hasher::new();
hasher.update(&hdr[0..19]); // magic + seq + op + key_len + val_len
hasher.update(key);
hasher.update(value);
let crc = hasher.finalize();
hdr[19..23].copy_from_slice(&crc.to_le_bytes());
// Append to file
let mut f = std::fs::OpenOptions::new()
.create(true)
.append(true)
.open(&self.path)?;
f.write_all(&hdr)?;
f.write_all(key)?;
f.write_all(value)?;
f.sync_all()?;
Ok(seq)
}
/// Append a commit marker for the given sequence. Fsyncs.
pub fn append_commit(&self, seq: u64) -> StorageResult<()> {
let mut buf = Vec::with_capacity(WAL_COMMIT_SIZE);
buf.extend_from_slice(&WAL_COMMIT_MAGIC.to_le_bytes());
buf.extend_from_slice(&seq.to_le_bytes());
// CRC over magic + seq
let mut hasher = crc32fast::Hasher::new();
hasher.update(&buf[0..10]);
let crc = hasher.finalize();
buf.extend_from_slice(&crc.to_le_bytes());
let mut f = std::fs::OpenOptions::new()
.create(true)
.append(true)
.open(&self.path)?;
f.write_all(&buf)?;
f.sync_all()?;
Ok(())
}
/// Recover: return all WAL entries that were NOT committed.
pub fn recover(&self) -> StorageResult<Vec<WalEntry>> {
let items = self.read_all_items()?;
// Collect committed seq numbers
let committed: std::collections::HashSet<u64> = items
.iter()
.filter_map(|item| {
if let WalItem::Commit(s) = item {
Some(*s)
} else {
None
}
})
.collect();
// Return records without a commit marker
let uncommitted: Vec<WalEntry> = items
.into_iter()
.filter_map(|item| {
if let WalItem::Record(entry) = item {
if !committed.contains(&entry.seq) {
return Some(entry);
}
}
None
})
.collect();
Ok(uncommitted)
}
/// Truncate the WAL: rewrite with just the file header (clears all entries).
pub fn truncate(&self) -> StorageResult<()> {
let mut f = std::fs::File::create(&self.path)?;
let hdr = FileHeader::new(FileType::Wal);
f.write_all(&hdr.encode())?;
f.flush()?;
f.sync_all()?;
// Don't reset next_seq — it should keep incrementing
Ok(())
}
/// Path to the WAL file.
pub fn path(&self) -> &Path {
&self.path
}
// -----------------------------------------------------------------------
// Internal: read all items from the WAL file
// -----------------------------------------------------------------------
fn read_all_items(&self) -> StorageResult<Vec<WalItem>> {
if !self.path.exists() {
return Ok(vec![]);
}
let file = std::fs::File::open(&self.path)?;
let mut reader = BufReader::new(file);
// Skip file header (if present)
let file_len = std::fs::metadata(&self.path)?.len();
if file_len >= FILE_HEADER_SIZE as u64 {
let mut hdr_buf = [0u8; FILE_HEADER_SIZE];
reader.read_exact(&mut hdr_buf)?;
// Validate but don't fail hard — allow reading even slightly off headers
let _ = FileHeader::decode(&hdr_buf);
}
let mut items = Vec::new();
loop {
// Peek at the magic to determine if this is a record or commit marker
let mut magic_buf = [0u8; 2];
match reader.read_exact(&mut magic_buf) {
Ok(()) => {}
Err(e) if e.kind() == io::ErrorKind::UnexpectedEof => break,
Err(e) => return Err(e.into()),
}
let magic = u16::from_le_bytes(magic_buf);
match magic {
WAL_RECORD_MAGIC => {
// Read rest of header: seq(8) + op(1) + key_len(4) + val_len(4) + crc(4) = 21
let mut rest = [0u8; 21];
match reader.read_exact(&mut rest) {
Ok(()) => {}
Err(e) if e.kind() == io::ErrorKind::UnexpectedEof => break,
Err(e) => return Err(e.into()),
}
let seq = u64::from_le_bytes(rest[0..8].try_into().unwrap());
let op = WalOpType::from_u8(rest[8])?;
let key_len = u32::from_le_bytes(rest[9..13].try_into().unwrap()) as usize;
let val_len = u32::from_le_bytes(rest[13..17].try_into().unwrap()) as usize;
let stored_crc = u32::from_le_bytes(rest[17..21].try_into().unwrap());
let mut payload = vec![0u8; key_len + val_len];
match reader.read_exact(&mut payload) {
Ok(()) => {}
Err(e) if e.kind() == io::ErrorKind::UnexpectedEof => break,
Err(e) => return Err(e.into()),
}
// Verify CRC
let mut hasher = crc32fast::Hasher::new();
hasher.update(&magic_buf);
hasher.update(&rest[0..17]); // seq + op + key_len + val_len
hasher.update(&payload);
let computed = hasher.finalize();
if computed != stored_crc {
// Corrupt WAL entry — skip it (best-effort recovery)
tracing::warn!(
seq,
"skipping corrupt WAL record: CRC mismatch (expected 0x{stored_crc:08X}, got 0x{computed:08X})"
);
continue;
}
let key = payload[..key_len].to_vec();
let value = payload[key_len..].to_vec();
items.push(WalItem::Record(WalEntry {
seq,
op,
key,
value,
}));
}
WAL_COMMIT_MAGIC => {
// Read rest: seq(8) + crc(4) = 12
let mut rest = [0u8; 12];
match reader.read_exact(&mut rest) {
Ok(()) => {}
Err(e) if e.kind() == io::ErrorKind::UnexpectedEof => break,
Err(e) => return Err(e.into()),
}
let seq = u64::from_le_bytes(rest[0..8].try_into().unwrap());
let stored_crc = u32::from_le_bytes(rest[8..12].try_into().unwrap());
let mut hasher = crc32fast::Hasher::new();
hasher.update(&magic_buf);
hasher.update(&rest[0..8]);
let computed = hasher.finalize();
if computed != stored_crc {
tracing::warn!(
seq,
"skipping corrupt WAL commit marker: CRC mismatch"
);
continue;
}
items.push(WalItem::Commit(seq));
}
_ => {
// Unknown magic — file is corrupt past this point
tracing::warn!("unknown WAL magic 0x{magic:04X}, stopping scan");
break;
}
}
}
Ok(items)
}
}
// ---------------------------------------------------------------------------
// Tests
// ---------------------------------------------------------------------------
#[cfg(test)]
mod tests {
use super::*;
fn make_wal(dir: &tempfile::TempDir) -> BinaryWal {
let path = dir.path().join("test.wal");
let wal = BinaryWal::new(path);
wal.initialize().unwrap();
wal
}
#[test]
fn append_and_commit() {
let dir = tempfile::tempdir().unwrap();
let wal = make_wal(&dir);
let seq = wal
.append(WalOpType::Insert, b"key1", b"value1")
.unwrap();
assert_eq!(seq, 1);
wal.append_commit(seq).unwrap();
// All committed — recover should return empty
let uncommitted = wal.recover().unwrap();
assert!(uncommitted.is_empty());
}
#[test]
fn uncommitted_entries_recovered() {
let dir = tempfile::tempdir().unwrap();
let wal = make_wal(&dir);
let s1 = wal
.append(WalOpType::Insert, b"k1", b"v1")
.unwrap();
wal.append_commit(s1).unwrap();
// s2 is NOT committed
let s2 = wal
.append(WalOpType::Update, b"k2", b"v2")
.unwrap();
let uncommitted = wal.recover().unwrap();
assert_eq!(uncommitted.len(), 1);
assert_eq!(uncommitted[0].seq, s2);
assert_eq!(uncommitted[0].op, WalOpType::Update);
assert_eq!(uncommitted[0].key, b"k2");
assert_eq!(uncommitted[0].value, b"v2");
}
#[test]
fn truncate_clears_wal() {
let dir = tempfile::tempdir().unwrap();
let wal = make_wal(&dir);
wal.append(WalOpType::Insert, b"k", b"v").unwrap();
wal.truncate().unwrap();
let uncommitted = wal.recover().unwrap();
assert!(uncommitted.is_empty());
}
#[test]
fn multiple_operations() {
let dir = tempfile::tempdir().unwrap();
let wal = make_wal(&dir);
let s1 = wal.append(WalOpType::Insert, b"a", b"1").unwrap();
let s2 = wal.append(WalOpType::Update, b"b", b"2").unwrap();
let s3 = wal.append(WalOpType::Delete, b"c", b"").unwrap();
// Commit only s1 and s3
wal.append_commit(s1).unwrap();
wal.append_commit(s3).unwrap();
let uncommitted = wal.recover().unwrap();
assert_eq!(uncommitted.len(), 1);
assert_eq!(uncommitted[0].seq, s2);
}
#[test]
fn sequence_numbers_persist_across_reinit() {
let dir = tempfile::tempdir().unwrap();
let path = dir.path().join("persist.wal");
{
let wal = BinaryWal::new(path.clone());
wal.initialize().unwrap();
let s1 = wal.append(WalOpType::Insert, b"k", b"v").unwrap();
assert_eq!(s1, 1);
wal.append_commit(s1).unwrap();
}
// Re-open — seq should continue from 2+ (since max committed was 1)
{
let wal = BinaryWal::new(path);
wal.initialize().unwrap();
let s2 = wal.append(WalOpType::Insert, b"k2", b"v2").unwrap();
assert!(s2 >= 2, "seq should continue: got {s2}");
}
}
#[test]
fn delete_has_empty_value() {
let dir = tempfile::tempdir().unwrap();
let wal = make_wal(&dir);
let seq = wal.append(WalOpType::Delete, b"key", b"").unwrap();
let uncommitted = wal.recover().unwrap();
assert_eq!(uncommitted.len(), 1);
assert_eq!(uncommitted[0].seq, seq);
assert_eq!(uncommitted[0].op, WalOpType::Delete);
assert!(uncommitted[0].value.is_empty());
}
}
@@ -0,0 +1,270 @@
//! Compaction for the Bitcask-style storage engine.
//!
//! Over time, the data file accumulates dead records (superseded by updates,
//! tombstones from deletes). Compaction rewrites the data file with only live
//! records, reclaiming disk space.
//!
//! The process is:
//! 1. Create a new `data.rdb.compact` file with a fresh file header.
//! 2. Iterate all live entries from the KeyDir.
//! 3. Read each live document from the old data file, write to the new file.
//! 4. Atomically rename `data.rdb.compact` → `data.rdb`.
//! 5. Update KeyDir entries with new offsets.
//! 6. Reset dead_bytes counter.
use std::io::{Seek, SeekFrom, Write};
use std::path::Path;
use std::sync::atomic::Ordering;
use tracing::info;
use crate::error::StorageResult;
use crate::keydir::{KeyDir, KeyDirEntry};
use crate::record::{DataRecord, FileHeader, FileType, FILE_HEADER_SIZE};
/// Result of a compaction operation.
#[derive(Debug)]
pub struct CompactionResult {
/// Number of live records written.
pub records_written: u64,
/// Bytes reclaimed (old file size - new file size).
pub bytes_reclaimed: u64,
/// New data file size.
pub new_file_size: u64,
}
/// Compact a collection's data file.
///
/// This function:
/// - Reads all live documents (entries present in the KeyDir) from the old data file
/// - Writes them sequentially to a new file
/// - Atomically renames the new file over the old one
/// - Updates all KeyDir entries with their new offsets
///
/// The caller must hold the collection's write lock during this operation.
pub fn compact_data_file(
data_path: &Path,
keydir: &KeyDir,
dead_bytes: &std::sync::atomic::AtomicU64,
data_file_size: &std::sync::atomic::AtomicU64,
) -> StorageResult<CompactionResult> {
let compact_path = data_path.with_extension("rdb.compact");
let old_file_size = std::fs::metadata(data_path)
.map(|m| m.len())
.unwrap_or(0);
// Collect all live entries with their keys
let mut live_entries: Vec<(String, KeyDirEntry)> = Vec::with_capacity(keydir.len() as usize);
keydir.for_each(|key, entry| {
live_entries.push((key.to_string(), *entry));
});
// Sort by offset for sequential reads (cache-friendly)
live_entries.sort_by_key(|(_, e)| e.offset);
// Create compact file with header
let mut compact_file = std::fs::File::create(&compact_path)?;
let hdr = FileHeader::new(FileType::Data);
compact_file.write_all(&hdr.encode())?;
let mut current_offset = FILE_HEADER_SIZE as u64;
let mut new_entries: Vec<(String, KeyDirEntry)> = Vec::with_capacity(live_entries.len());
let mut old_data_file = std::fs::File::open(data_path)?;
for (key, entry) in &live_entries {
// Read the record from the old file
old_data_file.seek(SeekFrom::Start(entry.offset))?;
let (record, _disk_size) = DataRecord::decode_from(&mut old_data_file)?
.ok_or_else(|| {
crate::error::StorageError::CorruptRecord(format!(
"compaction: unexpected EOF reading doc '{key}' at offset {}",
entry.offset
))
})?;
// Write to compact file
let encoded = record.encode();
let new_disk_size = encoded.len() as u32;
compact_file.write_all(&encoded)?;
new_entries.push((
key.clone(),
KeyDirEntry {
offset: current_offset,
record_len: new_disk_size,
value_len: entry.value_len,
timestamp: entry.timestamp,
},
));
current_offset += new_disk_size as u64;
}
compact_file.sync_all()?;
drop(compact_file);
drop(old_data_file);
// Atomic rename
std::fs::rename(&compact_path, data_path)?;
// Update KeyDir with new offsets
for (key, new_entry) in new_entries {
keydir.insert(key, new_entry);
}
// Reset counters
dead_bytes.store(0, Ordering::Relaxed);
data_file_size.store(current_offset, Ordering::Relaxed);
let bytes_reclaimed = old_file_size.saturating_sub(current_offset);
info!(
records = live_entries.len(),
old_size = old_file_size,
new_size = current_offset,
reclaimed = bytes_reclaimed,
"compaction complete"
);
Ok(CompactionResult {
records_written: live_entries.len() as u64,
bytes_reclaimed,
new_file_size: current_offset,
})
}
/// Check if compaction is warranted for a collection.
