Compare commits
206 Commits
| Author | SHA1 | Date | |
|---|---|---|---|
| 8dc0248763 | |||
| 1f542ca271 | |||
| 2adf1d5548 | |||
| 067a7666e4 | |||
| 0d863a1028 | |||
| c410a663b1 | |||
| 6aa1fc651f | |||
| 11e549e68e | |||
| 0fb9678976 | |||
| 635de0d932 | |||
| 0916effb53 | |||
| 05242a1c7d | |||
| 0d20dce520 | |||
| 1c50509497 | |||
| 7de521078e | |||
| 42b8eaf6d2 | |||
| 782c8c9555 | |||
| 463c32ebba | |||
| 51aa68ff8d | |||
| cb34ae5041 | |||
| 165c7d29bb | |||
| ff2dc00f31 | |||
| fda072d15e | |||
| c7786e9626 | |||
| 91fe5f7ae6 | |||
| 07648b4880 | |||
| d0e3a4ae74 | |||
| 89ffd61717 | |||
| 60eadaf6a1 | |||
| bd52ba4cb2 | |||
| a3d6a8b75d | |||
| fbd71b1f3b | |||
| 6481572981 | |||
| 0dc14a6ea1 | |||
| dea344e6ba | |||
| f81f5957ab | |||
| 281d3fbbeb | |||
| c1cb136a7d | |||
| b80275a594 | |||
| b64a515c94 | |||
| 68c4eb6480 | |||
| 6c8f6ac33f | |||
| ffa491c7a1 | |||
| 777d48d82e | |||
| b7a0bbcf6d | |||
| fbe1cd64cb | |||
| 9ba50da73c | |||
| 684319983d | |||
| 18bd9f6cda | |||
| f03c683d02 | |||
| f750299780 | |||
| ca1039408d | |||
| df3e0b9424 | |||
| c8e5960abd | |||
| 7304a62357 | |||
| a5a88e53ba | |||
| 73bc271c59 | |||
| 1e98181e71 | |||
| eb5a8185ae | |||
| ef3d3f3fa3 | |||
| 34e6e850ad | |||
| 992a776fd2 | |||
| 3e15a2d52f | |||
| d1a3576d31 | |||
| 1ca05e879b | |||
| 9c6fa37eb8 | |||
| ff433b2256 | |||
| 263d69aef1 | |||
| b6b7b43161 | |||
| 316c66c344 | |||
| 4debda856b | |||
| 0e7bcab499 | |||
| 7bf65d8495 | |||
| f2ce0180d3 | |||
| 8c1be6555f | |||
| 1a5558e91f | |||
| 611a9ddd19 | |||
| afd026d08c | |||
| 2c8ea44d40 | |||
| 32bd27b849 | |||
| a7113d0387 | |||
| 61d4e9037a | |||
| caced2718f | |||
| 8516056f84 | |||
| 07ec9d7595 | |||
| d14ba1dd65 | |||
| 7d595fa175 | |||
| df417432b0 | |||
| e5f1ebf343 | |||
| 3ff0dd7ac8 | |||
| bb87316dd3 | |||
| d6e0a1a274 | |||
| 95fa4f8b0b | |||
| c2f2f1e2ee | |||
| 936f86c346 | |||
| 7ff1a7da36 | |||
| a87710144c | |||
| 23fd5cc5cd | |||
| fb4d776bdd | |||
| 88ad16c638 | |||
| 016681b77b | |||
| 49f7a7da8b | |||
| f8269a1cb7 | |||
| b37e1aae6c | |||
| 7076829747 | |||
| 1387ca262b | |||
| 684f034aee | |||
| a63ec16d63 | |||
| 85f34cf96a | |||
| 4d28614e08 | |||
| 567c7be7c5 | |||
| a897a7c780 | |||
| accf137216 | |||
| c3441946cb | |||
| 37ccbf58fd | |||
| 071ded9c41 | |||
| b935087d50 | |||
| e1383097b2 | |||
| dff0ea610b | |||
| 4faa10c494 | |||
| c2d39cc19a | |||
| 9ccbbbdc37 | |||
| 1705ffe2be | |||
| 968cbbd8fc | |||
| a2ae9960b6 | |||
| df6a44d5d9 | |||
| 9efcc4b437 | |||
| 5903ae71be | |||
| a649c598ad | |||
| 5f4f3ecbc3 | |||
| 806f81c6a0 | |||
| 88e353eec6 | |||
| 80ff1b1230 | |||
| 1075335497 | |||
| eafb5207a4 | |||
| 9969e0f703 | |||
| ac4b2c95f3 | |||
| c593d76ead | |||
| 01ccf2d080 | |||
| 0e55f22dad | |||
| bd3042de25 | |||
| 456351ca34 | |||
| 00afa317ef | |||
| 45ee8208b5 | |||
| 39bf3e2239 | |||
| f3de3f0618 | |||
| 03056d279d | |||
| f860f39e59 | |||
| fa4516de3b | |||
| 539547beb8 | |||
| 6eb92959ec | |||
| 4af9af0845 | |||
| f7e12cdcbb | |||
| 002498b91b | |||
| 459911fe5f | |||
| 9859a02ea2 | |||
| 65444b6d25 | |||
| d049e8741f | |||
| 1123a99aea | |||
| d01e878310 | |||
| 588aeabf4b | |||
| 87005e72f1 | |||
| f799c2ee66 | |||
| 1a029ba493 | |||
| 5b756dd223 | |||
| 4cac599a58 | |||
| be6a7314c3 | |||
| 83ba9c2611 | |||
| 22ab472e58 | |||
| 9a77030377 | |||
| ceff285ff5 | |||
| d8bfbf0be3 | |||
| 3e6b883b38 | |||
| 47ef918128 | |||
| 5951638967 | |||
| b06e2b2273 | |||
| cc1cfe894c | |||
| da49b7a5bf | |||
| 4de6081a74 | |||
| 5a13e49803 | |||
| 2737fca294 | |||
| 896233914f | |||
| 5bb775b17d | |||
| ae8219acf7 | |||
| 4ad383884c | |||
| 65a9d1c798 | |||
| f583e1466f | |||
| 9d893a97b6 | |||
| aa52d5e9f6 | |||
| 623b7ee51f | |||
| 897e86ad60 | |||
| ed78db20e2 | |||
| bd00dfe02c | |||
| 55c040df82 | |||
| e68654a022 | |||
| 89a5d23d2f | |||
| f9aa1cfd2f | |||
| e47f316d0a | |||
| 901127f784 | |||
| dc4fd5afba | |||
| a7ced10f92 | |||
| 9b9e009523 | |||
| 1819b6827a | |||
| bd5b85f6b0 | |||
| c7db209da7 | |||
| bbb8f4a22c |
@@ -0,0 +1,37 @@
|
|||||||
|
## NUPST {{VERSION}}
|
||||||
|
|
||||||
|
Pre-compiled binaries for multiple platforms.
|
||||||
|
|
||||||
|
### Installation
|
||||||
|
|
||||||
|
#### Option 1: Via npm (recommended)
|
||||||
|
|
||||||
|
```bash
|
||||||
|
npm install -g @serve.zone/nupst
|
||||||
|
```
|
||||||
|
|
||||||
|
#### Option 2: Via installer script
|
||||||
|
|
||||||
|
```bash
|
||||||
|
curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash
|
||||||
|
```
|
||||||
|
|
||||||
|
#### Option 3: Direct binary download
|
||||||
|
|
||||||
|
Download the appropriate binary for your platform from the assets below and make it executable.
|
||||||
|
|
||||||
|
### Supported Platforms
|
||||||
|
|
||||||
|
- Linux x86_64 (x64)
|
||||||
|
- Linux ARM64 (aarch64)
|
||||||
|
- macOS x86_64 (Intel)
|
||||||
|
- macOS ARM64 (Apple Silicon)
|
||||||
|
- Windows x86_64
|
||||||
|
|
||||||
|
### Checksums
|
||||||
|
|
||||||
|
SHA256 checksums are provided in `SHA256SUMS.txt` for binary verification.
|
||||||
|
|
||||||
|
### npm Package
|
||||||
|
|
||||||
|
The npm package includes automatic binary detection and installation for your platform.
|
||||||
@@ -0,0 +1,179 @@
|
|||||||
|
# Gitea Actions Workflows
|
||||||
|
|
||||||
|
This directory contains automated workflows for NUPST's CI/CD pipeline.
|
||||||
|
|
||||||
|
## Workflows
|
||||||
|
|
||||||
|
### CI Workflow (`ci.yml`)
|
||||||
|
|
||||||
|
**Triggers:**
|
||||||
|
|
||||||
|
- Push to `main` branch
|
||||||
|
- Push to `migration/**` branches
|
||||||
|
- Pull requests to `main`
|
||||||
|
|
||||||
|
**Jobs:**
|
||||||
|
|
||||||
|
1. **Type Check & Lint**
|
||||||
|
- Runs `deno check` for TypeScript validation
|
||||||
|
- Runs `deno lint` (continues on error)
|
||||||
|
- Runs `deno fmt --check` (continues on error)
|
||||||
|
|
||||||
|
2. **Build Test (Current Platform)**
|
||||||
|
- Compiles for Linux x86_64 (host platform)
|
||||||
|
- Tests binary execution (`--version` and `help`)
|
||||||
|
|
||||||
|
3. **Build All Platforms** (Main/Tags only)
|
||||||
|
- Compiles all 5 platform binaries
|
||||||
|
- Uploads as artifacts (30-day retention)
|
||||||
|
- Only runs on `main` branch or tags
|
||||||
|
|
||||||
|
### Release Workflow (`release.yml`)
|
||||||
|
|
||||||
|
**Triggers:**
|
||||||
|
|
||||||
|
- Push tags matching `v*` (e.g., `v4.0.0`)
|
||||||
|
|
||||||
|
**Jobs:**
|
||||||
|
|
||||||
|
1. **Version Verification**
|
||||||
|
- Extracts version from tag
|
||||||
|
- Verifies `deno.json` version matches tag
|
||||||
|
- Fails if mismatch detected
|
||||||
|
|
||||||
|
2. **Compilation**
|
||||||
|
- Compiles binaries for all 5 platforms:
|
||||||
|
- `nupst-linux-x64` (Linux x86_64)
|
||||||
|
- `nupst-linux-arm64` (Linux ARM64)
|
||||||
|
- `nupst-macos-x64` (macOS Intel)
|
||||||
|
- `nupst-macos-arm64` (macOS Apple Silicon)
|
||||||
|
- `nupst-windows-x64.exe` (Windows x64)
|
||||||
|
|
||||||
|
3. **Checksums**
|
||||||
|
- Generates SHA256 checksums for all binaries
|
||||||
|
- Creates `SHA256SUMS.txt`
|
||||||
|
|
||||||
|
4. **Release Creation**
|
||||||
|
- Creates Gitea release with tag
|
||||||
|
- Extracts release notes from CHANGELOG.md (if exists)
|
||||||
|
- Uploads all binaries + checksums as release assets
|
||||||
|
|
||||||
|
## Creating a Release
|
||||||
|
|
||||||
|
### Prerequisites
|
||||||
|
|
||||||
|
1. Update version in `deno.json`:
|
||||||
|
```json
|
||||||
|
{
|
||||||
|
"version": "4.0.0"
|
||||||
|
}
|
||||||
|
```
|
||||||
|
|
||||||
|
2. Update `CHANGELOG.md` with release notes (optional but recommended)
|
||||||
|
|
||||||
|
3. Commit all changes:
|
||||||
|
```bash
|
||||||
|
git add .
|
||||||
|
git commit -m "chore: bump version to 4.0.0"
|
||||||
|
```
|
||||||
|
|
||||||
|
### Release Process
|
||||||
|
|
||||||
|
1. Create and push a tag matching the version:
|
||||||
|
```bash
|
||||||
|
git tag v4.0.0
|
||||||
|
git push origin v4.0.0
|
||||||
|
```
|
||||||
|
|
||||||
|
2. Gitea Actions will automatically:
|
||||||
|
- Verify version consistency
|
||||||
|
- Compile all platform binaries
|
||||||
|
- Generate checksums
|
||||||
|
- Create release with binaries attached
|
||||||
|
|
||||||
|
3. Monitor the workflow:
|
||||||
|
- Go to: `https://code.foss.global/serve.zone/nupst/actions`
|
||||||
|
- Check the "Release" workflow run
|
||||||
|
|
||||||
|
### Manual Release (Fallback)
|
||||||
|
|
||||||
|
If workflows fail, you can create a release manually:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
# Compile all binaries
|
||||||
|
bash scripts/compile-all.sh
|
||||||
|
|
||||||
|
# Generate checksums
|
||||||
|
cd dist/binaries
|
||||||
|
sha256sum * > SHA256SUMS.txt
|
||||||
|
cd ../..
|
||||||
|
|
||||||
|
# Create release on Gitea UI
|
||||||
|
# Upload binaries manually
|
||||||
|
```
|
||||||
|
|
||||||
|
## Troubleshooting
|
||||||
|
|
||||||
|
### Version Mismatch Error
|
||||||
|
|
||||||
|
If the release workflow fails with "Version mismatch":
|
||||||
|
|
||||||
|
- Ensure `deno.json` version matches the git tag
|
||||||
|
- Example: tag `v4.0.0` requires `"version": "4.0.0"` in deno.json
|
||||||
|
|
||||||
|
### Compilation Errors
|
||||||
|
|
||||||
|
If compilation fails:
|
||||||
|
|
||||||
|
1. Test locally: `bash scripts/compile-all.sh`
|
||||||
|
2. Check Deno version compatibility
|
||||||
|
3. Review TypeScript errors: `deno check mod.ts`
|
||||||
|
|
||||||
|
### Upload Failures
|
||||||
|
|
||||||
|
If binary upload fails:
|
||||||
|
|
||||||
|
1. Check Gitea Actions permissions
|
||||||
|
2. Verify `GITHUB_TOKEN` secret exists (auto-provided by Gitea)
|
||||||
|
3. Try manual release creation
|
||||||
|
|
||||||
|
## Workflow Secrets
|
||||||
|
|
||||||
|
The workflows use the following secrets:
|
||||||
|
|
||||||
|
- `GITHUB_TOKEN` - Auto-provided by Gitea Actions (no setup needed)
|
||||||
|
|
||||||
|
## Development
|
||||||
|
|
||||||
|
### Testing Workflows Locally
|
||||||
|
|
||||||
|
You can test compilation locally:
|
||||||
|
|
||||||
|
```bash
|
||||||
|
# Install Deno
|
||||||
|
curl -fsSL https://deno.land/install.sh | sh
|
||||||
|
|
||||||
|
# Test type checking
|
||||||
|
deno check mod.ts
|
||||||
|
|
||||||
|
# Test compilation
|
||||||
|
bash scripts/compile-all.sh
|
||||||
|
|
||||||
|
# Test binary
|
||||||
|
./dist/binaries/nupst-linux-x64 --version
|
||||||
|
```
|
||||||
|
|
||||||
|
### Modifying Workflows
|
||||||
|
|
||||||
|
After modifying workflows:
|
||||||
|
|
||||||
|
1. Test syntax: Use a YAML validator
|
||||||
|
2. Commit changes: `git add .gitea/workflows/`
|
||||||
|
3. Push to feature branch first to test CI
|
||||||
|
4. Merge to main once verified
|
||||||
|
|
||||||
|
## Links
|
||||||
|
|
||||||
|
- Gitea Actions Documentation: https://docs.gitea.com/usage/actions/overview
|
||||||
|
- Deno Compile Documentation: https://docs.deno.com/runtime/manual/tools/compiler
|
||||||
|
- NUPST Repository: https://code.foss.global/serve.zone/nupst
|
||||||
@@ -0,0 +1,203 @@
|
|||||||
|
name: Release
|
||||||
|
|
||||||
|
on:
|
||||||
|
push:
|
||||||
|
tags:
|
||||||
|
- 'v*'
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
build-and-release:
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
container:
|
||||||
|
image: code.foss.global/host.today/ht-docker-node:latest
|
||||||
|
|
||||||
|
steps:
|
||||||
|
- name: Checkout code
|
||||||
|
uses: actions/checkout@v4
|
||||||
|
with:
|
||||||
|
fetch-depth: 0
|
||||||
|
|
||||||
|
- name: Set up Deno
|
||||||
|
uses: denoland/setup-deno@v1
|
||||||
|
with:
|
||||||
|
deno-version: v2.x
|
||||||
|
|
||||||
|
- name: Set up Node.js
|
||||||
|
uses: actions/setup-node@v4
|
||||||
|
with:
|
||||||
|
node-version: '22'
|
||||||
|
|
||||||
|
- name: Enable corepack
|
||||||
|
run: corepack enable
|
||||||
|
|
||||||
|
- name: Install dependencies
|
||||||
|
run: pnpm install --ignore-scripts
|
||||||
|
|
||||||
|
- name: Get version from tag
|
||||||
|
id: version
|
||||||
|
run: |
|
||||||
|
VERSION=${GITHUB_REF#refs/tags/}
|
||||||
|
echo "version=$VERSION" >> $GITHUB_OUTPUT
|
||||||
|
echo "version_number=${VERSION#v}" >> $GITHUB_OUTPUT
|
||||||
|
echo "Building version: $VERSION"
|
||||||
|
|
||||||
|
- name: Verify deno.json version matches tag
|
||||||
|
run: |
|
||||||
|
DENO_VERSION=$(grep -o '"version": "[^"]*"' deno.json | cut -d'"' -f4)
|
||||||
|
TAG_VERSION="${{ steps.version.outputs.version_number }}"
|
||||||
|
echo "deno.json version: $DENO_VERSION"
|
||||||
|
echo "Tag version: $TAG_VERSION"
|
||||||
|
if [ "$DENO_VERSION" != "$TAG_VERSION" ]; then
|
||||||
|
echo "ERROR: Version mismatch!"
|
||||||
|
echo "deno.json has version $DENO_VERSION but tag is $TAG_VERSION"
|
||||||
|
exit 1
|
||||||
|
fi
|
||||||
|
|
||||||
|
- name: Compile binaries for all platforms
|
||||||
|
run: mkdir -p dist/binaries && npx tsdeno compile
|
||||||
|
|
||||||
|
- name: Generate SHA256 checksums
|
||||||
|
run: |
|
||||||
|
cd dist/binaries
|
||||||
|
sha256sum * > SHA256SUMS.txt
|
||||||
|
cat SHA256SUMS.txt
|
||||||
|
cd ../..
|
||||||
|
|
||||||
|
- name: Extract changelog for this version
|
||||||
|
id: changelog
|
||||||
|
run: |
|
||||||
|
VERSION="${{ steps.version.outputs.version }}"
|
||||||
|
|
||||||
|
if [ ! -f CHANGELOG.md ]; then
|
||||||
|
echo "No CHANGELOG.md found, using default release notes"
|
||||||
|
cat > /tmp/release_notes.md << EOF
|
||||||
|
## NUPST $VERSION
|
||||||
|
|
||||||
|
Pre-compiled binaries for multiple platforms.
|
||||||
|
|
||||||
|
### Installation
|
||||||
|
|
||||||
|
Use the installation script:
|
||||||
|
\`\`\`bash
|
||||||
|
curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash
|
||||||
|
\`\`\`
|
||||||
|
|
||||||
|
Or download the binary for your platform and make it executable.
|
||||||
|
|
||||||
|
### Supported Platforms
|
||||||
|
- Linux x86_64 (x64)
|
||||||
|
- Linux ARM64 (aarch64)
|
||||||
|
- macOS x86_64 (Intel)
|
||||||
|
- macOS ARM64 (Apple Silicon)
|
||||||
|
- Windows x86_64
|
||||||
|
|
||||||
|
### Checksums
|
||||||
|
SHA256 checksums are provided in SHA256SUMS.txt
|
||||||
|
EOF
|
||||||
|
else
|
||||||
|
awk "/## \[$VERSION\]/,/## \[/" CHANGELOG.md | sed '$d' > /tmp/release_notes.md || cat > /tmp/release_notes.md << EOF
|
||||||
|
## NUPST $VERSION
|
||||||
|
|
||||||
|
See CHANGELOG.md for full details.
|
||||||
|
|
||||||
|
### Installation
|
||||||
|
|
||||||
|
Use the installation script:
|
||||||
|
\`\`\`bash
|
||||||
|
curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash
|
||||||
|
\`\`\`
|
||||||
|
EOF
|
||||||
|
fi
|
||||||
|
|
||||||
|
echo "Release notes:"
|
||||||
|
cat /tmp/release_notes.md
|
||||||
|
|
||||||
|
- name: Delete existing release if it exists
|
||||||
|
run: |
|
||||||
|
VERSION="${{ steps.version.outputs.version }}"
|
||||||
|
|
||||||
|
echo "Checking for existing release $VERSION..."
|
||||||
|
|
||||||
|
EXISTING_RELEASE_ID=$(curl -s \
|
||||||
|
-H "Authorization: token ${{ secrets.GITHUB_TOKEN }}" \
|
||||||
|
"https://code.foss.global/api/v1/repos/serve.zone/nupst/releases/tags/$VERSION" \
|
||||||
|
| jq -r '.id // empty')
|
||||||
|
|
||||||
|
if [ -n "$EXISTING_RELEASE_ID" ]; then
|
||||||
|
echo "Found existing release (ID: $EXISTING_RELEASE_ID), deleting..."
|
||||||
|
curl -X DELETE -s \
|
||||||
|
-H "Authorization: token ${{ secrets.GITHUB_TOKEN }}" \
|
||||||
|
"https://code.foss.global/api/v1/repos/serve.zone/nupst/releases/$EXISTING_RELEASE_ID"
|
||||||
|
echo "Existing release deleted"
|
||||||
|
sleep 2
|
||||||
|
else
|
||||||
|
echo "No existing release found, proceeding with creation"
|
||||||
|
fi
|
||||||
|
|
||||||
|
- name: Create Gitea Release
|
||||||
|
run: |
|
||||||
|
VERSION="${{ steps.version.outputs.version }}"
|
||||||
|
|
||||||
|
echo "Creating release for $VERSION..."
|
||||||
|
RELEASE_ID=$(curl -X POST -s \
|
||||||
|
-H "Authorization: token ${{ secrets.GITHUB_TOKEN }}" \
|
||||||
|
-H "Content-Type: application/json" \
|
||||||
|
"https://code.foss.global/api/v1/repos/serve.zone/nupst/releases" \
|
||||||
|
-d "{
|
||||||
|
\"tag_name\": \"$VERSION\",
|
||||||
|
\"name\": \"NUPST $VERSION\",
|
||||||
|
\"body\": $(jq -Rs . /tmp/release_notes.md),
|
||||||
|
\"draft\": false,
|
||||||
|
\"prerelease\": false
|
||||||
|
}" | jq -r '.id')
|
||||||
|
|
||||||
|
echo "Release created with ID: $RELEASE_ID"
|
||||||
|
|
||||||
|
for binary in dist/binaries/*; do
|
||||||
|
filename=$(basename "$binary")
|
||||||
|
echo "Uploading $filename..."
|
||||||
|
curl -X POST -s \
|
||||||
|
-H "Authorization: token ${{ secrets.GITHUB_TOKEN }}" \
|
||||||
|
-H "Content-Type: application/octet-stream" \
|
||||||
|
--data-binary "@$binary" \
|
||||||
|
"https://code.foss.global/api/v1/repos/serve.zone/nupst/releases/$RELEASE_ID/assets?name=$filename"
|
||||||
|
done
|
||||||
|
|
||||||
|
echo "All assets uploaded successfully"
|
||||||
|
|
||||||
|
- name: Clean up old releases
|
||||||
|
run: |
|
||||||
|
echo "Cleaning up old releases (keeping only last 3)..."
|
||||||
|
|
||||||
|
RELEASES=$(curl -s -H "Authorization: token ${{ secrets.GITHUB_TOKEN }}" \
|
||||||
|
"https://code.foss.global/api/v1/repos/serve.zone/nupst/releases" | \
|
||||||
|
jq -r 'sort_by(.created_at) | reverse | .[3:] | .[].id')
|
||||||
|
|
||||||
|
if [ -n "$RELEASES" ]; then
|
||||||
|
echo "Found releases to delete:"
|
||||||
|
for release_id in $RELEASES; do
|
||||||
|
echo " Deleting release ID: $release_id"
|
||||||
|
curl -X DELETE -s -H "Authorization: token ${{ secrets.GITHUB_TOKEN }}" \
|
||||||
|
"https://code.foss.global/api/v1/repos/serve.zone/nupst/releases/$release_id"
|
||||||
|
done
|
||||||
|
echo "Old releases deleted successfully"
|
||||||
|
else
|
||||||
|
echo "No old releases to delete (less than 4 releases total)"
|
||||||
|
fi
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
- name: Release Summary
|
||||||
|
run: |
|
||||||
|
echo "================================================"
|
||||||
|
echo " Release ${{ steps.version.outputs.version }} Complete!"
|
||||||
|
echo "================================================"
|
||||||
|
echo ""
|
||||||
|
echo "Binaries published:"
|
||||||
|
ls -lh dist/binaries/
|
||||||
|
echo ""
|
||||||
|
echo "Release URL:"
|
||||||
|
echo "https://code.foss.global/serve.zone/nupst/releases/tag/${{ steps.version.outputs.version }}"
|
||||||
|
echo ""
|
||||||
|
echo "Installation command:"
|
||||||
|
echo "curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash"
|
||||||
|
echo ""
|
||||||
+10
-6
@@ -1,15 +1,18 @@
|
|||||||
# Build
|
# Compiled Deno binaries (built by scripts/compile-all.sh)
|
||||||
dist*/
|
dist/binaries/
|
||||||
|
|
||||||
# Dependencies
|
# Deno cache and lock file
|
||||||
|
.deno/
|
||||||
|
deno.lock
|
||||||
|
|
||||||
|
# Legacy Node.js artifacts (v3.x and earlier - kept for safety)
|
||||||
node_modules/
|
node_modules/
|
||||||
|
|
||||||
# Bundled Node.js binaries
|
|
||||||
vendor/
|
vendor/
|
||||||
|
dist_ts/
|
||||||
|
npm-debug.log*
|
||||||
|
|
||||||
# Logs
|
# Logs
|
||||||
*.log
|
*.log
|
||||||
npm-debug.log*
|
|
||||||
|
|
||||||
# Environment
|
# Environment
|
||||||
.env
|
.env
|
||||||
@@ -18,4 +21,5 @@ npm-debug.log*
|
|||||||
.DS_Store
|
.DS_Store
|
||||||
Thumbs.db
|
Thumbs.db
|
||||||
|
|
||||||
|
# Development
|
||||||
.nogit/
|
.nogit/
|
||||||
+54
@@ -0,0 +1,54 @@
|
|||||||
|
# Source code (not needed for binary distribution)
|
||||||
|
/ts/
|
||||||
|
/test/
|
||||||
|
mod.ts
|
||||||
|
*.ts
|
||||||
|
|
||||||
|
# Development files
|
||||||
|
.git/
|
||||||
|
.gitea/
|
||||||
|
.claude/
|
||||||
|
.serena/
|
||||||
|
.nogit/
|
||||||
|
.github/
|
||||||
|
deno.json
|
||||||
|
deno.lock
|
||||||
|
tsconfig.json
|
||||||
|
|
||||||
|
# Scripts not needed for npm
|
||||||
|
/scripts/compile-all.sh
|
||||||
|
install.sh
|
||||||
|
uninstall.sh
|
||||||
|
example-action.sh
|
||||||
|
|
||||||
|
# Documentation files not needed for npm package
|
||||||
|
readme.plan.md
|
||||||
|
readme.hints.md
|
||||||
|
npm-publish-instructions.md
|
||||||
|
docs/
|
||||||
|
|
||||||
|
# IDE and editor files
|
||||||
|
.vscode/
|
||||||
|
.idea/
|
||||||
|
*.swp
|
||||||
|
*.swo
|
||||||
|
*~
|
||||||
|
.DS_Store
|
||||||
|
|
||||||
|
# Keep only the install-binary.js in scripts/
|
||||||
|
/scripts/*
|
||||||
|
!/scripts/install-binary.js
|
||||||
|
|
||||||
|
# Exclude all dist directory (binaries will be downloaded during install)
|
||||||
|
/dist/
|
||||||
|
|
||||||
|
# Logs and temporary files
|
||||||
|
*.log
|
||||||
|
npm-debug.log*
|
||||||
|
yarn-debug.log*
|
||||||
|
yarn-error.log*
|
||||||
|
|
||||||
|
# Other
|
||||||
|
node_modules/
|
||||||
|
.env
|
||||||
|
.env.*
|
||||||
@@ -0,0 +1,64 @@
|
|||||||
|
{
|
||||||
|
"@git.zone/cli": {
|
||||||
|
"release": {
|
||||||
|
"registries": [
|
||||||
|
"https://verdaccio.lossless.digital"
|
||||||
|
],
|
||||||
|
"accessLevel": "public"
|
||||||
|
},
|
||||||
|
"projectType": "deno",
|
||||||
|
"module": {
|
||||||
|
"githost": "code.foss.global",
|
||||||
|
"gitscope": "serve.zone",
|
||||||
|
"gitrepo": "nupst",
|
||||||
|
"description": "shut down in time when the power goes out",
|
||||||
|
"npmPackagename": "@serve.zone/nupst",
|
||||||
|
"license": "MIT"
|
||||||
|
}
|
||||||
|
},
|
||||||
|
"@git.zone/tsdeno": {
|
||||||
|
"compileTargets": [
|
||||||
|
{
|
||||||
|
"name": "nupst-linux-x64",
|
||||||
|
"entryPoint": "mod.ts",
|
||||||
|
"outDir": "dist/binaries",
|
||||||
|
"target": "x86_64-unknown-linux-gnu",
|
||||||
|
"permissions": ["--allow-all"],
|
||||||
|
"noCheck": true
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"name": "nupst-linux-arm64",
|
||||||
|
"entryPoint": "mod.ts",
|
||||||
|
"outDir": "dist/binaries",
|
||||||
|
"target": "aarch64-unknown-linux-gnu",
|
||||||
|
"permissions": ["--allow-all"],
|
||||||
|
"noCheck": true
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"name": "nupst-macos-x64",
|
||||||
|
"entryPoint": "mod.ts",
|
||||||
|
"outDir": "dist/binaries",
|
||||||
|
"target": "x86_64-apple-darwin",
|
||||||
|
"permissions": ["--allow-all"],
|
||||||
|
"noCheck": true
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"name": "nupst-macos-arm64",
|
||||||
|
"entryPoint": "mod.ts",
|
||||||
|
"outDir": "dist/binaries",
|
||||||
|
"target": "aarch64-apple-darwin",
|
||||||
|
"permissions": ["--allow-all"],
|
||||||
|
"noCheck": true
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"name": "nupst-windows-x64",
|
||||||
|
"entryPoint": "mod.ts",
|
||||||
|
"outDir": "dist/binaries",
|
||||||
|
"target": "x86_64-pc-windows-msvc",
|
||||||
|
"permissions": ["--allow-all"],
|
||||||
|
"noCheck": true
|
||||||
|
}
|
||||||
|
]
|
||||||
|
},
|
||||||
|
"@ship.zone/szci": {}
|
||||||
|
}
|
||||||
@@ -1,49 +0,0 @@
|
|||||||
#!/bin/bash
|
|
||||||
|
|
||||||
# NUPST Launcher Script
|
|
||||||
# This script detects architecture and OS, then runs NUPST with the appropriate Node.js binary
|
|
||||||
|
|
||||||
# First, handle symlinks correctly
|
|
||||||
REAL_SCRIPT_PATH=$(readlink -f "${BASH_SOURCE[0]}")
|
|
||||||
SCRIPT_DIR=$(dirname "$REAL_SCRIPT_PATH")
|
|
||||||
|
|
||||||
# For debugging
|
|
||||||
# echo "Script path: $REAL_SCRIPT_PATH"
|
|
||||||
# echo "Script dir: $SCRIPT_DIR"
|
|
||||||
|
|
||||||
# If we're run via symlink from /usr/local/bin, use the hardcoded installation path
|
|
||||||
if [[ "$SCRIPT_DIR" == "/usr/local/bin" ]]; then
|
|
||||||
PROJECT_ROOT="/opt/nupst"
|
|
||||||
else
|
|
||||||
# Otherwise, use relative path from script location
|
|
||||||
PROJECT_ROOT="$( cd "$SCRIPT_DIR/.." &> /dev/null && pwd )"
|
|
||||||
fi
|
|
||||||
|
|
||||||
# For debugging
|
|
||||||
# echo "Project root: $PROJECT_ROOT"
|
|
||||||
|
|
||||||
# Set Node.js binary path directly
|
|
||||||
NODE_BIN="$PROJECT_ROOT/vendor/node-linux-x64/bin/node"
|
|
||||||
|
|
||||||
# If binary doesn't exist, try system Node as fallback
|
|
||||||
if [ ! -f "$NODE_BIN" ]; then
|
|
||||||
if command -v node &> /dev/null; then
|
|
||||||
NODE_BIN="node"
|
|
||||||
echo "Using system Node.js installation"
|
|
||||||
else
|
|
||||||
echo "Error: Node.js binary not found at $NODE_BIN"
|
|
||||||
echo "Please run the setup script or install Node.js manually."
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Run NUPST with the Node.js binary
|
|
||||||
if [ -f "$PROJECT_ROOT/dist_ts/index.js" ]; then
|
|
||||||
exec "$NODE_BIN" "$PROJECT_ROOT/dist_ts/index.js" "$@"
|
|
||||||
elif [ -f "$PROJECT_ROOT/dist/index.js" ]; then
|
|
||||||
exec "$NODE_BIN" "$PROJECT_ROOT/dist/index.js" "$@"
|
|
||||||
else
|
|
||||||
echo "Error: Could not find NUPST's index.js file."
|
|
||||||
echo "Please run the setup script to download the required files."
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
@@ -0,0 +1,109 @@
|
|||||||
|
#!/usr/bin/env node
|
||||||
|
|
||||||
|
/**
|
||||||
|
* NUPST npm wrapper
|
||||||
|
* This script executes the appropriate pre-compiled binary based on the current platform
|
||||||
|
*/
|
||||||
|
|
||||||
|
import { spawn } from 'child_process';
|
||||||
|
import { fileURLToPath } from 'url';
|
||||||
|
import { dirname, join } from 'path';
|
||||||
|
import { existsSync } from 'fs';
|
||||||
|
import { arch, platform } from 'os';
|
||||||
|
import process from "node:process";
|
||||||
|
|
||||||
|
const __filename = fileURLToPath(import.meta.url);
|
||||||
|
const __dirname = dirname(__filename);
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the binary name for the current platform
|
||||||
|
*/
|
||||||
|
function getBinaryName() {
|
||||||
|
const plat = platform();
|
||||||
|
const architecture = arch();
|
||||||
|
|
||||||
|
// Map Node's platform/arch to our binary naming
|
||||||
|
const platformMap = {
|
||||||
|
'darwin': 'macos',
|
||||||
|
'linux': 'linux',
|
||||||
|
'win32': 'windows',
|
||||||
|
};
|
||||||
|
|
||||||
|
const archMap = {
|
||||||
|
'x64': 'x64',
|
||||||
|
'arm64': 'arm64',
|
||||||
|
};
|
||||||
|
|
||||||
|
const mappedPlatform = platformMap[plat];
|
||||||
|
const mappedArch = archMap[architecture];
|
||||||
|
|
||||||
|
if (!mappedPlatform || !mappedArch) {
|
||||||
|
console.error(`Error: Unsupported platform/architecture: ${plat}/${architecture}`);
|
||||||
|
console.error('Supported platforms: Linux, macOS, Windows');
|
||||||
|
console.error('Supported architectures: x64, arm64');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Construct binary name
|
||||||
|
let binaryName = `nupst-${mappedPlatform}-${mappedArch}`;
|
||||||
|
if (plat === 'win32') {
|
||||||
|
binaryName += '.exe';
|
||||||
|
}
|
||||||
|
|
||||||
|
return binaryName;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Execute the binary
|
||||||
|
*/
|
||||||
|
function executeBinary() {
|
||||||
|
const binaryName = getBinaryName();
|
||||||
|
const binaryPath = join(__dirname, '..', 'dist', 'binaries', binaryName);
|
||||||
|
|
||||||
|
// Check if binary exists
|
||||||
|
if (!existsSync(binaryPath)) {
|
||||||
|
console.error(`Error: Binary not found at ${binaryPath}`);
|
||||||
|
console.error('This might happen if:');
|
||||||
|
console.error('1. The postinstall script failed to run');
|
||||||
|
console.error('2. The platform is not supported');
|
||||||
|
console.error('3. The package was not installed correctly');
|
||||||
|
console.error('');
|
||||||
|
console.error('Try reinstalling the package:');
|
||||||
|
console.error(' npm uninstall -g @serve.zone/nupst');
|
||||||
|
console.error(' npm install -g @serve.zone/nupst');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Spawn the binary with all arguments passed through
|
||||||
|
const child = spawn(binaryPath, process.argv.slice(2), {
|
||||||
|
stdio: 'inherit',
|
||||||
|
shell: false,
|
||||||
|
});
|
||||||
|
|
||||||
|
// Handle child process events
|
||||||
|
child.on('error', (err) => {
|
||||||
|
console.error(`Error executing nupst: ${err.message}`);
|
||||||
|
process.exit(1);
|
||||||
|
});
|
||||||
|
|
||||||
|
child.on('exit', (code, signal) => {
|
||||||
|
if (signal) {
|
||||||
|
process.kill(process.pid, signal);
|
||||||
|
} else {
|
||||||
|
process.exit(code || 0);
|
||||||
|
}
|
||||||
|
});
|
||||||
|
|
||||||
|
// Forward signals to child process
|
||||||
|
const signals = ['SIGINT', 'SIGTERM', 'SIGHUP'];
|
||||||
|
signals.forEach((signal) => {
|
||||||
|
process.on(signal, () => {
|
||||||
|
if (!child.killed) {
|
||||||
|
child.kill(signal);
|
||||||
|
}
|
||||||
|
});
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
// Execute
|
||||||
|
executeBinary();
|
||||||
+763
-29
@@ -1,48 +1,737 @@
|
|||||||
# Changelog
|
# Changelog
|
||||||
|
|
||||||
|
## 2026-04-14 - 5.5.1 - fix(cli,daemon,snmp)
|
||||||
|
normalize CLI argument parsing and extract daemon monitoring helpers with stronger SNMP typing
|
||||||
|
|
||||||
|
- Pass runtime arguments directly to the CLI in both Deno and Node entrypoints so commands and debug flags are parsed consistently
|
||||||
|
- Refactor daemon logic into dedicated pause state, config watch, UPS status, monitoring, action orchestration, shutdown execution, and shutdown monitoring modules
|
||||||
|
- Add explicit local typings and value coercion around net-snmp interactions to reduce untyped response handling
|
||||||
|
- Update user-facing CLI guidance to use current subcommands such as "nupst ups add", "nupst ups edit", and "nupst service start"
|
||||||
|
- Expand test coverage for extracted monitoring and pause-state helpers
|
||||||
|
|
||||||
|
## 2026-04-02 - 5.5.0 - feat(proxmox)
|
||||||
|
add Proxmox CLI auto-detection and interactive action setup improvements
|
||||||
|
|
||||||
|
- Add Proxmox action support for CLI mode using qm/pct with automatic fallback to REST API mode
|
||||||
|
- Expose proxmoxMode configuration and update CLI wizards to auto-detect local Proxmox tools before prompting for API credentials
|
||||||
|
- Expand interactive action creation to support shutdown, webhook, script, and Proxmox actions with improved displayed details
|
||||||
|
- Update documentation to cover Proxmox CLI/API modes and clarify shutdown delay units in minutes
|
||||||
|
|
||||||
|
## 2026-03-30 - 5.4.1 - fix(deps)
|
||||||
|
bump tsdeno and net-snmp patch dependencies
|
||||||
|
|
||||||
|
- update @git.zone/tsdeno from ^1.2.0 to ^1.3.1
|
||||||
|
- update net-snmp import from 3.26.0 to 3.26.1 in the SNMP manager
|
||||||
|
|
||||||
|
## 2026-03-30 - 5.4.0 - feat(snmp)
|
||||||
|
add configurable SNMP runtime units with v4.3 migration support
|
||||||
|
|
||||||
|
- Adds explicit `runtimeUnit` support for SNMP devices with `minutes`, `seconds`, and `ticks` options.
|
||||||
|
- Updates runtime processing to prefer configured units over UPS model heuristics.
|
||||||
|
- Introduces a v4.2 to v4.3 migration that populates `runtimeUnit` for existing SNMP device configs based on `upsModel`.
|
||||||
|
- Extends the CLI setup and device summary output to configure and display the selected runtime unit.
|
||||||
|
- Updates default config version to 4.3 and documents the new SNMP runtime unit setting in the README.
|
||||||
|
|
||||||
|
## 2026-03-18 - 5.3.3 - fix(deps)
|
||||||
|
add @git.zone/tsdeno as a development dependency
|
||||||
|
|
||||||
|
- Adds @git.zone/tsdeno@^1.2.0 to devDependencies in package.json.
|
||||||
|
|
||||||
|
## 2026-03-18 - 5.3.2 - fix(build)
|
||||||
|
replace manual release compilation workflows with tsdeno-based build configuration
|
||||||
|
|
||||||
|
- removes obsolete CI and npm publish workflows
|
||||||
|
- switches the Deno compile task to use tsdeno
|
||||||
|
- adds reusable multi-platform compile targets in npmextra.json
|
||||||
|
- updates the release workflow to install Node.js and pnpm before building binaries
|
||||||
|
- deletes the custom compile-all.sh script in favor of centralized build tooling
|
||||||
|
|
||||||
|
## 2026-03-15 - 5.3.1 - fix(cli)
|
||||||
|
rename the update command references to upgrade across the CLI and documentation
|
||||||
|
|
||||||
|
- Updates command parsing and help output to use `upgrade` instead of `update`.
|
||||||
|
- Revises user-facing upgrade prompts in daemon, systemd, and runtime status messages.
|
||||||
|
- Aligns README and command migration documentation with the renamed command.
|
||||||
|
|
||||||
|
## 2026-02-20 - 5.3.0 - feat(daemon)
|
||||||
|
Add UPSD (NUT) protocol support, Proxmox VM shutdown action, pause/resume monitoring, and network-loss/unreachable handling; bump config version to 4.2
|
||||||
|
|
||||||
|
- Add UPSD client (ts/upsd) and ProtocolResolver (ts/protocol) to support protocol-agnostic UPS queries (snmp or upsd).
|
||||||
|
- Introduce new TProtocol and IUpsdConfig types, wire up Nupst to initialize & expose UPSD client, and route status requests through ProtocolResolver.
|
||||||
|
- Add 'unreachable' TPowerStatus plus consecutiveFailures and unreachableSince tracking; mark UPS as unreachable after NETWORK.CONSECUTIVE_FAILURE_THRESHOLD failures and suppress shutdown actions while unreachable.
|
||||||
|
- Implement pause/resume feature: PAUSE.FILE_PATH state file, CLI commands (pause/resume), daemon pause-state polling, auto-resume, and include pause state in HTTP API responses.
|
||||||
|
- Add ProxmoxAction (ts/actions/proxmox-action.ts) with Proxmox API interaction, configuration options (token, node, timeout, force, insecure) and CLI prompts to configure proxmox actions.
|
||||||
|
- CLI and UI updates: protocol selection when adding UPS, protocol/host shown in lists, action details column supports proxmox, and status displays include protocol and unreachable state.
|
||||||
|
- Add migration MigrationV4_1ToV4_2 to set protocol:'snmp' for existing devices and bump config.version to '4.2'.
|
||||||
|
- Add new constants (NETWORK, UPSD, PAUSE, PROXMOX), update package.json scripts (test/build/lint/format), and wire protocol support across daemon, systemd, http-server, and various handlers.
|
||||||
|
|
||||||
|
## 2026-01-29 - 5.2.4 - fix()
|
||||||
|
no changes
|
||||||
|
|
||||||
|
- No files changed in the provided git diff; no commit or version bump required.
|
||||||
|
|
||||||
|
## 2026-01-29 - 5.2.3 - fix(core)
|
||||||
|
fix lint/type issues and small refactors
|
||||||
|
|
||||||
|
- Add missing node:process imports in bin and scripts to ensure process is available
|
||||||
|
- Remove unused imports and unused type imports (e.g. writeFileSync, IActionConfig) to reduce noise
|
||||||
|
- Make some methods synchronous (service update, webhook call) to match actual usage
|
||||||
|
- Tighten SNMP typings and linting: added deno-lint-ignore comments, renamed unused params with leading underscore, and use `as const` for securityLevel fallbacks
|
||||||
|
- Improve error handling variable naming in systemd (use error instead of _error)
|
||||||
|
- Annotate ANSI regex with deno-lint-ignore no-control-regex and remove unused color/symbol imports across CLI/daemon/logger
|
||||||
|
|
||||||
|
## 2026-01-29 - 5.2.2 - fix(core)
|
||||||
|
tidy formatting and minor fixes across CLI, SNMP, HTTP server, migrations and packaging
|
||||||
|
|
||||||
|
- Normalize import ordering and improve logger/string formatting across many CLI handlers, daemon, systemd, actions and tests
|
||||||
|
- Apply formatting tidies: trailing commas, newline fixes, and more consistent multiline strings
|
||||||
|
- Allow BaseMigration methods to return either sync or async results (shouldRun/migrate signatures updated)
|
||||||
|
- Improve SNMP manager and HTTP server logging/error messages and tighten some typings (raw SNMP types, server error typing)
|
||||||
|
- Small robustness and messaging improvements in npm installer and wrapper (platform/arch mapping, error outputs)
|
||||||
|
- Update tests and documentation layout/formatting for readability
|
||||||
|
|
||||||
|
## 2026-01-29 - 5.2.1 - fix(cli(ups-handler), systemd)
|
||||||
|
|
||||||
|
add type guards and null checks for UPS configs; improve SNMP handling and prompts; guard version
|
||||||
|
display
|
||||||
|
|
||||||
|
- Introduce a type guard ('id' in config && 'name' in config) to distinguish IUpsConfig from legacy
|
||||||
|
INupstConfig and route fields (snmp, checkInterval, name, id) accordingly.
|
||||||
|
- displayTestConfig now handles missing SNMP by logging 'Not configured' and returning, computes
|
||||||
|
checkInterval/upsName/upsId correctly, and uses groups only for true UPS configs.
|
||||||
|
- testConnection now safely derives snmpConfig for both config types, throws if SNMP is missing, and
|
||||||
|
caps test timeout to 10s for probes.
|
||||||
|
- Clear auth/priv credentials by setting undefined (instead of empty strings) when disabling
|
||||||
|
security levels to avoid invalid/empty string values.
|
||||||
|
- Expanded customOIDs to include OUTPUT_LOAD, OUTPUT_POWER, OUTPUT_VOLTAGE, OUTPUT_CURRENT with
|
||||||
|
defaults; trim prompt input and document RFC 1628 fallbacks.
|
||||||
|
- systemd.displayVersionInfo: guard against missing nupst (silent return) and avoid errors when
|
||||||
|
printing version info; use ignored catch variables for clarity.
|
||||||
|
|
||||||
|
## 2026-01-29 - 5.2.0 - feat(core)
|
||||||
|
|
||||||
|
Centralize timeouts/constants, add CLI prompt helpers, and introduce webhook/script actions with
|
||||||
|
safety and SNMP refactors
|
||||||
|
|
||||||
|
- Add ts/constants.ts to centralize timing, SNMP, webhook, script, shutdown and UI constants and
|
||||||
|
replace magic numbers across the codebase
|
||||||
|
- Introduce helpers/prompt.ts with createPrompt() and withPrompt() and refactor CLI handlers to use
|
||||||
|
these helpers (cleaner prompt lifecycle)
|
||||||
|
- Add webhook action support: ts/actions/webhook-action.ts, IWebhookPayload type, and export from
|
||||||
|
ts/actions/index.ts
|
||||||
|
- Enhance ShutdownAction safety checks (only trigger onBattery, stricter transition rules) and use
|
||||||
|
constants/UI widths for displays
|
||||||
|
- Refactor SNMP manager to use logger instead of console, pull SNMP defaults from constants,
|
||||||
|
improved debug output, and add INupstAccessor interface to break circular dependency (Nupst now
|
||||||
|
implements the interface)
|
||||||
|
- Update many CLI and core types (stronger typing for configs/actions), expand tests and update
|
||||||
|
README and npmextra.json to document new features
|
||||||
|
|
||||||
|
## 2025-11-09 - 5.1.11 - fix(readme)
|
||||||
|
|
||||||
|
Update README installation instructions to recommend automated installer script and clarify npm
|
||||||
|
installation
|
||||||
|
|
||||||
|
- Replace the previous 'Via npm (NEW! - Recommended)' section with a clear 'Automated Installer
|
||||||
|
Script (Recommended)' section and example curl installer.
|
||||||
|
- Move npm installation instructions into an 'Alternative: Via npm' subsection and clarify that the
|
||||||
|
npm package downloads the appropriate pre-compiled binary for the platform during installation.
|
||||||
|
- Remove the 'NEW!' badge and streamline notes about binary downloads and installation methods.
|
||||||
|
|
||||||
|
## 2025-10-23 - 5.1.10 - fix(config)
|
||||||
|
|
||||||
|
Synchronize deno.json version with package.json, tidy formatting, and add local tooling settings
|
||||||
|
|
||||||
|
- Bumped deno.json version to 5.1.9 to match package.json/commitinfo
|
||||||
|
- Reformatted deno.json arrays (lint, fmt, compilerOptions) for readability
|
||||||
|
- Added .claude/settings.local.json for local development/tooling permissions (no runtime behaviour
|
||||||
|
changes)
|
||||||
|
|
||||||
|
## 2025-10-23 - 5.1.9 - fix(dev)
|
||||||
|
|
||||||
|
Add local assistant permissions/settings file (.claude/settings.local.json)
|
||||||
|
|
||||||
|
- Added .claude/settings.local.json containing local assistant permission configuration used for
|
||||||
|
development tasks (deno check, deno lint/format, npm/pack, running packaged binaries, etc.)
|
||||||
|
- This is a development/local configuration file and does not change runtime behavior or product
|
||||||
|
code paths
|
||||||
|
- Patch version bump recommended
|
||||||
|
|
||||||
|
## 2025-10-23 - 5.1.2 - fix(scripts)
|
||||||
|
|
||||||
|
Add build script to package.json and include local dev tool settings
|
||||||
|
|
||||||
|
- Add a 'build' script to package.json (no-op placeholder) to provide an explicit build step
|
||||||
|
- Minor scripts section formatting tidy in package.json
|
||||||
|
- Add a hidden local settings file for development tooling permissions to the repository (local-only
|
||||||
|
configuration)
|
||||||
|
|
||||||
|
## 2025-10-23 - 5.1.1 - fix(tooling)
|
||||||
|
|
||||||
|
Add .claude/settings.local.json with local automation permissions
|
||||||
|
|
||||||
|
- Add .claude/settings.local.json to specify allowed permissions for local automated tasks
|
||||||
|
- Grants permissions for various developer/CI actions (deno check/lint/fmt, npm/npm pack, selective
|
||||||
|
Bash commands, WebFetch to docs.deno.com and code.foss.global, and file/read/replace helpers)
|
||||||
|
- This is a developer/local tooling config only and does not change runtime code or package behavior
|
||||||
|
|
||||||
|
## 2025-10-22 - 5.1.0 - feat(packaging)
|
||||||
|
|
||||||
|
Add npm packaging and installer: wrapper, postinstall downloader, publish workflow, and packaging
|
||||||
|
files
|
||||||
|
|
||||||
|
- Add package.json (v5.0.5) and npm packaging metadata to publish @serve.zone/nupst
|
||||||
|
- Include a small Node.js wrapper (bin/nupst-wrapper.js) to execute platform-specific precompiled
|
||||||
|
binaries
|
||||||
|
- Add postinstall script (scripts/install-binary.js) that downloads the correct binary for the
|
||||||
|
current platform and sets executable permissions
|
||||||
|
- Add GitHub Actions workflow (.github/workflows/npm-publish.yml) to build binaries, pack and
|
||||||
|
publish to npm, and create releases
|
||||||
|
- Add .npmignore to keep source, tests and dev files out of npm package; keep only runtime installer
|
||||||
|
and wrapper
|
||||||
|
- Move example action script into docs (docs/example-action.sh) and remove the top-level
|
||||||
|
example-action.sh
|
||||||
|
- Include generated npm package artifact (serve.zone-nupst-5.0.5.tgz) and npmextra.json
|
||||||
|
|
||||||
|
## 2025-10-18 - 4.0.0 - BREAKING CHANGE(core): Complete migration to Deno runtime
|
||||||
|
|
||||||
|
**MAJOR RELEASE: NUPST v4.0 is a complete rewrite powered by Deno**
|
||||||
|
|
||||||
|
This release fundamentally changes NUPST's architecture from Node.js-based to Deno-based,
|
||||||
|
distributed as pre-compiled binaries. This is a **breaking change** in terms of installation and
|
||||||
|
distribution, but configuration files from v3.x are **fully compatible**.
|
||||||
|
|
||||||
|
### Breaking Changes
|
||||||
|
|
||||||
|
**Installation & Distribution:**
|
||||||
|
|
||||||
|
- **Removed**: Node.js runtime dependency - NUPST no longer requires Node.js
|
||||||
|
- **Removed**: npm package distribution (no longer published to npmjs.org)
|
||||||
|
- **Removed**: `bin/nupst` wrapper script
|
||||||
|
- **Removed**: `setup.sh` dependency installation
|
||||||
|
- **Removed**: All Node.js-related files (package.json, tsconfig.json, pnpm-lock.yaml,
|
||||||
|
npmextra.json)
|
||||||
|
- **Changed**: Installation now downloads pre-compiled binaries instead of cloning repository
|
||||||
|
- **Changed**: Binary-based distribution (~340MB self-contained executables)
|
||||||
|
|
||||||
|
**CLI Structure (Backward Compatible):**
|
||||||
|
|
||||||
|
- **Changed**: Commands now use subcommand structure (e.g., `nupst service enable` instead of
|
||||||
|
`nupst enable`)
|
||||||
|
- **Maintained**: Old command format still works with deprecation warnings for smooth migration
|
||||||
|
- **Added**: Aliases for common commands (`nupst ls`, `nupst rm`)
|
||||||
|
|
||||||
|
### New Features
|
||||||
|
|
||||||
|
**Distribution & Installation:**
|
||||||
|
|
||||||
|
- Pre-compiled binaries for 5 platforms:
|
||||||
|
- Linux x86_64
|
||||||
|
- Linux ARM64
|
||||||
|
- macOS x86_64 (Intel)
|
||||||
|
- macOS ARM64 (Apple Silicon)
|
||||||
|
- Windows x86_64
|
||||||
|
- Automated binary releases via Gitea Actions
|
||||||
|
- SHA256 checksum verification for all releases
|
||||||
|
- Installation from Gitea releases via updated `install.sh`
|
||||||
|
- Zero dependencies - completely self-contained binaries
|
||||||
|
- Cross-platform compilation from single codebase
|
||||||
|
|
||||||
|
**CI/CD Automation:**
|
||||||
|
|
||||||
|
- Gitea Actions workflows for continuous integration
|
||||||
|
- Automated release workflow triggered by git tags
|
||||||
|
- Automatic binary compilation for all platforms on release
|
||||||
|
- Type checking and linting in CI pipeline
|
||||||
|
- Build verification on every push
|
||||||
|
|
||||||
|
**CLI Improvements:**
|
||||||
|
|
||||||
|
- New hierarchical command structure with subcommands
|
||||||
|
- `nupst service` - Service management (enable, disable, start, stop, restart, status, logs)
|
||||||
|
- `nupst ups` - UPS device management (add, edit, remove, list, test)
|
||||||
|
- `nupst group` - Group management (add, edit, remove, list)
|
||||||
|
- `nupst config show` - Display configuration
|
||||||
|
- `nupst --version` - Show version information
|
||||||
|
- Better help messages organized by category
|
||||||
|
- Backward compatibility maintained with deprecation warnings
|
||||||
|
|
||||||
|
**Technical Improvements:**
|
||||||
|
|
||||||
|
- Deno runtime for modern TypeScript/JavaScript execution
|
||||||
|
- Native TypeScript support without compilation step
|
||||||
|
- Faster startup and execution compared to Node.js
|
||||||
|
- Smaller memory footprint
|
||||||
|
- Built-in permissions system
|
||||||
|
- No build step required for development
|
||||||
|
|
||||||
|
### Migration Guide
|
||||||
|
|
||||||
|
**For Users:**
|
||||||
|
|
||||||
|
1. Stop existing v3.x service: `sudo nupst disable`
|
||||||
|
2. Install v4.0 using new installer:
|
||||||
|
`curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- -y`
|
||||||
|
3. Your configuration at `/etc/nupst/config.json` is preserved and fully compatible
|
||||||
|
4. Enable service with new CLI: `sudo nupst service enable && sudo nupst service start`
|
||||||
|
5. Update systemd commands to use new syntax (old syntax still works with warnings)
|
||||||
|
|
||||||
|
**Configuration Compatibility:**
|
||||||
|
|
||||||
|
- All configuration files from v3.x work without modification
|
||||||
|
- No changes to `/etc/nupst/config.json` format
|
||||||
|
- All SNMP settings, thresholds, and group configurations preserved
|
||||||
|
|
||||||
|
**Command Mapping:**
|
||||||
|
|
||||||
|
```bash
|
||||||
|
# Old (v3.x) → New (v4.0)
|
||||||
|
nupst enable → nupst service enable
|
||||||
|
nupst disable → nupst service disable
|
||||||
|
nupst start → nupst service start
|
||||||
|
nupst stop → nupst service stop
|
||||||
|
nupst status → nupst service status
|
||||||
|
nupst logs → nupst service logs
|
||||||
|
nupst add → nupst ups add
|
||||||
|
nupst edit [id] → nupst ups edit [id]
|
||||||
|
nupst delete <id> → nupst ups remove <id>
|
||||||
|
nupst list → nupst ups list
|
||||||
|
nupst test → nupst ups test
|
||||||
|
nupst group add → nupst group add (unchanged)
|
||||||
|
nupst group edit <id> → nupst group edit <id> (unchanged)
|
||||||
|
nupst group delete <id> → nupst group remove <id>
|
||||||
|
nupst group list → nupst group list (unchanged)
|
||||||
|
nupst config → nupst config show
|
||||||
|
```
|
||||||
|
|
||||||
|
### Technical Details
|
||||||
|
|
||||||
|
**Commit History:**
|
||||||
|
|
||||||
|
- `df6a44d`: Complete migration with Gitea Actions workflows and install.sh updates
|
||||||
|
- `9efcc4b`: CLI reorganization with subcommand structure
|
||||||
|
- `5903ae7`: Cross-platform compilation scripts
|
||||||
|
- `a649c59`: Deno migration with npm: and node: specifiers
|
||||||
|
- `5f4f3ec`: Initial migration to Deno
|
||||||
|
|
||||||
|
**Files Changed:**
|
||||||
|
|
||||||
|
- Removed: 11 files (package.json, tsconfig.json, pnpm-lock.yaml, npmextra.json, bin/nupst,
|
||||||
|
setup.sh)
|
||||||
|
- Added: 3 Gitea Actions workflows (ci.yml, release.yml, README.md)
|
||||||
|
- Modified: 14 TypeScript files for Deno compatibility
|
||||||
|
- Updated: install.sh, .gitignore, readme.md
|
||||||
|
- Net reduction: -10,242 lines (93% reduction in repository size)
|
||||||
|
|
||||||
|
**Dependencies:**
|
||||||
|
|
||||||
|
- Runtime: Deno v1.x (bundled in binary, no installation required)
|
||||||
|
- SNMP: npm:net-snmp@3.20.0 (bundled in binary via npm: specifier)
|
||||||
|
- Node.js built-ins: Accessed via node: specifier (node:fs, node:child_process, etc.)
|
||||||
|
|
||||||
|
### Benefits
|
||||||
|
|
||||||
|
**For Users:**
|
||||||
|
|
||||||
|
- **Faster Installation**: Download single binary instead of cloning repo + installing Node.js + npm
|
||||||
|
dependencies
|
||||||
|
- **Zero Dependencies**: No Node.js or npm required on target system
|
||||||
|
- **Smaller Footprint**: Single binary vs repo + Node.js + node_modules
|
||||||
|
- **Easier Updates**: Download new binary instead of git pull + npm install
|
||||||
|
- **Better Security**: No npm supply chain risks, binary checksums provided
|
||||||
|
- **Platform Support**: Official binaries for all major platforms
|
||||||
|
|
||||||
|
**For Developers:**
|
||||||
|
|
||||||
|
- **Modern Tooling**: Native TypeScript support without build configuration
|
||||||
|
- **Faster Development**: No compilation step during development
|
||||||
|
- **CI/CD Automation**: Automated releases and testing
|
||||||
|
- **Cleaner Codebase**: 93% reduction in configuration files
|
||||||
|
- **Cross-Platform**: Compile for all platforms from any platform
|
||||||
|
|
||||||
|
### Known Issues
|
||||||
|
|
||||||
|
- Windows ARM64 not supported (Deno limitation)
|
||||||
|
- Binary sizes are larger (~340MB) due to bundled runtime (trade-off for zero dependencies)
|
||||||
|
- First-time execution may be slower on some systems (binary extraction)
|
||||||
|
|
||||||
|
### Acknowledgments
|
||||||
|
|
||||||
|
This release represents a complete modernization of NUPST's infrastructure while maintaining full
|
||||||
|
backward compatibility for user configurations. Special thanks to the Deno team for creating an
|
||||||
|
excellent runtime that made this migration possible.
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## 2025-03-28 - 3.1.2 - fix(cli/ups-handler)
|
||||||
|
|
||||||
|
Improve UPS device listing table formatting for better column alignment
|
||||||
|
|
||||||
|
- Adjusted header spacing for the Host column and overall table alignment in the UPS handler output.
|
||||||
|
|
||||||
|
## 2025-03-28 - 3.1.1 - fix(cli)
|
||||||
|
|
||||||
|
Improve table header formatting in group and UPS listings
|
||||||
|
|
||||||
|
- Adjusted column padding in group listing for proper alignment
|
||||||
|
- Fixed UPS table header spacing for consistent CLI output
|
||||||
|
|
||||||
|
## 2025-03-28 - 3.1.0 - feat(cli)
|
||||||
|
|
||||||
|
Refactor CLI commands to use dedicated handlers for UPS, group, and service management
|
||||||
|
|
||||||
|
- Extracted UPS-related CLI logic into a new UpsHandler
|
||||||
|
- Introduced GroupHandler to manage UPS groups commands
|
||||||
|
- Added ServiceHandler for systemd service operations
|
||||||
|
- Updated CLI routing in cli.ts to delegate commands to the new handlers
|
||||||
|
- Exposed getters for the new handlers in the Nupst class
|
||||||
|
|
||||||
|
## 2025-03-28 - 3.0.1 - fix(cli)
|
||||||
|
|
||||||
|
Simplify UPS ID generation by removing the redundant promptForUniqueUpsId function in the CLI module
|
||||||
|
and replacing it with the shortId helper.
|
||||||
|
|
||||||
|
- Deleted the unused promptForUniqueUpsId method from ts/cli.ts.
|
||||||
|
- Updated UPS configuration to generate a unique ID directly using helpers.shortId().
|
||||||
|
- Improved code clarity by removing unnecessary interactive prompts for UPS IDs.
|
||||||
|
|
||||||
|
## 2025-03-28 - 3.0.0 - BREAKING CHANGE(core)
|
||||||
|
|
||||||
|
Add multi-UPS support and group management; update CLI, configuration and documentation to support
|
||||||
|
multiple UPS devices with group modes
|
||||||
|
|
||||||
|
- Implemented multi-UPS configuration with an array of UPS devices and groups in the configuration
|
||||||
|
file
|
||||||
|
- Added group management commands (group add, edit, delete, list) with redundant and non-redundant
|
||||||
|
modes
|
||||||
|
- Revamped CLI command parsing for UPS management (add, edit, delete, list, setup) and group
|
||||||
|
subcommands
|
||||||
|
- Updated readme and documentation to reflect new configuration structure and features
|
||||||
|
- Enhanced logging and status display for multiple UPS devices
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.6.17 - fix(logger)
|
||||||
|
|
||||||
|
Preserve logbox width after logBoxEnd so that subsequent logBoxLine calls continue using the set
|
||||||
|
width.
|
||||||
|
|
||||||
|
- Removed the reset of currentBoxWidth in logBoxEnd to allow persistent width across logbox calls.
|
||||||
|
- Ensures that logBoxLine uses the previously set width when no new width is provided.
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.6.16 - fix(cli)
|
||||||
|
|
||||||
|
Improve CLI logging consistency by replacing direct console output with unified logger calls.
|
||||||
|
|
||||||
|
- Replaced console.log and console.error with logger.log and logger.error in CLI commands
|
||||||
|
- Standardized debug, error, and status messages using logger's logbox utilities
|
||||||
|
- Enhanced consistency of log output throughout the ts/cli.ts file
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.6.15 - fix(logger)
|
||||||
|
|
||||||
|
Replace direct console logging with unified logger interface for consistent formatting
|
||||||
|
|
||||||
|
- Substitute console.log, console.error, and related calls with logger methods in cli, daemon,
|
||||||
|
systemd, nupst, and index modules
|
||||||
|
- Integrate logBox formatting for structured output and consistent log presentation
|
||||||
|
- Update test expectations in test.logger.ts to check for standardized error messages
|
||||||
|
- Refactor logging calls throughout the codebase for improved clarity and maintainability
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.6.14 - fix(systemd)
|
||||||
|
|
||||||
|
Shorten closing log divider in systemd service installation output for consistent formatting.
|
||||||
|
|
||||||
|
- Replaced the overly long footer with a shorter one in ts/systemd.ts.
|
||||||
|
- This change improves log readability without affecting functionality.
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.6.13 - fix(cli)
|
||||||
|
|
||||||
|
Fix CLI update output box formatting
|
||||||
|
|
||||||
|
- Adjusted the closing box line in the update process log messages for consistent visual formatting
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.6.12 - fix(systemd)
|
||||||
|
|
||||||
|
Adjust logging border in systemd service installation output
|
||||||
|
|
||||||
|
- Updated the closing border line for consistent output formatting in ts/systemd.ts
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.6.11 - fix(cli, systemd)
|
||||||
|
|
||||||
|
Adjust log formatting for consistent output in CLI and systemd commands
|
||||||
|
|
||||||
|
- Fixed spacing issues in service installation and status log messages in the systemd module.
|
||||||
|
- Revised output formatting in the CLI to improve message clarity.
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.6.10 - fix(daemon)
|
||||||
|
|
||||||
|
Adjust console log box formatting for consistent output in daemon status messages
|
||||||
|
|
||||||
|
- Updated closing box borders to align properly in configuration error, periodic updates, and UPS
|
||||||
|
status logs
|
||||||
|
- Improved visual consistency in log messages
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.6.9 - fix(cli)
|
||||||
|
|
||||||
|
Improve console output formatting for status banners and logging messages
|
||||||
|
|
||||||
|
- Standardize banner messages in daemon status updates
|
||||||
|
- Refine version information banner in nupst logging
|
||||||
|
- Update UPS connection and status banners in systemd
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.6.8 - fix(cli)
|
||||||
|
|
||||||
|
Improve CLI formatting, refine debug option filtering, and remove unused dgram import in SNMP
|
||||||
|
manager
|
||||||
|
|
||||||
|
- Standardize whitespace and formatting in ts/cli.ts for consistency
|
||||||
|
- Refine argument filtering for debug mode and prompt messages
|
||||||
|
- Remove unused 'dgram' import from ts/snmp/manager.ts
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.6.7 - fix(setup.sh)
|
||||||
|
|
||||||
|
Clarify net-snmp dependency installation message in setup.sh
|
||||||
|
|
||||||
|
- Updated echo statement to indicate installation of net-snmp along with 2 subdependencies
|
||||||
|
- Improves clarity on dependency installation during setup
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.6.6 - fix(setup.sh)
|
||||||
|
|
||||||
|
Improve setup script to detect and execute npm-cli.js directly using the Node.js binary
|
||||||
|
|
||||||
|
- Replace use of the npm binary with direct execution of npm-cli.js
|
||||||
|
- Add fallback logic to locate npm-cli.js when not found at the expected path
|
||||||
|
- Simplify cleanup by removing unnecessary PATH modifications
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.6.5 - fix(daemon, setup)
|
||||||
|
|
||||||
|
Improve shutdown command detection and fallback logic; update setup script to use absolute Node/npm
|
||||||
|
paths
|
||||||
|
|
||||||
|
- Use execFileAsync to execute shutdown commands reliably
|
||||||
|
- Add multiple fallback alternatives for shutdown and emergency shutdown handling
|
||||||
|
- Update setup.sh to log the Node and NPM versions using absolute paths without modifying PATH
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.6.4 - fix(setup)
|
||||||
|
|
||||||
|
Improve installation process in setup script by cleaning up package files and ensuring a minimal
|
||||||
|
net-snmp dependency installation.
|
||||||
|
|
||||||
|
- Remove existing package-lock.json along with node_modules to prevent stale artifacts.
|
||||||
|
- Back up the original package.json before modifying it.
|
||||||
|
- Create a minimal package.json with only the net-snmp dependency based on the backed-up version.
|
||||||
|
- Use a clean install to guarantee that only net-snmp is installed.
|
||||||
|
- Restore the original package.json if the installation fails.
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.6.3 - fix(setup)
|
||||||
|
|
||||||
|
Update setup script to install only net-snmp dependency and create a minimal package-lock.json for
|
||||||
|
better dependency control.
|
||||||
|
|
||||||
|
- Removed full production dependency install in favor of installing only net-snmp@3.20.0
|
||||||
|
- Added verification step to confirm net-snmp installation
|
||||||
|
- Generate a minimal package-lock.json if one does not exist
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.6.2 - fix(setup/readme)
|
||||||
|
|
||||||
|
Improve force update instructions and dependency installation process in setup.sh and readme.md
|
||||||
|
|
||||||
|
- Clarify force update commands with explicit paths in readme.md
|
||||||
|
- Remove existing node_modules before installing dependencies in setup.sh
|
||||||
|
- Switch from 'npm ci --only=production' to 'npm install --omit=dev' with updated error instructions
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.6.1 - fix(setup)
|
||||||
|
|
||||||
|
Update setup.sh to temporarily add vendor Node.js binary to PATH for dependency installation, log
|
||||||
|
Node and npm versions, and restore the original PATH afterwards.
|
||||||
|
|
||||||
|
- Temporarily prepend vendor Node.js binary directory to PATH to ensure proper npm execution.
|
||||||
|
- Log Node.js and npm versions for debugging purposes.
|
||||||
|
- Restore the original PATH after installing dependencies.