/// Returns true if dead bytes exceed 50% of live data.
pub fn should_compact(dead_bytes: u64, data_file_size: u64) -> bool {
if data_file_size <= FILE_HEADER_SIZE as u64 {
return false;
}
let useful_bytes = data_file_size - FILE_HEADER_SIZE as u64;
// Trigger when dead > 50% of total useful data
dead_bytes > useful_bytes / 2
}
// ---------------------------------------------------------------------------
// Tests
// ---------------------------------------------------------------------------
#[cfg(test)]
mod tests {
use super::*;
use crate::keydir::KeyDir;
use crate::record::{now_ms, DataRecord, FileHeader, FileType};
use std::io::Write;
use std::sync::atomic::AtomicU64;
#[test]
fn compact_removes_dead_records() {
let dir = tempfile::tempdir().unwrap();
let data_path = dir.path().join("data.rdb");
// Write a data file: insert A, update A (new version), insert B
let mut f = std::fs::File::create(&data_path).unwrap();
let hdr = FileHeader::new(FileType::Data);
f.write_all(&hdr.encode()).unwrap();
let ts = now_ms();
// Record 1: A v1 (will be superseded)
let r1 = DataRecord {
timestamp: ts,
key: b"aaa".to_vec(),
value: b"old_value".to_vec(),
};
let r1_enc = r1.encode();
let r1_offset = FILE_HEADER_SIZE as u64;
let r1_size = r1_enc.len();
f.write_all(&r1_enc).unwrap();
// Record 2: A v2 (current)
let r2 = DataRecord {
timestamp: ts + 1,
key: b"aaa".to_vec(),
value: b"new_value".to_vec(),
};
let r2_enc = r2.encode();
let r2_offset = r1_offset + r1_size as u64;
let r2_size = r2_enc.len();
f.write_all(&r2_enc).unwrap();
// Record 3: B (live)
let r3 = DataRecord {
timestamp: ts + 2,
key: b"bbb".to_vec(),
value: b"bbb_value".to_vec(),
};
let r3_enc = r3.encode();
let r3_offset = r2_offset + r2_size as u64;
f.write_all(&r3_enc).unwrap();
f.sync_all().unwrap();
drop(f);
let total_size = std::fs::metadata(&data_path).unwrap().len();
// Build KeyDir — only points to latest versions
let keydir = KeyDir::new();
keydir.insert(
"aaa".into(),
KeyDirEntry {
offset: r2_offset,
record_len: r2_size as u32,
value_len: r2.value.len() as u32,
timestamp: ts + 1,
},
);
keydir.insert(
"bbb".into(),
KeyDirEntry {
offset: r3_offset,
record_len: r3.encode().len() as u32,
value_len: r3.value.len() as u32,
timestamp: ts + 2,
},
);
let dead_bytes_counter = AtomicU64::new(r1_size as u64);
let data_file_size_counter = AtomicU64::new(total_size);
let result = compact_data_file(
&data_path,
&keydir,
&dead_bytes_counter,
&data_file_size_counter,
)
.unwrap();
assert_eq!(result.records_written, 2);
assert!(result.bytes_reclaimed > 0);
assert!(result.new_file_size < total_size);
// Verify dead_bytes was reset
assert_eq!(dead_bytes_counter.load(Ordering::Relaxed), 0);
// Verify KeyDir was updated with new offsets
let a_entry = keydir.get("aaa").unwrap();
assert_eq!(a_entry.offset, FILE_HEADER_SIZE as u64); // first record after header
assert_eq!(a_entry.value_len, b"new_value".len() as u32);
let b_entry = keydir.get("bbb").unwrap();
assert!(b_entry.offset > a_entry.offset);
// Verify the compacted file can be used to rebuild KeyDir
let (rebuilt, dead, _stats) = KeyDir::build_from_data_file(&data_path).unwrap();
assert_eq!(rebuilt.len(), 2);
assert_eq!(dead, 0); // no dead records in compacted file
}
#[test]
fn should_compact_thresholds() {
// Under threshold
assert!(!should_compact(10, 100 + FILE_HEADER_SIZE as u64));
// Over threshold (dead > 50% of useful)
assert!(should_compact(60, 100 + FILE_HEADER_SIZE as u64));
// Empty file
assert!(!should_compact(0, FILE_HEADER_SIZE as u64));
}
}
+9
View File
@@ -17,6 +17,15 @@ pub enum StorageError {
#[error("conflict detected: {0}")]
ConflictError(String),
#[error("corrupt record: {0}")]
CorruptRecord(String),
#[error("checksum mismatch: expected 0x{expected:08X}, got 0x{actual:08X}")]
ChecksumMismatch { expected: u32, actual: u32 },
#[error("WAL error: {0}")]
WalError(String),
}
impl From<serde_json::Error> for StorageError {
File diff suppressed because it is too large Load Diff
+562
View File
@@ -0,0 +1,562 @@
//! KeyDir — in-memory document location index for the Bitcask storage engine.
//!
//! Maps document `_id` (hex string) to its location in the append-only data file.
//! Backed by `DashMap` for lock-free concurrent reads and fine-grained write locking.
//!
//! The KeyDir can be rebuilt from a data file scan, or loaded quickly from a
//! persisted hint file for fast restart.
use std::io::{self, BufReader, BufWriter, Read, Seek, SeekFrom, Write};
use std::path::Path;
use std::sync::atomic::{AtomicU64, Ordering};
use dashmap::DashMap;
use crate::error::{StorageError, StorageResult};
use crate::record::{
DataRecord, FileHeader, FileType, RecordScanner, FILE_HEADER_SIZE, FORMAT_VERSION,
};
// ---------------------------------------------------------------------------
// KeyDirEntry
// ---------------------------------------------------------------------------
/// Location of a single document in the data file.
#[derive(Debug, Clone, Copy)]
pub struct KeyDirEntry {
/// Byte offset of the record in `data.rdb`.
pub offset: u64,
/// Total record size on disk (header + payload).
pub record_len: u32,
/// BSON value length. 0 means tombstone (used during compaction accounting).
pub value_len: u32,
/// Timestamp (epoch ms) from the record. Used for conflict detection.
pub timestamp: u64,
}
// ---------------------------------------------------------------------------
// BuildStats — statistics from building KeyDir from a data file scan
// ---------------------------------------------------------------------------
/// Statistics collected while building a KeyDir from a data file scan.
#[derive(Debug, Clone, Default)]
pub struct BuildStats {
/// Total records scanned (live + tombstones + superseded).
pub total_records_scanned: u64,
/// Number of live documents in the final KeyDir.
pub live_documents: u64,
/// Number of tombstone records encountered.
pub tombstones: u64,
/// Number of records superseded by a later write for the same key.
pub superseded_records: u64,
}
// ---------------------------------------------------------------------------
// KeyDir
// ---------------------------------------------------------------------------
/// In-memory index mapping document ID → data file location.
pub struct KeyDir {
map: DashMap<String, KeyDirEntry>,
/// Running count of live documents.
doc_count: AtomicU64,
}
impl KeyDir {
/// Create an empty KeyDir.
pub fn new() -> Self {
Self {
map: DashMap::new(),
doc_count: AtomicU64::new(0),
}
}
/// Insert or update an entry. Returns the previous entry if one existed.
pub fn insert(&self, key: String, entry: KeyDirEntry) -> Option<KeyDirEntry> {
let prev = self.map.insert(key, entry);
if prev.is_none() {
self.doc_count.fetch_add(1, Ordering::Relaxed);
}
prev
}
/// Look up an entry by key.
pub fn get(&self, key: &str) -> Option<KeyDirEntry> {
self.map.get(key).map(|r| *r.value())
}
/// Remove an entry. Returns the removed entry if it existed.
pub fn remove(&self, key: &str) -> Option<KeyDirEntry> {
let removed = self.map.remove(key).map(|(_, v)| v);
if removed.is_some() {
self.doc_count.fetch_sub(1, Ordering::Relaxed);
}
removed
}
/// Number of live documents.
pub fn len(&self) -> u64 {
self.doc_count.load(Ordering::Relaxed)
}
/// Whether the index is empty.
pub fn is_empty(&self) -> bool {
self.len() == 0
}
/// Check if a key exists.
pub fn contains(&self, key: &str) -> bool {
self.map.contains_key(key)
}
/// Iterate over all entries. The closure receives (key, entry).
pub fn for_each(&self, mut f: impl FnMut(&str, &KeyDirEntry)) {
for entry in self.map.iter() {
f(entry.key(), entry.value());
}
}
/// Collect all keys.
pub fn keys(&self) -> Vec<String> {
self.map.iter().map(|e| e.key().clone()).collect()
}
/// Clear all entries.
pub fn clear(&self) {
self.map.clear();
self.doc_count.store(0, Ordering::Relaxed);
}
// -----------------------------------------------------------------------
// Build from data file
// -----------------------------------------------------------------------
/// Rebuild the KeyDir by scanning an entire data file.
/// The file must start with a valid `FileHeader`.
/// Returns `(keydir, dead_bytes, stats)` where `dead_bytes` is the total size of
/// stale records (superseded by later writes or tombstoned).
pub fn build_from_data_file(path: &Path) -> StorageResult<(Self, u64, BuildStats)> {
let file = std::fs::File::open(path)?;
let mut reader = BufReader::new(file);
// Read and validate file header
let mut hdr_buf = [0u8; FILE_HEADER_SIZE];
reader.read_exact(&mut hdr_buf)?;
let hdr = FileHeader::decode(&hdr_buf)?;
if hdr.file_type != FileType::Data {
return Err(StorageError::CorruptRecord(format!(
"expected data file (type 1), got type {:?}",
hdr.file_type
)));
}
let keydir = KeyDir::new();
let mut dead_bytes: u64 = 0;
let mut stats = BuildStats::default();
let scanner = RecordScanner::new(reader, FILE_HEADER_SIZE as u64);
for result in scanner {
let (offset, record) = result?;
let is_tombstone = record.is_tombstone();
let disk_size = record.disk_size() as u32;
let value_len = record.value.len() as u32;
let timestamp = record.timestamp;
let key = String::from_utf8(record.key)
.map_err(|e| StorageError::CorruptRecord(format!("invalid UTF-8 key: {e}")))?;
stats.total_records_scanned += 1;
if is_tombstone {
stats.tombstones += 1;
// Remove from index; the tombstone itself is dead weight
if let Some(prev) = keydir.remove(&key) {
dead_bytes += prev.record_len as u64;
}
dead_bytes += disk_size as u64;
} else {
let entry = KeyDirEntry {
offset,
record_len: disk_size,
value_len,
timestamp,
};
if let Some(prev) = keydir.insert(key, entry) {
// Previous version of same key is now dead
dead_bytes += prev.record_len as u64;
stats.superseded_records += 1;
}
}
}
stats.live_documents = keydir.len();
Ok((keydir, dead_bytes, stats))
}
// -----------------------------------------------------------------------
// Hint file persistence (for fast startup)
// -----------------------------------------------------------------------
/// Persist the KeyDir to a hint file for fast restart.
///
/// Hint file format (after the 64-byte file header):
/// For each entry: [key_len:u32 LE][key bytes][offset:u64 LE][record_len:u32 LE][value_len:u32 LE][timestamp:u64 LE]
pub fn persist_to_hint_file(&self, path: &Path) -> StorageResult<()> {
let file = std::fs::File::create(path)?;
let mut writer = BufWriter::new(file);
// Write file header
let hdr = FileHeader::new(FileType::Hint);
writer.write_all(&hdr.encode())?;
// Write entries
for entry in self.map.iter() {
let key_bytes = entry.key().as_bytes();
let key_len = key_bytes.len() as u32;
writer.write_all(&key_len.to_le_bytes())?;
writer.write_all(key_bytes)?;
writer.write_all(&entry.value().offset.to_le_bytes())?;
writer.write_all(&entry.value().record_len.to_le_bytes())?;
writer.write_all(&entry.value().value_len.to_le_bytes())?;
writer.write_all(&entry.value().timestamp.to_le_bytes())?;
}
writer.flush()?;
Ok(())
}
/// Load a KeyDir from a hint file. Returns None if the file doesn't exist.
pub fn load_from_hint_file(path: &Path) -> StorageResult<Option<Self>> {
if !path.exists() {
return Ok(None);
}
let file = std::fs::File::open(path)?;
let mut reader = BufReader::new(file);
// Read and validate header
let mut hdr_buf = [0u8; FILE_HEADER_SIZE];
match reader.read_exact(&mut hdr_buf) {
Ok(()) => {}
Err(e) if e.kind() == io::ErrorKind::UnexpectedEof => return Ok(None),
Err(e) => return Err(e.into()),
}
let hdr = FileHeader::decode(&hdr_buf)?;
if hdr.file_type != FileType::Hint {
return Err(StorageError::CorruptRecord(format!(
"expected hint file (type 3), got type {:?}",
hdr.file_type
)));
}
if hdr.version > FORMAT_VERSION {
return Err(StorageError::CorruptRecord(format!(
"hint file version {} is newer than supported {}",
hdr.version, FORMAT_VERSION
)));
}
let keydir = KeyDir::new();
loop {
// Read key_len
let mut key_len_buf = [0u8; 4];
match reader.read_exact(&mut key_len_buf) {
Ok(()) => {}
Err(e) if e.kind() == io::ErrorKind::UnexpectedEof => break,
Err(e) => return Err(e.into()),
}
let key_len = u32::from_le_bytes(key_len_buf) as usize;
// Read key
let mut key_buf = vec![0u8; key_len];
reader.read_exact(&mut key_buf)?;
let key = String::from_utf8(key_buf)
.map_err(|e| StorageError::CorruptRecord(format!("invalid UTF-8 key: {e}")))?;
// Read entry fields
let mut fields = [0u8; 8 + 4 + 4 + 8]; // offset + record_len + value_len + timestamp = 24
reader.read_exact(&mut fields)?;
let offset = u64::from_le_bytes(fields[0..8].try_into().unwrap());
let record_len = u32::from_le_bytes(fields[8..12].try_into().unwrap());
let value_len = u32::from_le_bytes(fields[12..16].try_into().unwrap());
let timestamp = u64::from_le_bytes(fields[16..24].try_into().unwrap());
keydir.insert(
key,
KeyDirEntry {
offset,
record_len,
value_len,
timestamp,
},
);
}
Ok(Some(keydir))
}
// -----------------------------------------------------------------------
// Hint file validation
// -----------------------------------------------------------------------
/// Validate this KeyDir (loaded from a hint file) against the actual data file.
/// Returns `Ok(true)` if the hint appears consistent, `Ok(false)` if a rebuild
/// from the data file is recommended.
///
/// Checks:
/// 1. All entry offsets + record_len fit within the data file size.
/// 2. All entry offsets are >= FILE_HEADER_SIZE.