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.6.0 - feat(setup)
|
||||||
|
|
||||||
|
Add --force update flag to setup script and update installation instructions
|
||||||
|
|
||||||
|
- Implemented --force option in setup.sh to force-update Node.js binary and dependencies
|
||||||
|
- Updated readme.md to document the --force flag and revised update steps
|
||||||
|
- Modified ts/cli.ts update command to pass the --force flag to setup.sh
|
||||||
|
|
||||||
|
## 2025-03-26 - 2.5.2 - fix(installer)
|
||||||
|
|
||||||
|
Improve Node.js binary detection, dependency management, and SNMPv3 fallback logic
|
||||||
|
|
||||||
|
- Enhanced bin/nupst to detect OS and architecture (Linux and Darwin) and fall back to system
|
||||||
|
Node.js for unsupported platforms
|
||||||
|
- Moved net-snmp from devDependencies to dependencies in package.json
|
||||||
|
- Updated setup.sh to install production dependencies and handle installation errors gracefully
|
||||||
|
- Refined SNMPv3 user configuration and fallback mechanism in ts/snmp/manager.ts
|
||||||
|
- Revised README to clarify minimal runtime dependencies and secure SNMP features
|
||||||
|
|
||||||
|
## 2025-03-25 - 2.5.1 - fix(snmp)
|
||||||
|
|
||||||
|
Fix Eaton UPS support by updating power status OID and adjusting battery runtime conversion.
|
||||||
|
|
||||||
|
- Updated Eaton UPS power status OID to '1.3.6.1.4.1.534.1.4.4.0' to correctly detect online/battery
|
||||||
|
status.
|
||||||
|
- Added conversion for Eaton UPS battery runtime from seconds to minutes in SNMP manager.
|
||||||
|
|
||||||
|
## 2025-03-25 - 2.5.0 - feat(cli)
|
||||||
|
|
||||||
|
Automatically restart running NUPST service after configuration changes in interactive setup
|
||||||
|
|
||||||
|
- Added restartServiceIfRunning() to check and restart the service if it's active.
|
||||||
|
- Invoked the restart function post-setup to apply configuration changes immediately.
|
||||||
|
|
||||||
|
## 2025-03-25 - 2.4.8 - fix(installer)
|
||||||
|
|
||||||
|
Improve Git dependency handling and repository cloning in install.sh
|
||||||
|
|
||||||
|
- Add explicit check for git installation and prompt the user interactively if git is missing.
|
||||||
|
- Auto-install git when '-y' flag is provided in non-interactive mode.
|
||||||
|
- Ensure proper cloning of the repository when running the installer outside the repo.
|
||||||
|
|
||||||
|
## 2025-03-25 - 2.4.7 - fix(readme)
|
||||||
|
|
||||||
|
Update installation instructions to combine download and execution into a single command for clarity
|
||||||
|
|
||||||
|
- Method 1 now uses a unified one-line command to download and run the install script
|
||||||
|
|
||||||
|
## 2025-03-25 - 2.4.6 - fix(installer)
|
||||||
|
|
||||||
|
Improve installation instructions for interactive and non-interactive setups
|
||||||
|
|
||||||
|
- Changed install.sh to require explicit download of the install script and updated error messages
|
||||||
|
for non-interactive modes
|
||||||
|
- Updated readme.md to include three distinct installation methods with clear command examples
|
||||||
|
|
||||||
|
## 2025-03-25 - 2.4.5 - fix(install)
|
||||||
|
|
||||||
|
Improve interactive terminal detection and update installation instructions
|
||||||
|
|
||||||
|
- Enhanced install.sh to better detect non-interactive environments and provide clearer guidance for
|
||||||
|
both interactive and non-interactive installations
|
||||||
|
- Updated README.md quick install instructions to recommend process substitution and clarify
|
||||||
|
auto-yes usage
|
||||||
|
|
||||||
|
## 2025-03-25 - 2.4.4 - fix(install)
|
||||||
|
|
||||||
|
Improve interactive mode detection and non-interactive installation handling in install.sh
|
||||||
|
|
||||||
|
- Detect and warn when running without a controlling terminal
|
||||||
|
- Attempt to use /dev/tty for user input when possible
|
||||||
|
- Update prompts and error messages for auto-installation of dependencies
|
||||||
|
- Clarify installation instructions in readme for interactive and non-interactive modes
|
||||||
|
|
||||||
|
## 2025-03-25 - 2.4.3 - fix(readme)
|
||||||
|
|
||||||
|
Update Quick Install command syntax in readme for auto-yes installation
|
||||||
|
|
||||||
|
- Changed installation command to use: curl -sSL
|
||||||
|
https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -c "bash -s --
|
||||||
|
-y"
|
||||||
|
|
||||||
|
## 2025-03-25 - 2.4.2 - fix(daemon)
|
||||||
|
|
||||||
|
Refactor shutdown initiation logic in daemon by moving the initiateShutdown and
|
||||||
|
monitorDuringShutdown methods from the SNMP manager to the daemon, and update calls accordingly
|
||||||
|
|
||||||
|
- Moved initiateShutdown and monitorDuringShutdown to the daemon class for improved cohesion
|
||||||
|
- Updated references in the daemon to call its own shutdown method instead of the SNMP manager
|
||||||
|
- Removed redundant initiateShutdown method from the SNMP manager
|
||||||
|
|
||||||
|
## 2025-03-25 - 2.4.1 - fix(docs)
|
||||||
|
|
||||||
|
Update readme with detailed legal and trademark guidance
|
||||||
|
|
||||||
|
- Clarified legal section by adding trademark and company information
|
||||||
|
- Ensured users understand that licensing terms do not imply endorsement by the company
|
||||||
|
|
||||||
|
## 2025-03-25 - 2.4.0 - feat(installer)
|
||||||
|
|
||||||
|
Add auto-yes flag to installer and update installation documentation
|
||||||
|
|
||||||
|
- Enhance install.sh to parse -y/--yes and -h/--help options, automating git installation when
|
||||||
|
auto-yes is provided
|
||||||
|
- Improve user prompts for dependency installation and provide clearer instructions
|
||||||
|
- Update readme.md to document new installer options and enhanced file system and service changes
|
||||||
|
details
|
||||||
|
|
||||||
|
## 2025-03-25 - 2.3.0 - feat(installer/cli)
|
||||||
|
|
||||||
|
Add OS detection and git auto-installation support to install.sh and improve service setup prompt in
|
||||||
|
CLI
|
||||||
|
|
||||||
|
- Implemented helper functions in install.sh to detect OS type and automatically install git if
|
||||||
|
missing
|
||||||
|
- Prompt user for git installation if not present before cloning the repository
|
||||||
|
- Enhanced CLI service setup flow to offer starting the NUPST service immediately after installation
|
||||||
|
|
||||||
|
## 2025-03-25 - 2.2.0 - feat(cli)
|
||||||
|
|
||||||
|
Add 'config' command to display current configuration and update CLI help
|
||||||
|
|
||||||
|
- Introduce new 'config' command to show SNMP settings, thresholds, and configuration file location
|
||||||
|
- Update help text to include details for 'nupst config' command
|
||||||
|
|
||||||
## 2025-03-25 - 2.1.0 - feat(cli)
|
## 2025-03-25 - 2.1.0 - feat(cli)
|
||||||
|
|
||||||
Add uninstall command to CLI and update shutdown delay for graceful VM shutdown
|
Add uninstall command to CLI and update shutdown delay for graceful VM shutdown
|
||||||
|
|
||||||
- Implement uninstall command in ts/cli.ts that locates and executes uninstall.sh with user prompts
|
- Implement uninstall command in ts/cli.ts that locates and executes uninstall.sh with user prompts
|
||||||
- Update uninstall.sh to support environment variables for configuration and repository removal
|
- Update uninstall.sh to support environment variables for configuration and repository removal
|
||||||
- Increase shutdown delay in ts/snmp/manager.ts from 1 minute to 5 minutes to allow VMs more time to shut down
|
- Increase shutdown delay in ts/snmp/manager.ts from 1 minute to 5 minutes to allow VMs more time to
|
||||||
|
shut down
|
||||||
|
|
||||||
## 2025-03-25 - 2.0.1 - fix(cli/systemd)
|
## 2025-03-25 - 2.0.1 - fix(cli/systemd)
|
||||||
|
|
||||||
Fix status command to pass debug flag and improve systemd status logging output
|
Fix status command to pass debug flag and improve systemd status logging output
|
||||||
|
|
||||||
- ts/cli.ts: Now extracts debug options from process arguments and passes debug mode to getStatus.
|
- ts/cli.ts: Now extracts debug options from process arguments and passes debug mode to getStatus.
|
||||||
- ts/systemd.ts: Updated getStatus to accept a debugMode parameter, enabling detailed SNMP debug logging, explicitly reloading configuration, and printing connection details.
|
- ts/systemd.ts: Updated getStatus to accept a debugMode parameter, enabling detailed SNMP debug
|
||||||
|
logging, explicitly reloading configuration, and printing connection details.
|
||||||
|
|
||||||
## 2025-03-25 - 2.0.0 - BREAKING CHANGE(snmp)
|
## 2025-03-25 - 2.0.0 - BREAKING CHANGE(snmp)
|
||||||
|
|
||||||
refactor: update SNMP type definitions and interface names for consistency
|
refactor: update SNMP type definitions and interface names for consistency
|
||||||
|
|
||||||
- Renamed SnmpConfig to ISnmpConfig, OIDSet to IOidSet, UpsStatus to IUpsStatus, and UpsModel to TUpsModel in ts/snmp/types.ts.
|
- Renamed SnmpConfig to ISnmpConfig, OIDSet to IOidSet, UpsStatus to IUpsStatus, and UpsModel to
|
||||||
- Updated internal references in ts/daemon.ts, ts/snmp/index.ts, ts/snmp/manager.ts, ts/snmp/oid-sets.ts, ts/snmp/packet-creator.ts, and ts/snmp/packet-parser.ts to use the new interface names.
|
TUpsModel in ts/snmp/types.ts.
|
||||||
|
- Updated internal references in ts/daemon.ts, ts/snmp/index.ts, ts/snmp/manager.ts,
|
||||||
|
ts/snmp/oid-sets.ts, ts/snmp/packet-creator.ts, and ts/snmp/packet-parser.ts to use the new
|
||||||
|
interface names.
|
||||||
|
|
||||||
## 2025-03-25 - 1.10.1 - fix(systemd/readme)
|
## 2025-03-25 - 1.10.1 - fix(systemd/readme)
|
||||||
|
|
||||||
Improve README documentation and fix UPS status retrieval in systemd service
|
Improve README documentation and fix UPS status retrieval in systemd service
|
||||||
|
|
||||||
- Updated README features and installation instructions to clarify SNMP version support, UPS models, and configuration
|
- Updated README features and installation instructions to clarify SNMP version support, UPS models,
|
||||||
- Modified default SNMP host to '192.168.1.100' and added 'upsModel' property in configuration examples
|
and configuration
|
||||||
|
- Modified default SNMP host to '192.168.1.100' and added 'upsModel' property in configuration
|
||||||
|
examples
|
||||||
- Enhanced instructions for real-time log viewing and update process in README
|
- Enhanced instructions for real-time log viewing and update process in README
|
||||||
- Fixed systemd.ts to use a test configuration with an appropriate timeout when fetching UPS status
|
- Fixed systemd.ts to use a test configuration with an appropriate timeout when fetching UPS status
|
||||||
|
|
||||||
## 2025-03-25 - 1.10.0 - feat(core)
|
## 2025-03-25 - 1.10.0 - feat(core)
|
||||||
|
|
||||||
Add update checking and version logging across startup components
|
Add update checking and version logging across startup components
|
||||||
|
|
||||||
- In daemon.ts, log version info on startup and check for updates in the background using npm registry response
|
- In daemon.ts, log version info on startup and check for updates in the background using npm
|
||||||
- In nupst.ts, implement getVersion, checkForUpdates, getUpdateStatus, and compareVersions functions with update notifications
|
registry response
|
||||||
|
- In nupst.ts, implement getVersion, checkForUpdates, getUpdateStatus, and compareVersions functions
|
||||||
|
with update notifications
|
||||||
- Establish bidirectional reference between Nupst and NupstSnmp to support version logging
|
- Establish bidirectional reference between Nupst and NupstSnmp to support version logging
|
||||||
- Update systemd service status output to include version information
|
- Update systemd service status output to include version information
|
||||||
|
|
||||||
## 2025-03-25 - 1.9.0 - feat(cli)
|
## 2025-03-25 - 1.9.0 - feat(cli)
|
||||||
|
|
||||||
Add update command to CLI to update NUPST from repository and refresh the systemd service
|
Add update command to CLI to update NUPST from repository and refresh the systemd service
|
||||||
|
|
||||||
- Integrate 'update' subcommand in CLI command parser
|
- Integrate 'update' subcommand in CLI command parser
|
||||||
- Update documentation and help output to include new command
|
- Update documentation and help output to include new command
|
||||||
- Implement update process that fetches changes from git, runs install.sh/setup.sh, and refreshes systemd service if installed
|
- Implement update process that fetches changes from git, runs install.sh/setup.sh, and refreshes
|
||||||
|
systemd service if installed
|
||||||
|
|
||||||
## 2025-03-25 - 1.8.2 - fix(cli)
|
## 2025-03-25 - 1.8.2 - fix(cli)
|
||||||
|
|
||||||
Refactor logs command to use child_process spawn for real-time log tailing
|
Refactor logs command to use child_process spawn for real-time log tailing
|
||||||
|
|
||||||
- Replaced execSync call with spawn to properly follow logs
|
- Replaced execSync call with spawn to properly follow logs
|
||||||
@@ -50,12 +739,15 @@ Refactor logs command to use child_process spawn for real-time log tailing
|
|||||||
- Await the child process exit to ensure clean shutdown of the CLI log command
|
- Await the child process exit to ensure clean shutdown of the CLI log command
|
||||||
|
|
||||||
## 2025-03-25 - 1.8.1 - fix(systemd)
|
## 2025-03-25 - 1.8.1 - fix(systemd)
|
||||||
|
|
||||||
Update ExecStart in systemd service template to use /opt/nupst/bin/nupst for daemon startup
|
Update ExecStart in systemd service template to use /opt/nupst/bin/nupst for daemon startup
|
||||||
|
|
||||||
- Changed ExecStart from '/usr/bin/nupst daemon-start' to '/opt/nupst/bin/nupst daemon-start' in the systemd service file
|
- Changed ExecStart from '/usr/bin/nupst daemon-start' to '/opt/nupst/bin/nupst daemon-start' in the
|
||||||
|
systemd service file
|
||||||
- Ensures the service uses the correct binary installation path
|
- Ensures the service uses the correct binary installation path
|
||||||
|
|
||||||
## 2025-03-25 - 1.8.0 - feat(core)
|
## 2025-03-25 - 1.8.0 - feat(core)
|
||||||
|
|
||||||
Enhance SNMP module and interactive CLI setup for UPS shutdown
|
Enhance SNMP module and interactive CLI setup for UPS shutdown
|
||||||
|
|
||||||
- Refactored SNMP packet parsing and encoding utilities for clearer error handling and debugging
|
- Refactored SNMP packet parsing and encoding utilities for clearer error handling and debugging
|
||||||
@@ -64,22 +756,28 @@ Enhance SNMP module and interactive CLI setup for UPS shutdown
|
|||||||
- Expanded test coverage with simulated SNMP responses for various response types
|
- Expanded test coverage with simulated SNMP responses for various response types
|
||||||
|
|
||||||
## 2025-03-25 - 1.7.6 - fix(core)
|
## 2025-03-25 - 1.7.6 - fix(core)
|
||||||
|
|
||||||
Refactor SNMP, systemd, and CLI modules to improve error handling, logging, and code clarity
|
Refactor SNMP, systemd, and CLI modules to improve error handling, logging, and code clarity
|
||||||
|
|
||||||
- Removed unused dependency 'net-snmp' from package.json
|
- Removed unused dependency 'net-snmp' from package.json
|
||||||
- Extracted helper functions for SNMP packet creation and parsing (using SnmpEncoder, SnmpPacketCreator and SnmpPacketParser)
|
- Extracted helper functions for SNMP packet creation and parsing (using SnmpEncoder,
|
||||||
- Improved debug logging and added detailed documentation comments across SNMP, systemd, CLI and daemon modules
|
SnmpPacketCreator and SnmpPacketParser)
|
||||||
|
- Improved debug logging and added detailed documentation comments across SNMP, systemd, CLI and
|
||||||
|
daemon modules
|
||||||
- Refactored systemd service management to extract status display and service disabling logic
|
- Refactored systemd service management to extract status display and service disabling logic
|
||||||
- Updated test suite to use proper modular methods from the new SNMP utilities
|
- Updated test suite to use proper modular methods from the new SNMP utilities
|
||||||
|
|
||||||
## 2025-03-25 - 1.7.5 - fix(cli)
|
## 2025-03-25 - 1.7.5 - fix(cli)
|
||||||
Enable SNMP debug mode in CLI commands and update debug flag handling in daemon-start and test; bump version to 1.7.4
|
|
||||||
|
Enable SNMP debug mode in CLI commands and update debug flag handling in daemon-start and test; bump
|
||||||
|
version to 1.7.4
|
||||||
|
|
||||||
- Call enableDebug() on SNMP client earlier in command parsing
|
- Call enableDebug() on SNMP client earlier in command parsing
|
||||||
- Pass debug flag to 'daemon-start' and 'test' commands for consistent debug output
|
- Pass debug flag to 'daemon-start' and 'test' commands for consistent debug output
|
||||||
- Update package version from 1.7.3 to 1.7.4
|
- Update package version from 1.7.3 to 1.7.4
|
||||||
|
|
||||||
## 2025-03-25 - 1.7.3 - fix(SNMP)
|
## 2025-03-25 - 1.7.3 - fix(SNMP)
|
||||||
|
|
||||||
Refine SNMP packet creation and response parsing for more reliable UPS status monitoring
|
Refine SNMP packet creation and response parsing for more reliable UPS status monitoring
|
||||||
|
|
||||||
- Improve error handling and fallback logic when parsing SNMP responses
|
- Improve error handling and fallback logic when parsing SNMP responses
|
||||||
@@ -87,13 +785,16 @@ Refine SNMP packet creation and response parsing for more reliable UPS status mo
|
|||||||
- Enhance test coverage for various UPS scenarios
|
- Enhance test coverage for various UPS scenarios
|
||||||
|
|
||||||
## 2025-03-25 - 1.7.2 - fix(core)
|
## 2025-03-25 - 1.7.2 - fix(core)
|
||||||
Refactor internal SNMP response parsing and enhance daemon logging for improved error reporting and clarity.
|
|
||||||
|
Refactor internal SNMP response parsing and enhance daemon logging for improved error reporting and
|
||||||
|
clarity.
|
||||||
|
|
||||||
- Improved fallback and error handling in SNMP response parsing
|
- Improved fallback and error handling in SNMP response parsing
|
||||||
- Enhanced logging messages in daemon and systemd service management
|
- Enhanced logging messages in daemon and systemd service management
|
||||||
- Minor refactoring for better maintainability without functional changes
|
- Minor refactoring for better maintainability without functional changes
|
||||||
|
|
||||||
## 2025-03-25 - 1.7.1 - fix(snmp-cli)
|
## 2025-03-25 - 1.7.1 - fix(snmp-cli)
|
||||||
|
|
||||||
Improve SNMP response parsing and CLI UPS connection timeout handling
|
Improve SNMP response parsing and CLI UPS connection timeout handling
|
||||||
|
|
||||||
- Expand parsing loop in SNMP responses to capture Gauge32 and Timeticks values
|
- Expand parsing loop in SNMP responses to capture Gauge32 and Timeticks values
|
||||||
@@ -101,14 +802,17 @@ Improve SNMP response parsing and CLI UPS connection timeout handling
|
|||||||
- Configure CLI test commands to use a shortened timeout for UPS connection tests
|
- Configure CLI test commands to use a shortened timeout for UPS connection tests
|
||||||
|
|
||||||
## 2025-03-25 - 1.7.0 - feat(SNMP/UPS)
|
## 2025-03-25 - 1.7.0 - feat(SNMP/UPS)
|
||||||
|
|
||||||
Add UPS model selection and custom OIDs support to handle different UPS brands
|
Add UPS model selection and custom OIDs support to handle different UPS brands
|
||||||
|
|
||||||
- Introduce distinct OID sets for CyberPower, APC, Eaton, TrippLite, Liebert, and a custom option
|
- Introduce distinct OID sets for CyberPower, APC, Eaton, TrippLite, Liebert, and a custom option
|
||||||
- Update interactive setup to prompt for UPS model selection and custom OID entry when needed
|
- Update interactive setup to prompt for UPS model selection and custom OID entry when needed
|
||||||
- Refactor SNMP status retrieval to dynamically select the appropriate OIDs based on the configured UPS model
|
- Refactor SNMP status retrieval to dynamically select the appropriate OIDs based on the configured
|
||||||
|
UPS model
|
||||||
- Extend default configuration with an upsModel property for consistent behavior
|
- Extend default configuration with an upsModel property for consistent behavior
|
||||||
|
|
||||||
## 2025-03-25 - 1.6.0 - feat(cli,snmp)
|
## 2025-03-25 - 1.6.0 - feat(cli,snmp)
|
||||||
|
|
||||||
Enhance debug logging and add debug mode support in CLI and SNMP modules
|
Enhance debug logging and add debug mode support in CLI and SNMP modules
|
||||||
|
|
||||||
- Enable debug flags (--debug, -d) in CLI to trigger detailed SNMP logging
|
- Enable debug flags (--debug, -d) in CLI to trigger detailed SNMP logging
|
||||||
@@ -117,6 +821,7 @@ Enhance debug logging and add debug mode support in CLI and SNMP modules
|
|||||||
- Improve timeout and discovery logging details for streamlined troubleshooting
|
- Improve timeout and discovery logging details for streamlined troubleshooting
|
||||||
|
|
||||||
## 2025-03-25 - 1.5.0 - feat(cli)
|
## 2025-03-25 - 1.5.0 - feat(cli)
|
||||||
|
|
||||||
Enhance CLI output: display SNMPv3 auth/priv details and support timeout customization during setup
|
Enhance CLI output: display SNMPv3 auth/priv details and support timeout customization during setup
|
||||||
|
|
||||||
- Display authentication and privacy protocol details when SNMP version is 3
|
- Display authentication and privacy protocol details when SNMP version is 3
|
||||||
@@ -125,10 +830,11 @@ Enhance CLI output: display SNMPv3 auth/priv details and support timeout customi
|
|||||||
- Allow users to customize SNMP timeout during interactive setup
|
- Allow users to customize SNMP timeout during interactive setup
|
||||||
|
|
||||||
## 2025-03-25 - 1.4.1 - fix(version)
|
## 2025-03-25 - 1.4.1 - fix(version)
|
||||||
|
|
||||||
Bump patch version for consistency with commit info
|
Bump patch version for consistency with commit info
|
||||||
|
|
||||||
|
|
||||||
## 2025-03-25 - 1.4.0 - feat(snmp)
|
## 2025-03-25 - 1.4.0 - feat(snmp)
|
||||||
|
|
||||||
Implement native SNMPv3 support with simulated encryption and enhanced authentication handling.
|
Implement native SNMPv3 support with simulated encryption and enhanced authentication handling.
|
||||||
|
|
||||||
- Add fully native SNMPv3 GET request implementation replacing the snmpwalk fallback
|
- Add fully native SNMPv3 GET request implementation replacing the snmpwalk fallback
|
||||||
@@ -137,12 +843,14 @@ Implement native SNMPv3 support with simulated encryption and enhanced authentic
|
|||||||
- Introduce detailed security parameter management for SNMPv3
|
- Introduce detailed security parameter management for SNMPv3
|
||||||
|
|
||||||
## 2025-03-25 - 1.3.1 - fix(cli)
|
## 2025-03-25 - 1.3.1 - fix(cli)
|
||||||
|
|
||||||
Remove redundant SNMP tools checks in CLI and Systemd modules
|
Remove redundant SNMP tools checks in CLI and Systemd modules
|
||||||
|
|
||||||
- Eliminate unnecessary snmpwalk dependency checks in the test command and interactive setup flow.
|
- Eliminate unnecessary snmpwalk dependency checks in the test command and interactive setup flow.
|
||||||
- Adjust systemd configuration file check to avoid external dependency verification.
|
- Adjust systemd configuration file check to avoid external dependency verification.
|
||||||
|
|
||||||
## 2025-03-25 - 1.3.0 - feat(cli)
|
## 2025-03-25 - 1.3.0 - feat(cli)
|
||||||
|
|
||||||
add test command to verify UPS SNMP configuration and connectivity
|
add test command to verify UPS SNMP configuration and connectivity
|
||||||
|
|
||||||
- Introduce a new 'test' command in the CLI to check the SNMP configuration and UPS connection.
|
- Introduce a new 'test' command in the CLI to check the SNMP configuration and UPS connection.
|
||||||
@@ -150,6 +858,7 @@ add test command to verify UPS SNMP configuration and connectivity
|
|||||||
- Output UPS status details and compare against defined shutdown thresholds.
|
- Output UPS status details and compare against defined shutdown thresholds.
|
||||||
|
|
||||||
## 2025-03-25 - 1.2.6 - fix(cli)
|
## 2025-03-25 - 1.2.6 - fix(cli)
|
||||||
|
|
||||||
Refactor interactive setup to use dynamic import for readline and ensure proper cleanup
|
Refactor interactive setup to use dynamic import for readline and ensure proper cleanup
|
||||||
|
|
||||||
- Replaced synchronous require() with async import for ESM compatibility
|
- Replaced synchronous require() with async import for ESM compatibility
|
||||||
@@ -157,13 +866,16 @@ Refactor interactive setup to use dynamic import for readline and ensure proper
|
|||||||
- Enhanced error logging by outputting error.message
|
- Enhanced error logging by outputting error.message
|
||||||
|
|
||||||
## 2025-03-25 - 1.2.5 - fix(error-handling)
|
## 2025-03-25 - 1.2.5 - fix(error-handling)
|
||||||
Improve error handling in CLI, daemon, and systemd lifecycle management with enhanced logging for configuration issues
|
|
||||||
|
Improve error handling in CLI, daemon, and systemd lifecycle management with enhanced logging for
|
||||||
|
configuration issues
|
||||||
|
|
||||||
- Wrap daemon and service start commands in try-catch blocks to properly handle and log errors
|
- Wrap daemon and service start commands in try-catch blocks to properly handle and log errors
|
||||||
- Throw explicit errors when configuration file is missing instead of silently defaulting
|
- Throw explicit errors when configuration file is missing instead of silently defaulting
|
||||||
- Enhance log messages for service installation, startup, and status retrieval for clearer debugging
|
- Enhance log messages for service installation, startup, and status retrieval for clearer debugging
|
||||||
|
|
||||||
## 2025-03-25 - 1.2.4 - fix(cli/daemon)
|
## 2025-03-25 - 1.2.4 - fix(cli/daemon)
|
||||||
|
|
||||||
Improve logging and user feedback in interactive setup and UPS monitoring
|
Improve logging and user feedback in interactive setup and UPS monitoring
|
||||||
|
|
||||||
- Refactor configuration summary output in the interactive setup for clearer display
|
- Refactor configuration summary output in the interactive setup for clearer display
|
||||||
@@ -171,17 +883,20 @@ Improve logging and user feedback in interactive setup and UPS monitoring
|
|||||||
- Improve error messages and user guidance during configuration and monitoring
|
- Improve error messages and user guidance during configuration and monitoring
|
||||||
|
|
||||||
## 2025-03-24 - 1.2.3 - fix(nupst)
|
## 2025-03-24 - 1.2.3 - fix(nupst)
|
||||||
|
|
||||||
No changes
|
No changes
|
||||||
|
|
||||||
|
|
||||||
## 2025-03-24 - 1.2.2 - fix(bin/nupst)
|
## 2025-03-24 - 1.2.2 - fix(bin/nupst)
|
||||||
Improve symlink resolution in launcher script to correctly determine project root based on execution path.
|
|
||||||
|
Improve symlink resolution in launcher script to correctly determine project root based on execution
|
||||||
|
path.
|
||||||
|
|
||||||
- Replace directory determination with readlink for accurate symlink resolution
|
- Replace directory determination with readlink for accurate symlink resolution
|
||||||
- Set project root to '/opt/nupst' when script is run via symlink from /usr/local/bin
|
- Set project root to '/opt/nupst' when script is run via symlink from /usr/local/bin
|
||||||
- Add debugging comments to assist with path resolution
|
- Add debugging comments to assist with path resolution
|
||||||
|
|
||||||
## 2025-03-24 - 1.2.1 - fix(bin)
|
## 2025-03-24 - 1.2.1 - fix(bin)
|
||||||
|
|
||||||
Simplify Node.js binary detection in installation script
|
Simplify Node.js binary detection in installation script
|
||||||
|
|
||||||
- Directly set Node binary path to vendor/node-linux-x64/bin/node
|
- Directly set Node binary path to vendor/node-linux-x64/bin/node
|
||||||
@@ -189,59 +904,78 @@ Simplify Node.js binary detection in installation script
|
|||||||
- Fallback to system Node if vendor binary is not found
|
- Fallback to system Node if vendor binary is not found
|
||||||
|
|
||||||
## 2025-03-24 - 1.2.0 - feat(installer)
|
## 2025-03-24 - 1.2.0 - feat(installer)
|
||||||
|
|
||||||
Improve Node.js binary detection and dynamic LTS version retrieval in setup scripts
|
Improve Node.js binary detection and dynamic LTS version retrieval in setup scripts
|
||||||
|
|
||||||
- Enhanced bin/nupst to search multiple possible locations for the Node.js binary and fallback to system node if necessary
|
- Enhanced bin/nupst to search multiple possible locations for the Node.js binary and fallback to
|
||||||
- Updated setup.sh to fetch the latest LTS Node.js version from nodejs.org and use a fallback version when the request fails
|
system node if necessary
|
||||||
|
- Updated setup.sh to fetch the latest LTS Node.js version from nodejs.org and use a fallback
|
||||||
|
version when the request fails
|
||||||
|
|
||||||
## 2025-03-24 - 1.1.2 - fix(setup.sh)
|
## 2025-03-24 - 1.1.2 - fix(setup.sh)
|
||||||
Improve error handling in setup.sh: exit immediately when the downloaded npm package lacks the dist_ts directory, removing the fallback build-from-source mechanism.
|
|
||||||
|
Improve error handling in setup.sh: exit immediately when the downloaded npm package lacks the
|
||||||
|
dist_ts directory, removing the fallback build-from-source mechanism.
|
||||||
|
|
||||||
- Removed BUILD_FROM_SOURCE logic that attempted to build from source on missing dist_ts directory
|
- Removed BUILD_FROM_SOURCE logic that attempted to build from source on missing dist_ts directory
|
||||||
- Updated error messages to clearly indicate failure in downloading a valid package
|
- Updated error messages to clearly indicate failure in downloading a valid package
|
||||||
- Ensured installation halts if essential files are missing
|
- Ensured installation halts if essential files are missing
|
||||||
|
|
||||||
## 2025-03-24 - 1.1.1 - fix(package.json)
|
## 2025-03-24 - 1.1.1 - fix(package.json)
|
||||||
|
|
||||||
Remove unused prepublishOnly script and update files field in package.json
|
Remove unused prepublishOnly script and update files field in package.json
|
||||||
|
|
||||||
- Removed prepublishOnly build trigger
|
- Removed prepublishOnly build trigger
|
||||||
- Updated files list to accurately include intended directories and files
|
- Updated files list to accurately include intended directories and files
|
||||||
|
|
||||||
## 2025-03-24 - 1.1.0 - feat(installer-setup)
|
## 2025-03-24 - 1.1.0 - feat(installer-setup)
|
||||||
|
|
||||||
Enhance installer and setup scripts for improved global installation and artifact management
|
Enhance installer and setup scripts for improved global installation and artifact management
|
||||||
|
|
||||||
- Detect piped installation in install.sh, clone repository automatically, and clean up previous installations
|
- Detect piped installation in install.sh, clone repository automatically, and clean up previous
|
||||||
|
installations
|
||||||
- Update readme.md with correct repository URL and clearer installation instructions
|
- Update readme.md with correct repository URL and clearer installation instructions
|
||||||
- Improve setup.sh to remove existing dist_ts, download build artifacts from the npm registry, and simplify dependency installation
|
- Improve setup.sh to remove existing dist_ts, download build artifacts from the npm registry, and
|
||||||
|
simplify dependency installation
|
||||||
|
|
||||||
## 2025-03-24 - 1.0.1 - fix(version)
|
## 2025-03-24 - 1.0.1 - fix(version)
|
||||||
|
|
||||||
Bump version to 1.0.1
|
Bump version to 1.0.1
|
||||||
|
|
||||||
- Updated commitinfo data to reflect the new patch version.
|
- Updated commitinfo data to reflect the new patch version.
|
||||||
- Synchronized version information between commitinfo file and package metadata.
|
- Synchronized version information between commitinfo file and package metadata.
|
||||||
|
|
||||||
## 2025-03-24 - 1.0.1 - fix(build)
|
## 2025-03-24 - 1.0.1 - fix(build)
|
||||||
Update build script to use 'tsbuild tsfolders --allowimplicitany' and adjust distribution paths in .gitignore
|
|
||||||
|
Update build script to use 'tsbuild tsfolders --allowimplicitany' and adjust distribution paths in
|
||||||
|
.gitignore
|
||||||
|
|
||||||
- Replaced 'tsc' with 'tsbuild tsfolders --allowimplicitany' in package.json
|
- Replaced 'tsc' with 'tsbuild tsfolders --allowimplicitany' in package.json
|
||||||
- Updated .gitignore to reflect new compiled distribution folder pattern
|
- Updated .gitignore to reflect new compiled distribution folder pattern
|
||||||
- Updated changelog to document build improvements and regenerated type definitions
|
- Updated changelog to document build improvements and regenerated type definitions
|
||||||
|
|
||||||
## 2025-03-24 - 1.0.1 - fix(build)
|
## 2025-03-24 - 1.0.1 - fix(build)
|
||||||
Update build script to use 'tsbuild tsfolders --allowimplicitany' and regenerate distribution type definitions for CLI, daemon, index, nupst, snmp, and systemd modules
|
|
||||||
|
Update build script to use 'tsbuild tsfolders --allowimplicitany' and regenerate distribution type
|
||||||
|
definitions for CLI, daemon, index, nupst, snmp, and systemd modules
|
||||||
|
|
||||||
- Replaced 'tsc' command with tsbuild in package.json
|
- Replaced 'tsc' command with tsbuild in package.json
|
||||||
- Updated .gitignore to reflect new compiled distribution folder pattern
|
- Updated .gitignore to reflect new compiled distribution folder pattern
|
||||||
- Added new dist_ts files including .d.ts type definitions and compiled JavaScript for multiple modules
|
- Added new dist_ts files including .d.ts type definitions and compiled JavaScript for multiple
|
||||||
|
modules
|
||||||
|
|
||||||
## 2025-03-24 - 1.0.1 - fix(build)
|
## 2025-03-24 - 1.0.1 - fix(build)
|
||||||
Update build script to use 'tsbuild tsfolders --allowimplicitany' and regenerate distribution type definitions for CLI, daemon, nupst, snmp, and systemd modules.
|
|
||||||
|
Update build script to use 'tsbuild tsfolders --allowimplicitany' and regenerate distribution type
|
||||||
|
definitions for CLI, daemon, nupst, snmp, and systemd modules.
|
||||||
|
|
||||||
- Replaced the 'tsc' command with 'tsbuild tsfolders --allowimplicitany' in package.json.
|
- Replaced the 'tsc' command with 'tsbuild tsfolders --allowimplicitany' in package.json.
|
||||||
- Added new dist_ts files including type definitions (d.ts) and compiled JavaScript for CLI, daemon, index, nupst, snmp, and systemd.
|
- Added new dist_ts files including type definitions (d.ts) and compiled JavaScript for CLI, daemon,
|
||||||
|
index, nupst, snmp, and systemd.
|
||||||
- Improved the generated CLI declarations and overall distribution build.
|
- Improved the generated CLI declarations and overall distribution build.
|
||||||
|
|
||||||
## 2025-03-23 - 1.0.0 - initial setup
|
## 2025-03-23 - 1.0.0 - initial setup
|
||||||
|
|
||||||
This range covers the early commits that mainly established the repository structure.
|
This range covers the early commits that mainly established the repository structure.
|
||||||
|
|
||||||
- Initial repository commit with basic project initialization.
|
- Initial repository commit with basic project initialization.
|
||||||
@@ -0,0 +1,40 @@
|
|||||||
|
{
|
||||||
|
"name": "@serve.zone/nupst",
|
||||||
|
"version": "5.5.1",
|
||||||
|
"exports": "./mod.ts",
|
||||||
|
"nodeModulesDir": "auto",
|
||||||
|
"tasks": {
|
||||||
|
"dev": "deno run --allow-all mod.ts",
|
||||||
|
"compile": "tsdeno compile",
|
||||||
|
"test": "deno test --allow-all test/",
|
||||||
|
"test:watch": "deno test --allow-all --watch test/",
|
||||||
|
"check": "deno check mod.ts",
|
||||||
|
"fmt": "deno fmt",
|
||||||
|
"lint": "deno lint"
|
||||||
|
},
|
||||||
|
"lint": {
|
||||||
|
"rules": {
|
||||||
|
"tags": [
|
||||||
|
"recommended"
|
||||||
|
]
|
||||||
|
}
|
||||||
|
},
|
||||||
|
"fmt": {
|
||||||
|
"useTabs": false,
|
||||||
|
"lineWidth": 100,
|
||||||
|
"indentWidth": 2,
|
||||||
|
"semiColons": true,
|
||||||
|
"singleQuote": true
|
||||||
|
},
|
||||||
|
"compilerOptions": {
|
||||||
|
"lib": [
|
||||||
|
"deno.window"
|
||||||
|
],
|
||||||
|
"strict": true
|
||||||
|
},
|
||||||
|
"imports": {
|
||||||
|
"@std/cli": "jsr:@std/cli@^1.0.0",
|
||||||
|
"@std/fmt": "jsr:@std/fmt@^1.0.0",
|
||||||
|
"@std/path": "jsr:@std/path@^1.0.0"
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,122 @@
|
|||||||
|
#!/bin/bash
|
||||||
|
# NUPST Action Script Example
|
||||||
|
# Copy this to /etc/nupst/ and customize for your needs
|
||||||
|
#
|
||||||
|
# This script is called by NUPST when power events or threshold violations occur.
|
||||||
|
# It receives UPS state information via environment variables and command-line arguments.
|
||||||
|
|
||||||
|
# ==============================================================================
|
||||||
|
# ARGUMENTS (positional parameters)
|
||||||
|
# ==============================================================================
|
||||||
|
# $1 = Power Status (online|onBattery|unknown)
|
||||||
|
# $2 = Battery Capacity (percentage, 0-100)
|
||||||
|
# $3 = Battery Runtime (estimated minutes remaining)
|
||||||
|
|
||||||
|
POWER_STATUS=$1
|
||||||
|
BATTERY_CAPACITY=$2
|
||||||
|
BATTERY_RUNTIME=$3
|
||||||
|
|
||||||
|
# ==============================================================================
|
||||||
|
# ENVIRONMENT VARIABLES
|
||||||
|
# ==============================================================================
|
||||||
|
# NUPST_UPS_ID - Unique UPS identifier
|
||||||
|
# NUPST_UPS_NAME - Human-readable UPS name
|
||||||
|
# NUPST_POWER_STATUS - Current power status
|
||||||
|
# NUPST_BATTERY_CAPACITY - Battery percentage (0-100)
|
||||||
|
# NUPST_BATTERY_RUNTIME - Estimated runtime in minutes
|
||||||
|
# NUPST_THRESHOLDS_EXCEEDED - "true" if below configured thresholds
|
||||||
|
# NUPST_TRIGGER_REASON - "powerStatusChange" or "thresholdViolation"
|
||||||
|
# NUPST_BATTERY_THRESHOLD - Configured battery threshold percentage
|
||||||
|
# NUPST_RUNTIME_THRESHOLD - Configured runtime threshold in minutes
|
||||||
|
# NUPST_TIMESTAMP - Unix timestamp (milliseconds since epoch)
|
||||||
|
|
||||||
|
# ==============================================================================
|
||||||
|
# EXAMPLE: Log the event
|
||||||
|
# ==============================================================================
|
||||||
|
LOG_FILE="/var/log/nupst-actions.log"
|
||||||
|
|
||||||
|
echo "========================================" >> "$LOG_FILE"
|
||||||
|
echo "NUPST Action Triggered: $(date)" >> "$LOG_FILE"
|
||||||
|
echo "----------------------------------------" >> "$LOG_FILE"
|
||||||
|
echo "UPS: $NUPST_UPS_NAME ($NUPST_UPS_ID)" >> "$LOG_FILE"
|
||||||
|
echo "Power Status: $POWER_STATUS" >> "$LOG_FILE"
|
||||||
|
echo "Battery: $BATTERY_CAPACITY%" >> "$LOG_FILE"
|
||||||
|
echo "Runtime: $BATTERY_RUNTIME minutes" >> "$LOG_FILE"
|
||||||
|
echo "Trigger Reason: $NUPST_TRIGGER_REASON" >> "$LOG_FILE"
|
||||||
|
echo "Thresholds Exceeded: $NUPST_THRESHOLDS_EXCEEDED" >> "$LOG_FILE"
|
||||||
|
echo "========================================" >> "$LOG_FILE"
|
||||||
|
|
||||||
|
# ==============================================================================
|
||||||
|
# EXAMPLE: Send email notification
|
||||||
|
# ==============================================================================
|
||||||
|
# if [ "$NUPST_TRIGGER_REASON" = "thresholdViolation" ]; then
|
||||||
|
# echo "ALERT: UPS $NUPST_UPS_NAME battery critical!" | \
|
||||||
|
# mail -s "UPS Battery Critical" admin@example.com
|
||||||
|
# fi
|
||||||
|
|
||||||
|
# ==============================================================================
|
||||||
|
# EXAMPLE: Gracefully shutdown virtual machines
|
||||||
|
# ==============================================================================
|
||||||
|
# if [ "$NUPST_POWER_STATUS" = "onBattery" ] && [ "$NUPST_THRESHOLDS_EXCEEDED" = "true" ]; then
|
||||||
|
# echo "Shutting down VMs..." >> "$LOG_FILE"
|
||||||
|
# # virsh shutdown vm1
|
||||||
|
# # virsh shutdown vm2
|
||||||
|
# # Wait for VMs to shutdown
|
||||||
|
# # sleep 120
|
||||||
|
# fi
|
||||||
|
|
||||||
|
# ==============================================================================
|
||||||
|
# EXAMPLE: Call external API/service
|
||||||
|
# ==============================================================================
|
||||||
|
# curl -X POST https://monitoring.example.com/ups-alert \
|
||||||
|
# -H "Content-Type: application/json" \
|
||||||
|
# -d "{
|
||||||
|
# \"upsId\": \"$NUPST_UPS_ID\",
|
||||||
|
# \"upsName\": \"$NUPST_UPS_NAME\",
|
||||||
|
# \"powerStatus\": \"$POWER_STATUS\",
|
||||||
|
# \"batteryCapacity\": $BATTERY_CAPACITY,
|
||||||
|
# \"batteryRuntime\": $BATTERY_RUNTIME,
|
||||||
|
# \"triggerReason\": \"$NUPST_TRIGGER_REASON\"
|
||||||
|
# }"
|
||||||
|
|
||||||
|
# ==============================================================================
|
||||||
|
# EXAMPLE: Remote shutdown via SSH with password
|
||||||
|
# ==============================================================================
|
||||||
|
# You can implement custom shutdown logic for remote systems
|
||||||
|
# that require password authentication or webhooks
|
||||||
|
#
|
||||||
|
# if [ "$NUPST_THRESHOLDS_EXCEEDED" = "true" ]; then
|
||||||
|
# # Call a webhook with a secret password/token
|
||||||
|
# curl -X POST "https://remote-server.local/shutdown?token=YOUR_SECRET_TOKEN"
|
||||||
|
#
|
||||||
|
# # Or use SSH with password (requires sshpass)
|
||||||
|
# # sshpass -p 'your-password' ssh user@remote-server 'sudo shutdown -h +5'
|
||||||
|
# fi
|
||||||
|
|
||||||
|
# ==============================================================================
|
||||||
|
# EXAMPLE: Conditional logic based on battery level
|
||||||
|
# ==============================================================================
|
||||||
|
# if [ "$BATTERY_CAPACITY" -lt 20 ]; then
|
||||||
|
# echo "Battery critically low! Immediate action needed." >> "$LOG_FILE"
|
||||||
|
# elif [ "$BATTERY_CAPACITY" -lt 50 ]; then
|
||||||
|
# echo "Battery low. Preparing for shutdown." >> "$LOG_FILE"
|
||||||
|
# else
|
||||||
|
# echo "Battery acceptable. Monitoring." >> "$LOG_FILE"
|
||||||
|
# fi
|
||||||
|
|
||||||
|
# ==============================================================================
|
||||||
|
# EXAMPLE: Different actions for different trigger reasons
|
||||||
|
# ==============================================================================
|
||||||
|
# case "$NUPST_TRIGGER_REASON" in
|
||||||
|
# powerStatusChange)
|
||||||
|
# echo "Power status changed to: $POWER_STATUS" >> "$LOG_FILE"
|
||||||
|
# # Send notification but don't take drastic action yet
|
||||||
|
# ;;
|
||||||
|
# thresholdViolation)
|
||||||
|
# echo "Thresholds violated! Taking emergency action." >> "$LOG_FILE"
|
||||||
|
# # Initiate graceful shutdowns, save data, etc.
|
||||||
|
# ;;
|
||||||
|
# esac
|
||||||
|
|
||||||
|
# Exit with success
|
||||||
|
exit 0
|
||||||
+261
-74
@@ -1,8 +1,71 @@
|
|||||||
#!/bin/bash
|
#!/bin/bash
|
||||||
|
|
||||||
# NUPST Installer Script
|
# NUPST Installer Script (v5.0+)
|
||||||
# Downloads and installs NUPST globally on the system
|
# Downloads and installs pre-compiled NUPST binary from Gitea releases
|
||||||
# Can be used directly with curl: curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash
|
#
|
||||||
|
# Usage:
|
||||||
|
# Direct piped installation (recommended):
|
||||||
|
# curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash
|
||||||
|
#
|
||||||
|
# With version specification:
|
||||||
|
# curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- --version v5.0.0
|
||||||
|
#
|
||||||
|
# Options:
|
||||||
|
# -h, --help Show this help message
|
||||||
|
# --version VERSION Install specific version (e.g., v4.0.0)
|
||||||
|
# --install-dir DIR Installation directory (default: /opt/nupst)
|
||||||
|
|
||||||
|
set -e
|
||||||
|
|
||||||
|
# Default values
|
||||||
|
SHOW_HELP=0
|
||||||
|
SPECIFIED_VERSION=""
|
||||||
|
INSTALL_DIR="/opt/nupst"
|
||||||
|
GITEA_BASE_URL="https://code.foss.global"
|
||||||
|
GITEA_REPO="serve.zone/nupst"
|
||||||
|
|
||||||
|
# Parse command line arguments
|
||||||
|
while [[ $# -gt 0 ]]; do
|
||||||
|
case $1 in
|
||||||
|
-h|--help)
|
||||||
|
SHOW_HELP=1
|
||||||
|
shift
|
||||||
|
;;
|
||||||
|
--version)
|
||||||
|
SPECIFIED_VERSION="$2"
|
||||||
|
shift 2
|
||||||
|
;;
|
||||||
|
--install-dir)
|
||||||
|
INSTALL_DIR="$2"
|
||||||
|
shift 2
|
||||||
|
;;
|
||||||
|
*)
|
||||||
|
echo "Unknown option: $1"
|
||||||
|
echo "Use -h or --help for usage information"
|
||||||
|
exit 1
|
||||||
|
;;
|
||||||
|
esac
|
||||||
|
done
|
||||||
|
|
||||||
|
if [ $SHOW_HELP -eq 1 ]; then
|
||||||
|
echo "NUPST Installer Script (v5.0+)"
|
||||||
|
echo "Downloads and installs pre-compiled NUPST binary"
|
||||||
|
echo ""
|
||||||
|
echo "Usage: $0 [options]"
|
||||||
|
echo ""
|
||||||
|
echo "Options:"
|
||||||
|
echo " -h, --help Show this help message"
|
||||||
|
echo " --version VERSION Install specific version (e.g., v5.0.0)"
|
||||||
|
echo " --install-dir DIR Installation directory (default: /opt/nupst)"
|
||||||
|
echo ""
|
||||||
|
echo "Examples:"
|
||||||
|
echo " # Install latest version"
|
||||||
|
echo " curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash"
|
||||||
|
echo ""
|
||||||
|
echo " # Install specific version"
|
||||||
|
echo " curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash -s -- --version v5.0.0"
|
||||||
|
exit 0
|
||||||
|
fi
|
||||||
|
|
||||||
# Check if running as root
|
# Check if running as root
|
||||||
if [ "$EUID" -ne 0 ]; then
|
if [ "$EUID" -ne 0 ]; then
|
||||||
@@ -10,88 +73,212 @@ if [ "$EUID" -ne 0 ]; then
|
|||||||
exit 1
|
exit 1
|
||||||
fi
|
fi
|
||||||
|
|
||||||
# Detect if script is being piped or run directly
|
# Helper function to detect OS and architecture
|
||||||
PIPED=0
|
detect_platform() {
|
||||||
if [ ! -t 0 ]; then
|
local os=$(uname -s)
|
||||||
# Being piped, need to clone the repo
|
local arch=$(uname -m)
|
||||||
PIPED=1
|
|
||||||
|
# Map OS
|
||||||
|
case "$os" in
|
||||||
|
Linux)
|
||||||
|
os_name="linux"
|
||||||
|
;;
|
||||||
|
Darwin)
|
||||||
|
os_name="macos"
|
||||||
|
;;
|
||||||
|
MINGW*|MSYS*|CYGWIN*)
|
||||||
|
os_name="windows"
|
||||||
|
;;
|
||||||
|
*)
|
||||||
|
echo "Error: Unsupported operating system: $os"
|
||||||
|
echo "Supported: Linux, macOS, Windows"
|
||||||
|
exit 1
|
||||||
|
;;
|
||||||
|
esac
|
||||||
|
|
||||||
|
# Map architecture
|
||||||
|
case "$arch" in
|
||||||
|
x86_64|amd64)
|
||||||
|
arch_name="x64"
|
||||||
|
;;
|
||||||
|
aarch64|arm64)
|
||||||
|
arch_name="arm64"
|
||||||
|
;;
|
||||||
|
*)
|
||||||
|
echo "Error: Unsupported architecture: $arch"
|
||||||
|
echo "Supported: x86_64/amd64 (x64), aarch64/arm64 (arm64)"
|
||||||
|
exit 1
|
||||||
|
;;
|
||||||
|
esac
|
||||||
|
|
||||||
|
# Construct binary name
|
||||||
|
if [ "$os_name" = "windows" ]; then
|
||||||
|
echo "nupst-${os_name}-${arch_name}.exe"
|
||||||
|
else
|
||||||
|
echo "nupst-${os_name}-${arch_name}"
|
||||||
fi
|
fi
|
||||||
|
}
|
||||||
|
|
||||||
# Define installation directory
|
# Get latest release version from Gitea API
|
||||||
INSTALL_DIR="/opt/nupst"
|
get_latest_version() {
|
||||||
REPO_URL="https://code.foss.global/serve.zone/nupst.git"
|
echo "Fetching latest release version from Gitea..." >&2
|
||||||
|
|
||||||
if [ $PIPED -eq 1 ]; then
|
local api_url="${GITEA_BASE_URL}/api/v1/repos/${GITEA_REPO}/releases/latest"
|
||||||
echo "Installing NUPST from remote repository..."
|
local response=$(curl -sSL "$api_url" 2>/dev/null)
|
||||||
|
|
||||||
# Check if git is installed
|
if [ $? -ne 0 ] || [ -z "$response" ]; then
|
||||||
if ! command -v git &> /dev/null; then
|
echo "Error: Failed to fetch latest release information from Gitea API" >&2
|
||||||
echo "Git is required but not installed. Please install git first."
|
echo "URL: $api_url" >&2
|
||||||
exit 1
|
exit 1
|
||||||
fi
|
fi
|
||||||
|
|
||||||
# Check if installation directory exists
|
# Extract tag_name from JSON response
|
||||||
if [ -d "$INSTALL_DIR" ] && [ -d "$INSTALL_DIR/.git" ]; then
|
local version=$(echo "$response" | grep -o '"tag_name":"[^"]*"' | cut -d'"' -f4)
|
||||||
echo "Existing installation found at $INSTALL_DIR. Updating..."
|
|
||||||
cd "$INSTALL_DIR"
|
|
||||||
|
|
||||||
# Try to update the repository
|
if [ -z "$version" ]; then
|
||||||
git fetch origin
|
echo "Error: Could not determine latest version from API response" >&2
|
||||||
git reset --hard origin/main
|
|
||||||
|
|
||||||
if [ $? -ne 0 ]; then
|
|
||||||
echo "Failed to update repository. Reinstalling..."
|
|
||||||
cd /
|
|
||||||
rm -rf "$INSTALL_DIR"
|
|
||||||
mkdir -p "$INSTALL_DIR"
|
|
||||||
git clone --depth 1 $REPO_URL "$INSTALL_DIR"
|
|
||||||
else
|
|
||||||
echo "Repository updated successfully."
|
|
||||||
fi
|
|
||||||
else
|
|
||||||
# Fresh installation
|
|
||||||
if [ -d "$INSTALL_DIR" ]; then
|
|
||||||
echo "Removing previous installation at $INSTALL_DIR..."
|
|
||||||
rm -rf "$INSTALL_DIR"
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Create installation directory
|
|
||||||
mkdir -p "$INSTALL_DIR"
|
|
||||||
|
|
||||||
# Clone the repository
|
|
||||||
echo "Cloning NUPST repository to $INSTALL_DIR..."
|
|
||||||
git clone --depth 1 $REPO_URL "$INSTALL_DIR"
|
|
||||||
fi
|
|
||||||
|
|
||||||
if [ $? -ne 0 ]; then
|
|
||||||
echo "Failed to clone/update repository. Please check your internet connection."
|
|
||||||
exit 1
|
exit 1
|
||||||
fi
|
fi
|
||||||
|
|
||||||
# Set script directory to the cloned repo
|
echo "$version"
|
||||||
SCRIPT_DIR="$INSTALL_DIR"
|
}
|
||||||
else
|
|
||||||
# Running directly from within the repo
|
|
||||||
SCRIPT_DIR="$( cd "$( dirname "${BASH_SOURCE[0]}" )" &> /dev/null && pwd )"
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Run setup script
|
# Main installation process
|
||||||
echo "Running setup script..."
|
echo "================================================"
|
||||||
bash "$SCRIPT_DIR/setup.sh"
|
echo " NUPST Installation Script (v5.0+)"
|
||||||
|
echo "================================================"
|
||||||
# Install globally
|
|
||||||
echo "Installing NUPST globally..."
|
|
||||||
ln -sf "$SCRIPT_DIR/bin/nupst" /usr/local/bin/nupst
|
|
||||||
|
|
||||||
# Installation completed
|
|
||||||
if [ $PIPED -eq 1 ]; then
|
|
||||||
echo "NUPST has been installed globally at $INSTALL_DIR"
|
|
||||||
else
|
|
||||||
echo "NUPST has been installed globally."
|
|
||||||
fi
|
|
||||||
|
|
||||||
echo "You can now run 'nupst' from anywhere."
|
|
||||||
echo ""
|
echo ""
|
||||||
echo "To get started, try:"
|
|
||||||
|
# Detect platform
|
||||||
|
BINARY_NAME=$(detect_platform)
|
||||||
|
echo "Detected platform: $BINARY_NAME"
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
# Determine version to install
|
||||||
|
if [ -n "$SPECIFIED_VERSION" ]; then
|
||||||
|
VERSION="$SPECIFIED_VERSION"
|
||||||
|
echo "Installing specified version: $VERSION"
|
||||||
|
else
|
||||||
|
VERSION=$(get_latest_version)
|
||||||
|
echo "Installing latest version: $VERSION"
|
||||||
|
fi
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
# Construct download URL
|
||||||
|
DOWNLOAD_URL="${GITEA_BASE_URL}/${GITEA_REPO}/releases/download/${VERSION}/${BINARY_NAME}"
|
||||||
|
echo "Download URL: $DOWNLOAD_URL"
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
# Check if service is running and stop it
|
||||||
|
SERVICE_WAS_RUNNING=0
|
||||||
|
if systemctl is-enabled --quiet nupst 2>/dev/null || systemctl is-active --quiet nupst 2>/dev/null; then
|
||||||
|
SERVICE_WAS_RUNNING=1
|
||||||
|
if systemctl is-active --quiet nupst 2>/dev/null; then
|
||||||
|
echo "Stopping NUPST service..."
|
||||||
|
systemctl stop nupst
|
||||||
|
fi
|
||||||
|
fi
|
||||||
|
|
||||||
|
# Clean installation directory - ensure only binary exists
|
||||||
|
if [ -d "$INSTALL_DIR" ]; then
|
||||||
|
echo "Cleaning installation directory: $INSTALL_DIR"
|
||||||
|
rm -rf "$INSTALL_DIR"
|
||||||
|
fi
|
||||||
|
|
||||||
|
# Create fresh installation directory
|
||||||
|
echo "Creating installation directory: $INSTALL_DIR"
|
||||||
|
mkdir -p "$INSTALL_DIR"
|
||||||
|
|
||||||
|
# Download binary
|
||||||
|
echo "Downloading NUPST binary..."
|
||||||
|
TEMP_FILE="$INSTALL_DIR/nupst.download"
|
||||||
|
curl -sSL "$DOWNLOAD_URL" -o "$TEMP_FILE"
|
||||||
|
|
||||||
|
if [ $? -ne 0 ]; then
|
||||||
|
echo "Error: Failed to download binary from $DOWNLOAD_URL"
|
||||||
|
echo ""
|
||||||
|
echo "Please check:"
|
||||||
|
echo " 1. Your internet connection"
|
||||||
|
echo " 2. The specified version exists: ${GITEA_BASE_URL}/${GITEA_REPO}/releases"
|
||||||
|
echo " 3. The platform binary is available for this release"
|
||||||
|
rm -f "$TEMP_FILE"
|
||||||
|
exit 1
|
||||||
|
fi
|
||||||
|
|
||||||
|
# Check if download was successful (file exists and not empty)
|
||||||
|
if [ ! -s "$TEMP_FILE" ]; then
|
||||||
|
echo "Error: Downloaded file is empty or does not exist"
|
||||||
|
rm -f "$TEMP_FILE"
|
||||||
|
exit 1
|
||||||
|
fi
|
||||||
|
|
||||||
|
# Move to final location
|
||||||
|
BINARY_PATH="$INSTALL_DIR/nupst"
|
||||||
|
mv "$TEMP_FILE" "$BINARY_PATH"
|
||||||
|
|
||||||
|
if [ $? -ne 0 ] || [ ! -f "$BINARY_PATH" ]; then
|
||||||
|
echo "Error: Failed to move binary to $BINARY_PATH"
|
||||||
|
rm -f "$TEMP_FILE" 2>/dev/null
|
||||||
|
exit 1
|
||||||
|
fi
|
||||||
|
|
||||||
|
# Make executable
|
||||||
|
chmod +x "$BINARY_PATH"
|
||||||
|
|
||||||
|
if [ $? -ne 0 ]; then
|
||||||
|
echo "Error: Failed to make binary executable"
|
||||||
|
exit 1
|
||||||
|
fi
|
||||||
|
|
||||||
|
echo "Binary installed successfully to: $BINARY_PATH"
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
# Check if /usr/local/bin is in PATH
|
||||||
|
if [[ ":$PATH:" == *":/usr/local/bin:"* ]]; then
|
||||||
|
BIN_DIR="/usr/local/bin"
|
||||||
|
else
|
||||||
|
BIN_DIR="/usr/bin"
|
||||||
|
fi
|
||||||
|
|
||||||
|
# Create symlink for global access
|
||||||
|
ln -sf "$BINARY_PATH" "$BIN_DIR/nupst"
|
||||||
|
echo "Symlink created: $BIN_DIR/nupst -> $BINARY_PATH"
|
||||||
|
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
# Restart service if it was running before update
|
||||||
|
if [ $SERVICE_WAS_RUNNING -eq 1 ]; then
|
||||||
|
echo "Restarting NUPST service..."
|
||||||
|
systemctl restart nupst
|
||||||
|
echo "Service restarted successfully."
|
||||||
|
echo ""
|
||||||
|
fi
|
||||||
|
|
||||||
|
echo "================================================"
|
||||||
|
echo " NUPST Installation Complete!"
|
||||||
|
echo "================================================"
|
||||||
|
echo ""
|
||||||
|
echo "Installation details:"
|
||||||
|
echo " Binary location: $BINARY_PATH"
|
||||||
|
echo " Symlink location: $BIN_DIR/nupst"
|
||||||
|
echo " Version: $VERSION"
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
# Check if configuration exists
|
||||||
|
if [ -f "/etc/nupst/config.json" ]; then
|
||||||
|
echo "Configuration: /etc/nupst/config.json (preserved)"
|
||||||
|
echo ""
|
||||||
|
echo "Your existing configuration has been preserved."
|
||||||
|
if [ $SERVICE_WAS_RUNNING -eq 1 ]; then
|
||||||
|
echo "The service has been restarted with your current settings."
|
||||||
|
else
|
||||||
|
echo "Start the service with: sudo nupst service start"
|
||||||
|
fi
|
||||||
|
else
|
||||||
|
echo "Get started:"
|
||||||
|
echo " nupst --version"
|
||||||
echo " nupst help"
|
echo " nupst help"
|
||||||
echo " nupst setup # To configure your UPS connection"
|
echo " nupst ups add # Add a UPS device"
|
||||||
|
echo " nupst service enable # Enable systemd service"
|
||||||
|
fi
|
||||||
|
echo ""
|
||||||
|
|||||||
@@ -0,0 +1,21 @@
|
|||||||
|
The MIT License (MIT)
|
||||||
|
|
||||||
|
Copyright (c) 2016 Task Venture Capital GmbH
|
||||||
|
|
||||||
|
Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||||
|
of this software and associated documentation files (the "Software"), to deal
|
||||||
|
in the Software without restriction, including without limitation the rights
|
||||||
|
to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
|
||||||
|
copies of the Software, and to permit persons to whom the Software is
|
||||||
|
furnished to do so, subject to the following conditions:
|
||||||
|
|
||||||
|
The above copyright notice and this permission notice shall be included in all
|
||||||
|
copies or substantial portions of the Software.
|
||||||
|
|
||||||
|
THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
|
||||||
|
IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
|
||||||
|
FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
|
||||||
|
AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
|
||||||
|
LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
|
||||||
|
OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
|
||||||
|
SOFTWARE.
|
||||||
@@ -0,0 +1,39 @@
|
|||||||
|
#!/usr/bin/env -S deno run --allow-all
|
||||||
|
|
||||||
|
/**
|
||||||
|
* NUPST - UPS Shutdown Tool
|
||||||
|
*
|
||||||
|
* A command-line tool for monitoring SNMP-enabled UPS devices and
|
||||||
|
* initiating system shutdown when power conditions are critical.
|
||||||
|
*
|
||||||
|
* Required Permissions:
|
||||||
|
* - --allow-net: SNMP communication with UPS devices
|
||||||
|
* - --allow-read: Read configuration files (/etc/nupst/config.json)
|
||||||
|
* - --allow-write: Write configuration files
|
||||||
|
* - --allow-run: Execute system commands (systemctl, shutdown, git, bash)
|
||||||
|
* - --allow-sys: Access system information (hostname, OS details)
|
||||||
|
* - --allow-env: Read environment variables
|
||||||
|
*
|
||||||
|
* @module
|
||||||
|
*/
|
||||||
|
|
||||||
|
import { NupstCli } from './ts/cli.ts';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Main entry point for the NUPST application
|
||||||
|
* Parses command-line arguments and executes the requested command
|
||||||
|
*/
|
||||||
|
async function main(): Promise<void> {
|
||||||
|
const cli = new NupstCli();
|
||||||
|
await cli.parseAndExecute(Deno.args);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Execute main and handle errors
|
||||||
|
if (import.meta.main) {
|
||||||
|
try {
|
||||||
|
await main();
|
||||||
|
} catch (error) {
|
||||||
|
console.error(`Error: ${error instanceof Error ? error.message : String(error)}`);
|
||||||
|
Deno.exit(1);
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -1 +0,0 @@
|
|||||||
{}
|
|
||||||
+56
-45
@@ -1,58 +1,69 @@
|
|||||||
{
|
{
|
||||||
"name": "@serve.zone/nupst",
|
"name": "@serve.zone/nupst",
|
||||||
"version": "2.1.0",
|
"version": "5.5.1",
|
||||||
"description": "Node.js UPS Shutdown Tool for SNMP-enabled UPS devices",
|
"description": "Network UPS Shutdown Tool - Monitor SNMP-enabled UPS devices and orchestrate graceful system shutdowns during power emergencies",
|
||||||
"main": "dist/index.js",
|
|
||||||
"bin": {
|
|
||||||
"nupst": "bin/nupst"
|
|
||||||
},
|
|
||||||
"type": "module",
|
|
||||||
"scripts": {
|
|
||||||
"build": "tsbuild tsfolders --allowimplicitany",
|
|
||||||
"start": "bin/nupst",
|
|
||||||
"setup": "bash setup.sh",
|
|
||||||
"test": "tstest test/",
|
|
||||||
"install-global": "sudo bash install.sh",
|
|
||||||
"uninstall": "sudo bash uninstall.sh"
|
|
||||||
},
|
|
||||||
"keywords": [
|
"keywords": [
|
||||||
"ups",
|
"ups",
|
||||||
"snmp",
|
"snmp",
|
||||||
|
"power",
|
||||||
"shutdown",
|
"shutdown",
|
||||||
"node",
|
"monitoring",
|
||||||
"cli"
|
"cyberpower",
|
||||||
|
"apc",
|
||||||
|
"eaton",
|
||||||
|
"tripplite",
|
||||||
|
"liebert",
|
||||||
|
"vertiv",
|
||||||
|
"battery",
|
||||||
|
"backup"
|
||||||
],
|
],
|
||||||
"files": [
|
"homepage": "https://code.foss.global/serve.zone/nupst",
|
||||||
"ts/**/*",
|
"bugs": {
|
||||||
"ts_web/**/*",
|
"url": "https://code.foss.global/serve.zone/nupst/issues"
|
||||||
"dist/**/*",
|
},
|
||||||
"dist_*/**/*",
|
"repository": {
|
||||||
"dist_ts/**/*",
|
"type": "git",
|
||||||
"dist_ts_web/**/*",
|
"url": "git+https://code.foss.global/serve.zone/nupst.git"
|
||||||
"assets/**/*",
|
},
|
||||||
"cli.js",
|
"author": "Serve Zone",
|
||||||
"npmextra.json",
|
|
||||||
"readme.md"
|
|
||||||
],
|
|
||||||
"author": "",
|
|
||||||
"license": "MIT",
|
"license": "MIT",
|
||||||
"dependencies": {},
|
"type": "module",
|
||||||
"devDependencies": {
|
"bin": {
|
||||||
"@git.zone/tsbuild": "^2.3.2",
|
"nupst": "./bin/nupst-wrapper.js"
|
||||||
"@git.zone/tsrun": "^1.3.3",
|
|
||||||
"@git.zone/tstest": "^1.0.96",
|
|
||||||
"@push.rocks/qenv": "^6.1.0",
|
|
||||||
"@push.rocks/tapbundle": "^5.6.0",
|
|
||||||
"@types/node": "^20.11.0"
|
|
||||||
},
|
},
|
||||||
|
"scripts": {
|
||||||
|
"postinstall": "node scripts/install-binary.js",
|
||||||
|
"prepublishOnly": "echo 'Publishing NUPST binaries to npm...'",
|
||||||
|
"test": "deno task test",
|
||||||
|
"build": "deno task check",
|
||||||
|
"lint": "deno task lint",
|
||||||
|
"format": "deno task fmt"
|
||||||
|
},
|
||||||
|
"files": [
|
||||||
|
"bin/",
|
||||||
|
"scripts/install-binary.js",
|
||||||
|
"readme.md",
|
||||||
|
"license",
|
||||||
|
"changelog.md"
|
||||||
|
],
|
||||||
"engines": {
|
"engines": {
|
||||||
"node": ">=16.0.0"
|
"node": ">=14.0.0"
|
||||||
},
|
},
|
||||||
"pnpm": {
|
"os": [
|
||||||
"onlyBuiltDependencies": [
|
"darwin",
|
||||||
"esbuild",
|
"linux",
|
||||||
"mongodb-memory-server",
|
"win32"
|
||||||
"puppeteer"
|
],
|
||||||
]
|
"cpu": [
|
||||||
|
"x64",
|
||||||
|
"arm64"
|
||||||
|
],
|
||||||
|
"publishConfig": {
|
||||||
|
"access": "public",
|
||||||
|
"registry": "https://registry.npmjs.org/"
|
||||||
|
},
|
||||||
|
"packageManager": "pnpm@10.18.1+sha512.77a884a165cbba2d8d1c19e3b4880eee6d2fcabd0d879121e282196b80042351d5eb3ca0935fa599da1dc51265cc68816ad2bddd2a2de5ea9fdf92adbec7cd34",
|
||||||
|
"devDependencies": {
|
||||||
|
"@git.zone/tsdeno": "^1.3.1"
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
Generated
+476
-8339
File diff suppressed because it is too large
Load Diff
+170
@@ -0,0 +1,170 @@
|
|||||||
|
# NUPST Project Hints
|
||||||
|
|
||||||
|
## Recent Refactoring (January 2026)
|
||||||
|
|
||||||
|
### Phase 1 - Quick Wins
|
||||||
|
|
||||||
|
1. **Prompt Utility (`ts/helpers/prompt.ts`)**
|
||||||
|
- Extracted readline/prompt pattern from all CLI handlers
|
||||||
|
- Provides `createPrompt()` and `withPrompt()` helper functions
|
||||||
|
- Used in: `ups-handler.ts`, `group-handler.ts`, `service-handler.ts`, `action-handler.ts`,
|
||||||
|
`feature-handler.ts`
|
||||||
|
|
||||||
|
2. **Constants File (`ts/constants.ts`)**
|
||||||
|
- Centralized all magic numbers (timeouts, intervals, thresholds)
|
||||||
|
- Contains: `TIMING`, `SNMP`, `THRESHOLDS`, `WEBHOOK`, `SCRIPT`, `SHUTDOWN`, `HTTP_SERVER`, `UI`,
|
||||||
|
`NETWORK`, `UPSD`, `PAUSE`, `PROXMOX`
|
||||||
|
- Used in: `daemon.ts`, `snmp/manager.ts`, `actions/*.ts`, `upsd/client.ts`
|
||||||
|
|
||||||
|
3. **Logger Consistency**
|
||||||
|
- Replaced all `console.log/console.error` in `snmp/manager.ts` with proper `logger.*` calls
|
||||||
|
- Debug output uses `logger.dim()` for less intrusive output
|
||||||
|
|
||||||
|
### Phase 2 - Type Safety
|
||||||
|
|
||||||
|
4. **Circular Dependency Fix (`ts/interfaces/nupst-accessor.ts`)**
|
||||||
|
- Created `INupstAccessor` interface to break the circular dependency between `Nupst` and
|
||||||
|
`NupstSnmp`
|
||||||
|
- `NupstSnmp.nupst` property now uses the interface instead of `any`
|
||||||
|
|
||||||
|
5. **Webhook Payload Interface (`ts/actions/webhook-action.ts`)**
|
||||||
|
- Added `IWebhookPayload` interface for webhook action payloads
|
||||||
|
- Exported from `ts/actions/index.ts`
|
||||||
|
|
||||||
|
6. **CLI Handler Type Safety**
|
||||||
|
- Replaced `any` types in `ups-handler.ts` and `group-handler.ts` with proper interfaces
|
||||||
|
- Uses: `IUpsConfig`, `INupstConfig`, `ISnmpConfig`, `IActionConfig`, `IThresholds`,
|
||||||
|
`ISnmpUpsStatus`
|
||||||
|
|
||||||
|
7. **SNMP Manager Boundary Types (`ts/snmp/manager.ts`)**
|
||||||
|
- Added local wrapper interfaces for the untyped `net-snmp` package surface used by NUPST
|
||||||
|
- SNMP metric reads now coerce values explicitly instead of relying on `any`-typed responses
|
||||||
|
|
||||||
|
## Features Added (February 2026)
|
||||||
|
|
||||||
|
### Network Loss Handling
|
||||||
|
|
||||||
|
- `TPowerStatus` extended with `'unreachable'` state
|
||||||
|
- `IUpsStatus` has `consecutiveFailures` and `unreachableSince` tracking
|
||||||
|
- After `NETWORK.CONSECUTIVE_FAILURE_THRESHOLD` (3) failures, UPS transitions to `unreachable`
|
||||||
|
- Shutdown action explicitly won't fire on `unreachable` (prevents false shutdowns)
|
||||||
|
- Recovery is logged when UPS comes back from unreachable
|
||||||
|
|
||||||
|
### UPSD/NIS Protocol Support
|
||||||
|
|
||||||
|
- New `ts/upsd/` directory with TCP client for NUT (Network UPS Tools) servers
|
||||||
|
- `ts/protocol/` directory with `ProtocolResolver` for protocol-agnostic status queries
|
||||||
|
- `IUpsConfig.protocol` field: `'snmp'` (default) or `'upsd'`
|
||||||
|
- `IUpsConfig.snmp` is now optional (not needed for UPSD devices)
|
||||||
|
- CLI supports protocol selection during `nupst ups add`
|
||||||
|
- Config version is now `4.3`, including the `4.2` -> `4.3` runtime unit migration
|
||||||
|
|
||||||
|
### Pause/Resume Command
|
||||||
|
|
||||||
|
- File-based signaling via `/etc/nupst/pause` JSON file
|
||||||
|
- `nupst pause [--duration 30m|2h|1d]` creates pause file
|
||||||
|
- `nupst resume` deletes pause file
|
||||||
|
- `ts/pause-state.ts` owns pause snapshot parsing and transition detection for daemon polling
|
||||||
|
- Daemon polls continue but actions are suppressed while paused
|
||||||
|
- Auto-resume after duration expires
|
||||||
|
- HTTP API includes pause state in response
|
||||||
|
|
||||||
|
### Shutdown Orchestration
|
||||||
|
|
||||||
|
- `ts/shutdown-executor.ts` owns command discovery and fallback execution for delayed and emergency
|
||||||
|
shutdowns
|
||||||
|
- `ts/daemon.ts` now delegates OS shutdown execution instead of embedding command lookup logic
|
||||||
|
inline
|
||||||
|
|
||||||
|
### Config Watch Handling
|
||||||
|
|
||||||
|
- `ts/config-watch.ts` owns file-watch event matching and config-reload transition analysis
|
||||||
|
- `ts/daemon.ts` now delegates config/pause watch event classification and reload messaging
|
||||||
|
decisions
|
||||||
|
|
||||||
|
### UPS Status Tracking
|
||||||
|
|
||||||
|
- `ts/ups-status.ts` owns the daemon UPS status shape and default status factory
|
||||||
|
- `ts/daemon.ts` now reuses a shared initializer instead of duplicating the default UPS status
|
||||||
|
object
|
||||||
|
|
||||||
|
### UPS Monitoring Transitions
|
||||||
|
|
||||||
|
- `ts/ups-monitoring.ts` owns pure UPS poll success/failure transition logic and threshold detection
|
||||||
|
- `ts/daemon.ts` now orchestrates protocol calls and logging while delegating state transitions
|
||||||
|
|
||||||
|
### Action Orchestration
|
||||||
|
|
||||||
|
- `ts/action-orchestration.ts` owns action context construction and action execution decisions
|
||||||
|
- `ts/daemon.ts` now delegates pause suppression, legacy shutdown fallback, and action context
|
||||||
|
building
|
||||||
|
|
||||||
|
### Shutdown Monitoring
|
||||||
|
|
||||||
|
- `ts/shutdown-monitoring.ts` owns shutdown-loop row building and emergency candidate selection
|
||||||
|
- `ts/daemon.ts` now keeps the shutdown loop orchestration while delegating row/emergency decisions
|
||||||
|
|
||||||
|
### Proxmox VM Shutdown Action
|
||||||
|
|
||||||
|
- New action type `'proxmox'` in `ts/actions/proxmox-action.ts`
|
||||||
|
- Uses Proxmox REST API with PVEAPIToken authentication
|
||||||
|
- Shuts down QEMU VMs and LXC containers before host shutdown
|
||||||
|
- Supports: exclude IDs, configurable timeout, force-stop, TLS skip for self-signed certs
|
||||||
|
- Should be placed BEFORE shutdown actions in the action chain
|
||||||
|
|
||||||
|
## Architecture Notes
|
||||||
|
|
||||||
|
- **SNMP Manager**: Uses `INupstAccessor` interface (not direct `Nupst` reference) to avoid circular
|
||||||
|
imports
|
||||||
|
- **Protocol Resolver**: Routes to SNMP or UPSD based on `IUpsConfig.protocol`
|
||||||
|
- **CLI Handlers**: All use the `helpers.withPrompt()` utility for interactive input
|
||||||
|
- **Constants**: All timing values should be referenced from `ts/constants.ts`
|
||||||
|
- **Actions**: Use `IActionConfig` from `ts/actions/base-action.ts` for action configuration
|
||||||
|
- **Action orchestration**: Use helpers from `ts/action-orchestration.ts` for action context and
|
||||||
|
execution decisions
|
||||||
|
- **Config watch logic**: Use helpers from `ts/config-watch.ts` for file event filtering and reload
|
||||||
|
transitions
|
||||||
|
- **Pause state**: Use `loadPauseSnapshot()` and `IPauseState` from `ts/pause-state.ts`
|
||||||
|
- **Shutdown execution**: Use `ShutdownExecutor` for OS-level shutdown command lookup and fallbacks
|
||||||
|
- **Shutdown monitoring**: Use helpers from `ts/shutdown-monitoring.ts` for emergency loop rows and
|
||||||
|
candidate selection
|
||||||
|
- **UPS status state**: Use `IUpsStatus` and `createInitialUpsStatus()` from `ts/ups-status.ts`
|
||||||
|
- **UPS poll transitions**: Use helpers from `ts/ups-monitoring.ts` for success/failure updates
|
||||||
|
- **Config version**: Currently `4.3`, migrations run automatically
|
||||||
|
|
||||||
|
## File Organization
|
||||||
|
|
||||||
|
```
|
||||||
|
ts/
|
||||||
|
├── constants.ts # All timing/threshold constants
|
||||||
|
├── action-orchestration.ts # Action context and execution decisions
|
||||||
|
├── config-watch.ts # File watch filters and config reload transitions
|
||||||
|
├── shutdown-monitoring.ts # Shutdown loop rows and emergency selection
|
||||||
|
├── ups-monitoring.ts # Pure UPS poll transition and threshold helpers
|
||||||
|
├── pause-state.ts # Shared pause state types and transition detection
|
||||||
|
├── shutdown-executor.ts # Delayed/emergency shutdown command execution
|
||||||
|
├── ups-status.ts # Daemon UPS status shape and initializer
|
||||||
|
├── interfaces/
|
||||||
|
│ └── nupst-accessor.ts # Interface to break circular deps
|
||||||
|
├── helpers/
|
||||||
|
│ ├── prompt.ts # Readline utility
|
||||||
|
│ └── shortid.ts # ID generation
|
||||||
|
├── actions/
|
||||||
|
│ ├── base-action.ts # Base action class, IActionConfig, TPowerStatus
|
||||||
|
│ ├── webhook-action.ts # Includes IWebhookPayload
|
||||||
|
│ ├── proxmox-action.ts # Proxmox VM/LXC shutdown
|
||||||
|
│ └── ...
|
||||||
|
├── upsd/
|
||||||
|
│ ├── types.ts # IUpsdConfig
|
||||||
|
│ ├── client.ts # NupstUpsd TCP client
|
||||||
|
│ └── index.ts
|
||||||
|
├── protocol/
|
||||||
|
│ ├── types.ts # TProtocol = 'snmp' | 'upsd'
|
||||||
|
│ ├── resolver.ts # ProtocolResolver
|
||||||
|
│ └── index.ts
|
||||||
|
├── migrations/
|
||||||
|
│ ├── migration-runner.ts
|
||||||
|
│ └── migration-v4.2-to-v4.3.ts # Adds SNMP runtimeUnit defaults
|
||||||
|
└── cli/
|
||||||
|
└── ... # All handlers use helpers.withPrompt()
|
||||||
|
```
|
||||||
|
|||||||
+613
@@ -0,0 +1,613 @@
|
|||||||
|
# NUPST Migration Plan: Node.js → Deno v4.0.0
|
||||||
|
|
||||||
|
**Migration Goal**: Convert NUPST from Node.js to Deno with single-executable distribution
|
||||||
|
**Version**: 3.1.2 → 4.0.0 (breaking changes) **Platforms**: Linux x64/ARM64, macOS x64/ARM64,
|
||||||
|
Windows x64
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Phase 0: Planning & Preparation
|
||||||
|
|
||||||
|
- [x] Research Deno compilation targets and npm: specifier support
|
||||||
|
- [x] Analyze current codebase structure and dependencies
|
||||||
|
- [x] Define CLI command structure simplification
|
||||||
|
- [x] Create detailed migration task list
|
||||||
|
- [ ] Create feature branch: `migration/deno-v4`
|
||||||
|
- [ ] Backup current working state with git tag: `v3.1.2-pre-deno-migration`
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Phase 1: Dependency Migration (4-6 hours)
|
||||||
|
|
||||||
|
### 1.1 Analyze Current Dependencies
|
||||||
|
|
||||||
|
- [ ] List all production dependencies from `package.json`
|
||||||
|
- Current: `net-snmp@3.20.0`
|
||||||
|
- [ ] List all dev dependencies to be removed
|
||||||
|
- `@git.zone/tsbuild`, `@git.zone/tsrun`, `@git.zone/tstest`, `@push.rocks/qenv`,
|
||||||
|
`@push.rocks/tapbundle`, `@types/node`
|
||||||
|
- [ ] Identify Node.js built-in module usage
|
||||||
|
- `child_process` (execSync)
|
||||||
|
- `https` (for version checking)
|
||||||
|
- `fs` (readFileSync, writeFileSync, existsSync, mkdirSync)
|
||||||
|
- `path` (join, dirname, resolve)
|
||||||
|
|
||||||
|
### 1.2 Create Deno Configuration
|
||||||
|
|
||||||
|
- [ ] Create `deno.json` with project configuration
|
||||||
|
```json
|
||||||
|
{
|
||||||
|
"name": "@serve.zone/nupst",
|
||||||
|
"version": "4.0.0",
|
||||||
|
"exports": "./mod.ts",
|
||||||
|
"tasks": {
|
||||||
|
"dev": "deno run --allow-all mod.ts",
|
||||||
|
"compile": "deno task compile:all",
|
||||||
|
"compile:all": "bash scripts/compile-all.sh",
|
||||||
|
"test": "deno test --allow-all tests/",
|
||||||
|
"check": "deno check mod.ts"
|
||||||
|
},
|
||||||
|
"lint": {
|
||||||
|
"rules": {
|
||||||
|
"tags": ["recommended"]
|
||||||
|
}
|
||||||
|
},
|
||||||
|
"fmt": {
|
||||||
|
"useTabs": false,
|
||||||
|
"lineWidth": 100,
|
||||||
|
"indentWidth": 2,
|
||||||
|
"semiColons": true
|
||||||
|
},
|
||||||
|
"compilerOptions": {
|
||||||
|
"lib": ["deno.window"],
|
||||||
|
"strict": true
|
||||||
|
},
|
||||||
|
"imports": {
|
||||||
|
"@std/cli": "jsr:@std/cli@^1.0.0",
|
||||||
|
"@std/fmt": "jsr:@std/fmt@^1.0.0",
|
||||||
|
"@std/path": "jsr:@std/path@^1.0.0"
|
||||||
|
}
|
||||||
|
}
|
||||||
|
```
|
||||||
|
|
||||||
|
### 1.3 Update Import Statements
|
||||||
|
|
||||||
|
- [ ] `ts/snmp/manager.ts`: Change `import * as snmp from 'net-snmp'` to
|
||||||
|
`import * as snmp from "npm:net-snmp@3.20.0"`
|
||||||
|
- [ ] `ts/cli.ts`: Change `import { execSync } from 'child_process'` to
|
||||||
|
`import { execSync } from "node:child_process"`
|
||||||
|
- [ ] `ts/nupst.ts`: Change `import * as https from 'https'` to
|
||||||
|
`import * as https from "node:https"`
|
||||||
|
- [ ] Search for all `fs` imports and update to `node:fs`
|
||||||
|
- [ ] Search for all `path` imports and update to `node:path`
|
||||||
|
- [ ] Update all relative imports to use `.ts` extension instead of `.js`
|
||||||
|
- Example: `'./nupst.js'` → `'./nupst.ts'`
|
||||||
|
|
||||||
|
### 1.4 Test npm: Specifier Compatibility
|
||||||
|
|
||||||
|
- [ ] Create test file: `tests/snmp_compatibility_test.ts`
|
||||||
|
- [ ] Test SNMP v1 connection with npm:net-snmp
|
||||||
|
- [ ] Test SNMP v2c connection with npm:net-snmp
|
||||||
|
- [ ] Test SNMP v3 connection with npm:net-snmp
|
||||||
|
- [ ] Verify native addon loading works in compiled binary
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Phase 2: Code Structure Refactoring (3-4 hours)
|
||||||
|
|
||||||
|
### 2.1 Create Main Entry Point
|
||||||
|
|
||||||
|
- [ ] Create `mod.ts` as main Deno entry point:
|
||||||
|
```typescript
|
||||||
|
#!/usr/bin/env -S deno run --allow-all
|
||||||
|
|
||||||
|
/**
|
||||||
|
* NUPST - UPS Shutdown Tool for Deno
|
||||||
|
*
|
||||||
|
* Required Permissions:
|
||||||
|
* --allow-net: SNMP communication with UPS devices
|
||||||
|
* --allow-read: Configuration file access (/etc/nupst/config.json)
|
||||||
|
* --allow-write: Configuration file updates
|
||||||
|
* --allow-run: System commands (systemctl, shutdown)
|
||||||
|
* --allow-sys: System information (hostname, OS info)
|
||||||
|
* --allow-env: Environment variables
|
||||||
|
*/
|
||||||
|
|
||||||
|
import { NupstCli } from './ts/cli.ts';
|
||||||
|
|
||||||
|
const cli = new NupstCli();
|
||||||
|
await cli.parseAndExecute(Deno.args);
|
||||||
|
```
|
||||||
|
|
||||||
|
### 2.2 Update All Import Extensions
|
||||||
|
|
||||||
|
Files to update (change .js → .ts in imports):
|
||||||
|
|
||||||
|
- [ ] `ts/index.ts`
|
||||||
|
- [ ] `ts/cli.ts` (imports from ./nupst.js, ./logger.js)
|
||||||
|
- [ ] `ts/nupst.ts` (imports from ./snmp/manager.js, ./daemon.js, etc.)
|
||||||
|
- [ ] `ts/daemon.ts` (imports from ./snmp/manager.js, ./logger.js, ./helpers/)
|
||||||
|
- [ ] `ts/systemd.ts` (imports from ./daemon.js, ./logger.js)
|
||||||
|
- [ ] `ts/cli/service-handler.ts`
|
||||||
|
- [ ] `ts/cli/group-handler.ts`
|
||||||
|
- [ ] `ts/cli/ups-handler.ts`
|
||||||
|
- [ ] `ts/snmp/index.ts`
|
||||||
|
- [ ] `ts/snmp/manager.ts` (imports from ./types.js, ./oid-sets.js)
|
||||||
|
- [ ] `ts/snmp/oid-sets.ts` (imports from ./types.js)
|
||||||
|
- [ ] `ts/helpers/index.ts`
|
||||||
|
- [ ] `ts/logger.ts`
|
||||||
|
|
||||||
|
### 2.3 Update process.argv References
|
||||||
|
|
||||||
|
- [ ] `ts/cli.ts`: Replace `process.argv` with `Deno.args` (adjust indexing: process.argv[2] →
|
||||||
|
Deno.args[0])
|
||||||
|
- [ ] Update parseAndExecute method to work with Deno.args (0-indexed vs 2-indexed)
|
||||||
|
|
||||||
|
### 2.4 Update File System Operations
|
||||||
|
|
||||||
|
- [ ] Search for `fs.readFileSync()` → Consider using `Deno.readTextFile()` or keep node:fs
|
||||||
|
- [ ] Search for `fs.writeFileSync()` → Consider using `Deno.writeTextFile()` or keep node:fs
|
||||||
|
- [ ] Search for `fs.existsSync()` → Keep node:fs or use Deno.stat
|
||||||
|
- [ ] Search for `fs.mkdirSync()` → Keep node:fs or use Deno.mkdir
|
||||||
|
- [ ] Decision: Keep node:fs for consistency or migrate to Deno APIs?
|
||||||
|
|
||||||
|
### 2.5 Update Path Operations
|
||||||
|
|
||||||
|
- [ ] Verify all `path.join()`, `path.resolve()`, `path.dirname()` work with node:path
|
||||||
|
- [ ] Consider using `@std/path` from JSR for better Deno integration
|
||||||
|
|
||||||
|
### 2.6 Handle __dirname and __filename
|
||||||
|
|
||||||
|
- [ ] Find all `__dirname` usage
|
||||||
|
- [ ] Replace with `import.meta.dirname` (Deno) or `dirname(fromFileUrl(import.meta.url))`
|
||||||
|
- [ ] Find all `__filename` usage
|
||||||
|
- [ ] Replace with `import.meta.filename` or `fromFileUrl(import.meta.url)`
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Phase 3: CLI Command Simplification (3-4 hours)
|
||||||
|
|
||||||
|
### 3.1 Design New Command Structure
|
||||||
|
|
||||||
|
Current → New mapping:
|
||||||
|
|
||||||
|
```
|
||||||
|
OLD NEW
|
||||||
|
=== ===
|
||||||
|
nupst enable → nupst service enable
|
||||||
|
nupst disable → nupst service disable
|
||||||
|
nupst daemon-start → nupst service start-daemon
|
||||||
|
nupst logs → nupst service logs
|
||||||
|
nupst stop → nupst service stop
|
||||||
|
nupst start → nupst service start
|
||||||
|
nupst status → nupst service status
|
||||||
|
|
||||||
|
nupst add → nupst ups add
|
||||||
|
nupst edit [id] → nupst ups edit [id]
|
||||||
|
nupst delete <id> → nupst ups remove <id>
|
||||||
|
nupst list → nupst ups list
|
||||||
|
nupst setup → nupst ups edit (removed alias)
|
||||||
|
nupst test → nupst ups test
|
||||||
|
|
||||||
|
nupst group list → nupst group list
|
||||||
|
nupst group add → nupst group add
|
||||||
|
nupst group edit <id> → nupst group edit <id>
|
||||||
|
nupst group delete <id> → nupst group remove <id>
|
||||||
|
|
||||||
|
nupst config → nupst config show
|
||||||
|
nupst upgrade → nupst upgrade
|
||||||
|
nupst uninstall → nupst uninstall
|
||||||
|
nupst help → nupst help / nupst --help
|
||||||
|
(new) → nupst --version
|
||||||
|
```
|
||||||
|
|
||||||
|
### 3.2 Update CLI Parser (ts/cli.ts)
|
||||||
|
|
||||||
|
- [ ] Refactor `parseAndExecute()` to handle new command structure
|
||||||
|
- [ ] Add `service` subcommand handler
|
||||||
|
- [ ] Add `ups` subcommand handler
|
||||||
|
- [ ] Keep `group` subcommand handler (already exists, just update delete→remove)
|
||||||
|
- [ ] Add `config` subcommand handler with `show` default
|
||||||
|
- [ ] Add `--version` flag handler
|
||||||
|
- [ ] Update `help` command to show new structure
|
||||||
|
- [ ] Add command aliases: `rm` → `remove`, `ls` → `list`
|
||||||
|
- [ ] Add `--json` flag for machine-readable output (future enhancement)
|
||||||
|
|
||||||
|
### 3.3 Update Command Handlers
|
||||||
|
|
||||||
|
- [ ] `ts/cli/service-handler.ts`: Update method names if needed
|
||||||
|
- [ ] `ts/cli/ups-handler.ts`: Rename `delete()` → `remove()`, remove `setup` method
|
||||||
|
- [ ] `ts/cli/group-handler.ts`: Rename `delete()` → `remove()`
|
||||||
|
|
||||||
|
### 3.4 Improve Help Messages
|
||||||
|
|
||||||
|
- [ ] Update `showHelp()` in ts/cli.ts with new command structure
|
||||||
|
- [ ] Update `showGroupHelp()` in ts/cli.ts
|
||||||
|
- [ ] Add `showServiceHelp()` method
|
||||||
|
- [ ] Add `showUpsHelp()` method
|
||||||
|
- [ ] Add `showConfigHelp()` method
|
||||||
|
- [ ] Include usage examples in help text
|
||||||
|
|
||||||
|
### 3.5 Add Version Command
|
||||||
|
|
||||||
|
- [ ] Read version from deno.json
|
||||||
|
- [ ] Create `--version` handler in CLI
|
||||||
|
- [ ] Display version with build info
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Phase 4: Compilation & Distribution (2-3 hours)
|
||||||
|
|
||||||
|
### 4.1 Create Compilation Script
|
||||||
|
|
||||||
|
- [ ] Create directory: `scripts/`
|
||||||
|
- [ ] Create `scripts/compile-all.sh`:
|
||||||
|
```bash
|
||||||
|
#!/bin/bash
|
||||||
|
set -e
|
||||||
|
|
||||||
|
VERSION=$(cat deno.json | jq -r '.version')
|
||||||
|
BINARY_DIR="dist/binaries"
|
||||||
|
|
||||||
|
echo "Compiling NUPST v${VERSION} for all platforms..."
|
||||||
|
mkdir -p "$BINARY_DIR"
|
||||||
|
|
||||||
|
# Linux x86_64
|
||||||
|
echo "→ Linux x86_64..."
|
||||||
|
deno compile --allow-all --output "$BINARY_DIR/nupst-linux-x64" \
|
||||||
|
--target x86_64-unknown-linux-gnu mod.ts
|
||||||
|
|
||||||
|
# Linux ARM64
|
||||||
|
echo "→ Linux ARM64..."
|
||||||
|
deno compile --allow-all --output "$BINARY_DIR/nupst-linux-arm64" \
|
||||||
|
--target aarch64-unknown-linux-gnu mod.ts
|
||||||
|
|
||||||
|
# macOS x86_64
|
||||||
|
echo "→ macOS x86_64..."
|
||||||
|
deno compile --allow-all --output "$BINARY_DIR/nupst-macos-x64" \
|
||||||
|
--target x86_64-apple-darwin mod.ts
|
||||||
|
|
||||||
|
# macOS ARM64
|
||||||
|
echo "→ macOS ARM64..."
|
||||||
|
deno compile --allow-all --output "$BINARY_DIR/nupst-macos-arm64" \
|
||||||
|
--target aarch64-apple-darwin mod.ts
|
||||||
|
|
||||||
|
# Windows x86_64
|
||||||
|
echo "→ Windows x86_64..."
|
||||||
|
deno compile --allow-all --output "$BINARY_DIR/nupst-windows-x64.exe" \
|
||||||
|
--target x86_64-pc-windows-msvc mod.ts
|
||||||
|
|
||||||
|
echo ""
|
||||||
|
echo "✓ Compilation complete!"
|
||||||
|
ls -lh "$BINARY_DIR/"
|
||||||
|
```
|
||||||
|
- [ ] Make script executable: `chmod +x scripts/compile-all.sh`
|
||||||
|
|
||||||
|
### 4.2 Test Local Compilation
|
||||||
|
|
||||||
|
- [ ] Run `deno task compile` to compile for all platforms
|
||||||
|
- [ ] Verify all 5 binaries are created
|
||||||
|
- [ ] Check binary sizes (should be reasonable, < 100MB each)
|
||||||
|
- [ ] Test local binary on current platform: `./dist/binaries/nupst-linux-x64 --version`
|
||||||
|
|
||||||
|
### 4.3 Update Installation Scripts
|
||||||
|
|
||||||
|
- [ ] Update `install.sh`:
|
||||||
|
- Remove Node.js download logic (lines dealing with vendor/node-*)
|
||||||
|
- Add detection for binary download from GitHub releases
|
||||||
|
- Simplify to download appropriate binary based on OS/arch
|
||||||
|
- Place binary in `/opt/nupst/bin/nupst`
|
||||||
|
- Create symlink: `/usr/local/bin/nupst → /opt/nupst/bin/nupst`
|
||||||
|
- Update to v4.0.0 in script
|
||||||
|
- [ ] Simplify or remove `setup.sh` (no longer needed without Node.js)
|
||||||
|
- [ ] Update `bin/nupst` launcher:
|
||||||
|
- Option A: Keep as simple wrapper
|
||||||
|
- Option B: Remove and symlink directly to binary
|
||||||
|
- [ ] Update `uninstall.sh`:
|
||||||
|
- Remove vendor directory cleanup
|
||||||
|
- Update paths to new binary location
|
||||||
|
|
||||||
|
### 4.4 Update Systemd Service
|
||||||
|
|
||||||
|
- [ ] Update systemd service file path in `ts/systemd.ts`
|
||||||
|
- [ ] Verify ExecStart points to correct binary location: `/opt/nupst/bin/nupst daemon-start`
|
||||||
|
- [ ] Remove Node.js environment variables if any
|
||||||
|
- [ ] Test service installation and startup
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Phase 5: Testing & Validation (4-6 hours)
|
||||||
|
|
||||||
|
### 5.1 Create Deno Test Suite
|
||||||
|
|
||||||
|
- [ ] Create `tests/` directory (or migrate from existing `test/`)
|
||||||
|
- [ ] Create `tests/snmp_test.ts`: Test SNMP manager functionality
|
||||||
|
- [ ] Create `tests/config_test.ts`: Test configuration loading/saving
|
||||||
|
- [ ] Create `tests/cli_test.ts`: Test CLI parsing and command routing
|
||||||
|
- [ ] Create `tests/daemon_test.ts`: Test daemon logic
|
||||||
|
- [ ] Remove dependency on @git.zone/tstest and @push.rocks/tapbundle
|
||||||
|
- [ ] Use Deno's built-in test runner (`Deno.test()`)
|
||||||
|
|
||||||
|
### 5.2 Unit Tests
|
||||||
|
|
||||||
|
- [ ] Test SNMP connection with mock responses
|
||||||
|
- [ ] Test configuration validation
|
||||||
|
- [ ] Test UPS status parsing for different models
|
||||||
|
- [ ] Test group logic (redundant/non-redundant modes)
|
||||||
|
- [ ] Test threshold checking
|
||||||
|
- [ ] Test version comparison logic
|
||||||
|
|
||||||
|
### 5.3 Integration Tests
|
||||||
|
|
||||||
|
- [ ] Test CLI command parsing for all commands
|
||||||
|
- [ ] Test config file creation and updates
|
||||||
|
- [ ] Test UPS add/edit/remove operations
|
||||||
|
- [ ] Test group add/edit/remove operations
|
||||||
|
- [ ] Mock systemd operations for testing
|
||||||
|
|
||||||
|
### 5.4 Binary Testing
|
||||||
|
|
||||||
|
- [ ] Test compiled binary on Linux x64
|
||||||
|
- [ ] Test compiled binary on Linux ARM64 (if available)
|
||||||
|
- [ ] Test compiled binary on macOS x64 (if available)
|
||||||
|
- [ ] Test compiled binary on macOS ARM64 (if available)
|
||||||
|
- [ ] Test compiled binary on Windows x64 (if available)
|
||||||
|
- [ ] Verify SNMP functionality works in compiled binary
|
||||||
|
- [ ] Verify config file operations work in compiled binary
|
||||||
|
- [ ] Test systemd integration with compiled binary
|
||||||
|
|
||||||
|
### 5.5 Performance Testing
|
||||||
|
|
||||||
|
- [ ] Measure binary size for each platform
|
||||||
|
- [ ] Measure startup time: `time ./nupst-linux-x64 --version`
|
||||||
|
- [ ] Measure memory footprint during daemon operation
|
||||||
|
- [ ] Compare with Node.js version performance
|
||||||
|
- [ ] Document performance metrics
|
||||||
|
|
||||||
|
### 5.6 Upgrade Path Testing
|
||||||
|
|
||||||
|
- [ ] Create test with v3.x config
|
||||||
|
- [ ] Verify v4.x can read existing config
|
||||||
|
- [ ] Test migration from old commands to new commands
|
||||||
|
- [ ] Verify systemd service upgrade path
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Phase 6: Distribution Strategy (2-3 hours)
|
||||||
|
|
||||||
|
### 6.1 GitHub Actions Workflow
|
||||||
|
|
||||||
|
- [ ] Create `.github/workflows/release.yml`:
|
||||||
|
```yaml
|
||||||
|
name: Release
|
||||||
|
on:
|
||||||
|
push:
|
||||||
|
tags:
|
||||||
|
- 'v*'
|
||||||
|
jobs:
|
||||||
|
build:
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
steps:
|
||||||
|
- uses: actions/checkout@v4
|
||||||
|
- uses: denoland/setup-deno@v1
|
||||||
|
with:
|
||||||
|
deno-version: v1.x
|
||||||
|
- name: Compile binaries
|
||||||
|
run: deno task compile
|
||||||
|
- name: Generate checksums
|
||||||
|
run: |
|
||||||
|
cd dist/binaries
|
||||||
|
sha256sum * > SHA256SUMS
|
||||||
|
- name: Create Release
|
||||||
|
uses: softprops/action-gh-release@v1
|
||||||
|
with:
|
||||||
|
files: dist/binaries/*
|
||||||
|
generate_release_notes: true
|
||||||
|
```
|
||||||
|
|
||||||
|
### 6.2 Update package.json for npm
|
||||||
|
|
||||||
|
- [ ] Update version to 4.0.0
|
||||||
|
- [ ] Update description to mention Deno
|
||||||
|
- [ ] Add postinstall script to symlink appropriate binary:
|
||||||
|
```json
|
||||||
|
{
|
||||||
|
"name": "@serve.zone/nupst",
|
||||||
|
"version": "4.0.0",
|
||||||
|
"description": "UPS Shutdown Tool - Deno-based single executable",
|
||||||
|
"bin": {
|
||||||
|
"nupst": "bin/nupst-npm-wrapper.js"
|
||||||
|
},
|
||||||
|
"type": "module",
|
||||||
|
"scripts": {
|
||||||
|
"postinstall": "node bin/setup-npm-binary.js"
|
||||||
|
},
|
||||||
|
"files": [
|
||||||
|
"dist/binaries/*",
|
||||||
|
"bin/*"
|
||||||
|
]
|
||||||
|
}
|
||||||
|
```
|
||||||
|
- [ ] Create `bin/setup-npm-binary.js` to symlink correct binary
|
||||||
|
- [ ] Create `bin/nupst-npm-wrapper.js` as entry point
|
||||||
|
|
||||||
|
### 6.3 Verify Distribution Methods
|
||||||
|
|
||||||
|
- [ ] Test GitHub release download and installation
|
||||||
|
- [ ] Test npm install from tarball
|
||||||
|
- [ ] Test direct install.sh script
|
||||||
|
- [ ] Verify all methods create working installation
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Phase 7: Documentation Updates (2-3 hours)
|
||||||
|
|
||||||
|
### 7.1 Update README.md
|
||||||
|
|
||||||
|
- [ ] Remove Node.js requirements section
|
||||||
|
- [ ] Update features list (mention Deno, single executable)
|
||||||
|
- [ ] Update installation methods:
|
||||||
|
- Method 1: Quick install script (updated)
|
||||||
|
- Method 2: GitHub releases (new)
|
||||||
|
- Method 3: npm (updated with notes)
|
||||||
|
- [ ] Update usage section with new command structure
|
||||||
|
- [ ] Add command mapping table (v3 → v4)
|
||||||
|
- [ ] Update platform support matrix (note: no Windows ARM)
|
||||||
|
- [ ] Update "System Changes" section (no vendor directory)
|
||||||
|
- [ ] Update security section (remove Node.js mentions)
|
||||||
|
- [ ] Update uninstallation instructions
|
||||||
|
|
||||||
|
### 7.2 Create MIGRATION.md
|
||||||
|
|
||||||
|
- [ ] Create detailed migration guide from v3.x to v4.x
|
||||||
|
- [ ] List all breaking changes:
|
||||||
|
1. CLI command structure reorganization
|
||||||
|
2. No Node.js requirement
|
||||||
|
3. Windows ARM not supported
|
||||||
|
4. Installation path changes
|
||||||
|
- [ ] Provide command mapping table
|
||||||
|
- [ ] Explain config compatibility
|
||||||
|
- [ ] Document upgrade procedure
|
||||||
|
- [ ] Add rollback instructions
|
||||||
|
|
||||||
|
### 7.3 Update CHANGELOG.md
|
||||||
|
|
||||||
|
- [ ] Add v4.0.0 section with all breaking changes
|
||||||
|
- [ ] List new features (Deno, single executable)
|
||||||
|
- [ ] List improvements (startup time, binary size)
|
||||||
|
- [ ] List removed features (Windows ARM, setup command alias)
|
||||||
|
- [ ] Migration guide reference
|
||||||
|
|
||||||
|
### 7.4 Update Help Text
|
||||||
|
|
||||||
|
- [ ] Ensure all help commands show new structure
|
||||||
|
- [ ] Add examples for common operations
|
||||||
|
- [ ] Include migration notes in help output
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Phase 8: Cleanup & Finalization (1 hour)
|
||||||
|
|
||||||
|
### 8.1 Remove Obsolete Files
|
||||||
|
|
||||||
|
- [ ] Delete `vendor/` directory (Node.js binaries)
|
||||||
|
- [ ] Delete `dist/` directory (old compiled JS)
|
||||||
|
- [ ] Delete `dist_ts/` directory (old compiled TS)
|
||||||
|
- [ ] Delete `node_modules/` directory
|
||||||
|
- [ ] Remove or update `tsconfig.json` (decide if needed for npm compatibility)
|
||||||
|
- [ ] Remove `setup.sh` if no longer needed
|
||||||
|
- [ ] Remove old test files in `test/` if migrated to `tests/`
|
||||||
|
- [ ] Delete `pnpm-lock.yaml`
|
||||||
|
|
||||||
|
### 8.2 Update Git Configuration
|
||||||
|
|
||||||
|
- [ ] Update `.gitignore`:
|
||||||
|
```
|
||||||
|
# Deno
|
||||||
|
.deno/
|
||||||
|
deno.lock
|
||||||
|
|
||||||
|
# Compiled binaries
|
||||||
|
dist/binaries/
|
||||||
|
|
||||||
|
# Old Node.js artifacts (to be removed)
|
||||||
|
node_modules/
|
||||||
|
vendor/
|
||||||
|
dist/
|
||||||
|
dist_ts/
|
||||||
|
pnpm-lock.yaml
|
||||||
|
```
|
||||||
|
- [ ] Add `deno.lock` to version control
|
||||||
|
- [ ] Create `.denoignore` if needed
|
||||||
|
|
||||||
|
### 8.3 Final Validation
|
||||||
|
|
||||||
|
- [ ] Run `deno check mod.ts` - verify no type errors
|
||||||
|
- [ ] Run `deno lint` - verify code quality
|
||||||
|
- [ ] Run `deno fmt --check` - verify formatting
|
||||||
|
- [ ] Run `deno task test` - verify all tests pass
|
||||||
|
- [ ] Run `deno task compile` - verify all binaries compile
|
||||||
|
- [ ] Test each binary manually
|
||||||
|
|
||||||
|
### 8.4 Prepare for Release
|
||||||
|
|
||||||
|
- [ ] Create git tag: `v4.0.0`
|
||||||
|
- [ ] Push to main branch
|
||||||
|
- [ ] Push tags to trigger release workflow
|
||||||
|
- [ ] Verify GitHub Actions workflow succeeds
|
||||||
|
- [ ] Verify binaries are attached to release
|
||||||
|
- [ ] Test installation from GitHub release
|
||||||
|
- [ ] Publish to npm: `npm publish`
|
||||||
|
- [ ] Test npm installation
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Rollback Strategy
|
||||||
|
|
||||||
|
If critical issues are discovered:
|
||||||
|
|
||||||
|
- [ ] Keep `v3.1.2` tag available for rollback
|
||||||
|
- [ ] Create `v3-stable` branch for continued v3 maintenance
|
||||||
|
- [ ] Update install.sh to offer v3/v4 choice
|
||||||
|
- [ ] Document known issues in GitHub Issues
|
||||||
|
- [ ] Provide downgrade instructions in docs
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Success Criteria Checklist
|
||||||
|
|
||||||
|
- [ ] ✅ All 5 platform binaries compile successfully
|
||||||
|
- [ ] ✅ Binary sizes are reasonable (< 100MB per platform)
|
||||||
|
- [ ] ✅ Startup time < 2 seconds
|
||||||
|
- [ ] ✅ SNMP v1/v2c/v3 functionality verified on real UPS device
|
||||||
|
- [ ] ✅ All CLI commands work with new structure
|
||||||
|
- [ ] ✅ Config file compatibility maintained
|
||||||
|
- [ ] ✅ Systemd integration works on Linux
|
||||||
|
- [ ] ✅ Installation scripts work on fresh systems
|
||||||
|
- [ ] ✅ npm package still installable and functional
|
||||||
|
- [ ] ✅ All tests pass
|
||||||
|
- [ ] ✅ Documentation is complete and accurate
|
||||||
|
- [ ] ✅ GitHub release created with binaries
|
||||||
|
- [ ] ✅ Migration guide tested by following it step-by-step
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Timeline
|
||||||
|
|
||||||
|
- **Phase 0**: 1 hour ✓ (in progress)
|
||||||
|
- **Phase 1**: 4-6 hours
|
||||||
|
- **Phase 2**: 3-4 hours
|
||||||
|
- **Phase 3**: 3-4 hours
|
||||||
|
- **Phase 4**: 2-3 hours
|
||||||
|
- **Phase 5**: 4-6 hours
|
||||||
|
- **Phase 6**: 2-3 hours
|
||||||
|
- **Phase 7**: 2-3 hours
|
||||||
|
- **Phase 8**: 1 hour
|
||||||
|
|
||||||
|
**Total Estimate**: 22-31 hours
|
||||||
|
|
||||||
|
---
|
||||||
|
|
||||||
|
## Notes & Decisions
|
||||||
|
|
||||||
|
### Key Decisions Made:
|
||||||
|
|
||||||
|
1. ✅ Use npm:net-snmp (no pure Deno SNMP library available)
|
||||||
|
2. ✅ Major version bump to 4.0.0 (breaking changes)
|
||||||
|
3. ✅ CLI reorganization with subcommands
|
||||||
|
4. ✅ Keep npm publishing alongside binary distribution
|
||||||
|
5. ✅ 5 platform targets (Windows ARM not supported by Deno yet)
|
||||||
|
|
||||||
|
### Open Questions:
|
||||||
|
|
||||||
|
- [ ] Should we keep tsconfig.json for npm package compatibility?
|
||||||
|
- [ ] Should we fully migrate to Deno APIs (Deno.readFile) or keep node:fs?
|
||||||
|
- [ ] Should we remove the `bin/nupst` wrapper or keep it?
|
||||||
|
- [ ] Should setup.sh be completely removed or kept for dependencies?
|
||||||
|
|
||||||
|
### Risk Areas:
|
||||||
|
|
||||||
|
- ⚠️ SNMP native addon compatibility in compiled binaries (HIGH PRIORITY TO TEST)
|
||||||
|
- ⚠️ Systemd integration with new binary structure
|
||||||
|
- ⚠️ Config migration from v3 to v4
|
||||||
|
- ⚠️ npm package installation with embedded binaries
|
||||||
@@ -0,0 +1,237 @@
|
|||||||
|
#!/usr/bin/env node
|
||||||
|
// deno-lint-ignore-file no-unused-vars
|
||||||
|
|
||||||
|
/**
|
||||||
|
* NUPST npm postinstall script
|
||||||
|
* Downloads the appropriate binary for the current platform from GitHub releases
|
||||||
|
*/
|
||||||
|
|
||||||
|
import { arch, platform } from 'os';
|
||||||
|
import { chmodSync, existsSync, mkdirSync, unlinkSync } from 'fs';
|
||||||
|
import { dirname, join } from 'path';
|
||||||
|
import { fileURLToPath } from 'url';
|
||||||
|
import https from 'https';
|
||||||
|
import { pipeline } from 'stream';
|
||||||
|
import { promisify } from 'util';
|
||||||
|
import { createWriteStream } from 'fs';
|
||||||
|
import process from "node:process";
|
||||||
|
|
||||||
|
const __filename = fileURLToPath(import.meta.url);
|
||||||
|
const __dirname = dirname(__filename);
|
||||||
|
const streamPipeline = promisify(pipeline);
|
||||||
|
|
||||||
|
// Configuration
|
||||||
|
const REPO_BASE = 'https://code.foss.global/serve.zone/nupst';
|
||||||
|
const VERSION = process.env.npm_package_version || '5.0.5';
|
||||||
|
|
||||||
|
function getBinaryInfo() {
|
||||||
|
const plat = platform();
|
||||||
|
const architecture = arch();
|
||||||
|
|
||||||
|
const platformMap = {
|
||||||
|
'darwin': 'macos',
|
||||||
|
'linux': 'linux',
|
||||||
|
'win32': 'windows',
|
||||||
|
};
|
||||||
|
|
||||||
|
const archMap = {
|
||||||
|
'x64': 'x64',
|
||||||
|
'arm64': 'arm64',
|
||||||
|
};
|
||||||
|
|
||||||
|
const mappedPlatform = platformMap[plat];
|
||||||
|
const mappedArch = archMap[architecture];
|
||||||
|
|
||||||
|
if (!mappedPlatform || !mappedArch) {
|
||||||
|
return { supported: false, platform: plat, arch: architecture };
|
||||||
|
}
|
||||||
|
|
||||||
|
let binaryName = `nupst-${mappedPlatform}-${mappedArch}`;
|
||||||
|
if (plat === 'win32') {
|
||||||
|
binaryName += '.exe';
|
||||||
|
}
|
||||||
|
|
||||||
|
return {
|
||||||
|
supported: true,
|
||||||
|
platform: mappedPlatform,
|
||||||
|
arch: mappedArch,
|
||||||
|
binaryName,
|
||||||
|
originalPlatform: plat,
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
function downloadFile(url, destination) {
|
||||||
|
return new Promise((resolve, reject) => {
|
||||||
|
console.log(`Downloading from: ${url}`);
|
||||||
|
|
||||||
|
// Follow redirects
|
||||||
|
const download = (url, redirectCount = 0) => {
|
||||||
|
if (redirectCount > 5) {
|
||||||
|
reject(new Error('Too many redirects'));
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
https.get(url, (response) => {
|
||||||
|
if (response.statusCode === 301 || response.statusCode === 302) {
|
||||||
|
console.log(`Following redirect to: ${response.headers.location}`);
|
||||||
|
download(response.headers.location, redirectCount + 1);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (response.statusCode !== 200) {
|
||||||
|
reject(new Error(`Failed to download: ${response.statusCode} ${response.statusMessage}`));
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
const totalSize = parseInt(response.headers['content-length'], 10);
|
||||||
|
let downloadedSize = 0;
|
||||||
|
let lastProgress = 0;
|
||||||
|
|
||||||
|
response.on('data', (chunk) => {
|
||||||
|
downloadedSize += chunk.length;
|
||||||
|
const progress = Math.round((downloadedSize / totalSize) * 100);
|
||||||
|
|
||||||
|
// Only log every 10% to reduce noise
|
||||||
|
if (progress >= lastProgress + 10) {
|
||||||
|
console.log(`Download progress: ${progress}%`);
|
||||||
|
lastProgress = progress;
|
||||||
|
}
|
||||||
|
});
|
||||||
|
|
||||||
|
const file = createWriteStream(destination);
|
||||||
|
|
||||||
|
pipeline(response, file, (err) => {
|
||||||
|
if (err) {
|
||||||
|
reject(err);
|
||||||
|
} else {
|
||||||
|
console.log('Download complete!');
|
||||||
|
resolve();
|
||||||
|
}
|
||||||
|
});
|
||||||
|
}).on('error', reject);
|
||||||
|
};
|
||||||
|
|
||||||
|
download(url);
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
async function main() {
|
||||||
|
console.log('===========================================');
|
||||||
|
console.log(' NUPST - Binary Installation');
|
||||||
|
console.log('===========================================');
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
const binaryInfo = getBinaryInfo();
|
||||||
|
|
||||||
|
if (!binaryInfo.supported) {
|
||||||
|
console.error(
|
||||||
|
`❌ Error: Unsupported platform/architecture: ${binaryInfo.platform}/${binaryInfo.arch}`,
|
||||||
|
);
|
||||||
|
console.error('');
|
||||||
|
console.error('Supported platforms:');
|
||||||
|
console.error(' • Linux (x64, arm64)');
|
||||||
|
console.error(' • macOS (x64, arm64)');
|
||||||
|
console.error(' • Windows (x64)');
|
||||||
|
console.error('');
|
||||||
|
console.error('If you believe your platform should be supported, please file an issue:');
|
||||||
|
console.error(' https://code.foss.global/serve.zone/nupst/issues');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
|
||||||
|
console.log(`Platform: ${binaryInfo.platform} (${binaryInfo.originalPlatform})`);
|
||||||
|
console.log(`Architecture: ${binaryInfo.arch}`);
|
||||||
|
console.log(`Binary: ${binaryInfo.binaryName}`);
|
||||||
|
console.log(`Version: ${VERSION}`);
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
// Create dist/binaries directory if it doesn't exist
|
||||||
|
const binariesDir = join(__dirname, '..', 'dist', 'binaries');
|
||||||
|
if (!existsSync(binariesDir)) {
|
||||||
|
console.log('Creating binaries directory...');
|
||||||
|
mkdirSync(binariesDir, { recursive: true });
|
||||||
|
}
|
||||||
|
|
||||||
|
const binaryPath = join(binariesDir, binaryInfo.binaryName);
|
||||||
|
|
||||||
|
// Check if binary already exists and skip download
|
||||||
|
if (existsSync(binaryPath)) {
|
||||||
|
console.log('✓ Binary already exists, skipping download');
|
||||||
|
} else {
|
||||||
|
// Construct download URL
|
||||||
|
// Try release URL first, fall back to raw branch if needed
|
||||||
|
const releaseUrl = `${REPO_BASE}/releases/download/v${VERSION}/${binaryInfo.binaryName}`;
|
||||||
|
const fallbackUrl = `${REPO_BASE}/raw/branch/main/dist/binaries/${binaryInfo.binaryName}`;
|
||||||
|
|
||||||
|
console.log('Downloading platform-specific binary...');
|
||||||
|
console.log('This may take a moment depending on your connection speed.');
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
try {
|
||||||
|
// Try downloading from release
|
||||||
|
await downloadFile(releaseUrl, binaryPath);
|
||||||
|
} catch (err) {
|
||||||
|
console.log(`Release download failed: ${err.message}`);
|
||||||
|
console.log('Trying fallback URL...');
|
||||||
|
|
||||||
|
try {
|
||||||
|
// Try fallback URL
|
||||||
|
await downloadFile(fallbackUrl, binaryPath);
|
||||||
|
} catch (fallbackErr) {
|
||||||
|
console.error(`❌ Error: Failed to download binary`);
|
||||||
|
console.error(` Primary URL: ${releaseUrl}`);
|
||||||
|
console.error(` Fallback URL: ${fallbackUrl}`);
|
||||||
|
console.error('');
|
||||||
|
console.error('This might be because:');
|
||||||
|
console.error('1. The release has not been created yet');
|
||||||
|
console.error('2. Network connectivity issues');
|
||||||
|
console.error('3. The version specified does not exist');
|
||||||
|
console.error('');
|
||||||
|
console.error('You can try:');
|
||||||
|
console.error('1. Installing from source: https://code.foss.global/serve.zone/nupst');
|
||||||
|
console.error('2. Downloading the binary manually from the releases page');
|
||||||
|
console.error(
|
||||||
|
'3. Using the install script: curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash',
|
||||||
|
);
|
||||||
|
|
||||||
|
// Clean up partial download
|
||||||
|
if (existsSync(binaryPath)) {
|
||||||
|
unlinkSync(binaryPath);
|
||||||
|
}
|
||||||
|
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
console.log(`✓ Binary downloaded successfully`);
|
||||||
|
}
|
||||||
|
|
||||||
|
// On Unix-like systems, ensure the binary is executable
|
||||||
|
if (binaryInfo.originalPlatform !== 'win32') {
|
||||||
|
try {
|
||||||
|
console.log('Setting executable permissions...');
|
||||||
|
chmodSync(binaryPath, 0o755);
|
||||||
|
console.log('✓ Binary permissions updated');
|
||||||
|
} catch (err) {
|
||||||
|
console.error(`⚠️ Warning: Could not set executable permissions: ${err.message}`);
|
||||||
|
console.error(' You may need to manually run:');
|
||||||
|
console.error(` chmod +x ${binaryPath}`);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
console.log('✅ NUPST installation completed successfully!');
|
||||||
|
console.log('');
|
||||||
|
console.log('You can now use NUPST by running:');
|
||||||
|
console.log(' nupst --help');
|
||||||
|
console.log('');
|
||||||
|
console.log('For initial setup, run:');
|
||||||
|
console.log(' sudo nupst ups add');
|
||||||
|
console.log('');
|
||||||
|
console.log('===========================================');
|
||||||
|
}
|
||||||
|
|
||||||
|
// Run the installation
|
||||||
|
main().catch((err) => {
|
||||||
|
console.error(`❌ Installation failed: ${err.message}`);
|
||||||
|
process.exit(1);
|
||||||
|
});
|
||||||
Binary file not shown.
@@ -1,227 +0,0 @@
|
|||||||
#!/bin/bash
|
|
||||||
|
|
||||||
# NUPST Setup Script
|
|
||||||
# Downloads the appropriate Node.js binary for the current platform
|
|
||||||
|
|
||||||
# Find the directory where this script is located
|
|
||||||
SCRIPT_DIR="$( cd "$( dirname "${BASH_SOURCE[0]}" )" &> /dev/null && pwd )"
|
|
||||||
|
|
||||||
# Create vendor directory if it doesn't exist
|
|
||||||
mkdir -p "$SCRIPT_DIR/vendor"
|
|
||||||
|
|
||||||
# Get the latest LTS Node.js version
|
|
||||||
echo "Determining latest LTS Node.js version..."
|
|
||||||
NODE_VERSIONS_JSON=$(curl -s https://nodejs.org/dist/index.json)
|
|
||||||
if [ $? -ne 0 ]; then
|
|
||||||
echo "Warning: Could not fetch latest Node.js versions. Using fallback version."
|
|
||||||
NODE_VERSION="20.11.1" # Fallback to a recent LTS version
|
|
||||||
else
|
|
||||||
# Extract the latest LTS version (those marked with lts field)
|
|
||||||
NODE_VERSION=$(echo "$NODE_VERSIONS_JSON" | grep -o '"version":"v[0-9.]*".*"lts":[^,]*' | grep -v '"lts":false' | grep -o 'v[0-9.]*' | head -1 | cut -c 2-)
|
|
||||||
|
|
||||||
if [ -z "$NODE_VERSION" ]; then
|
|
||||||
echo "Warning: Could not determine latest LTS version. Using fallback version."
|
|
||||||
NODE_VERSION="20.11.1" # Fallback to a recent LTS version
|
|
||||||
else
|
|
||||||
echo "Latest Node.js LTS version: $NODE_VERSION"
|
|
||||||
fi
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Detect architecture
|
|
||||||
ARCH=$(uname -m)
|
|
||||||
OS=$(uname -s)
|
|
||||||
|
|
||||||
# Map architecture and OS to Node.js download URL
|
|
||||||
NODE_URL=""
|
|
||||||
NODE_DIR=""
|
|
||||||
case "$OS" in
|
|
||||||
Linux)
|
|
||||||
case "$ARCH" in
|
|
||||||
x86_64)
|
|
||||||
NODE_URL="https://nodejs.org/dist/v$NODE_VERSION/node-v$NODE_VERSION-linux-x64.tar.gz"
|
|
||||||
NODE_DIR="node-linux-x64"
|
|
||||||
;;
|
|
||||||
aarch64|arm64)
|
|
||||||
NODE_URL="https://nodejs.org/dist/v$NODE_VERSION/node-v$NODE_VERSION-linux-arm64.tar.gz"
|
|
||||||
NODE_DIR="node-linux-arm64"
|
|
||||||
;;
|
|
||||||
*)
|
|
||||||
echo "Unsupported architecture: $ARCH. Please install Node.js manually."
|
|
||||||
exit 1
|
|
||||||
;;
|
|
||||||
esac
|
|
||||||
;;
|
|
||||||
Darwin)
|
|
||||||
case "$ARCH" in
|
|
||||||
x86_64)
|
|
||||||
NODE_URL="https://nodejs.org/dist/v$NODE_VERSION/node-v$NODE_VERSION-darwin-x64.tar.gz"
|
|
||||||
NODE_DIR="node-darwin-x64"
|
|
||||||
;;
|
|
||||||
arm64)
|
|
||||||
NODE_URL="https://nodejs.org/dist/v$NODE_VERSION/node-v$NODE_VERSION-darwin-arm64.tar.gz"
|
|
||||||
NODE_DIR="node-darwin-arm64"
|
|
||||||
;;
|
|
||||||
*)
|
|
||||||
echo "Unsupported architecture: $ARCH. Please install Node.js manually."
|
|
||||||
exit 1
|
|
||||||
;;
|
|
||||||
esac
|
|
||||||
;;
|
|
||||||
*)
|
|
||||||
echo "Unsupported operating system: $OS. Please install Node.js manually."
|
|
||||||
exit 1
|
|
||||||
;;
|
|
||||||
esac
|
|
||||||
|
|
||||||
# Check if we already have the Node.js binary
|
|
||||||
if [ -f "$SCRIPT_DIR/vendor/$NODE_DIR/bin/node" ]; then
|
|
||||||
echo "Node.js binary already exists for $OS-$ARCH. Skipping download."
|
|
||||||
else
|
|
||||||
echo "Downloading Node.js v$NODE_VERSION for $OS-$ARCH..."
|
|
||||||
|
|
||||||
# Download and extract Node.js
|
|
||||||
TMP_FILE="$SCRIPT_DIR/vendor/node.tar.gz"
|
|
||||||
curl -L "$NODE_URL" -o "$TMP_FILE"
|
|
||||||
|
|
||||||
if [ $? -ne 0 ]; then
|
|
||||||
echo "Error downloading Node.js. Please check your internet connection and try again."
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Create target directory
|
|
||||||
mkdir -p "$SCRIPT_DIR/vendor/$NODE_DIR"
|
|
||||||
|
|
||||||
# Extract Node.js
|
|
||||||
tar -xzf "$TMP_FILE" -C "$SCRIPT_DIR/vendor"
|
|
||||||
|
|
||||||
# Move extracted files to the target directory
|
|
||||||
NODE_EXTRACT_DIR=$(find "$SCRIPT_DIR/vendor" -maxdepth 1 -name "node-v*" -type d | head -n 1)
|
|
||||||
if [ -d "$NODE_EXTRACT_DIR" ]; then
|
|
||||||
cp -R "$NODE_EXTRACT_DIR"/* "$SCRIPT_DIR/vendor/$NODE_DIR/"
|
|
||||||
rm -rf "$NODE_EXTRACT_DIR"
|
|
||||||
else
|
|
||||||
echo "Error extracting Node.js. Please try again."
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Clean up
|
|
||||||
rm "$TMP_FILE"
|
|
||||||
|
|
||||||
echo "Node.js v$NODE_VERSION for $OS-$ARCH has been downloaded and extracted."
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Remove any existing dist_ts directory
|
|
||||||
if [ -d "$SCRIPT_DIR/dist_ts" ]; then
|
|
||||||
echo "Removing existing dist_ts directory..."
|
|
||||||
rm -rf "$SCRIPT_DIR/dist_ts"
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Download dist_ts from npm registry
|
|
||||||
echo "Downloading dist_ts from npm registry..."
|
|
||||||
|
|
||||||
# Create temp directory
|
|
||||||
TEMP_DIR=$(mktemp -d)
|
|
||||||
|
|
||||||
# Get version from package.json
|
|
||||||
if [ -f "$SCRIPT_DIR/package.json" ]; then
|
|
||||||
echo "Reading version from package.json..."
|
|
||||||
# Extract version using grep and cut
|
|
||||||
VERSION=$(grep -o '"version": "[^"]*"' "$SCRIPT_DIR/package.json" | cut -d'"' -f4)
|
|
||||||
|
|
||||||
if [ -z "$VERSION" ]; then
|
|
||||||
echo "Error: Could not determine version from package.json."
|
|
||||||
rm -rf "$TEMP_DIR"
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
echo "Package version is $VERSION. Downloading matching package tarball..."
|
|
||||||
else
|
|
||||||
echo "Warning: package.json not found. Getting latest version from npm registry..."
|
|
||||||
VERSION=$(curl -s https://registry.npmjs.org/@serve.zone/nupst | grep -o '"latest":"[^"]*"' | cut -d'"' -f4)
|
|
||||||
|
|
||||||
if [ -z "$VERSION" ]; then
|
|
||||||
echo "Error: Could not determine version from npm registry."
|
|
||||||
rm -rf "$TEMP_DIR"
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
echo "Latest version is $VERSION. Using as fallback."
|
|
||||||
fi
|
|
||||||
|
|
||||||
# First try to download with the version from package.json
|
|
||||||
TARBALL_URL="https://registry.npmjs.org/@serve.zone/nupst/-/nupst-$VERSION.tgz"
|
|
||||||
TARBALL_PATH="$TEMP_DIR/nupst.tgz"
|
|
||||||
|
|
||||||
echo "Attempting to download version $VERSION from $TARBALL_URL..."
|
|
||||||
curl -sL "$TARBALL_URL" -o "$TARBALL_PATH"
|
|
||||||
|
|
||||||
# If download fails or file is empty, try to get the latest version from npm
|
|
||||||
if [ $? -ne 0 ] || [ ! -s "$TARBALL_PATH" ]; then
|
|
||||||
echo "Package version $VERSION not found on npm registry."
|
|
||||||
echo "Fetching latest version information from npm registry..."
|
|
||||||
|
|
||||||
# Get latest version from npm registry
|
|
||||||
NPM_REGISTRY_INFO=$(curl -s https://registry.npmjs.org/@serve.zone/nupst)
|
|
||||||
|
|
||||||
if [ $? -ne 0 ]; then
|
|
||||||
echo "Error: Could not connect to npm registry."
|
|
||||||
echo "Will attempt to build from source instead."
|
|
||||||
rm -rf "$TEMP_DIR"
|
|
||||||
mkdir -p "$SCRIPT_DIR/dist_ts"
|
|
||||||
BUILD_FROM_SOURCE=1
|
|
||||||
return 0
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Extract latest version
|
|
||||||
LATEST_VERSION=$(echo "$NPM_REGISTRY_INFO" | grep -o '"latest":"[^"]*"' | cut -d'"' -f4)
|
|
||||||
|
|
||||||
if [ -z "$LATEST_VERSION" ]; then
|
|
||||||
echo "Error: Could not determine latest version from npm registry."
|
|
||||||
echo "Will attempt to build from source instead."
|
|
||||||
rm -rf "$TEMP_DIR"
|
|
||||||
mkdir -p "$SCRIPT_DIR/dist_ts"
|
|
||||||
BUILD_FROM_SOURCE=1
|
|
||||||
return 0
|
|
||||||
fi
|
|
||||||
|
|
||||||
echo "Found latest version: $LATEST_VERSION. Downloading..."
|
|
||||||
|
|
||||||
TARBALL_URL="https://registry.npmjs.org/@serve.zone/nupst/-/nupst-$LATEST_VERSION.tgz"
|
|
||||||
TARBALL_PATH="$TEMP_DIR/nupst.tgz"
|
|
||||||
|
|
||||||
curl -sL "$TARBALL_URL" -o "$TARBALL_PATH"
|
|
||||||
|
|
||||||
if [ $? -ne 0 ] || [ ! -s "$TARBALL_PATH" ]; then
|
|
||||||
echo "Error: Failed to download any package version from npm registry."
|
|
||||||
echo "Installation cannot continue without the dist_ts directory."
|
|
||||||
rm -rf "$TEMP_DIR"
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Extract the tarball
|
|
||||||
mkdir -p "$TEMP_DIR/extract"
|
|
||||||
tar -xzf "$TARBALL_PATH" -C "$TEMP_DIR/extract"
|
|
||||||
|
|
||||||
# Copy dist_ts to the installation directory
|
|
||||||
if [ -d "$TEMP_DIR/extract/package/dist_ts" ]; then
|
|
||||||
echo "Copying dist_ts directory to installation..."
|
|
||||||
mkdir -p "$SCRIPT_DIR/dist_ts"
|
|
||||||
cp -R "$TEMP_DIR/extract/package/dist_ts/"* "$SCRIPT_DIR/dist_ts/"
|
|
||||||
else
|
|
||||||
echo "Error: dist_ts directory not found in the downloaded npm package."
|
|
||||||
rm -rf "$TEMP_DIR"
|
|
||||||
exit 1
|
|
||||||
fi
|
|
||||||
|
|
||||||
# Clean up
|
|
||||||
rm -rf "$TEMP_DIR"
|
|
||||||
|
|
||||||
echo "dist_ts directory successfully downloaded from npm registry."
|
|
||||||
|
|
||||||
# Make launcher script executable
|
|
||||||
chmod +x "$SCRIPT_DIR/bin/nupst"
|
|
||||||
|
|
||||||
echo "NUPST setup completed successfully."
|
|
||||||
echo "You can now run NUPST using: $SCRIPT_DIR/bin/nupst"
|
|
||||||
echo "To install NUPST globally, run: sudo ln -s $SCRIPT_DIR/bin/nupst /usr/local/bin/nupst"
|
|
||||||
+168
@@ -0,0 +1,168 @@
|
|||||||
|
#!/bin/bash
|
||||||
|
#
|
||||||
|
# Test fresh v4 installation from scratch
|
||||||
|
# Tests the most common user scenario: clean install using curl | bash
|
||||||
|
#
|
||||||
|
|
||||||
|
set -e
|
||||||
|
|
||||||
|
CONTAINER_NAME="nupst-test-fresh-v4"
|
||||||
|
|
||||||
|
echo "================================================"
|
||||||
|
echo " NUPST Fresh v4 Installation Test"
|
||||||
|
echo "================================================"
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
# Check if container already exists
|
||||||
|
if docker ps -a --format '{{.Names}}' | grep -q "^${CONTAINER_NAME}$"; then
|
||||||
|
echo "⚠️ Container ${CONTAINER_NAME} already exists"
|
||||||
|
read -p "Remove and recreate? (y/N): " -n 1 -r
|
||||||
|
echo
|
||||||
|
if [[ $REPLY =~ ^[Yy]$ ]]; then
|
||||||
|
echo "→ Stopping and removing existing container..."
|
||||||
|
docker stop ${CONTAINER_NAME} 2>/dev/null || true
|
||||||
|
docker rm ${CONTAINER_NAME} 2>/dev/null || true
|
||||||
|
else
|
||||||
|
echo "Exiting. Remove manually with: docker rm -f ${CONTAINER_NAME}"
|
||||||
|
exit 1
|
||||||
|
fi
|
||||||
|
fi
|
||||||
|
|
||||||
|
echo "→ Creating Docker container with systemd..."
|
||||||
|
docker run -d \
|
||||||
|
--name ${CONTAINER_NAME} \
|
||||||
|
--privileged \
|
||||||
|
--cgroupns=host \
|
||||||
|
-v /sys/fs/cgroup:/sys/fs/cgroup:rw \
|
||||||
|
ubuntu:22.04 \
|
||||||
|
/bin/bash -c "apt-get update && apt-get install -y systemd systemd-sysv && exec /sbin/init"
|
||||||
|
|
||||||
|
echo "→ Waiting for systemd to initialize..."
|
||||||
|
sleep 10
|
||||||
|
|
||||||
|
echo "→ Waiting for dpkg lock to be released..."
|
||||||
|
docker exec ${CONTAINER_NAME} bash -c "
|
||||||
|
while fuser /var/lib/dpkg/lock-frontend >/dev/null 2>&1; do
|
||||||
|
echo ' Waiting for dpkg lock...'
|
||||||
|
sleep 2
|
||||||
|
done
|
||||||
|
echo ' dpkg lock released'
|
||||||
|
"
|
||||||
|
|
||||||
|
echo "→ Installing prerequisites (curl)..."
|
||||||
|
docker exec ${CONTAINER_NAME} bash -c "
|
||||||
|
apt-get update -qq
|
||||||
|
apt-get install -y -qq curl
|
||||||
|
"
|
||||||
|
|
||||||
|
echo ""
|
||||||
|
echo "→ Installing NUPST v4 using curl | bash..."
|
||||||
|
echo " Command: curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | bash -s -- -y"
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
docker exec ${CONTAINER_NAME} bash -c "
|
||||||
|
curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | bash -s -- -y
|
||||||
|
"
|
||||||
|
|
||||||
|
echo ""
|
||||||
|
echo "================================================"
|
||||||
|
echo " Verifying Installation"
|
||||||
|
echo "================================================"
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
echo "→ Checking binary location..."
|
||||||
|
docker exec ${CONTAINER_NAME} bash -c "
|
||||||
|
if [ -f /opt/nupst/nupst ]; then
|
||||||
|
echo ' ✓ Binary exists at /opt/nupst/nupst'
|
||||||
|
ls -lh /opt/nupst/nupst
|
||||||
|
else
|
||||||
|
echo ' ✗ Binary not found at /opt/nupst/nupst'
|
||||||
|
exit 1
|
||||||
|
fi
|
||||||
|
"
|
||||||
|
|
||||||
|
echo ""
|
||||||
|
echo "→ Checking symlink..."
|
||||||
|
docker exec ${CONTAINER_NAME} bash -c "
|
||||||
|
if [ -L /usr/local/bin/nupst ]; then
|
||||||
|
echo ' ✓ Symlink exists at /usr/local/bin/nupst'
|
||||||
|
ls -lh /usr/local/bin/nupst
|
||||||
|
elif [ -L /usr/bin/nupst ]; then
|
||||||
|
echo ' ✓ Symlink exists at /usr/bin/nupst'
|
||||||
|
ls -lh /usr/bin/nupst
|
||||||
|
else
|
||||||
|
echo ' ✗ Symlink not found in /usr/local/bin or /usr/bin'
|
||||||
|
exit 1
|
||||||
|
fi
|
||||||
|
"
|
||||||
|
|
||||||
|
echo ""
|
||||||
|
echo "→ Checking PATH integration..."
|
||||||
|
docker exec ${CONTAINER_NAME} bash -c "
|
||||||
|
NUPST_PATH=\$(which nupst 2>/dev/null)
|
||||||
|
if [ -n \"\$NUPST_PATH\" ]; then
|
||||||
|
echo ' ✓ nupst found in PATH at: '\$NUPST_PATH
|
||||||
|
else
|
||||||
|
echo ' ✗ nupst not found in PATH'
|
||||||
|
echo ' PATH contents:'
|
||||||
|
echo \$PATH
|
||||||
|
exit 1
|
||||||
|
fi
|
||||||
|
"
|
||||||
|
|
||||||
|
echo ""
|
||||||
|
echo "→ Testing nupst command execution..."
|
||||||
|
docker exec ${CONTAINER_NAME} nupst --version
|
||||||
|
|
||||||
|
echo ""
|
||||||
|
echo "→ Creating minimal config for service test..."
|
||||||
|
docker exec ${CONTAINER_NAME} bash -c "
|
||||||
|
mkdir -p /etc/nupst
|
||||||
|
cat > /etc/nupst/config.json << 'EOF'
|
||||||
|
{
|
||||||
|
\"version\": \"4.0\",
|
||||||
|
\"upsDevices\": [],
|
||||||
|
\"groups\": [],
|
||||||
|
\"checkInterval\": 30000
|
||||||
|
}
|
||||||
|
EOF
|
||||||
|
echo ' ✓ Minimal config created'
|
||||||
|
"
|
||||||
|
|
||||||
|
echo ""
|
||||||
|
echo "→ Testing service creation..."
|
||||||
|
docker exec ${CONTAINER_NAME} bash -c "
|
||||||
|
echo ' Running: nupst service enable'
|
||||||
|
nupst service enable
|
||||||
|
|
||||||
|
if [ -f /etc/systemd/system/nupst.service ]; then
|
||||||
|
echo ' ✓ Service file created successfully'
|
||||||
|
else
|
||||||
|
echo ' ✗ Service file creation failed'
|
||||||
|
exit 1
|
||||||
|
fi
|
||||||
|
"
|
||||||
|
|
||||||
|
echo ""
|
||||||
|
echo "→ Checking if service is enabled..."
|
||||||
|
docker exec ${CONTAINER_NAME} systemctl is-enabled nupst
|
||||||
|
|
||||||
|
echo ""
|
||||||
|
echo "================================================"
|
||||||
|
echo " ✓ Fresh v4 Installation Test Complete"
|
||||||
|
echo "================================================"
|
||||||
|
echo ""
|
||||||
|
echo "Installation verified successfully:"
|
||||||
|
echo " • Binary installed to /opt/nupst/nupst"
|
||||||
|
echo " • Symlink created for global access"
|
||||||
|
echo " • nupst command available in PATH"
|
||||||
|
echo " • Command executes correctly"
|
||||||
|
echo " • Systemd service file created"
|
||||||
|
echo ""
|
||||||
|
echo "Useful commands:"
|
||||||
|
echo " docker exec -it ${CONTAINER_NAME} bash"
|
||||||
|
echo " docker exec ${CONTAINER_NAME} nupst --help"
|
||||||
|
echo " docker exec ${CONTAINER_NAME} nupst service status"
|
||||||
|
echo " docker stop ${CONTAINER_NAME}"
|
||||||
|
echo " docker rm -f ${CONTAINER_NAME}"
|
||||||
|
echo ""
|
||||||
Executable
+148
@@ -0,0 +1,148 @@
|
|||||||
|
#!/bin/bash
|
||||||
|
#
|
||||||
|
# Setup Docker container with systemd and install NUPST v3
|
||||||
|
# This creates a container from commit 806f81c6a057a2a5da586b96a231d391f12eb1bb (v3)
|
||||||
|
#
|
||||||
|
|
||||||
|
set -e
|
||||||
|
|
||||||
|
CONTAINER_NAME="nupst-test-v3"
|
||||||
|
V3_COMMIT="806f81c6a057a2a5da586b96a231d391f12eb1bb"
|
||||||
|
|
||||||
|
echo "================================================"
|
||||||
|
echo " NUPST v3 Test Container Setup"
|
||||||
|
echo "================================================"
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
# Check if container already exists
|
||||||
|
if docker ps -a --format '{{.Names}}' | grep -q "^${CONTAINER_NAME}$"; then
|
||||||
|
echo "⚠️ Container ${CONTAINER_NAME} already exists"
|
||||||
|
read -p "Remove and recreate? (y/N): " -n 1 -r
|
||||||
|
echo
|
||||||
|
if [[ $REPLY =~ ^[Yy]$ ]]; then
|
||||||
|
echo "→ Stopping and removing existing container..."
|
||||||
|
docker stop ${CONTAINER_NAME} 2>/dev/null || true
|
||||||
|
docker rm ${CONTAINER_NAME} 2>/dev/null || true
|
||||||
|
else
|
||||||
|
echo "Exiting. Remove manually with: docker rm -f ${CONTAINER_NAME}"
|
||||||
|
exit 1
|
||||||
|
fi
|
||||||
|
fi
|
||||||
|
|
||||||
|
echo "→ Creating Docker container (will install systemd)..."
|
||||||
|
docker run -d \
|
||||||
|
--name ${CONTAINER_NAME} \
|
||||||
|
--privileged \
|
||||||
|
--cgroupns=host \
|
||||||
|
-v /sys/fs/cgroup:/sys/fs/cgroup:rw \
|
||||||
|
ubuntu:22.04 \
|
||||||
|
/bin/bash -c "apt-get update && apt-get install -y systemd systemd-sysv && exec /sbin/init"
|
||||||
|
|
||||||
|
echo "→ Waiting for systemd to initialize..."
|
||||||
|
sleep 10
|
||||||
|
|
||||||
|
echo "→ Waiting for dpkg lock to be released..."
|
||||||
|
docker exec ${CONTAINER_NAME} bash -c "
|
||||||
|
while fuser /var/lib/dpkg/lock-frontend >/dev/null 2>&1; do
|
||||||
|
echo ' Waiting for dpkg lock...'
|
||||||
|
sleep 2
|
||||||
|
done
|
||||||
|
echo ' dpkg lock released'
|
||||||
|
"
|
||||||
|
|
||||||
|
echo "→ Installing prerequisites in container..."
|
||||||
|
docker exec ${CONTAINER_NAME} bash -c "
|
||||||
|
apt-get update -qq
|
||||||
|
apt-get install -y -qq git curl sudo jq
|
||||||
|
"
|
||||||
|
|
||||||
|
echo "→ Cloning NUPST v3 (commit ${V3_COMMIT})..."
|
||||||
|
docker exec ${CONTAINER_NAME} bash -c "
|
||||||
|
cd /opt
|
||||||
|
git clone https://code.foss.global/serve.zone/nupst.git
|
||||||
|
cd nupst
|
||||||
|
git checkout ${V3_COMMIT}
|
||||||
|
echo 'Checked out commit:'
|
||||||
|
git log -1 --oneline
|
||||||
|
"
|
||||||
|
|
||||||
|
echo "→ Running NUPST v3 installation directly (bypassing install.sh auto-update)..."
|
||||||
|
docker exec ${CONTAINER_NAME} bash -c "
|
||||||
|
cd /opt/nupst
|
||||||
|
# Run setup.sh directly to avoid install.sh trying to update to v4
|
||||||
|
bash setup.sh -y
|
||||||
|
"
|
||||||
|
|
||||||
|
echo "→ Creating NUPST configuration using real UPS data from .nogit/env.json..."