/// 3. A random sample of entries is spot-checked by reading the record at
/// the offset and verifying the key matches.
pub fn validate_against_data_file(&self, data_path: &Path, sample_size: usize) -> StorageResult<bool> {
let file_size = std::fs::metadata(data_path)
.map(|m| m.len())
.unwrap_or(0);
if file_size < FILE_HEADER_SIZE as u64 {
// Data file is too small to even contain a header
return Ok(self.is_empty());
}
// Pass 1: bounds check all entries
let mut all_keys: Vec<(String, KeyDirEntry)> = Vec::with_capacity(self.len() as usize);
let mut bounds_ok = true;
self.for_each(|key, entry| {
if entry.offset < FILE_HEADER_SIZE as u64
|| entry.offset + entry.record_len as u64 > file_size
{
bounds_ok = false;
}
all_keys.push((key.to_string(), *entry));
});
if !bounds_ok {
return Ok(false);
}
// Pass 2: spot-check a sample of entries by reading records from data.rdb
if all_keys.is_empty() {
return Ok(true);
}
// Sort by offset for sequential I/O, take first `sample_size` entries
all_keys.sort_by_key(|(_, e)| e.offset);
let step = if all_keys.len() <= sample_size {
1
} else {
all_keys.len() / sample_size
};
let mut file = std::fs::File::open(data_path)?;
let mut checked = 0usize;
for (i, (expected_key, entry)) in all_keys.iter().enumerate() {
if checked >= sample_size {
break;
}
if i % step != 0 {
continue;
}
// Seek to the entry's offset and try to decode the record
file.seek(SeekFrom::Start(entry.offset))?;
match DataRecord::decode_from(&mut file) {
Ok(Some((record, _disk_size))) => {
let record_key = String::from_utf8_lossy(&record.key);
if record_key != *expected_key {
return Ok(false);
}
}
Ok(None) | Err(_) => {
return Ok(false);
}
}
checked += 1;
}
Ok(true)
}
}
impl Default for KeyDir {
fn default() -> Self {
Self::new()
}
}
// ---------------------------------------------------------------------------
// Tests
// ---------------------------------------------------------------------------
#[cfg(test)]
mod tests {
use super::*;
use crate::record::DataRecord;
use std::io::Write;
#[test]
fn basic_insert_get_remove() {
let kd = KeyDir::new();
assert!(kd.is_empty());
let entry = KeyDirEntry {
offset: 100,
record_len: 50,
value_len: 30,
timestamp: 1700000000000,
};
assert!(kd.insert("abc".into(), entry).is_none());
assert_eq!(kd.len(), 1);
assert!(kd.contains("abc"));
let got = kd.get("abc").unwrap();
assert_eq!(got.offset, 100);
assert_eq!(got.value_len, 30);
let removed = kd.remove("abc").unwrap();
assert_eq!(removed.offset, 100);
assert_eq!(kd.len(), 0);
assert!(!kd.contains("abc"));
}
#[test]
fn insert_overwrites_returns_previous() {
let kd = KeyDir::new();
let e1 = KeyDirEntry {
offset: 100,
record_len: 50,
value_len: 30,
timestamp: 1,
};
let e2 = KeyDirEntry {
offset: 200,
record_len: 60,
value_len: 40,
timestamp: 2,
};
kd.insert("k".into(), e1);
assert_eq!(kd.len(), 1);
let prev = kd.insert("k".into(), e2).unwrap();
assert_eq!(prev.offset, 100);
// Count stays at 1 (overwrite, not new)
assert_eq!(kd.len(), 1);
assert_eq!(kd.get("k").unwrap().offset, 200);
}
#[test]
fn build_from_data_file() {
let dir = tempfile::tempdir().unwrap();
let data_path = dir.path().join("data.rdb");
// Write a data file with 3 records: insert A, insert B, delete A
{
let mut f = std::fs::File::create(&data_path).unwrap();
let hdr = FileHeader::new(FileType::Data);
f.write_all(&hdr.encode()).unwrap();
let r1 = DataRecord {
timestamp: 1,
key: b"aaa".to_vec(),
value: b"val_a".to_vec(),
};
let r2 = DataRecord {
timestamp: 2,
key: b"bbb".to_vec(),
value: b"val_b".to_vec(),
};
let r3 = DataRecord {
timestamp: 3,
key: b"aaa".to_vec(),
value: vec![], // tombstone
};
f.write_all(&r1.encode()).unwrap();
f.write_all(&r2.encode()).unwrap();
f.write_all(&r3.encode()).unwrap();
}
let (kd, dead_bytes, stats) = KeyDir::build_from_data_file(&data_path).unwrap();
// Only B should be live
assert_eq!(kd.len(), 1);
assert!(kd.contains("bbb"));
assert!(!kd.contains("aaa"));
// Dead bytes: r1 (aaa live, then superseded by tombstone) + r3 (tombstone itself)
assert!(dead_bytes > 0);
// Stats
assert_eq!(stats.total_records_scanned, 3);
assert_eq!(stats.live_documents, 1);
assert_eq!(stats.tombstones, 1);
assert_eq!(stats.superseded_records, 0); // aaa was removed by tombstone, not superseded
}
#[test]
fn hint_file_roundtrip() {
let dir = tempfile::tempdir().unwrap();
let hint_path = dir.path().join("keydir.hint");
let kd = KeyDir::new();
kd.insert(
"doc1".into(),
KeyDirEntry {
offset: 64,
record_len: 100,
value_len: 80,
timestamp: 1000,
},
);
kd.insert(
"doc2".into(),
KeyDirEntry {
offset: 164,
record_len: 200,
value_len: 150,
timestamp: 2000,
},
);
kd.persist_to_hint_file(&hint_path).unwrap();
let loaded = KeyDir::load_from_hint_file(&hint_path).unwrap().unwrap();
assert_eq!(loaded.len(), 2);
let e1 = loaded.get("doc1").unwrap();
assert_eq!(e1.offset, 64);
assert_eq!(e1.record_len, 100);
assert_eq!(e1.value_len, 80);
assert_eq!(e1.timestamp, 1000);
let e2 = loaded.get("doc2").unwrap();
assert_eq!(e2.offset, 164);
assert_eq!(e2.timestamp, 2000);
}
#[test]
fn hint_file_nonexistent_returns_none() {
let result = KeyDir::load_from_hint_file(Path::new("/tmp/nonexistent_hint_file.hint"));
assert!(result.unwrap().is_none());
}
#[test]
fn for_each_and_keys() {
let kd = KeyDir::new();
let e = KeyDirEntry {
offset: 0,
record_len: 10,
value_len: 5,
timestamp: 1,
};
kd.insert("x".into(), e);
kd.insert("y".into(), e);
let mut collected = Vec::new();
kd.for_each(|k, _| collected.push(k.to_string()));
collected.sort();
assert_eq!(collected, vec!["x", "y"]);
let mut keys = kd.keys();
keys.sort();
assert_eq!(keys, vec!["x", "y"]);
}
}
+15 -5
View File
@@ -2,21 +2,31 @@
//!
//! Provides the [`StorageAdapter`] trait and two concrete implementations:
//! - [`MemoryStorageAdapter`] -- fast in-memory store backed by `DashMap`
//! - [`FileStorageAdapter`] -- JSON-file-per-collection persistent store
//! - [`FileStorageAdapter`] -- Bitcask-style append-only log with crash recovery
//!
//! Also includes an [`OpLog`] for operation logging and a [`WriteAheadLog`]
//! for crash recovery.
//! Also includes an [`OpLog`] for operation logging, a [`BinaryWal`] for
//! write-ahead logging, and [`compaction`] for dead record reclamation.
pub mod adapter;
pub mod binary_wal;
pub mod compaction;
pub mod error;
pub mod file;
pub mod keydir;
pub mod memory;
pub mod oplog;
pub mod wal;
pub mod record;
pub mod validate;
pub use adapter::StorageAdapter;
pub use binary_wal::{BinaryWal, WalEntry, WalOpType};
pub use compaction::{compact_data_file, should_compact, CompactionResult};
pub use error::{StorageError, StorageResult};
pub use file::FileStorageAdapter;
pub use keydir::{BuildStats, KeyDir, KeyDirEntry};
pub use memory::MemoryStorageAdapter;
pub use oplog::{OpLog, OpLogEntry, OpLogStats, OpType};
pub use wal::{WalOp, WalRecord, WriteAheadLog};
pub use record::{
DataRecord, FileHeader, FileType, RecordScanner, FILE_HEADER_SIZE, FILE_MAGIC, FORMAT_VERSION,
RECORD_HEADER_SIZE, RECORD_MAGIC,
};
+452
View File
@@ -0,0 +1,452 @@
//! Binary data record format for the Bitcask-style storage engine.
//!
//! # File Version Header (64 bytes, at offset 0 of every .rdb / .hint file)
//!
//! ```text
//! ┌──────────────┬──────────┬──────────┬──────────┬──────────┬───────────────┐
//! │ magic │ version │ file_type│ flags │ created │ reserved │
//! │ 8 bytes │ u16 LE │ u8 │ u32 LE │ u64 LE │ 41 bytes │
//! │ "SMARTDB\0" │ │ │ │ epoch_ms │ (zeros) │
//! └──────────────┴──────────┴──────────┴──────────┴──────────┴───────────────┘
//! ```
//!
//! # Data Record (appended after the header)
//!
//! ```text
//! ┌──────────┬──────────┬──────────┬──────────┬──────────┬──────────────────┐
//! │ magic │ timestamp│ key_len │ val_len │ crc32 │ payload │
//! │ u16 LE │ u64 LE │ u32 LE │ u32 LE │ u32 LE │ [key][value] │
//! │ 0xDB01 │ epoch_ms │ │ 0=delete │ │ │
//! └──────────┴──────────┴──────────┴──────────┴──────────┴──────────────────┘
//! ```
use std::io::{self, Read};
use std::time::{SystemTime, UNIX_EPOCH};
use crate::error::{StorageError, StorageResult};
// ---------------------------------------------------------------------------
// Constants
// ---------------------------------------------------------------------------
/// File-level magic: b"SMARTDB\0"
pub const FILE_MAGIC: &[u8; 8] = b"SMARTDB\0";
/// Current storage format version.
pub const FORMAT_VERSION: u16 = 1;
/// File version header size.
pub const FILE_HEADER_SIZE: usize = 64;
/// Per-record magic.
pub const RECORD_MAGIC: u16 = 0xDB01;
/// Per-record header size (before payload).
pub const RECORD_HEADER_SIZE: usize = 2 + 8 + 4 + 4 + 4; // 22 bytes
// ---------------------------------------------------------------------------
// File type tag stored in the version header
// ---------------------------------------------------------------------------
#[derive(Debug, Clone, Copy, PartialEq, Eq)]
#[repr(u8)]
pub enum FileType {
Data = 1,
Wal = 2,
Hint = 3,
}
impl FileType {
pub fn from_u8(v: u8) -> StorageResult<Self> {
match v {
1 => Ok(FileType::Data),
2 => Ok(FileType::Wal),
3 => Ok(FileType::Hint),
_ => Err(StorageError::CorruptRecord(format!(
"unknown file type tag: {v}"
))),
}
}
}
// ---------------------------------------------------------------------------
// File Version Header
// ---------------------------------------------------------------------------
#[derive(Debug, Clone)]
pub struct FileHeader {
pub version: u16,
pub file_type: FileType,
pub flags: u32,
pub created_ms: u64,
}
impl FileHeader {
/// Create a new header for the current format version.
pub fn new(file_type: FileType) -> Self {
Self {
version: FORMAT_VERSION,
file_type,
flags: 0,
created_ms: now_ms(),
}
}
/// Encode the header to a 64-byte buffer.
pub fn encode(&self) -> [u8; FILE_HEADER_SIZE] {
let mut buf = [0u8; FILE_HEADER_SIZE];
buf[0..8].copy_from_slice(FILE_MAGIC);
buf[8..10].copy_from_slice(&self.version.to_le_bytes());
buf[10] = self.file_type as u8;
buf[11..15].copy_from_slice(&self.flags.to_le_bytes());
buf[15..23].copy_from_slice(&self.created_ms.to_le_bytes());
// bytes 23..64 are reserved (zeros)
buf
}
/// Decode a 64-byte header. Validates magic and version.
pub fn decode(buf: &[u8; FILE_HEADER_SIZE]) -> StorageResult<Self> {
if &buf[0..8] != FILE_MAGIC {
return Err(StorageError::CorruptRecord(
"invalid file magic — not a SmartDB file".into(),
));
}
let version = u16::from_le_bytes([buf[8], buf[9]]);
if version > FORMAT_VERSION {
return Err(StorageError::CorruptRecord(format!(
"file format version {version} is newer than supported version {FORMAT_VERSION} — please upgrade"
)));
}
if version == 0 {
return Err(StorageError::CorruptRecord(
"file format version 0 is invalid".into(),
));
}
let file_type = FileType::from_u8(buf[10])?;
let flags = u32::from_le_bytes([buf[11], buf[12], buf[13], buf[14]]);
let created_ms = u64::from_le_bytes([
buf[15], buf[16], buf[17], buf[18], buf[19], buf[20], buf[21], buf[22],
]);
Ok(Self {
version,
file_type,
flags,
created_ms,
})
}
}
// ---------------------------------------------------------------------------
// Data Record
// ---------------------------------------------------------------------------
/// A single data record (live document or tombstone).
#[derive(Debug, Clone)]
pub struct DataRecord {
pub timestamp: u64,
pub key: Vec<u8>,
/// BSON value bytes. Empty for tombstones.
pub value: Vec<u8>,
}
impl DataRecord {
/// Whether this record is a tombstone (delete marker).
pub fn is_tombstone(&self) -> bool {
self.value.is_empty()
}
/// Total size on disk (header + payload).
pub fn disk_size(&self) -> usize {
RECORD_HEADER_SIZE + self.key.len() + self.value.len()
}
/// Encode to bytes. CRC32 covers magic + timestamp + key_len + val_len + payload.
pub fn encode(&self) -> Vec<u8> {
let key_len = self.key.len() as u32;
let val_len = self.value.len() as u32;
let total = RECORD_HEADER_SIZE + self.key.len() + self.value.len();
let mut buf = Vec::with_capacity(total);
// Write fields WITHOUT crc first to compute checksum.
buf.extend_from_slice(&RECORD_MAGIC.to_le_bytes()); // 2
buf.extend_from_slice(&self.timestamp.to_le_bytes()); // 8
buf.extend_from_slice(&key_len.to_le_bytes()); // 4
buf.extend_from_slice(&val_len.to_le_bytes()); // 4
// placeholder for crc32 — we'll fill it after computing
buf.extend_from_slice(&0u32.to_le_bytes()); // 4
buf.extend_from_slice(&self.key); // key_len
buf.extend_from_slice(&self.value); // val_len
// CRC covers everything except the crc32 field itself:
// bytes [0..18] (magic+ts+key_len+val_len) + bytes [22..] (payload)
let mut hasher = crc32fast::Hasher::new();
hasher.update(&buf[0..18]);
hasher.update(&buf[22..]);
let crc = hasher.finalize();
buf[18..22].copy_from_slice(&crc.to_le_bytes());
buf
}
/// Decode a record from a reader. Returns the record and its total disk size.