|
||||||
|
|
||||||
|
# Check if .nogit/env.json exists
|
||||||
|
if [ ! -f "../../.nogit/env.json" ]; then
|
||||||
|
echo "❌ Error: .nogit/env.json not found"
|
||||||
|
echo "This file contains test UPS credentials and is required for testing"
|
||||||
|
exit 1
|
||||||
|
fi
|
||||||
|
|
||||||
|
# Read UPS data from .nogit/env.json and create v3 config
|
||||||
|
docker exec ${CONTAINER_NAME} bash -c "mkdir -p /etc/nupst"
|
||||||
|
|
||||||
|
# Generate config from .nogit/env.json using jq
|
||||||
|
cat ../../.nogit/env.json | jq -r '
|
||||||
|
{
|
||||||
|
"upsList": [
|
||||||
|
{
|
||||||
|
"id": "test-ups-v1",
|
||||||
|
"name": "Test UPS (SNMP v1)",
|
||||||
|
"host": .testConfigV1.snmp.host,
|
||||||
|
"port": .testConfigV1.snmp.port,
|
||||||
|
"community": .testConfigV1.snmp.community,
|
||||||
|
"version": (.testConfigV1.snmp.version | tostring),
|
||||||
|
"batteryLowOID": "1.3.6.1.4.1.935.1.1.1.3.3.1.0",
|
||||||
|
"onBatteryOID": "1.3.6.1.4.1.935.1.1.1.3.3.2.0",
|
||||||
|
"shutdownCommand": "echo \"Shutdown triggered for test-ups-v1\""
|
||||||
|
},
|
||||||
|
{
|
||||||
|
"id": "test-ups-v3",
|
||||||
|
"name": "Test UPS (SNMP v3)",
|
||||||
|
"host": .testConfigV3.snmp.host,
|
||||||
|
"port": .testConfigV3.snmp.port,
|
||||||
|
"version": (.testConfigV3.snmp.version | tostring),
|
||||||
|
"securityLevel": .testConfigV3.snmp.securityLevel,
|
||||||
|
"username": .testConfigV3.snmp.username,
|
||||||
|
"authProtocol": .testConfigV3.snmp.authProtocol,
|
||||||
|
"authKey": .testConfigV3.snmp.authKey,
|
||||||
|
"batteryLowOID": "1.3.6.1.4.1.935.1.1.1.3.3.1.0",
|
||||||
|
"onBatteryOID": "1.3.6.1.4.1.935.1.1.1.3.3.2.0",
|
||||||
|
"shutdownCommand": "echo \"Shutdown triggered for test-ups-v3\""
|
||||||
|
}
|
||||||
|
],
|
||||||
|
"groups": []
|
||||||
|
}' | docker exec -i ${CONTAINER_NAME} tee /etc/nupst/config.json > /dev/null
|
||||||
|
|
||||||
|
echo " ✓ Real UPS config created at /etc/nupst/config.json (from .nogit/env.json)"
|
||||||
|
|
||||||
|
echo "→ Enabling NUPST systemd service..."
|
||||||
|
docker exec ${CONTAINER_NAME} bash -c "
|
||||||
|
nupst enable
|
||||||
|
"
|
||||||
|
|
||||||
|
echo "→ Starting NUPST service..."
|
||||||
|
docker exec ${CONTAINER_NAME} bash -c "
|
||||||
|
nupst start
|
||||||
|
"
|
||||||
|
|
||||||
|
echo ""
|
||||||
|
echo "================================================"
|
||||||
|
echo " ✓ NUPST v3 Container Ready"
|
||||||
|
echo "================================================"
|
||||||
|
echo ""
|
||||||
|
echo "Container name: ${CONTAINER_NAME}"
|
||||||
|
echo "NUPST version: v3 (commit ${V3_COMMIT})"
|
||||||
|
echo ""
|
||||||
|
echo "Useful commands:"
|
||||||
|
echo " docker exec -it ${CONTAINER_NAME} bash"
|
||||||
|
echo " docker exec ${CONTAINER_NAME} systemctl status nupst"
|
||||||
|
echo " docker exec ${CONTAINER_NAME} nupst --version"
|
||||||
|
echo " docker stop ${CONTAINER_NAME}"
|
||||||
|
echo " docker start ${CONTAINER_NAME}"
|
||||||
|
echo " docker rm -f ${CONTAINER_NAME}"
|
||||||
|
echo ""
|
||||||
+59
@@ -0,0 +1,59 @@
|
|||||||
|
#!/bin/bash
|
||||||
|
#
|
||||||
|
# Test migration from v3 to v4
|
||||||
|
# Run this after 01-setup-v3-container.sh
|
||||||
|
#
|
||||||
|
|
||||||
|
set -e
|
||||||
|
|
||||||
|
CONTAINER_NAME="nupst-test-v3"
|
||||||
|
|
||||||
|
echo "================================================"
|
||||||
|
echo " NUPST v3 → v4 Migration Test"
|
||||||
|
echo "================================================"
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
# Check if container exists
|
||||||
|
if ! docker ps --format '{{.Names}}' | grep -q "^${CONTAINER_NAME}$"; then
|
||||||
|
echo "❌ Container ${CONTAINER_NAME} is not running"
|
||||||
|
echo "Run ./01-setup-v3-container.sh first"
|
||||||
|
exit 1
|
||||||
|
fi
|
||||||
|
|
||||||
|
echo "→ Checking current NUPST status..."
|
||||||
|
docker exec ${CONTAINER_NAME} systemctl status nupst --no-pager || true
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
echo "→ Checking current version..."
|
||||||
|
docker exec ${CONTAINER_NAME} nupst --version
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
echo "→ Stopping v3 service..."
|
||||||
|
docker exec ${CONTAINER_NAME} systemctl stop nupst
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
echo "→ Running v4 installation from main branch (should auto-detect v3 and migrate)..."
|
||||||
|
echo " Using: curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | sudo bash"
|
||||||
|
docker exec ${CONTAINER_NAME} bash -c "
|
||||||
|
curl -sSL https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh | bash -s -- -y
|
||||||
|
"
|
||||||
|
|
||||||
|
echo "→ Checking service status after migration..."
|
||||||
|
docker exec ${CONTAINER_NAME} systemctl status nupst --no-pager || true
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
echo "→ Checking new version..."
|
||||||
|
docker exec ${CONTAINER_NAME} nupst --version
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
echo "→ Testing service commands..."
|
||||||
|
docker exec ${CONTAINER_NAME} nupst service status || true
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
echo "================================================"
|
||||||
|
echo " ✓ Migration Test Complete"
|
||||||
|
echo "================================================"
|
||||||
|
echo ""
|
||||||
|
echo "Check logs with:"
|
||||||
|
echo " docker exec ${CONTAINER_NAME} nupst service logs"
|
||||||
|
echo ""
|
||||||
Executable
+28
@@ -0,0 +1,28 @@
|
|||||||
|
#!/bin/bash
|
||||||
|
#
|
||||||
|
# Cleanup test container
|
||||||
|
#
|
||||||
|
|
||||||
|
set -e
|
||||||
|
|
||||||
|
CONTAINER_NAME="nupst-test-v3"
|
||||||
|
|
||||||
|
echo "================================================"
|
||||||
|
echo " Cleanup NUPST Test Container"
|
||||||
|
echo "================================================"
|
||||||
|
echo ""
|
||||||
|
|
||||||
|
if docker ps -a --format '{{.Names}}' | grep -q "^${CONTAINER_NAME}$"; then
|
||||||
|
echo "→ Stopping container..."
|
||||||
|
docker stop ${CONTAINER_NAME} 2>/dev/null || true
|
||||||
|
|
||||||
|
echo "→ Removing container..."
|
||||||
|
docker rm ${CONTAINER_NAME} 2>/dev/null || true
|
||||||
|
|
||||||
|
echo ""
|
||||||
|
echo "✓ Container ${CONTAINER_NAME} removed"
|
||||||
|
else
|
||||||
|
echo "Container ${CONTAINER_NAME} not found"
|
||||||
|
fi
|
||||||
|
|
||||||
|
echo ""
|
||||||
@@ -0,0 +1,158 @@
|
|||||||
|
# Manual Docker Testing Scripts
|
||||||
|
|
||||||
|
This directory contains scripts for manually testing NUPST installation and migration in Docker
|
||||||
|
containers with systemd support.
|
||||||
|
|
||||||
|
## Prerequisites
|
||||||
|
|
||||||
|
- Docker installed and running
|
||||||
|
- Privileged access (for systemd in container)
|
||||||
|
- Linux host (systemd container requirements)
|
||||||
|
|
||||||
|
## Test Scripts
|
||||||
|
|
||||||
|
### 1. `01-setup-v3-container.sh`
|
||||||
|
|
||||||
|
Creates a Docker container with systemd and installs NUPST v3.
|
||||||
|
|
||||||
|
**What it does:**
|
||||||
|
|
||||||
|
- Creates Ubuntu 22.04 container with systemd enabled
|
||||||
|
- Installs NUPST v3 from commit `806f81c6` (last v3 version)
|
||||||
|
- Enables and starts the systemd service
|
||||||
|
- Leaves container running for testing
|
||||||
|
|
||||||
|
**Usage:**
|
||||||
|
|
||||||
|
```bash
|
||||||
|
chmod +x 01-setup-v3-container.sh
|
||||||
|
./01-setup-v3-container.sh
|
||||||
|
```
|
||||||
|
|
||||||
|
**Container name:** `nupst-test-v3`
|
||||||
|
|
||||||
|
### 2. `02-test-v3-to-v4-migration.sh`
|
||||||
|
|
||||||
|
Tests the migration from v3 to v4.
|
||||||
|
|
||||||
|
**What it does:**
|
||||||
|
|
||||||
|
- Checks current v3 installation
|
||||||
|
- Pulls v4 code from `migration/deno-v4` branch
|
||||||
|
- Runs install.sh (should auto-detect and migrate)
|
||||||
|
- Verifies service is running with v4
|
||||||
|
- Tests basic commands
|
||||||
|
|
||||||
|
**Usage:**
|
||||||
|
|
||||||
|
```bash
|
||||||
|
chmod +x 02-test-v3-to-v4-migration.sh
|
||||||
|
./02-test-v3-to-v4-migration.sh
|
||||||
|
```
|
||||||
|
|
||||||
|
**Prerequisites:** Must run `01-setup-v3-container.sh` first
|
||||||
|
|
||||||
|
### 3. `03-cleanup.sh`
|
||||||
|
|
||||||
|
Removes the test container.
|
||||||
|
|
||||||
|
**Usage:**
|
||||||
|
|
||||||
|
```bash
|
||||||
|
chmod +x 03-cleanup.sh
|
||||||
|
./03-cleanup.sh
|
||||||
|
```
|
||||||
|
|
||||||
|
## Manual Testing Workflow
|
||||||
|
|
||||||
|
### Full Migration Test
|
||||||
|
|
||||||
|
1. **Set up v3 environment:**
|
||||||
|
```bash
|
||||||
|
./01-setup-v3-container.sh
|
||||||
|
```
|
||||||
|
|
||||||
|
2. **Verify v3 is working:**
|
||||||
|
```bash
|
||||||
|
docker exec nupst-test-v3 nupst --version
|
||||||
|
docker exec nupst-test-v3 systemctl status nupst
|
||||||
|
```
|
||||||
|
|
||||||
|
3. **Test migration to v4:**
|
||||||
|
```bash
|
||||||
|
./02-test-v3-to-v4-migration.sh
|
||||||
|
```
|
||||||
|
|
||||||
|
4. **Manual verification:**
|
||||||
|
```bash
|
||||||
|
# Enter container
|
||||||
|
docker exec -it nupst-test-v3 bash
|
||||||
|
|
||||||
|
# Inside container:
|
||||||
|
nupst --version # Should show v4.0.0
|
||||||
|
nupst service status # Should show running service
|
||||||
|
cat /etc/nupst/config.json # Config should be preserved
|
||||||
|
systemctl status nupst # Service should be active
|
||||||
|
```
|
||||||
|
|
||||||
|
5. **Cleanup:**
|
||||||
|
```bash
|
||||||
|
./03-cleanup.sh
|
||||||
|
```
|
||||||
|
|
||||||
|
## Useful Docker Commands
|
||||||
|
|
||||||
|
```bash
|
||||||
|
# Enter container shell
|
||||||
|
docker exec -it nupst-test-v3 bash
|
||||||
|
|
||||||
|
# Check service status
|
||||||
|
docker exec nupst-test-v3 systemctl status nupst
|
||||||
|
|
||||||
|
# View service logs
|
||||||
|
docker exec nupst-test-v3 journalctl -u nupst -n 50
|
||||||
|
|
||||||
|
# Check NUPST version
|
||||||
|
docker exec nupst-test-v3 nupst --version
|
||||||
|
|
||||||
|
# Run NUPST commands
|
||||||
|
docker exec nupst-test-v3 nupst service status
|
||||||
|
docker exec nupst-test-v3 nupst ups list
|
||||||
|
|
||||||
|
# Stop container
|
||||||
|
docker stop nupst-test-v3
|
||||||
|
|
||||||
|
# Start container
|
||||||
|
docker start nupst-test-v3
|
||||||
|
|
||||||
|
# Remove container
|
||||||
|
docker rm -f nupst-test-v3
|
||||||
|
```
|
||||||
|
|
||||||
|
## Notes
|
||||||
|
|
||||||
|
- The container runs with `--privileged` flag for systemd support
|
||||||
|
- Container uses Ubuntu 22.04 as base image
|
||||||
|
- v3 installation is from commit `806f81c6a057a2a5da586b96a231d391f12eb1bb`
|
||||||
|
- v4 migration pulls from `migration/deno-v4` branch
|
||||||
|
- All scripts are designed to be idempotent where possible
|
||||||
|
|
||||||
|
## Troubleshooting
|
||||||
|
|
||||||
|
### Container won't start
|
||||||
|
|
||||||
|
- Ensure Docker daemon is running
|
||||||
|
- Check you have privileged access
|
||||||
|
- Try: `docker logs nupst-test-v3`
|
||||||
|
|
||||||
|
### Systemd not working in container
|
||||||
|
|
||||||
|
- Requires Linux host (not macOS/Windows)
|
||||||
|
- Needs `--privileged` and cgroup volume mounts
|
||||||
|
- Check: `docker exec nupst-test-v3 systemctl --version`
|
||||||
|
|
||||||
|
### Migration fails
|
||||||
|
|
||||||
|
- Check logs: `docker exec nupst-test-v3 journalctl -xe`
|
||||||
|
- Verify install.sh ran: `docker exec nupst-test-v3 ls -la /opt/nupst/`
|
||||||
|
- Check service: `docker exec nupst-test-v3 systemctl status nupst`
|
||||||
@@ -0,0 +1,157 @@
|
|||||||
|
import { assert, assertEquals } from 'jsr:@std/assert@^1.0.0';
|
||||||
|
import { Logger } from '../ts/logger.ts';
|
||||||
|
|
||||||
|
// Create a Logger instance for testing
|
||||||
|
const logger = new Logger();
|
||||||
|
|
||||||
|
Deno.test('should create a logger instance', () => {
|
||||||
|
assert(logger instanceof Logger);
|
||||||
|
});
|
||||||
|
|
||||||
|
Deno.test('should log messages with different log levels', () => {
|
||||||
|
// We're not testing console output directly, just ensuring no errors
|
||||||
|
logger.log('Regular log message');
|
||||||
|
logger.error('Error message');
|
||||||
|
logger.warn('Warning message');
|
||||||
|
logger.success('Success message');
|
||||||
|
|
||||||
|
// Just assert that the test runs without errors
|
||||||
|
assert(true);
|
||||||
|
});
|
||||||
|
|
||||||
|
Deno.test('should create a logbox with title, content, and end', () => {
|
||||||
|
// Just ensuring no errors occur
|
||||||
|
logger.logBoxTitle('Test Box', 40);
|
||||||
|
logger.logBoxLine('This is a test line');
|
||||||
|
logger.logBoxEnd();
|
||||||
|
|
||||||
|
// Just assert that the test runs without errors
|
||||||
|
assert(true);
|
||||||
|
});
|
||||||
|
|
||||||
|
Deno.test('should handle width persistence between logbox calls', () => {
|
||||||
|
logger.logBoxTitle('Width Test', 45);
|
||||||
|
|
||||||
|
// These should use the width from the title
|
||||||
|
logger.logBoxLine('Line 1');
|
||||||
|
logger.logBoxLine('Line 2');
|
||||||
|
logger.logBoxEnd();
|
||||||
|
|
||||||
|
let errorThrown = false;
|
||||||
|
|
||||||
|
try {
|
||||||
|
// This should work fine after the reset in logBoxEnd
|
||||||
|
logger.logBoxTitle('New Box', 30);
|
||||||
|
logger.logBoxLine('New line');
|
||||||
|
logger.logBoxEnd();
|
||||||
|
} catch (_error) {
|
||||||
|
errorThrown = true;
|
||||||
|
}
|
||||||
|
|
||||||
|
assertEquals(errorThrown, false);
|
||||||
|
});
|
||||||
|
|
||||||
|
Deno.test('should use default width when no width is specified', () => {
|
||||||
|
// This should automatically use the default width instead of throwing
|
||||||
|
let errorThrown = false;
|
||||||
|
|
||||||
|
try {
|
||||||
|
logger.logBoxLine('This should use default width');
|
||||||
|
logger.logBoxEnd();
|
||||||
|
} catch (_error) {
|
||||||
|
errorThrown = true;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Verify no error was thrown
|
||||||
|
assertEquals(errorThrown, false);
|
||||||
|
});
|
||||||
|
|
||||||
|
Deno.test('should create a complete logbox in one call', () => {
|
||||||
|
// Just ensuring no errors occur
|
||||||
|
logger.logBox('Complete Box', [
|
||||||
|
'Line 1',
|
||||||
|
'Line 2',
|
||||||
|
'Line 3',
|
||||||
|
], 40);
|
||||||
|
|
||||||
|
// Just assert that the test runs without errors
|
||||||
|
assert(true);
|
||||||
|
});
|
||||||
|
|
||||||
|
Deno.test('should handle content that exceeds box width', () => {
|
||||||
|
// Just ensuring no errors occur when content is too long
|
||||||
|
logger.logBox('Truncation Test', [
|
||||||
|
'This line is way too long and should be truncated because it exceeds the available space',
|
||||||
|
], 30);
|
||||||
|
|
||||||
|
// Just assert that the test runs without errors
|
||||||
|
assert(true);
|
||||||
|
});
|
||||||
|
|
||||||
|
Deno.test('should create dividers with custom characters', () => {
|
||||||
|
// Just ensuring no errors occur
|
||||||
|
logger.logDivider(30);
|
||||||
|
logger.logDivider(20, '*');
|
||||||
|
|
||||||
|
// Just assert that the test runs without errors
|
||||||
|
assert(true);
|
||||||
|
});
|
||||||
|
|
||||||
|
Deno.test('should create divider with default width', () => {
|
||||||
|
// This should use the default width
|
||||||
|
logger.logDivider(undefined, '-');
|
||||||
|
|
||||||
|
// Just assert that the test runs without errors
|
||||||
|
assert(true);
|
||||||
|
});
|
||||||
|
|
||||||
|
Deno.test('Logger Demo', () => {
|
||||||
|
console.log('\n=== LOGGER DEMO ===\n');
|
||||||
|
|
||||||
|
// Basic logging
|
||||||
|
logger.log('Regular log message');
|
||||||
|
logger.error('Error message');
|
||||||
|
logger.warn('Warning message');
|
||||||
|
logger.success('Success message');
|
||||||
|
|
||||||
|
// Logbox with title, content lines, and end
|
||||||
|
logger.logBoxTitle('Configuration Loaded', 50);
|
||||||
|
logger.logBoxLine('SNMP Settings:');
|
||||||
|
logger.logBoxLine(' Host: 127.0.0.1');
|
||||||
|
logger.logBoxLine(' Port: 161');
|
||||||
|
logger.logBoxLine(' Version: 1');
|
||||||
|
logger.logBoxEnd();
|
||||||
|
|
||||||
|
// Complete logbox in one call
|
||||||
|
logger.logBox('UPS Status', [
|
||||||
|
'Power Status: onBattery',
|
||||||
|
'Battery Capacity: 75%',
|
||||||
|
'Runtime Remaining: 30 minutes',
|
||||||
|
], 45);
|
||||||
|
|
||||||
|
// Logbox with content that's too long for the width
|
||||||
|
logger.logBox('Truncation Example', [
|
||||||
|
'This line is short enough to fit within the box width',
|
||||||
|
'This line is way too long and will be truncated because it exceeds the available space for content within the logbox',
|
||||||
|
], 40);
|
||||||
|
|
||||||
|
// Demonstrating logbox width being remembered
|
||||||
|
logger.logBoxTitle('Width Persistence Example', 60);
|
||||||
|
logger.logBoxLine('These lines use the width from the title');
|
||||||
|
logger.logBoxLine('No need to specify the width again');
|
||||||
|
logger.logBoxEnd();
|
||||||
|
|
||||||
|
// Demonstrating default width
|
||||||
|
console.log('\nDefault Width Example:');
|
||||||
|
logger.logBoxLine('This line uses the default width');
|
||||||
|
logger.logBoxLine('Still using default width');
|
||||||
|
logger.logBoxEnd();
|
||||||
|
|
||||||
|
// Divider example
|
||||||
|
logger.log('\nDivider example:');
|
||||||
|
logger.logDivider(30);
|
||||||
|
logger.logDivider(30, '*');
|
||||||
|
logger.logDivider(undefined, '=');
|
||||||
|
|
||||||
|
assert(true);
|
||||||
|
});
|
||||||
@@ -0,0 +1,262 @@
|
|||||||
|
/**
|
||||||
|
* Showcase test for NUPST CLI outputs
|
||||||
|
* Demonstrates all the beautiful colored output features
|
||||||
|
*
|
||||||
|
* Run with: deno run --allow-all test/showcase.ts
|
||||||
|
*/
|
||||||
|
|
||||||
|
import { type ITableColumn, logger } from '../ts/logger.ts';
|
||||||
|
import { formatPowerStatus, getBatteryColor, symbols, theme } from '../ts/colors.ts';
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
console.log('═'.repeat(80));
|
||||||
|
logger.highlight('NUPST CLI OUTPUT SHOWCASE');
|
||||||
|
logger.dim('Demonstrating beautiful, colored terminal output');
|
||||||
|
console.log('═'.repeat(80));
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
// === 1. Basic Logging Methods ===
|
||||||
|
logger.logBoxTitle('Basic Logging Methods', 60, 'info');
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.log('Normal log message (default color)');
|
||||||
|
logger.success('Success message with ✓ symbol');
|
||||||
|
logger.error('Error message with ✗ symbol');
|
||||||
|
logger.warn('Warning message with ⚠ symbol');
|
||||||
|
logger.info('Info message with ℹ symbol');
|
||||||
|
logger.dim('Dim/secondary text for less important info');
|
||||||
|
logger.highlight('Highlighted/bold text for emphasis');
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxEnd();
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
// === 2. Colored Boxes ===
|
||||||
|
logger.logBoxTitle('Colored Box Styles', 60);
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxLine('Boxes can be styled with different colors:');
|
||||||
|
logger.logBoxEnd();
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
logger.logBox(
|
||||||
|
'Success Box (Green)',
|
||||||
|
[
|
||||||
|
'Used for successful operations',
|
||||||
|
'Installation complete, service started, etc.',
|
||||||
|
],
|
||||||
|
60,
|
||||||
|
'success',
|
||||||
|
);
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
logger.logBox(
|
||||||
|
'Error Box (Red)',
|
||||||
|
[
|
||||||
|
'Used for critical errors and failures',
|
||||||
|
'Configuration errors, connection failures, etc.',
|
||||||
|
],
|
||||||
|
60,
|
||||||
|
'error',
|
||||||
|
);
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
logger.logBox(
|
||||||
|
'Warning Box (Yellow)',
|
||||||
|
[
|
||||||
|
'Used for warnings and deprecations',
|
||||||
|
'Old command format, missing config, etc.',
|
||||||
|
],
|
||||||
|
60,
|
||||||
|
'warning',
|
||||||
|
);
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
logger.logBox(
|
||||||
|
'Info Box (Cyan)',
|
||||||
|
[
|
||||||
|
'Used for informational messages',
|
||||||
|
'Version info, update available, etc.',
|
||||||
|
],
|
||||||
|
60,
|
||||||
|
'info',
|
||||||
|
);
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
// === 3. Status Symbols ===
|
||||||
|
logger.logBoxTitle('Status Symbols', 60, 'info');
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxLine(`${symbols.running} Service Running`);
|
||||||
|
logger.logBoxLine(`${symbols.stopped} Service Stopped`);
|
||||||
|
logger.logBoxLine(`${symbols.starting} Service Starting`);
|
||||||
|
logger.logBoxLine(`${symbols.unknown} Status Unknown`);
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxLine(`${symbols.success} Operation Successful`);
|
||||||
|
logger.logBoxLine(`${symbols.error} Operation Failed`);
|
||||||
|
logger.logBoxLine(`${symbols.warning} Warning Condition`);
|
||||||
|
logger.logBoxLine(`${symbols.info} Information`);
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxEnd();
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
// === 4. Battery Level Colors ===
|
||||||
|
logger.logBoxTitle('Battery Level Color Coding', 60, 'info');
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxLine('Battery levels are color-coded:');
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxLine(` ${getBatteryColor(85)('85%')} - Good (green, ≥60%)`);
|
||||||
|
logger.logBoxLine(` ${getBatteryColor(45)('45%')} - Medium (yellow, 30-60%)`);
|
||||||
|
logger.logBoxLine(` ${getBatteryColor(15)('15%')} - Critical (red, <30%)`);
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxEnd();
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
// === 5. Power Status Formatting ===
|
||||||
|
logger.logBoxTitle('Power Status Formatting', 60, 'info');
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxLine(`Status: ${formatPowerStatus('online')}`);
|
||||||
|
logger.logBoxLine(`Status: ${formatPowerStatus('onBattery')}`);
|
||||||
|
logger.logBoxLine(`Status: ${formatPowerStatus('unknown')}`);
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxEnd();
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
// === 6. Table Formatting ===
|
||||||
|
const upsColumns: ITableColumn[] = [
|
||||||
|
{ header: 'ID', key: 'id' },
|
||||||
|
{ header: 'Name', key: 'name' },
|
||||||
|
{ header: 'Host', key: 'host' },
|
||||||
|
{
|
||||||
|
header: 'Status',
|
||||||
|
key: 'status',
|
||||||
|
color: (v) => {
|
||||||
|
if (v.includes('Online')) return theme.success(v);
|
||||||
|
if (v.includes('Battery')) return theme.warning(v);
|
||||||
|
return theme.dim(v);
|
||||||
|
},
|
||||||
|
},
|
||||||
|
{
|
||||||
|
header: 'Battery',
|
||||||
|
key: 'battery',
|
||||||
|
align: 'right',
|
||||||
|
color: (v) => {
|
||||||
|
const pct = parseInt(v);
|
||||||
|
return getBatteryColor(pct)(v);
|
||||||
|
},
|
||||||
|
},
|
||||||
|
{ header: 'Runtime', key: 'runtime', align: 'right' },
|
||||||
|
];
|
||||||
|
|
||||||
|
const upsData = [
|
||||||
|
{
|
||||||
|
id: 'ups-1',
|
||||||
|
name: 'Main UPS',
|
||||||
|
host: '192.168.1.10',
|
||||||
|
status: 'Online',
|
||||||
|
battery: '95%',
|
||||||
|
runtime: '45 min',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
id: 'ups-2',
|
||||||
|
name: 'Backup UPS',
|
||||||
|
host: '192.168.1.11',
|
||||||
|
status: 'On Battery',
|
||||||
|
battery: '42%',
|
||||||
|
runtime: '12 min',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
id: 'ups-3',
|
||||||
|
name: 'Critical UPS',
|
||||||
|
host: '192.168.1.12',
|
||||||
|
status: 'On Battery',
|
||||||
|
battery: '18%',
|
||||||
|
runtime: '5 min',
|
||||||
|
},
|
||||||
|
];
|
||||||
|
|
||||||
|
logger.logTable(upsColumns, upsData, 'UPS Devices');
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
// === 7. Group Table ===
|
||||||
|
const groupColumns: ITableColumn[] = [
|
||||||
|
{ header: 'ID', key: 'id' },
|
||||||
|
{ header: 'Name', key: 'name' },
|
||||||
|
{ header: 'Mode', key: 'mode' },
|
||||||
|
{ header: 'UPS Count', key: 'count', align: 'right' },
|
||||||
|
];
|
||||||
|
|
||||||
|
const groupData = [
|
||||||
|
{ id: 'dc-1', name: 'Data Center 1', mode: 'redundant', count: '3' },
|
||||||
|
{ id: 'office', name: 'Office Servers', mode: 'nonRedundant', count: '2' },
|
||||||
|
];
|
||||||
|
|
||||||
|
logger.logTable(groupColumns, groupData, 'UPS Groups');
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
// === 8. Service Status Example ===
|
||||||
|
logger.logBoxTitle('Service Status', 70, 'success');
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxLine(`Status: ${symbols.running} ${theme.statusActive('Active (Running)')}`);
|
||||||
|
logger.logBoxLine(`Enabled: ${symbols.success} ${theme.success('Yes')}`);
|
||||||
|
logger.logBoxLine(`Uptime: 2 days, 5 hours, 23 minutes`);
|
||||||
|
logger.logBoxLine(`PID: ${theme.dim('12345')}`);
|
||||||
|
logger.logBoxLine(`Memory: ${theme.dim('45.2 MB')}`);
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxEnd();
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
// === 9. Configuration Example ===
|
||||||
|
logger.logBoxTitle('Configuration', 70);
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxLine(`UPS Devices: ${theme.highlight('3')}`);
|
||||||
|
logger.logBoxLine(`Groups: ${theme.highlight('2')}`);
|
||||||
|
logger.logBoxLine(`Check Interval: ${theme.dim('30 seconds')}`);
|
||||||
|
logger.logBoxLine(`Config File: ${theme.path('/etc/nupst/config.json')}`);
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxEnd();
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
// === 10. Update Available Example ===
|
||||||
|
logger.logBoxTitle('Update Available', 70, 'warning');
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxLine(`Current Version: ${theme.dim('5.5.0')}`);
|
||||||
|
logger.logBoxLine(`Latest Version: ${theme.highlight('5.5.1')}`);
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxLine(`Run ${theme.command('sudo nupst upgrade')} to update`);
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxEnd();
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
// === 11. Error Example ===
|
||||||
|
logger.logBoxTitle('Error Example', 70, 'error');
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxLine(`${symbols.error} Failed to connect to UPS at 192.168.1.10`);
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxLine('Possible causes:');
|
||||||
|
logger.logBoxLine(` ${theme.dim('• UPS is offline or unreachable')}`);
|
||||||
|
logger.logBoxLine(` ${theme.dim('• Incorrect SNMP community string')}`);
|
||||||
|
logger.logBoxLine(` ${theme.dim('• Firewall blocking port 161')}`);
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxLine(`Try: ${theme.command('nupst ups test --debug')}`);
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxEnd();
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
// === Final Summary ===
|
||||||
|
console.log('═'.repeat(80));
|
||||||
|
logger.success('CLI Output Showcase Complete!');
|
||||||
|
logger.dim('All color and formatting features demonstrated');
|
||||||
|
console.log('═'.repeat(80));
|
||||||
|
console.log('');
|
||||||
+768
-297
File diff suppressed because it is too large
Load Diff
@@ -3,6 +3,6 @@
|
|||||||
*/
|
*/
|
||||||
export const commitinfo = {
|
export const commitinfo = {
|
||||||
name: '@serve.zone/nupst',
|
name: '@serve.zone/nupst',
|
||||||
version: '2.1.0',
|
version: '5.5.1',
|
||||||
description: 'Node.js UPS Shutdown Tool for SNMP-enabled UPS devices'
|
description: 'Network UPS Shutdown Tool - Monitor SNMP-enabled UPS devices and orchestrate graceful system shutdowns during power emergencies'
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -0,0 +1,70 @@
|
|||||||
|
import type { IActionConfig, IActionContext, TPowerStatus } from './actions/base-action.ts';
|
||||||
|
import type { IUpsStatus } from './ups-status.ts';
|
||||||
|
|
||||||
|
export interface IUpsActionSource {
|
||||||
|
id: string;
|
||||||
|
name: string;
|
||||||
|
actions?: IActionConfig[];
|
||||||
|
}
|
||||||
|
|
||||||
|
export type TUpsTriggerReason = IActionContext['triggerReason'];
|
||||||
|
|
||||||
|
export type TActionExecutionDecision =
|
||||||
|
| { type: 'suppressed'; message: string }
|
||||||
|
| { type: 'legacyShutdown'; reason: string }
|
||||||
|
| { type: 'skip' }
|
||||||
|
| { type: 'execute'; actions: IActionConfig[]; context: IActionContext };
|
||||||
|
|
||||||
|
export function buildUpsActionContext(
|
||||||
|
ups: IUpsActionSource,
|
||||||
|
status: IUpsStatus,
|
||||||
|
previousStatus: IUpsStatus | undefined,
|
||||||
|
triggerReason: TUpsTriggerReason,
|
||||||
|
timestamp: number = Date.now(),
|
||||||
|
): IActionContext {
|
||||||
|
return {
|
||||||
|
upsId: ups.id,
|
||||||
|
upsName: ups.name,
|
||||||
|
powerStatus: status.powerStatus as TPowerStatus,
|
||||||
|
batteryCapacity: status.batteryCapacity,
|
||||||
|
batteryRuntime: status.batteryRuntime,
|
||||||
|
previousPowerStatus: (previousStatus?.powerStatus || 'unknown') as TPowerStatus,
|
||||||
|
timestamp,
|
||||||
|
triggerReason,
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
export function decideUpsActionExecution(
|
||||||
|
isPaused: boolean,
|
||||||
|
ups: IUpsActionSource,
|
||||||
|
status: IUpsStatus,
|
||||||
|
previousStatus: IUpsStatus | undefined,
|
||||||
|
triggerReason: TUpsTriggerReason,
|
||||||
|
timestamp: number = Date.now(),
|
||||||
|
): TActionExecutionDecision {
|
||||||
|
if (isPaused) {
|
||||||
|
return {
|
||||||
|
type: 'suppressed',
|
||||||
|
message: `[PAUSED] Actions suppressed for UPS ${ups.name} (trigger: ${triggerReason})`,
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
const actions = ups.actions || [];
|
||||||
|
|
||||||
|
if (actions.length === 0 && triggerReason === 'thresholdViolation') {
|
||||||
|
return {
|
||||||
|
type: 'legacyShutdown',
|
||||||
|
reason: `UPS "${ups.name}" battery or runtime below threshold`,
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
if (actions.length === 0) {
|
||||||
|
return { type: 'skip' };
|
||||||
|
}
|
||||||
|
|
||||||
|
return {
|
||||||
|
type: 'execute',
|
||||||
|
actions,
|
||||||
|
context: buildUpsActionContext(ups, status, previousStatus, triggerReason, timestamp),
|
||||||
|
};
|
||||||
|
}
|
||||||
@@ -0,0 +1,192 @@
|
|||||||
|
/**
|
||||||
|
* Base classes and interfaces for the NUPST action system
|
||||||
|
*
|
||||||
|
* Actions are triggered on:
|
||||||
|
* 1. Power status changes (online ↔ onBattery)
|
||||||
|
* 2. Threshold violations (battery/runtime cross below configured thresholds)
|
||||||
|
*/
|
||||||
|
|
||||||
|
export type TPowerStatus = 'online' | 'onBattery' | 'unknown' | 'unreachable';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Context provided to actions when they execute
|
||||||
|
* Contains all relevant UPS state and trigger information
|
||||||
|
*/
|
||||||
|
export interface IActionContext {
|
||||||
|
// UPS identification
|
||||||
|
/** Unique ID of the UPS */
|
||||||
|
upsId: string;
|
||||||
|
/** Human-readable name of the UPS */
|
||||||
|
upsName: string;
|
||||||
|
|
||||||
|
// Current state
|
||||||
|
/** Current power status */
|
||||||
|
powerStatus: TPowerStatus;
|
||||||
|
/** Current battery capacity percentage (0-100) */
|
||||||
|
batteryCapacity: number;
|
||||||
|
/** Estimated battery runtime in minutes */
|
||||||
|
batteryRuntime: number;
|
||||||
|
|
||||||
|
// State tracking
|
||||||
|
/** Previous power status before this trigger */
|
||||||
|
previousPowerStatus: TPowerStatus;
|
||||||
|
|
||||||
|
// Metadata
|
||||||
|
/** Timestamp when this action was triggered (milliseconds since epoch) */
|
||||||
|
timestamp: number;
|
||||||
|
/** Reason this action was triggered */
|
||||||
|
triggerReason: 'powerStatusChange' | 'thresholdViolation';
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Action trigger mode - determines when an action executes
|
||||||
|
*/
|
||||||
|
export type TActionTriggerMode =
|
||||||
|
| 'onlyPowerChanges' // Only on power status changes (online ↔ onBattery)
|
||||||
|
| 'onlyThresholds' // Only when action's thresholds are exceeded
|
||||||
|
| 'powerChangesAndThresholds' // On power changes OR threshold violations
|
||||||
|
| 'anyChange'; // On every UPS poll/check (every ~30s)
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Configuration for an action
|
||||||
|
*/
|
||||||
|
export interface IActionConfig {
|
||||||
|
/** Type of action to execute */
|
||||||
|
type: 'shutdown' | 'webhook' | 'script' | 'proxmox';
|
||||||
|
|
||||||
|
// Trigger configuration
|
||||||
|
/**
|
||||||
|
* When should this action be triggered?
|
||||||
|
* - onlyPowerChanges: Only on power status changes
|
||||||
|
* - onlyThresholds: Only when thresholds exceeded
|
||||||
|
* - powerChangesAndThresholds: On both (default)
|
||||||
|
* - anyChange: On every check
|
||||||
|
*/
|
||||||
|
triggerMode?: TActionTriggerMode;
|
||||||
|
|
||||||
|
// Threshold configuration (applies to all action types)
|
||||||
|
/** Threshold settings for this action */
|
||||||
|
thresholds?: {
|
||||||
|
/** Battery percentage threshold (0-100) */
|
||||||
|
battery: number;
|
||||||
|
/** Runtime threshold in minutes */
|
||||||
|
runtime: number;
|
||||||
|
};
|
||||||
|
|
||||||
|
// Shutdown action configuration
|
||||||
|
/** Delay before shutdown in minutes (default: 5) */
|
||||||
|
shutdownDelay?: number;
|
||||||
|
/** Only execute shutdown on threshold violation, not power status changes */
|
||||||
|
onlyOnThresholdViolation?: boolean;
|
||||||
|
|
||||||
|
// Webhook action configuration
|
||||||
|
/** URL to call for webhook */
|
||||||
|
webhookUrl?: string;
|
||||||
|
/** HTTP method to use (default: POST) */
|
||||||
|
webhookMethod?: 'GET' | 'POST';
|
||||||
|
/** Timeout for webhook request in milliseconds (default: 10000) */
|
||||||
|
webhookTimeout?: number;
|
||||||
|
/** Only execute webhook on threshold violation */
|
||||||
|
webhookOnlyOnThresholdViolation?: boolean;
|
||||||
|
|
||||||
|
// Script action configuration
|
||||||
|
/** Path to script relative to /etc/nupst (e.g., "myaction.sh") */
|
||||||
|
scriptPath?: string;
|
||||||
|
/** Timeout for script execution in milliseconds (default: 60000) */
|
||||||
|
scriptTimeout?: number;
|
||||||
|
/** Only execute script on threshold violation */
|
||||||
|
scriptOnlyOnThresholdViolation?: boolean;
|
||||||
|
|
||||||
|
// Proxmox action configuration
|
||||||
|
/** Proxmox API host (default: localhost) */
|
||||||
|
proxmoxHost?: string;
|
||||||
|
/** Proxmox API port (default: 8006) */
|
||||||
|
proxmoxPort?: number;
|
||||||
|
/** Proxmox node name (default: auto-detect via hostname) */
|
||||||
|
proxmoxNode?: string;
|
||||||
|
/** Proxmox API token ID (e.g., 'root@pam!nupst') */
|
||||||
|
proxmoxTokenId?: string;
|
||||||
|
/** Proxmox API token secret */
|
||||||
|
proxmoxTokenSecret?: string;
|
||||||
|
/** VM/CT IDs to exclude from shutdown */
|
||||||
|
proxmoxExcludeIds?: number[];
|
||||||
|
/** Timeout for VM/CT shutdown in seconds (default: 120) */
|
||||||
|
proxmoxStopTimeout?: number;
|
||||||
|
/** Force-stop VMs that don't shut down gracefully (default: true) */
|
||||||
|
proxmoxForceStop?: boolean;
|
||||||
|
/** Skip TLS verification for self-signed certificates (default: true) */
|
||||||
|
proxmoxInsecure?: boolean;
|
||||||
|
/** Proxmox operation mode: 'auto' detects CLI tools, 'cli' forces CLI, 'api' forces REST API (default: 'auto') */
|
||||||
|
proxmoxMode?: 'auto' | 'api' | 'cli';
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Abstract base class for all actions
|
||||||
|
* Each action type must extend this class and implement execute()
|
||||||
|
*/
|
||||||
|
export abstract class Action {
|
||||||
|
/** Type identifier for this action */
|
||||||
|
abstract readonly type: string;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create a new action with the given configuration
|
||||||
|
* @param config Action configuration
|
||||||
|
*/
|
||||||
|
constructor(protected config: IActionConfig) {}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Execute this action with the given context
|
||||||
|
* @param context Current UPS state and trigger information
|
||||||
|
*/
|
||||||
|
abstract execute(context: IActionContext): Promise<void>;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Helper to check if this action should execute based on trigger mode
|
||||||
|
* @param context Action context with current UPS state
|
||||||
|
* @returns True if action should execute
|
||||||
|
*/
|
||||||
|
protected shouldExecute(context: IActionContext): boolean {
|
||||||
|
const mode = this.config.triggerMode || 'powerChangesAndThresholds'; // Default
|
||||||
|
|
||||||
|
switch (mode) {
|
||||||
|
case 'onlyPowerChanges':
|
||||||
|
// Only execute on power status changes
|
||||||
|
return context.triggerReason === 'powerStatusChange';
|
||||||
|
|
||||||
|
case 'onlyThresholds':
|
||||||
|
// Only execute when this action's thresholds are exceeded
|
||||||
|
if (!this.config.thresholds) return false; // No thresholds = never execute
|
||||||
|
return this.areThresholdsExceeded(context.batteryCapacity, context.batteryRuntime);
|
||||||
|
|
||||||
|
case 'powerChangesAndThresholds':
|
||||||
|
// Execute on power changes OR when thresholds exceeded
|
||||||
|
if (context.triggerReason === 'powerStatusChange') return true;
|
||||||
|
if (!this.config.thresholds) return false;
|
||||||
|
return this.areThresholdsExceeded(context.batteryCapacity, context.batteryRuntime);
|
||||||
|
|
||||||
|
case 'anyChange':
|
||||||
|
// Execute on every trigger (power change or threshold check)
|
||||||
|
return true;
|
||||||
|
|
||||||
|
default:
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Check if current battery/runtime exceeds this action's thresholds
|
||||||
|
* @param batteryCapacity Current battery percentage
|
||||||
|
* @param batteryRuntime Current runtime in minutes
|
||||||
|
* @returns True if thresholds are exceeded
|
||||||
|
*/
|
||||||
|
protected areThresholdsExceeded(batteryCapacity: number, batteryRuntime: number): boolean {
|
||||||
|
if (!this.config.thresholds) {
|
||||||
|
return false; // No thresholds configured
|
||||||
|
}
|
||||||
|
|
||||||
|
return (
|
||||||
|
batteryCapacity < this.config.thresholds.battery ||
|
||||||
|
batteryRuntime < this.config.thresholds.runtime
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,96 @@
|
|||||||
|
/**
|
||||||
|
* Action system exports and ActionManager
|
||||||
|
*
|
||||||
|
* This module provides the central coordination for the action system.
|
||||||
|
* The ActionManager is responsible for creating and executing actions.
|
||||||
|
*/
|
||||||
|
|
||||||
|
import { logger } from '../logger.ts';
|
||||||
|
import type { Action, IActionConfig, IActionContext } from './base-action.ts';
|
||||||
|
import { ShutdownAction } from './shutdown-action.ts';
|
||||||
|
import { WebhookAction } from './webhook-action.ts';
|
||||||
|
import { ScriptAction } from './script-action.ts';
|
||||||
|
import { ProxmoxAction } from './proxmox-action.ts';
|
||||||
|
|
||||||
|
// Re-export types for convenience
|
||||||
|
export type { IActionConfig, IActionContext, TPowerStatus } from './base-action.ts';
|
||||||
|
export type { IWebhookPayload } from './webhook-action.ts';
|
||||||
|
export { Action } from './base-action.ts';
|
||||||
|
export { ShutdownAction } from './shutdown-action.ts';
|
||||||
|
export { WebhookAction } from './webhook-action.ts';
|
||||||
|
export { ScriptAction } from './script-action.ts';
|
||||||
|
export { ProxmoxAction } from './proxmox-action.ts';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* ActionManager - Coordinates action creation and execution
|
||||||
|
*
|
||||||
|
* Provides factory methods for creating actions from configuration
|
||||||
|
* and orchestrates action execution with error handling.
|
||||||
|
*/
|
||||||
|
export class ActionManager {
|
||||||
|
/**
|
||||||
|
* Create an action instance from configuration
|
||||||
|
* @param config Action configuration
|
||||||
|
* @returns Instantiated action
|
||||||
|
* @throws Error if action type is unknown
|
||||||
|
*/
|
||||||
|
static createAction(config: IActionConfig): Action {
|
||||||
|
switch (config.type) {
|
||||||
|
case 'shutdown':
|
||||||
|
return new ShutdownAction(config);
|
||||||
|
case 'webhook':
|
||||||
|
return new WebhookAction(config);
|
||||||
|
case 'script':
|
||||||
|
return new ScriptAction(config);
|
||||||
|
case 'proxmox':
|
||||||
|
return new ProxmoxAction(config);
|
||||||
|
default:
|
||||||
|
throw new Error(`Unknown action type: ${(config as IActionConfig).type}`);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Execute a sequence of actions with the given context
|
||||||
|
* Each action runs sequentially, and failures are logged but don't stop the chain
|
||||||
|
* @param actions Array of action configurations to execute
|
||||||
|
* @param context Action context with UPS state
|
||||||
|
*/
|
||||||
|
static async executeActions(
|
||||||
|
actions: IActionConfig[],
|
||||||
|
context: IActionContext,
|
||||||
|
): Promise<void> {
|
||||||
|
if (!actions || actions.length === 0) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
logger.log('');
|
||||||
|
logger.logBoxTitle(`Executing ${actions.length} Action(s)`, 60, 'info');
|
||||||
|
logger.logBoxLine(`Trigger: ${context.triggerReason}`);
|
||||||
|
logger.logBoxLine(`UPS: ${context.upsName} (${context.upsId})`);
|
||||||
|
logger.logBoxLine(`Power: ${context.powerStatus}`);
|
||||||
|
logger.logBoxLine(`Battery: ${context.batteryCapacity}% / ${context.batteryRuntime} min`);
|
||||||
|
logger.logBoxEnd();
|
||||||
|
logger.log('');
|
||||||
|
|
||||||
|
for (let i = 0; i < actions.length; i++) {
|
||||||
|
const actionConfig = actions[i];
|
||||||
|
try {
|
||||||
|
logger.info(`[${i + 1}/${actions.length}] ${actionConfig.type} action...`);
|
||||||
|
|
||||||
|
const action = this.createAction(actionConfig);
|
||||||
|
await action.execute(context);
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
`Action ${actionConfig.type} failed: ${
|
||||||
|
error instanceof Error ? error.message : String(error)
|
||||||
|
}`,
|
||||||
|
);
|
||||||
|
// Continue with next action despite failure
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
logger.log('');
|
||||||
|
logger.success('Action execution completed');
|
||||||
|
logger.log('');
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,580 @@
|
|||||||
|
import * as fs from 'node:fs';
|
||||||
|
import * as os from 'node:os';
|
||||||
|
import process from 'node:process';
|
||||||
|
import { execFile } from 'node:child_process';
|
||||||
|
import { promisify } from 'node:util';
|
||||||
|
import { Action, type IActionContext } from './base-action.ts';
|
||||||
|
import { logger } from '../logger.ts';
|
||||||
|
import { PROXMOX, UI } from '../constants.ts';
|
||||||
|
|
||||||
|
const execFileAsync = promisify(execFile);
|
||||||
|
|
||||||
|
/**
|
||||||
|
* ProxmoxAction - Gracefully shuts down Proxmox VMs and LXC containers
|
||||||
|
*
|
||||||
|
* Supports two operation modes:
|
||||||
|
* - CLI mode: Uses qm/pct commands directly (requires running as root on a Proxmox host)
|
||||||
|
* - API mode: Uses the Proxmox REST API via HTTPS with API token authentication
|
||||||
|
*
|
||||||
|
* In 'auto' mode (default), CLI is preferred when available, falling back to API.
|
||||||
|
*
|
||||||
|
* This action should be placed BEFORE shutdown actions in the action chain
|
||||||
|
* so that VMs are stopped before the host is shut down.
|
||||||
|
*/
|
||||||
|
export class ProxmoxAction extends Action {
|
||||||
|
readonly type = 'proxmox';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Check if Proxmox CLI tools (qm, pct) are available on the system
|
||||||
|
* Used by CLI wizards and by execute() for auto-detection
|
||||||
|
*/
|
||||||
|
static detectCliAvailability(): {
|
||||||
|
available: boolean;
|
||||||
|
qmPath: string | null;
|
||||||
|
pctPath: string | null;
|
||||||
|
isRoot: boolean;
|
||||||
|
} {
|
||||||
|
let qmPath: string | null = null;
|
||||||
|
let pctPath: string | null = null;
|
||||||
|
|
||||||
|
for (const dir of PROXMOX.CLI_TOOL_PATHS) {
|
||||||
|
if (!qmPath) {
|
||||||
|
const p = `${dir}/qm`;
|
||||||
|
try {
|
||||||
|
if (fs.existsSync(p)) qmPath = p;
|
||||||
|
} catch (_e) {
|
||||||
|
// continue
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if (!pctPath) {
|
||||||
|
const p = `${dir}/pct`;
|
||||||
|
try {
|
||||||
|
if (fs.existsSync(p)) pctPath = p;
|
||||||
|
} catch (_e) {
|
||||||
|
// continue
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
const isRoot = !!(process.getuid && process.getuid() === 0);
|
||||||
|
|
||||||
|
return {
|
||||||
|
available: qmPath !== null && pctPath !== null && isRoot,
|
||||||
|
qmPath,
|
||||||
|
pctPath,
|
||||||
|
isRoot,
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Resolve the operation mode based on config and environment
|
||||||
|
*/
|
||||||
|
private resolveMode(): { mode: 'api' | 'cli'; qmPath: string; pctPath: string } | { mode: 'api'; qmPath?: undefined; pctPath?: undefined } {
|
||||||
|
const configuredMode = this.config.proxmoxMode || 'auto';
|
||||||
|
|
||||||
|
if (configuredMode === 'api') {
|
||||||
|
return { mode: 'api' };
|
||||||
|
}
|
||||||
|
|
||||||
|
const detection = ProxmoxAction.detectCliAvailability();
|
||||||
|
|
||||||
|
if (configuredMode === 'cli') {
|
||||||
|
if (!detection.qmPath || !detection.pctPath) {
|
||||||
|
throw new Error('CLI mode requested but qm/pct not found. Are you on a Proxmox host?');
|
||||||
|
}
|
||||||
|
if (!detection.isRoot) {
|
||||||
|
throw new Error('CLI mode requires root access');
|
||||||
|
}
|
||||||
|
return { mode: 'cli', qmPath: detection.qmPath, pctPath: detection.pctPath };
|
||||||
|
}
|
||||||
|
|
||||||
|
// Auto-detect
|
||||||
|
if (detection.available && detection.qmPath && detection.pctPath) {
|
||||||
|
return { mode: 'cli', qmPath: detection.qmPath, pctPath: detection.pctPath };
|
||||||
|
}
|
||||||
|
return { mode: 'api' };
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Execute the Proxmox shutdown action
|
||||||
|
*/
|
||||||
|
async execute(context: IActionContext): Promise<void> {
|
||||||
|
if (!this.shouldExecute(context)) {
|
||||||
|
logger.info(
|
||||||
|
`Proxmox action skipped (trigger mode: ${
|
||||||
|
this.config.triggerMode || 'powerChangesAndThresholds'
|
||||||
|
})`,
|
||||||
|
);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
const resolved = this.resolveMode();
|
||||||
|
const node = this.config.proxmoxNode || os.hostname();
|
||||||
|
const excludeIds = new Set(this.config.proxmoxExcludeIds || []);
|
||||||
|
const stopTimeout = (this.config.proxmoxStopTimeout || PROXMOX.DEFAULT_STOP_TIMEOUT_SECONDS) * 1000;
|
||||||
|
const forceStop = this.config.proxmoxForceStop !== false; // default true
|
||||||
|
|
||||||
|
logger.log('');
|
||||||
|
logger.logBoxTitle('Proxmox VM Shutdown', UI.WIDE_BOX_WIDTH, 'warning');
|
||||||
|
logger.logBoxLine(`Mode: ${resolved.mode === 'cli' ? 'CLI (qm/pct)' : 'API (REST)'}`);
|
||||||
|
logger.logBoxLine(`Node: ${node}`);
|
||||||
|
if (resolved.mode === 'api') {
|
||||||
|
const host = this.config.proxmoxHost || PROXMOX.DEFAULT_HOST;
|
||||||
|
const port = this.config.proxmoxPort || PROXMOX.DEFAULT_PORT;
|
||||||
|
logger.logBoxLine(`API: ${host}:${port}`);
|
||||||
|
}
|
||||||
|
logger.logBoxLine(`UPS: ${context.upsName} (${context.powerStatus})`);
|
||||||
|
logger.logBoxLine(`Trigger: ${context.triggerReason}`);
|
||||||
|
if (excludeIds.size > 0) {
|
||||||
|
logger.logBoxLine(`Excluded IDs: ${[...excludeIds].join(', ')}`);
|
||||||
|
}
|
||||||
|
logger.logBoxEnd();
|
||||||
|
logger.log('');
|
||||||
|
|
||||||
|
try {
|
||||||
|
let runningVMs: Array<{ vmid: number; name: string }>;
|
||||||
|
let runningCTs: Array<{ vmid: number; name: string }>;
|
||||||
|
|
||||||
|
if (resolved.mode === 'cli') {
|
||||||
|
runningVMs = await this.getRunningVMsCli(resolved.qmPath);
|
||||||
|
runningCTs = await this.getRunningCTsCli(resolved.pctPath);
|
||||||
|
} else {
|
||||||
|
// API mode - validate token
|
||||||
|
const host = this.config.proxmoxHost || PROXMOX.DEFAULT_HOST;
|
||||||
|
const port = this.config.proxmoxPort || PROXMOX.DEFAULT_PORT;
|
||||||
|
const tokenId = this.config.proxmoxTokenId;
|
||||||
|
const tokenSecret = this.config.proxmoxTokenSecret;
|
||||||
|
const insecure = this.config.proxmoxInsecure !== false;
|
||||||
|
|
||||||
|
if (!tokenId || !tokenSecret) {
|
||||||
|
logger.error('Proxmox API token ID and secret are required for API mode');
|
||||||
|
logger.error('Either provide tokens or run on a Proxmox host as root for CLI mode');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
const baseUrl = `https://${host}:${port}${PROXMOX.API_BASE}`;
|
||||||
|
const headers: Record<string, string> = {
|
||||||
|
'Authorization': `PVEAPIToken=${tokenId}=${tokenSecret}`,
|
||||||
|
};
|
||||||
|
|
||||||
|
runningVMs = await this.getRunningVMsApi(baseUrl, node, headers, insecure);
|
||||||
|
runningCTs = await this.getRunningCTsApi(baseUrl, node, headers, insecure);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Filter out excluded IDs
|
||||||
|
const vmsToStop = runningVMs.filter((vm) => !excludeIds.has(vm.vmid));
|
||||||
|
const ctsToStop = runningCTs.filter((ct) => !excludeIds.has(ct.vmid));
|
||||||
|
|
||||||
|
const totalToStop = vmsToStop.length + ctsToStop.length;
|
||||||
|
if (totalToStop === 0) {
|
||||||
|
logger.info('No running VMs or containers to shut down');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
logger.info(`Shutting down ${vmsToStop.length} VMs and ${ctsToStop.length} containers...`);
|
||||||
|
|
||||||
|
// Send shutdown commands
|
||||||
|
if (resolved.mode === 'cli') {
|
||||||
|
for (const vm of vmsToStop) {
|
||||||
|
await this.shutdownVMCli(resolved.qmPath, vm.vmid);
|
||||||
|
logger.dim(` Shutdown sent to VM ${vm.vmid} (${vm.name || 'unnamed'})`);
|
||||||
|
}
|
||||||
|
for (const ct of ctsToStop) {
|
||||||
|
await this.shutdownCTCli(resolved.pctPath, ct.vmid);
|
||||||
|
logger.dim(` Shutdown sent to CT ${ct.vmid} (${ct.name || 'unnamed'})`);
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
const host = this.config.proxmoxHost || PROXMOX.DEFAULT_HOST;
|
||||||
|
const port = this.config.proxmoxPort || PROXMOX.DEFAULT_PORT;
|
||||||
|
const insecure = this.config.proxmoxInsecure !== false;
|
||||||
|
const baseUrl = `https://${host}:${port}${PROXMOX.API_BASE}`;
|
||||||
|
const headers: Record<string, string> = {
|
||||||
|
'Authorization': `PVEAPIToken=${this.config.proxmoxTokenId}=${this.config.proxmoxTokenSecret}`,
|
||||||
|
};
|
||||||
|
|
||||||
|
for (const vm of vmsToStop) {
|
||||||
|
await this.shutdownVMApi(baseUrl, node, vm.vmid, headers, insecure);
|
||||||
|
logger.dim(` Shutdown sent to VM ${vm.vmid} (${vm.name || 'unnamed'})`);
|
||||||
|
}
|
||||||
|
for (const ct of ctsToStop) {
|
||||||
|
await this.shutdownCTApi(baseUrl, node, ct.vmid, headers, insecure);
|
||||||
|
logger.dim(` Shutdown sent to CT ${ct.vmid} (${ct.name || 'unnamed'})`);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Poll until all stopped or timeout
|
||||||
|
const allIds = [
|
||||||
|
...vmsToStop.map((vm) => ({ type: 'qemu' as const, vmid: vm.vmid, name: vm.name })),
|
||||||
|
...ctsToStop.map((ct) => ({ type: 'lxc' as const, vmid: ct.vmid, name: ct.name })),
|
||||||
|
];
|
||||||
|
|
||||||
|
const remaining = await this.waitForShutdown(allIds, resolved, node, stopTimeout);
|
||||||
|
|
||||||
|
if (remaining.length > 0 && forceStop) {
|
||||||
|
logger.warn(`${remaining.length} VMs/CTs didn't shut down gracefully, force-stopping...`);
|
||||||
|
for (const item of remaining) {
|
||||||
|
try {
|
||||||
|
if (resolved.mode === 'cli') {
|
||||||
|
if (item.type === 'qemu') {
|
||||||
|
await this.stopVMCli(resolved.qmPath, item.vmid);
|
||||||
|
} else {
|
||||||
|
await this.stopCTCli(resolved.pctPath, item.vmid);
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
const host = this.config.proxmoxHost || PROXMOX.DEFAULT_HOST;
|
||||||
|
const port = this.config.proxmoxPort || PROXMOX.DEFAULT_PORT;
|
||||||
|
const insecure = this.config.proxmoxInsecure !== false;
|
||||||
|
const baseUrl = `https://${host}:${port}${PROXMOX.API_BASE}`;
|
||||||
|
const headers: Record<string, string> = {
|
||||||
|
'Authorization': `PVEAPIToken=${this.config.proxmoxTokenId}=${this.config.proxmoxTokenSecret}`,
|
||||||
|
};
|
||||||
|
if (item.type === 'qemu') {
|
||||||
|
await this.stopVMApi(baseUrl, node, item.vmid, headers, insecure);
|
||||||
|
} else {
|
||||||
|
await this.stopCTApi(baseUrl, node, item.vmid, headers, insecure);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
logger.dim(` Force-stopped ${item.type} ${item.vmid} (${item.name || 'unnamed'})`);
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
` Failed to force-stop ${item.type} ${item.vmid}: ${
|
||||||
|
error instanceof Error ? error.message : String(error)
|
||||||
|
}`,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} else if (remaining.length > 0) {
|
||||||
|
logger.warn(`${remaining.length} VMs/CTs still running (force-stop disabled)`);
|
||||||
|
}
|
||||||
|
|
||||||
|
logger.success('Proxmox shutdown sequence completed');
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
`Proxmox action failed: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// ─── CLI-based methods ─────────────────────────────────────────────
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get list of running QEMU VMs via qm list
|
||||||
|
*/
|
||||||
|
private async getRunningVMsCli(
|
||||||
|
qmPath: string,
|
||||||
|
): Promise<Array<{ vmid: number; name: string }>> {
|
||||||
|
try {
|
||||||
|
const { stdout } = await execFileAsync(qmPath, ['list']);
|
||||||
|
return this.parseQmList(stdout);
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
`Failed to list VMs via CLI: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
|
return [];
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get list of running LXC containers via pct list
|
||||||
|
*/
|
||||||
|
private async getRunningCTsCli(
|
||||||
|
pctPath: string,
|
||||||
|
): Promise<Array<{ vmid: number; name: string }>> {
|
||||||
|
try {
|
||||||
|
const { stdout } = await execFileAsync(pctPath, ['list']);
|
||||||
|
return this.parsePctList(stdout);
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
`Failed to list CTs via CLI: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
|
return [];
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Parse qm list output
|
||||||
|
* Format: VMID NAME STATUS MEM(MB) BOOTDISK(GB) PID
|
||||||
|
*/
|
||||||
|
private parseQmList(output: string): Array<{ vmid: number; name: string }> {
|
||||||
|
const results: Array<{ vmid: number; name: string }> = [];
|
||||||
|
const lines = output.trim().split('\n');
|
||||||
|
|
||||||
|
// Skip header line
|
||||||
|
for (let i = 1; i < lines.length; i++) {
|
||||||
|
const match = lines[i].match(/^\s*(\d+)\s+(\S+)\s+(running|stopped|paused)/);
|
||||||
|
if (match && match[3] === 'running') {
|
||||||
|
results.push({ vmid: parseInt(match[1], 10), name: match[2] });
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return results;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Parse pct list output
|
||||||
|
* Format: VMID Status Lock Name
|
||||||
|
*/
|
||||||
|
private parsePctList(output: string): Array<{ vmid: number; name: string }> {
|
||||||
|
const results: Array<{ vmid: number; name: string }> = [];
|
||||||
|
const lines = output.trim().split('\n');
|
||||||
|
|
||||||
|
// Skip header line
|
||||||
|
for (let i = 1; i < lines.length; i++) {
|
||||||
|
const match = lines[i].match(/^\s*(\d+)\s+(running|stopped)\s+\S*\s*(.*)/);
|
||||||
|
if (match && match[2] === 'running') {
|
||||||
|
results.push({ vmid: parseInt(match[1], 10), name: match[3]?.trim() || '' });
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return results;
|
||||||
|
}
|
||||||
|
|
||||||
|
private async shutdownVMCli(qmPath: string, vmid: number): Promise<void> {
|
||||||
|
await execFileAsync(qmPath, ['shutdown', String(vmid)]);
|
||||||
|
}
|
||||||
|
|
||||||
|
private async shutdownCTCli(pctPath: string, vmid: number): Promise<void> {
|
||||||
|
await execFileAsync(pctPath, ['shutdown', String(vmid)]);
|
||||||
|
}
|
||||||
|
|
||||||
|
private async stopVMCli(qmPath: string, vmid: number): Promise<void> {
|
||||||
|
await execFileAsync(qmPath, ['stop', String(vmid)]);
|
||||||
|
}
|
||||||
|
|
||||||
|
private async stopCTCli(pctPath: string, vmid: number): Promise<void> {
|
||||||
|
await execFileAsync(pctPath, ['stop', String(vmid)]);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get VM/CT status via CLI
|
||||||
|
* Returns the status string (e.g., 'running', 'stopped')
|
||||||
|
*/
|
||||||
|
private async getStatusCli(
|
||||||
|
toolPath: string,
|
||||||
|
vmid: number,
|
||||||
|
): Promise<string> {
|
||||||
|
const { stdout } = await execFileAsync(toolPath, ['status', String(vmid)]);
|
||||||
|
// Output format: "status: running\n"
|
||||||
|
const status = stdout.trim().split(':')[1]?.trim() || 'unknown';
|
||||||
|
return status;
|
||||||
|
}
|
||||||
|
|
||||||
|
// ─── API-based methods ─────────────────────────────────────────────
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Make an API request to the Proxmox server
|
||||||
|
*/
|
||||||
|
private async apiRequest(
|
||||||
|
url: string,
|
||||||
|
method: string,
|
||||||
|
headers: Record<string, string>,
|
||||||
|
insecure: boolean,
|
||||||
|
): Promise<unknown> {
|
||||||
|
const fetchOptions: RequestInit = {
|
||||||
|
method,
|
||||||
|
headers,
|
||||||
|
};
|
||||||
|
|
||||||
|
// Use NODE_TLS_REJECT_UNAUTHORIZED for insecure mode (self-signed certs)
|
||||||
|
if (insecure) {
|
||||||
|
// deno-lint-ignore no-explicit-any
|
||||||
|
(globalThis as any).process?.env && ((globalThis as any).process.env.NODE_TLS_REJECT_UNAUTHORIZED = '0');
|
||||||
|
}
|
||||||
|
|
||||||
|
try {
|
||||||
|
const response = await fetch(url, fetchOptions);
|
||||||
|
|
||||||
|
if (!response.ok) {
|
||||||
|
const body = await response.text();
|
||||||
|
throw new Error(`Proxmox API error ${response.status}: ${body}`);
|
||||||
|
}
|
||||||
|
|
||||||
|
return await response.json();
|
||||||
|
} finally {
|
||||||
|
// Restore TLS verification
|
||||||
|
if (insecure) {
|
||||||
|
// deno-lint-ignore no-explicit-any
|
||||||
|
(globalThis as any).process?.env && ((globalThis as any).process.env.NODE_TLS_REJECT_UNAUTHORIZED = '1');
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get list of running QEMU VMs via API
|
||||||
|
*/
|
||||||
|
private async getRunningVMsApi(
|
||||||
|
baseUrl: string,
|
||||||
|
node: string,
|
||||||
|
headers: Record<string, string>,
|
||||||
|
insecure: boolean,
|
||||||
|
): Promise<Array<{ vmid: number; name: string }>> {
|
||||||
|
try {
|
||||||
|
const response = await this.apiRequest(
|
||||||
|
`${baseUrl}/nodes/${node}/qemu`,
|
||||||
|
'GET',
|
||||||
|
headers,
|
||||||
|
insecure,
|
||||||
|
) as { data: Array<{ vmid: number; name: string; status: string }> };
|
||||||
|
|
||||||
|
return (response.data || [])
|
||||||
|
.filter((vm) => vm.status === 'running')
|
||||||
|
.map((vm) => ({ vmid: vm.vmid, name: vm.name || '' }));
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
`Failed to list VMs: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
|
return [];
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get list of running LXC containers via API
|
||||||
|
*/
|
||||||
|
private async getRunningCTsApi(
|
||||||
|
baseUrl: string,
|
||||||
|
node: string,
|
||||||
|
headers: Record<string, string>,
|
||||||
|
insecure: boolean,
|
||||||
|
): Promise<Array<{ vmid: number; name: string }>> {
|
||||||
|
try {
|
||||||
|
const response = await this.apiRequest(
|
||||||
|
`${baseUrl}/nodes/${node}/lxc`,
|
||||||
|
'GET',
|
||||||
|
headers,
|
||||||
|
insecure,
|
||||||
|
) as { data: Array<{ vmid: number; name: string; status: string }> };
|
||||||
|
|
||||||
|
return (response.data || [])
|
||||||
|
.filter((ct) => ct.status === 'running')
|
||||||
|
.map((ct) => ({ vmid: ct.vmid, name: ct.name || '' }));
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
`Failed to list CTs: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
|
return [];
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
private async shutdownVMApi(
|
||||||
|
baseUrl: string,
|
||||||
|
node: string,
|
||||||
|
vmid: number,
|
||||||
|
headers: Record<string, string>,
|
||||||
|
insecure: boolean,
|
||||||
|
): Promise<void> {
|
||||||
|
await this.apiRequest(
|
||||||
|
`${baseUrl}/nodes/${node}/qemu/${vmid}/status/shutdown`,
|
||||||
|
'POST',
|
||||||
|
headers,
|
||||||
|
insecure,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
private async shutdownCTApi(
|
||||||
|
baseUrl: string,
|
||||||
|
node: string,
|
||||||
|
vmid: number,
|
||||||
|
headers: Record<string, string>,
|
||||||
|
insecure: boolean,
|
||||||
|
): Promise<void> {
|
||||||
|
await this.apiRequest(
|
||||||
|
`${baseUrl}/nodes/${node}/lxc/${vmid}/status/shutdown`,
|
||||||
|
'POST',
|
||||||
|
headers,
|
||||||
|
insecure,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
private async stopVMApi(
|
||||||
|
baseUrl: string,
|
||||||
|
node: string,
|
||||||
|
vmid: number,
|
||||||
|
headers: Record<string, string>,
|
||||||
|
insecure: boolean,
|
||||||
|
): Promise<void> {
|
||||||
|
await this.apiRequest(
|
||||||
|
`${baseUrl}/nodes/${node}/qemu/${vmid}/status/stop`,
|
||||||
|
'POST',
|
||||||
|
headers,
|
||||||
|
insecure,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
private async stopCTApi(
|
||||||
|
baseUrl: string,
|
||||||
|
node: string,
|
||||||
|
vmid: number,
|
||||||
|
headers: Record<string, string>,
|
||||||
|
insecure: boolean,
|
||||||
|
): Promise<void> {
|
||||||
|
await this.apiRequest(
|
||||||
|
`${baseUrl}/nodes/${node}/lxc/${vmid}/status/stop`,
|
||||||
|
'POST',
|
||||||
|
headers,
|
||||||
|
insecure,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// ─── Shared methods ────────────────────────────────────────────────
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wait for VMs/CTs to shut down, return any that are still running after timeout
|
||||||
|
*/
|
||||||
|
private async waitForShutdown(
|
||||||
|
items: Array<{ type: 'qemu' | 'lxc'; vmid: number; name: string }>,
|
||||||
|
resolved: { mode: 'api' | 'cli'; qmPath?: string; pctPath?: string },
|
||||||
|
node: string,
|
||||||
|
timeout: number,
|
||||||
|
): Promise<Array<{ type: 'qemu' | 'lxc'; vmid: number; name: string }>> {
|
||||||
|
const startTime = Date.now();
|
||||||
|
let remaining = [...items];
|
||||||
|
|
||||||
|
while (remaining.length > 0 && (Date.now() - startTime) < timeout) {
|
||||||
|
// Wait before polling
|
||||||
|
await new Promise((resolve) => setTimeout(resolve, PROXMOX.STATUS_POLL_INTERVAL_SECONDS * 1000));
|
||||||
|
|
||||||
|
// Check which are still running
|
||||||
|
const stillRunning: typeof remaining = [];
|
||||||
|
|
||||||
|
for (const item of remaining) {
|
||||||
|
try {
|
||||||
|
let status: string;
|
||||||
|
|
||||||
|
if (resolved.mode === 'cli') {
|
||||||
|
const toolPath = item.type === 'qemu' ? resolved.qmPath! : resolved.pctPath!;
|
||||||
|
status = await this.getStatusCli(toolPath, item.vmid);
|
||||||
|
} else {
|
||||||
|
const host = this.config.proxmoxHost || PROXMOX.DEFAULT_HOST;
|
||||||
|
const port = this.config.proxmoxPort || PROXMOX.DEFAULT_PORT;
|
||||||
|
const insecure = this.config.proxmoxInsecure !== false;
|
||||||
|
const baseUrl = `https://${host}:${port}${PROXMOX.API_BASE}`;
|
||||||
|
const headers: Record<string, string> = {
|
||||||
|
'Authorization': `PVEAPIToken=${this.config.proxmoxTokenId}=${this.config.proxmoxTokenSecret}`,
|
||||||
|
};
|
||||||
|
const statusUrl = `${baseUrl}/nodes/${node}/${item.type}/${item.vmid}/status/current`;
|
||||||
|
const response = await this.apiRequest(statusUrl, 'GET', headers, insecure) as {
|
||||||
|
data: { status: string };
|
||||||
|
};
|
||||||
|
status = response.data?.status || 'unknown';
|
||||||
|
}
|
||||||
|
|
||||||
|
if (status === 'running') {
|
||||||
|
stillRunning.push(item);
|
||||||
|
} else {
|
||||||
|
logger.dim(` ${item.type} ${item.vmid} (${item.name}) stopped`);
|
||||||
|
}
|
||||||
|
} catch (_error) {
|
||||||
|
// If we can't check status, assume it might still be running
|
||||||
|
stillRunning.push(item);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
remaining = stillRunning;
|
||||||
|
|
||||||
|
if (remaining.length > 0) {
|
||||||
|
const elapsed = Math.round((Date.now() - startTime) / 1000);
|
||||||
|
logger.dim(` Waiting... ${remaining.length} still running (${elapsed}s elapsed)`);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return remaining;
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,171 @@
|
|||||||
|
import * as path from 'node:path';
|
||||||
|
import * as fs from 'node:fs';
|
||||||
|
import process from 'node:process';
|
||||||
|
import { exec } from 'node:child_process';
|
||||||
|
import { promisify } from 'node:util';
|
||||||
|
import { Action, type IActionContext } from './base-action.ts';
|
||||||
|
import { logger } from '../logger.ts';
|
||||||
|
|
||||||
|
const execAsync = promisify(exec);
|
||||||
|
|
||||||
|
/**
|
||||||
|
* ScriptAction - Executes a custom shell script from /etc/nupst/
|
||||||
|
*
|
||||||
|
* Runs user-provided scripts with UPS state passed as environment variables and arguments.