/// On EOF at the very start (no bytes to read), returns Ok(None).
pub fn decode_from<R: Read>(reader: &mut R) -> StorageResult<Option<(Self, usize)>> {
// Read header
let mut hdr = [0u8; RECORD_HEADER_SIZE];
match reader.read_exact(&mut hdr) {
Ok(()) => {}
Err(e) if e.kind() == io::ErrorKind::UnexpectedEof => return Ok(None),
Err(e) => return Err(e.into()),
}
let magic = u16::from_le_bytes([hdr[0], hdr[1]]);
if magic != RECORD_MAGIC {
return Err(StorageError::CorruptRecord(format!(
"invalid record magic: 0x{magic:04X}, expected 0x{RECORD_MAGIC:04X}"
)));
}
let timestamp = u64::from_le_bytes(hdr[2..10].try_into().unwrap());
let key_len = u32::from_le_bytes(hdr[10..14].try_into().unwrap()) as usize;
let val_len = u32::from_le_bytes(hdr[14..18].try_into().unwrap()) as usize;
let stored_crc = u32::from_le_bytes(hdr[18..22].try_into().unwrap());
// Read payload
let payload_len = key_len + val_len;
let mut payload = vec![0u8; payload_len];
reader.read_exact(&mut payload)?;
// Verify CRC: covers header bytes [0..18] + payload
let mut hasher = crc32fast::Hasher::new();
hasher.update(&hdr[0..18]);
hasher.update(&payload);
let computed_crc = hasher.finalize();
if computed_crc != stored_crc {
return Err(StorageError::ChecksumMismatch {
expected: stored_crc,
actual: computed_crc,
});
}
let key = payload[..key_len].to_vec();
let value = payload[key_len..].to_vec();
let disk_size = RECORD_HEADER_SIZE + payload_len;
Ok(Some((
DataRecord {
timestamp,
key,
value,
},
disk_size,
)))
}
}
// ---------------------------------------------------------------------------
// Record Scanner — iterate records from a byte slice or reader
// ---------------------------------------------------------------------------
/// Scans records sequentially from a reader, yielding (offset, record) pairs.
/// Starts reading from the current reader position. The `base_offset` parameter
/// indicates the byte offset in the file where reading begins (typically
/// `FILE_HEADER_SIZE` for a data file).
pub struct RecordScanner<R> {
reader: R,
offset: u64,
}
impl<R: Read> RecordScanner<R> {
pub fn new(reader: R, base_offset: u64) -> Self {
Self {
reader,
offset: base_offset,
}
}
}
impl<R: Read> Iterator for RecordScanner<R> {
/// (file_offset, record) or an error. Iteration stops on EOF or error.
type Item = StorageResult<(u64, DataRecord)>;
fn next(&mut self) -> Option<Self::Item> {
match DataRecord::decode_from(&mut self.reader) {
Ok(Some((record, disk_size))) => {
let offset = self.offset;
self.offset += disk_size as u64;
Some(Ok((offset, record)))
}
Ok(None) => None, // clean EOF
Err(e) => Some(Err(e)),
}
}
}
// ---------------------------------------------------------------------------
// Helpers
// ---------------------------------------------------------------------------
/// Current time in milliseconds since UNIX epoch.
pub fn now_ms() -> u64 {
SystemTime::now()
.duration_since(UNIX_EPOCH)
.unwrap()
.as_millis() as u64
}
// ---------------------------------------------------------------------------
// Tests
// ---------------------------------------------------------------------------
#[cfg(test)]
mod tests {
use super::*;
#[test]
fn file_header_roundtrip() {
let hdr = FileHeader::new(FileType::Data);
let buf = hdr.encode();
assert_eq!(buf.len(), FILE_HEADER_SIZE);
let decoded = FileHeader::decode(&buf).unwrap();
assert_eq!(decoded.version, FORMAT_VERSION);
assert_eq!(decoded.file_type, FileType::Data);
assert_eq!(decoded.flags, 0);
assert_eq!(decoded.created_ms, hdr.created_ms);
}
#[test]
fn file_header_rejects_bad_magic() {
let mut buf = [0u8; FILE_HEADER_SIZE];
buf[0..8].copy_from_slice(b"BADMAGIC");
assert!(FileHeader::decode(&buf).is_err());
}
#[test]
fn file_header_rejects_future_version() {
let mut hdr = FileHeader::new(FileType::Data);
hdr.version = FORMAT_VERSION + 1;
let buf = hdr.encode();
// Manually patch the version in the buffer
let mut buf2 = buf;
buf2[8..10].copy_from_slice(&(FORMAT_VERSION + 1).to_le_bytes());
assert!(FileHeader::decode(&buf2).is_err());
}
#[test]
fn record_roundtrip_live() {
let rec = DataRecord {
timestamp: 1700000000000,
key: b"abc123".to_vec(),
value: b"\x10\x00\x00\x00\x02hi\x00\x03\x00\x00\x00ok\x00\x00".to_vec(),
};
let encoded = rec.encode();
assert_eq!(encoded.len(), rec.disk_size());
let mut cursor = std::io::Cursor::new(&encoded);
let (decoded, size) = DataRecord::decode_from(&mut cursor).unwrap().unwrap();
assert_eq!(size, encoded.len());
assert_eq!(decoded.timestamp, rec.timestamp);
assert_eq!(decoded.key, rec.key);
assert_eq!(decoded.value, rec.value);
assert!(!decoded.is_tombstone());
}
#[test]
fn record_roundtrip_tombstone() {
let rec = DataRecord {
timestamp: 1700000000000,
key: b"def456".to_vec(),
value: vec![],
};
assert!(rec.is_tombstone());
let encoded = rec.encode();
let mut cursor = std::io::Cursor::new(&encoded);
let (decoded, _) = DataRecord::decode_from(&mut cursor).unwrap().unwrap();
assert!(decoded.is_tombstone());
assert_eq!(decoded.key, b"def456");
}
#[test]
fn record_detects_corruption() {
let rec = DataRecord {
timestamp: 42,
key: b"key".to_vec(),
value: b"value".to_vec(),
};
let mut encoded = rec.encode();
// Flip a bit in the payload
let last = encoded.len() - 1;
encoded[last] ^= 0xFF;
let mut cursor = std::io::Cursor::new(&encoded);
let result = DataRecord::decode_from(&mut cursor);
assert!(matches!(result, Err(StorageError::ChecksumMismatch { .. })));
}
#[test]
fn record_detects_bad_magic() {
let rec = DataRecord {
timestamp: 42,
key: b"key".to_vec(),
value: b"value".to_vec(),
};
let mut encoded = rec.encode();
encoded[0] = 0xFF;
encoded[1] = 0xFF;
let mut cursor = std::io::Cursor::new(&encoded);
let result = DataRecord::decode_from(&mut cursor);
assert!(matches!(result, Err(StorageError::CorruptRecord(_))));
}
#[test]
fn eof_returns_none() {
let empty: &[u8] = &[];
let mut cursor = std::io::Cursor::new(empty);
let result = DataRecord::decode_from(&mut cursor).unwrap();
assert!(result.is_none());
}
#[test]
fn scanner_iterates_multiple_records() {
let records = vec![
DataRecord {
timestamp: 1,
key: b"a".to_vec(),
value: b"v1".to_vec(),
},
DataRecord {
timestamp: 2,
key: b"b".to_vec(),
value: b"v2".to_vec(),
},
DataRecord {
timestamp: 3,
key: b"c".to_vec(),
value: vec![],
},
];
let mut buf = Vec::new();
for r in &records {
buf.extend_from_slice(&r.encode());
}
let scanner = RecordScanner::new(std::io::Cursor::new(&buf), 0);
let results: Vec<_> = scanner.collect::<Result<Vec<_>, _>>().unwrap();
assert_eq!(results.len(), 3);
assert_eq!(results[0].1.key, b"a");
assert_eq!(results[1].1.key, b"b");
assert!(results[2].1.is_tombstone());
// Verify offsets are correct
assert_eq!(results[0].0, 0);
assert_eq!(results[1].0, records[0].disk_size() as u64);
assert_eq!(
results[2].0,
(records[0].disk_size() + records[1].disk_size()) as u64
);
}
}
+324
View File
@@ -0,0 +1,324 @@
//! Data integrity validation for RustDb storage directories.
//!
//! Provides offline validation of data files without starting the server.
//! Checks header magic, record CRC32 checksums, duplicate IDs, and
//! keydir.hint consistency.
use std::collections::HashMap;
use std::io::{BufReader, Read};
use std::path::Path;
use crate::error::{StorageError, StorageResult};
use crate::keydir::KeyDir;
use crate::record::{FileHeader, FileType, RecordScanner, FILE_HEADER_SIZE};
/// Result of validating an entire data directory.
pub struct ValidationReport {
pub collections: Vec<CollectionReport>,
}
/// Result of validating a single collection.
pub struct CollectionReport {
pub db: String,
pub collection: String,
pub header_valid: bool,
pub total_records: u64,
pub live_documents: u64,
pub tombstones: u64,
pub duplicate_ids: Vec<String>,
pub checksum_errors: u64,
pub decode_errors: u64,
pub data_file_size: u64,
pub hint_file_exists: bool,
pub orphaned_hint_entries: u64,
pub errors: Vec<String>,
}
impl ValidationReport {
/// Whether any errors were found across all collections.
pub fn has_errors(&self) -> bool {
self.collections.iter().any(|c| {
!c.header_valid
|| !c.duplicate_ids.is_empty()
|| c.checksum_errors > 0
|| c.decode_errors > 0
|| c.orphaned_hint_entries > 0
|| !c.errors.is_empty()
})
}
/// Print a human-readable summary to stdout.
pub fn print_summary(&self) {
println!("=== SmartDB Data Integrity Report ===");
println!();
let mut total_errors = 0u64;
for report in &self.collections {
println!("Database: {}", report.db);
println!(" Collection: {}", report.collection);
println!(
" Header: {}",
if report.header_valid { "OK" } else { "INVALID" }
);
println!(
" Records: {} ({} live, {} tombstones)",
report.total_records, report.live_documents, report.tombstones
);
println!(" Data size: {} bytes", report.data_file_size);
if report.duplicate_ids.is_empty() {
println!(" Duplicates: 0");
} else {
let ids_preview: Vec<&str> = report.duplicate_ids.iter().take(5).map(|s| s.as_str()).collect();
let suffix = if report.duplicate_ids.len() > 5 {
format!(", ... and {} more", report.duplicate_ids.len() - 5)
} else {
String::new()
};
println!(
" Duplicates: {} (ids: {}{})",
report.duplicate_ids.len(),
ids_preview.join(", "),
suffix
);
}
if report.checksum_errors > 0 {
println!(" CRC errors: {}", report.checksum_errors);
} else {
println!(" CRC errors: 0");
}
if report.decode_errors > 0 {
println!(" Decode errors: {}", report.decode_errors);
}
if report.hint_file_exists {
if report.orphaned_hint_entries > 0 {
println!(
" Hint file: STALE ({} orphaned entries)",
report.orphaned_hint_entries
);
} else {
println!(" Hint file: OK");
}
} else {
println!(" Hint file: absent");
}
for err in &report.errors {
println!(" ERROR: {}", err);
}
println!();
if !report.header_valid { total_errors += 1; }
total_errors += report.duplicate_ids.len() as u64;
total_errors += report.checksum_errors;
total_errors += report.decode_errors;
total_errors += report.orphaned_hint_entries;
total_errors += report.errors.len() as u64;
}
println!(
"Summary: {} collection(s) checked, {} error(s) found.",
self.collections.len(),
total_errors
);
}
}
/// Validate all collections in a data directory.
///
/// The directory structure is expected to be:
/// ```text
/// {base_path}/{db}/{collection}/data.rdb
/// ```
pub fn validate_data_directory(base_path: &str) -> StorageResult<ValidationReport> {
let base = Path::new(base_path);
if !base.exists() {
return Err(StorageError::IoError(std::io::Error::new(
std::io::ErrorKind::NotFound,
format!("data directory not found: {base_path}"),
)));
}
let mut collections = Vec::new();
// Iterate database directories
let entries = std::fs::read_dir(base)?;
for entry in entries {
let entry = entry?;
if !entry.file_type()?.is_dir() {
continue;
}
let db_name = match entry.file_name().to_str() {
Some(s) => s.to_string(),
None => continue,
};
// Iterate collection directories
let db_entries = std::fs::read_dir(entry.path())?;
for coll_entry in db_entries {
let coll_entry = coll_entry?;
if !coll_entry.file_type()?.is_dir() {
continue;
}
let coll_name = match coll_entry.file_name().to_str() {
Some(s) => s.to_string(),
None => continue,
};
let data_path = coll_entry.path().join("data.rdb");
if !data_path.exists() {
continue;
}
let report = validate_collection(&db_name, &coll_name, &coll_entry.path());
collections.push(report);
}
}
// Sort for deterministic output
collections.sort_by(|a, b| (&a.db, &a.collection).cmp(&(&b.db, &b.collection)));
Ok(ValidationReport { collections })
}
/// Validate a single collection directory.
fn validate_collection(db: &str, coll: &str, coll_dir: &Path) -> CollectionReport {
let data_path = coll_dir.join("data.rdb");
let hint_path = coll_dir.join("keydir.hint");
let mut report = CollectionReport {
db: db.to_string(),
collection: coll.to_string(),
header_valid: false,
total_records: 0,
live_documents: 0,
tombstones: 0,
duplicate_ids: Vec::new(),
checksum_errors: 0,
decode_errors: 0,
data_file_size: 0,
hint_file_exists: hint_path.exists(),
orphaned_hint_entries: 0,
errors: Vec::new(),
};
// Get file size
match std::fs::metadata(&data_path) {
Ok(m) => report.data_file_size = m.len(),
Err(e) => {
report.errors.push(format!("cannot stat data.rdb: {e}"));
return report;
}
}
// Open and validate header
let file = match std::fs::File::open(&data_path) {
Ok(f) => f,
Err(e) => {
report.errors.push(format!("cannot open data.rdb: {e}"));
return report;
}
};
let mut reader = BufReader::new(file);
let mut hdr_buf = [0u8; FILE_HEADER_SIZE];
if let Err(e) = reader.read_exact(&mut hdr_buf) {
report.errors.push(format!("cannot read header: {e}"));
return report;
}
match FileHeader::decode(&hdr_buf) {
Ok(hdr) => {
if hdr.file_type != FileType::Data {
report.errors.push(format!(
"wrong file type: expected Data, got {:?}",
hdr.file_type
));
} else {
report.header_valid = true;
}
}
Err(e) => {
report.errors.push(format!("invalid header: {e}"));
return report;
}
}
// Scan all records
let mut id_counts: HashMap<String, u64> = HashMap::new();
let mut live_ids: std::collections::HashSet<String> = std::collections::HashSet::new();
let scanner = RecordScanner::new(reader, FILE_HEADER_SIZE as u64);
for result in scanner {
match result {
Ok((_offset, record)) => {
report.total_records += 1;
let key = String::from_utf8_lossy(&record.key).to_string();
if record.is_tombstone() {
report.tombstones += 1;
live_ids.remove(&key);
} else {
*id_counts.entry(key.clone()).or_insert(0) += 1;
live_ids.insert(key);
}
}
Err(e) => {
let err_str = e.to_string();
if err_str.contains("checksum") || err_str.contains("Checksum") {
report.checksum_errors += 1;
} else {
report.decode_errors += 1;
}
// Cannot continue scanning after a decode error — the stream position is lost
report.errors.push(format!("record decode error: {e}"));
break;
}
}
}
report.live_documents = live_ids.len() as u64;
// Find duplicates (keys that appeared more than once as live inserts)
for (id, count) in &id_counts {
if *count > 1 {
report.duplicate_ids.push(id.clone());
}
}
report.duplicate_ids.sort();
// Validate hint file if present
if hint_path.exists() {
match KeyDir::load_from_hint_file(&hint_path) {
Ok(Some(hint_kd)) => {
// Check for orphaned entries: keys in hint but not live in data
hint_kd.for_each(|key, _entry| {
if !live_ids.contains(key) {
report.orphaned_hint_entries += 1;
}
});
// Also check if hint references offsets beyond file size
hint_kd.for_each(|_key, entry| {
if entry.offset + entry.record_len as u64 > report.data_file_size {
report.orphaned_hint_entries += 1;
}
});
}
Ok(None) => {
// File existed but was empty or unreadable
report.errors.push("hint file exists but is empty".into());
}
Err(e) => {
report.errors.push(format!("hint file decode error: {e}"));
}
}
}
report
}
-186
View File
@@ -1,186 +0,0 @@
//! Write-Ahead Log (WAL) for crash recovery.