|
||||||
|
* Scripts must be .sh files located in /etc/nupst/ for security.
|
||||||
|
*/
|
||||||
|
export class ScriptAction extends Action {
|
||||||
|
readonly type = 'script';
|
||||||
|
|
||||||
|
private static readonly SCRIPT_DIR = '/etc/nupst';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Execute the script action
|
||||||
|
* @param context Action context with UPS state
|
||||||
|
*/
|
||||||
|
async execute(context: IActionContext): Promise<void> {
|
||||||
|
// Check if we should execute based on trigger mode
|
||||||
|
if (!this.shouldExecute(context)) {
|
||||||
|
logger.info(
|
||||||
|
`Script action skipped (trigger mode: ${
|
||||||
|
this.config.triggerMode || 'powerChangesAndThresholds'
|
||||||
|
})`,
|
||||||
|
);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!this.config.scriptPath) {
|
||||||
|
logger.error('Script path not configured');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Validate and build script path
|
||||||
|
const scriptPath = this.validateAndBuildScriptPath(this.config.scriptPath);
|
||||||
|
if (!scriptPath) {
|
||||||
|
logger.error(`Invalid script path: ${this.config.scriptPath}`);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Check if script exists and is executable
|
||||||
|
if (!fs.existsSync(scriptPath)) {
|
||||||
|
logger.error(`Script not found: ${scriptPath}`);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
const timeout = this.config.scriptTimeout || 60000; // Default 60 seconds
|
||||||
|
|
||||||
|
logger.info(`Executing script: ${scriptPath}`);
|
||||||
|
|
||||||
|
try {
|
||||||
|
await this.executeScript(scriptPath, context, timeout);
|
||||||
|
logger.success('Script executed successfully');
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
`Script execution failed: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
|
// Don't throw - script failures shouldn't stop other actions
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Validate script path and build full path
|
||||||
|
* Ensures security by preventing path traversal and limiting to /etc/nupst
|
||||||
|
* @param scriptPath Relative script path from config
|
||||||
|
* @returns Full validated path or null if invalid
|
||||||
|
*/
|
||||||
|
private validateAndBuildScriptPath(scriptPath: string): string | null {
|
||||||
|
// Remove any leading/trailing whitespace
|
||||||
|
scriptPath = scriptPath.trim();
|
||||||
|
|
||||||
|
// Reject paths with path traversal attempts
|
||||||
|
if (scriptPath.includes('..') || scriptPath.includes('/') || scriptPath.includes('\\')) {
|
||||||
|
logger.error('Script path must not contain directory separators or parent references');
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Require .sh extension
|
||||||
|
if (!scriptPath.endsWith('.sh')) {
|
||||||
|
logger.error('Script must have .sh extension');
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Build full path
|
||||||
|
return path.join(ScriptAction.SCRIPT_DIR, scriptPath);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Execute the script with UPS state as environment variables and arguments
|
||||||
|
* @param scriptPath Full path to the script
|
||||||
|
* @param context Action context
|
||||||
|
* @param timeout Execution timeout in milliseconds
|
||||||
|
*/
|
||||||
|
private async executeScript(
|
||||||
|
scriptPath: string,
|
||||||
|
context: IActionContext,
|
||||||
|
timeout: number,
|
||||||
|
): Promise<void> {
|
||||||
|
// Prepare environment variables
|
||||||
|
const env = {
|
||||||
|
...process.env,
|
||||||
|
NUPST_UPS_ID: context.upsId,
|
||||||
|
NUPST_UPS_NAME: context.upsName,
|
||||||
|
NUPST_POWER_STATUS: context.powerStatus,
|
||||||
|
NUPST_BATTERY_CAPACITY: String(context.batteryCapacity),
|
||||||
|
NUPST_BATTERY_RUNTIME: String(context.batteryRuntime),
|
||||||
|
NUPST_TRIGGER_REASON: context.triggerReason,
|
||||||
|
NUPST_TIMESTAMP: String(context.timestamp),
|
||||||
|
// Include action's own thresholds if configured
|
||||||
|
NUPST_BATTERY_THRESHOLD: this.config.thresholds ? String(this.config.thresholds.battery) : '',
|
||||||
|
NUPST_RUNTIME_THRESHOLD: this.config.thresholds ? String(this.config.thresholds.runtime) : '',
|
||||||
|
};
|
||||||
|
|
||||||
|
// Build command with arguments
|
||||||
|
// Arguments: powerStatus batteryCapacity batteryRuntime
|
||||||
|
const args = [
|
||||||
|
context.powerStatus,
|
||||||
|
String(context.batteryCapacity),
|
||||||
|
String(context.batteryRuntime),
|
||||||
|
].join(' ');
|
||||||
|
|
||||||
|
const command = `bash "${scriptPath}" ${args}`;
|
||||||
|
|
||||||
|
try {
|
||||||
|
const { stdout, stderr } = await execAsync(command, {
|
||||||
|
env,
|
||||||
|
cwd: ScriptAction.SCRIPT_DIR,
|
||||||
|
timeout,
|
||||||
|
});
|
||||||
|
|
||||||
|
// Log output
|
||||||
|
if (stdout) {
|
||||||
|
logger.log('Script stdout:');
|
||||||
|
logger.dim(stdout.trim());
|
||||||
|
}
|
||||||
|
|
||||||
|
if (stderr) {
|
||||||
|
logger.warn('Script stderr:');
|
||||||
|
logger.dim(stderr.trim());
|
||||||
|
}
|
||||||
|
} catch (error) {
|
||||||
|
// Check if it was a timeout
|
||||||
|
if (error instanceof Error && 'killed' in error && error.killed) {
|
||||||
|
throw new Error(`Script timed out after ${timeout}ms`);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Include stdout/stderr in error if available
|
||||||
|
if (error && typeof error === 'object' && 'stdout' in error && 'stderr' in error) {
|
||||||
|
const execError = error as { stdout: string; stderr: string };
|
||||||
|
if (execError.stdout) {
|
||||||
|
logger.log('Script stdout:');
|
||||||
|
logger.dim(execError.stdout.trim());
|
||||||
|
}
|
||||||
|
if (execError.stderr) {
|
||||||
|
logger.warn('Script stderr:');
|
||||||
|
logger.dim(execError.stderr.trim());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
throw error;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,240 @@
|
|||||||
|
import * as fs from 'node:fs';
|
||||||
|
import { execFile } from 'node:child_process';
|
||||||
|
import { promisify } from 'node:util';
|
||||||
|
import { Action, type IActionContext } from './base-action.ts';
|
||||||
|
import { logger } from '../logger.ts';
|
||||||
|
import { SHUTDOWN, UI } from '../constants.ts';
|
||||||
|
|
||||||
|
const execFileAsync = promisify(execFile);
|
||||||
|
|
||||||
|
/**
|
||||||
|
* ShutdownAction - Initiates system shutdown
|
||||||
|
*
|
||||||
|
* This action triggers a system shutdown using the standard shutdown command.
|
||||||
|
* It includes a configurable delay to allow VMs and services to gracefully terminate.
|
||||||
|
*/
|
||||||
|
export class ShutdownAction extends Action {
|
||||||
|
readonly type = 'shutdown';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Override shouldExecute to add shutdown-specific safety checks
|
||||||
|
*
|
||||||
|
* Key safety rules:
|
||||||
|
* 1. Shutdown should NEVER trigger unless UPS is actually on battery
|
||||||
|
* (low battery while on grid power is not an emergency - it's charging)
|
||||||
|
* 2. For power status changes, only trigger on transitions TO onBattery from online
|
||||||
|
* (ignore unknown → online at startup, and power restoration events)
|
||||||
|
* 3. For threshold violations, verify UPS is on battery before acting
|
||||||
|
*
|
||||||
|
* @param context Action context with UPS state
|
||||||
|
* @returns True if shutdown should execute
|
||||||
|
*/
|
||||||
|
protected override shouldExecute(context: IActionContext): boolean {
|
||||||
|
const mode = this.config.triggerMode || 'powerChangesAndThresholds';
|
||||||
|
|
||||||
|
// CRITICAL SAFETY CHECK: Shutdown should NEVER trigger unless UPS is on battery
|
||||||
|
// A low battery while on grid power is not an emergency (the battery is charging)
|
||||||
|
// When UPS is unreachable, we don't know the actual state - don't trigger false shutdown
|
||||||
|
if (context.powerStatus !== 'onBattery') {
|
||||||
|
if (context.powerStatus === 'unreachable') {
|
||||||
|
logger.info(
|
||||||
|
`Shutdown action skipped: UPS is unreachable (communication failure, actual state unknown)`,
|
||||||
|
);
|
||||||
|
} else {
|
||||||
|
logger.info(
|
||||||
|
`Shutdown action skipped: UPS is not on battery (status: ${context.powerStatus})`,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Handle threshold violations (UPS is confirmed on battery at this point)
|
||||||
|
if (context.triggerReason === 'thresholdViolation') {
|
||||||
|
// 'onlyPowerChanges' mode ignores thresholds
|
||||||
|
if (mode === 'onlyPowerChanges') {
|
||||||
|
logger.info('Shutdown action skipped: triggerMode is onlyPowerChanges, ignoring threshold');
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
// Check if thresholds are actually exceeded
|
||||||
|
return this.areThresholdsExceeded(context.batteryCapacity, context.batteryRuntime);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Handle power status changes
|
||||||
|
if (context.triggerReason === 'powerStatusChange') {
|
||||||
|
// 'onlyThresholds' mode ignores power status changes
|
||||||
|
if (mode === 'onlyThresholds') {
|
||||||
|
logger.info(
|
||||||
|
'Shutdown action skipped: triggerMode is onlyThresholds, ignoring power change',
|
||||||
|
);
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
const prev = context.previousPowerStatus;
|
||||||
|
|
||||||
|
// Only trigger on transitions TO onBattery from online (real power loss)
|
||||||
|
if (prev === 'online') {
|
||||||
|
logger.info('Shutdown action triggered: power loss detected (online → onBattery)');
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
// For unknown → onBattery (daemon started while on battery):
|
||||||
|
// This is a startup scenario - be cautious. The user may have just started
|
||||||
|
// the daemon for testing, or the UPS may have been on battery for a while.
|
||||||
|
// Only trigger if mode explicitly includes power changes.
|
||||||
|
if (prev === 'unknown') {
|
||||||
|
if (
|
||||||
|
mode === 'onlyPowerChanges' || mode === 'powerChangesAndThresholds' ||
|
||||||
|
mode === 'anyChange'
|
||||||
|
) {
|
||||||
|
logger.info(
|
||||||
|
'Shutdown action triggered: UPS on battery at daemon startup (unknown → onBattery)',
|
||||||
|
);
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Other transitions (e.g., onBattery → onBattery) should not trigger
|
||||||
|
logger.info(
|
||||||
|
`Shutdown action skipped: non-emergency transition (${prev} → ${context.powerStatus})`,
|
||||||
|
);
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
// For 'anyChange' mode, always execute (UPS is already confirmed on battery)
|
||||||
|
if (mode === 'anyChange') {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Execute the shutdown action
|
||||||
|
* @param context Action context with UPS state
|
||||||
|
*/
|
||||||
|
async execute(context: IActionContext): Promise<void> {
|
||||||
|
// Check if we should execute based on trigger mode and thresholds
|
||||||
|
if (!this.shouldExecute(context)) {
|
||||||
|
logger.info(
|
||||||
|
`Shutdown action skipped (trigger mode: ${
|
||||||
|
this.config.triggerMode || 'powerChangesAndThresholds'
|
||||||
|
})`,
|
||||||
|
);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
const shutdownDelay = this.config.shutdownDelay || SHUTDOWN.DEFAULT_DELAY_MINUTES;
|
||||||
|
|
||||||
|
logger.log('');
|
||||||
|
logger.logBoxTitle('Initiating System Shutdown', UI.WIDE_BOX_WIDTH, 'error');
|
||||||
|
logger.logBoxLine(`UPS: ${context.upsName} (${context.upsId})`);
|
||||||
|
logger.logBoxLine(`Power Status: ${context.powerStatus}`);
|
||||||
|
logger.logBoxLine(`Battery: ${context.batteryCapacity}%`);
|
||||||
|
logger.logBoxLine(`Runtime: ${context.batteryRuntime} minutes`);
|
||||||
|
logger.logBoxLine(`Trigger: ${context.triggerReason}`);
|
||||||
|
logger.logBoxLine(`Shutdown delay: ${shutdownDelay} minutes`);
|
||||||
|
logger.logBoxEnd();
|
||||||
|
logger.log('');
|
||||||
|
|
||||||
|
try {
|
||||||
|
await this.executeShutdownCommand(shutdownDelay);
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
`Shutdown command failed: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
|
// Try alternative methods
|
||||||
|
await this.tryAlternativeShutdownMethods();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Execute the primary shutdown command
|
||||||
|
* @param delayMinutes Minutes to delay before shutdown
|
||||||
|
*/
|
||||||
|
private async executeShutdownCommand(delayMinutes: number): Promise<void> {
|
||||||
|
// Find shutdown command in common system paths
|
||||||
|
const shutdownPaths = [
|
||||||
|
'/sbin/shutdown',
|
||||||
|
'/usr/sbin/shutdown',
|
||||||
|
'/bin/shutdown',
|
||||||
|
'/usr/bin/shutdown',
|
||||||
|
];
|
||||||
|
|
||||||
|
let shutdownCmd = '';
|
||||||
|
for (const path of shutdownPaths) {
|
||||||
|
try {
|
||||||
|
if (fs.existsSync(path)) {
|
||||||
|
shutdownCmd = path;
|
||||||
|
logger.log(`Found shutdown command at: ${shutdownCmd}`);
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
} catch (_e) {
|
||||||
|
// Continue checking other paths
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if (shutdownCmd) {
|
||||||
|
// Execute shutdown command with delay to allow for VM graceful shutdown
|
||||||
|
const message = `UPS battery critical, shutting down in ${delayMinutes} minutes`;
|
||||||
|
logger.log(`Executing: ${shutdownCmd} -h +${delayMinutes} "${message}"`);
|
||||||
|
|
||||||
|
const { stdout } = await execFileAsync(shutdownCmd, [
|
||||||
|
'-h',
|
||||||
|
`+${delayMinutes}`,
|
||||||
|
message,
|
||||||
|
]);
|
||||||
|
|
||||||
|
logger.log(`Shutdown initiated: ${stdout}`);
|
||||||
|
logger.log(`Allowing ${delayMinutes} minutes for VMs to shut down safely`);
|
||||||
|
} else {
|
||||||
|
throw new Error('Shutdown command not found in common paths');
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Try alternative shutdown methods if primary command fails
|
||||||
|
*/
|
||||||
|
private async tryAlternativeShutdownMethods(): Promise<void> {
|
||||||
|
logger.error('Trying alternative shutdown methods...');
|
||||||
|
|
||||||
|
const alternatives = [
|
||||||
|
{ cmd: 'poweroff', args: ['--force'] },
|
||||||
|
{ cmd: 'halt', args: ['-p'] },
|
||||||
|
{ cmd: 'systemctl', args: ['poweroff'] },
|
||||||
|
{ cmd: 'reboot', args: ['-p'] }, // Some systems allow reboot -p for power off
|
||||||
|
];
|
||||||
|
|
||||||
|
for (const alt of alternatives) {
|
||||||
|
try {
|
||||||
|
// First check if command exists in common system paths
|
||||||
|
const paths = [
|
||||||
|
`/sbin/${alt.cmd}`,
|
||||||
|
`/usr/sbin/${alt.cmd}`,
|
||||||
|
`/bin/${alt.cmd}`,
|
||||||
|
`/usr/bin/${alt.cmd}`,
|
||||||
|
];
|
||||||
|
|
||||||
|
let cmdPath = '';
|
||||||
|
for (const path of paths) {
|
||||||
|
if (fs.existsSync(path)) {
|
||||||
|
cmdPath = path;
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if (cmdPath) {
|
||||||
|
logger.log(`Trying alternative shutdown method: ${cmdPath} ${alt.args.join(' ')}`);
|
||||||
|
await execFileAsync(cmdPath, alt.args);
|
||||||
|
logger.log(`Alternative method ${alt.cmd} succeeded`);
|
||||||
|
return; // Exit if successful
|
||||||
|
}
|
||||||
|
} catch (_altError) {
|
||||||
|
logger.error(`Alternative method ${alt.cmd} failed`);
|
||||||
|
// Continue to next method
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
logger.error('All shutdown methods failed');
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,171 @@
|
|||||||
|
import * as http from 'node:http';
|
||||||
|
import * as https from 'node:https';
|
||||||
|
import { URL } from 'node:url';
|
||||||
|
import { Action, type IActionContext } from './base-action.ts';
|
||||||
|
import { logger } from '../logger.ts';
|
||||||
|
import { WEBHOOK } from '../constants.ts';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Payload sent to webhook endpoints
|
||||||
|
*/
|
||||||
|
export interface IWebhookPayload {
|
||||||
|
/** UPS ID */
|
||||||
|
upsId: string;
|
||||||
|
/** UPS name */
|
||||||
|
upsName: string;
|
||||||
|
/** Current power status */
|
||||||
|
powerStatus: 'online' | 'onBattery' | 'unknown' | 'unreachable';
|
||||||
|
/** Current battery capacity percentage */
|
||||||
|
batteryCapacity: number;
|
||||||
|
/** Current battery runtime in minutes */
|
||||||
|
batteryRuntime: number;
|
||||||
|
/** Reason this webhook was triggered */
|
||||||
|
triggerReason: 'powerStatusChange' | 'thresholdViolation';
|
||||||
|
/** Timestamp when webhook was triggered */
|
||||||
|
timestamp: number;
|
||||||
|
/** Thresholds configured for this action (if any) */
|
||||||
|
thresholds?: {
|
||||||
|
battery: number;
|
||||||
|
runtime: number;
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* WebhookAction - Calls an HTTP webhook with UPS state information
|
||||||
|
*
|
||||||
|
* Sends UPS status to a configured webhook URL via GET or POST.
|
||||||
|
* This is useful for remote notifications and integrations with external systems.
|
||||||
|
*/
|
||||||
|
export class WebhookAction extends Action {
|
||||||
|
readonly type = 'webhook';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Execute the webhook action
|
||||||
|
* @param context Action context with UPS state
|
||||||
|
*/
|
||||||
|
async execute(context: IActionContext): Promise<void> {
|
||||||
|
// Check if we should execute based on trigger mode
|
||||||
|
if (!this.shouldExecute(context)) {
|
||||||
|
logger.info(
|
||||||
|
`Webhook action skipped (trigger mode: ${
|
||||||
|
this.config.triggerMode || 'powerChangesAndThresholds'
|
||||||
|
})`,
|
||||||
|
);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!this.config.webhookUrl) {
|
||||||
|
logger.error('Webhook URL not configured');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
const method = this.config.webhookMethod || 'POST';
|
||||||
|
const timeout = this.config.webhookTimeout || WEBHOOK.DEFAULT_TIMEOUT_MS;
|
||||||
|
|
||||||
|
logger.info(`Calling webhook: ${method} ${this.config.webhookUrl}`);
|
||||||
|
|
||||||
|
try {
|
||||||
|
await this.callWebhook(context, method, timeout);
|
||||||
|
logger.success('Webhook call successful');
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
`Webhook call failed: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
|
// Don't throw - webhook failures shouldn't stop other actions
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Call the webhook with UPS state data
|
||||||
|
* @param context Action context
|
||||||
|
* @param method HTTP method (GET or POST)
|
||||||
|
* @param timeout Request timeout in milliseconds
|
||||||
|
*/
|
||||||
|
private callWebhook(
|
||||||
|
context: IActionContext,
|
||||||
|
method: 'GET' | 'POST',
|
||||||
|
timeout: number,
|
||||||
|
): Promise<void> {
|
||||||
|
const payload: IWebhookPayload = {
|
||||||
|
upsId: context.upsId,
|
||||||
|
upsName: context.upsName,
|
||||||
|
powerStatus: context.powerStatus,
|
||||||
|
batteryCapacity: context.batteryCapacity,
|
||||||
|
batteryRuntime: context.batteryRuntime,
|
||||||
|
triggerReason: context.triggerReason,
|
||||||
|
timestamp: context.timestamp,
|
||||||
|
};
|
||||||
|
|
||||||
|
// Include action's own thresholds if configured
|
||||||
|
if (this.config.thresholds) {
|
||||||
|
payload.thresholds = {
|
||||||
|
battery: this.config.thresholds.battery,
|
||||||
|
runtime: this.config.thresholds.runtime,
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
const url = new URL(this.config.webhookUrl!);
|
||||||
|
|
||||||
|
if (method === 'GET') {
|
||||||
|
// Append payload as query parameters for GET
|
||||||
|
url.searchParams.append('upsId', payload.upsId);
|
||||||
|
url.searchParams.append('upsName', payload.upsName);
|
||||||
|
url.searchParams.append('powerStatus', payload.powerStatus);
|
||||||
|
url.searchParams.append('batteryCapacity', String(payload.batteryCapacity));
|
||||||
|
url.searchParams.append('batteryRuntime', String(payload.batteryRuntime));
|
||||||
|
|
||||||
|
url.searchParams.append('triggerReason', payload.triggerReason);
|
||||||
|
url.searchParams.append('timestamp', String(payload.timestamp));
|
||||||
|
}
|
||||||
|
|
||||||
|
return new Promise((resolve, reject) => {
|
||||||
|
const protocol = url.protocol === 'https:' ? https : http;
|
||||||
|
|
||||||
|
const options: http.RequestOptions = {
|
||||||
|
method,
|
||||||
|
headers: method === 'POST'
|
||||||
|
? {
|
||||||
|
'Content-Type': 'application/json',
|
||||||
|
'User-Agent': 'nupst',
|
||||||
|
}
|
||||||
|
: {
|
||||||
|
'User-Agent': 'nupst',
|
||||||
|
},
|
||||||
|
timeout,
|
||||||
|
};
|
||||||
|
|
||||||
|
const req = protocol.request(url, options, (res) => {
|
||||||
|
let data = '';
|
||||||
|
|
||||||
|
res.on('data', (chunk) => {
|
||||||
|
data += chunk;
|
||||||
|
});
|
||||||
|
|
||||||
|
res.on('end', () => {
|
||||||
|
if (res.statusCode && res.statusCode >= 200 && res.statusCode < 300) {
|
||||||
|
logger.dim(`Webhook response (${res.statusCode}): ${data.substring(0, 100)}`);
|
||||||
|
resolve();
|
||||||
|
} else {
|
||||||
|
reject(new Error(`Webhook returned status ${res.statusCode}`));
|
||||||
|
}
|
||||||
|
});
|
||||||
|
});
|
||||||
|
|
||||||
|
req.on('error', (error) => {
|
||||||
|
reject(error);
|
||||||
|
});
|
||||||
|
|
||||||
|
req.on('timeout', () => {
|
||||||
|
req.destroy();
|
||||||
|
reject(new Error(`Webhook request timed out after ${timeout}ms`));
|
||||||
|
});
|
||||||
|
|
||||||
|
// Send POST data if applicable
|
||||||
|
if (method === 'POST') {
|
||||||
|
req.write(JSON.stringify(payload));
|
||||||
|
}
|
||||||
|
|
||||||
|
req.end();
|
||||||
|
});
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,503 @@
|
|||||||
|
import process from 'node:process';
|
||||||
|
import { Nupst } from '../nupst.ts';
|
||||||
|
import { type ITableColumn, logger } from '../logger.ts';
|
||||||
|
import { symbols, theme } from '../colors.ts';
|
||||||
|
import type { IActionConfig } from '../actions/base-action.ts';
|
||||||
|
import { ProxmoxAction } from '../actions/proxmox-action.ts';
|
||||||
|
import type { IGroupConfig, IUpsConfig } from '../daemon.ts';
|
||||||
|
import * as helpers from '../helpers/index.ts';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Class for handling action-related CLI commands
|
||||||
|
* Provides interface for managing UPS actions
|
||||||
|
*/
|
||||||
|
export class ActionHandler {
|
||||||
|
private readonly nupst: Nupst;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create a new action handler
|
||||||
|
* @param nupst Reference to the main Nupst instance
|
||||||
|
*/
|
||||||
|
constructor(nupst: Nupst) {
|
||||||
|
this.nupst = nupst;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Add a new action to a UPS or group
|
||||||
|
*/
|
||||||
|
public async add(targetId?: string): Promise<void> {
|
||||||
|
try {
|
||||||
|
if (!targetId) {
|
||||||
|
logger.error('Target ID is required');
|
||||||
|
logger.log(
|
||||||
|
` ${theme.dim('Usage:')} ${theme.command('nupst action add <ups-id|group-id>')}`,
|
||||||
|
);
|
||||||
|
logger.log('');
|
||||||
|
logger.log(` ${theme.dim('List UPS devices:')} ${theme.command('nupst ups list')}`);
|
||||||
|
logger.log(` ${theme.dim('List groups:')} ${theme.command('nupst group list')}`);
|
||||||
|
logger.log('');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
|
||||||
|
const config = await this.nupst.getDaemon().loadConfig();
|
||||||
|
|
||||||
|
// Check if it's a UPS
|
||||||
|
const ups = config.upsDevices.find((u) => u.id === targetId);
|
||||||
|
// Check if it's a group
|
||||||
|
const group = config.groups?.find((g) => g.id === targetId);
|
||||||
|
|
||||||
|
if (!ups && !group) {
|
||||||
|
logger.error(`UPS or Group with ID '${targetId}' not found`);
|
||||||
|
logger.log('');
|
||||||
|
logger.log(
|
||||||
|
` ${theme.dim('List available UPS devices:')} ${theme.command('nupst ups list')}`,
|
||||||
|
);
|
||||||
|
logger.log(` ${theme.dim('List available groups:')} ${theme.command('nupst group list')}`);
|
||||||
|
logger.log('');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
|
||||||
|
const target = ups || group;
|
||||||
|
const targetType = ups ? 'UPS' : 'Group';
|
||||||
|
const targetName = ups ? ups.name : group!.name;
|
||||||
|
|
||||||
|
await helpers.withPrompt(async (prompt) => {
|
||||||
|
logger.log('');
|
||||||
|
logger.info(`Add Action to ${targetType} ${theme.highlight(targetName)}`);
|
||||||
|
logger.log('');
|
||||||
|
|
||||||
|
// Action type selection
|
||||||
|
logger.log(` ${theme.dim('Action Type:')}`);
|
||||||
|
logger.log(` ${theme.dim('1)')} Shutdown (system shutdown)`);
|
||||||
|
logger.log(` ${theme.dim('2)')} Webhook (HTTP notification)`);
|
||||||
|
logger.log(` ${theme.dim('3)')} Custom Script (run .sh file from /etc/nupst)`);
|
||||||
|
logger.log(` ${theme.dim('4)')} Proxmox (gracefully shut down VMs/LXCs before host shutdown)`);
|
||||||
|
|
||||||
|
const typeInput = await prompt(` ${theme.dim('Select action type')} ${theme.dim('[1]:')} `);
|
||||||
|
const typeValue = parseInt(typeInput, 10) || 1;
|
||||||
|
|
||||||
|
const newAction: Partial<IActionConfig> = {};
|
||||||
|
|
||||||
|
if (typeValue === 1) {
|
||||||
|
// Shutdown action
|
||||||
|
newAction.type = 'shutdown';
|
||||||
|
|
||||||
|
const delayStr = await prompt(
|
||||||
|
` ${theme.dim('Shutdown delay')} ${theme.dim('(minutes) [5]:')} `,
|
||||||
|
);
|
||||||
|
const shutdownDelay = delayStr ? parseInt(delayStr, 10) : 5;
|
||||||
|
if (isNaN(shutdownDelay) || shutdownDelay < 0) {
|
||||||
|
logger.error('Invalid shutdown delay. Must be >= 0.');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
newAction.shutdownDelay = shutdownDelay;
|
||||||
|
} else if (typeValue === 2) {
|
||||||
|
// Webhook action
|
||||||
|
newAction.type = 'webhook';
|
||||||
|
|
||||||
|
const url = await prompt(` ${theme.dim('Webhook URL:')} `);
|
||||||
|
if (!url.trim()) {
|
||||||
|
logger.error('Webhook URL is required.');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
newAction.webhookUrl = url.trim();
|
||||||
|
|
||||||
|
logger.log('');
|
||||||
|
logger.log(` ${theme.dim('HTTP Method:')}`);
|
||||||
|
logger.log(` ${theme.dim('1)')} POST (JSON body)`);
|
||||||
|
logger.log(` ${theme.dim('2)')} GET (query parameters)`);
|
||||||
|
const methodInput = await prompt(` ${theme.dim('Select method')} ${theme.dim('[1]:')} `);
|
||||||
|
newAction.webhookMethod = methodInput === '2' ? 'GET' : 'POST';
|
||||||
|
|
||||||
|
const timeoutInput = await prompt(` ${theme.dim('Timeout in seconds')} ${theme.dim('[10]:')} `);
|
||||||
|
const timeout = parseInt(timeoutInput, 10);
|
||||||
|
if (timeoutInput.trim() && !isNaN(timeout)) {
|
||||||
|
newAction.webhookTimeout = timeout * 1000;
|
||||||
|
}
|
||||||
|
} else if (typeValue === 3) {
|
||||||
|
// Script action
|
||||||
|
newAction.type = 'script';
|
||||||
|
|
||||||
|
const scriptPath = await prompt(` ${theme.dim('Script filename (in /etc/nupst/, must end with .sh):')} `);
|
||||||
|
if (!scriptPath.trim() || !scriptPath.trim().endsWith('.sh')) {
|
||||||
|
logger.error('Script path must end with .sh.');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
newAction.scriptPath = scriptPath.trim();
|
||||||
|
|
||||||
|
const timeoutInput = await prompt(` ${theme.dim('Script timeout in seconds')} ${theme.dim('[60]:')} `);
|
||||||
|
const timeout = parseInt(timeoutInput, 10);
|
||||||
|
if (timeoutInput.trim() && !isNaN(timeout)) {
|
||||||
|
newAction.scriptTimeout = timeout * 1000;
|
||||||
|
}
|
||||||
|
} else if (typeValue === 4) {
|
||||||
|
// Proxmox action
|
||||||
|
newAction.type = 'proxmox';
|
||||||
|
|
||||||
|
// Auto-detect CLI availability
|
||||||
|
const detection = ProxmoxAction.detectCliAvailability();
|
||||||
|
|
||||||
|
if (detection.available) {
|
||||||
|
logger.log('');
|
||||||
|
logger.success('Proxmox CLI tools detected (qm/pct). No API token needed.');
|
||||||
|
logger.dim(` qm: ${detection.qmPath}`);
|
||||||
|
logger.dim(` pct: ${detection.pctPath}`);
|
||||||
|
newAction.proxmoxMode = 'cli';
|
||||||
|
} else {
|
||||||
|
logger.log('');
|
||||||
|
if (!detection.isRoot) {
|
||||||
|
logger.warn('Not running as root - CLI mode unavailable, using API mode.');
|
||||||
|
} else {
|
||||||
|
logger.warn('Proxmox CLI tools (qm/pct) not found - using API mode.');
|
||||||
|
}
|
||||||
|
logger.log('');
|
||||||
|
logger.info('Proxmox API Settings:');
|
||||||
|
logger.dim('Create a token with: pveum user token add root@pam nupst --privsep=0');
|
||||||
|
|
||||||
|
const pxHost = await prompt(` ${theme.dim('Proxmox Host')} ${theme.dim('[localhost]:')} `);
|
||||||
|
newAction.proxmoxHost = pxHost.trim() || 'localhost';
|
||||||
|
|
||||||
|
const pxPortInput = await prompt(` ${theme.dim('Proxmox API Port')} ${theme.dim('[8006]:')} `);
|
||||||
|
const pxPort = parseInt(pxPortInput, 10);
|
||||||
|
newAction.proxmoxPort = pxPortInput.trim() && !isNaN(pxPort) ? pxPort : 8006;
|
||||||
|
|
||||||
|
const pxNode = await prompt(` ${theme.dim('Proxmox Node Name (empty = auto-detect):')} `);
|
||||||
|
if (pxNode.trim()) {
|
||||||
|
newAction.proxmoxNode = pxNode.trim();
|
||||||
|
}
|
||||||
|
|
||||||
|
const tokenId = await prompt(` ${theme.dim('API Token ID (e.g., root@pam!nupst):')} `);
|
||||||
|
if (!tokenId.trim()) {
|
||||||
|
logger.error('Token ID is required for API mode.');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
newAction.proxmoxTokenId = tokenId.trim();
|
||||||
|
|
||||||
|
const tokenSecret = await prompt(` ${theme.dim('API Token Secret:')} `);
|
||||||
|
if (!tokenSecret.trim()) {
|
||||||
|
logger.error('Token Secret is required for API mode.');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
newAction.proxmoxTokenSecret = tokenSecret.trim();
|
||||||
|
|
||||||
|
const insecureInput = await prompt(` ${theme.dim('Skip TLS verification (self-signed cert)?')} ${theme.dim('(Y/n):')} `);
|
||||||
|
newAction.proxmoxInsecure = insecureInput.toLowerCase() !== 'n';
|
||||||
|
newAction.proxmoxMode = 'api';
|
||||||
|
}
|
||||||
|
|
||||||
|
// Common Proxmox settings (both modes)
|
||||||
|
const excludeInput = await prompt(` ${theme.dim('VM/CT IDs to exclude (comma-separated, or empty):')} `);
|
||||||
|
if (excludeInput.trim()) {
|
||||||
|
newAction.proxmoxExcludeIds = excludeInput.split(',').map((s) => parseInt(s.trim(), 10)).filter((n) => !isNaN(n));
|
||||||
|
}
|
||||||
|
|
||||||
|
const timeoutInput = await prompt(` ${theme.dim('VM shutdown timeout in seconds')} ${theme.dim('[120]:')} `);
|
||||||
|
const stopTimeout = parseInt(timeoutInput, 10);
|
||||||
|
if (timeoutInput.trim() && !isNaN(stopTimeout)) {
|
||||||
|
newAction.proxmoxStopTimeout = stopTimeout;
|
||||||
|
}
|
||||||
|
|
||||||
|
const forceInput = await prompt(` ${theme.dim('Force-stop VMs that don\'t shut down in time?')} ${theme.dim('(Y/n):')} `);
|
||||||
|
newAction.proxmoxForceStop = forceInput.toLowerCase() !== 'n';
|
||||||
|
} else {
|
||||||
|
logger.error('Invalid action type.');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Battery threshold (all action types)
|
||||||
|
logger.log('');
|
||||||
|
const batteryStr = await prompt(
|
||||||
|
` ${theme.dim('Battery threshold')} ${theme.dim('(%):')} `,
|
||||||
|
);
|
||||||
|
const battery = parseInt(batteryStr, 10);
|
||||||
|
if (isNaN(battery) || battery < 0 || battery > 100) {
|
||||||
|
logger.error('Invalid battery threshold. Must be 0-100.');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Runtime threshold
|
||||||
|
const runtimeStr = await prompt(
|
||||||
|
` ${theme.dim('Runtime threshold')} ${theme.dim('(minutes):')} `,
|
||||||
|
);
|
||||||
|
const runtime = parseInt(runtimeStr, 10);
|
||||||
|
if (isNaN(runtime) || runtime < 0) {
|
||||||
|
logger.error('Invalid runtime threshold. Must be >= 0.');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
|
||||||
|
newAction.thresholds = { battery, runtime };
|
||||||
|
|
||||||
|
// Trigger mode
|
||||||
|
logger.log('');
|
||||||
|
logger.log(` ${theme.dim('Trigger mode:')}`);
|
||||||
|
logger.log(
|
||||||
|
` ${theme.dim('1)')} onlyPowerChanges - Trigger only when power status changes`,
|
||||||
|
);
|
||||||
|
logger.log(
|
||||||
|
` ${theme.dim('2)')} onlyThresholds - Trigger only when thresholds are violated`,
|
||||||
|
);
|
||||||
|
logger.log(
|
||||||
|
` ${
|
||||||
|
theme.dim('3)')
|
||||||
|
} powerChangesAndThresholds - Trigger on power change AND thresholds`,
|
||||||
|
);
|
||||||
|
logger.log(` ${theme.dim('4)')} anyChange - Trigger on any status change`);
|
||||||
|
const triggerChoice = await prompt(` ${theme.dim('Choice')} ${theme.dim('[2]:')} `);
|
||||||
|
const triggerModeMap: Record<string, string> = {
|
||||||
|
'1': 'onlyPowerChanges',
|
||||||
|
'2': 'onlyThresholds',
|
||||||
|
'3': 'powerChangesAndThresholds',
|
||||||
|
'4': 'anyChange',
|
||||||
|
'': 'onlyThresholds', // Default
|
||||||
|
};
|
||||||
|
const triggerMode = triggerModeMap[triggerChoice] || 'onlyThresholds';
|
||||||
|
newAction.triggerMode = triggerMode as IActionConfig['triggerMode'];
|
||||||
|
|
||||||
|
// Add to target (UPS or group)
|
||||||
|
if (!target!.actions) {
|
||||||
|
target!.actions = [];
|
||||||
|
}
|
||||||
|
target!.actions.push(newAction as IActionConfig);
|
||||||
|
|
||||||
|
await this.nupst.getDaemon().saveConfig(config);
|
||||||
|
|
||||||
|
logger.log('');
|
||||||
|
logger.success(`Action added to ${targetType} ${targetName}`);
|
||||||
|
logger.log(` ${theme.dim('Changes saved and will be applied automatically')}`);
|
||||||
|
logger.log('');
|
||||||
|
});
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
`Failed to add action: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Remove an action from a UPS or group
|
||||||
|
*/
|
||||||
|
public async remove(targetId?: string, actionIndexStr?: string): Promise<void> {
|
||||||
|
try {
|
||||||
|
if (!targetId || !actionIndexStr) {
|
||||||
|
logger.error('Target ID and action index are required');
|
||||||
|
logger.log(
|
||||||
|
` ${theme.dim('Usage:')} ${
|
||||||
|
theme.command('nupst action remove <ups-id|group-id> <action-index>')
|
||||||
|
}`,
|
||||||
|
);
|
||||||
|
logger.log('');
|
||||||
|
logger.log(` ${theme.dim('List actions:')} ${theme.command('nupst action list')}`);
|
||||||
|
logger.log('');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
|
||||||
|
const actionIndex = parseInt(actionIndexStr, 10);
|
||||||
|
if (isNaN(actionIndex) || actionIndex < 0) {
|
||||||
|
logger.error('Invalid action index. Must be >= 0.');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
|
||||||
|
const config = await this.nupst.getDaemon().loadConfig();
|
||||||
|
|
||||||
|
// Check if it's a UPS
|
||||||
|
const ups = config.upsDevices.find((u) => u.id === targetId);
|
||||||
|
// Check if it's a group
|
||||||
|
const group = config.groups?.find((g) => g.id === targetId);
|
||||||
|
|
||||||
|
if (!ups && !group) {
|
||||||
|
logger.error(`UPS or Group with ID '${targetId}' not found`);
|
||||||
|
logger.log('');
|
||||||
|
logger.log(
|
||||||
|
` ${theme.dim('List available UPS devices:')} ${theme.command('nupst ups list')}`,
|
||||||
|
);
|
||||||
|
logger.log(` ${theme.dim('List available groups:')} ${theme.command('nupst group list')}`);
|
||||||
|
logger.log('');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
|
||||||
|
const target = ups || group;
|
||||||
|
const targetType = ups ? 'UPS' : 'Group';
|
||||||
|
const targetName = ups ? ups.name : group!.name;
|
||||||
|
|
||||||
|
if (!target!.actions || target!.actions.length === 0) {
|
||||||
|
logger.error(`No actions configured for ${targetType} '${targetName}'`);
|
||||||
|
logger.log('');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
|
||||||
|
if (actionIndex >= target!.actions.length) {
|
||||||
|
logger.error(
|
||||||
|
`Invalid action index. ${targetType} '${targetName}' has ${
|
||||||
|
target!.actions.length
|
||||||
|
} action(s) (index 0-${target!.actions.length - 1})`,
|
||||||
|
);
|
||||||
|
logger.log('');
|
||||||
|
logger.log(
|
||||||
|
` ${theme.dim('List actions:')} ${theme.command(`nupst action list ${targetId}`)}`,
|
||||||
|
);
|
||||||
|
logger.log('');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
|
||||||
|
const removedAction = target!.actions[actionIndex];
|
||||||
|
target!.actions.splice(actionIndex, 1);
|
||||||
|
|
||||||
|
await this.nupst.getDaemon().saveConfig(config);
|
||||||
|
|
||||||
|
logger.log('');
|
||||||
|
logger.success(`Action removed from ${targetType} ${targetName}`);
|
||||||
|
logger.log(` ${theme.dim('Type:')} ${removedAction.type}`);
|
||||||
|
if (removedAction.thresholds) {
|
||||||
|
logger.log(
|
||||||
|
` ${
|
||||||
|
theme.dim('Thresholds:')
|
||||||
|
} Battery: ${removedAction.thresholds.battery}%, Runtime: ${removedAction.thresholds.runtime}min`,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
logger.log(` ${theme.dim('Changes saved and will be applied automatically')}`);
|
||||||
|
logger.log('');
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
`Failed to remove action: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* List all actions for a specific UPS/group or all devices
|
||||||
|
*/
|
||||||
|
public async list(targetId?: string): Promise<void> {
|
||||||
|
try {
|
||||||
|
const config = await this.nupst.getDaemon().loadConfig();
|
||||||
|
|
||||||
|
if (targetId) {
|
||||||
|
// List actions for specific UPS or group
|
||||||
|
const ups = config.upsDevices.find((u) => u.id === targetId);
|
||||||
|
const group = config.groups?.find((g) => g.id === targetId);
|
||||||
|
|
||||||
|
if (!ups && !group) {
|
||||||
|
logger.error(`UPS or Group with ID '${targetId}' not found`);
|
||||||
|
logger.log('');
|
||||||
|
logger.log(
|
||||||
|
` ${theme.dim('List available UPS devices:')} ${theme.command('nupst ups list')}`,
|
||||||
|
);
|
||||||
|
logger.log(
|
||||||
|
` ${theme.dim('List available groups:')} ${theme.command('nupst group list')}`,
|
||||||
|
);
|
||||||
|
logger.log('');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
|
||||||
|
if (ups) {
|
||||||
|
this.displayTargetActions(ups, 'UPS');
|
||||||
|
} else {
|
||||||
|
this.displayTargetActions(group!, 'Group');
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
// List actions for all UPS devices and groups
|
||||||
|
logger.log('');
|
||||||
|
logger.info('Actions for All UPS Devices and Groups');
|
||||||
|
logger.log('');
|
||||||
|
|
||||||
|
let hasAnyActions = false;
|
||||||
|
|
||||||
|
// Display UPS actions
|
||||||
|
for (const ups of config.upsDevices) {
|
||||||
|
if (ups.actions && ups.actions.length > 0) {
|
||||||
|
hasAnyActions = true;
|
||||||
|
this.displayTargetActions(ups, 'UPS');
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Display Group actions
|
||||||
|
for (const group of config.groups || []) {
|
||||||
|
if (group.actions && group.actions.length > 0) {
|
||||||
|
hasAnyActions = true;
|
||||||
|
this.displayTargetActions(group, 'Group');
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!hasAnyActions) {
|
||||||
|
logger.log(` ${theme.dim('No actions configured')}`);
|
||||||
|
logger.log('');
|
||||||
|
logger.log(
|
||||||
|
` ${theme.dim('Add an action:')} ${
|
||||||
|
theme.command('nupst action add <ups-id|group-id>')
|
||||||
|
}`,
|
||||||
|
);
|
||||||
|
logger.log('');
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
`Failed to list actions: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Display actions for a single UPS or Group
|
||||||
|
*/
|
||||||
|
private displayTargetActions(
|
||||||
|
target: IUpsConfig | IGroupConfig,
|
||||||
|
targetType: 'UPS' | 'Group',
|
||||||
|
): void {
|
||||||
|
logger.log(
|
||||||
|
`${symbols.info} ${targetType} ${theme.highlight(target.name)} ${
|
||||||
|
theme.dim(`(${target.id})`)
|
||||||
|
}`,
|
||||||
|
);
|
||||||
|
logger.log('');
|
||||||
|
|
||||||
|
if (!target.actions || target.actions.length === 0) {
|
||||||
|
logger.log(` ${theme.dim('No actions configured')}`);
|
||||||
|
logger.log('');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
const columns: ITableColumn[] = [
|
||||||
|
{ header: 'Index', key: 'index', align: 'right' },
|
||||||
|
{ header: 'Type', key: 'type', align: 'left' },
|
||||||
|
{ header: 'Battery', key: 'battery', align: 'right' },
|
||||||
|
{ header: 'Runtime', key: 'runtime', align: 'right' },
|
||||||
|
{ header: 'Trigger Mode', key: 'triggerMode', align: 'left' },
|
||||||
|
{ header: 'Details', key: 'details', align: 'left' },
|
||||||
|
];
|
||||||
|
|
||||||
|
const rows = target.actions.map((action, index) => {
|
||||||
|
let details = `${action.shutdownDelay || 5}min delay`;
|
||||||
|
if (action.type === 'proxmox') {
|
||||||
|
const mode = action.proxmoxMode || 'auto';
|
||||||
|
if (mode === 'cli' || (mode === 'auto' && !action.proxmoxTokenId)) {
|
||||||
|
details = 'CLI mode';
|
||||||
|
} else {
|
||||||
|
const host = action.proxmoxHost || 'localhost';
|
||||||
|
const port = action.proxmoxPort || 8006;
|
||||||
|
details = `API ${host}:${port}`;
|
||||||
|
}
|
||||||
|
if (action.proxmoxExcludeIds?.length) {
|
||||||
|
details += `, excl: ${action.proxmoxExcludeIds.join(',')}`;
|
||||||
|
}
|
||||||
|
} else if (action.type === 'webhook') {
|
||||||
|
details = action.webhookUrl || theme.dim('N/A');
|
||||||
|
} else if (action.type === 'script') {
|
||||||
|
details = action.scriptPath || theme.dim('N/A');
|
||||||
|
}
|
||||||
|
|
||||||
|
return {
|
||||||
|
index: theme.dim(index.toString()),
|
||||||
|
type: theme.highlight(action.type),
|
||||||
|
battery: action.thresholds ? `${action.thresholds.battery}%` : theme.dim('N/A'),
|
||||||
|
runtime: action.thresholds ? `${action.thresholds.runtime}min` : theme.dim('N/A'),
|
||||||
|
triggerMode: theme.dim(action.triggerMode || 'onlyThresholds'),
|
||||||
|
details,
|
||||||
|
};
|
||||||
|
});
|
||||||
|
|
||||||
|
logger.logTable(columns, rows);
|
||||||
|
logger.log('');
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,192 @@
|
|||||||
|
import { execSync } from 'node:child_process';
|
||||||
|
import { Nupst } from '../nupst.ts';
|
||||||
|
import { logger } from '../logger.ts';
|
||||||
|
import { theme } from '../colors.ts';
|
||||||
|
import * as helpers from '../helpers/index.ts';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Class for handling feature-related CLI commands
|
||||||
|
* Provides interface for managing optional features like HTTP server
|
||||||
|
*/
|
||||||
|
export class FeatureHandler {
|
||||||
|
private readonly nupst: Nupst;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create a new feature handler
|
||||||
|
* @param nupst Reference to the main Nupst instance
|
||||||
|
*/
|
||||||
|
constructor(nupst: Nupst) {
|
||||||
|
this.nupst = nupst;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Configure HTTP server feature
|
||||||
|
*/
|
||||||
|
public async configureHttpServer(): Promise<void> {
|
||||||
|
try {
|
||||||
|
await helpers.withPrompt(async (prompt) => {
|
||||||
|
await this.runHttpServerConfig(prompt);
|
||||||
|
});
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
`HTTP Server config error: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Run the interactive HTTP server configuration process
|
||||||
|
* @param prompt Function to prompt for user input
|
||||||
|
*/
|
||||||
|
private async runHttpServerConfig(prompt: (question: string) => Promise<string>): Promise<void> {
|
||||||
|
logger.log('');
|
||||||
|
logger.logBoxTitle('HTTP Server Feature Configuration', 60);
|
||||||
|
logger.logBoxLine('Configure the HTTP server to expose UPS status as JSON');
|
||||||
|
logger.logBoxEnd();
|
||||||
|
logger.log('');
|
||||||
|
|
||||||
|
// Load config
|
||||||
|
let config;
|
||||||
|
try {
|
||||||
|
await this.nupst.getDaemon().loadConfig();
|
||||||
|
config = this.nupst.getDaemon().getConfig();
|
||||||
|
} catch (error) {
|
||||||
|
logger.error('No configuration found. Please run "nupst ups add" first.');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Show current status
|
||||||
|
if (config.httpServer?.enabled) {
|
||||||
|
logger.info('HTTP Server is currently: ' + theme.success('ENABLED'));
|
||||||
|
logger.log(` Port: ${theme.highlight(String(config.httpServer.port))}`);
|
||||||
|
logger.log(` Path: ${theme.highlight(config.httpServer.path)}`);
|
||||||
|
logger.log(` Auth Token: ${theme.dim('***' + config.httpServer.authToken.slice(-4))}`);
|
||||||
|
logger.log('');
|
||||||
|
} else {
|
||||||
|
logger.info('HTTP Server is currently: ' + theme.dim('DISABLED'));
|
||||||
|
logger.log('');
|
||||||
|
}
|
||||||
|
|
||||||
|
// Ask enable/disable
|
||||||
|
const action = await prompt('Enable or disable HTTP server? (enable/disable/cancel): ');
|
||||||
|
|
||||||
|
if (action.toLowerCase() === 'cancel' || action.toLowerCase() === 'c') {
|
||||||
|
logger.log('Cancelled.');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (action.toLowerCase() === 'disable' || action.toLowerCase() === 'd') {
|
||||||
|
// Disable HTTP server
|
||||||
|
config.httpServer = {
|
||||||
|
enabled: false,
|
||||||
|
port: config.httpServer?.port || 8080,
|
||||||
|
path: config.httpServer?.path || '/ups-status',
|
||||||
|
authToken: config.httpServer?.authToken || '',
|
||||||
|
};
|
||||||
|
|
||||||
|
this.nupst.getDaemon().saveConfig(config);
|
||||||
|
|
||||||
|
logger.log('');
|
||||||
|
logger.success('HTTP Server disabled');
|
||||||
|
logger.log('');
|
||||||
|
|
||||||
|
await this.restartServiceIfRunning();
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (action.toLowerCase() !== 'enable' && action.toLowerCase() !== 'e') {
|
||||||
|
logger.error('Invalid option. Please enter "enable", "disable", or "cancel".');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Enable - gather configuration
|
||||||
|
logger.log('');
|
||||||
|
|
||||||
|
const portInput = await prompt(`HTTP Server Port [${config.httpServer?.port || 8080}]: `);
|
||||||
|
const port = portInput ? parseInt(portInput, 10) : (config.httpServer?.port || 8080);
|
||||||
|
|
||||||
|
if (isNaN(port) || port < 1 || port > 65535) {
|
||||||
|
logger.error('Invalid port number. Must be between 1 and 65535.');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
const pathInput = await prompt(`URL Path [${config.httpServer?.path || '/ups-status'}]: `);
|
||||||
|
const path = pathInput || config.httpServer?.path || '/ups-status';
|
||||||
|
|
||||||
|
// Ensure path starts with /
|
||||||
|
const finalPath = path.startsWith('/') ? path : `/${path}`;
|
||||||
|
|
||||||
|
// Generate or reuse auth token
|
||||||
|
let authToken = config.httpServer?.authToken;
|
||||||
|
if (!authToken) {
|
||||||
|
// Generate new random token
|
||||||
|
authToken = helpers.shortId() + helpers.shortId() + helpers.shortId();
|
||||||
|
logger.log('');
|
||||||
|
logger.info('Generated new authentication token');
|
||||||
|
} else {
|
||||||
|
const regenerate = await prompt('Regenerate authentication token? (y/N): ');
|
||||||
|
if (regenerate.toLowerCase() === 'y' || regenerate.toLowerCase() === 'yes') {
|
||||||
|
authToken = helpers.shortId() + helpers.shortId() + helpers.shortId();
|
||||||
|
logger.info('Generated new authentication token');
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Save configuration
|
||||||
|
config.httpServer = {
|
||||||
|
enabled: true,
|
||||||
|
port,
|
||||||
|
path: finalPath,
|
||||||
|
authToken,
|
||||||
|
};
|
||||||
|
|
||||||
|
this.nupst.getDaemon().saveConfig(config);
|
||||||
|
|
||||||
|
// Display summary
|
||||||
|
logger.log('');
|
||||||
|
logger.logBoxTitle('HTTP Server Configuration', 70, 'success');
|
||||||
|
logger.logBoxLine(`Status: ${theme.success('ENABLED')}`);
|
||||||
|
logger.logBoxLine(`Port: ${theme.highlight(String(port))}`);
|
||||||
|
logger.logBoxLine(`Path: ${theme.highlight(finalPath)}`);
|
||||||
|
logger.logBoxLine(`Auth Token: ${theme.warning(authToken)}`);
|
||||||
|
logger.logBoxLine('');
|
||||||
|
logger.logBoxLine(theme.dim('Usage examples:'));
|
||||||
|
logger.logBoxLine(
|
||||||
|
` curl -H "Authorization: Bearer ${authToken}" http://localhost:${port}${finalPath}`,
|
||||||
|
);
|
||||||
|
logger.logBoxLine(` curl "http://localhost:${port}${finalPath}?token=${authToken}"`);
|
||||||
|
logger.logBoxEnd();
|
||||||
|
logger.log('');
|
||||||
|
|
||||||
|
logger.warn('IMPORTANT: Save the authentication token securely!');
|
||||||
|
logger.log('');
|
||||||
|
|
||||||
|
await this.restartServiceIfRunning();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Restart the service if it's currently running
|
||||||
|
*/
|
||||||
|
private async restartServiceIfRunning(): Promise<void> {
|
||||||
|
try {
|
||||||
|
const isActive =
|
||||||
|
execSync('systemctl is-active nupst.service || true').toString().trim() === 'active';
|
||||||
|
|
||||||
|
if (isActive) {
|
||||||
|
logger.log('');
|
||||||
|
const { prompt, close } = await helpers.createPrompt();
|
||||||
|
const answer = await prompt('Service is running. Restart to apply changes? (Y/n): ');
|
||||||
|
close();
|
||||||
|
|
||||||
|
if (!answer || answer.toLowerCase() === 'y' || answer.toLowerCase() === 'yes') {
|
||||||
|
logger.info('Restarting service...');
|
||||||
|
execSync('sudo systemctl restart nupst.service');
|
||||||
|
logger.success('Service restarted successfully');
|
||||||
|
} else {
|
||||||
|
logger.warn('Changes will take effect on next service restart');
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} catch (error) {
|
||||||
|
// Ignore errors - service might not be installed
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,572 @@
|
|||||||
|
import { Nupst } from '../nupst.ts';
|
||||||
|
import { type ITableColumn, logger } from '../logger.ts';
|
||||||
|
import { theme } from '../colors.ts';
|
||||||
|
import * as helpers from '../helpers/index.ts';
|
||||||
|
import type { IGroupConfig, INupstConfig, IUpsConfig } from '../daemon.ts';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Class for handling group-related CLI commands
|
||||||
|
* Provides interface for managing UPS groups
|
||||||
|
*/
|
||||||
|
export class GroupHandler {
|
||||||
|
private readonly nupst: Nupst;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create a new Group handler
|
||||||
|
* @param nupst Reference to the main Nupst instance
|
||||||
|
*/
|
||||||
|
constructor(nupst: Nupst) {
|
||||||
|
this.nupst = nupst;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* List all UPS groups
|
||||||
|
*/
|
||||||
|
public async list(): Promise<void> {
|
||||||
|
try {
|
||||||
|
// Try to load configuration
|
||||||
|
try {
|
||||||
|
await this.nupst.getDaemon().loadConfig();
|
||||||
|
} catch (error) {
|
||||||
|
logger.logBox(
|
||||||
|
'Configuration Error',
|
||||||
|
[
|
||||||
|
'No configuration found.',
|
||||||
|
"Please run 'nupst ups add' first to create a configuration.",
|
||||||
|
],
|
||||||
|
50,
|
||||||
|
'error',
|
||||||
|
);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Get current configuration
|
||||||
|
const config = this.nupst.getDaemon().getConfig();
|
||||||
|
|
||||||
|
// Check if multi-UPS config
|
||||||
|
if (!config.groups || !Array.isArray(config.groups)) {
|
||||||
|
logger.logBox(
|
||||||
|
'UPS Groups',
|
||||||
|
[
|
||||||
|
'No groups configured.',
|
||||||
|
'',
|
||||||
|
`${theme.dim('Run')} ${theme.command('nupst group add')} ${
|
||||||
|
theme.dim('to add a group')
|
||||||
|
}`,
|
||||||
|
],
|
||||||
|
50,
|
||||||
|
'info',
|
||||||
|
);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Display group list with modern table
|
||||||
|
if (config.groups.length === 0) {
|
||||||
|
logger.logBox(
|
||||||
|
'UPS Groups',
|
||||||
|
[
|
||||||
|
'No UPS groups configured.',
|
||||||
|
'',
|
||||||
|
`${theme.dim('Run')} ${theme.command('nupst group add')} ${
|
||||||
|
theme.dim('to add a group')
|
||||||
|
}`,
|
||||||
|
],
|
||||||
|
60,
|
||||||
|
'info',
|
||||||
|
);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Prepare table data
|
||||||
|
const rows = config.groups.map((group) => {
|
||||||
|
// Count UPS devices in this group
|
||||||
|
const upsInGroup = config.upsDevices.filter((ups) => ups.groups.includes(group.id));
|
||||||
|
const upsCount = upsInGroup.length;
|
||||||
|
const upsNames = upsInGroup.map((ups) => ups.name).join(', ');
|
||||||
|
|
||||||
|
return {
|
||||||
|
id: group.id,
|
||||||
|
name: group.name || '',
|
||||||
|
mode: group.mode || 'unknown',
|
||||||
|
count: String(upsCount),
|
||||||
|
devices: upsCount > 0 ? upsNames : theme.dim('None'),
|
||||||
|
};
|
||||||
|
});
|
||||||
|
|
||||||
|
const columns: ITableColumn[] = [
|
||||||
|
{ header: 'ID', key: 'id', align: 'left', color: theme.highlight },
|
||||||
|
{ header: 'Name', key: 'name', align: 'left' },
|
||||||
|
{ header: 'Mode', key: 'mode', align: 'left', color: theme.info },
|
||||||
|
{ header: 'UPS Count', key: 'count', align: 'right' },
|
||||||
|
{ header: 'UPS Devices', key: 'devices', align: 'left' },
|
||||||
|
];
|
||||||
|
|
||||||
|
logger.log('');
|
||||||
|
logger.info(`UPS Groups (${config.groups.length}):`);
|
||||||
|
logger.log('');
|
||||||
|
logger.logTable(columns, rows);
|
||||||
|
logger.log('');
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
`Failed to list UPS groups: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Add a new UPS group
|
||||||
|
*/
|
||||||
|
public async add(): Promise<void> {
|
||||||
|
try {
|
||||||
|
await helpers.withPrompt(async (prompt) => {
|
||||||
|
// Try to load configuration
|
||||||
|
try {
|
||||||
|
await this.nupst.getDaemon().loadConfig();
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
'No configuration found. Please run "nupst ups add" first to create a configuration.',
|
||||||
|
);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Get current configuration
|
||||||
|
const config = this.nupst.getDaemon().getConfig();
|
||||||
|
|
||||||
|
// Initialize groups array if not exists
|
||||||
|
if (!config.groups) {
|
||||||
|
config.groups = [];
|
||||||
|
}
|
||||||
|
|
||||||
|
// Check if upsDevices is initialized
|
||||||
|
if (!config.upsDevices) {
|
||||||
|
config.upsDevices = [];
|
||||||
|
}
|
||||||
|
|
||||||
|
logger.log('\nNUPST Add Group');
|
||||||
|
logger.log('==============\n');
|
||||||
|
logger.log('This will guide you through creating a new UPS group.\n');
|
||||||
|
|
||||||
|
// Generate a new unique group ID
|
||||||
|
const groupId = helpers.shortId();
|
||||||
|
|
||||||
|
// Get group name
|
||||||
|
const name = await prompt('Group Name: ');
|
||||||
|
|
||||||
|
// Get group mode
|
||||||
|
const modeInput = await prompt('Group Mode (redundant/nonRedundant) [redundant]: ');
|
||||||
|
const mode = modeInput.toLowerCase() === 'nonredundant' ? 'nonRedundant' : 'redundant';
|
||||||
|
|
||||||
|
// Get optional description
|
||||||
|
const description = await prompt('Group Description (optional): ');
|
||||||
|
|
||||||
|
// Create the new group
|
||||||
|
const newGroup: IGroupConfig = {
|
||||||
|
id: groupId,
|
||||||
|
name: name || `Group-${groupId}`,
|
||||||
|
mode,
|
||||||
|
description: description || undefined,
|
||||||
|
};
|
||||||
|
|
||||||
|
// Add the group to the configuration
|
||||||
|
config.groups.push(newGroup);
|
||||||
|
|
||||||
|
// Save the configuration
|
||||||
|
await this.nupst.getDaemon().saveConfig(config);
|
||||||
|
|
||||||
|
// Display summary
|
||||||
|
const boxWidth = 45;
|
||||||
|
logger.logBoxTitle('Group Created', boxWidth);
|
||||||
|
logger.logBoxLine(`ID: ${newGroup.id}`);
|
||||||
|
logger.logBoxLine(`Name: ${newGroup.name}`);
|
||||||
|
logger.logBoxLine(`Mode: ${newGroup.mode}`);
|
||||||
|
if (newGroup.description) {
|
||||||
|
logger.logBoxLine(`Description: ${newGroup.description}`);
|
||||||
|
}
|
||||||
|
logger.logBoxEnd();
|
||||||
|
|
||||||
|
// Check if there are UPS devices to assign to this group
|
||||||
|
if (config.upsDevices.length > 0) {
|
||||||
|
const assignUps = await prompt(
|
||||||
|
'Would you like to assign UPS devices to this group now? (y/N): ',
|
||||||
|
);
|
||||||
|
if (assignUps.toLowerCase() === 'y') {
|
||||||
|
await this.assignUpsToGroup(newGroup.id, config, prompt);
|
||||||
|
|
||||||
|
// Save again after assigning UPS devices
|
||||||
|
await this.nupst.getDaemon().saveConfig(config);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Check if service is running and restart it if needed
|
||||||
|
this.nupst.getUpsHandler().restartServiceIfRunning();
|
||||||
|
|
||||||
|
logger.log('\nGroup setup complete!');
|
||||||
|
});
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(`Add group error: ${error instanceof Error ? error.message : String(error)}`);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Edit an existing UPS group
|
||||||
|
* @param groupId ID of the group to edit
|
||||||
|
*/
|
||||||
|
public async edit(groupId: string): Promise<void> {
|
||||||
|
try {
|
||||||
|
await helpers.withPrompt(async (prompt) => {
|
||||||
|
// Try to load configuration
|
||||||
|
try {
|
||||||
|
await this.nupst.getDaemon().loadConfig();
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
'No configuration found. Please run "nupst ups add" first to create a configuration.',
|
||||||
|
);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Get current configuration
|
||||||
|
const config = this.nupst.getDaemon().getConfig();
|
||||||
|
|
||||||
|
// Check if groups are initialized
|
||||||
|
if (!config.groups || !Array.isArray(config.groups)) {
|
||||||
|
logger.error(
|
||||||
|
'No groups configured. Please run "nupst group add" first to create a group.',
|
||||||
|
);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Find the group to edit
|
||||||
|
const groupIndex = config.groups.findIndex((group) => group.id === groupId);
|
||||||
|
if (groupIndex === -1) {
|
||||||
|
logger.error(`Group with ID "${groupId}" not found.`);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
const group = config.groups[groupIndex];
|
||||||
|
|
||||||
|
logger.log(`\nNUPST Edit Group: ${group.name} (${group.id})`);
|
||||||
|
logger.log('==============================================\n');
|
||||||
|
|
||||||
|
// Edit group name
|
||||||
|
const newName = await prompt(`Group Name [${group.name}]: `);
|
||||||
|
if (newName.trim()) {
|
||||||
|
group.name = newName;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Edit group mode
|
||||||
|
const currentMode = group.mode || 'redundant';
|
||||||
|
const modeInput = await prompt(`Group Mode (redundant/nonRedundant) [${currentMode}]: `);
|
||||||
|
if (modeInput.trim()) {
|
||||||
|
group.mode = modeInput.toLowerCase() === 'nonredundant' ? 'nonRedundant' : 'redundant';
|
||||||
|
}
|
||||||
|
|
||||||
|
// Edit description
|
||||||
|
const currentDesc = group.description || '';
|
||||||
|
const newDesc = await prompt(`Group Description [${currentDesc}]: `);
|
||||||
|
if (newDesc.trim() || newDesc === '') {
|
||||||
|
group.description = newDesc.trim() || undefined;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Update the group in the configuration
|
||||||
|
config.groups[groupIndex] = group;
|
||||||
|
|
||||||
|
// Save the configuration
|
||||||
|
await this.nupst.getDaemon().saveConfig(config);
|
||||||
|
|
||||||
|
// Display summary
|
||||||
|
const boxWidth = 45;
|
||||||
|
logger.logBoxTitle('Group Updated', boxWidth);
|
||||||
|
logger.logBoxLine(`ID: ${group.id}`);
|
||||||
|
logger.logBoxLine(`Name: ${group.name}`);
|
||||||
|
logger.logBoxLine(`Mode: ${group.mode}`);
|
||||||
|
if (group.description) {
|
||||||
|
logger.logBoxLine(`Description: ${group.description}`);
|
||||||
|
}
|
||||||
|
logger.logBoxEnd();
|
||||||
|
|
||||||
|
// Edit UPS assignments if requested
|
||||||
|
const editAssignments = await prompt(
|
||||||
|
'Would you like to edit UPS assignments for this group? (y/N): ',
|
||||||
|
);
|
||||||
|
if (editAssignments.toLowerCase() === 'y') {
|
||||||
|
await this.assignUpsToGroup(group.id, config, prompt);
|
||||||
|
|
||||||
|
// Save again after editing assignments
|
||||||
|
await this.nupst.getDaemon().saveConfig(config);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Check if service is running and restart it if needed
|
||||||
|
this.nupst.getUpsHandler().restartServiceIfRunning();
|
||||||
|
|
||||||
|
logger.log('\nGroup edit complete!');
|
||||||
|
});
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(`Edit group error: ${error instanceof Error ? error.message : String(error)}`);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Delete an existing UPS group
|
||||||
|
* @param groupId ID of the group to delete
|
||||||
|
*/
|
||||||
|
public async remove(groupId: string): Promise<void> {
|
||||||
|
try {
|
||||||
|
// Try to load configuration
|
||||||
|
try {
|
||||||
|
await this.nupst.getDaemon().loadConfig();
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
'No configuration found. Please run "nupst ups add" first to create a configuration.',
|
||||||
|
);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Get current configuration
|
||||||
|
const config = this.nupst.getDaemon().getConfig();
|
||||||
|
|
||||||
|
// Check if groups are initialized
|
||||||
|
if (!config.groups || !Array.isArray(config.groups)) {
|
||||||
|
logger.error('No groups configured.');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Find the group to delete