//!
//! Before any mutation is applied to storage, it is first written to the WAL.
//! On recovery, uncommitted WAL entries can be replayed or discarded.
use std::path::PathBuf;
use std::sync::atomic::{AtomicU64, Ordering};
use bson::Document;
use serde::{Deserialize, Serialize};
use tokio::io::AsyncWriteExt;
use tracing::{debug, warn};
use crate::error::StorageResult;
/// WAL operation kind.
#[derive(Debug, Clone, Serialize, Deserialize, PartialEq, Eq)]
pub enum WalOp {
Insert,
Update,
Delete,
}
/// A single WAL record.
#[derive(Debug, Clone, Serialize, Deserialize)]
pub struct WalRecord {
/// Sequence number.
pub seq: u64,
/// Operation kind.
pub op: WalOp,
/// Database name.
pub db: String,
/// Collection name.
pub collection: String,
/// Document id (hex string).
pub document_id: String,
/// Document data (for insert/update).
pub document: Option<Document>,
/// Whether this record has been committed (applied to storage).
pub committed: bool,
/// CRC32 checksum of the serialized payload for integrity verification.
pub checksum: u32,
}
/// Write-ahead log that persists records to a file.
pub struct WriteAheadLog {
path: PathBuf,
next_seq: AtomicU64,
}
impl WriteAheadLog {
/// Create a new WAL at the given file path.
pub fn new(path: PathBuf) -> Self {
Self {
path,
next_seq: AtomicU64::new(1),
}
}
/// Initialize the WAL (create file if needed, load sequence counter).
pub async fn initialize(&self) -> StorageResult<()> {
if let Some(parent) = self.path.parent() {
tokio::fs::create_dir_all(parent).await?;
}
if self.path.exists() {
// Load existing records to find the max sequence number.
let records = self.read_all().await?;
if let Some(max_seq) = records.iter().map(|r| r.seq).max() {
self.next_seq.store(max_seq + 1, Ordering::SeqCst);
}
}
debug!("WAL initialized at {:?}", self.path);
Ok(())
}
/// Append a record to the WAL. Returns the sequence number.
pub async fn append(
&self,
op: WalOp,
db: &str,
collection: &str,
document_id: &str,
document: Option<Document>,
) -> StorageResult<u64> {
let seq = self.next_seq.fetch_add(1, Ordering::SeqCst);
// Compute checksum over the payload.
let payload = serde_json::json!({
"op": op,
"db": db,
"collection": collection,
"document_id": document_id,
});
let payload_bytes = serde_json::to_vec(&payload)?;
let checksum = crc32fast::hash(&payload_bytes);
let record = WalRecord {
seq,
op,
db: db.to_string(),
collection: collection.to_string(),
document_id: document_id.to_string(),
document,
committed: false,
checksum,
};
let line = serde_json::to_string(&record)?;
let mut file = tokio::fs::OpenOptions::new()
.create(true)
.append(true)
.open(&self.path)
.await?;
file.write_all(line.as_bytes()).await?;
file.write_all(b"\n").await?;
file.flush().await?;
Ok(seq)
}
/// Mark a WAL record as committed by rewriting the file.
pub async fn mark_committed(&self, seq: u64) -> StorageResult<()> {
let mut records = self.read_all().await?;
for record in &mut records {
if record.seq == seq {
record.committed = true;
}
}
self.write_all(&records).await
}
/// Read all WAL records.
pub async fn read_all(&self) -> StorageResult<Vec<WalRecord>> {
if !self.path.exists() {
return Ok(vec![]);
}
let data = tokio::fs::read_to_string(&self.path).await?;
let mut records = Vec::new();
for line in data.lines() {
if line.trim().is_empty() {
continue;
}
match serde_json::from_str::<WalRecord>(line) {
Ok(record) => records.push(record),
Err(e) => {
warn!("skipping corrupt WAL record: {e}");
}
}
}
Ok(records)
}
/// Get all uncommitted records (for replay during recovery).
pub async fn uncommitted(&self) -> StorageResult<Vec<WalRecord>> {
let records = self.read_all().await?;
Ok(records.into_iter().filter(|r| !r.committed).collect())
}
/// Truncate the WAL, removing all committed records.
pub async fn truncate_committed(&self) -> StorageResult<()> {
let records = self.read_all().await?;
let uncommitted: Vec<_> = records.into_iter().filter(|r| !r.committed).collect();
self.write_all(&uncommitted).await
}
/// Clear the entire WAL.
pub async fn clear(&self) -> StorageResult<()> {
if self.path.exists() {
tokio::fs::write(&self.path, "").await?;
}
self.next_seq.store(1, Ordering::SeqCst);
Ok(())
}
/// Write all records to the WAL file (overwrites).
async fn write_all(&self, records: &[WalRecord]) -> StorageResult<()> {
let mut content = String::new();
for record in records {
let line = serde_json::to_string(record)?;
content.push_str(&line);
content.push('\n');
}
tokio::fs::write(&self.path, content).await?;
Ok(())
}
}
+104 -3
View File
@@ -1,6 +1,8 @@
pub mod management;
use std::path::PathBuf;
use std::sync::Arc;
use std::time::Duration;
use anyhow::Result;
use dashmap::DashMap;
@@ -14,7 +16,7 @@ use rustdb_config::{RustDbOptions, StorageType};
use rustdb_wire::{WireCodec, OP_QUERY};
use rustdb_wire::{encode_op_msg_response, encode_op_reply_response};
use rustdb_storage::{StorageAdapter, MemoryStorageAdapter, FileStorageAdapter, OpLog};
// IndexEngine is used indirectly via CommandContext
use rustdb_index::{IndexEngine, IndexOptions};
use rustdb_txn::{TransactionEngine, SessionEngine};
use rustdb_commands::{CommandRouter, CommandContext};
@@ -33,7 +35,16 @@ impl RustDb {
// Create storage adapter
let storage: Arc<dyn StorageAdapter> = match options.storage {
StorageType::Memory => {
let adapter = MemoryStorageAdapter::new();
let adapter = if let Some(ref pp) = options.persist_path {
tracing::info!("MemoryStorageAdapter with periodic persistence to {}", pp);
MemoryStorageAdapter::with_persist_path(PathBuf::from(pp))
} else {
tracing::warn!(
"SmartDB is using in-memory storage — data will NOT survive a restart. \
Set storage to 'file' for durable persistence."
);
MemoryStorageAdapter::new()
};
Arc::new(adapter)
}
StorageType::File => {
@@ -49,9 +60,99 @@ impl RustDb {
// Initialize storage
storage.initialize().await?;
// Restore any previously persisted state (no-op for file storage and
// memory storage without a persist_path).
storage.restore().await?;
// Spawn periodic persistence task for memory storage with persist_path.
if options.storage == StorageType::Memory && options.persist_path.is_some() {
let persist_storage = storage.clone();
let interval_ms = options.persist_interval_ms;
tokio::spawn(async move {
let mut interval = tokio::time::interval(Duration::from_millis(interval_ms));
interval.tick().await; // skip the immediate first tick
loop {
interval.tick().await;
if let Err(e) = persist_storage.persist().await {
tracing::error!("Periodic persist failed: {}", e);
}
}
});
}
let indexes: Arc<DashMap<String, IndexEngine>> = Arc::new(DashMap::new());
// Restore persisted indexes from storage.
if let Ok(databases) = storage.list_databases().await {
for db_name in &databases {
if let Ok(collections) = storage.list_collections(db_name).await {
for coll_name in &collections {
if let Ok(specs) = storage.get_indexes(db_name, coll_name).await {
let has_custom = specs.iter().any(|s| {
s.get_str("name").unwrap_or("_id_") != "_id_"
});
if !has_custom {
continue;
}
let ns_key = format!("{}.{}", db_name, coll_name);
let mut engine = IndexEngine::new();
for spec in &specs {
let name = spec.get_str("name").unwrap_or("").to_string();
if name == "_id_" {
continue; // already created by IndexEngine::new()
}
let key = match spec.get("key") {
Some(bson::Bson::Document(k)) => k.clone(),
_ => continue,
};
let unique = matches!(spec.get("unique"), Some(bson::Bson::Boolean(true)));
let sparse = matches!(spec.get("sparse"), Some(bson::Bson::Boolean(true)));
let expire_after_seconds = match spec.get("expireAfterSeconds") {
Some(bson::Bson::Int32(n)) => Some(*n as u64),
Some(bson::Bson::Int64(n)) => Some(*n as u64),
_ => None,
};
let options = IndexOptions {
name: Some(name.clone()),
unique,
sparse,
expire_after_seconds,
};
if let Err(e) = engine.create_index(key, options) {
tracing::warn!(
namespace = %ns_key,
index = %name,
error = %e,
"failed to restore index"
);
}
}
// Rebuild index data from existing documents.
if let Ok(docs) = storage.find_all(db_name, coll_name).await {
if !docs.is_empty() {
engine.rebuild_from_documents(&docs);
}
}
tracing::info!(
namespace = %ns_key,
indexes = engine.list_indexes().len(),
"restored indexes"
);
indexes.insert(ns_key, engine);
}
}
}
}
}
let ctx = Arc::new(CommandContext {
storage,
indexes: Arc::new(DashMap::new()),
indexes,
transactions: Arc::new(TransactionEngine::new()),
sessions: Arc::new(SessionEngine::new(30 * 60 * 1000, 60 * 1000)),
cursors: Arc::new(DashMap::new()),
+17 -1
View File
@@ -25,6 +25,10 @@ struct Cli {
#[arg(long)]
validate: bool,
/// Validate data integrity of a storage directory (offline check)
#[arg(long, value_name = "PATH")]
validate_data: Option<String>,
/// Run in management mode (JSON-over-stdin IPC for TypeScript wrapper)
#[arg(long)]
management: bool,
@@ -55,7 +59,7 @@ async fn main() -> Result<()> {
let options = RustDbOptions::from_file(&cli.config)
.map_err(|e| anyhow::anyhow!("Failed to load config '{}': {}", cli.config, e))?;
// Validate-only mode
// Validate-only mode (config)
if cli.validate {
match options.validate() {
Ok(()) => {
@@ -69,6 +73,18 @@ async fn main() -> Result<()> {
}
}
// Validate data integrity mode
if let Some(ref data_path) = cli.validate_data {
tracing::info!("Validating data integrity at {}", data_path);
let report = rustdb_storage::validate::validate_data_directory(data_path)
.map_err(|e| anyhow::anyhow!("Validation failed: {}", e))?;
report.print_summary();
if report.has_errors() {
std::process::exit(1);
}
return Ok(());
}
// Create and start server
let mut db = RustDb::new(options).await?;
db.start().await?;
+256
View File
@@ -0,0 +1,256 @@
import { expect, tap } from '@git.zone/tstest/tapbundle';
import * as smartdb from '../ts/index.js';
import { MongoClient, Db } from 'mongodb';
import * as fs from 'fs';
import * as path from 'path';
import * as os from 'os';
// ---------------------------------------------------------------------------
// Helpers
// ---------------------------------------------------------------------------
let tmpDir: string;
let server: smartdb.SmartdbServer;
let client: MongoClient;
let db: Db;
function makeTmpDir(): string {
return fs.mkdtempSync(path.join(os.tmpdir(), 'smartdb-compact-test-'));
}
function cleanTmpDir(dir: string): void {
if (fs.existsSync(dir)) {
fs.rmSync(dir, { recursive: true, force: true });
}
}
function getDataFileSize(storagePath: string, dbName: string, collName: string): number {
const dataPath = path.join(storagePath, dbName, collName, 'data.rdb');
if (!fs.existsSync(dataPath)) return 0;
return fs.statSync(dataPath).size;
}
// ============================================================================
// Compaction: Setup
// ============================================================================
tap.test('compaction: start server with file storage', async () => {
tmpDir = makeTmpDir();
server = new smartdb.SmartdbServer({
socketPath: path.join(os.tmpdir(), `smartdb-compact-${Date.now()}-${Math.random().toString(36).slice(2)}.sock`),
storage: 'file',
storagePath: tmpDir,
});
await server.start();
client = new MongoClient(server.getConnectionUri(), {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
db = client.db('compactdb');
});
// ============================================================================
// Compaction: Updates grow the data file
// ============================================================================
tap.test('compaction: repeated updates grow the data file', async () => {
const coll = db.collection('growing');
// Insert a document
await coll.insertOne({ key: 'target', counter: 0, payload: 'x'.repeat(200) });
const sizeAfterInsert = getDataFileSize(tmpDir, 'compactdb', 'growing');
expect(sizeAfterInsert).toBeGreaterThan(0);
// Update the same document 50 times — each update appends a new record
for (let i = 1; i <= 50; i++) {
await coll.updateOne(
{ key: 'target' },
{ $set: { counter: i, payload: 'y'.repeat(200) } }
);
}
const sizeAfterUpdates = getDataFileSize(tmpDir, 'compactdb', 'growing');
// Compaction may have run during updates, so we can't assert the file is
// much larger. What matters is the data is correct.
// The collection still has just 1 document
const count = await coll.countDocuments();
expect(count).toEqual(1);
const doc = await coll.findOne({ key: 'target' });
expect(doc!.counter).toEqual(50);
});
// ============================================================================
// Compaction: Deletes create tombstones
// ============================================================================
tap.test('compaction: insert-then-delete creates dead space', async () => {
const coll = db.collection('tombstones');
// Insert 100 documents
const docs = [];
for (let i = 0; i < 100; i++) {
docs.push({ idx: i, data: 'delete-me-' + 'z'.repeat(100) });
}
await coll.insertMany(docs);
const sizeAfterInsert = getDataFileSize(tmpDir, 'compactdb', 'tombstones');
// Delete all 100
await coll.deleteMany({});
const sizeAfterDelete = getDataFileSize(tmpDir, 'compactdb', 'tombstones');
// File may have been compacted during deletes (dead > 50% threshold),
// but the operation itself should succeed regardless of file size.
// After deleting all docs, the file might be very small (just header + compacted).