|
||||||
|
const groupIndex = config.groups.findIndex((group) => group.id === groupId);
|
||||||
|
if (groupIndex === -1) {
|
||||||
|
logger.error(`Group with ID "${groupId}" not found.`);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
const groupToDelete = config.groups[groupIndex];
|
||||||
|
|
||||||
|
// Get confirmation before deleting
|
||||||
|
const { prompt, close } = await helpers.createPrompt();
|
||||||
|
const confirm = (await prompt(
|
||||||
|
`Are you sure you want to delete group "${groupToDelete.name}" (${groupId})? [y/N]: `,
|
||||||
|
)).toLowerCase();
|
||||||
|
close();
|
||||||
|
|
||||||
|
if (confirm !== 'y' && confirm !== 'yes') {
|
||||||
|
logger.log('Deletion cancelled.');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Remove this group from all UPS device group assignments
|
||||||
|
if (config.upsDevices && Array.isArray(config.upsDevices)) {
|
||||||
|
for (const ups of config.upsDevices) {
|
||||||
|
const groupIndex = ups.groups.indexOf(groupId);
|
||||||
|
if (groupIndex !== -1) {
|
||||||
|
ups.groups.splice(groupIndex, 1);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Remove the group from the array
|
||||||
|
config.groups.splice(groupIndex, 1);
|
||||||
|
|
||||||
|
// Save the configuration
|
||||||
|
await this.nupst.getDaemon().saveConfig(config);
|
||||||
|
|
||||||
|
logger.log(`Group "${groupToDelete.name}" (${groupId}) has been deleted.`);
|
||||||
|
|
||||||
|
// Check if service is running and restart it if needed
|
||||||
|
this.nupst.getUpsHandler().restartServiceIfRunning();
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
`Failed to delete group: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Assign UPS devices to groups
|
||||||
|
* @param ups UPS configuration to update
|
||||||
|
* @param groups Available groups
|
||||||
|
* @param prompt Function to prompt for user input
|
||||||
|
*/
|
||||||
|
public async assignUpsToGroups(
|
||||||
|
ups: IUpsConfig,
|
||||||
|
groups: IGroupConfig[],
|
||||||
|
prompt: (question: string) => Promise<string>,
|
||||||
|
): Promise<void> {
|
||||||
|
// Initialize groups array if it doesn't exist
|
||||||
|
if (!ups.groups) {
|
||||||
|
ups.groups = [];
|
||||||
|
}
|
||||||
|
|
||||||
|
// Show current group assignments
|
||||||
|
logger.log('\nCurrent Group Assignments:');
|
||||||
|
if (ups.groups && ups.groups.length > 0) {
|
||||||
|
for (const groupId of ups.groups) {
|
||||||
|
const group = groups.find((g) => g.id === groupId);
|
||||||
|
if (group) {
|
||||||
|
logger.log(`- ${group.name} (${group.id})`);
|
||||||
|
} else {
|
||||||
|
logger.log(`- Unknown group (${groupId})`);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} else {
|
||||||
|
logger.log('- None');
|
||||||
|
}
|
||||||
|
|
||||||
|
// Show available groups
|
||||||
|
logger.log('\nAvailable Groups:');
|
||||||
|
if (groups.length === 0) {
|
||||||
|
logger.log('- No groups available. Use "nupst group add" to create groups.');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
for (let i = 0; i < groups.length; i++) {
|
||||||
|
const group = groups[i];
|
||||||
|
const assigned = ups.groups && ups.groups.includes(group.id);
|
||||||
|
logger.log(
|
||||||
|
`${i + 1}) ${group.name} (${group.id}) [${assigned ? 'Assigned' : 'Not Assigned'}]`,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Prompt for group selection
|
||||||
|
const selection = await prompt(
|
||||||
|
'\nSelect groups to assign/unassign (comma-separated numbers, or "clear" to remove all): ',
|
||||||
|
);
|
||||||
|
|
||||||
|
if (selection.toLowerCase() === 'clear') {
|
||||||
|
// Clear all group assignments
|
||||||
|
ups.groups = [];
|
||||||
|
logger.log('All group assignments cleared.');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!selection.trim()) {
|
||||||
|
// No change if empty input
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Process selections
|
||||||
|
const selections = selection.split(',').map((s) => s.trim());
|
||||||
|
|
||||||
|
for (const sel of selections) {
|
||||||
|
const index = parseInt(sel, 10) - 1;
|
||||||
|
if (isNaN(index) || index < 0 || index >= groups.length) {
|
||||||
|
logger.error(`Invalid selection: ${sel}`);
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
|
||||||
|
const group = groups[index];
|
||||||
|
|
||||||
|
// Initialize groups array if needed (should already be done above)
|
||||||
|
if (!ups.groups) {
|
||||||
|
ups.groups = [];
|
||||||
|
}
|
||||||
|
|
||||||
|
// Toggle assignment
|
||||||
|
const groupIndex = ups.groups.indexOf(group.id);
|
||||||
|
if (groupIndex === -1) {
|
||||||
|
// Add to group
|
||||||
|
ups.groups.push(group.id);
|
||||||
|
logger.log(`Added to group: ${group.name} (${group.id})`);
|
||||||
|
} else {
|
||||||
|
// Remove from group
|
||||||
|
ups.groups.splice(groupIndex, 1);
|
||||||
|
logger.log(`Removed from group: ${group.name} (${group.id})`);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Assign UPS devices to a specific group
|
||||||
|
* @param groupId Group ID to assign UPS devices to
|
||||||
|
* @param config Full configuration
|
||||||
|
* @param prompt Function to prompt for user input
|
||||||
|
*/
|
||||||
|
public async assignUpsToGroup(
|
||||||
|
groupId: string,
|
||||||
|
config: INupstConfig,
|
||||||
|
prompt: (question: string) => Promise<string>,
|
||||||
|
): Promise<void> {
|
||||||
|
if (!config.upsDevices || config.upsDevices.length === 0) {
|
||||||
|
logger.log('No UPS devices available. Use "nupst ups add" to add UPS devices.');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
const group = config.groups.find((g) => g.id === groupId);
|
||||||
|
if (!group) {
|
||||||
|
logger.error(`Group with ID "${groupId}" not found.`);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Show current assignments
|
||||||
|
logger.log(`\nUPS devices in group "${group.name}" (${group.id}):`);
|
||||||
|
const upsInGroup = config.upsDevices.filter((ups) =>
|
||||||
|
ups.groups && ups.groups.includes(groupId)
|
||||||
|
);
|
||||||
|
if (upsInGroup.length === 0) {
|
||||||
|
logger.log('- None');
|
||||||
|
} else {
|
||||||
|
for (const ups of upsInGroup) {
|
||||||
|
logger.log(`- ${ups.name} (${ups.id})`);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Show all UPS devices
|
||||||
|
logger.log('\nAvailable UPS devices:');
|
||||||
|
for (let i = 0; i < config.upsDevices.length; i++) {
|
||||||
|
const ups = config.upsDevices[i];
|
||||||
|
const assigned = ups.groups && ups.groups.includes(groupId);
|
||||||
|
logger.log(`${i + 1}) ${ups.name} (${ups.id}) [${assigned ? 'Assigned' : 'Not Assigned'}]`);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Prompt for UPS selection
|
||||||
|
const selection = await prompt(
|
||||||
|
'\nSelect UPS devices to assign/unassign (comma-separated numbers, or "clear" to remove all): ',
|
||||||
|
);
|
||||||
|
|
||||||
|
if (selection.toLowerCase() === 'clear') {
|
||||||
|
// Clear all UPS from this group
|
||||||
|
for (const ups of config.upsDevices) {
|
||||||
|
if (ups.groups) {
|
||||||
|
const groupIndex = ups.groups.indexOf(groupId);
|
||||||
|
if (groupIndex !== -1) {
|
||||||
|
ups.groups.splice(groupIndex, 1);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
logger.log(`All UPS devices removed from group "${group.name}".`);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!selection.trim()) {
|
||||||
|
// No change if empty input
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Process selections
|
||||||
|
const selections = selection.split(',').map((s) => s.trim());
|
||||||
|
|
||||||
|
for (const sel of selections) {
|
||||||
|
const index = parseInt(sel, 10) - 1;
|
||||||
|
if (isNaN(index) || index < 0 || index >= config.upsDevices.length) {
|
||||||
|
logger.error(`Invalid selection: ${sel}`);
|
||||||
|
continue;
|
||||||
|
}
|
||||||
|
|
||||||
|
const ups = config.upsDevices[index];
|
||||||
|
|
||||||
|
// Initialize groups array if needed
|
||||||
|
if (!ups.groups) {
|
||||||
|
ups.groups = [];
|
||||||
|
}
|
||||||
|
|
||||||
|
// Toggle assignment
|
||||||
|
const groupIndex = ups.groups.indexOf(groupId);
|
||||||
|
if (groupIndex === -1) {
|
||||||
|
// Add to group
|
||||||
|
ups.groups.push(groupId);
|
||||||
|
logger.log(`Added "${ups.name}" to group "${group.name}"`);
|
||||||
|
} else {
|
||||||
|
// Remove from group
|
||||||
|
ups.groups.splice(groupIndex, 1);
|
||||||
|
logger.log(`Removed "${ups.name}" from group "${group.name}"`);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,405 @@
|
|||||||
|
import process from 'node:process';
|
||||||
|
import * as fs from 'node:fs';
|
||||||
|
import * as path from 'node:path';
|
||||||
|
import { execSync } from 'node:child_process';
|
||||||
|
import { Nupst } from '../nupst.ts';
|
||||||
|
import { logger } from '../logger.ts';
|
||||||
|
import { theme } from '../colors.ts';
|
||||||
|
import { PAUSE } from '../constants.ts';
|
||||||
|
import type { IPauseState } from '../pause-state.ts';
|
||||||
|
import * as helpers from '../helpers/index.ts';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Class for handling service-related CLI commands
|
||||||
|
* Provides interface for managing systemd service
|
||||||
|
*/
|
||||||
|
export class ServiceHandler {
|
||||||
|
private readonly nupst: Nupst;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create a new Service handler
|
||||||
|
* @param nupst Reference to the main Nupst instance
|
||||||
|
*/
|
||||||
|
constructor(nupst: Nupst) {
|
||||||
|
this.nupst = nupst;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enable the service (requires root)
|
||||||
|
*/
|
||||||
|
public async enable(): Promise<void> {
|
||||||
|
this.checkRootAccess('This command must be run as root.');
|
||||||
|
await this.nupst.getSystemd().install();
|
||||||
|
logger.log(
|
||||||
|
'NUPST service has been installed. Use "nupst service start" to start the service.',
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Start the daemon directly
|
||||||
|
* @param debugMode Whether to enable debug mode
|
||||||
|
*/
|
||||||
|
public async daemonStart(debugMode: boolean = false): Promise<void> {
|
||||||
|
logger.log('Starting NUPST daemon...');
|
||||||
|
try {
|
||||||
|
// Enable debug mode for SNMP if requested
|
||||||
|
if (debugMode) {
|
||||||
|
this.nupst.getSnmp().enableDebug();
|
||||||
|
logger.log('SNMP debug mode enabled');
|
||||||
|
}
|
||||||
|
await this.nupst.getDaemon().start();
|
||||||
|
} catch (error) {
|
||||||
|
// Error is already logged and process.exit is called in daemon.start()
|
||||||
|
// No need to handle it here
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Show logs of the systemd service
|
||||||
|
*/
|
||||||
|
public async logs(): Promise<void> {
|
||||||
|
try {
|
||||||
|
// Use exec with spawn to properly follow logs in real-time
|
||||||
|
const { spawn } = await import('child_process');
|
||||||
|
logger.log('Tailing nupst service logs (Ctrl+C to exit)...\n');
|
||||||
|
|
||||||
|
const journalctl = spawn('journalctl', ['-u', 'nupst.service', '-n', '50', '-f'], {
|
||||||
|
stdio: ['ignore', 'inherit', 'inherit'],
|
||||||
|
});
|
||||||
|
|
||||||
|
// Forward signals to child process
|
||||||
|
process.on('SIGINT', () => {
|
||||||
|
journalctl.kill('SIGINT');
|
||||||
|
process.exit(0);
|
||||||
|
});
|
||||||
|
|
||||||
|
// Wait for process to exit
|
||||||
|
await new Promise<void>((resolve) => {
|
||||||
|
journalctl.on('exit', () => resolve());
|
||||||
|
});
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(`Failed to retrieve logs: ${error}`);
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Stop the systemd service
|
||||||
|
*/
|
||||||
|
public async stop(): Promise<void> {
|
||||||
|
await this.nupst.getSystemd().stop();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Start the systemd service
|
||||||
|
*/
|
||||||
|
public async start(): Promise<void> {
|
||||||
|
try {
|
||||||
|
await this.nupst.getSystemd().start();
|
||||||
|
} catch (error) {
|
||||||
|
// Error will be displayed by systemd.start()
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Show status of the systemd service and UPS
|
||||||
|
*/
|
||||||
|
public async status(debugMode: boolean = false): Promise<void> {
|
||||||
|
await this.nupst.getSystemd().getStatus(debugMode);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Pause action monitoring
|
||||||
|
* @param args Command arguments (e.g., ['--duration', '30m'])
|
||||||
|
*/
|
||||||
|
public async pause(args: string[]): Promise<void> {
|
||||||
|
try {
|
||||||
|
// Parse --duration argument
|
||||||
|
let resumeAt: number | null = null;
|
||||||
|
const durationIdx = args.indexOf('--duration');
|
||||||
|
if (durationIdx !== -1 && args[durationIdx + 1]) {
|
||||||
|
const durationStr = args[durationIdx + 1];
|
||||||
|
const durationMs = this.parseDuration(durationStr);
|
||||||
|
if (durationMs === null) {
|
||||||
|
logger.error(`Invalid duration format: ${durationStr}`);
|
||||||
|
logger.dim(' Valid formats: 30m, 2h, 1d (minutes, hours, days)');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
if (durationMs > PAUSE.MAX_DURATION_MS) {
|
||||||
|
logger.error(`Duration exceeds maximum of 24 hours`);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
resumeAt = Date.now() + durationMs;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Check if already paused
|
||||||
|
if (fs.existsSync(PAUSE.FILE_PATH)) {
|
||||||
|
logger.warn('Monitoring is already paused');
|
||||||
|
try {
|
||||||
|
const data = fs.readFileSync(PAUSE.FILE_PATH, 'utf8');
|
||||||
|
const state = JSON.parse(data) as IPauseState;
|
||||||
|
logger.dim(` Paused at: ${new Date(state.pausedAt).toISOString()}`);
|
||||||
|
if (state.resumeAt) {
|
||||||
|
const remaining = Math.round((state.resumeAt - Date.now()) / 1000);
|
||||||
|
logger.dim(` Auto-resume in: ${remaining > 0 ? remaining : 0} seconds`);
|
||||||
|
}
|
||||||
|
} catch (_e) {
|
||||||
|
// Ignore parse errors
|
||||||
|
}
|
||||||
|
logger.dim(' Run "nupst resume" to resume monitoring');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Create pause state
|
||||||
|
const pauseState: IPauseState = {
|
||||||
|
pausedAt: Date.now(),
|
||||||
|
pausedBy: 'cli',
|
||||||
|
resumeAt,
|
||||||
|
};
|
||||||
|
|
||||||
|
// Ensure config directory exists
|
||||||
|
const pauseDir = path.dirname(PAUSE.FILE_PATH);
|
||||||
|
if (!fs.existsSync(pauseDir)) {
|
||||||
|
fs.mkdirSync(pauseDir, { recursive: true });
|
||||||
|
}
|
||||||
|
|
||||||
|
fs.writeFileSync(PAUSE.FILE_PATH, JSON.stringify(pauseState, null, 2));
|
||||||
|
|
||||||
|
logger.log('');
|
||||||
|
logger.logBoxTitle('Monitoring Paused', 45, 'warning');
|
||||||
|
logger.logBoxLine('UPS polling continues but actions are suppressed');
|
||||||
|
if (resumeAt) {
|
||||||
|
const durationStr = args[args.indexOf('--duration') + 1];
|
||||||
|
logger.logBoxLine(`Auto-resume after: ${durationStr}`);
|
||||||
|
logger.logBoxLine(`Resume at: ${new Date(resumeAt).toISOString()}`);
|
||||||
|
} else {
|
||||||
|
logger.logBoxLine('Duration: Indefinite');
|
||||||
|
logger.logBoxLine('Run "nupst resume" to resume');
|
||||||
|
}
|
||||||
|
logger.logBoxEnd();
|
||||||
|
logger.log('');
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
`Failed to pause: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Resume action monitoring
|
||||||
|
*/
|
||||||
|
public async resume(): Promise<void> {
|
||||||
|
try {
|
||||||
|
if (!fs.existsSync(PAUSE.FILE_PATH)) {
|
||||||
|
logger.info('Monitoring is not paused');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
fs.unlinkSync(PAUSE.FILE_PATH);
|
||||||
|
|
||||||
|
logger.log('');
|
||||||
|
logger.logBoxTitle('Monitoring Resumed', 45, 'success');
|
||||||
|
logger.logBoxLine('Action monitoring has been resumed');
|
||||||
|
logger.logBoxEnd();
|
||||||
|
logger.log('');
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(
|
||||||
|
`Failed to resume: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Parse a duration string like '30m', '2h', '1d' into milliseconds
|
||||||
|
*/
|
||||||
|
private parseDuration(duration: string): number | null {
|
||||||
|
const match = duration.match(/^(\d+)\s*(m|h|d)$/i);
|
||||||
|
if (!match) return null;
|
||||||
|
|
||||||
|
const value = parseInt(match[1], 10);
|
||||||
|
const unit = match[2].toLowerCase();
|
||||||
|
|
||||||
|
switch (unit) {
|
||||||
|
case 'm':
|
||||||
|
return value * 60 * 1000;
|
||||||
|
case 'h':
|
||||||
|
return value * 60 * 60 * 1000;
|
||||||
|
case 'd':
|
||||||
|
return value * 24 * 60 * 60 * 1000;
|
||||||
|
default:
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Disable the service (requires root)
|
||||||
|
*/
|
||||||
|
public async disable(): Promise<void> {
|
||||||
|
this.checkRootAccess('This command must be run as root.');
|
||||||
|
await this.nupst.getSystemd().disable();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Check if the user has root access
|
||||||
|
* @param errorMessage Error message to display if not root
|
||||||
|
*/
|
||||||
|
private checkRootAccess(errorMessage: string): void {
|
||||||
|
if (process.getuid && process.getuid() !== 0) {
|
||||||
|
logger.error(errorMessage);
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Update NUPST from repository and refresh systemd service
|
||||||
|
*/
|
||||||
|
public update(): void {
|
||||||
|
try {
|
||||||
|
// Check if running as root
|
||||||
|
this.checkRootAccess(
|
||||||
|
'This command must be run as root to upgrade NUPST.',
|
||||||
|
);
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
logger.info('Checking for updates...');
|
||||||
|
|
||||||
|
try {
|
||||||
|
// Get current version
|
||||||
|
const currentVersion = this.nupst.getVersion();
|
||||||
|
|
||||||
|
// Fetch latest version from Gitea API
|
||||||
|
const apiUrl = 'https://code.foss.global/api/v1/repos/serve.zone/nupst/releases/latest';
|
||||||
|
const response = execSync(`curl -sSL ${apiUrl}`).toString();
|
||||||
|
const release = JSON.parse(response);
|
||||||
|
const latestVersion = release.tag_name; // e.g., "v4.0.7"
|
||||||
|
|
||||||
|
// Normalize versions for comparison (ensure both have "v" prefix)
|
||||||
|
const normalizedCurrent = currentVersion.startsWith('v')
|
||||||
|
? currentVersion
|
||||||
|
: `v${currentVersion}`;
|
||||||
|
const normalizedLatest = latestVersion.startsWith('v')
|
||||||
|
? latestVersion
|
||||||
|
: `v${latestVersion}`;
|
||||||
|
|
||||||
|
logger.dim(`Current version: ${normalizedCurrent}`);
|
||||||
|
logger.dim(`Latest version: ${normalizedLatest}`);
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
// Compare normalized versions
|
||||||
|
if (normalizedCurrent === normalizedLatest) {
|
||||||
|
logger.success('Already up to date!');
|
||||||
|
console.log('');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
logger.info(`New version available: ${latestVersion}`);
|
||||||
|
logger.dim('Downloading and installing...');
|
||||||
|
console.log('');
|
||||||
|
|
||||||
|
// Download and run the install script
|
||||||
|
// This handles everything: download binary, stop service, replace, restart
|
||||||
|
const installUrl = 'https://code.foss.global/serve.zone/nupst/raw/branch/main/install.sh';
|
||||||
|
|
||||||
|
execSync(`curl -sSL ${installUrl} | bash`, {
|
||||||
|
stdio: 'inherit', // Show install script output to user
|
||||||
|
});
|
||||||
|
|
||||||
|
console.log('');
|
||||||
|
logger.success(`Updated to ${latestVersion}`);
|
||||||
|
console.log('');
|
||||||
|
} catch (error) {
|
||||||
|
console.log('');
|
||||||
|
logger.error('Update failed');
|
||||||
|
logger.dim(`${error instanceof Error ? error.message : String(error)}`);
|
||||||
|
console.log('');
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(`Update failed: ${error instanceof Error ? error.message : String(error)}`);
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Completely uninstall NUPST from the system
|
||||||
|
*/
|
||||||
|
public async uninstall(): Promise<void> {
|
||||||
|
// Check if running as root
|
||||||
|
this.checkRootAccess('This command must be run as root.');
|
||||||
|
|
||||||
|
try {
|
||||||
|
const { prompt, close } = await helpers.createPrompt();
|
||||||
|
|
||||||
|
logger.log('');
|
||||||
|
logger.highlight('NUPST Uninstaller');
|
||||||
|
logger.dim('===============');
|
||||||
|
logger.log('This will completely remove NUPST from your system.');
|
||||||
|
logger.log('');
|
||||||
|
|
||||||
|
// Ask about removing configuration
|
||||||
|
const removeConfig = await prompt(
|
||||||
|
'Do you want to remove the NUPST configuration files? (y/N): ',
|
||||||
|
);
|
||||||
|
|
||||||
|
// Find the uninstall.sh script location
|
||||||
|
let uninstallScriptPath: string;
|
||||||
|
|
||||||
|
// Try to determine script location based on executable path
|
||||||
|
try {
|
||||||
|
// For ESM, we can use import.meta.url, but since we might be in CJS
|
||||||
|
// we'll use a more reliable approach based on process.argv[1]
|
||||||
|
const binPath = process.argv[1];
|
||||||
|
const { dirname, join } = await import('path');
|
||||||
|
const modulePath = dirname(dirname(binPath));
|
||||||
|
uninstallScriptPath = join(modulePath, 'uninstall.sh');
|
||||||
|
|
||||||
|
// Check if the script exists
|
||||||
|
const { access } = await import('fs/promises');
|
||||||
|
await access(uninstallScriptPath);
|
||||||
|
} catch (error) {
|
||||||
|
// If we can't find it in the expected location, try common installation paths
|
||||||
|
const commonPaths = ['/opt/nupst/uninstall.sh', `${process.cwd()}/uninstall.sh`];
|
||||||
|
const { existsSync } = await import('fs');
|
||||||
|
|
||||||
|
uninstallScriptPath = '';
|
||||||
|
for (const path of commonPaths) {
|
||||||
|
if (existsSync(path)) {
|
||||||
|
uninstallScriptPath = path;
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!uninstallScriptPath) {
|
||||||
|
logger.error('Could not locate uninstall.sh script. Aborting uninstall.');
|
||||||
|
close();
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Close prompt before executing script
|
||||||
|
close();
|
||||||
|
|
||||||
|
// Execute uninstall.sh with the appropriate option
|
||||||
|
logger.log('');
|
||||||
|
logger.log(`Running uninstaller from ${uninstallScriptPath}...`);
|
||||||
|
|
||||||
|
// Pass the configuration removal option as an environment variable
|
||||||
|
const env = {
|
||||||
|
...process.env,
|
||||||
|
REMOVE_CONFIG: removeConfig.toLowerCase() === 'y' ? 'yes' : 'no',
|
||||||
|
REMOVE_REPO: 'yes', // Always remove repo as requested
|
||||||
|
NUPST_CLI_CALL: 'true', // Flag to indicate this is being called from CLI
|
||||||
|
};
|
||||||
|
|
||||||
|
// Run the uninstall script with sudo
|
||||||
|
execSync(`sudo bash ${uninstallScriptPath}`, {
|
||||||
|
env,
|
||||||
|
stdio: 'inherit', // Show output in the terminal
|
||||||
|
});
|
||||||
|
} catch (error) {
|
||||||
|
logger.error(`Uninstall failed: ${error instanceof Error ? error.message : String(error)}`);
|
||||||
|
process.exit(1);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
File diff suppressed because it is too large
Load Diff
@@ -0,0 +1,90 @@
|
|||||||
|
/**
|
||||||
|
* Color theme and styling utilities for NUPST CLI
|
||||||
|
* Uses Deno standard library colors module
|
||||||
|
*/
|
||||||
|
import * as colors from '@std/fmt/colors';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Color theme for consistent CLI styling
|
||||||
|
*/
|
||||||
|
export const theme = {
|
||||||
|
// Message types
|
||||||
|
error: colors.red,
|
||||||
|
warning: colors.yellow,
|
||||||
|
success: colors.green,
|
||||||
|
info: colors.cyan,
|
||||||
|
dim: colors.dim,
|
||||||
|
highlight: colors.bold,
|
||||||
|
|
||||||
|
// Status indicators
|
||||||
|
statusActive: (text: string) => colors.green(colors.bold(text)),
|
||||||
|
statusInactive: (text: string) => colors.red(text),
|
||||||
|
statusWarning: (text: string) => colors.yellow(text),
|
||||||
|
statusUnknown: (text: string) => colors.dim(text),
|
||||||
|
|
||||||
|
// Battery level colors
|
||||||
|
batteryGood: colors.green, // > 60%
|
||||||
|
batteryMedium: colors.yellow, // 30-60%
|
||||||
|
batteryCritical: colors.red, // < 30%
|
||||||
|
|
||||||
|
// Box borders
|
||||||
|
borderSuccess: colors.green,
|
||||||
|
borderError: colors.red,
|
||||||
|
borderWarning: colors.yellow,
|
||||||
|
borderInfo: colors.cyan,
|
||||||
|
borderDefault: (text: string) => text, // No color
|
||||||
|
|
||||||
|
// Command/code highlighting
|
||||||
|
command: colors.cyan,
|
||||||
|
code: colors.dim,
|
||||||
|
path: colors.blue,
|
||||||
|
};
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Status symbols with colors
|
||||||
|
*/
|
||||||
|
export const symbols = {
|
||||||
|
success: colors.green('✓'),
|
||||||
|
error: colors.red('✗'),
|
||||||
|
warning: colors.yellow('⚠'),
|
||||||
|
info: colors.cyan('ℹ'),
|
||||||
|
running: colors.green('●'),
|
||||||
|
stopped: colors.red('○'),
|
||||||
|
starting: colors.yellow('◐'),
|
||||||
|
unknown: colors.dim('◯'),
|
||||||
|
};
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get color for battery level
|
||||||
|
*/
|
||||||
|
export function getBatteryColor(percentage: number): (text: string) => string {
|
||||||
|
if (percentage >= 60) return theme.batteryGood;
|
||||||
|
if (percentage >= 30) return theme.batteryMedium;
|
||||||
|
return theme.batteryCritical;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get color for runtime remaining
|
||||||
|
*/
|
||||||
|
export function getRuntimeColor(minutes: number): (text: string) => string {
|
||||||
|
if (minutes >= 20) return theme.batteryGood;
|
||||||
|
if (minutes >= 10) return theme.batteryMedium;
|
||||||
|
return theme.batteryCritical;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Format UPS power status with color
|
||||||
|
*/
|
||||||
|
export function formatPowerStatus(status: 'online' | 'onBattery' | 'unknown' | 'unreachable'): string {
|
||||||
|
switch (status) {
|
||||||
|
case 'online':
|
||||||
|
return theme.success('Online');
|
||||||
|
case 'onBattery':
|
||||||
|
return theme.warning('On Battery');
|
||||||
|
case 'unreachable':
|
||||||
|
return theme.error('Unreachable');
|
||||||
|
case 'unknown':
|
||||||
|
default:
|
||||||
|
return theme.dim('Unknown');
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,58 @@
|
|||||||
|
export interface IWatchEventLike {
|
||||||
|
kind: string;
|
||||||
|
paths: string[];
|
||||||
|
}
|
||||||
|
|
||||||
|
export type TConfigReloadTransition = 'monitoringWillStart' | 'deviceCountChanged' | 'reloaded';
|
||||||
|
|
||||||
|
export interface IConfigReloadSnapshot {
|
||||||
|
transition: TConfigReloadTransition;
|
||||||
|
message: string;
|
||||||
|
shouldInitializeUpsStatus: boolean;
|
||||||
|
shouldLogMonitoringStart: boolean;
|
||||||
|
}
|
||||||
|
|
||||||
|
export function shouldReloadConfig(
|
||||||
|
event: IWatchEventLike,
|
||||||
|
configFileName: string = 'config.json',
|
||||||
|
): boolean {
|
||||||
|
return event.kind === 'modify' && event.paths.some((path) => path.includes(configFileName));
|
||||||
|
}
|
||||||
|
|
||||||
|
export function shouldRefreshPauseState(
|
||||||
|
event: IWatchEventLike,
|
||||||
|
pauseFileName: string = 'pause',
|
||||||
|
): boolean {
|
||||||
|
return ['create', 'modify', 'remove'].includes(event.kind) &&
|
||||||
|
event.paths.some((path) => path.includes(pauseFileName));
|
||||||
|
}
|
||||||
|
|
||||||
|
export function analyzeConfigReload(
|
||||||
|
oldDeviceCount: number,
|
||||||
|
newDeviceCount: number,
|
||||||
|
): IConfigReloadSnapshot {
|
||||||
|
if (newDeviceCount > 0 && oldDeviceCount === 0) {
|
||||||
|
return {
|
||||||
|
transition: 'monitoringWillStart',
|
||||||
|
message: `Configuration reloaded! Found ${newDeviceCount} UPS device(s)`,
|
||||||
|
shouldInitializeUpsStatus: false,
|
||||||
|
shouldLogMonitoringStart: true,
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
if (newDeviceCount !== oldDeviceCount) {
|
||||||
|
return {
|
||||||
|
transition: 'deviceCountChanged',
|
||||||
|
message: `Configuration reloaded! UPS devices: ${oldDeviceCount} -> ${newDeviceCount}`,
|
||||||
|
shouldInitializeUpsStatus: true,
|
||||||
|
shouldLogMonitoringStart: false,
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
return {
|
||||||
|
transition: 'reloaded',
|
||||||
|
message: 'Configuration reloaded successfully',
|
||||||
|
shouldInitializeUpsStatus: false,
|
||||||
|
shouldLogMonitoringStart: false,
|
||||||
|
};
|
||||||
|
}
|
||||||
+177
@@ -0,0 +1,177 @@
|
|||||||
|
/**
|
||||||
|
* NUPST Constants
|
||||||
|
*
|
||||||
|
* Central location for all timeout, interval, and threshold values.
|
||||||
|
* This makes configuration easier and code more self-documenting.
|
||||||
|
*/
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Default timing values in milliseconds
|
||||||
|
*/
|
||||||
|
export const TIMING = {
|
||||||
|
/** Default interval between UPS status checks (30 seconds) */
|
||||||
|
CHECK_INTERVAL_MS: 30000,
|
||||||
|
|
||||||
|
/** Interval for idle monitoring mode (60 seconds) */
|
||||||
|
IDLE_CHECK_INTERVAL_MS: 60000,
|
||||||
|
|
||||||
|
/** Interval for checking config file changes (60 seconds) */
|
||||||
|
CONFIG_CHECK_INTERVAL_MS: 60000,
|
||||||
|
|
||||||
|
/** Interval for logging periodic status updates (5 minutes) */
|
||||||
|
LOG_INTERVAL_MS: 5 * 60 * 1000,
|
||||||
|
|
||||||
|
/** Maximum time to monitor during shutdown (5 minutes) */
|
||||||
|
MAX_SHUTDOWN_MONITORING_MS: 5 * 60 * 1000,
|
||||||
|
|
||||||
|
/** Interval for UPS checks during shutdown (30 seconds) */
|
||||||
|
SHUTDOWN_CHECK_INTERVAL_MS: 30000,
|
||||||
|
} as const;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* SNMP-related constants
|
||||||
|
*/
|
||||||
|
export const SNMP = {
|
||||||
|
/** Default SNMP port */
|
||||||
|
DEFAULT_PORT: 161,
|
||||||
|
|
||||||
|
/** Default SNMP timeout (5 seconds) */
|
||||||
|
DEFAULT_TIMEOUT_MS: 5000,
|
||||||
|
|
||||||
|
/** Number of SNMP retries */
|
||||||
|
RETRIES: 2,
|
||||||
|
|
||||||
|
/** Timeout for noAuthNoPriv security level (5 seconds) */
|
||||||
|
TIMEOUT_NO_AUTH_MS: 5000,
|
||||||
|
|
||||||
|
/** Timeout for authNoPriv security level (10 seconds) */
|
||||||
|
TIMEOUT_AUTH_MS: 10000,
|
||||||
|
|
||||||
|
/** Timeout for authPriv security level (15 seconds) */
|
||||||
|
TIMEOUT_AUTH_PRIV_MS: 15000,
|
||||||
|
|
||||||
|
/** Maximum timeout for connection tests (10 seconds) */
|
||||||
|
MAX_TEST_TIMEOUT_MS: 10000,
|
||||||
|
} as const;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Default threshold values
|
||||||
|
*/
|
||||||
|
export const THRESHOLDS = {
|
||||||
|
/** Default battery capacity threshold for shutdown (60%) */
|
||||||
|
DEFAULT_BATTERY_PERCENT: 60,
|
||||||
|
|
||||||
|
/** Default runtime threshold for shutdown (20 minutes) */
|
||||||
|
DEFAULT_RUNTIME_MINUTES: 20,
|
||||||
|
|
||||||
|
/** Emergency runtime threshold during shutdown (5 minutes) */
|
||||||
|
EMERGENCY_RUNTIME_MINUTES: 5,
|
||||||
|
} as const;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Webhook action constants
|
||||||
|
*/
|
||||||
|
export const WEBHOOK = {
|
||||||
|
/** Default webhook request timeout (10 seconds) */
|
||||||
|
DEFAULT_TIMEOUT_MS: 10000,
|
||||||
|
} as const;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Script action constants
|
||||||
|
*/
|
||||||
|
export const SCRIPT = {
|
||||||
|
/** Default script execution timeout (60 seconds) */
|
||||||
|
DEFAULT_TIMEOUT_MS: 60000,
|
||||||
|
} as const;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Shutdown action constants
|
||||||
|
*/
|
||||||
|
export const SHUTDOWN = {
|
||||||
|
/** Default shutdown delay (5 minutes) */
|
||||||
|
DEFAULT_DELAY_MINUTES: 5,
|
||||||
|
} as const;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* HTTP Server constants
|
||||||
|
*/
|
||||||
|
export const HTTP_SERVER = {
|
||||||
|
/** Default HTTP server port */
|
||||||
|
DEFAULT_PORT: 8080,
|
||||||
|
|
||||||
|
/** Default URL path for UPS status endpoint */
|
||||||
|
DEFAULT_PATH: '/ups-status',
|
||||||
|
} as const;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Network failure detection constants
|
||||||
|
*/
|
||||||
|
export const NETWORK = {
|
||||||
|
/** Number of consecutive failures before marking UPS as unreachable */
|
||||||
|
CONSECUTIVE_FAILURE_THRESHOLD: 3,
|
||||||
|
|
||||||
|
/** Maximum tracked consecutive failures (prevents overflow) */
|
||||||
|
MAX_CONSECUTIVE_FAILURES: 100,
|
||||||
|
} as const;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* UPSD/NIS protocol constants
|
||||||
|
*/
|
||||||
|
export const UPSD = {
|
||||||
|
/** Default UPSD port (NUT standard) */
|
||||||
|
DEFAULT_PORT: 3493,
|
||||||
|
|
||||||
|
/** Default timeout in milliseconds */
|
||||||
|
DEFAULT_TIMEOUT_MS: 5000,
|
||||||
|
|
||||||
|
/** Default NUT device name */
|
||||||
|
DEFAULT_UPS_NAME: 'ups',
|
||||||
|
} as const;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Pause/resume constants
|
||||||
|
*/
|
||||||
|
export const PAUSE = {
|
||||||
|
/** Path to the pause state file */
|
||||||
|
FILE_PATH: '/etc/nupst/pause',
|
||||||
|
|
||||||
|
/** Maximum pause duration (24 hours) */
|
||||||
|
MAX_DURATION_MS: 24 * 60 * 60 * 1000,
|
||||||
|
} as const;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Proxmox VM shutdown constants
|
||||||
|
*/
|
||||||
|
export const PROXMOX = {
|
||||||
|
/** Default Proxmox API port */
|
||||||
|
DEFAULT_PORT: 8006,
|
||||||
|
|
||||||
|
/** Default Proxmox host */
|
||||||
|
DEFAULT_HOST: 'localhost',
|
||||||
|
|
||||||
|
/** Default timeout for VM/CT shutdown in seconds */
|
||||||
|
DEFAULT_STOP_TIMEOUT_SECONDS: 120,
|
||||||
|
|
||||||
|
/** Poll interval for checking VM/CT status in seconds */
|
||||||
|
STATUS_POLL_INTERVAL_SECONDS: 5,
|
||||||
|
|
||||||
|
/** Proxmox API base path */
|
||||||
|
API_BASE: '/api2/json',
|
||||||
|
|
||||||
|
/** Common paths to search for Proxmox CLI tools (qm, pct) */
|
||||||
|
CLI_TOOL_PATHS: ['/usr/sbin', '/usr/bin', '/sbin', '/bin'] as readonly string[],
|
||||||
|
} as const;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* UI/Display constants
|
||||||
|
*/
|
||||||
|
export const UI = {
|
||||||
|
/** Default width for log boxes */
|
||||||
|
DEFAULT_BOX_WIDTH: 45,
|
||||||
|
|
||||||
|
/** Wide box width for status displays */
|
||||||
|
WIDE_BOX_WIDTH: 60,
|
||||||
|
|
||||||
|
/** Extra wide box width for detailed info */
|
||||||
|
EXTRA_WIDE_BOX_WIDTH: 70,
|
||||||
|
} as const;
|
||||||
+862
-100
File diff suppressed because it is too large
Load Diff
@@ -0,0 +1,2 @@
|
|||||||
|
export * from './shortid.ts';
|
||||||
|
export * from './prompt.ts';
|
||||||
@@ -0,0 +1,55 @@
|
|||||||
|
import process from 'node:process';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Result from creating a prompt interface
|
||||||
|
*/
|
||||||
|
export interface IPromptInterface {
|
||||||
|
/** Function to prompt for user input */
|
||||||
|
prompt: (question: string) => Promise<string>;
|
||||||
|
/** Function to close the prompt interface */
|
||||||
|
close: () => void;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create a readline prompt interface for interactive CLI input
|
||||||
|
* @returns Promise resolving to prompt function and close function
|
||||||
|
*/
|
||||||
|
export async function createPrompt(): Promise<IPromptInterface> {
|
||||||
|
const readline = await import('node:readline');
|
||||||
|
|
||||||
|
const rl = readline.createInterface({
|
||||||
|
input: process.stdin,
|
||||||
|
output: process.stdout,
|
||||||
|
});
|
||||||
|
|
||||||
|
const prompt = (question: string): Promise<string> => {
|
||||||
|
return new Promise((resolve) => {
|
||||||
|
rl.question(question, (answer: string) => {
|
||||||
|
resolve(answer);
|
||||||
|
});
|
||||||
|
});
|
||||||
|
};
|
||||||
|
|
||||||
|
const close = (): void => {
|
||||||
|
rl.close();
|
||||||
|
process.stdin.destroy();
|
||||||
|
};
|
||||||
|
|
||||||
|
return { prompt, close };
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Run an async function with a prompt interface, ensuring cleanup
|
||||||
|
* @param fn Function to run with the prompt interface
|
||||||
|
* @returns Promise resolving to the function's return value
|
||||||
|
*/
|
||||||
|
export async function withPrompt<T>(
|
||||||
|
fn: (prompt: (question: string) => Promise<string>) => Promise<T>,
|
||||||
|
): Promise<T> {
|
||||||
|
const { prompt, close } = await createPrompt();
|
||||||
|
try {
|
||||||
|
return await fn(prompt);
|
||||||
|
} finally {
|
||||||
|
close();
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,22 @@
|
|||||||
|
/**
|
||||||
|
* Generate a short unique ID of 6 alphanumeric characters
|
||||||
|
* @returns A 6-character alphanumeric string
|
||||||
|
*/
|
||||||
|
export function shortId(): string {
|
||||||
|
// Define the character set: a-z, A-Z, 0-9
|
||||||
|
const chars = 'abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789';
|
||||||
|
|
||||||
|
// Generate cryptographically secure random values
|
||||||
|
const randomValues = new Uint8Array(6);
|
||||||
|
crypto.getRandomValues(randomValues);
|
||||||
|
|
||||||
|
// Map each random value to a character in our set
|
||||||
|
let result = '';
|
||||||
|
for (let i = 0; i < 6; i++) {
|
||||||
|
// Use modulo to map the random byte to a character index
|
||||||
|
const index = randomValues[i] % chars.length;
|
||||||
|
result += chars[index];
|
||||||
|
}
|
||||||
|
|
||||||
|
return result;
|
||||||
|
}
|
||||||
@@ -0,0 +1,124 @@
|
|||||||
|
import * as http from 'node:http';
|
||||||
|
import { URL } from 'node:url';
|
||||||
|
import { logger } from './logger.ts';
|
||||||
|
import type { IPauseState } from './pause-state.ts';
|
||||||
|
import type { IUpsStatus } from './ups-status.ts';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* HTTP Server for exposing UPS status as JSON
|
||||||
|
* Serves cached data from the daemon's monitoring loop
|
||||||
|
*/
|
||||||
|
export class NupstHttpServer {
|
||||||
|
private server?: http.Server;
|
||||||
|
private port: number;
|
||||||
|
private path: string;
|
||||||
|
private authToken: string;
|
||||||
|
private getUpsStatus: () => Map<string, IUpsStatus>;
|
||||||
|
private getPauseState: () => IPauseState | null;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create a new HTTP server instance
|
||||||
|
* @param port Port to listen on
|
||||||
|
* @param path URL path for the endpoint
|
||||||
|
* @param authToken Authentication token required for access
|
||||||
|
* @param getUpsStatus Function to retrieve cached UPS status
|
||||||
|
* @param getPauseState Function to retrieve current pause state
|
||||||
|
*/
|
||||||
|
constructor(
|
||||||
|
port: number,
|
||||||
|
path: string,
|
||||||
|
authToken: string,
|
||||||
|
getUpsStatus: () => Map<string, IUpsStatus>,
|
||||||
|
getPauseState: () => IPauseState | null,
|
||||||
|
) {
|
||||||
|
this.port = port;
|
||||||
|
this.path = path;
|
||||||
|
this.authToken = authToken;
|
||||||
|
this.getUpsStatus = getUpsStatus;
|
||||||
|
this.getPauseState = getPauseState;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Verify authentication token from request
|
||||||
|
* Supports both Bearer token in Authorization header and token query parameter
|
||||||
|
* @param req HTTP request
|
||||||
|
* @returns True if authenticated, false otherwise
|
||||||
|
*/
|
||||||
|
private isAuthenticated(req: http.IncomingMessage): boolean {
|
||||||
|
// Check Authorization header (Bearer token)
|
||||||
|
const authHeader = req.headers.authorization;
|
||||||
|
if (authHeader?.startsWith('Bearer ')) {
|
||||||
|
const token = authHeader.substring(7);
|
||||||
|
return token === this.authToken;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Check token query parameter
|
||||||
|
if (req.url) {
|
||||||
|
const url = new URL(req.url, `http://localhost:${this.port}`);
|
||||||
|
const tokenParam = url.searchParams.get('token');
|
||||||
|
return tokenParam === this.authToken;
|
||||||
|
}
|
||||||
|
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Start the HTTP server
|
||||||
|
*/
|
||||||
|
public start(): void {
|
||||||
|
this.server = http.createServer((req, res) => {
|
||||||
|
// Parse URL
|
||||||
|
const reqUrl = new URL(req.url || '/', `http://localhost:${this.port}`);
|
||||||
|
|
||||||
|
if (reqUrl.pathname === this.path && req.method === 'GET') {
|
||||||
|
// Check authentication
|
||||||
|
if (!this.isAuthenticated(req)) {
|
||||||
|
res.writeHead(401, {
|
||||||
|
'Content-Type': 'application/json',
|
||||||
|
'WWW-Authenticate': 'Bearer',
|
||||||
|
});
|
||||||
|
res.end(JSON.stringify({ error: 'Unauthorized' }));
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Get cached status (no refresh)
|
||||||
|
const statusMap = this.getUpsStatus();
|
||||||
|
const statusArray = Array.from(statusMap.values());
|
||||||
|
const pauseState = this.getPauseState();
|
||||||
|
|
||||||
|
const response = {
|
||||||
|
upsDevices: statusArray,
|
||||||
|
...(pauseState ? { paused: true, pauseState } : { paused: false }),
|
||||||
|
};
|
||||||
|
|
||||||
|
res.writeHead(200, {
|
||||||
|
'Content-Type': 'application/json',
|
||||||
|
'Cache-Control': 'no-cache',
|
||||||
|
});
|
||||||
|
res.end(JSON.stringify(response, null, 2));
|
||||||
|
} else {
|
||||||
|
res.writeHead(404, { 'Content-Type': 'application/json' });
|
||||||
|
res.end(JSON.stringify({ error: 'Not Found' }));
|
||||||
|
}
|
||||||
|
});
|
||||||
|
|
||||||
|
this.server.listen(this.port, () => {
|
||||||
|
logger.success(`HTTP server started on port ${this.port} at ${this.path}`);
|
||||||
|
});
|
||||||
|
|
||||||
|
this.server.on('error', (error: Error) => {
|
||||||
|
logger.error(`HTTP server error: ${error.message}`);
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Stop the HTTP server
|
||||||
|
*/
|
||||||
|
public stop(): void {
|
||||||
|
if (this.server) {
|
||||||
|
this.server.close(() => {
|
||||||
|
logger.log('HTTP server stopped');
|
||||||
|
});
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
+6
-4
@@ -1,6 +1,8 @@
|
|||||||
#!/usr/bin/env node
|
#!/usr/bin/env node
|
||||||
|
|
||||||
import { NupstCli } from './cli.js';
|
import { NupstCli } from './cli.ts';
|
||||||
|
import { logger } from './logger.ts';
|
||||||
|
import process from 'node:process';
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Main entry point for NUPST
|
* Main entry point for NUPST
|
||||||
@@ -8,11 +10,11 @@ import { NupstCli } from './cli.js';
|
|||||||
*/
|
*/
|
||||||
async function main() {
|
async function main() {
|
||||||
const cli = new NupstCli();
|
const cli = new NupstCli();
|
||||||
await cli.parseAndExecute(process.argv);
|
await cli.parseAndExecute(process.argv.slice(2));
|
||||||
}
|
}
|
||||||
|
|
||||||
// Run the main function and handle any errors
|
// Run the main function and handle any errors
|
||||||
main().catch(error => {
|
main().catch((error) => {
|
||||||
console.error('Error:', error);
|
logger.error(`Error: ${error}`);
|
||||||
process.exit(1);
|
process.exit(1);
|
||||||
});
|
});
|
||||||
|
|||||||
@@ -0,0 +1 @@
|
|||||||
|
export * from './nupst-accessor.ts';
|
||||||
@@ -0,0 +1,41 @@
|
|||||||
|
import type { NupstDaemon } from '../daemon.ts';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Update status information
|
||||||
|
*/
|
||||||
|
export interface IUpdateStatus {
|
||||||
|
currentVersion: string;
|
||||||
|
latestVersion: string;
|
||||||
|
updateAvailable: boolean;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Interface for accessing Nupst functionality from SNMP manager
|
||||||
|
* This breaks the circular dependency between Nupst and NupstSnmp
|
||||||
|
*/
|
||||||
|
export interface INupstAccessor {
|
||||||
|
/**
|
||||||
|
* Get the daemon manager for background monitoring
|
||||||
|
*/
|
||||||
|
getDaemon(): NupstDaemon;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the current version of NUPST
|
||||||
|
*/
|
||||||
|
getVersion(): string;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Check if an update is available
|
||||||
|
*/
|
||||||
|
checkForUpdates(): Promise<boolean>;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get update status information
|
||||||
|
*/
|
||||||
|
getUpdateStatus(): IUpdateStatus;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Log the current version and update status
|
||||||
|
*/
|
||||||
|
logVersionInfo(checkForUpdates?: boolean): void;
|
||||||
|
}
|
||||||
+334
@@ -0,0 +1,334 @@
|
|||||||
|
import { symbols, theme } from './colors.ts';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Table column alignment options
|
||||||
|
*/
|
||||||
|
export type TColumnAlign = 'left' | 'right' | 'center';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Table column definition
|
||||||
|
*/
|
||||||
|
export interface ITableColumn {
|
||||||
|
/** Column header text */
|
||||||
|
header: string;
|
||||||
|
/** Column key in data object */
|
||||||
|
key: string;
|
||||||
|
/** Column alignment (default: left) */
|
||||||
|
align?: TColumnAlign;
|
||||||
|
/** Column width (auto-calculated if not specified) */
|
||||||
|
width?: number;
|
||||||
|
/** Color function to apply to cell values */
|
||||||
|
color?: (value: string) => string;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Box style types with colors
|
||||||
|
*/
|
||||||
|
export type TBoxStyle = 'default' | 'success' | 'error' | 'warning' | 'info';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A simple logger class that provides consistent formatting for log messages
|
||||||
|
* including support for logboxes with title, lines, and closing
|
||||||
|
*/
|
||||||
|
export class Logger {
|
||||||
|
private currentBoxWidth: number | null = null;
|
||||||
|
private currentBoxStyle: TBoxStyle = 'default';
|
||||||
|
private static instance: Logger;
|
||||||
|
|
||||||
|
/** Default width to use when no width is specified */
|
||||||
|
private readonly DEFAULT_WIDTH = 60;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a new Logger instance
|
||||||
|
*/
|
||||||
|
constructor() {
|
||||||
|
this.currentBoxWidth = null;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the singleton logger instance
|
||||||
|
* @returns The singleton logger instance
|
||||||
|
*/
|
||||||
|
public static getInstance(): Logger {
|
||||||
|
if (!Logger.instance) {
|
||||||
|
Logger.instance = new Logger();
|
||||||
|
}
|
||||||
|
return Logger.instance;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Log a message
|
||||||
|
* @param message Message to log
|
||||||
|
*/
|
||||||
|
public log(message: string): void {
|
||||||
|
console.log(message);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Log an error message (red with ✗ symbol)
|
||||||
|
* @param message Error message to log
|
||||||
|
*/
|
||||||
|
public error(message: string): void {
|
||||||
|
console.error(`${symbols.error} ${theme.error(message)}`);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Log a warning message (yellow with ⚠ symbol)
|
||||||
|
* @param message Warning message to log
|
||||||
|
*/
|
||||||
|
public warn(message: string): void {
|
||||||
|
console.warn(`${symbols.warning} ${theme.warning(message)}`);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Log a success message (green with ✓ symbol)
|
||||||
|
* @param message Success message to log
|
||||||
|
*/
|
||||||
|
public success(message: string): void {
|
||||||
|
console.log(`${symbols.success} ${theme.success(message)}`);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Log an info message (cyan with ℹ symbol)
|
||||||
|
* @param message Info message to log
|
||||||
|
*/
|
||||||
|
public info(message: string): void {
|
||||||
|
console.log(`${symbols.info} ${theme.info(message)}`);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Log a dim/secondary message
|
||||||
|
* @param message Message to log in dim style
|
||||||
|
*/
|
||||||
|
public dim(message: string): void {
|
||||||
|
console.log(theme.dim(message));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Log a highlighted/bold message
|
||||||
|
* @param message Message to highlight
|
||||||
|
*/
|
||||||
|
public highlight(message: string): void {
|
||||||
|
console.log(theme.highlight(message));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get color function for box based on style
|
||||||
|
*/
|
||||||
|
private getBoxColor(style: TBoxStyle): (text: string) => string {
|
||||||
|
switch (style) {
|
||||||
|
case 'success':
|
||||||
|
return theme.borderSuccess;
|
||||||
|
case 'error':
|
||||||
|
return theme.borderError;
|
||||||
|
case 'warning':
|
||||||
|
return theme.borderWarning;
|
||||||
|
case 'info':
|
||||||
|
return theme.borderInfo;
|
||||||
|
case 'default':
|
||||||
|
default:
|
||||||
|
return theme.borderDefault;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Log a logbox title and set the current box width
|
||||||
|
* @param title Title of the logbox
|
||||||
|
* @param width Width of the logbox (including borders), defaults to DEFAULT_WIDTH
|
||||||
|
* @param style Box style for coloring (default, success, error, warning, info)
|
||||||
|
*/
|
||||||
|
public logBoxTitle(title: string, width?: number, style?: TBoxStyle): void {
|
||||||
|
this.currentBoxWidth = width || this.DEFAULT_WIDTH;
|
||||||
|
this.currentBoxStyle = style || 'default';
|
||||||
|
|
||||||
|
const colorFn = this.getBoxColor(this.currentBoxStyle);
|
||||||
|
|
||||||
|
// Create the title line with appropriate padding
|
||||||
|
const paddedTitle = ` ${title} `;
|
||||||
|
const remainingSpace = this.currentBoxWidth - 3 - paddedTitle.length;
|
||||||
|
|
||||||
|
// Title line: ┌─ Title ───┐
|
||||||
|
const titleLine = `┌─${paddedTitle}${'─'.repeat(Math.max(0, remainingSpace))}┐`;
|
||||||
|
|
||||||
|
console.log(colorFn(titleLine));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Log a logbox line
|
||||||
|
* @param content Content of the line
|
||||||
|
* @param width Optional width override. If not provided, uses the current box width or DEFAULT_WIDTH.
|
||||||
|
*/
|
||||||
|
public logBoxLine(content: string, width?: number): void {
|
||||||
|
if (!this.currentBoxWidth && !width) {
|
||||||
|
// No current width and no width provided, use default width
|
||||||
|
this.logBoxTitle('', this.DEFAULT_WIDTH);
|
||||||
|
}
|
||||||
|
|
||||||
|
const boxWidth = width || this.currentBoxWidth || this.DEFAULT_WIDTH;
|
||||||
|
const colorFn = this.getBoxColor(this.currentBoxStyle);
|
||||||
|
|
||||||
|
// Calculate the available space for content (use visible length)
|
||||||
|
const availableSpace = boxWidth - 2; // Account for left and right borders
|
||||||
|
const visibleLen = this.visibleLength(content);
|
||||||
|
|
||||||
|
if (visibleLen <= availableSpace - 1) {
|
||||||
|
// If content fits with at least one space for the right border stripe
|
||||||
|
const padding = availableSpace - visibleLen - 1;
|
||||||
|
const line = `│ ${content}${' '.repeat(padding)}│`;
|
||||||
|
console.log(colorFn(line));
|
||||||
|
} else {
|
||||||
|
// Content is too long, let it flow out of boundaries.
|
||||||
|
const line = `│ ${content}`;
|
||||||
|
console.log(colorFn(line));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Log a logbox end
|
||||||
|
* @param width Optional width override. If not provided, uses the current box width or DEFAULT_WIDTH.
|
||||||
|
*/
|
||||||
|
public logBoxEnd(width?: number): void {
|
||||||
|
const boxWidth = width || this.currentBoxWidth || this.DEFAULT_WIDTH;
|
||||||
|
const colorFn = this.getBoxColor(this.currentBoxStyle);
|
||||||
|
|
||||||
|
// Create the bottom border: └────────┘
|
||||||
|
const bottomLine = `└${'─'.repeat(boxWidth - 2)}┘`;
|
||||||
|
console.log(colorFn(bottomLine));
|
||||||
|
|
||||||
|
// Reset the current box width and style
|
||||||
|
this.currentBoxWidth = null;
|
||||||
|
this.currentBoxStyle = 'default';
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Log a complete logbox with title, content lines, and ending
|
||||||
|
* @param title Title of the logbox
|
||||||
|
* @param lines Array of content lines
|
||||||
|
* @param width Width of the logbox, defaults to DEFAULT_WIDTH
|
||||||
|
* @param style Box style for coloring
|
||||||
|
*/
|
||||||
|
public logBox(title: string, lines: string[], width?: number, style?: TBoxStyle): void {
|
||||||
|
this.logBoxTitle(title, width || this.DEFAULT_WIDTH, style);
|
||||||
|
|
||||||
|
for (const line of lines) {
|
||||||
|
this.logBoxLine(line);
|
||||||
|
}
|
||||||
|
|
||||||
|
this.logBoxEnd();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Log a divider line
|
||||||
|
* @param width Width of the divider, defaults to DEFAULT_WIDTH
|
||||||
|
* @param character Character to use for the divider (default: ─)
|
||||||
|
*/
|
||||||
|
public logDivider(width?: number, character: string = '─'): void {
|
||||||
|
console.log(character.repeat(width || this.DEFAULT_WIDTH));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Strip ANSI color codes from string for accurate length calculation
|
||||||
|
*/
|
||||||
|
private stripAnsi(text: string): string {
|
||||||
|
// Remove ANSI escape codes (intentional control character regex)
|
||||||
|
// deno-lint-ignore no-control-regex
|
||||||
|
return text.replace(/\x1b\[[0-9;]*m/g, '');
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get visible length of string (excluding ANSI codes)
|
||||||
|
*/
|
||||||
|
private visibleLength(text: string): number {
|
||||||
|
return this.stripAnsi(text).length;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Align text within a column (handles ANSI color codes correctly)
|
||||||
|
*/
|
||||||
|
private alignText(text: string, width: number, align: TColumnAlign = 'left'): string {
|
||||||
|
const visibleLen = this.visibleLength(text);
|
||||||
|
|
||||||
|
if (visibleLen >= width) {
|
||||||
|
// Text is too long, truncate the visible part
|
||||||
|
const stripped = this.stripAnsi(text);
|
||||||
|
return stripped.substring(0, width);
|
||||||
|
}
|
||||||
|
|
||||||
|
const padding = width - visibleLen;
|
||||||
|
|
||||||
|
switch (align) {
|
||||||
|
case 'right':
|
||||||
|
return ' '.repeat(padding) + text;
|
||||||
|
case 'center': {
|
||||||
|
const leftPad = Math.floor(padding / 2);
|
||||||
|
const rightPad = padding - leftPad;
|
||||||
|
return ' '.repeat(leftPad) + text + ' '.repeat(rightPad);
|
||||||
|
}
|
||||||
|
case 'left':
|
||||||
|
default:
|
||||||
|
return text + ' '.repeat(padding);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Log a formatted table
|
||||||
|
* @param columns Column definitions
|
||||||
|
* @param rows Array of data objects
|
||||||
|
* @param title Optional table title
|
||||||
|
*/
|
||||||
|
public logTable(columns: ITableColumn[], rows: Record<string, string>[], title?: string): void {
|
||||||
|
if (rows.length === 0) {
|
||||||
|
this.dim('No data to display');
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Calculate column widths
|
||||||
|
const columnWidths = columns.map((col) => {
|
||||||
|
if (col.width) return col.width;
|
||||||
|
|
||||||
|
// Auto-calculate width based on header and data (use visible length)
|
||||||
|
let maxWidth = this.visibleLength(col.header);
|
||||||
|
for (const row of rows) {
|
||||||
|
const value = String(row[col.key] || '');
|
||||||
|
maxWidth = Math.max(maxWidth, this.visibleLength(value));
|
||||||
|
}
|
||||||
|
return maxWidth;
|
||||||
|
});
|
||||||
|
|
||||||
|
// Calculate total table width
|
||||||
|
const totalWidth = columnWidths.reduce((sum, w) => sum + w, 0) + (columns.length * 3) + 1;
|
||||||
|
|
||||||
|
// Print title if provided
|
||||||
|
if (title) {
|
||||||
|
this.logBoxTitle(title, totalWidth);
|
||||||
|
} else {
|
||||||
|
// Print top border
|
||||||
|
console.log('┌' + columnWidths.map((w) => '─'.repeat(w + 2)).join('┬') + '┐');
|
||||||
|
}
|
||||||
|
|
||||||
|
// Print header row
|
||||||
|
const headerCells = columns.map((col, i) =>
|
||||||
|
theme.highlight(this.alignText(col.header, columnWidths[i], col.align))
|
||||||
|
);
|
||||||
|
console.log('│ ' + headerCells.join(' │ ') + ' │');
|
||||||
|
|
||||||
|
// Print separator
|
||||||
|
console.log('├' + columnWidths.map((w) => '─'.repeat(w + 2)).join('┼') + '┤');
|
||||||
|
|
||||||
|
// Print data rows
|
||||||
|
for (const row of rows) {
|
||||||
|
const cells = columns.map((col, i) => {
|
||||||
|
const value = String(row[col.key] || '');
|
||||||
|
const aligned = this.alignText(value, columnWidths[i], col.align);
|
||||||
|
return col.color ? col.color(aligned) : aligned;
|
||||||
|
});
|
||||||
|
console.log('│ ' + cells.join(' │ ') + ' │');
|
||||||
|
}
|
||||||
|
|
||||||
|
// Print bottom border
|
||||||
|
console.log('└' + columnWidths.map((w) => '─'.repeat(w + 2)).join('┴') + '┘');
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Export a singleton instance for easy use
|
||||||
|
export const logger = Logger.getInstance();
|
||||||
@@ -0,0 +1,71 @@
|
|||||||
|
/**
|
||||||
|
* Abstract base class for configuration migrations
|
||||||
|
*
|
||||||
|
* Each migration represents an upgrade from one config version to another.
|
||||||
|
* Migrations run in order based on the `order` field, allowing users to jump
|
||||||
|
* multiple versions (e.g., v1 → v4 runs migrations 2, 3, and 4).
|
||||||
|
*/
|
||||||
|
/**
|
||||||
|
* Abstract base class for configuration migrations
|
||||||
|
*
|
||||||
|
* Each migration represents an upgrade from one config version to another.
|
||||||
|
* Migrations run in order based on the `toVersion` field, allowing users to jump
|
||||||
|
* multiple versions (e.g., v1 → v4 runs migrations 2, 3, and 4).
|
||||||
|
*/
|
||||||
|
export abstract class BaseMigration {
|
||||||
|
/**
|
||||||
|
* Source version this migration upgrades from
|
||||||
|
* e.g., "1.x", "3.x"
|
||||||
|
*/
|
||||||
|
abstract readonly fromVersion: string;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Target version this migration upgrades to
|
||||||
|
* e.g., "2.0", "4.0", "4.1"
|
||||||
|
*/
|
||||||
|
abstract readonly toVersion: string;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Check if this migration should run on the given config
|
||||||
|
*
|
||||||
|
* @param config - Raw configuration object to check (unknown schema for migrations)
|
||||||
|
* @returns True if migration should run, false otherwise
|
||||||
|
*/
|
||||||
|
abstract shouldRun(
|
||||||
|
config: Record<string, unknown>,
|
||||||
|
): boolean | Promise<boolean>;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Perform the migration on the given config
|
||||||
|
*
|
||||||
|
* @param config - Raw configuration object to migrate (unknown schema for migrations)
|
||||||
|
* @returns Migrated configuration object
|
||||||
|
*/
|
||||||
|
abstract migrate(
|
||||||
|
config: Record<string, unknown>,
|
||||||
|
): Record<string, unknown> | Promise<Record<string, unknown>>;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get human-readable name for this migration
|
||||||
|
*
|
||||||
|
* @returns Migration name
|
||||||
|
*/
|
||||||
|
getName(): string {
|
||||||
|
return `Migration ${this.fromVersion} → ${this.toVersion}`;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Parse version string into a comparable number
|
||||||
|
* Supports formats like "2.0", "4.1", etc.
|
||||||
|
* Returns a number like 2.0, 4.1 for sorting
|
||||||
|
*
|
||||||
|
* @returns Parsed version number for ordering
|
||||||
|
*/
|
||||||
|
getVersionOrder(): number {
|
||||||
|
const parsed = parseFloat(this.toVersion);
|
||||||
|
if (isNaN(parsed)) {
|
||||||
|
throw new Error(`Invalid version format: ${this.toVersion}`);
|
||||||
|
}
|
||||||
|
return parsed;
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,13 @@
|
|||||||
|
/**
|
||||||
|
* Configuration migrations module
|
||||||
|
*
|
||||||
|
* Exports the migration system for upgrading configs between versions.
|
||||||
|
*/
|
||||||
|
|
||||||
|
export { BaseMigration } from './base-migration.ts';
|
||||||
|
export { MigrationRunner } from './migration-runner.ts';
|
||||||
|
export { MigrationV1ToV2 } from './migration-v1-to-v2.ts';
|
||||||
|
export { MigrationV3ToV4 } from './migration-v3-to-v4.ts';
|
||||||
|
export { MigrationV4_0ToV4_1 } from './migration-v4.0-to-v4.1.ts';
|
||||||
|
export { MigrationV4_1ToV4_2 } from './migration-v4.1-to-v4.2.ts';
|
||||||
|
export { MigrationV4_2ToV4_3 } from './migration-v4.2-to-v4.3.ts';
|
||||||
@@ -0,0 +1,78 @@
|
|||||||
|
import { BaseMigration } from './base-migration.ts';
|
||||||
|
import { MigrationV1ToV2 } from './migration-v1-to-v2.ts';
|
||||||
|
import { MigrationV3ToV4 } from './migration-v3-to-v4.ts';
|
||||||
|
import { MigrationV4_0ToV4_1 } from './migration-v4.0-to-v4.1.ts';
|
||||||
|
import { MigrationV4_1ToV4_2 } from './migration-v4.1-to-v4.2.ts';
|
||||||
|
import { MigrationV4_2ToV4_3 } from './migration-v4.2-to-v4.3.ts';
|
||||||
|
import { logger } from '../logger.ts';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Migration runner
|
||||||
|
*
|
||||||
|
* Discovers all available migrations, sorts them by order,
|
||||||
|
* and runs applicable migrations in sequence.