// But count is 0
const count = await coll.countDocuments();
expect(count).toEqual(0);
});
// ============================================================================
// Compaction: Data integrity after compaction trigger
// ============================================================================
tap.test('compaction: data file shrinks after heavy updates trigger compaction', async () => {
const coll = db.collection('shrinktest');
// Insert 10 documents with large payloads
const docs = [];
for (let i = 0; i < 10; i++) {
docs.push({ idx: i, data: 'a'.repeat(500) });
}
await coll.insertMany(docs);
const sizeAfterInsert = getDataFileSize(tmpDir, 'compactdb', 'shrinktest');
// Update each document 20 times (creates 200 dead records vs 10 live)
// This should trigger compaction (dead > 50% threshold)
for (let round = 0; round < 20; round++) {
for (let i = 0; i < 10; i++) {
await coll.updateOne(
{ idx: i },
{ $set: { data: `round-${round}-` + 'b'.repeat(500) } }
);
}
}
// After compaction, file should be smaller than the pre-compaction peak
// (We can't measure the peak exactly, but the final size should be reasonable)
const sizeAfterCompaction = getDataFileSize(tmpDir, 'compactdb', 'shrinktest');
// The file should not be 20x the insert size since compaction should have run
// With 10 live records of ~530 bytes each, the file should be roughly that
// plus header overhead. Without compaction it would be 210 * ~530 bytes.
const maxExpectedSize = sizeAfterInsert * 5; // generous upper bound
expect(sizeAfterCompaction).toBeLessThanOrEqual(maxExpectedSize);
// All documents should still be readable and correct
const count = await coll.countDocuments();
expect(count).toEqual(10);
for (let i = 0; i < 10; i++) {
const doc = await coll.findOne({ idx: i });
expect(doc).toBeTruthy();
expect(doc!.data.startsWith('round-19-')).toBeTrue();
}
});
// ============================================================================
// Compaction: Persistence after compaction + restart
// ============================================================================
tap.test('compaction: data survives compaction + restart', async () => {
await client.close();
await server.stop();
server = new smartdb.SmartdbServer({
socketPath: path.join(os.tmpdir(), `smartdb-compact-${Date.now()}-${Math.random().toString(36).slice(2)}.sock`),
storage: 'file',
storagePath: tmpDir,
});
await server.start();
client = new MongoClient(server.getConnectionUri(), {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
db = client.db('compactdb');
// Verify shrinktest data
const coll = db.collection('shrinktest');
const count = await coll.countDocuments();
expect(count).toEqual(10);
for (let i = 0; i < 10; i++) {
const doc = await coll.findOne({ idx: i });
expect(doc).toBeTruthy();
expect(doc!.data.startsWith('round-19-')).toBeTrue();
}
// Verify growing collection
const growing = db.collection('growing');
const growDoc = await growing.findOne({ key: 'target' });
expect(growDoc).toBeTruthy();
expect(growDoc!.counter).toEqual(50);
// Verify tombstones collection is empty
const tombCount = await db.collection('tombstones').countDocuments();
expect(tombCount).toEqual(0);
});
// ============================================================================
// Compaction: Mixed operations stress test
// ============================================================================
tap.test('compaction: mixed insert-update-delete stress test', async () => {
const coll = db.collection('stress');
// Phase 1: Insert 200 documents
const batch = [];
for (let i = 0; i < 200; i++) {
batch.push({ idx: i, value: `initial-${i}`, alive: true });
}
await coll.insertMany(batch);
// Phase 2: Update every even-indexed document
for (let i = 0; i < 200; i += 2) {
await coll.updateOne({ idx: i }, { $set: { value: `updated-${i}` } });
}
// Phase 3: Delete every document where idx % 3 === 0
await coll.deleteMany({ idx: { $in: Array.from({ length: 67 }, (_, k) => k * 3) } });
// Verify: documents where idx % 3 !== 0 should remain
const remaining = await coll.find({}).toArray();
for (const doc of remaining) {
expect(doc.idx % 3).not.toEqual(0);
if (doc.idx % 2 === 0) {
expect(doc.value).toEqual(`updated-${doc.idx}`);
} else {
expect(doc.value).toEqual(`initial-${doc.idx}`);
}
}
// Count should be 200 - 67 = 133
const count = await coll.countDocuments();
expect(count).toEqual(133);
});
// ============================================================================
// Cleanup
// ============================================================================
tap.test('compaction: cleanup', async () => {
await client.close();
await server.stop();
cleanTmpDir(tmpDir);
});
export default tap.start();
+394
View File
@@ -0,0 +1,394 @@
import { expect, tap } from '@git.zone/tstest/tapbundle';
import * as smartdb from '../ts/index.js';
import { MongoClient, Db } from 'mongodb';
import * as fs from 'fs';
import * as path from 'path';
import * as os from 'os';
// ---------------------------------------------------------------------------
// Helpers
// ---------------------------------------------------------------------------
let tmpDir: string;
let server: smartdb.SmartdbServer;
let client: MongoClient;
let db: Db;
function makeTmpDir(): string {
return fs.mkdtempSync(path.join(os.tmpdir(), 'smartdb-test-'));
}
function cleanTmpDir(dir: string): void {
if (fs.existsSync(dir)) {
fs.rmSync(dir, { recursive: true, force: true });
}
}
// ============================================================================
// File Storage: Startup
// ============================================================================
tap.test('file-storage: should start server with file storage', async () => {
tmpDir = makeTmpDir();
server = new smartdb.SmartdbServer({
port: 27118,
storage: 'file',
storagePath: tmpDir,
});
await server.start();
expect(server.running).toBeTrue();
});
tap.test('file-storage: should connect MongoClient', async () => {
client = new MongoClient('mongodb://127.0.0.1:27118', {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
db = client.db('filetest');
expect(db).toBeTruthy();
});
// ============================================================================
// File Storage: Data files are created on disk
// ============================================================================
tap.test('file-storage: inserting creates data files on disk', async () => {
const coll = db.collection('diskcheck');
await coll.insertOne({ name: 'disk-test', value: 42 });
// The storage directory should now contain a database directory
const dbDir = path.join(tmpDir, 'filetest');
expect(fs.existsSync(dbDir)).toBeTrue();
// Collection directory with data.rdb should exist
const collDir = path.join(dbDir, 'diskcheck');
expect(fs.existsSync(collDir)).toBeTrue();
const dataFile = path.join(collDir, 'data.rdb');
expect(fs.existsSync(dataFile)).toBeTrue();
// data.rdb should have the SMARTDB magic header
const header = Buffer.alloc(8);
const fd = fs.openSync(dataFile, 'r');
fs.readSync(fd, header, 0, 8, 0);
fs.closeSync(fd);
expect(header.toString('ascii')).toEqual('SMARTDB\0');
});
// ============================================================================
// File Storage: Full CRUD cycle
// ============================================================================
tap.test('file-storage: insertOne returns valid id', async () => {
const coll = db.collection('crud');
const result = await coll.insertOne({ name: 'Alice', age: 30 });
expect(result.acknowledged).toBeTrue();
expect(result.insertedId).toBeTruthy();
});
tap.test('file-storage: insertMany returns all ids', async () => {
const coll = db.collection('crud');
const result = await coll.insertMany([
{ name: 'Bob', age: 25 },
{ name: 'Charlie', age: 35 },
{ name: 'Diana', age: 28 },
{ name: 'Eve', age: 32 },
]);
expect(result.insertedCount).toEqual(4);
});
tap.test('file-storage: findOne retrieves correct document', async () => {
const coll = db.collection('crud');
const doc = await coll.findOne({ name: 'Alice' });
expect(doc).toBeTruthy();
expect(doc!.name).toEqual('Alice');
expect(doc!.age).toEqual(30);
});
tap.test('file-storage: find with filter returns correct subset', async () => {
const coll = db.collection('crud');
const docs = await coll.find({ age: { $gte: 30 } }).toArray();
expect(docs.length).toEqual(3); // Alice(30), Charlie(35), Eve(32)
expect(docs.every(d => d.age >= 30)).toBeTrue();
});
tap.test('file-storage: updateOne modifies document', async () => {
const coll = db.collection('crud');
const result = await coll.updateOne(
{ name: 'Alice' },
{ $set: { age: 31, updated: true } }
);
expect(result.modifiedCount).toEqual(1);
const doc = await coll.findOne({ name: 'Alice' });
expect(doc!.age).toEqual(31);
expect(doc!.updated).toBeTrue();
});
tap.test('file-storage: deleteOne removes document', async () => {
const coll = db.collection('crud');
const result = await coll.deleteOne({ name: 'Eve' });
expect(result.deletedCount).toEqual(1);
const doc = await coll.findOne({ name: 'Eve' });
expect(doc).toBeNull();
});
tap.test('file-storage: count reflects current state', async () => {
const coll = db.collection('crud');
const count = await coll.countDocuments();
expect(count).toEqual(4); // 5 inserted - 1 deleted = 4
});
// ============================================================================
// File Storage: Persistence across server restart
// ============================================================================
tap.test('file-storage: stop server for restart test', async () => {
await client.close();
await server.stop();
expect(server.running).toBeFalse();
});
tap.test('file-storage: restart server with same data path', async () => {
server = new smartdb.SmartdbServer({
port: 27118,
storage: 'file',
storagePath: tmpDir,
});
await server.start();
expect(server.running).toBeTrue();
client = new MongoClient('mongodb://127.0.0.1:27118', {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
db = client.db('filetest');
});
tap.test('file-storage: data persists after restart', async () => {
const coll = db.collection('crud');
// Alice should still be there with updated age
const alice = await coll.findOne({ name: 'Alice' });
expect(alice).toBeTruthy();
expect(alice!.age).toEqual(31);
expect(alice!.updated).toBeTrue();
// Bob, Charlie, Diana should be there
const bob = await coll.findOne({ name: 'Bob' });
expect(bob).toBeTruthy();
expect(bob!.age).toEqual(25);
const charlie = await coll.findOne({ name: 'Charlie' });
expect(charlie).toBeTruthy();
const diana = await coll.findOne({ name: 'Diana' });
expect(diana).toBeTruthy();
// Eve should still be deleted
const eve = await coll.findOne({ name: 'Eve' });
expect(eve).toBeNull();
});
tap.test('file-storage: count is correct after restart', async () => {
const coll = db.collection('crud');
const count = await coll.countDocuments();
expect(count).toEqual(4);
});
tap.test('file-storage: can write new data after restart', async () => {
const coll = db.collection('crud');
const result = await coll.insertOne({ name: 'Frank', age: 45 });
expect(result.acknowledged).toBeTrue();
const doc = await coll.findOne({ name: 'Frank' });
expect(doc).toBeTruthy();
expect(doc!.age).toEqual(45);
const count = await coll.countDocuments();
expect(count).toEqual(5);
});
// ============================================================================
// File Storage: Multiple collections in same database
// ============================================================================
tap.test('file-storage: multiple collections are independent', async () => {
const products = db.collection('products');
const orders = db.collection('orders');
await products.insertMany([
{ sku: 'A001', name: 'Widget', price: 9.99 },
{ sku: 'A002', name: 'Gadget', price: 19.99 },
]);
await orders.insertMany([
{ orderId: 1, sku: 'A001', qty: 3 },
{ orderId: 2, sku: 'A002', qty: 1 },
{ orderId: 3, sku: 'A001', qty: 2 },
]);
const productCount = await products.countDocuments();
const orderCount = await orders.countDocuments();
expect(productCount).toEqual(2);
expect(orderCount).toEqual(3);
// Deleting from one collection doesn't affect the other
await products.deleteOne({ sku: 'A001' });
expect(await products.countDocuments()).toEqual(1);
expect(await orders.countDocuments()).toEqual(3);
});
// ============================================================================
// File Storage: Multiple databases
// ============================================================================
tap.test('file-storage: multiple databases are independent', async () => {
const db2 = client.db('filetest2');
const coll2 = db2.collection('items');
await coll2.insertOne({ name: 'cross-db-test', source: 'db2' });
// db2 has 1 doc
const count2 = await coll2.countDocuments();
expect(count2).toEqual(1);
// original db is unaffected
const crudCount = await db.collection('crud').countDocuments();
expect(crudCount).toEqual(5);
await db2.dropDatabase();
});
// ============================================================================
// File Storage: Large batch insert and retrieval
// ============================================================================
tap.test('file-storage: bulk insert 1000 documents', async () => {
const coll = db.collection('bulk');
const docs = [];
for (let i = 0; i < 1000; i++) {
docs.push({ index: i, data: `value-${i}`, timestamp: Date.now() });
}
const result = await coll.insertMany(docs);
expect(result.insertedCount).toEqual(1000);
});
tap.test('file-storage: find all 1000 documents', async () => {
const coll = db.collection('bulk');
const docs = await coll.find({}).toArray();
expect(docs.length).toEqual(1000);
});
tap.test('file-storage: range query on 1000 documents', async () => {
const coll = db.collection('bulk');
const docs = await coll.find({ index: { $gte: 500, $lt: 600 } }).toArray();
expect(docs.length).toEqual(100);
expect(docs.every(d => d.index >= 500 && d.index < 600)).toBeTrue();
});
tap.test('file-storage: sorted retrieval with limit', async () => {
const coll = db.collection('bulk');
const docs = await coll.find({}).sort({ index: -1 }).limit(10).toArray();
expect(docs.length).toEqual(10);
expect(docs[0].index).toEqual(999);
expect(docs[9].index).toEqual(990);
});
// ============================================================================
// File Storage: Update many and verify persistence
// ============================================================================
tap.test('file-storage: updateMany on bulk collection', async () => {
const coll = db.collection('bulk');
const result = await coll.updateMany(
{ index: { $lt: 100 } },
{ $set: { batch: 'first-hundred' } }
);
expect(result.modifiedCount).toEqual(100);
const updated = await coll.find({ batch: 'first-hundred' }).toArray();
expect(updated.length).toEqual(100);
});
// ============================================================================
// File Storage: Delete many and verify
// ============================================================================
tap.test('file-storage: deleteMany removes correct documents', async () => {
const coll = db.collection('bulk');
const result = await coll.deleteMany({ index: { $gte: 900 } });
expect(result.deletedCount).toEqual(100);
const remaining = await coll.countDocuments();
expect(remaining).toEqual(900);
});
// ============================================================================
// File Storage: Persistence of bulk data across restart
// ============================================================================
tap.test('file-storage: stop server for bulk restart test', async () => {
await client.close();
await server.stop();
expect(server.running).toBeFalse();
});
tap.test('file-storage: restart and verify bulk data', async () => {
server = new smartdb.SmartdbServer({
port: 27118,
storage: 'file',
storagePath: tmpDir,
});
await server.start();
client = new MongoClient('mongodb://127.0.0.1:27118', {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
db = client.db('filetest');
const coll = db.collection('bulk');
const count = await coll.countDocuments();
expect(count).toEqual(900);
// Verify the updateMany persisted
const firstHundred = await coll.find({ batch: 'first-hundred' }).toArray();
expect(firstHundred.length).toEqual(100);
// Verify deleted docs are gone
const over900 = await coll.find({ index: { $gte: 900 } }).toArray();
expect(over900.length).toEqual(0);
});
// ============================================================================
// File Storage: Index persistence
// ============================================================================
tap.test('file-storage: default indexes.json exists on disk', async () => {
// The indexes.json is created when the collection is first created,
// containing the default _id_ index spec.
const indexFile = path.join(tmpDir, 'filetest', 'crud', 'indexes.json');
expect(fs.existsSync(indexFile)).toBeTrue();
const indexData = JSON.parse(fs.readFileSync(indexFile, 'utf-8'));
const names = indexData.map((i: any) => i.name);
expect(names).toContain('_id_');
});
// ============================================================================
// Cleanup
// ============================================================================
tap.test('file-storage: cleanup', async () => {
await client.close();
await server.stop();
expect(server.running).toBeFalse();
cleanTmpDir(tmpDir);
});
export default tap.start();
+235
View File
@@ -0,0 +1,235 @@
import { expect, tap } from '@git.zone/tstest/tapbundle';
import * as smartdb from '../ts/index.js';
import { MongoClient, Db } from 'mongodb';
import * as fs from 'fs';
import * as path from 'path';
import * as os from 'os';
// ---------------------------------------------------------------------------
// Helpers
// ---------------------------------------------------------------------------
let tmpDir: string;
let localDb: smartdb.LocalSmartDb;
let client: MongoClient;
let db: Db;
function makeTmpDir(): string {
return fs.mkdtempSync(path.join(os.tmpdir(), 'smartdb-local-test-'));
}
function cleanTmpDir(dir: string): void {
if (fs.existsSync(dir)) {
fs.rmSync(dir, { recursive: true, force: true });
}
}
// ============================================================================
// LocalSmartDb: Lifecycle
// ============================================================================
tap.test('localsmartdb: should start with just a folder path', async () => {
tmpDir = makeTmpDir();
localDb = new smartdb.LocalSmartDb({ folderPath: tmpDir });
const info = await localDb.start();
expect(localDb.running).toBeTrue();
expect(info.socketPath).toBeTruthy();
expect(info.connectionUri).toBeTruthy();
expect(info.connectionUri.startsWith('mongodb://')).toBeTrue();
});
tap.test('localsmartdb: should connect via returned connectionUri', async () => {
const info = localDb.getConnectionInfo();
client = new MongoClient(info.connectionUri, {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
db = client.db('localtest');
expect(db).toBeTruthy();
});
tap.test('localsmartdb: should reject double start', async () => {
let threw = false;
try {
await localDb.start();
} catch {
threw = true;
}
expect(threw).toBeTrue();
});
// ============================================================================
// LocalSmartDb: CRUD via Unix socket
// ============================================================================
tap.test('localsmartdb: insert and find documents', async () => {
const coll = db.collection('notes');
await coll.insertMany([
{ title: 'Note 1', body: 'First note', priority: 1 },
{ title: 'Note 2', body: 'Second note', priority: 2 },
{ title: 'Note 3', body: 'Third note', priority: 3 },
]);
const all = await coll.find({}).toArray();
expect(all.length).toEqual(3);
const high = await coll.findOne({ priority: 3 });
expect(high).toBeTruthy();
expect(high!.title).toEqual('Note 3');
});
tap.test('localsmartdb: update and verify', async () => {
const coll = db.collection('notes');
await coll.updateOne(
{ title: 'Note 2' },
{ $set: { body: 'Updated second note', edited: true } }
);
const doc = await coll.findOne({ title: 'Note 2' });
expect(doc!.body).toEqual('Updated second note');
expect(doc!.edited).toBeTrue();
});
tap.test('localsmartdb: delete and verify', async () => {
const coll = db.collection('notes');
await coll.deleteOne({ title: 'Note 1' });
const count = await coll.countDocuments();
expect(count).toEqual(2);
const deleted = await coll.findOne({ title: 'Note 1' });
expect(deleted).toBeNull();
});
// ============================================================================
// LocalSmartDb: Persistence across restart
// ============================================================================
tap.test('localsmartdb: stop for restart', async () => {
await client.close();
await localDb.stop();
expect(localDb.running).toBeFalse();
});
tap.test('localsmartdb: restart with same folder', async () => {
localDb = new smartdb.LocalSmartDb({ folderPath: tmpDir });
const info = await localDb.start();
expect(localDb.running).toBeTrue();
client = new MongoClient(info.connectionUri, {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
db = client.db('localtest');
});
tap.test('localsmartdb: data persists after restart', async () => {
const coll = db.collection('notes');
const count = await coll.countDocuments();
expect(count).toEqual(2); // 3 inserted - 1 deleted
const note2 = await coll.findOne({ title: 'Note 2' });
expect(note2!.body).toEqual('Updated second note');
expect(note2!.edited).toBeTrue();
const note3 = await coll.findOne({ title: 'Note 3' });
expect(note3!.priority).toEqual(3);
});
// ============================================================================
// LocalSmartDb: Custom socket path
// ============================================================================
tap.test('localsmartdb: works with custom socket path', async () => {
await client.close();
await localDb.stop();
const customSocket = path.join(os.tmpdir(), `smartdb-custom-${Date.now()}.sock`);
const tmpDir2 = makeTmpDir();
const localDb2 = new smartdb.LocalSmartDb({
folderPath: tmpDir2,
socketPath: customSocket,
});
const info = await localDb2.start();
expect(info.socketPath).toEqual(customSocket);
const client2 = new MongoClient(info.connectionUri, {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client2.connect();
const testDb = client2.db('customsock');
await testDb.collection('test').insertOne({ x: 1 });
const doc = await testDb.collection('test').findOne({ x: 1 });
expect(doc).toBeTruthy();
await client2.close();
await localDb2.stop();
cleanTmpDir(tmpDir2);
// Reconnect original for remaining tests
localDb = new smartdb.LocalSmartDb({ folderPath: tmpDir });
const origInfo = await localDb.start();
client = new MongoClient(origInfo.connectionUri, {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
db = client.db('localtest');
});
// ============================================================================
// LocalSmartDb: getConnectionUri and getServer helpers
// ============================================================================
tap.test('localsmartdb: getConnectionUri returns valid uri', async () => {
const uri = localDb.getConnectionUri();
expect(uri.startsWith('mongodb://')).toBeTrue();
});
tap.test('localsmartdb: getServer returns the SmartdbServer', async () => {
const srv = localDb.getServer();
expect(srv).toBeTruthy();
expect(srv.running).toBeTrue();
});
// ============================================================================
// LocalSmartDb: Data isolation between databases
// ============================================================================
tap.test('localsmartdb: databases are isolated', async () => {
const dbA = client.db('isoA');
const dbB = client.db('isoB');
await dbA.collection('shared').insertOne({ source: 'A', val: 1 });
await dbB.collection('shared').insertOne({ source: 'B', val: 2 });
const docsA = await dbA.collection('shared').find({}).toArray();
const docsB = await dbB.collection('shared').find({}).toArray();
expect(docsA.length).toEqual(1);
expect(docsA[0].source).toEqual('A');
expect(docsB.length).toEqual(1);
expect(docsB[0].source).toEqual('B');
await dbA.dropDatabase();
await dbB.dropDatabase();
});
// ============================================================================
// Cleanup
// ============================================================================
tap.test('localsmartdb: cleanup', async () => {
await client.close();
await localDb.stop();
expect(localDb.running).toBeFalse();
cleanTmpDir(tmpDir);
});
export default tap.start();
+269
View File
@@ -0,0 +1,269 @@
import { expect, tap } from '@git.zone/tstest/tapbundle';
import * as smartdb from '../ts/index.js';
import { MongoClient, Db } from 'mongodb';
import * as fs from 'fs';
import * as path from 'path';
import * as os from 'os';
// ---------------------------------------------------------------------------
// Helpers
// ---------------------------------------------------------------------------
let tmpDir: string;
function makeTmpDir(): string {
return fs.mkdtempSync(path.join(os.tmpdir(), 'smartdb-migration-test-'));
}
function cleanTmpDir(dir: string): void {
if (fs.existsSync(dir)) {
fs.rmSync(dir, { recursive: true, force: true });
}
}
/**
* Create a v0 (legacy JSON) storage layout:
* {base}/{db}/{coll}.json
* {base}/{db}/{coll}.indexes.json
*/
function createV0Layout(basePath: string, dbName: string, collName: string, docs: any[]): void {
const dbDir = path.join(basePath, dbName);
fs.mkdirSync(dbDir, { recursive: true });
// Convert docs to the extended JSON format that the old Rust engine wrote:
// ObjectId is stored as { "$oid": "hex" }
const jsonDocs = docs.map(doc => {
const clone = { ...doc };
if (!clone._id) {
// Generate a fake ObjectId-like hex string
const hex = [...Array(24)].map(() => Math.floor(Math.random() * 16).toString(16)).join('');
clone._id = { '$oid': hex };
}
return clone;
});
const collPath = path.join(dbDir, `${collName}.json`);
fs.writeFileSync(collPath, JSON.stringify(jsonDocs, null, 2));
const indexPath = path.join(dbDir, `${collName}.indexes.json`);
fs.writeFileSync(indexPath, JSON.stringify([
{ name: '_id_', key: { _id: 1 } },
], null, 2));
}
// ============================================================================
// Migration: v0 → v1 basic
// ============================================================================
tap.test('migration: detects v0 format and migrates on startup', async () => {
tmpDir = makeTmpDir();
// Create v0 layout with test data
createV0Layout(tmpDir, 'mydb', 'users', [
{ name: 'Alice', age: 30, email: 'alice@test.com' },
{ name: 'Bob', age: 25, email: 'bob@test.com' },
{ name: 'Charlie', age: 35, email: 'charlie@test.com' },
]);
createV0Layout(tmpDir, 'mydb', 'products', [
{ sku: 'W001', name: 'Widget', price: 9.99 },
{ sku: 'G001', name: 'Gadget', price: 19.99 },
]);
// Verify v0 files exist
expect(fs.existsSync(path.join(tmpDir, 'mydb', 'users.json'))).toBeTrue();
expect(fs.existsSync(path.join(tmpDir, 'mydb', 'products.json'))).toBeTrue();
// Start server — migration should run automatically
const server = new smartdb.SmartdbServer({
socketPath: path.join(os.tmpdir(), `smartdb-mig-${Date.now()}-${Math.random().toString(36).slice(2)}.sock`),
storage: 'file',
storagePath: tmpDir,
});
await server.start();
// v1 directories should now exist
expect(fs.existsSync(path.join(tmpDir, 'mydb', 'users', 'data.rdb'))).toBeTrue();
expect(fs.existsSync(path.join(tmpDir, 'mydb', 'products', 'data.rdb'))).toBeTrue();
// v0 files should still exist (not deleted)
expect(fs.existsSync(path.join(tmpDir, 'mydb', 'users.json'))).toBeTrue();
expect(fs.existsSync(path.join(tmpDir, 'mydb', 'products.json'))).toBeTrue();
// Connect and verify data is accessible
const client = new MongoClient(server.getConnectionUri(), {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
const db = client.db('mydb');
// Users collection
const users = await db.collection('users').find({}).toArray();
expect(users.length).toEqual(3);
const alice = users.find(u => u.name === 'Alice');
expect(alice).toBeTruthy();
expect(alice!.age).toEqual(30);
expect(alice!.email).toEqual('alice@test.com');
// Products collection
const products = await db.collection('products').find({}).toArray();
expect(products.length).toEqual(2);
const widget = products.find(p => p.sku === 'W001');
expect(widget).toBeTruthy();
expect(widget!.price).toEqual(9.99);
await client.close();
await server.stop();
});
// ============================================================================
// Migration: migrated data survives another restart
// ============================================================================
tap.test('migration: migrated data persists across restart', async () => {
const server = new smartdb.SmartdbServer({
socketPath: path.join(os.tmpdir(), `smartdb-mig-${Date.now()}-${Math.random().toString(36).slice(2)}.sock`),
storage: 'file',
storagePath: tmpDir,
});
await server.start();
const client = new MongoClient(server.getConnectionUri(), {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
const db = client.db('mydb');
const users = await db.collection('users').find({}).toArray();
expect(users.length).toEqual(3);
const products = await db.collection('products').find({}).toArray();
expect(products.length).toEqual(2);
await client.close();
await server.stop();
});
// ============================================================================
// Migration: can write new data after migration
// ============================================================================
tap.test('migration: new writes work after migration', async () => {
const server = new smartdb.SmartdbServer({
socketPath: path.join(os.tmpdir(), `smartdb-mig-${Date.now()}-${Math.random().toString(36).slice(2)}.sock`),
storage: 'file',
storagePath: tmpDir,
});
await server.start();
const client = new MongoClient(server.getConnectionUri(), {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
const db = client.db('mydb');
// Insert new documents
await db.collection('users').insertOne({ name: 'Diana', age: 28 });
const count = await db.collection('users').countDocuments();
expect(count).toEqual(4);
// Update existing migrated document
await db.collection('users').updateOne(
{ name: 'Alice' },
{ $set: { age: 31 } }
);
const alice = await db.collection('users').findOne({ name: 'Alice' });
expect(alice!.age).toEqual(31);
// Delete a migrated document
await db.collection('products').deleteOne({ sku: 'G001' });
const prodCount = await db.collection('products').countDocuments();
expect(prodCount).toEqual(1);
await client.close();
await server.stop();
cleanTmpDir(tmpDir);
});
// ============================================================================
// Migration: skips already-migrated data
// ============================================================================
tap.test('migration: no-op for v1 format', async () => {
tmpDir = makeTmpDir();
// Start fresh to create v1 layout
const server = new smartdb.SmartdbServer({
socketPath: path.join(os.tmpdir(), `smartdb-mig-${Date.now()}-${Math.random().toString(36).slice(2)}.sock`),
storage: 'file',
storagePath: tmpDir,
});
await server.start();
const client = new MongoClient(server.getConnectionUri(), {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
const db = client.db('v1test');
await db.collection('items').insertOne({ x: 1 });
await client.close();
await server.stop();
// Restart — migration should detect v1 and skip
const server2 = new smartdb.SmartdbServer({
socketPath: path.join(os.tmpdir(), `smartdb-mig-${Date.now()}-${Math.random().toString(36).slice(2)}.sock`),
storage: 'file',
storagePath: tmpDir,
});
await server2.start();
const client2 = new MongoClient(server2.getConnectionUri(), {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client2.connect();
const db2 = client2.db('v1test');
const doc = await db2.collection('items').findOne({ x: 1 });
expect(doc).toBeTruthy();
await client2.close();
await server2.stop();
cleanTmpDir(tmpDir);
});
// ============================================================================
// Migration: empty storage is handled gracefully
// ============================================================================
tap.test('migration: empty storage directory works', async () => {
tmpDir = makeTmpDir();
const server = new smartdb.SmartdbServer({
socketPath: path.join(os.tmpdir(), `smartdb-mig-${Date.now()}-${Math.random().toString(36).slice(2)}.sock`),
storage: 'file',
storagePath: tmpDir,
});
await server.start();
const client = new MongoClient(server.getConnectionUri(), {
directConnection: true,
serverSelectionTimeoutMS: 5000,
});
await client.connect();
// Should work fine with empty storage
const db = client.db('emptytest');
await db.collection('first').insertOne({ hello: 'world' });
const doc = await db.collection('first').findOne({ hello: 'world' });
expect(doc).toBeTruthy();
await client.close();
await server.stop();
cleanTmpDir(tmpDir);
});
export default tap.start();
+1 -1
View File
@@ -3,6 +3,6 @@
*/
export const commitinfo = {
name: '@push.rocks/smartdb',
version: '2.1.1',
version: '2.5.7',
description: 'A MongoDB-compatible embedded database server with wire protocol support, backed by a high-performance Rust engine.'