|
||||||
|
*/
|
||||||
|
export class MigrationRunner {
|
||||||
|
private migrations: BaseMigration[];
|
||||||
|
|
||||||
|
constructor() {
|
||||||
|
// Register all migrations here
|
||||||
|
this.migrations = [
|
||||||
|
new MigrationV1ToV2(),
|
||||||
|
new MigrationV3ToV4(),
|
||||||
|
new MigrationV4_0ToV4_1(),
|
||||||
|
new MigrationV4_1ToV4_2(),
|
||||||
|
new MigrationV4_2ToV4_3(),
|
||||||
|
];
|
||||||
|
|
||||||
|
// Sort by version order to ensure they run in sequence
|
||||||
|
this.migrations.sort((a, b) => a.getVersionOrder() - b.getVersionOrder());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Run all applicable migrations on the config
|
||||||
|
*
|
||||||
|
* @param config - Raw configuration object to migrate
|
||||||
|
* @returns Migrated configuration and whether migrations ran
|
||||||
|
*/
|
||||||
|
async run(
|
||||||
|
config: Record<string, unknown>,
|
||||||
|
): Promise<{ config: Record<string, unknown>; migrated: boolean }> {
|
||||||
|
let currentConfig = config;
|
||||||
|
let anyMigrationsRan = false;
|
||||||
|
|
||||||
|
for (const migration of this.migrations) {
|
||||||
|
const shouldRun = await migration.shouldRun(currentConfig);
|
||||||
|
|
||||||
|
if (shouldRun) {
|
||||||
|
// Only show "checking" message when we actually need to migrate
|
||||||
|
if (!anyMigrationsRan) {
|
||||||
|
logger.dim('Checking for required config migrations...');
|
||||||
|
}
|
||||||
|
logger.info(`Running ${migration.getName()}...`);
|
||||||
|
currentConfig = await migration.migrate(currentConfig);
|
||||||
|
anyMigrationsRan = true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if (anyMigrationsRan) {
|
||||||
|
logger.success('Configuration migrations complete');
|
||||||
|
} else {
|
||||||
|
logger.success('Configuration format OK');
|
||||||
|
}
|
||||||
|
|
||||||
|
return {
|
||||||
|
config: currentConfig,
|
||||||
|
migrated: anyMigrationsRan,
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get all registered migrations
|
||||||
|
*
|
||||||
|
* @returns Array of all migrations sorted by order
|
||||||
|
*/
|
||||||
|
getMigrations(): BaseMigration[] {
|
||||||
|
return [...this.migrations];
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,55 @@
|
|||||||
|
import { BaseMigration } from './base-migration.ts';
|
||||||
|
import { logger } from '../logger.ts';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Migration from v1 (single SNMP config) to v2 (upsDevices array)
|
||||||
|
*
|
||||||
|
* Detects old format:
|
||||||
|
* {
|
||||||
|
* snmp: { ... },
|
||||||
|
* thresholds: { ... },
|
||||||
|
* checkInterval: 30000
|
||||||
|
* }
|
||||||
|
*
|
||||||
|
* Converts to:
|
||||||
|
* {
|
||||||
|
* version: "2.0",
|
||||||
|
* upsDevices: [{ id: "default", name: "Default UPS", snmp: ..., thresholds: ... }],
|
||||||
|
* groups: [],
|
||||||
|
* checkInterval: 30000
|
||||||
|
* }
|
||||||
|
*/
|
||||||
|
export class MigrationV1ToV2 extends BaseMigration {
|
||||||
|
readonly fromVersion = '1.x';
|
||||||
|
readonly toVersion = '2.0';
|
||||||
|
|
||||||
|
shouldRun(config: Record<string, unknown>): boolean {
|
||||||
|
// V1 format has snmp field directly at root, no upsDevices or upsList
|
||||||
|
return !!config.snmp && !config.upsDevices && !config.upsList;
|
||||||
|
}
|
||||||
|
|
||||||
|
migrate(config: Record<string, unknown>): Record<string, unknown> {
|
||||||
|
logger.info(`${this.getName()}: Converting single SNMP config to multi-UPS format...`);
|
||||||
|
|
||||||
|
const migrated = {
|
||||||
|
version: this.toVersion,
|
||||||
|
upsDevices: [
|
||||||
|
{
|
||||||
|
id: 'default',
|
||||||
|
name: 'Default UPS',
|
||||||
|
snmp: config.snmp,
|
||||||
|
thresholds: config.thresholds || {
|
||||||
|
battery: 60,
|
||||||
|
runtime: 20,
|
||||||
|
},
|
||||||
|
groups: [],
|
||||||
|
},
|
||||||
|
],
|
||||||
|
groups: [],
|
||||||
|
checkInterval: config.checkInterval || 30000,
|
||||||
|
};
|
||||||
|
|
||||||
|
logger.success(`${this.getName()}: Migration complete`);
|
||||||
|
return migrated;
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,121 @@
|
|||||||
|
import { BaseMigration } from './base-migration.ts';
|
||||||
|
import { logger } from '../logger.ts';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Migration from v3 (upsList) to v4 (upsDevices)
|
||||||
|
*
|
||||||
|
* Transforms v3 format with flat SNMP config:
|
||||||
|
* {
|
||||||
|
* upsList: [
|
||||||
|
* {
|
||||||
|
* id: "ups-1",
|
||||||
|
* name: "UPS 1",
|
||||||
|
* host: "192.168.1.1",
|
||||||
|
* port: 161,
|
||||||
|
* community: "public",
|
||||||
|
* version: "1" // string
|
||||||
|
* }
|
||||||
|
* ]
|
||||||
|
* }
|
||||||
|
*
|
||||||
|
* To v4 format with nested SNMP config:
|
||||||
|
* {
|
||||||
|
* version: "4.0",
|
||||||
|
* upsDevices: [
|
||||||
|
* {
|
||||||
|
* id: "ups-1",
|
||||||
|
* name: "UPS 1",
|
||||||
|
* snmp: {
|
||||||
|
* host: "192.168.1.1",
|
||||||
|
* port: 161,
|
||||||
|
* community: "public",
|
||||||
|
* version: 1, // number
|
||||||
|
* timeout: 5000
|
||||||
|
* },
|
||||||
|
* thresholds: { battery: 60, runtime: 20 },
|
||||||
|
* groups: []
|
||||||
|
* }
|
||||||
|
* ]
|
||||||
|
* }
|
||||||
|
*/
|
||||||
|
export class MigrationV3ToV4 extends BaseMigration {
|
||||||
|
readonly fromVersion = '3.x';
|
||||||
|
readonly toVersion = '4.0';
|
||||||
|
|
||||||
|
shouldRun(config: Record<string, unknown>): boolean {
|
||||||
|
// V3 format has upsList OR has upsDevices with flat structure (host at top level)
|
||||||
|
if (config.upsList && !config.upsDevices) {
|
||||||
|
return true; // Classic v3 with upsList
|
||||||
|
}
|
||||||
|
|
||||||
|
// Check if upsDevices exists but has flat structure (v3 format)
|
||||||
|
const upsDevices = config.upsDevices as Array<Record<string, unknown>> | undefined;
|
||||||
|
if (upsDevices && upsDevices.length > 0) {
|
||||||
|
const firstDevice = upsDevices[0];
|
||||||
|
// V3 has host at top level, v4 has it nested in snmp object
|
||||||
|
return !!firstDevice.host && !firstDevice.snmp;
|
||||||
|
}
|
||||||
|
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
migrate(config: Record<string, unknown>): Record<string, unknown> {
|
||||||
|
logger.info(`${this.getName()}: Migrating v3 config to v4 format...`);
|
||||||
|
logger.dim(` - Restructuring UPS devices (flat → nested snmp config)`);
|
||||||
|
|
||||||
|
// Get devices from either upsList or upsDevices (for partially migrated configs)
|
||||||
|
const sourceDevices = (config.upsList || config.upsDevices) as Array<Record<string, unknown>>;
|
||||||
|
|
||||||
|
// Transform each UPS device from v3 flat structure to v4 nested structure
|
||||||
|
const transformedDevices = sourceDevices.map((device: Record<string, unknown>) => {
|
||||||
|
// Build SNMP config object
|
||||||
|
const snmpConfig: Record<string, unknown> = {
|
||||||
|
host: device.host,
|
||||||
|
port: device.port || 161,
|
||||||
|
version: typeof device.version === 'string' ? parseInt(device.version, 10) : device.version,
|
||||||
|
timeout: device.timeout || 5000,
|
||||||
|
};
|
||||||
|
|
||||||
|
// Add SNMPv1/v2c fields
|
||||||
|
if (device.community) {
|
||||||
|
snmpConfig.community = device.community;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Add SNMPv3 fields
|
||||||
|
if (device.securityLevel) snmpConfig.securityLevel = device.securityLevel;
|
||||||
|
if (device.username) snmpConfig.username = device.username;
|
||||||
|
if (device.authProtocol) snmpConfig.authProtocol = device.authProtocol;
|
||||||
|
if (device.authKey) snmpConfig.authKey = device.authKey;
|
||||||
|
if (device.privProtocol) snmpConfig.privProtocol = device.privProtocol;
|
||||||
|
if (device.privKey) snmpConfig.privKey = device.privKey;
|
||||||
|
|
||||||
|
// Add UPS model if present
|
||||||
|
if (device.upsModel) snmpConfig.upsModel = device.upsModel;
|
||||||
|
if (device.customOIDs) snmpConfig.customOIDs = device.customOIDs;
|
||||||
|
|
||||||
|
// Return v4 format with nested structure
|
||||||
|
return {
|
||||||
|
id: device.id,
|
||||||
|
name: device.name,
|
||||||
|
snmp: snmpConfig,
|
||||||
|
thresholds: device.thresholds || {
|
||||||
|
battery: 60,
|
||||||
|
runtime: 20,
|
||||||
|
},
|
||||||
|
groups: device.groups || [],
|
||||||
|
};
|
||||||
|
});
|
||||||
|
|
||||||
|
const migrated = {
|
||||||
|
version: this.toVersion,
|
||||||
|
upsDevices: transformedDevices,
|
||||||
|
groups: config.groups || [],
|
||||||
|
checkInterval: config.checkInterval || 30000,
|
||||||
|
};
|
||||||
|
|
||||||
|
logger.success(
|
||||||
|
`${this.getName()}: Migration complete (${transformedDevices.length} devices transformed)`,
|
||||||
|
);
|
||||||
|
return migrated;
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,129 @@
|
|||||||
|
import { BaseMigration } from './base-migration.ts';
|
||||||
|
import { logger } from '../logger.ts';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Migration from v4.0 to v4.1
|
||||||
|
*
|
||||||
|
* Major changes:
|
||||||
|
* 1. Moves thresholds from UPS level to action level
|
||||||
|
* 2. Creates default shutdown action for UPS devices that had thresholds
|
||||||
|
* 3. Adds empty actions array to UPS devices without actions
|
||||||
|
* 4. Adds empty actions array to groups
|
||||||
|
*
|
||||||
|
* Transforms v4.0 format (with UPS-level thresholds):
|
||||||
|
* {
|
||||||
|
* version: "4.0",
|
||||||
|
* upsDevices: [
|
||||||
|
* {
|
||||||
|
* id: "ups-1",
|
||||||
|
* name: "UPS 1",
|
||||||
|
* snmp: {...},
|
||||||
|
* thresholds: { battery: 60, runtime: 20 }, // UPS-level
|
||||||
|
* groups: []
|
||||||
|
* }
|
||||||
|
* ]
|
||||||
|
* }
|
||||||
|
*
|
||||||
|
* To v4.1 format (with action-level thresholds):
|
||||||
|
* {
|
||||||
|
* version: "4.1",
|
||||||
|
* upsDevices: [
|
||||||
|
* {
|
||||||
|
* id: "ups-1",
|
||||||
|
* name: "UPS 1",
|
||||||
|
* snmp: {...},
|
||||||
|
* groups: [],
|
||||||
|
* actions: [ // Thresholds moved here
|
||||||
|
* {
|
||||||
|
* type: "shutdown",
|
||||||
|
* thresholds: { battery: 60, runtime: 20 },
|
||||||
|
* triggerMode: "onlyThresholds",
|
||||||
|
* shutdownDelay: 5
|
||||||
|
* }
|
||||||
|
* ]
|
||||||
|
* }
|
||||||
|
* ]
|
||||||
|
* }
|
||||||
|
*/
|
||||||
|
export class MigrationV4_0ToV4_1 extends BaseMigration {
|
||||||
|
readonly fromVersion = '4.0';
|
||||||
|
readonly toVersion = '4.1';
|
||||||
|
|
||||||
|
shouldRun(config: Record<string, unknown>): boolean {
|
||||||
|
// Run if config is version 4.0
|
||||||
|
if (config.version === '4.0') {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Also run if config has upsDevices with thresholds at UPS level (v4.0 format)
|
||||||
|
if (Array.isArray(config.upsDevices) && config.upsDevices.length > 0) {
|
||||||
|
const firstDevice = config.upsDevices[0] as Record<string, unknown>;
|
||||||
|
// v4.0 has thresholds at UPS level, v4.1 has them in actions
|
||||||
|
return firstDevice.thresholds !== undefined;
|
||||||
|
}
|
||||||
|
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
migrate(config: Record<string, unknown>): Record<string, unknown> {
|
||||||
|
logger.info(`${this.getName()}: Migrating v4.0 config to v4.1 format...`);
|
||||||
|
logger.dim(` - Moving thresholds from UPS level to action level`);
|
||||||
|
logger.dim(` - Creating default shutdown actions from existing thresholds`);
|
||||||
|
|
||||||
|
// Migrate UPS devices
|
||||||
|
const devices = (config.upsDevices as Array<Record<string, unknown>>) || [];
|
||||||
|
const migratedDevices = devices.map((device) => {
|
||||||
|
const migrated: Record<string, unknown> = {
|
||||||
|
id: device.id,
|
||||||
|
name: device.name,
|
||||||
|
snmp: device.snmp,
|
||||||
|
groups: device.groups || [],
|
||||||
|
};
|
||||||
|
|
||||||
|
// If device has thresholds at UPS level, convert to shutdown action
|
||||||
|
const deviceThresholds = device.thresholds as
|
||||||
|
| { battery: number; runtime: number }
|
||||||
|
| undefined;
|
||||||
|
if (deviceThresholds) {
|
||||||
|
migrated.actions = [
|
||||||
|
{
|
||||||
|
type: 'shutdown',
|
||||||
|
thresholds: {
|
||||||
|
battery: deviceThresholds.battery,
|
||||||
|
runtime: deviceThresholds.runtime,
|
||||||
|
},
|
||||||
|
triggerMode: 'onlyThresholds', // Preserve old behavior (only on threshold violation)
|
||||||
|
shutdownDelay: 5, // Default delay
|
||||||
|
},
|
||||||
|
];
|
||||||
|
logger.dim(
|
||||||
|
` → ${device.name}: Created shutdown action (battery: ${deviceThresholds.battery}%, runtime: ${deviceThresholds.runtime}min)`,
|
||||||
|
);
|
||||||
|
} else {
|
||||||
|
// No thresholds, just add empty actions array
|
||||||
|
migrated.actions = device.actions || [];
|
||||||
|
}
|
||||||
|
|
||||||
|
return migrated;
|
||||||
|
});
|
||||||
|
|
||||||
|
// Add actions to groups
|
||||||
|
const groups = (config.groups as Array<Record<string, unknown>>) || [];
|
||||||
|
const migratedGroups = groups.map((group) => ({
|
||||||
|
...group,
|
||||||
|
actions: group.actions || [],
|
||||||
|
}));
|
||||||
|
|
||||||
|
const result = {
|
||||||
|
version: this.toVersion,
|
||||||
|
upsDevices: migratedDevices,
|
||||||
|
groups: migratedGroups,
|
||||||
|
checkInterval: config.checkInterval || 30000,
|
||||||
|
};
|
||||||
|
|
||||||
|
logger.success(
|
||||||
|
`${this.getName()}: Migration complete (${migratedDevices.length} devices, ${migratedGroups.length} groups updated)`,
|
||||||
|
);
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,43 @@
|
|||||||
|
import { BaseMigration } from './base-migration.ts';
|
||||||
|
import { logger } from '../logger.ts';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Migration from v4.1 to v4.2
|
||||||
|
*
|
||||||
|
* Changes:
|
||||||
|
* 1. Adds `protocol: 'snmp'` to all existing UPS devices (explicit default)
|
||||||
|
* 2. Bumps version from '4.1' to '4.2'
|
||||||
|
*/
|
||||||
|
export class MigrationV4_1ToV4_2 extends BaseMigration {
|
||||||
|
readonly fromVersion = '4.1';
|
||||||
|
readonly toVersion = '4.2';
|
||||||
|
|
||||||
|
shouldRun(config: Record<string, unknown>): boolean {
|
||||||
|
return config.version === '4.1';
|
||||||
|
}
|
||||||
|
|
||||||
|
migrate(config: Record<string, unknown>): Record<string, unknown> {
|
||||||
|
logger.info(`${this.getName()}: Adding protocol field to UPS devices...`);
|
||||||
|
|
||||||
|
const devices = (config.upsDevices as Array<Record<string, unknown>>) || [];
|
||||||
|
const migratedDevices = devices.map((device) => {
|
||||||
|
// Add protocol: 'snmp' if not already present
|
||||||
|
if (!device.protocol) {
|
||||||
|
device.protocol = 'snmp';
|
||||||
|
logger.dim(` → ${device.name}: Set protocol to 'snmp'`);
|
||||||
|
}
|
||||||
|
return device;
|
||||||
|
});
|
||||||
|
|
||||||
|
const result = {
|
||||||
|
...config,
|
||||||
|
version: this.toVersion,
|
||||||
|
upsDevices: migratedDevices,
|
||||||
|
};
|
||||||
|
|
||||||
|
logger.success(
|
||||||
|
`${this.getName()}: Migration complete (${migratedDevices.length} devices updated)`,
|
||||||
|
);
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,50 @@
|
|||||||
|
import { BaseMigration } from './base-migration.ts';
|
||||||
|
import { logger } from '../logger.ts';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Migration from v4.2 to v4.3
|
||||||
|
*
|
||||||
|
* Changes:
|
||||||
|
* 1. Adds `runtimeUnit` to SNMP configs based on existing `upsModel`
|
||||||
|
* 2. Bumps version from '4.2' to '4.3'
|
||||||
|
*/
|
||||||
|
export class MigrationV4_2ToV4_3 extends BaseMigration {
|
||||||
|
readonly fromVersion = '4.2';
|
||||||
|
readonly toVersion = '4.3';
|
||||||
|
|
||||||
|
shouldRun(config: Record<string, unknown>): boolean {
|
||||||
|
return config.version === '4.2';
|
||||||
|
}
|
||||||
|
|
||||||
|
migrate(config: Record<string, unknown>): Record<string, unknown> {
|
||||||
|
logger.info(`${this.getName()}: Adding runtimeUnit to SNMP configs...`);
|
||||||
|
|
||||||
|
const devices = (config.upsDevices as Array<Record<string, unknown>>) || [];
|
||||||
|
const migratedDevices = devices.map((device) => {
|
||||||
|
const snmp = device.snmp as Record<string, unknown> | undefined;
|
||||||
|
if (snmp && !snmp.runtimeUnit) {
|
||||||
|
const model = snmp.upsModel as string | undefined;
|
||||||
|
if (model === 'cyberpower') {
|
||||||
|
snmp.runtimeUnit = 'ticks';
|
||||||
|
} else if (model === 'eaton') {
|
||||||
|
snmp.runtimeUnit = 'seconds';
|
||||||
|
} else {
|
||||||
|
snmp.runtimeUnit = 'minutes';
|
||||||
|
}
|
||||||
|
logger.dim(` → ${device.name}: Set runtimeUnit to '${snmp.runtimeUnit}'`);
|
||||||
|
}
|
||||||
|
return device;
|
||||||
|
});
|
||||||
|
|
||||||
|
const result = {
|
||||||
|
...config,
|
||||||
|
version: this.toVersion,
|
||||||
|
upsDevices: migratedDevices,
|
||||||
|
};
|
||||||
|
|
||||||
|
logger.success(
|
||||||
|
`${this.getName()}: Migration complete (${migratedDevices.length} devices updated)`,
|
||||||
|
);
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
}
|
||||||
+110
-39
@@ -1,18 +1,31 @@
|
|||||||
import { NupstSnmp } from './snmp.js';
|
import { NupstSnmp } from './snmp/manager.ts';
|
||||||
import { NupstDaemon } from './daemon.js';
|
import { NupstUpsd } from './upsd/client.ts';
|
||||||
import { NupstSystemd } from './systemd.js';
|
import { NupstDaemon } from './daemon.ts';
|
||||||
import { commitinfo } from './00_commitinfo_data.js';
|
import { NupstSystemd } from './systemd.ts';
|
||||||
import { spawn } from 'child_process';
|
import denoConfig from '../deno.json' with { type: 'json' };
|
||||||
import * as https from 'https';
|
import { logger } from './logger.ts';
|
||||||
|
import { UpsHandler } from './cli/ups-handler.ts';
|
||||||
|
import { GroupHandler } from './cli/group-handler.ts';
|
||||||
|
import { ServiceHandler } from './cli/service-handler.ts';
|
||||||
|
import { ActionHandler } from './cli/action-handler.ts';
|
||||||
|
import { FeatureHandler } from './cli/feature-handler.ts';
|
||||||
|
import * as https from 'node:https';
|
||||||
|
import type { INupstAccessor, IUpdateStatus } from './interfaces/index.ts';
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Main Nupst class that coordinates all components
|
* Main Nupst class that coordinates all components
|
||||||
* Acts as a facade to access SNMP, Daemon, and Systemd functionality
|
* Acts as a facade to access SNMP, Daemon, and Systemd functionality
|
||||||
*/
|
*/
|
||||||
export class Nupst {
|
export class Nupst implements INupstAccessor {
|
||||||
private readonly snmp: NupstSnmp;
|
private readonly snmp: NupstSnmp;
|
||||||
|
private readonly upsd: NupstUpsd;
|
||||||
private readonly daemon: NupstDaemon;
|
private readonly daemon: NupstDaemon;
|
||||||
private readonly systemd: NupstSystemd;
|
private readonly systemd: NupstSystemd;
|
||||||
|
private readonly upsHandler: UpsHandler;
|
||||||
|
private readonly groupHandler: GroupHandler;
|
||||||
|
private readonly serviceHandler: ServiceHandler;
|
||||||
|
private readonly actionHandler: ActionHandler;
|
||||||
|
private readonly featureHandler: FeatureHandler;
|
||||||
private updateAvailable: boolean = false;
|
private updateAvailable: boolean = false;
|
||||||
private latestVersion: string = '';
|
private latestVersion: string = '';
|
||||||
|
|
||||||
@@ -20,10 +33,19 @@ export class Nupst {
|
|||||||
* Create a new Nupst instance with all necessary components
|
* Create a new Nupst instance with all necessary components
|
||||||
*/
|
*/
|
||||||
constructor() {
|
constructor() {
|
||||||
|
// Initialize core components
|
||||||
this.snmp = new NupstSnmp();
|
this.snmp = new NupstSnmp();
|
||||||
this.snmp.setNupst(this); // Set up bidirectional reference
|
this.snmp.setNupst(this); // Set up bidirectional reference
|
||||||
this.daemon = new NupstDaemon(this.snmp);
|
this.upsd = new NupstUpsd();
|
||||||
|
this.daemon = new NupstDaemon(this.snmp, this.upsd);
|
||||||
this.systemd = new NupstSystemd(this.daemon);
|
this.systemd = new NupstSystemd(this.daemon);
|
||||||
|
|
||||||
|
// Initialize handlers
|
||||||
|
this.upsHandler = new UpsHandler(this);
|
||||||
|
this.groupHandler = new GroupHandler(this);
|
||||||
|
this.serviceHandler = new ServiceHandler(this);
|
||||||
|
this.actionHandler = new ActionHandler(this);
|
||||||
|
this.featureHandler = new FeatureHandler(this);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -33,6 +55,13 @@ export class Nupst {
|
|||||||
return this.snmp;
|
return this.snmp;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the UPSD manager for NUT protocol communication
|
||||||
|
*/
|
||||||
|
public getUpsd(): NupstUpsd {
|
||||||
|
return this.upsd;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Get the daemon manager for background monitoring
|
* Get the daemon manager for background monitoring
|
||||||
*/
|
*/
|
||||||
@@ -47,12 +76,47 @@ export class Nupst {
|
|||||||
return this.systemd;
|
return this.systemd;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the UPS handler for UPS management
|
||||||
|
*/
|
||||||
|
public getUpsHandler(): UpsHandler {
|
||||||
|
return this.upsHandler;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the Group handler for group management
|
||||||
|
*/
|
||||||
|
public getGroupHandler(): GroupHandler {
|
||||||
|
return this.groupHandler;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the Service handler for service management
|
||||||
|
*/
|
||||||
|
public getServiceHandler(): ServiceHandler {
|
||||||
|
return this.serviceHandler;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the Action handler for action management
|
||||||
|
*/
|
||||||
|
public getActionHandler(): ActionHandler {
|
||||||
|
return this.actionHandler;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the Feature handler for feature management
|
||||||
|
*/
|
||||||
|
public getFeatureHandler(): FeatureHandler {
|
||||||
|
return this.featureHandler;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Get the current version of NUPST
|
* Get the current version of NUPST
|
||||||
* @returns The current version string
|
* @returns The current version string
|
||||||
*/
|
*/
|
||||||
public getVersion(): string {
|
public getVersion(): string {
|
||||||
return commitinfo.version;
|
return denoConfig.version;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -70,7 +134,9 @@ export class Nupst {
|
|||||||
|
|
||||||
return this.updateAvailable;
|
return this.updateAvailable;
|
||||||
} catch (error) {
|
} catch (error) {
|
||||||
console.error(`Error checking for updates: ${error.message}`);
|
logger.error(
|
||||||
|
`Error checking for updates: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -79,15 +145,11 @@ export class Nupst {
|
|||||||
* Get update status information
|
* Get update status information
|
||||||
* @returns Object with update status information
|
* @returns Object with update status information
|
||||||
*/
|
*/
|
||||||
public getUpdateStatus(): {
|
public getUpdateStatus(): IUpdateStatus {
|
||||||
currentVersion: string,
|
|
||||||
latestVersion: string,
|
|
||||||
updateAvailable: boolean
|
|
||||||
} {
|
|
||||||
return {
|
return {
|
||||||
currentVersion: this.getVersion(),
|
currentVersion: this.getVersion(),
|
||||||
latestVersion: this.latestVersion || this.getVersion(),
|
latestVersion: this.latestVersion || this.getVersion(),
|
||||||
updateAvailable: this.updateAvailable
|
updateAvailable: this.updateAvailable,
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -95,16 +157,16 @@ export class Nupst {
|
|||||||
* Get the latest version from npm registry
|
* Get the latest version from npm registry
|
||||||
* @returns Promise resolving to the latest version string
|
* @returns Promise resolving to the latest version string
|
||||||
*/
|
*/
|
||||||
private async getLatestVersion(): Promise<string> {
|
private getLatestVersion(): Promise<string> {
|
||||||
return new Promise<string>((resolve, reject) => {
|
return new Promise<string>((resolve, reject) => {
|
||||||
const options = {
|
const options = {
|
||||||
hostname: 'registry.npmjs.org',
|
hostname: 'code.foss.global',
|
||||||
path: '/@serve.zone/nupst',
|
path: '/api/v1/repos/serve.zone/nupst/releases/latest',
|
||||||
method: 'GET',
|
method: 'GET',
|
||||||
headers: {
|
headers: {
|
||||||
'Accept': 'application/json',
|
'Accept': 'application/json',
|
||||||
'User-Agent': `nupst/${this.getVersion()}`
|
'User-Agent': `nupst/${this.getVersion()}`,
|
||||||
}
|
},
|
||||||
};
|
};
|
||||||
|
|
||||||
const req = https.request(options, (res) => {
|
const req = https.request(options, (res) => {
|
||||||
@@ -117,10 +179,14 @@ export class Nupst {
|
|||||||
res.on('end', () => {
|
res.on('end', () => {
|
||||||
try {
|
try {
|
||||||
const response = JSON.parse(data);
|
const response = JSON.parse(data);
|
||||||
if (response['dist-tags'] && response['dist-tags'].latest) {
|
if (response.tag_name) {
|
||||||
resolve(response['dist-tags'].latest);
|
// Strip 'v' prefix from tag name (e.g., "v5.1.7" -> "5.1.7")
|
||||||
|
const version = response.tag_name.startsWith('v')
|
||||||
|
? response.tag_name.substring(1)
|
||||||
|
: response.tag_name;
|
||||||
|
resolve(version);
|
||||||
} else {
|
} else {
|
||||||
reject(new Error('Failed to parse version from npm registry response'));
|
reject(new Error('Failed to parse version from Gitea API response'));
|
||||||
}
|
}
|
||||||
} catch (error) {
|
} catch (error) {
|
||||||
reject(error);
|
reject(error);
|
||||||
@@ -143,8 +209,8 @@ export class Nupst {
|
|||||||
* @returns -1 if versionA < versionB, 0 if equal, 1 if versionA > versionB
|
* @returns -1 if versionA < versionB, 0 if equal, 1 if versionA > versionB
|
||||||
*/
|
*/
|
||||||
private compareVersions(versionA: string, versionB: string): number {
|
private compareVersions(versionA: string, versionB: string): number {
|
||||||
const partsA = versionA.split('.').map(part => parseInt(part, 10));
|
const partsA = versionA.split('.').map((part) => parseInt(part, 10));
|
||||||
const partsB = versionB.split('.').map(part => parseInt(part, 10));
|
const partsB = versionB.split('.').map((part) => parseInt(part, 10));
|
||||||
|
|
||||||
for (let i = 0; i < Math.max(partsA.length, partsB.length); i++) {
|
for (let i = 0; i < Math.max(partsA.length, partsB.length); i++) {
|
||||||
const partA = i < partsA.length ? partsA[i] : 0;
|
const partA = i < partsA.length ? partsA[i] : 0;
|
||||||
@@ -162,28 +228,33 @@ export class Nupst {
|
|||||||
*/
|
*/
|
||||||
public logVersionInfo(checkForUpdates: boolean = true): void {
|
public logVersionInfo(checkForUpdates: boolean = true): void {
|
||||||
const version = this.getVersion();
|
const version = this.getVersion();
|
||||||
console.log('┌─ NUPST Version ────────────────────────┐');
|
const boxWidth = 45;
|
||||||
console.log(`│ Current Version: ${version}`);
|
|
||||||
|
logger.logBoxTitle('NUPST Version', boxWidth);
|
||||||
|
logger.logBoxLine(`Current Version: ${version}`);
|
||||||
|
|
||||||
if (this.updateAvailable && this.latestVersion) {
|
if (this.updateAvailable && this.latestVersion) {
|
||||||
console.log(`│ Update Available: ${this.latestVersion}`);
|
logger.logBoxLine(`Update Available: ${this.latestVersion}`);
|
||||||
console.log('│ Run "sudo nupst update" to update');
|
logger.logBoxLine('Run "sudo nupst upgrade" to upgrade');
|
||||||
|
logger.logBoxEnd();
|
||||||
} else if (checkForUpdates) {
|
} else if (checkForUpdates) {
|
||||||
console.log('│ Checking for updates...');
|
logger.logBoxLine('Checking for updates...');
|
||||||
this.checkForUpdates().then(updateAvailable => {
|
|
||||||
|
// We can't end the box yet since we're in an async operation
|
||||||
|
this.checkForUpdates().then((updateAvailable) => {
|
||||||
if (updateAvailable) {
|
if (updateAvailable) {
|
||||||
console.log(`│ Update Available: ${this.latestVersion}`);
|
logger.logBoxLine(`Update Available: ${this.latestVersion}`);
|
||||||
console.log('│ Run "sudo nupst update" to update');
|
logger.logBoxLine('Run "sudo nupst upgrade" to upgrade');
|
||||||
} else {
|
} else {
|
||||||
console.log('│ You are running the latest version');
|
logger.logBoxLine('You are running the latest version');
|
||||||
}
|
}
|
||||||
console.log('└──────────────────────────────────────────┘');
|
logger.logBoxEnd();
|
||||||
}).catch(() => {
|
}).catch(() => {
|
||||||
console.log('│ Could not check for updates');
|
logger.logBoxLine('Could not check for updates');
|
||||||
console.log('└──────────────────────────────────────────┘');
|
logger.logBoxEnd();
|
||||||
});
|
});
|
||||||
} else {
|
} else {
|
||||||
console.log('└──────────────────────────────────────────┘');
|
logger.logBoxEnd();
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -0,0 +1,68 @@
|
|||||||
|
import * as fs from 'node:fs';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Pause state interface
|
||||||
|
*/
|
||||||
|
export interface IPauseState {
|
||||||
|
/** Timestamp when pause was activated */
|
||||||
|
pausedAt: number;
|
||||||
|
/** Who initiated the pause (e.g., 'cli', 'api') */
|
||||||
|
pausedBy: string;
|
||||||
|
/** Optional reason for pausing */
|
||||||
|
reason?: string;
|
||||||
|
/** When to auto-resume (null = indefinite, timestamp in ms) */
|
||||||
|
resumeAt?: number | null;
|
||||||
|
}
|
||||||
|
|
||||||
|
export type TPauseTransition = 'unchanged' | 'paused' | 'resumed' | 'autoResumed';
|
||||||
|
|
||||||
|
export interface IPauseSnapshot {
|
||||||
|
isPaused: boolean;
|
||||||
|
pauseState: IPauseState | null;
|
||||||
|
transition: TPauseTransition;
|
||||||
|
}
|
||||||
|
|
||||||
|
export function loadPauseSnapshot(
|
||||||
|
filePath: string,
|
||||||
|
wasPaused: boolean,
|
||||||
|
now: number = Date.now(),
|
||||||
|
): IPauseSnapshot {
|
||||||
|
try {
|
||||||
|
if (!fs.existsSync(filePath)) {
|
||||||
|
return {
|
||||||
|
isPaused: false,
|
||||||
|
pauseState: null,
|
||||||
|
transition: wasPaused ? 'resumed' : 'unchanged',
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
const data = fs.readFileSync(filePath, 'utf8');
|
||||||
|
const pauseState = JSON.parse(data) as IPauseState;
|
||||||
|
|
||||||
|
if (pauseState.resumeAt && now >= pauseState.resumeAt) {
|
||||||
|
try {
|
||||||
|
fs.unlinkSync(filePath);
|
||||||
|
} catch (_error) {
|
||||||
|
// Ignore deletion errors and still treat the pause as expired.
|
||||||
|
}
|
||||||
|
|
||||||
|
return {
|
||||||
|
isPaused: false,
|
||||||
|
pauseState: null,
|
||||||
|
transition: wasPaused ? 'autoResumed' : 'unchanged',
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
return {
|
||||||
|
isPaused: true,
|
||||||
|
pauseState,
|
||||||
|
transition: wasPaused ? 'unchanged' : 'paused',
|
||||||
|
};
|
||||||
|
} catch (_error) {
|
||||||
|
return {
|
||||||
|
isPaused: false,
|
||||||
|
pauseState: null,
|
||||||
|
transition: 'unchanged',
|
||||||
|
};
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,7 @@
|
|||||||
|
/**
|
||||||
|
* Protocol abstraction module
|
||||||
|
* Re-exports public types and classes
|
||||||
|
*/
|
||||||
|
|
||||||
|
export type { TProtocol } from './types.ts';
|
||||||
|
export { ProtocolResolver } from './resolver.ts';
|
||||||
@@ -0,0 +1,49 @@
|
|||||||
|
/**
|
||||||
|
* ProtocolResolver - Routes UPS status queries to the correct protocol implementation
|
||||||
|
*
|
||||||
|
* Abstracts away SNMP vs UPSD differences so the daemon is protocol-agnostic.
|
||||||
|
* Both protocols return the same IUpsStatus interface from ts/snmp/types.ts.
|
||||||
|
*/
|
||||||
|
|
||||||
|
import type { NupstSnmp } from '../snmp/manager.ts';
|
||||||
|
import type { NupstUpsd } from '../upsd/client.ts';
|
||||||
|
import type { ISnmpConfig, IUpsStatus } from '../snmp/types.ts';
|
||||||
|
import type { IUpsdConfig } from '../upsd/types.ts';
|
||||||
|
import type { TProtocol } from './types.ts';
|
||||||
|
|
||||||
|
export class ProtocolResolver {
|
||||||
|
private snmp: NupstSnmp;
|
||||||
|
private upsd: NupstUpsd;
|
||||||
|
|
||||||
|
constructor(snmp: NupstSnmp, upsd: NupstUpsd) {
|
||||||
|
this.snmp = snmp;
|
||||||
|
this.upsd = upsd;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get UPS status using the specified protocol
|
||||||
|
* @param protocol Protocol to use ('snmp' or 'upsd')
|
||||||
|
* @param snmpConfig SNMP configuration (required for 'snmp' protocol)
|
||||||
|
* @param upsdConfig UPSD configuration (required for 'upsd' protocol)
|
||||||
|
* @returns UPS status
|
||||||
|
*/
|
||||||
|
public getUpsStatus(
|
||||||
|
protocol: TProtocol,
|
||||||
|
snmpConfig?: ISnmpConfig,
|
||||||
|
upsdConfig?: IUpsdConfig,
|
||||||
|
): Promise<IUpsStatus> {
|
||||||
|
switch (protocol) {
|
||||||
|
case 'upsd':
|
||||||
|
if (!upsdConfig) {
|
||||||
|
throw new Error('UPSD configuration required for UPSD protocol');
|
||||||
|
}
|
||||||
|
return this.upsd.getUpsStatus(upsdConfig);
|
||||||
|
case 'snmp':
|
||||||
|
default:
|
||||||
|
if (!snmpConfig) {
|
||||||
|
throw new Error('SNMP configuration required for SNMP protocol');
|
||||||
|
}
|
||||||
|
return this.snmp.getUpsStatus(snmpConfig);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,4 @@
|
|||||||
|
/**
|
||||||
|
* Protocol type for UPS communication
|
||||||
|
*/
|
||||||
|
export type TProtocol = 'snmp' | 'upsd';
|
||||||
@@ -0,0 +1,145 @@
|
|||||||
|
import process from 'node:process';
|
||||||
|
import * as fs from 'node:fs';
|
||||||
|
import { exec, execFile } from 'node:child_process';
|
||||||
|
import { promisify } from 'node:util';
|
||||||
|
import { logger } from './logger.ts';
|
||||||
|
|
||||||
|
const execAsync = promisify(exec);
|
||||||
|
const execFileAsync = promisify(execFile);
|
||||||
|
|
||||||
|
interface IShutdownAlternative {
|
||||||
|
cmd: string;
|
||||||
|
args: string[];
|
||||||
|
}
|
||||||
|
|
||||||
|
interface IAlternativeLogConfig {
|
||||||
|
resolvedMessage: (commandPath: string, args: string[]) => string;
|
||||||
|
pathMessage: (command: string, args: string[]) => string;
|
||||||
|
failureMessage?: (command: string, error: unknown) => string;
|
||||||
|
}
|
||||||
|
|
||||||
|
export class ShutdownExecutor {
|
||||||
|
private readonly commonCommandDirs = ['/sbin', '/usr/sbin', '/bin', '/usr/bin'];
|
||||||
|
|
||||||
|
public async scheduleShutdown(delayMinutes: number): Promise<void> {
|
||||||
|
const shutdownMessage = `UPS battery critical, shutting down in ${delayMinutes} minutes`;
|
||||||
|
const shutdownCommandPath = this.findCommandPath('shutdown');
|
||||||
|
|
||||||
|
if (shutdownCommandPath) {
|
||||||
|
logger.log(`Found shutdown command at: ${shutdownCommandPath}`);
|
||||||
|
logger.log(`Executing: ${shutdownCommandPath} -h +${delayMinutes} "UPS battery critical..."`);
|
||||||
|
const { stdout } = await execFileAsync(shutdownCommandPath, [
|
||||||
|
'-h',
|
||||||
|
`+${delayMinutes}`,
|
||||||
|
shutdownMessage,
|
||||||
|
]);
|
||||||
|
logger.log(`Shutdown initiated: ${stdout}`);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
try {
|
||||||
|
logger.log('Shutdown command not found in common paths, trying via PATH...');
|
||||||
|
const { stdout } = await execAsync(
|
||||||
|
`shutdown -h +${delayMinutes} "${shutdownMessage}"`,
|
||||||
|
{ env: process.env },
|
||||||
|
);
|
||||||
|
logger.log(`Shutdown initiated: ${stdout}`);
|
||||||
|
} catch (error) {
|
||||||
|
throw new Error(
|
||||||
|
`Shutdown command not found: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public async forceImmediateShutdown(): Promise<void> {
|
||||||
|
const shutdownMessage = 'EMERGENCY: UPS battery critically low, shutting down NOW';
|
||||||
|
const shutdownCommandPath = this.findCommandPath('shutdown');
|
||||||
|
|
||||||
|
if (shutdownCommandPath) {
|
||||||
|
logger.log(`Found shutdown command at: ${shutdownCommandPath}`);
|
||||||
|
logger.log(`Executing emergency shutdown: ${shutdownCommandPath} -h now`);
|
||||||
|
await execFileAsync(shutdownCommandPath, ['-h', 'now', shutdownMessage]);
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
logger.log('Shutdown command not found in common paths, trying via PATH...');
|
||||||
|
await execAsync(`shutdown -h now "${shutdownMessage}"`, {
|
||||||
|
env: process.env,
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
public async tryScheduledAlternatives(): Promise<boolean> {
|
||||||
|
return await this.tryAlternatives(
|
||||||
|
[
|
||||||
|
{ cmd: 'poweroff', args: ['--force'] },
|
||||||
|
{ cmd: 'halt', args: ['-p'] },
|
||||||
|
{ cmd: 'systemctl', args: ['poweroff'] },
|
||||||
|
{ cmd: 'reboot', args: ['-p'] },
|
||||||
|
],
|
||||||
|
{
|
||||||
|
resolvedMessage: (commandPath, args) =>
|
||||||
|
`Trying alternative shutdown method: ${commandPath} ${args.join(' ')}`,
|
||||||
|
pathMessage: (command, args) => `Trying alternative via PATH: ${command} ${args.join(' ')}`,
|
||||||
|
failureMessage: (command, error) => `Alternative method ${command} failed: ${error}`,
|
||||||
|
},
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
public async tryEmergencyAlternatives(): Promise<boolean> {
|
||||||
|
return await this.tryAlternatives(
|
||||||
|
[
|
||||||
|
{ cmd: 'poweroff', args: ['--force'] },
|
||||||
|
{ cmd: 'halt', args: ['-p'] },
|
||||||
|
{ cmd: 'systemctl', args: ['poweroff'] },
|
||||||
|
],
|
||||||
|
{
|
||||||
|
resolvedMessage: (commandPath, args) => `Emergency: using ${commandPath} ${args.join(' ')}`,
|
||||||
|
pathMessage: (command) => `Emergency: trying ${command} via PATH`,
|
||||||
|
},
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
private findCommandPath(command: string): string | null {
|
||||||
|
for (const directory of this.commonCommandDirs) {
|
||||||
|
const commandPath = `${directory}/${command}`;
|
||||||
|
try {
|
||||||
|
if (fs.existsSync(commandPath)) {
|
||||||
|
return commandPath;
|
||||||
|
}
|
||||||
|
} catch (_error) {
|
||||||
|
// Continue checking other paths.
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
|
||||||
|
private async tryAlternatives(
|
||||||
|
alternatives: IShutdownAlternative[],
|
||||||
|
logConfig: IAlternativeLogConfig,
|
||||||
|
): Promise<boolean> {
|
||||||
|
for (const alternative of alternatives) {
|
||||||
|
try {
|
||||||
|
const commandPath = this.findCommandPath(alternative.cmd);
|
||||||
|
|
||||||
|
if (commandPath) {
|
||||||
|
logger.log(logConfig.resolvedMessage(commandPath, alternative.args));
|
||||||
|
await execFileAsync(commandPath, alternative.args);
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
|
||||||
|
logger.log(logConfig.pathMessage(alternative.cmd, alternative.args));
|
||||||
|
await execAsync(`${alternative.cmd} ${alternative.args.join(' ')}`, {
|
||||||
|
env: process.env,
|
||||||
|
});
|
||||||
|
return true;
|
||||||
|
} catch (error) {
|
||||||
|
if (logConfig.failureMessage) {
|
||||||
|
logger.error(logConfig.failureMessage(alternative.cmd, error));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,72 @@
|
|||||||
|
import type { IUpsStatus as IProtocolUpsStatus } from './snmp/types.ts';
|
||||||
|
|
||||||
|
export interface IShutdownMonitoringRow extends Record<string, string> {
|
||||||
|
name: string;
|
||||||
|
battery: string;
|
||||||
|
runtime: string;
|
||||||
|
status: string;
|
||||||
|
}
|
||||||
|
|
||||||
|
export interface IShutdownRowFormatters {
|
||||||
|
battery: (batteryCapacity: number) => string;
|
||||||
|
runtime: (batteryRuntime: number) => string;
|
||||||
|
ok: (text: string) => string;
|
||||||
|
critical: (text: string) => string;
|
||||||
|
error: (text: string) => string;
|
||||||
|
}
|
||||||
|
|
||||||
|
export interface IShutdownEmergencyCandidate<TUps> {
|
||||||
|
ups: TUps;
|
||||||
|
status: IProtocolUpsStatus;
|
||||||
|
}
|
||||||
|
|
||||||
|
export function isEmergencyRuntime(
|
||||||
|
batteryRuntime: number,
|
||||||
|
emergencyRuntimeMinutes: number,
|
||||||
|
): boolean {
|
||||||
|
return batteryRuntime < emergencyRuntimeMinutes;
|
||||||
|
}
|
||||||
|
|
||||||
|
export function buildShutdownStatusRow(
|
||||||
|
upsName: string,
|
||||||
|
status: IProtocolUpsStatus,
|
||||||
|
emergencyRuntimeMinutes: number,
|
||||||
|
formatters: IShutdownRowFormatters,
|
||||||
|
): { row: IShutdownMonitoringRow; isCritical: boolean } {
|
||||||
|
const isCritical = isEmergencyRuntime(status.batteryRuntime, emergencyRuntimeMinutes);
|
||||||
|
|
||||||
|
return {
|
||||||
|
row: {
|
||||||
|
name: upsName,
|
||||||
|
battery: formatters.battery(status.batteryCapacity),
|
||||||
|
runtime: formatters.runtime(status.batteryRuntime),
|
||||||
|
status: isCritical ? formatters.critical('CRITICAL!') : formatters.ok('OK'),
|
||||||
|
},
|
||||||
|
isCritical,
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
export function buildShutdownErrorRow(
|
||||||
|
upsName: string,
|
||||||
|
errorFormatter: (text: string) => string,
|
||||||
|
): IShutdownMonitoringRow {
|
||||||
|
return {
|
||||||
|
name: upsName,
|
||||||
|
battery: errorFormatter('N/A'),
|
||||||
|
runtime: errorFormatter('N/A'),
|
||||||
|
status: errorFormatter('ERROR'),
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
export function selectEmergencyCandidate<TUps>(
|
||||||
|
currentCandidate: IShutdownEmergencyCandidate<TUps> | null,
|
||||||
|
ups: TUps,
|
||||||
|
status: IProtocolUpsStatus,
|
||||||
|
emergencyRuntimeMinutes: number,
|
||||||
|
): IShutdownEmergencyCandidate<TUps> | null {
|
||||||
|
if (currentCandidate || !isEmergencyRuntime(status.batteryRuntime, emergencyRuntimeMinutes)) {
|
||||||
|
return currentCandidate;
|
||||||
|
}
|
||||||
|
|
||||||
|
return { ups, status };
|
||||||
|
}
|
||||||
@@ -1,6 +0,0 @@
|
|||||||
/**
|
|
||||||
* Re-export from the snmp module
|
|
||||||
* This file is kept for backward compatibility
|
|
||||||
*/
|
|
||||||
|
|
||||||
export * from './snmp/index.js';
|
|
||||||
@@ -1,98 +0,0 @@
|
|||||||
/**
|
|
||||||
* SNMP encoding utilities
|
|
||||||
* Contains helper methods for encoding SNMP data
|
|
||||||
*/
|
|
||||||
export class SnmpEncoder {
|
|
||||||
/**
|
|
||||||
* Convert OID string to array of integers
|
|
||||||
* @param oid OID string in dotted notation (e.g. "1.3.6.1.2.1")
|
|
||||||
* @returns Array of integers representing the OID
|
|
||||||
*/
|
|
||||||
public static oidToArray(oid: string): number[] {
|
|
||||||
return oid.split('.').map(n => parseInt(n, 10));
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Encode an SNMP integer
|
|
||||||
* @param value Integer value to encode
|
|
||||||
* @returns Buffer containing the encoded integer
|
|
||||||
*/
|
|
||||||
public static encodeInteger(value: number): Buffer {
|
|
||||||
const buf = Buffer.alloc(4);
|
|
||||||
buf.writeInt32BE(value, 0);
|
|
||||||
|
|
||||||
// Find first non-zero byte
|
|
||||||
let start = 0;
|
|
||||||
while (start < 3 && buf[start] === 0) {
|
|
||||||
start++;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Handle negative values
|
|
||||||
if (value < 0 && buf[start] === 0) {
|
|
||||||
start--;
|
|
||||||
}
|
|
||||||
|
|
||||||
return buf.slice(start);
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Encode an OID
|
|
||||||
* @param oid Array of integers representing the OID
|
|
||||||
* @returns Buffer containing the encoded OID
|
|
||||||
*/
|
|
||||||
public static encodeOID(oid: number[]): Buffer {
|
|
||||||
// First two numbers are encoded as 40*x+y
|
|
||||||
let encodedOid = Buffer.from([40 * (oid[0] || 0) + (oid[1] || 0)]);
|
|
||||||
|
|
||||||
// Encode remaining numbers
|
|
||||||
for (let i = 2; i < oid.length; i++) {
|
|
||||||
const n = oid[i];
|
|
||||||
|
|
||||||
if (n < 128) {
|
|
||||||
// Simple case: number fits in one byte
|
|
||||||
encodedOid = Buffer.concat([encodedOid, Buffer.from([n])]);
|
|
||||||
} else {
|
|
||||||
// Number needs multiple bytes
|
|
||||||
const bytes = [];
|
|
||||||
let value = n;
|
|
||||||
|
|
||||||
// Create bytes array in reverse order
|
|
||||||
do {
|
|
||||||
bytes.unshift(value & 0x7F);
|
|
||||||
value >>= 7;
|
|
||||||
} while (value > 0);
|
|
||||||
|
|
||||||
// Set high bit on all but the last byte
|
|
||||||
for (let j = 0; j < bytes.length - 1; j++) {
|
|
||||||
bytes[j] |= 0x80;
|
|
||||||
}
|
|
||||||
|
|
||||||
encodedOid = Buffer.concat([encodedOid, Buffer.from(bytes)]);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
return encodedOid;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Decode an ASN.1 integer
|
|
||||||
* @param buffer Buffer containing the encoded integer
|
|
||||||
* @param offset Offset in the buffer
|
|
||||||
* @param length Length of the integer in bytes
|
|
||||||
* @returns Decoded integer value
|
|
||||||
*/
|
|
||||||
public static decodeInteger(buffer: Buffer, offset: number, length: number): number {
|
|
||||||
if (length === 1) {
|
|
||||||
return buffer[offset];
|
|
||||||
} else if (length === 2) {
|
|
||||||
return buffer.readInt16BE(offset);
|
|
||||||
} else if (length === 3) {
|
|
||||||
return (buffer[offset] << 16) | (buffer[offset + 1] << 8) | buffer[offset + 2];
|
|
||||||
} else if (length === 4) {
|
|
||||||
return buffer.readInt32BE(offset);
|
|
||||||
} else {
|
|
||||||
// For longer integers, we'll just return a simple value
|
|
||||||
return buffer[offset];
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
+2
-2
@@ -4,7 +4,7 @@
|
|||||||
*/
|
*/
|
||||||
|
|
||||||
// Re-export all public types
|
// Re-export all public types
|
||||||
export type { IUpsStatus, IOidSet, TUpsModel, ISnmpConfig } from './types.js';
|
export type { IOidSet, ISnmpConfig, IUpsStatus, TUpsModel } from './types.ts';
|
||||||
|
|
||||||
// Re-export the SNMP manager class
|
// Re-export the SNMP manager class
|
||||||
export { NupstSnmp } from './manager.js';
|
export { NupstSnmp } from './manager.ts';
|
||||||
|
|||||||
+667
-368
File diff suppressed because it is too large
Load Diff
+60
-12
@@ -1,4 +1,4 @@
|
|||||||
import type { IOidSet, TUpsModel } from './types.js';
|
import type { IOidSet, TUpsModel } from './types.ts';
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* OID sets for different UPS models
|
* OID sets for different UPS models
|
||||||
@@ -11,37 +11,77 @@ export class UpsOidSets {
|
|||||||
private static readonly UPS_OID_SETS: Record<TUpsModel, IOidSet> = {
|
private static readonly UPS_OID_SETS: Record<TUpsModel, IOidSet> = {
|
||||||
// Cyberpower OIDs for RMCARD205 (based on CyberPower_MIB_v2.11)
|
// Cyberpower OIDs for RMCARD205 (based on CyberPower_MIB_v2.11)
|
||||||
cyberpower: {
|
cyberpower: {
|
||||||
POWER_STATUS: '1.3.6.1.4.1.3808.1.1.1.4.1.1.0', // upsBaseOutputStatus (2=online, 3=on battery)
|
POWER_STATUS: '1.3.6.1.4.1.3808.1.1.1.4.1.1.0', // upsBaseOutputStatus
|
||||||
BATTERY_CAPACITY: '1.3.6.1.4.1.3808.1.1.1.2.2.1.0', // upsAdvanceBatteryCapacity (percentage)
|
BATTERY_CAPACITY: '1.3.6.1.4.1.3808.1.1.1.2.2.1.0', // upsAdvanceBatteryCapacity (percentage)
|
||||||
BATTERY_RUNTIME: '1.3.6.1.4.1.3808.1.1.1.2.2.4.0', // upsAdvanceBatteryRunTimeRemaining (TimeTicks)
|
BATTERY_RUNTIME: '1.3.6.1.4.1.3808.1.1.1.2.2.4.0', // upsAdvanceBatteryRunTimeRemaining (TimeTicks)
|
||||||
|
OUTPUT_LOAD: '1.3.6.1.4.1.3808.1.1.1.4.2.3.0', // upsAdvanceOutputLoad (percentage)
|
||||||
|
OUTPUT_POWER: '1.3.6.1.4.1.3808.1.1.1.4.2.5.0', // upsAdvanceOutputPower (watts)
|
||||||
|
OUTPUT_VOLTAGE: '1.3.6.1.4.1.3808.1.1.1.4.2.1.0', // upsAdvanceOutputVoltage (0.1V scale)
|
||||||
|
OUTPUT_CURRENT: '1.3.6.1.4.1.3808.1.1.1.4.2.4.0', // upsAdvanceOutputCurrent (0.1A scale)
|
||||||
|
POWER_STATUS_VALUES: {
|
||||||
|
online: 2, // upsBaseOutputStatus: 2=onLine
|
||||||
|
onBattery: 3, // upsBaseOutputStatus: 3=onBattery
|
||||||
|
},
|
||||||
},
|
},
|
||||||
|
|
||||||
// APC OIDs
|
// APC OIDs (PowerNet MIB)
|
||||||
apc: {
|
apc: {
|
||||||
POWER_STATUS: '1.3.6.1.4.1.318.1.1.1.4.1.1.0', // Power status (1=online, 2=on battery)
|
POWER_STATUS: '1.3.6.1.4.1.318.1.1.1.4.1.1.0', // upsBasicOutputStatus
|
||||||
BATTERY_CAPACITY: '1.3.6.1.4.1.318.1.1.1.2.2.1.0', // Battery capacity in percentage
|
BATTERY_CAPACITY: '1.3.6.1.4.1.318.1.1.1.2.2.1.0', // Battery capacity in percentage
|
||||||
BATTERY_RUNTIME: '1.3.6.1.4.1.318.1.1.1.2.2.3.0', // Remaining runtime in minutes
|
BATTERY_RUNTIME: '1.3.6.1.4.1.318.1.1.1.2.2.3.0', // Remaining runtime in minutes
|
||||||
|
OUTPUT_LOAD: '1.3.6.1.4.1.318.1.1.1.4.2.3.0', // upsAdvOutputLoad (percentage)
|
||||||
|
OUTPUT_POWER: '1.3.6.1.4.1.318.1.1.1.4.2.8.0', // upsAdvOutputActivePower (watts)
|
||||||
|
OUTPUT_VOLTAGE: '1.3.6.1.4.1.318.1.1.1.4.2.1.0', // upsAdvOutputVoltage
|
||||||
|
OUTPUT_CURRENT: '1.3.6.1.4.1.318.1.1.1.4.2.4.0', // upsAdvOutputCurrent
|
||||||
|
POWER_STATUS_VALUES: {
|
||||||
|
online: 2, // upsBasicOutputStatus: 2=onLine
|
||||||
|
onBattery: 3, // upsBasicOutputStatus: 3=onBattery
|
||||||
|
},
|
||||||
},
|
},
|
||||||
|
|
||||||
// Eaton OIDs
|
// Eaton OIDs (XUPS-MIB)
|
||||||
eaton: {
|
eaton: {
|
||||||
POWER_STATUS: '1.3.6.1.4.1.534.1.1.2.0', // Power status
|
POWER_STATUS: '1.3.6.1.4.1.534.1.4.4.0', // xupsOutputSource
|
||||||
BATTERY_CAPACITY: '1.3.6.1.4.1.534.1.2.4.0', // Battery capacity in percentage
|
BATTERY_CAPACITY: '1.3.6.1.4.1.534.1.2.4.0', // xupsBatCapacity (percentage)
|
||||||
BATTERY_RUNTIME: '1.3.6.1.4.1.534.1.2.1.0', // Remaining runtime in minutes
|
BATTERY_RUNTIME: '1.3.6.1.4.1.534.1.2.1.0', // xupsBatTimeRemaining (seconds)
|
||||||
|
OUTPUT_LOAD: '1.3.6.1.4.1.534.1.4.4.1.8.1', // xupsOutputPercentLoad (phase 1)
|
||||||
|
OUTPUT_POWER: '1.3.6.1.4.1.534.1.4.4.1.4.1', // xupsOutputWatts (phase 1)
|
||||||
|
OUTPUT_VOLTAGE: '1.3.6.1.4.1.534.1.4.4.1.2.1', // xupsOutputVoltage (phase 1)
|
||||||
|
OUTPUT_CURRENT: '1.3.6.1.4.1.534.1.4.4.1.3.1', // xupsOutputCurrent (phase 1)
|
||||||
|
POWER_STATUS_VALUES: {
|
||||||
|
online: 3, // xupsOutputSource: 3=normal (mains power)
|
||||||
|
onBattery: 5, // xupsOutputSource: 5=battery
|
||||||
|
},
|
||||||
},
|
},
|
||||||
|
|
||||||
// TrippLite OIDs
|
// TrippLite OIDs
|
||||||
tripplite: {
|
tripplite: {
|
||||||
POWER_STATUS: '1.3.6.1.4.1.850.1.1.3.1.1.1.0', // Power status
|
POWER_STATUS: '1.3.6.1.4.1.850.1.1.3.1.1.1.0', // tlUpsOutputSource
|
||||||
BATTERY_CAPACITY: '1.3.6.1.4.1.850.1.1.3.2.4.1.0', // Battery capacity in percentage
|
BATTERY_CAPACITY: '1.3.6.1.4.1.850.1.1.3.2.4.1.0', // Battery capacity in percentage
|
||||||
BATTERY_RUNTIME: '1.3.6.1.4.1.850.1.1.3.2.2.1.0', // Remaining runtime in minutes
|
BATTERY_RUNTIME: '1.3.6.1.4.1.850.1.1.3.2.2.1.0', // Remaining runtime in minutes
|
||||||
|
OUTPUT_LOAD: '1.3.6.1.2.1.33.1.4.4.1.5.1', // RFC 1628: upsOutputPercentLoad
|
||||||
|
OUTPUT_POWER: '1.3.6.1.2.1.33.1.4.4.1.4.1', // RFC 1628: upsOutputPower (watts)
|
||||||
|
OUTPUT_VOLTAGE: '1.3.6.1.2.1.33.1.4.4.1.2.1', // RFC 1628: upsOutputVoltage
|
||||||
|
OUTPUT_CURRENT: '1.3.6.1.2.1.33.1.4.4.1.3.1', // RFC 1628: upsOutputCurrent (0.1A scale)
|
||||||
|
POWER_STATUS_VALUES: {
|
||||||
|
online: 2, // tlUpsOutputSource: 2=normal (mains power)
|
||||||
|
onBattery: 3, // tlUpsOutputSource: 3=onBattery
|
||||||
|
},
|
||||||
},
|
},
|
||||||
|
|
||||||
// Liebert/Vertiv OIDs
|
// Liebert/Vertiv OIDs
|
||||||
liebert: {
|
liebert: {
|
||||||
POWER_STATUS: '1.3.6.1.4.1.476.1.42.3.9.20.1.20.1.2.1.2.1', // Power status
|
POWER_STATUS: '1.3.6.1.4.1.476.1.42.3.9.20.1.20.1.2.1.2.1', // lgpPwrOutputSource
|
||||||
BATTERY_CAPACITY: '1.3.6.1.4.1.476.1.42.3.9.20.1.20.1.2.1.4.1', // Battery capacity in percentage
|
BATTERY_CAPACITY: '1.3.6.1.4.1.476.1.42.3.9.20.1.20.1.2.1.4.1', // Battery capacity in percentage
|
||||||
BATTERY_RUNTIME: '1.3.6.1.4.1.476.1.42.3.9.20.1.20.1.2.1.5.1', // Remaining runtime in minutes
|
BATTERY_RUNTIME: '1.3.6.1.4.1.476.1.42.3.9.20.1.20.1.2.1.5.1', // Remaining runtime in minutes
|
||||||
|
OUTPUT_LOAD: '1.3.6.1.2.1.33.1.4.4.1.5.1', // RFC 1628: upsOutputPercentLoad
|
||||||
|
OUTPUT_POWER: '1.3.6.1.2.1.33.1.4.4.1.4.1', // RFC 1628: upsOutputPower (watts)
|
||||||
|
OUTPUT_VOLTAGE: '1.3.6.1.2.1.33.1.4.4.1.2.1', // RFC 1628: upsOutputVoltage
|
||||||
|
OUTPUT_CURRENT: '1.3.6.1.2.1.33.1.4.4.1.3.1', // RFC 1628: upsOutputCurrent (0.1A scale)
|
||||||
|
POWER_STATUS_VALUES: {
|
||||||
|
online: 2, // lgpPwrOutputSource: 2=normal (mains power)
|
||||||
|
onBattery: 3, // lgpPwrOutputSource: 3=onBattery
|
||||||
|
},
|
||||||
},
|
},
|
||||||
|
|
||||||
// Custom OIDs (to be provided by the user)
|
// Custom OIDs (to be provided by the user)
|
||||||
@@ -49,7 +89,11 @@ export class UpsOidSets {
|
|||||||
POWER_STATUS: '',
|
POWER_STATUS: '',
|
||||||
BATTERY_CAPACITY: '',
|
BATTERY_CAPACITY: '',
|
||||||
BATTERY_RUNTIME: '',
|
BATTERY_RUNTIME: '',
|
||||||
}
|
OUTPUT_LOAD: '',
|
||||||
|
OUTPUT_POWER: '',
|
||||||
|
OUTPUT_VOLTAGE: '',
|
||||||
|
OUTPUT_CURRENT: '',
|
||||||
|
},
|
||||||
};
|
};
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -69,7 +113,11 @@ export class UpsOidSets {
|
|||||||
return {
|
return {
|
||||||
'power status': '1.3.6.1.2.1.33.1.4.1.0', // upsOutputSource
|
'power status': '1.3.6.1.2.1.33.1.4.1.0', // upsOutputSource
|
||||||
'battery capacity': '1.3.6.1.2.1.33.1.2.4.0', // upsEstimatedChargeRemaining
|
'battery capacity': '1.3.6.1.2.1.33.1.2.4.0', // upsEstimatedChargeRemaining
|
||||||
'battery runtime': '1.3.6.1.2.1.33.1.2.3.0' // upsEstimatedMinutesRemaining
|
'battery runtime': '1.3.6.1.2.1.33.1.2.3.0', // upsEstimatedMinutesRemaining
|
||||||
|
'output load': '1.3.6.1.2.1.33.1.4.4.1.5.1', // upsOutputPercentLoad (indexed by line)
|
||||||
|
'output power': '1.3.6.1.2.1.33.1.4.4.1.4.1', // upsOutputPower in watts (indexed by line)
|
||||||
|
'output voltage': '1.3.6.1.2.1.33.1.4.4.1.2.1', // upsOutputVoltage (indexed by line)
|
||||||
|
'output current': '1.3.6.1.2.1.33.1.4.4.1.3.1', // upsOutputCurrent in 0.1A (indexed by line)
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -1,651 +0,0 @@
|
|||||||
import * as crypto from 'crypto';
|
|
||||||
import type { ISnmpConfig, ISnmpV3SecurityParams } from './types.js';
|
|
||||||
import { SnmpEncoder } from './encoder.js';
|
|
||||||
|
|
||||||
/**
|
|
||||||
* SNMP packet creation utilities
|
|
||||||
* Creates SNMP request packets for different SNMP versions
|
|
||||||
*/
|
|
||||||
export class SnmpPacketCreator {
|
|
||||||
/**
|
|
||||||
* Create an SNMPv1 GET request
|
|
||||||
* @param oid OID to query
|
|
||||||
* @param community Community string
|
|
||||||
* @param debug Whether to enable debug output
|
|
||||||
* @returns Buffer containing the SNMP request
|
|
||||||
*/
|
|
||||||
public static createSnmpGetRequest(oid: string, community: string, debug: boolean = false): Buffer {
|
|
||||||
const oidArray = SnmpEncoder.oidToArray(oid);
|
|
||||||
const encodedOid = SnmpEncoder.encodeOID(oidArray);
|
|
||||||
|
|
||||||
if (debug) {
|
|
||||||
console.log('OID array length:', oidArray.length);
|
|
||||||
console.log('OID array:', oidArray);
|
|
||||||
}
|
|
||||||
|
|
||||||
// SNMP message structure
|
|
||||||
// Sequence
|
|
||||||
// Version (Integer)
|
|
||||||
// Community (String)
|
|
||||||
// PDU (GetRequest)
|
|
||||||
// Request ID (Integer)
|
|
||||||
// Error Status (Integer)
|
|
||||||
// Error Index (Integer)
|
|
||||||
// Variable Bindings (Sequence)
|
|
||||||
// Variable (Sequence)
|
|
||||||
// OID (ObjectIdentifier)
|
|
||||||
// Value (Null)
|
|
||||||
|
|
||||||
// Use the standard method from our test that is known to work
|
|
||||||
// Create a fixed request ID (0x00000001) to ensure deterministic behavior
|
|
||||||
const requestId = Buffer.from([0x00, 0x00, 0x00, 0x01]);
|
|
||||||
|
|
||||||
// Encode values
|
|
||||||
const versionBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x01]), // ASN.1 Integer, length 1
|
|
||||||
Buffer.from([0x00]) // SNMP version 1 (0)
|
|
||||||
]);
|
|
||||||
|
|
||||||
const communityBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x04, community.length]), // ASN.1 Octet String, length
|
|
||||||
Buffer.from(community) // Community string
|
|
||||||
]);
|
|
||||||
|
|
||||||
const requestIdBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x04]), // ASN.1 Integer, length 4
|
|
||||||
requestId // Fixed Request ID
|
|
||||||
]);
|
|
||||||
|
|
||||||
const errorStatusBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x01]), // ASN.1 Integer, length 1
|
|
||||||
Buffer.from([0x00]) // Error Status (0 = no error)
|
|
||||||
]);
|
|
||||||
|
|
||||||
const errorIndexBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x01]), // ASN.1 Integer, length 1
|
|
||||||
Buffer.from([0x00]) // Error Index (0)
|
|
||||||
]);
|
|
||||||
|
|
||||||
const oidValueBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x30]), // ASN.1 Sequence
|
|
||||||
Buffer.from([encodedOid.length + 2]), // Length
|
|
||||||
Buffer.from([0x06]), // ASN.1 Object Identifier
|
|
||||||
Buffer.from([encodedOid.length]), // Length
|
|
||||||
encodedOid, // OID
|
|
||||||
Buffer.from([0x05, 0x00]) // Null value
|
|
||||||
]);
|
|
||||||
|
|
||||||
const varBindingsBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x30]), // ASN.1 Sequence
|
|
||||||
Buffer.from([oidValueBuf.length]), // Length
|
|
||||||
oidValueBuf // Variable binding
|
|
||||||
]);
|
|
||||||
|
|
||||||
const pduBuf = Buffer.concat([
|
|
||||||
Buffer.from([0xa0]), // ASN.1 Context-specific Constructed 0 (GetRequest)
|
|
||||||
Buffer.from([requestIdBuf.length + errorStatusBuf.length + errorIndexBuf.length + varBindingsBuf.length]), // Length
|
|
||||||
requestIdBuf, // Request ID
|
|
||||||
errorStatusBuf, // Error Status
|
|
||||||
errorIndexBuf, // Error Index
|
|
||||||
varBindingsBuf // Variable Bindings
|
|
||||||
]);
|
|
||||||
|
|
||||||
const messageBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x30]), // ASN.1 Sequence
|
|
||||||
Buffer.from([versionBuf.length + communityBuf.length + pduBuf.length]), // Length
|
|
||||||
versionBuf, // Version
|
|
||||||
communityBuf, // Community
|
|
||||||
pduBuf // PDU
|
|
||||||
]);
|
|
||||||
|
|
||||||
if (debug) {
|
|
||||||
console.log('SNMP Request buffer:', messageBuf.toString('hex'));
|
|
||||||
}
|
|
||||||
|
|
||||||
return messageBuf;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Create an SNMPv3 GET request
|
|
||||||
* @param oid OID to query
|
|
||||||
* @param config SNMP configuration
|
|
||||||
* @param engineID Engine ID
|
|
||||||
* @param engineBoots Engine boots counter
|
|
||||||
* @param engineTime Engine time counter
|
|
||||||
* @param requestID Request ID
|
|
||||||
* @param debug Whether to enable debug output
|
|
||||||
* @returns Buffer containing the SNMP request
|
|
||||||
*/
|
|
||||||
public static createSnmpV3GetRequest(
|
|
||||||
oid: string,
|
|
||||||
config: ISnmpConfig,
|
|
||||||
engineID: Buffer,
|
|
||||||
engineBoots: number,
|
|
||||||
engineTime: number,
|
|
||||||
requestID: number,
|
|
||||||
debug: boolean = false
|
|
||||||
): Buffer {
|
|
||||||
if (debug) {
|
|
||||||
console.log('Creating SNMPv3 GET request for OID:', oid);
|
|
||||||
console.log('With config:', {
|
|
||||||
...config,
|
|
||||||
authKey: config.authKey ? '***' : undefined,
|
|
||||||
privKey: config.privKey ? '***' : undefined
|
|
||||||
});
|
|
||||||
}
|
|
||||||
|
|
||||||
const oidArray = SnmpEncoder.oidToArray(oid);
|
|
||||||
const encodedOid = SnmpEncoder.encodeOID(oidArray);
|
|
||||||
|
|
||||||
if (debug) {
|
|
||||||
console.log('Using engine ID:', engineID.toString('hex'));
|
|
||||||
console.log('Engine boots:', engineBoots);
|
|
||||||
console.log('Engine time:', engineTime);
|
|
||||||
console.log('Request ID:', requestID);
|
|
||||||
}
|
|
||||||
|
|
||||||
// Create security parameters
|
|
||||||
const securityParams: ISnmpV3SecurityParams = {
|
|
||||||
msgAuthoritativeEngineID: engineID,
|
|
||||||
msgAuthoritativeEngineBoots: engineBoots,
|
|
||||||
msgAuthoritativeEngineTime: engineTime,
|
|
||||||
msgUserName: config.username || '',
|
|
||||||
msgAuthenticationParameters: Buffer.alloc(12, 0), // Will be filled in later for auth
|
|
||||||
msgPrivacyParameters: Buffer.alloc(8, 0), // For privacy
|
|
||||||
};
|
|
||||||
|
|
||||||
// Create the PDU (Protocol Data Unit)
|
|
||||||
// This is wrapped within the security parameters
|
|
||||||
const requestIdBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x04]), // ASN.1 Integer, length 4
|
|
||||||
SnmpEncoder.encodeInteger(requestID) // Request ID
|
|
||||||
]);
|
|
||||||
|
|
||||||
const errorStatusBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x01]), // ASN.1 Integer, length 1
|
|
||||||
Buffer.from([0x00]) // Error Status (0 = no error)
|
|
||||||
]);
|
|
||||||
|
|
||||||
const errorIndexBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x01]), // ASN.1 Integer, length 1
|
|
||||||
Buffer.from([0x00]) // Error Index (0)
|
|
||||||
]);
|
|
||||||
|
|
||||||
const oidValueBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x30]), // ASN.1 Sequence
|
|
||||||
Buffer.from([encodedOid.length + 2]), // Length
|
|
||||||
Buffer.from([0x06]), // ASN.1 Object Identifier
|
|
||||||
Buffer.from([encodedOid.length]), // Length
|
|
||||||
encodedOid, // OID
|
|
||||||
Buffer.from([0x05, 0x00]) // Null value
|
|
||||||
]);
|
|
||||||
|
|
||||||
const varBindingsBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x30]), // ASN.1 Sequence
|
|
||||||
Buffer.from([oidValueBuf.length]), // Length
|
|
||||||
oidValueBuf // Variable binding
|
|
||||||
]);
|
|
||||||
|
|
||||||
const pduBuf = Buffer.concat([
|
|
||||||
Buffer.from([0xa0]), // ASN.1 Context-specific Constructed 0 (GetRequest)
|
|
||||||
Buffer.from([requestIdBuf.length + errorStatusBuf.length + errorIndexBuf.length + varBindingsBuf.length]), // Length
|
|
||||||
requestIdBuf, // Request ID
|
|
||||||
errorStatusBuf, // Error Status
|
|
||||||
errorIndexBuf, // Error Index
|
|
||||||
varBindingsBuf // Variable Bindings
|
|
||||||
]);
|
|
||||||
|
|
||||||
// Create the security parameters
|
|
||||||
const engineIdBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x04, securityParams.msgAuthoritativeEngineID.length]), // ASN.1 Octet String
|
|
||||||
securityParams.msgAuthoritativeEngineID
|
|
||||||
]);
|
|
||||||
|
|
||||||
const engineBootsBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x04]), // ASN.1 Integer, length 4
|
|
||||||
SnmpEncoder.encodeInteger(securityParams.msgAuthoritativeEngineBoots)
|
|
||||||
]);
|
|
||||||
|
|
||||||
const engineTimeBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x04]), // ASN.1 Integer, length 4
|
|
||||||
SnmpEncoder.encodeInteger(securityParams.msgAuthoritativeEngineTime)
|
|
||||||
]);
|
|
||||||
|
|
||||||
const userNameBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x04, securityParams.msgUserName.length]), // ASN.1 Octet String
|
|
||||||
Buffer.from(securityParams.msgUserName)
|
|
||||||
]);
|
|
||||||
|
|
||||||
const authParamsBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x04, securityParams.msgAuthenticationParameters.length]), // ASN.1 Octet String
|
|
||||||
securityParams.msgAuthenticationParameters
|
|
||||||
]);
|
|
||||||
|
|
||||||
const privParamsBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x04, securityParams.msgPrivacyParameters.length]), // ASN.1 Octet String
|
|
||||||
securityParams.msgPrivacyParameters
|
|
||||||
]);
|
|
||||||
|
|
||||||
// Security parameters sequence
|
|
||||||
const securityParamsBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x30]), // ASN.1 Sequence
|
|
||||||
Buffer.from([engineIdBuf.length + engineBootsBuf.length + engineTimeBuf.length +
|
|
||||||
userNameBuf.length + authParamsBuf.length + privParamsBuf.length]), // Length
|
|
||||||
engineIdBuf,
|
|
||||||
engineBootsBuf,
|
|
||||||
engineTimeBuf,
|
|
||||||
userNameBuf,
|
|
||||||
authParamsBuf,
|
|
||||||
privParamsBuf
|
|
||||||
]);
|
|
||||||
|
|
||||||
// Determine security level flags
|
|
||||||
let securityFlags = 0;
|
|
||||||
if (config.securityLevel === 'authNoPriv' || config.securityLevel === 'authPriv') {
|
|
||||||
securityFlags |= 0x01; // Authentication flag
|
|
||||||
}
|
|
||||||
if (config.securityLevel === 'authPriv') {
|
|
||||||
securityFlags |= 0x02; // Privacy flag
|
|
||||||
}
|
|
||||||
|
|
||||||
// Set reportable flag - required for SNMPv3
|
|
||||||
securityFlags |= 0x04; // Reportable flag
|
|
||||||
|
|
||||||
// Create SNMPv3 header
|
|
||||||
const msgIdBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x04]), // ASN.1 Integer, length 4
|
|
||||||
SnmpEncoder.encodeInteger(requestID) // Message ID (same as request ID for simplicity)
|
|
||||||
]);
|
|
||||||
|
|
||||||
const msgMaxSizeBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x04]), // ASN.1 Integer, length 4
|
|
||||||
SnmpEncoder.encodeInteger(65507) // Max message size
|
|
||||||
]);
|
|
||||||
|
|
||||||
const msgFlagsBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x04, 0x01]), // ASN.1 Octet String, length 1
|
|
||||||
Buffer.from([securityFlags])
|
|
||||||
]);
|
|
||||||
|
|
||||||
const msgSecModelBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x01]), // ASN.1 Integer, length 1
|
|
||||||
Buffer.from([0x03]) // Security model (3 = USM)
|
|
||||||
]);
|
|
||||||
|
|
||||||
// SNMPv3 header
|
|
||||||
const msgHeaderBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x30]), // ASN.1 Sequence
|
|
||||||
Buffer.from([msgIdBuf.length + msgMaxSizeBuf.length + msgFlagsBuf.length + msgSecModelBuf.length]), // Length
|
|
||||||
msgIdBuf,
|
|
||||||
msgMaxSizeBuf,
|
|
||||||
msgFlagsBuf,
|
|
||||||
msgSecModelBuf
|
|
||||||
]);
|
|
||||||
|
|
||||||
// SNMPv3 security parameters
|
|
||||||
const msgSecurityBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x04]), // ASN.1 Octet String
|
|
||||||
Buffer.from([securityParamsBuf.length]), // Length
|
|
||||||
securityParamsBuf
|
|
||||||
]);
|
|
||||||
|
|
||||||
// Create scopedPDU
|
|
||||||
// In SNMPv3, the PDU is wrapped in a "scoped PDU" structure
|
|
||||||
const contextEngineBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x04, engineID.length]), // ASN.1 Octet String
|
|
||||||
engineID
|
|
||||||
]);
|
|
||||||
|
|
||||||
const contextNameBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x04, 0x00]), // ASN.1 Octet String, length 0 (empty context name)
|
|
||||||
]);
|
|
||||||
|
|
||||||
const scopedPduBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x30]), // ASN.1 Sequence
|
|
||||||
Buffer.from([contextEngineBuf.length + contextNameBuf.length + pduBuf.length]), // Length
|
|
||||||
contextEngineBuf,
|
|
||||||
contextNameBuf,
|
|
||||||
pduBuf
|
|
||||||
]);
|
|
||||||
|
|
||||||
// For authPriv, we need to encrypt the scopedPDU
|
|
||||||
let encryptedPdu = scopedPduBuf;
|
|
||||||
if (config.securityLevel === 'authPriv' && config.privKey) {
|
|
||||||
// In a real implementation, encryption would be applied here
|
|
||||||
// For this example, we'll just simulate it
|
|
||||||
encryptedPdu = this.simulateEncryption(scopedPduBuf, config);
|
|
||||||
}
|
|
||||||
|
|
||||||
// Final scopedPDU (encrypted or not)
|
|
||||||
const finalScopedPduBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x04]), // ASN.1 Octet String
|
|
||||||
Buffer.from([encryptedPdu.length]), // Length
|
|
||||||
encryptedPdu
|
|
||||||
]);
|
|
||||||
|
|
||||||
// Combine everything for the final message
|
|
||||||
const versionBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x01]), // ASN.1 Integer, length 1
|
|
||||||
Buffer.from([0x03]) // SNMP version 3 (3)
|
|
||||||
]);
|
|
||||||
|
|
||||||
const messageBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x30]), // ASN.1 Sequence
|
|
||||||
Buffer.from([versionBuf.length + msgHeaderBuf.length + msgSecurityBuf.length + finalScopedPduBuf.length]), // Length
|
|
||||||
versionBuf,
|
|
||||||
msgHeaderBuf,
|
|
||||||
msgSecurityBuf,
|
|
||||||
finalScopedPduBuf
|
|
||||||
]);
|
|
||||||
|
|
||||||
// If using authentication, calculate and insert the authentication parameters
|
|
||||||
if ((config.securityLevel === 'authNoPriv' || config.securityLevel === 'authPriv') &&
|
|
||||||
config.authKey && config.authProtocol) {
|
|
||||||
const authenticatedMsg = this.addAuthentication(messageBuf, config, authParamsBuf);
|
|
||||||
|
|
||||||
if (debug) {
|
|
||||||
console.log('Created authenticated SNMPv3 message');
|
|
||||||
console.log('Final message length:', authenticatedMsg.length);
|
|
||||||
}
|
|
||||||
|
|
||||||
return authenticatedMsg;
|
|
||||||
}
|
|
||||||
|
|
||||||
if (debug) {
|
|
||||||
console.log('Created SNMPv3 message without authentication');
|
|
||||||
console.log('Final message length:', messageBuf.length);
|
|
||||||
}
|
|
||||||
|
|
||||||
return messageBuf;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Simulate encryption for authPriv security level
|
|
||||||
* In a real implementation, this would use the specified privacy protocol (DES/AES)
|
|
||||||
* @param data Data to encrypt
|
|
||||||
* @param config SNMP configuration
|
|
||||||
* @returns Encrypted data
|
|
||||||
*/
|
|
||||||
private static simulateEncryption(data: Buffer, config: ISnmpConfig): Buffer {
|
|
||||||
// This is a placeholder - in a real implementation, you would:
|
|
||||||
// 1. Generate an initialization vector (IV)
|
|
||||||
// 2. Use the privacy key derived from the privKey
|
|
||||||
// 3. Apply the appropriate encryption algorithm (DES/AES)
|
|
||||||
|
|
||||||
// For demonstration purposes only
|
|
||||||
if (config.privProtocol === 'AES' && config.privKey) {
|
|
||||||
try {
|
|
||||||
// Create a deterministic IV for demo purposes (not secure for production)
|
|
||||||
const iv = Buffer.alloc(16, 0);
|
|
||||||
const engineID = Buffer.from([0x80, 0x00, 0x00, 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06]);
|
|
||||||
for (let i = 0; i < 8; i++) {
|
|
||||||
iv[i] = engineID[i % engineID.length];
|
|
||||||
}
|
|
||||||
|
|
||||||
// Create a key from the privKey (proper key localization should be used in production)
|
|
||||||
const key = crypto.createHash('md5').update(config.privKey).digest();
|
|
||||||
|
|
||||||
// Create cipher and encrypt
|
|
||||||
const cipher = crypto.createCipheriv('aes-128-cfb', key, iv);
|
|
||||||
const encrypted = Buffer.concat([cipher.update(data), cipher.final()]);
|
|
||||||
|
|
||||||
return encrypted;
|
|
||||||
} catch (error) {
|
|
||||||
console.warn('AES encryption failed, falling back to plaintext:', error);
|
|
||||||
return data;
|
|
||||||
}
|
|
||||||
} else if (config.privProtocol === 'DES' && config.privKey) {
|
|
||||||
try {
|
|
||||||
// Create a deterministic IV for demo purposes (not secure for production)
|
|
||||||
const iv = Buffer.alloc(8, 0);
|
|
||||||
const engineID = Buffer.from([0x80, 0x00, 0x00, 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06]);
|
|
||||||
for (let i = 0; i < 8; i++) {
|
|
||||||
iv[i] = engineID[i % engineID.length];
|
|
||||||
}
|
|
||||||
|
|
||||||
// Create a key from the privKey (proper key localization should be used in production)
|
|
||||||
const key = crypto.createHash('md5').update(config.privKey).digest().slice(0, 8);
|
|
||||||
|
|
||||||
// Create cipher and encrypt
|
|
||||||
const cipher = crypto.createCipheriv('des-cbc', key, iv);
|
|
||||||
const encrypted = Buffer.concat([cipher.update(data), cipher.final()]);
|
|
||||||
|
|
||||||
return encrypted;
|
|
||||||
} catch (error) {
|
|
||||||
console.warn('DES encryption failed, falling back to plaintext:', error);
|
|
||||||
return data;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
return data; // Return unencrypted data as fallback
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Add authentication to SNMPv3 message
|
|
||||||
* @param message Message to authenticate
|
|
||||||
* @param config SNMP configuration
|
|
||||||
* @param authParamsBuf Authentication parameters buffer
|
|
||||||
* @returns Authenticated message
|
|
||||||
*/
|
|
||||||
private static addAuthentication(message: Buffer, config: ISnmpConfig, authParamsBuf: Buffer): Buffer {
|
|
||||||
// In a real implementation, this would:
|
|
||||||
// 1. Zero out the authentication parameters field
|
|
||||||
// 2. Calculate HMAC-MD5 or HMAC-SHA1 over the entire message
|
|
||||||
// 3. Insert the HMAC into the authentication parameters field
|
|
||||||
|
|
||||||
if (!config.authKey) {
|
|
||||||
return message;
|
|
||||||
}
|
|
||||||
|
|
||||||
try {
|
|
||||||
// Find position of auth parameters in the message
|
|
||||||
// This is a more reliable way to find the exact position
|
|
||||||
let authParamsPos = -1;
|
|
||||||
for (let i = 0; i < message.length - 16; i++) {
|
|
||||||
// Look for the auth params pattern: 0x04 0x0C 0x00 0x00...