}
+3
View File
@@ -7,6 +7,9 @@ export * from './ts_smartdb/index.js';
export { LocalSmartDb } from './ts_local/index.js';
export type { ILocalSmartDbOptions, ILocalSmartDbConnectionInfo } from './ts_local/index.js';
// Export migration
export { StorageMigrator } from './ts_migration/index.js';
// Export commitinfo
export { commitinfo };
+59
View File
@@ -1,7 +1,10 @@
import * as crypto from 'crypto';
import * as fs from 'fs/promises';
import * as net from 'net';
import * as path from 'path';
import * as os from 'os';
import { SmartdbServer } from '../ts_smartdb/index.js';
import { StorageMigrator } from '../ts_migration/index.js';
/**
* Connection information returned by LocalSmartDb.start()
@@ -65,6 +68,55 @@ export class LocalSmartDb {
return path.join(os.tmpdir(), `smartdb-${randomId}.sock`);
}
/**
* Check if a Unix socket is alive by attempting to connect.
*/
private static isSocketAlive(socketPath: string): Promise<boolean> {
return new Promise((resolve) => {
const client = net.createConnection({ path: socketPath }, () => {
client.destroy();
resolve(true);
});
client.on('error', () => {
resolve(false);
});
client.setTimeout(500, () => {
client.destroy();
resolve(false);
});
});
}
/**
* Remove stale smartdb-*.sock files from /tmp.
* A socket is considered stale if connecting to it fails.
*/
private static async cleanStaleSockets(): Promise<void> {
const tmpDir = os.tmpdir();
let entries: string[];
try {
entries = await fs.readdir(tmpDir);
} catch {
return;
}
const socketFiles = entries.filter(
(f) => f.startsWith('smartdb-') && f.endsWith('.sock')
);
for (const name of socketFiles) {
const fullPath = path.join(tmpDir, name);
try {
const stat = await fs.stat(fullPath);
if (!stat.isSocket()) continue;
const alive = await LocalSmartDb.isSocketAlive(fullPath);
if (!alive) {
await fs.unlink(fullPath);
}
} catch {
// File may have been removed already; ignore
}
}
}
/**
* Start the local SmartDB server and return connection info
*/
@@ -73,6 +125,13 @@ export class LocalSmartDb {
throw new Error('LocalSmartDb is already running');
}
// Clean up stale sockets from previous crashed instances
await LocalSmartDb.cleanStaleSockets();
// Run storage migration before starting the Rust engine
const migrator = new StorageMigrator(this.options.folderPath);
await migrator.run();
// Use provided socket path or generate one
this.generatedSocketPath = this.options.socketPath ?? this.generateSocketPath();
@@ -0,0 +1,93 @@
import * as fs from 'fs';
import * as path from 'path';
import { migrateV0ToV1 } from './migrators/v0_to_v1.js';
/**
* Detected storage format version.
* - v0: Legacy JSON format ({db}/{coll}.json files)
* - v1: Bitcask binary format ({db}/{coll}/data.rdb directories)
*/
type TStorageVersion = 0 | 1;
/**
* StorageMigrator — runs before the Rust engine starts.
*
* Detects the current storage format version and runs the appropriate
* migration chain. The Rust engine only knows the current format (v1).
*
* Migration is safe: original files are never modified or deleted.
* On success, a console hint is printed about which old files can be removed.
*/
export class StorageMigrator {
private storagePath: string;
constructor(storagePath: string) {
this.storagePath = storagePath;
}
/**
* Run any needed migrations. Safe to call even if storage is already current.
*/
async run(): Promise<void> {
if (!fs.existsSync(this.storagePath)) {
return; // No data yet — nothing to migrate
}
const version = this.detectVersion();
if (version === 1) {
return; // Already current
}
if (version === 0) {
console.log(`[smartdb] Detected v0 (JSON) storage format at ${this.storagePath}`);
console.log(`[smartdb] Running migration v0 → v1 (Bitcask binary format)...`);
const deletableFiles = await migrateV0ToV1(this.storagePath);
if (deletableFiles.length > 0) {
console.log(`[smartdb] Migration v0 → v1 complete.`);
console.log(`[smartdb] The following old files can be safely deleted:`);
for (const f of deletableFiles) {
console.log(`[smartdb] ${f}`);
}
} else {
console.log(`[smartdb] Migration v0 → v1 complete. No old files to clean up.`);
}
}
}
/**
* Detect the storage format version by inspecting the directory structure.
*
* v0: {db}/{coll}.json files exist
* v1: {db}/{coll}/data.rdb directories exist
*/
private detectVersion(): TStorageVersion {
const entries = fs.readdirSync(this.storagePath, { withFileTypes: true });
for (const entry of entries) {
if (!entry.isDirectory()) continue;
const dbDir = path.join(this.storagePath, entry.name);
const dbEntries = fs.readdirSync(dbDir, { withFileTypes: true });
for (const dbEntry of dbEntries) {
// v1: subdirectory with data.rdb
if (dbEntry.isDirectory()) {
const dataRdb = path.join(dbDir, dbEntry.name, 'data.rdb');
if (fs.existsSync(dataRdb)) {
return 1;
}
}
// v0: .json file (not .indexes.json)
if (dbEntry.isFile() && dbEntry.name.endsWith('.json') && !dbEntry.name.endsWith('.indexes.json')) {
return 0;
}
}
}
// Empty or unrecognized — treat as v1 (fresh start)
return 1;
}
}
+1
View File
@@ -0,0 +1 @@
export { StorageMigrator } from './classes.storagemigrator.js';
+253
View File
@@ -0,0 +1,253 @@
import * as fs from 'fs';
import * as path from 'path';
import * as crypto from 'crypto';
import { BSON } from 'bson';
// ---------------------------------------------------------------------------
// Binary format constants (must match Rust: record.rs)
// ---------------------------------------------------------------------------
/** File-level magic: "SMARTDB\0" */
const FILE_MAGIC = Buffer.from('SMARTDB\0', 'ascii');
/** Current format version */
const FORMAT_VERSION = 1;
/** File type tags */
const FILE_TYPE_DATA = 1;
const FILE_TYPE_HINT = 3;
/** File header total size */
const FILE_HEADER_SIZE = 64;
/** Per-record magic */
const RECORD_MAGIC = 0xDB01;
/** Per-record header size */
const RECORD_HEADER_SIZE = 22; // 2 + 8 + 4 + 4 + 4
// ---------------------------------------------------------------------------
// Binary encoding helpers
// ---------------------------------------------------------------------------
function writeFileHeader(fileType: number): Buffer {
const buf = Buffer.alloc(FILE_HEADER_SIZE, 0);
FILE_MAGIC.copy(buf, 0);
buf.writeUInt16LE(FORMAT_VERSION, 8);
buf.writeUInt8(fileType, 10);
buf.writeUInt32LE(0, 11); // flags
const now = BigInt(Date.now());
buf.writeBigUInt64LE(now, 15);
// bytes 23..64 are reserved (zeros)
return buf;
}
function encodeDataRecord(timestamp: bigint, key: Buffer, value: Buffer): Buffer {
const keyLen = key.length;
const valLen = value.length;
const totalSize = RECORD_HEADER_SIZE + keyLen + valLen;
const buf = Buffer.alloc(totalSize);
// Write header fields (without CRC)
buf.writeUInt16LE(RECORD_MAGIC, 0);
buf.writeBigUInt64LE(timestamp, 2);
buf.writeUInt32LE(keyLen, 10);
buf.writeUInt32LE(valLen, 14);
// CRC placeholder at offset 18..22 (will fill below)
key.copy(buf, RECORD_HEADER_SIZE);
value.copy(buf, RECORD_HEADER_SIZE + keyLen);
// CRC32 covers everything except the CRC field itself:
// bytes [0..18] + bytes [22..]
const crc = crc32(Buffer.concat([
buf.subarray(0, 18),
buf.subarray(22),
]));
buf.writeUInt32LE(crc, 18);
return buf;
}
function encodeHintEntry(key: string, offset: bigint, recordLen: number, valueLen: number, timestamp: bigint): Buffer {
const keyBuf = Buffer.from(key, 'utf-8');
const buf = Buffer.alloc(4 + keyBuf.length + 8 + 4 + 4 + 8);
let pos = 0;
buf.writeUInt32LE(keyBuf.length, pos); pos += 4;
keyBuf.copy(buf, pos); pos += keyBuf.length;
buf.writeBigUInt64LE(offset, pos); pos += 8;
buf.writeUInt32LE(recordLen, pos); pos += 4;
buf.writeUInt32LE(valueLen, pos); pos += 4;
buf.writeBigUInt64LE(timestamp, pos);
return buf;
}
// ---------------------------------------------------------------------------
// CRC32 (matching crc32fast in Rust)
// ---------------------------------------------------------------------------
const CRC32_TABLE = (() => {
const table = new Uint32Array(256);
for (let i = 0; i < 256; i++) {
let crc = i;
for (let j = 0; j < 8; j++) {
crc = (crc & 1) ? (0xEDB88320 ^ (crc >>> 1)) : (crc >>> 1);
}
table[i] = crc;
}
return table;
})();
function crc32(data: Buffer): number {
let crc = 0xFFFFFFFF;
for (let i = 0; i < data.length; i++) {
crc = CRC32_TABLE[(crc ^ data[i]) & 0xFF] ^ (crc >>> 8);
}
return (crc ^ 0xFFFFFFFF) >>> 0;
}
// ---------------------------------------------------------------------------
// Migration: v0 (JSON) → v1 (Bitcask binary)
// ---------------------------------------------------------------------------
interface IKeyDirEntry {
offset: bigint;
recordLen: number;
valueLen: number;
timestamp: bigint;
}
/**
* Migrate a storage directory from v0 (JSON-per-collection) to v1 (Bitcask binary).
*
* - Original .json files are NOT modified or deleted.
* - New v1 files are written into {db}/{coll}/ subdirectories.
* - Returns a list of old files that can be safely deleted.
* - On failure, cleans up any partial new files and throws.
*/
export async function migrateV0ToV1(storagePath: string): Promise<string[]> {
const deletableFiles: string[] = [];
const createdDirs: string[] = [];
try {
const dbEntries = fs.readdirSync(storagePath, { withFileTypes: true });
for (const dbEntry of dbEntries) {
if (!dbEntry.isDirectory()) continue;
const dbDir = path.join(storagePath, dbEntry.name);
const collFiles = fs.readdirSync(dbDir, { withFileTypes: true });
for (const collFile of collFiles) {
if (!collFile.isFile()) continue;
if (!collFile.name.endsWith('.json')) continue;
if (collFile.name.endsWith('.indexes.json')) continue;
const collName = collFile.name.replace(/\.json$/, '');
const jsonPath = path.join(dbDir, collFile.name);
const indexJsonPath = path.join(dbDir, `${collName}.indexes.json`);
// Target directory
const collDir = path.join(dbDir, collName);
if (fs.existsSync(collDir)) {
// Already migrated
continue;
}
console.log(`[smartdb] Migrating ${dbEntry.name}.${collName}...`);
// Read the JSON collection
const jsonData = fs.readFileSync(jsonPath, 'utf-8');
const docs: any[] = JSON.parse(jsonData);
// Create collection directory
fs.mkdirSync(collDir, { recursive: true });
createdDirs.push(collDir);
// Write data.rdb
const dataPath = path.join(collDir, 'data.rdb');
const fd = fs.openSync(dataPath, 'w');
try {
// File header
const headerBuf = writeFileHeader(FILE_TYPE_DATA);
fs.writeSync(fd, headerBuf);
let currentOffset = BigInt(FILE_HEADER_SIZE);
const keydir: Map<string, IKeyDirEntry> = new Map();
const ts = BigInt(Date.now());
for (const doc of docs) {
// Extract _id
let idHex: string;
if (doc._id && doc._id.$oid) {
idHex = doc._id.$oid;
} else if (typeof doc._id === 'string') {
idHex = doc._id;
} else if (doc._id) {
idHex = String(doc._id);
} else {
// Generate a new ObjectId
idHex = crypto.randomBytes(12).toString('hex');
doc._id = { $oid: idHex };
}
// Serialize to BSON
const bsonBytes = BSON.serialize(doc);
const keyBuf = Buffer.from(idHex, 'utf-8');
const valueBuf = Buffer.from(bsonBytes);
const record = encodeDataRecord(ts, keyBuf, valueBuf);
fs.writeSync(fd, record);
keydir.set(idHex, {
offset: currentOffset,
recordLen: record.length,
valueLen: valueBuf.length,
timestamp: ts,
});
currentOffset += BigInt(record.length);
}
fs.fsyncSync(fd);
fs.closeSync(fd);
// Write keydir.hint
const hintPath = path.join(collDir, 'keydir.hint');
const hintFd = fs.openSync(hintPath, 'w');
fs.writeSync(hintFd, writeFileHeader(FILE_TYPE_HINT));
for (const [key, entry] of keydir) {
fs.writeSync(hintFd, encodeHintEntry(key, entry.offset, entry.recordLen, entry.valueLen, entry.timestamp));
}
fs.fsyncSync(hintFd);
fs.closeSync(hintFd);
} catch (writeErr) {
// Clean up on write failure
try { fs.closeSync(fd); } catch {}
throw writeErr;
}
// Copy indexes.json if it exists
if (fs.existsSync(indexJsonPath)) {
const destIndexPath = path.join(collDir, 'indexes.json');
fs.copyFileSync(indexJsonPath, destIndexPath);
deletableFiles.push(indexJsonPath);
} else {
// Write default _id index
const destIndexPath = path.join(collDir, 'indexes.json');
fs.writeFileSync(destIndexPath, JSON.stringify([{ name: '_id_', key: { _id: 1 } }], null, 2));
}
deletableFiles.push(jsonPath);
console.log(`[smartdb] Migrated ${dbEntry.name}.${collName}: ${docs.length} documents`);
}
}
} catch (err) {
// Clean up any partially created directories
for (const dir of createdDirs) {
try {
fs.rmSync(dir, { recursive: true, force: true });
} catch {}
}
throw err;
}
return deletableFiles;
}
+7
View File
@@ -1,4 +1,5 @@
import { RustDbBridge } from '../rust-db-bridge.js';
import { StorageMigrator } from '../../ts_migration/index.js';
import type {
IOpLogEntry,
IOpLogResult,
@@ -75,6 +76,12 @@ export class SmartdbServer {
throw new Error('Server is already running');
}
// Run storage migration for file-based storage before starting Rust engine
if (this.options.storage === 'file' && this.options.storagePath) {
const migrator = new StorageMigrator(this.options.storagePath);
await migrator.run();
}
const spawned = await this.bridge.spawn();
if (!spawned) {
throw new Error(
File diff suppressed because one or more lines are too long