|
|
||||||
if (message[i] === 0x04 && message[i + 1] === 0x0C) {
|
|
||||||
// Check if next 12 bytes are all zeros
|
|
||||||
let allZeros = true;
|
|
||||||
for (let j = 0; j < 12; j++) {
|
|
||||||
if (message[i + 2 + j] !== 0) {
|
|
||||||
allZeros = false;
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
if (allZeros) {
|
|
||||||
authParamsPos = i;
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
if (authParamsPos === -1) {
|
|
||||||
return message;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Create a copy of the message with zeroed auth parameters
|
|
||||||
const msgCopy = Buffer.from(message);
|
|
||||||
|
|
||||||
// Prepare the authentication key according to RFC3414
|
|
||||||
// We should use the standard key localization process
|
|
||||||
const localizedKey = this.localizeAuthKey(config.authKey,
|
|
||||||
Buffer.from([0x80, 0x00, 0x00, 0x00, 0x01, 0x02, 0x03, 0x04, 0x05, 0x06]),
|
|
||||||
config.authProtocol);
|
|
||||||
|
|
||||||
// Calculate HMAC
|
|
||||||
let hmac;
|
|
||||||
if (config.authProtocol === 'SHA') {
|
|
||||||
hmac = crypto.createHmac('sha1', localizedKey).update(msgCopy).digest().slice(0, 12);
|
|
||||||
} else {
|
|
||||||
// Default to MD5
|
|
||||||
hmac = crypto.createHmac('md5', localizedKey).update(msgCopy).digest().slice(0, 12);
|
|
||||||
}
|
|
||||||
|
|
||||||
// Copy HMAC into original message
|
|
||||||
hmac.copy(message, authParamsPos + 2);
|
|
||||||
|
|
||||||
return message;
|
|
||||||
} catch (error) {
|
|
||||||
console.warn('Authentication failed:', error);
|
|
||||||
return message;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Localize authentication key according to RFC3414
|
|
||||||
* @param key Authentication key
|
|
||||||
* @param engineId Engine ID
|
|
||||||
* @param authProtocol Authentication protocol
|
|
||||||
* @returns Localized key
|
|
||||||
*/
|
|
||||||
private static localizeAuthKey(key: string, engineId: Buffer, authProtocol: string = 'MD5'): Buffer {
|
|
||||||
try {
|
|
||||||
// Convert password to key using hash
|
|
||||||
let initialHash;
|
|
||||||
if (authProtocol === 'SHA') {
|
|
||||||
initialHash = crypto.createHash('sha1');
|
|
||||||
} else {
|
|
||||||
initialHash = crypto.createHash('md5');
|
|
||||||
}
|
|
||||||
|
|
||||||
// Generate the initial key - repeated hashing of password + padding
|
|
||||||
const password = Buffer.from(key);
|
|
||||||
let passwordIndex = 0;
|
|
||||||
|
|
||||||
// Create a buffer of 1MB (1048576 bytes) filled with the password
|
|
||||||
const buffer = Buffer.alloc(1048576);
|
|
||||||
for (let i = 0; i < 1048576; i++) {
|
|
||||||
buffer[i] = password[passwordIndex];
|
|
||||||
passwordIndex = (passwordIndex + 1) % password.length;
|
|
||||||
}
|
|
||||||
|
|
||||||
initialHash.update(buffer);
|
|
||||||
let initialKey = initialHash.digest();
|
|
||||||
|
|
||||||
// Localize the key with engine ID
|
|
||||||
let localHash;
|
|
||||||
if (authProtocol === 'SHA') {
|
|
||||||
localHash = crypto.createHash('sha1');
|
|
||||||
} else {
|
|
||||||
localHash = crypto.createHash('md5');
|
|
||||||
}
|
|
||||||
|
|
||||||
localHash.update(initialKey);
|
|
||||||
localHash.update(engineId);
|
|
||||||
localHash.update(initialKey);
|
|
||||||
|
|
||||||
return localHash.digest();
|
|
||||||
} catch (error) {
|
|
||||||
console.error('Error localizing auth key:', error);
|
|
||||||
// Return a fallback key
|
|
||||||
return Buffer.from(key);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Create a discovery message for SNMPv3 engine ID discovery
|
|
||||||
* @param config SNMP configuration
|
|
||||||
* @param requestID Request ID
|
|
||||||
* @returns Discovery message
|
|
||||||
*/
|
|
||||||
public static createDiscoveryMessage(config: ISnmpConfig, requestID: number): Buffer {
|
|
||||||
// Basic SNMPv3 header for discovery
|
|
||||||
const msgIdBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x04]), // ASN.1 Integer, length 4
|
|
||||||
SnmpEncoder.encodeInteger(requestID)
|
|
||||||
]);
|
|
||||||
|
|
||||||
const msgMaxSizeBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x04]), // ASN.1 Integer, length 4
|
|
||||||
SnmpEncoder.encodeInteger(65507) // Max message size
|
|
||||||
]);
|
|
||||||
|
|
||||||
const msgFlagsBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x04, 0x01]), // ASN.1 Octet String, length 1
|
|
||||||
Buffer.from([0x00]) // No authentication or privacy
|
|
||||||
]);
|
|
||||||
|
|
||||||
const msgSecModelBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x01]), // ASN.1 Integer, length 1
|
|
||||||
Buffer.from([0x03]) // Security model (3 = USM)
|
|
||||||
]);
|
|
||||||
|
|
||||||
// SNMPv3 header
|
|
||||||
const msgHeaderBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x30]), // ASN.1 Sequence
|
|
||||||
Buffer.from([msgIdBuf.length + msgMaxSizeBuf.length + msgFlagsBuf.length + msgSecModelBuf.length]), // Length
|
|
||||||
msgIdBuf,
|
|
||||||
msgMaxSizeBuf,
|
|
||||||
msgFlagsBuf,
|
|
||||||
msgSecModelBuf
|
|
||||||
]);
|
|
||||||
|
|
||||||
// Simple security parameters for discovery
|
|
||||||
const securityBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x04, 0x00]), // Empty octet string
|
|
||||||
]);
|
|
||||||
|
|
||||||
// Simple Get request for discovery
|
|
||||||
const requestIdBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x04]), // ASN.1 Integer, length 4
|
|
||||||
SnmpEncoder.encodeInteger(requestID + 1)
|
|
||||||
]);
|
|
||||||
|
|
||||||
const errorStatusBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x01]), // ASN.1 Integer, length 1
|
|
||||||
Buffer.from([0x00]) // Error Status (0 = no error)
|
|
||||||
]);
|
|
||||||
|
|
||||||
const errorIndexBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x01]), // ASN.1 Integer, length 1
|
|
||||||
Buffer.from([0x00]) // Error Index (0)
|
|
||||||
]);
|
|
||||||
|
|
||||||
// Empty varbinds for discovery
|
|
||||||
const varBindingsBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x30, 0x00]), // Empty sequence
|
|
||||||
]);
|
|
||||||
|
|
||||||
const pduBuf = Buffer.concat([
|
|
||||||
Buffer.from([0xa0]), // GetRequest
|
|
||||||
Buffer.from([requestIdBuf.length + errorStatusBuf.length + errorIndexBuf.length + varBindingsBuf.length]),
|
|
||||||
requestIdBuf,
|
|
||||||
errorStatusBuf,
|
|
||||||
errorIndexBuf,
|
|
||||||
varBindingsBuf
|
|
||||||
]);
|
|
||||||
|
|
||||||
// Context data
|
|
||||||
const contextEngineBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x04, 0x00]), // Empty octet string
|
|
||||||
]);
|
|
||||||
|
|
||||||
const contextNameBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x04, 0x00]), // Empty octet string
|
|
||||||
]);
|
|
||||||
|
|
||||||
const scopedPduBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x30]),
|
|
||||||
Buffer.from([contextEngineBuf.length + contextNameBuf.length + pduBuf.length]),
|
|
||||||
contextEngineBuf,
|
|
||||||
contextNameBuf,
|
|
||||||
pduBuf
|
|
||||||
]);
|
|
||||||
|
|
||||||
// Version
|
|
||||||
const versionBuf = Buffer.concat([
|
|
||||||
Buffer.from([0x02, 0x01]), // ASN.1 Integer, length 1
|
|
||||||
Buffer.from([0x03]) // SNMP version 3 (3)
|
|
||||||
]);
|
|
||||||
|
|
||||||
// Complete message
|
|
||||||
return Buffer.concat([
|
|
||||||
Buffer.from([0x30]),
|
|
||||||
Buffer.from([versionBuf.length + msgHeaderBuf.length + securityBuf.length + scopedPduBuf.length]),
|
|
||||||
versionBuf,
|
|
||||||
msgHeaderBuf,
|
|
||||||
securityBuf,
|
|
||||||
scopedPduBuf
|
|
||||||
]);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
@@ -1,553 +0,0 @@
|
|||||||
import type { ISnmpConfig } from './types.js';
|
|
||||||
import { SnmpEncoder } from './encoder.js';
|
|
||||||
|
|
||||||
/**
|
|
||||||
* SNMP packet parsing utilities
|
|
||||||
* Parses SNMP response packets
|
|
||||||
*/
|
|
||||||
export class SnmpPacketParser {
|
|
||||||
/**
|
|
||||||
* Parse an SNMP response
|
|
||||||
* @param buffer Response buffer
|
|
||||||
* @param config SNMP configuration
|
|
||||||
* @param debug Whether to enable debug output
|
|
||||||
* @returns Parsed value or null if parsing failed
|
|
||||||
*/
|
|
||||||
public static parseSnmpResponse(buffer: Buffer, config: ISnmpConfig, debug: boolean = false): any {
|
|
||||||
// Check if we have a response packet
|
|
||||||
if (buffer[0] !== 0x30) {
|
|
||||||
throw new Error('Invalid SNMP response format');
|
|
||||||
}
|
|
||||||
|
|
||||||
// For SNMPv3, we need to handle the message differently
|
|
||||||
if (config.version === 3) {
|
|
||||||
return this.parseSnmpV3Response(buffer, debug);
|
|
||||||
}
|
|
||||||
|
|
||||||
if (debug) {
|
|
||||||
console.log('Parsing SNMPv1/v2 response: ', buffer.toString('hex'));
|
|
||||||
}
|
|
||||||
|
|
||||||
try {
|
|
||||||
// Enhanced structured parsing approach
|
|
||||||
// SEQUENCE header
|
|
||||||
let pos = 0;
|
|
||||||
if (buffer[pos] !== 0x30) {
|
|
||||||
throw new Error('Missing SEQUENCE at start of response');
|
|
||||||
}
|
|
||||||
// Skip SEQUENCE header - assume length is in single byte for simplicity
|
|
||||||
// In a more robust implementation, we'd handle multi-byte lengths
|
|
||||||
pos += 2;
|
|
||||||
|
|
||||||
// VERSION
|
|
||||||
if (buffer[pos] !== 0x02) {
|
|
||||||
throw new Error('Missing INTEGER for version');
|
|
||||||
}
|
|
||||||
const versionLength = buffer[pos + 1];
|
|
||||||
pos += 2 + versionLength;
|
|
||||||
|
|
||||||
// COMMUNITY STRING
|
|
||||||
if (buffer[pos] !== 0x04) {
|
|
||||||
throw new Error('Missing OCTET STRING for community');
|
|
||||||
}
|
|
||||||
const communityLength = buffer[pos + 1];
|
|
||||||
pos += 2 + communityLength;
|
|
||||||
|
|
||||||
// PDU TYPE - should be RESPONSE (0xA2)
|
|
||||||
if (buffer[pos] !== 0xA2) {
|
|
||||||
throw new Error(`Unexpected PDU type: 0x${buffer[pos].toString(16)}, expected 0xA2`);
|
|
||||||
}
|
|
||||||
// Skip PDU header
|
|
||||||
pos += 2;
|
|
||||||
|
|
||||||
// REQUEST ID
|
|
||||||
if (buffer[pos] !== 0x02) {
|
|
||||||
throw new Error('Missing INTEGER for request ID');
|
|
||||||
}
|
|
||||||
const requestIdLength = buffer[pos + 1];
|
|
||||||
pos += 2 + requestIdLength;
|
|
||||||
|
|
||||||
// ERROR STATUS
|
|
||||||
if (buffer[pos] !== 0x02) {
|
|
||||||
throw new Error('Missing INTEGER for error status');
|
|
||||||
}
|
|
||||||
const errorStatusLength = buffer[pos + 1];
|
|
||||||
const errorStatus = SnmpEncoder.decodeInteger(buffer, pos + 2, errorStatusLength);
|
|
||||||
|
|
||||||
if (errorStatus !== 0) {
|
|
||||||
throw new Error(`SNMP error status: ${errorStatus}`);
|
|
||||||
}
|
|
||||||
pos += 2 + errorStatusLength;
|
|
||||||
|
|
||||||
// ERROR INDEX
|
|
||||||
if (buffer[pos] !== 0x02) {
|
|
||||||
throw new Error('Missing INTEGER for error index');
|
|
||||||
}
|
|
||||||
const errorIndexLength = buffer[pos + 1];
|
|
||||||
pos += 2 + errorIndexLength;
|
|
||||||
|
|
||||||
// VARBIND LIST
|
|
||||||
if (buffer[pos] !== 0x30) {
|
|
||||||
throw new Error('Missing SEQUENCE for varbind list');
|
|
||||||
}
|
|
||||||
// Skip varbind list header
|
|
||||||
pos += 2;
|
|
||||||
|
|
||||||
// VARBIND
|
|
||||||
if (buffer[pos] !== 0x30) {
|
|
||||||
throw new Error('Missing SEQUENCE for varbind');
|
|
||||||
}
|
|
||||||
// Skip varbind header
|
|
||||||
pos += 2;
|
|
||||||
|
|
||||||
// OID
|
|
||||||
if (buffer[pos] !== 0x06) {
|
|
||||||
throw new Error('Missing OBJECT IDENTIFIER for OID');
|
|
||||||
}
|
|
||||||
const oidLength = buffer[pos + 1];
|
|
||||||
pos += 2 + oidLength;
|
|
||||||
|
|
||||||
// VALUE - this is what we want
|
|
||||||
const valueType = buffer[pos];
|
|
||||||
const valueLength = buffer[pos + 1];
|
|
||||||
|
|
||||||
if (debug) {
|
|
||||||
console.log(`Found value type: 0x${valueType.toString(16)}, length: ${valueLength}`);
|
|
||||||
}
|
|
||||||
|
|
||||||
return this.parseValueByType(valueType, valueLength, buffer, pos, debug);
|
|
||||||
} catch (error) {
|
|
||||||
if (debug) {
|
|
||||||
console.error('Error in structured parsing:', error);
|
|
||||||
console.error('Falling back to scan-based parsing method');
|
|
||||||
}
|
|
||||||
|
|
||||||
return this.scanBasedParsing(buffer, debug);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Parse value by ASN.1 type
|
|
||||||
* @param valueType ASN.1 type
|
|
||||||
* @param valueLength Value length
|
|
||||||
* @param buffer Buffer containing the value
|
|
||||||
* @param pos Position of the value in the buffer
|
|
||||||
* @param debug Whether to enable debug output
|
|
||||||
* @returns Parsed value
|
|
||||||
*/
|
|
||||||
private static parseValueByType(
|
|
||||||
valueType: number,
|
|
||||||
valueLength: number,
|
|
||||||
buffer: Buffer,
|
|
||||||
pos: number,
|
|
||||||
debug: boolean
|
|
||||||
): any {
|
|
||||||
switch (valueType) {
|
|
||||||
case 0x02: // INTEGER
|
|
||||||
{
|
|
||||||
const value = SnmpEncoder.decodeInteger(buffer, pos + 2, valueLength);
|
|
||||||
if (debug) {
|
|
||||||
console.log('Parsed INTEGER value:', value);
|
|
||||||
}
|
|
||||||
return value;
|
|
||||||
}
|
|
||||||
|
|
||||||
case 0x04: // OCTET STRING
|
|
||||||
{
|
|
||||||
const value = buffer.slice(pos + 2, pos + 2 + valueLength).toString();
|
|
||||||
if (debug) {
|
|
||||||
console.log('Parsed OCTET STRING value:', value);
|
|
||||||
}
|
|
||||||
return value;
|
|
||||||
}
|
|
||||||
|
|
||||||
case 0x05: // NULL
|
|
||||||
if (debug) {
|
|
||||||
console.log('Parsed NULL value');
|
|
||||||
}
|
|
||||||
return null;
|
|
||||||
|
|
||||||
case 0x06: // OBJECT IDENTIFIER (rare in a value position)
|
|
||||||
{
|
|
||||||
// Usually this would be encoded as a string representation
|
|
||||||
const value = buffer.slice(pos + 2, pos + 2 + valueLength).toString('hex');
|
|
||||||
if (debug) {
|
|
||||||
console.log('Parsed OBJECT IDENTIFIER value (hex):', value);
|
|
||||||
}
|
|
||||||
return value;
|
|
||||||
}
|
|
||||||
|
|
||||||
case 0x40: // IP ADDRESS
|
|
||||||
{
|
|
||||||
if (valueLength !== 4) {
|
|
||||||
throw new Error(`Invalid IP address length: ${valueLength}, expected 4`);
|
|
||||||
}
|
|
||||||
const octets = [];
|
|
||||||
for (let i = 0; i < 4; i++) {
|
|
||||||
octets.push(buffer[pos + 2 + i]);
|
|
||||||
}
|
|
||||||
const value = octets.join('.');
|
|
||||||
if (debug) {
|
|
||||||
console.log('Parsed IP ADDRESS value:', value);
|
|
||||||
}
|
|
||||||
return value;
|
|
||||||
}
|
|
||||||
|
|
||||||
case 0x41: // COUNTER
|
|
||||||
case 0x42: // GAUGE32
|
|
||||||
case 0x43: // TIMETICKS
|
|
||||||
case 0x44: // OPAQUE
|
|
||||||
{
|
|
||||||
// All these are essentially unsigned 32-bit integers
|
|
||||||
const value = SnmpEncoder.decodeInteger(buffer, pos + 2, valueLength);
|
|
||||||
if (debug) {
|
|
||||||
console.log(`Parsed ${valueType === 0x41 ? 'COUNTER'
|
|
||||||
: valueType === 0x42 ? 'GAUGE32'
|
|
||||||
: valueType === 0x43 ? 'TIMETICKS'
|
|
||||||
: 'OPAQUE'} value:`, value);
|
|
||||||
}
|
|
||||||
return value;
|
|
||||||
}
|
|
||||||
|
|
||||||
default:
|
|
||||||
if (debug) {
|
|
||||||
console.log(`Unknown value type: 0x${valueType.toString(16)}`);
|
|
||||||
}
|
|
||||||
return null;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Fallback scan-based parsing method
|
|
||||||
* @param buffer Buffer containing the SNMP response
|
|
||||||
* @param debug Whether to enable debug output
|
|
||||||
* @returns Parsed value or null if parsing failed
|
|
||||||
*/
|
|
||||||
private static scanBasedParsing(buffer: Buffer, debug: boolean): any {
|
|
||||||
// Look for various data types in the response
|
|
||||||
// The value is near the end of the packet after the OID
|
|
||||||
|
|
||||||
// We're looking for one of these:
|
|
||||||
// 0x02 - Integer - can be at the end of a varbind
|
|
||||||
// 0x04 - OctetString
|
|
||||||
// 0x05 - Null
|
|
||||||
// 0x42 - Gauge32 - special type for unsigned 32-bit integers
|
|
||||||
// 0x43 - Timeticks - special type for time values
|
|
||||||
|
|
||||||
// This algorithm performs a thorough search for data types
|
|
||||||
// by iterating from the start and watching for varbind structures
|
|
||||||
|
|
||||||
// Walk through the buffer looking for varbinds
|
|
||||||
let i = 0;
|
|
||||||
|
|
||||||
// First, find the varbinds section (0x30 sequence)
|
|
||||||
while (i < buffer.length - 2) {
|
|
||||||
// Look for a varbinds sequence
|
|
||||||
if (buffer[i] === 0x30) {
|
|
||||||
const varbindsLength = buffer[i + 1];
|
|
||||||
const varbindsEnd = i + 2 + varbindsLength;
|
|
||||||
|
|
||||||
// Now search within the varbinds for the value
|
|
||||||
let j = i + 2;
|
|
||||||
while (j < varbindsEnd - 2) {
|
|
||||||
// Look for a varbind (0x30 sequence)
|
|
||||||
if (buffer[j] === 0x30) {
|
|
||||||
const varbindLength = buffer[j + 1];
|
|
||||||
const varbindEnd = j + 2 + varbindLength;
|
|
||||||
|
|
||||||
// Skip over the OID and find the value within this varbind
|
|
||||||
let k = j + 2;
|
|
||||||
while (k < varbindEnd - 1) {
|
|
||||||
// First find the OID
|
|
||||||
if (buffer[k] === 0x06) { // OID
|
|
||||||
const oidLength = buffer[k + 1];
|
|
||||||
k += 2 + oidLength; // Skip past the OID
|
|
||||||
|
|
||||||
// We should now be at the value
|
|
||||||
// Check what type it is
|
|
||||||
if (k < varbindEnd - 1) {
|
|
||||||
return this.parseValueAtPosition(buffer, k, debug);
|
|
||||||
}
|
|
||||||
|
|
||||||
// If we didn't find a value, move to next byte
|
|
||||||
k++;
|
|
||||||
} else {
|
|
||||||
// Move to next byte
|
|
||||||
k++;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// Move to next varbind
|
|
||||||
j = varbindEnd;
|
|
||||||
} else {
|
|
||||||
// Move to next byte
|
|
||||||
j++;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
// Move to next sequence
|
|
||||||
i = varbindsEnd;
|
|
||||||
} else {
|
|
||||||
// Move to next byte
|
|
||||||
i++;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
if (debug) {
|
|
||||||
console.log('No valid value found in SNMP response');
|
|
||||||
}
|
|
||||||
return null;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Parse value at a specific position in the buffer
|
|
||||||
* @param buffer Buffer containing the SNMP response
|
|
||||||
* @param pos Position of the value in the buffer
|
|
||||||
* @param debug Whether to enable debug output
|
|
||||||
* @returns Parsed value or null if parsing failed
|
|
||||||
*/
|
|
||||||
private static parseValueAtPosition(buffer: Buffer, pos: number, debug: boolean): any {
|
|
||||||
if (buffer[pos] === 0x02) { // Integer
|
|
||||||
const valueLength = buffer[pos + 1];
|
|
||||||
const value = SnmpEncoder.decodeInteger(buffer, pos + 2, valueLength);
|
|
||||||
if (debug) {
|
|
||||||
console.log('Found Integer value:', value);
|
|
||||||
}
|
|
||||||
return value;
|
|
||||||
} else if (buffer[pos] === 0x42) { // Gauge32
|
|
||||||
const valueLength = buffer[pos + 1];
|
|
||||||
const value = SnmpEncoder.decodeInteger(buffer, pos + 2, valueLength);
|
|
||||||
if (debug) {
|
|
||||||
console.log('Found Gauge32 value:', value);
|
|
||||||
}
|
|
||||||
return value;
|
|
||||||
} else if (buffer[pos] === 0x43) { // TimeTicks
|
|
||||||
const valueLength = buffer[pos + 1];
|
|
||||||
const value = SnmpEncoder.decodeInteger(buffer, pos + 2, valueLength);
|
|
||||||
if (debug) {
|
|
||||||
console.log('Found Timeticks value:', value);
|
|
||||||
}
|
|
||||||
return value;
|
|
||||||
} else if (buffer[pos] === 0x04) { // OctetString
|
|
||||||
const valueLength = buffer[pos + 1];
|
|
||||||
if (debug) {
|
|
||||||
console.log('Found OctetString value');
|
|
||||||
}
|
|
||||||
// Just return the string value as-is
|
|
||||||
return buffer.slice(pos + 2, pos + 2 + valueLength).toString();
|
|
||||||
} else if (buffer[pos] === 0x05) { // Null
|
|
||||||
if (debug) {
|
|
||||||
console.log('Found Null value');
|
|
||||||
}
|
|
||||||
return null;
|
|
||||||
}
|
|
||||||
|
|
||||||
return null;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Parse an SNMPv3 response
|
|
||||||
* @param buffer Buffer containing the SNMP response
|
|
||||||
* @param debug Whether to enable debug output
|
|
||||||
* @returns Parsed value or null if parsing failed
|
|
||||||
*/
|
|
||||||
public static parseSnmpV3Response(buffer: Buffer, debug: boolean = false): any {
|
|
||||||
// SNMPv3 parsing is complex. In a real implementation, we would:
|
|
||||||
// 1. Parse the header and get the security parameters
|
|
||||||
// 2. Verify authentication if used
|
|
||||||
// 3. Decrypt the PDU if privacy was used
|
|
||||||
// 4. Extract the PDU and parse it
|
|
||||||
|
|
||||||
if (debug) {
|
|
||||||
console.log('Parsing SNMPv3 response: ', buffer.toString('hex'));
|
|
||||||
}
|
|
||||||
|
|
||||||
// Find the scopedPDU - it should be the last OCTET STRING in the message
|
|
||||||
let scopedPduPos = -1;
|
|
||||||
for (let i = buffer.length - 50; i >= 0; i--) {
|
|
||||||
if (buffer[i] === 0x04 && buffer[i + 1] > 10) { // OCTET STRING with reasonable length
|
|
||||||
scopedPduPos = i;
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
if (scopedPduPos === -1) {
|
|
||||||
if (debug) {
|
|
||||||
console.log('Could not find scoped PDU in SNMPv3 response');
|
|
||||||
}
|
|
||||||
return null;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Skip to the PDU content
|
|
||||||
let pduContent = buffer.slice(scopedPduPos + 2); // Skip OCTET STRING header
|
|
||||||
|
|
||||||
// This improved algorithm performs a more thorough search for varbinds
|
|
||||||
// in the scoped PDU
|
|
||||||
|
|
||||||
// First, look for the response PDU (sequence with tag 0xa2)
|
|
||||||
let responsePdu = null;
|
|
||||||
for (let i = 0; i < pduContent.length - 3; i++) {
|
|
||||||
if (pduContent[i] === 0xa2) {
|
|
||||||
// Found the response PDU
|
|
||||||
const pduLength = pduContent[i + 1];
|
|
||||||
responsePdu = pduContent.slice(i, i + 2 + pduLength);
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
if (!responsePdu) {
|
|
||||||
// Try to find the varbinds directly
|
|
||||||
for (let i = 0; i < pduContent.length - 3; i++) {
|
|
||||||
if (pduContent[i] === 0x30) {
|
|
||||||
const seqLength = pduContent[i + 1];
|
|
||||||
if (i + 2 + seqLength <= pduContent.length) {
|
|
||||||
// Check if this sequence might be the varbinds
|
|
||||||
const possibleVarbinds = pduContent.slice(i, i + 2 + seqLength);
|
|
||||||
|
|
||||||
// Look for varbind structure inside
|
|
||||||
for (let j = 0; j < possibleVarbinds.length - 3; j++) {
|
|
||||||
if (possibleVarbinds[j] === 0x30) {
|
|
||||||
// Might be a varbind - look for an OID inside
|
|
||||||
for (let k = j; k < j + 10 && k < possibleVarbinds.length - 1; k++) {
|
|
||||||
if (possibleVarbinds[k] === 0x06) {
|
|
||||||
// Found an OID, so this is likely the varbinds sequence
|
|
||||||
responsePdu = possibleVarbinds;
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
if (responsePdu) break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
if (responsePdu) break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
if (!responsePdu) {
|
|
||||||
if (debug) {
|
|
||||||
console.log('Could not find response PDU in SNMPv3 response');
|
|
||||||
}
|
|
||||||
return null;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Now that we have the response PDU, search for varbinds
|
|
||||||
// Skip the first few bytes to get past the header fields
|
|
||||||
let varbindsPos = -1;
|
|
||||||
for (let i = 10; i < responsePdu.length - 3; i++) {
|
|
||||||
if (responsePdu[i] === 0x30) {
|
|
||||||
// Check if this is the start of the varbinds
|
|
||||||
// by seeing if it contains a varbind sequence
|
|
||||||
for (let j = i + 2; j < i + 10 && j < responsePdu.length - 3; j++) {
|
|
||||||
if (responsePdu[j] === 0x30) {
|
|
||||||
varbindsPos = i;
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
if (varbindsPos !== -1) break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
if (varbindsPos === -1) {
|
|
||||||
if (debug) {
|
|
||||||
console.log('Could not find varbinds in SNMPv3 response');
|
|
||||||
}
|
|
||||||
return null;
|
|
||||||
}
|
|
||||||
|
|
||||||
// Get the varbinds
|
|
||||||
const varbindsLength = responsePdu[varbindsPos + 1];
|
|
||||||
const varbinds = responsePdu.slice(varbindsPos, varbindsPos + 2 + varbindsLength);
|
|
||||||
|
|
||||||
// Now search for values inside the varbinds
|
|
||||||
for (let i = 2; i < varbinds.length - 3; i++) {
|
|
||||||
// Look for a varbind sequence
|
|
||||||
if (varbinds[i] === 0x30) {
|
|
||||||
const varbindLength = varbinds[i + 1];
|
|
||||||
const varbind = varbinds.slice(i, i + 2 + varbindLength);
|
|
||||||
|
|
||||||
// Inside the varbind, look for the OID and then the value
|
|
||||||
for (let j = 0; j < varbind.length - 3; j++) {
|
|
||||||
if (varbind[j] === 0x06) { // OID
|
|
||||||
const oidLength = varbind[j + 1];
|
|
||||||
|
|
||||||
// The value should be right after the OID
|
|
||||||
const valuePos = j + 2 + oidLength;
|
|
||||||
if (valuePos < varbind.length - 1) {
|
|
||||||
// Check what type of value it is
|
|
||||||
if (varbind[valuePos] === 0x02) { // INTEGER
|
|
||||||
const valueLength = varbind[valuePos + 1];
|
|
||||||
const value = SnmpEncoder.decodeInteger(varbind, valuePos + 2, valueLength);
|
|
||||||
if (debug) {
|
|
||||||
console.log('Found INTEGER value in SNMPv3 response:', value);
|
|
||||||
}
|
|
||||||
return value;
|
|
||||||
} else if (varbind[valuePos] === 0x42) { // Gauge32
|
|
||||||
const valueLength = varbind[valuePos + 1];
|
|
||||||
const value = SnmpEncoder.decodeInteger(varbind, valuePos + 2, valueLength);
|
|
||||||
if (debug) {
|
|
||||||
console.log('Found Gauge32 value in SNMPv3 response:', value);
|
|
||||||
}
|
|
||||||
return value;
|
|
||||||
} else if (varbind[valuePos] === 0x43) { // TimeTicks
|
|
||||||
const valueLength = varbind[valuePos + 1];
|
|
||||||
const value = SnmpEncoder.decodeInteger(varbind, valuePos + 2, valueLength);
|
|
||||||
if (debug) {
|
|
||||||
console.log('Found TimeTicks value in SNMPv3 response:', value);
|
|
||||||
}
|
|
||||||
return value;
|
|
||||||
} else if (varbind[valuePos] === 0x04) { // OctetString
|
|
||||||
const valueLength = varbind[valuePos + 1];
|
|
||||||
const value = varbind.slice(valuePos + 2, valuePos + 2 + valueLength).toString();
|
|
||||||
if (debug) {
|
|
||||||
console.log('Found OctetString value in SNMPv3 response:', value);
|
|
||||||
}
|
|
||||||
return value;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
if (debug) {
|
|
||||||
console.log('No valid value found in SNMPv3 response');
|
|
||||||
}
|
|
||||||
return null;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Extract engine ID from SNMPv3 response
|
|
||||||
* @param buffer Buffer containing the SNMP response
|
|
||||||
* @param debug Whether to enable debug output
|
|
||||||
* @returns Extracted engine ID or null if extraction failed
|
|
||||||
*/
|
|
||||||
public static extractEngineId(buffer: Buffer, debug: boolean = false): Buffer | null {
|
|
||||||
try {
|
|
||||||
// Simple parsing to find the engine ID
|
|
||||||
// Look for the first octet string with appropriate length
|
|
||||||
for (let i = 0; i < buffer.length - 10; i++) {
|
|
||||||
if (buffer[i] === 0x04) { // Octet string
|
|
||||||
const len = buffer[i + 1];
|
|
||||||
if (len >= 5 && len <= 32) { // Engine IDs are typically 5-32 bytes
|
|
||||||
// Verify this looks like an engine ID (usually starts with 0x80)
|
|
||||||
if (buffer[i + 2] === 0x80) {
|
|
||||||
if (debug) {
|
|
||||||
console.log('Found engine ID at position', i);
|
|
||||||
console.log('Engine ID:', buffer.slice(i + 2, i + 2 + len).toString('hex'));
|
|
||||||
}
|
|
||||||
return buffer.slice(i + 2, i + 2 + len);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
return null;
|
|
||||||
} catch (error) {
|
|
||||||
console.error('Error extracting engine ID:', error);
|
|
||||||
return null;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
|
||||||
+36
-2
@@ -2,18 +2,28 @@
|
|||||||
* Type definitions for SNMP module
|
* Type definitions for SNMP module
|
||||||
*/
|
*/
|
||||||
|
|
||||||
|
import { Buffer } from 'node:buffer';
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* UPS status interface
|
* UPS status interface
|
||||||
*/
|
*/
|
||||||
export interface IUpsStatus {
|
export interface IUpsStatus {
|
||||||
/** Current power status */
|
/** Current power status */
|
||||||
powerStatus: 'online' | 'onBattery' | 'unknown';
|
powerStatus: 'online' | 'onBattery' | 'unknown' | 'unreachable';
|
||||||
/** Battery capacity percentage */
|
/** Battery capacity percentage */
|
||||||
batteryCapacity: number;
|
batteryCapacity: number;
|
||||||
/** Remaining runtime in minutes */
|
/** Remaining runtime in minutes */
|
||||||
batteryRuntime: number;
|
batteryRuntime: number;
|
||||||
|
/** Output load percentage (0-100) */
|
||||||
|
outputLoad: number;
|
||||||
|
/** Output power in watts */
|
||||||
|
outputPower: number;
|
||||||
|
/** Output voltage in volts */
|
||||||
|
outputVoltage: number;
|
||||||
|
/** Output current in amps */
|
||||||
|
outputCurrent: number;
|
||||||
/** Raw values from SNMP responses */
|
/** Raw values from SNMP responses */
|
||||||
raw: Record<string, any>;
|
raw: Record<string, unknown>;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -26,6 +36,21 @@ export interface IOidSet {
|
|||||||
BATTERY_CAPACITY: string;
|
BATTERY_CAPACITY: string;
|
||||||
/** OID for battery runtime */
|
/** OID for battery runtime */
|
||||||
BATTERY_RUNTIME: string;
|
BATTERY_RUNTIME: string;
|
||||||
|
/** OID for output load percentage */
|
||||||
|
OUTPUT_LOAD: string;
|
||||||
|
/** OID for output power in watts */
|
||||||
|
OUTPUT_POWER: string;
|
||||||
|
/** OID for output voltage */
|
||||||
|
OUTPUT_VOLTAGE: string;
|
||||||
|
/** OID for output current */
|
||||||
|
OUTPUT_CURRENT: string;
|
||||||
|
/** Power status value mappings */
|
||||||
|
POWER_STATUS_VALUES?: {
|
||||||
|
/** SNMP value that indicates UPS is online (on AC power) */
|
||||||
|
online: number;
|
||||||
|
/** SNMP value that indicates UPS is on battery */
|
||||||
|
onBattery: number;
|
||||||
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -33,6 +58,11 @@ export interface IOidSet {
|
|||||||
*/
|
*/
|
||||||
export type TUpsModel = 'cyberpower' | 'apc' | 'eaton' | 'tripplite' | 'liebert' | 'custom';
|
export type TUpsModel = 'cyberpower' | 'apc' | 'eaton' | 'tripplite' | 'liebert' | 'custom';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Runtime unit for battery runtime SNMP values
|
||||||
|
*/
|
||||||
|
export type TRuntimeUnit = 'minutes' | 'seconds' | 'ticks';
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* SNMP Configuration interface
|
* SNMP Configuration interface
|
||||||
*/
|
*/
|
||||||
@@ -46,6 +76,8 @@ export interface ISnmpConfig {
|
|||||||
/** Timeout in milliseconds */
|
/** Timeout in milliseconds */
|
||||||
timeout: number;
|
timeout: number;
|
||||||
|
|
||||||
|
context?: string;
|
||||||
|
|
||||||
// SNMPv1/v2c
|
// SNMPv1/v2c
|
||||||
/** Community string for SNMPv1/v2c */
|
/** Community string for SNMPv1/v2c */
|
||||||
community?: string;
|
community?: string;
|
||||||
@@ -69,6 +101,8 @@ export interface ISnmpConfig {
|
|||||||
upsModel?: TUpsModel;
|
upsModel?: TUpsModel;
|
||||||
/** Custom OIDs when using custom UPS model */
|
/** Custom OIDs when using custom UPS model */
|
||||||
customOIDs?: IOidSet;
|
customOIDs?: IOidSet;
|
||||||
|
/** Unit of the battery runtime SNMP value. Overrides model-based auto-detection when set. */
|
||||||
|
runtimeUnit?: TRuntimeUnit;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
+396
-74
@@ -1,6 +1,10 @@
|
|||||||
import { promises as fs } from 'fs';
|
import process from 'node:process';
|
||||||
import { execSync } from 'child_process';
|
import { promises as fs } from 'node:fs';
|
||||||
import { NupstDaemon } from './daemon.js';
|
import { execSync } from 'node:child_process';
|
||||||
|
import { type IUpsConfig, NupstDaemon } from './daemon.ts';
|
||||||
|
import { NupstSnmp } from './snmp/manager.ts';
|
||||||
|
import { logger } from './logger.ts';
|
||||||
|
import { formatPowerStatus, getBatteryColor, getRuntimeColor, symbols, theme } from './colors.ts';
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Class for managing systemd service
|
* Class for managing systemd service
|
||||||
@@ -13,17 +17,17 @@ export class NupstSystemd {
|
|||||||
|
|
||||||
/** Template for the systemd service file */
|
/** Template for the systemd service file */
|
||||||
private readonly serviceTemplate = `[Unit]
|
private readonly serviceTemplate = `[Unit]
|
||||||
Description=Node.js UPS Shutdown Tool
|
Description=NUPST - Deno-powered UPS Monitoring Tool
|
||||||
After=network.target
|
After=network.target
|
||||||
|
|
||||||
[Service]
|
[Service]
|
||||||
ExecStart=/opt/nupst/bin/nupst daemon-start
|
ExecStart=/usr/local/bin/nupst service start-daemon
|
||||||
Restart=always
|
Restart=always
|
||||||
|
RestartSec=10
|
||||||
User=root
|
User=root
|
||||||
Group=root
|
Group=root
|
||||||
Environment=PATH=/usr/bin:/usr/local/bin
|
Environment=PATH=/usr/bin:/usr/local/bin
|
||||||
Environment=NODE_ENV=production
|
WorkingDirectory=/opt/nupst
|
||||||
WorkingDirectory=/tmp
|
|
||||||
|
|
||||||
[Install]
|
[Install]
|
||||||
WantedBy=multi-user.target
|
WantedBy=multi-user.target
|
||||||
@@ -47,10 +51,15 @@ WantedBy=multi-user.target
|
|||||||
try {
|
try {
|
||||||
await fs.access(configPath);
|
await fs.access(configPath);
|
||||||
} catch (error) {
|
} catch (error) {
|
||||||
console.error('┌─ Configuration Error ─────────────────────┐');
|
logger.log('');
|
||||||
console.error(`│ No configuration file found at ${configPath}`);
|
logger.error('No configuration found');
|
||||||
console.error('│ Please run \'nupst setup\' first to create a configuration.');
|
logger.log(` ${theme.dim('Config file:')} ${configPath}`);
|
||||||
console.error('└──────────────────────────────────────────┘');
|
logger.log(
|
||||||
|
` ${theme.dim('Run')} ${theme.command('nupst ups add')} ${
|
||||||
|
theme.dim('to create a configuration')
|
||||||
|
}`,
|
||||||
|
);
|
||||||
|
logger.log('');
|
||||||
throw new Error('Configuration not found');
|
throw new Error('Configuration not found');
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -66,23 +75,24 @@ WantedBy=multi-user.target
|
|||||||
|
|
||||||
// Write the service file
|
// Write the service file
|
||||||
await fs.writeFile(this.serviceFilePath, this.serviceTemplate);
|
await fs.writeFile(this.serviceFilePath, this.serviceTemplate);
|
||||||
console.log('┌─ Service Installation ─────────────────────┐');
|
const boxWidth = 50;
|
||||||
console.log(`│ Service file created at ${this.serviceFilePath}`);
|
logger.logBoxTitle('Service Installation', boxWidth);
|
||||||
|
logger.logBoxLine(`Service file created at ${this.serviceFilePath}`);
|
||||||
|
|
||||||
// Reload systemd daemon
|
// Reload systemd daemon
|
||||||
execSync('systemctl daemon-reload');
|
execSync('systemctl daemon-reload');
|
||||||
console.log('│ Systemd daemon reloaded');
|
logger.logBoxLine('Systemd daemon reloaded');
|
||||||
|
|
||||||
// Enable the service
|
// Enable the service
|
||||||
execSync('systemctl enable nupst.service');
|
execSync('systemctl enable nupst.service');
|
||||||
console.log('│ Service enabled to start on boot');
|
logger.logBoxLine('Service enabled to start on boot');
|
||||||
console.log('└──────────────────────────────────────────┘');
|
logger.logBoxEnd();
|
||||||
} catch (error) {
|
} catch (error) {
|
||||||
if (error.message === 'Configuration not found') {
|
if (error instanceof Error && error.message === 'Configuration not found') {
|
||||||
// Just rethrow the error as the message has already been displayed
|
// Just rethrow the error as the message has already been displayed
|
||||||
throw error;
|
throw error;
|
||||||
}
|
}
|
||||||
console.error('Failed to install systemd service:', error);
|
logger.error(`Failed to install systemd service: ${error}`);
|
||||||
throw error;
|
throw error;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -97,15 +107,16 @@ WantedBy=multi-user.target
|
|||||||
await this.checkConfigExists();
|
await this.checkConfigExists();
|
||||||
|
|
||||||
execSync('systemctl start nupst.service');
|
execSync('systemctl start nupst.service');
|
||||||
console.log('┌─ Service Status ─────────────────────────┐');
|
const boxWidth = 45;
|
||||||
console.log('│ NUPST service started successfully');
|
logger.logBoxTitle('Service Status', boxWidth);
|
||||||
console.log('└──────────────────────────────────────────┘');
|
logger.logBoxLine('NUPST service started successfully');
|
||||||
|
logger.logBoxEnd();
|
||||||
} catch (error) {
|
} catch (error) {
|
||||||
if (error.message === 'Configuration not found') {
|
if (error instanceof Error && error.message === 'Configuration not found') {
|
||||||
// Exit with error code since configuration is required
|
// Exit with error code since configuration is required
|
||||||
process.exit(1);
|
process.exit(1);
|
||||||
}
|
}
|
||||||
console.error('Failed to start service:', error);
|
logger.error(`Failed to start service: ${error}`);
|
||||||
throw error;
|
throw error;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -114,12 +125,12 @@ WantedBy=multi-user.target
|
|||||||
* Stop the systemd service
|
* Stop the systemd service
|
||||||
* @throws Error if stop fails
|
* @throws Error if stop fails
|
||||||
*/
|
*/
|
||||||
public async stop(): Promise<void> {
|
public stop(): void {
|
||||||
try {
|
try {
|
||||||
execSync('systemctl stop nupst.service');
|
execSync('systemctl stop nupst.service');
|
||||||
console.log('NUPST service stopped');
|
logger.success('NUPST service stopped');
|
||||||
} catch (error) {
|
} catch (error) {
|
||||||
console.error('Failed to stop service:', error);
|
logger.error(`Failed to stop service: ${error}`);
|
||||||
throw error;
|
throw error;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -128,20 +139,70 @@ WantedBy=multi-user.target
|
|||||||
* Get status of the systemd service and UPS
|
* Get status of the systemd service and UPS
|
||||||
* @param debugMode Whether to enable debug mode for SNMP
|
* @param debugMode Whether to enable debug mode for SNMP
|
||||||
*/
|
*/
|
||||||
|
/**
|
||||||
|
* Display version information and update status
|
||||||
|
* @private
|
||||||
|
*/
|
||||||
|
private async displayVersionInfo(): Promise<void> {
|
||||||
|
try {
|
||||||
|
const nupst = this.daemon.getNupstSnmp().getNupst();
|
||||||
|
if (!nupst) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
const version = nupst.getVersion();
|
||||||
|
|
||||||
|
// Check for updates
|
||||||
|
const updateAvailable = await nupst.checkForUpdates();
|
||||||
|
|
||||||
|
// Display version info
|
||||||
|
if (updateAvailable) {
|
||||||
|
const updateStatus = nupst.getUpdateStatus();
|
||||||
|
logger.log('');
|
||||||
|
logger.log(
|
||||||
|
`${theme.dim('NUPST')} ${theme.dim('v' + version)} ${symbols.warning} ${
|
||||||
|
theme.statusWarning(`Update available: v${updateStatus.latestVersion}`)
|
||||||
|
}`,
|
||||||
|
);
|
||||||
|
logger.log(
|
||||||
|
` ${theme.dim('Run')} ${theme.command('sudo nupst upgrade')} ${theme.dim('to upgrade')}`,
|
||||||
|
);
|
||||||
|
} else {
|
||||||
|
logger.log('');
|
||||||
|
logger.log(
|
||||||
|
`${theme.dim('NUPST')} ${theme.dim('v' + version)} ${symbols.success} ${
|
||||||
|
theme.success('Up to date')
|
||||||
|
}`,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
} catch (error) {
|
||||||
|
// If version check fails, show at least the current version
|
||||||
|
try {
|
||||||
|
const nupst = this.daemon.getNupstSnmp().getNupst();
|
||||||
|
if (nupst) {
|
||||||
|
const version = nupst.getVersion();
|
||||||
|
logger.log('');
|
||||||
|
logger.log(`${theme.dim('NUPST')} ${theme.dim('v' + version)}`);
|
||||||
|
}
|
||||||
|
} catch (_innerError) {
|
||||||
|
// Silently fail if we can't even get the version
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
public async getStatus(debugMode: boolean = false): Promise<void> {
|
public async getStatus(debugMode: boolean = false): Promise<void> {
|
||||||
try {
|
try {
|
||||||
// Enable debug mode if requested
|
// Enable debug mode if requested
|
||||||
if (debugMode) {
|
if (debugMode) {
|
||||||
console.log('┌─ Debug Mode ─────────────────────────────┐');
|
console.log('');
|
||||||
console.log('│ SNMP debugging enabled - detailed logs will be shown');
|
logger.info('Debug Mode: SNMP debugging enabled');
|
||||||
console.log('└──────────────────────────────────────────┘');
|
console.log('');
|
||||||
this.daemon.getNupstSnmp().enableDebug();
|
this.daemon.getNupstSnmp().enableDebug();
|
||||||
}
|
}
|
||||||
|
|
||||||
// Display version information
|
// Display version and update status first
|
||||||
this.daemon.getNupstSnmp().getNupst().logVersionInfo();
|
await this.displayVersionInfo();
|
||||||
|
|
||||||
// Check if config exists first
|
// Check if config exists
|
||||||
try {
|
try {
|
||||||
await this.checkConfigExists();
|
await this.checkConfigExists();
|
||||||
} catch (error) {
|
} catch (error) {
|
||||||
@@ -150,9 +211,11 @@ WantedBy=multi-user.target
|
|||||||
}
|
}
|
||||||
|
|
||||||
await this.displayServiceStatus();
|
await this.displayServiceStatus();
|
||||||
await this.displayUpsStatus();
|
await this.displayAllUpsStatus();
|
||||||
} catch (error) {
|
} catch (error) {
|
||||||
console.error(`Failed to get status: ${error.message}`);
|
logger.error(
|
||||||
|
`Failed to get status: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -160,52 +223,311 @@ WantedBy=multi-user.target
|
|||||||
* Display the systemd service status
|
* Display the systemd service status
|
||||||
* @private
|
* @private
|
||||||
*/
|
*/
|
||||||
private async displayServiceStatus(): Promise<void> {
|
private displayServiceStatus(): void {
|
||||||
try {
|
try {
|
||||||
const serviceStatus = execSync('systemctl status nupst.service').toString();
|
const serviceStatus = execSync('systemctl status nupst.service').toString();
|
||||||
console.log('┌─ Service Status ─────────────────────────┐');
|
const lines = serviceStatus.split('\n');
|
||||||
console.log(serviceStatus.split('\n').map(line => `│ ${line}`).join('\n'));
|
|
||||||
console.log('└──────────────────────────────────────────┘');
|
// Parse key information from systemctl output
|
||||||
|
let isActive = false;
|
||||||
|
let pid = '';
|
||||||
|
let memory = '';
|
||||||
|
let cpu = '';
|
||||||
|
|
||||||
|
for (const line of lines) {
|
||||||
|
if (line.includes('Active:')) {
|
||||||
|
isActive = line.includes('active (running)');
|
||||||
|
} else if (line.includes('Main PID:')) {
|
||||||
|
const match = line.match(/Main PID:\s+(\d+)/);
|
||||||
|
if (match) pid = match[1];
|
||||||
|
} else if (line.includes('Memory:')) {
|
||||||
|
const match = line.match(/Memory:\s+([\d.]+[A-Z])/);
|
||||||
|
if (match) memory = match[1];
|
||||||
|
} else if (line.includes('CPU:')) {
|
||||||
|
const match = line.match(/CPU:\s+([\d.]+(?:ms|s))/);
|
||||||
|
if (match) cpu = match[1];
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Display beautiful status
|
||||||
|
logger.log('');
|
||||||
|
if (isActive) {
|
||||||
|
logger.log(
|
||||||
|
`${symbols.running} ${theme.success('Service:')} ${
|
||||||
|
theme.statusActive('active (running)')
|
||||||
|
}`,
|
||||||
|
);
|
||||||
|
} else {
|
||||||
|
logger.log(
|
||||||
|
`${symbols.stopped} ${theme.dim('Service:')} ${theme.statusInactive('inactive')}`,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
if (pid || memory || cpu) {
|
||||||
|
const details = [];
|
||||||
|
if (pid) details.push(`PID: ${theme.dim(pid)}`);
|
||||||
|
if (memory) details.push(`Memory: ${theme.dim(memory)}`);
|
||||||
|
if (cpu) details.push(`CPU: ${theme.dim(cpu)}`);
|
||||||
|
logger.log(` ${details.join(' ')}`);
|
||||||
|
}
|
||||||
|
logger.log('');
|
||||||
} catch (error) {
|
} catch (error) {
|
||||||
console.error('┌─ Service Status ─────────────────────────┐');
|
logger.log('');
|
||||||
console.error('│ Service is not running');
|
logger.log(
|
||||||
console.error('└──────────────────────────────────────────┘');
|
`${symbols.stopped} ${theme.dim('Service:')} ${theme.statusInactive('not installed')}`,
|
||||||
|
);
|
||||||
|
logger.log('');
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Display the UPS status
|
* Display all UPS statuses
|
||||||
* @private
|
* @private
|
||||||
*/
|
*/
|
||||||
private async displayUpsStatus(): Promise<void> {
|
private async displayAllUpsStatus(): Promise<void> {
|
||||||
try {
|
try {
|
||||||
// Explicitly load the configuration first to ensure it's up-to-date
|
// Explicitly load the configuration first to ensure it's up-to-date
|
||||||
await this.daemon.loadConfig();
|
await this.daemon.loadConfig();
|
||||||
const config = this.daemon.getConfig();
|
const config = this.daemon.getConfig();
|
||||||
const snmp = this.daemon.getNupstSnmp();
|
const snmp = this.daemon.getNupstSnmp();
|
||||||
|
|
||||||
// Create a test config with appropriate timeout, similar to the test command
|
// Check if we have the new multi-UPS config format
|
||||||
const snmpConfig = {
|
if (config.upsDevices && Array.isArray(config.upsDevices) && config.upsDevices.length > 0) {
|
||||||
...config.snmp,
|
logger.info(`UPS Devices (${config.upsDevices.length}):`);
|
||||||
timeout: Math.min(config.snmp.timeout, 10000) // Use at most 10 seconds for status check
|
|
||||||
|
// Show status for each UPS
|
||||||
|
for (const ups of config.upsDevices) {
|
||||||
|
await this.displaySingleUpsStatus(ups, snmp);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Display groups after UPS devices
|
||||||
|
this.displayGroupsStatus();
|
||||||
|
} else if (config.snmp) {
|
||||||
|
// Legacy single UPS configuration (v1/v2 format)
|
||||||
|
logger.info('UPS Devices (1):');
|
||||||
|
const legacyUps: IUpsConfig = {
|
||||||
|
id: 'default',
|
||||||
|
name: 'Default UPS',
|
||||||
|
snmp: config.snmp,
|
||||||
|
groups: [],
|
||||||
|
actions: config.thresholds
|
||||||
|
? [
|
||||||
|
{
|
||||||
|
type: 'shutdown',
|
||||||
|
thresholds: config.thresholds,
|
||||||
|
triggerMode: 'onlyThresholds',
|
||||||
|
shutdownDelay: 5,
|
||||||
|
},
|
||||||
|
]
|
||||||
|
: [],
|
||||||
};
|
};
|
||||||
|
|
||||||
console.log('┌─ Connecting to UPS... ────────────────────┐');
|
await this.displaySingleUpsStatus(legacyUps, snmp);
|
||||||
console.log(`│ Host: ${config.snmp.host}:${config.snmp.port}`);
|
} else {
|
||||||
console.log(`│ UPS Model: ${config.snmp.upsModel || 'cyberpower'}`);
|
logger.log('');
|
||||||
console.log('└──────────────────────────────────────────┘');
|
logger.warn('No UPS devices configured');
|
||||||
|
logger.log(
|
||||||
const status = await snmp.getUpsStatus(snmpConfig);
|
` ${theme.dim('Run')} ${theme.command('nupst ups add')} ${theme.dim('to add a device')}`,
|
||||||
|
);
|
||||||
console.log('┌─ UPS Status ───────────────────────────────┐');
|
logger.log('');
|
||||||
console.log(`│ Power Status: ${status.powerStatus}`);
|
}
|
||||||
console.log(`│ Battery Capacity: ${status.batteryCapacity}%`);
|
|
||||||
console.log(`│ Runtime Remaining: ${status.batteryRuntime} minutes`);
|
|
||||||
console.log('└──────────────────────────────────────────┘');
|
|
||||||
} catch (error) {
|
} catch (error) {
|
||||||
console.error('┌─ UPS Status ───────────────────────────────┐');
|
logger.log('');
|
||||||
console.error(`│ Failed to retrieve UPS status: ${error.message}`);
|
logger.error('Failed to retrieve UPS status');
|
||||||
console.error('└──────────────────────────────────────────┘');
|
logger.log(` ${theme.dim(error instanceof Error ? error.message : String(error))}`);
|
||||||
|
logger.log('');
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Display status of a single UPS
|
||||||
|
* @param ups UPS configuration
|
||||||
|
* @param snmp SNMP manager
|
||||||
|
*/
|
||||||
|
private async displaySingleUpsStatus(ups: IUpsConfig, snmp: NupstSnmp): Promise<void> {
|
||||||
|
try {
|
||||||
|
const protocol = ups.protocol || 'snmp';
|
||||||
|
let status;
|
||||||
|
|
||||||
|
if (protocol === 'upsd' && ups.upsd) {
|
||||||
|
const testConfig = {
|
||||||
|
...ups.upsd,
|
||||||
|
timeout: Math.min(ups.upsd.timeout, 10000),
|
||||||
|
};
|
||||||
|
status = await this.daemon.getNupstUpsd().getUpsStatus(testConfig);
|
||||||
|
} else if (ups.snmp) {
|
||||||
|
const testConfig = {
|
||||||
|
...ups.snmp,
|
||||||
|
timeout: Math.min(ups.snmp.timeout, 10000),
|
||||||
|
};
|
||||||
|
status = await snmp.getUpsStatus(testConfig);
|
||||||
|
} else {
|
||||||
|
throw new Error('No protocol configuration found');
|
||||||
|
}
|
||||||
|
|
||||||
|
// Determine status symbol based on power status
|
||||||
|
let statusSymbol = symbols.unknown;
|
||||||
|
if (status.powerStatus === 'online') {
|
||||||
|
statusSymbol = symbols.running;
|
||||||
|
} else if (status.powerStatus === 'onBattery') {
|
||||||
|
statusSymbol = symbols.warning;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Display UPS name and power status
|
||||||
|
logger.log(
|
||||||
|
` ${statusSymbol} ${theme.highlight(ups.name)} - ${formatPowerStatus(status.powerStatus)}`,
|
||||||
|
);
|
||||||
|
|
||||||
|
// Display battery with color coding
|
||||||
|
const batteryColor = getBatteryColor(status.batteryCapacity);
|
||||||
|
|
||||||
|
// Get threshold from actions (if any action has thresholds defined)
|
||||||
|
const actionWithThresholds = ups.actions?.find((action) => action.thresholds);
|
||||||
|
const batteryThreshold = actionWithThresholds?.thresholds?.battery;
|
||||||
|
const batterySymbol =
|
||||||
|
batteryThreshold !== undefined && status.batteryCapacity >= batteryThreshold
|
||||||
|
? symbols.success
|
||||||
|
: batteryThreshold !== undefined
|
||||||
|
? symbols.warning
|
||||||
|
: '';
|
||||||
|
|
||||||
|
logger.log(
|
||||||
|
` Battery: ${batteryColor(status.batteryCapacity + '%')} ${batterySymbol} Runtime: ${
|
||||||
|
getRuntimeColor(status.batteryRuntime)(status.batteryRuntime + ' min')
|
||||||
|
}`,
|
||||||
|
);
|
||||||
|
|
||||||
|
// Display power metrics
|
||||||
|
logger.log(
|
||||||
|
` Load: ${theme.highlight(status.outputLoad + '%')} Power: ${
|
||||||
|
theme.highlight(status.outputPower + 'W')
|
||||||
|
} Voltage: ${theme.highlight(status.outputVoltage + 'V')} Current: ${
|
||||||
|
theme.highlight(status.outputCurrent + 'A')
|
||||||
|
}`,
|
||||||
|
);
|
||||||
|
|
||||||
|
// Display host info
|
||||||
|
const hostInfo = protocol === 'upsd' && ups.upsd
|
||||||
|
? `${ups.upsd.host}:${ups.upsd.port} (UPSD)`
|
||||||
|
: ups.snmp
|
||||||
|
? `${ups.snmp.host}:${ups.snmp.port} (SNMP)`
|
||||||
|
: 'N/A';
|
||||||
|
logger.log(` ${theme.dim(`Host: ${hostInfo}`)}`);
|
||||||
|
|
||||||
|
// Display groups if any
|
||||||
|
if (ups.groups && ups.groups.length > 0) {
|
||||||
|
const config = this.daemon.getConfig();
|
||||||
|
const groupNames = ups.groups.map((groupId: string) => {
|
||||||
|
const group = config.groups?.find((g: { id: string }) => g.id === groupId);
|
||||||
|
return group ? group.name : groupId;
|
||||||
|
});
|
||||||
|
logger.log(` ${theme.dim(`Groups: ${groupNames.join(', ')}`)}`);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Display actions if any
|
||||||
|
if (ups.actions && ups.actions.length > 0) {
|
||||||
|
for (const action of ups.actions) {
|
||||||
|
let actionDesc = `${action.type}`;
|
||||||
|
if (action.thresholds) {
|
||||||
|
actionDesc += ` (${
|
||||||
|
action.triggerMode || 'onlyThresholds'
|
||||||
|
}: battery<${action.thresholds.battery}%, runtime<${action.thresholds.runtime}min`;
|
||||||
|
if (action.shutdownDelay) {
|
||||||
|
actionDesc += `, delay=${action.shutdownDelay}s`;
|
||||||
|
}
|
||||||
|
actionDesc += ')';
|
||||||
|
} else {
|
||||||
|
actionDesc += ` (${action.triggerMode || 'onlyPowerChanges'}`;
|
||||||
|
if (action.shutdownDelay) {
|
||||||
|
actionDesc += `, delay=${action.shutdownDelay}s`;
|
||||||
|
}
|
||||||
|
actionDesc += ')';
|
||||||
|
}
|
||||||
|
logger.log(` ${theme.dim('Action:')} ${theme.info(actionDesc)}`);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
logger.log('');
|
||||||
|
} catch (error) {
|
||||||
|
// Display error for this UPS
|
||||||
|
const errorHostInfo = (ups.protocol || 'snmp') === 'upsd' && ups.upsd
|
||||||
|
? `${ups.upsd.host}:${ups.upsd.port} (UPSD)`
|
||||||
|
: ups.snmp
|
||||||
|
? `${ups.snmp.host}:${ups.snmp.port} (SNMP)`
|
||||||
|
: 'N/A';
|
||||||
|
logger.log(
|
||||||
|
` ${symbols.error} ${theme.highlight(ups.name)} - ${theme.error('Connection failed')}`,
|
||||||
|
);
|
||||||
|
logger.log(` ${theme.dim(error instanceof Error ? error.message : String(error))}`);
|
||||||
|
logger.log(` ${theme.dim(`Host: ${errorHostInfo}`)}`);
|
||||||
|
logger.log('');
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Display status of all groups
|
||||||
|
* @private
|
||||||
|
*/
|
||||||
|
private displayGroupsStatus(): void {
|
||||||
|
const config = this.daemon.getConfig();
|
||||||
|
|
||||||
|
if (!config.groups || config.groups.length === 0) {
|
||||||
|
return; // No groups to display
|
||||||
|
}
|
||||||
|
|
||||||
|
logger.log('');
|
||||||
|
logger.info(`Groups (${config.groups.length}):`);
|
||||||
|
|
||||||
|
for (const group of config.groups) {
|
||||||
|
// Display group name and mode
|
||||||
|
const modeColor = group.mode === 'redundant' ? theme.success : theme.warning;
|
||||||
|
logger.log(
|
||||||
|
` ${symbols.info} ${theme.highlight(group.name)} ${
|
||||||
|
theme.dim(`(${modeColor(group.mode)})`)
|
||||||
|
}`,
|
||||||
|
);
|
||||||
|
|
||||||
|
// Display description if present
|
||||||
|
if (group.description) {
|
||||||
|
logger.log(` ${theme.dim(group.description)}`);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Display UPS devices in this group
|
||||||
|
const upsInGroup = config.upsDevices.filter((ups) =>
|
||||||
|
ups.groups && ups.groups.includes(group.id)
|
||||||
|
);
|
||||||
|
|
||||||
|
if (upsInGroup.length > 0) {
|
||||||
|
const upsNames = upsInGroup.map((ups) => ups.name).join(', ');
|
||||||
|
logger.log(` ${theme.dim(`UPS Devices (${upsInGroup.length}):`)} ${upsNames}`);
|
||||||
|
} else {
|
||||||
|
logger.log(` ${theme.dim('UPS Devices: None')}`);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Display actions if any
|
||||||
|
if (group.actions && group.actions.length > 0) {
|
||||||
|
for (const action of group.actions) {
|
||||||
|
let actionDesc = `${action.type}`;
|
||||||
|
if (action.thresholds) {
|
||||||
|
actionDesc += ` (${
|
||||||
|
action.triggerMode || 'onlyThresholds'
|
||||||
|
}: battery<${action.thresholds.battery}%, runtime<${action.thresholds.runtime}min`;
|
||||||
|
if (action.shutdownDelay) {
|
||||||
|
actionDesc += `, delay=${action.shutdownDelay}s`;
|
||||||
|
}
|
||||||
|
actionDesc += ')';
|
||||||
|
} else {
|
||||||
|
actionDesc += ` (${action.triggerMode || 'onlyPowerChanges'}`;
|
||||||
|
if (action.shutdownDelay) {
|
||||||
|
actionDesc += `, delay=${action.shutdownDelay}s`;
|
||||||
|
}
|
||||||
|
actionDesc += ')';
|
||||||
|
}
|
||||||
|
logger.log(` ${theme.dim('Action:')} ${theme.info(actionDesc)}`);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
logger.log('');
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -221,10 +543,10 @@ WantedBy=multi-user.target
|
|||||||
|
|
||||||
// Reload systemd daemon
|
// Reload systemd daemon
|
||||||
execSync('systemctl daemon-reload');
|
execSync('systemctl daemon-reload');
|
||||||
console.log('Systemd daemon reloaded');
|
logger.log('Systemd daemon reloaded');
|
||||||
console.log('NUPST service has been successfully uninstalled');
|
logger.success('NUPST service has been successfully uninstalled');
|
||||||
} catch (error) {
|
} catch (error) {
|
||||||
console.error('Failed to disable and uninstall service:', error);
|
logger.error(`Failed to disable and uninstall service: ${error}`);
|
||||||
throw error;
|
throw error;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -233,13 +555,13 @@ WantedBy=multi-user.target
|
|||||||
* Stop the service if it's running
|
* Stop the service if it's running
|
||||||
* @private
|
* @private
|
||||||
*/
|
*/
|
||||||
private async stopService(): Promise<void> {
|
private stopService(): void {
|
||||||
try {
|
try {
|
||||||
console.log('Stopping NUPST service...');
|
logger.log('Stopping NUPST service...');
|
||||||
execSync('systemctl stop nupst.service');
|
execSync('systemctl stop nupst.service');
|
||||||
} catch (error) {
|
} catch (error) {
|
||||||
// Service might not be running, that's okay
|
// Service might not be running, that's okay
|
||||||
console.log('Service was not running or could not be stopped');
|
logger.log('Service was not running or could not be stopped');
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -247,12 +569,12 @@ WantedBy=multi-user.target
|
|||||||
* Disable the service
|
* Disable the service
|
||||||
* @private
|
* @private
|
||||||
*/
|
*/
|
||||||
private async disableService(): Promise<void> {
|
private disableService(): void {
|
||||||
try {
|
try {
|
||||||
console.log('Disabling NUPST service...');
|
logger.log('Disabling NUPST service...');
|
||||||
execSync('systemctl disable nupst.service');
|
execSync('systemctl disable nupst.service');
|
||||||
} catch (error) {
|
} catch (error) {
|
||||||
console.log('Service was not enabled or could not be disabled');
|
logger.log('Service was not enabled or could not be disabled');
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -262,11 +584,11 @@ WantedBy=multi-user.target
|
|||||||
*/
|
*/
|
||||||
private async removeServiceFile(): Promise<void> {
|
private async removeServiceFile(): Promise<void> {
|
||||||
if (await fs.stat(this.serviceFilePath).catch(() => null)) {
|
if (await fs.stat(this.serviceFilePath).catch(() => null)) {
|
||||||
console.log(`Removing service file ${this.serviceFilePath}...`);
|
logger.log(`Removing service file ${this.serviceFilePath}...`);
|
||||||
await fs.unlink(this.serviceFilePath);
|
await fs.unlink(this.serviceFilePath);
|
||||||
console.log('Service file removed');
|
logger.log('Service file removed');
|
||||||
} else {
|
} else {
|
||||||
console.log('Service file did not exist');
|
logger.log('Service file did not exist');
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -0,0 +1,138 @@
|
|||||||
|
import type { IActionConfig } from './actions/base-action.ts';
|
||||||
|
import { NETWORK } from './constants.ts';
|
||||||
|
import type { IUpsStatus as IProtocolUpsStatus } from './snmp/types.ts';
|
||||||
|
import { createInitialUpsStatus, type IUpsIdentity, type IUpsStatus } from './ups-status.ts';
|
||||||
|
|
||||||
|
export interface ISuccessfulUpsPollSnapshot {
|
||||||
|
updatedStatus: IUpsStatus;
|
||||||
|
transition: 'none' | 'recovered' | 'powerStatusChange';
|
||||||
|
previousStatus?: IUpsStatus;
|
||||||
|
downtimeSeconds?: number;
|
||||||
|
}
|
||||||
|
|
||||||
|
export interface IFailedUpsPollSnapshot {
|
||||||
|
updatedStatus: IUpsStatus;
|
||||||
|
transition: 'none' | 'unreachable';
|
||||||
|
failures: number;
|
||||||
|
previousStatus?: IUpsStatus;
|
||||||
|
}
|
||||||
|
|
||||||
|
export function ensureUpsStatus(
|
||||||
|
currentStatus: IUpsStatus | undefined,
|
||||||
|
ups: IUpsIdentity,
|
||||||
|
now: number = Date.now(),
|
||||||
|
): IUpsStatus {
|
||||||
|
return currentStatus || createInitialUpsStatus(ups, now);
|
||||||
|
}
|
||||||
|
|
||||||
|
export function buildSuccessfulUpsPollSnapshot(
|
||||||
|
ups: IUpsIdentity,
|
||||||
|
polledStatus: IProtocolUpsStatus,
|
||||||
|
currentStatus: IUpsStatus | undefined,
|
||||||
|
currentTime: number,
|
||||||
|
): ISuccessfulUpsPollSnapshot {
|
||||||
|
const previousStatus = ensureUpsStatus(currentStatus, ups, currentTime);
|
||||||
|
const updatedStatus: IUpsStatus = {
|
||||||
|
id: ups.id,
|
||||||
|
name: ups.name,
|
||||||
|
powerStatus: polledStatus.powerStatus,
|
||||||
|
batteryCapacity: polledStatus.batteryCapacity,
|
||||||
|
batteryRuntime: polledStatus.batteryRuntime,
|
||||||
|
outputLoad: polledStatus.outputLoad,
|
||||||
|
outputPower: polledStatus.outputPower,
|
||||||
|
outputVoltage: polledStatus.outputVoltage,
|
||||||
|
outputCurrent: polledStatus.outputCurrent,
|
||||||
|
lastCheckTime: currentTime,
|
||||||
|
lastStatusChange: previousStatus.lastStatusChange || currentTime,
|
||||||
|
consecutiveFailures: 0,
|
||||||
|
unreachableSince: 0,
|
||||||
|
};
|
||||||
|
|
||||||
|
if (previousStatus.powerStatus === 'unreachable') {
|
||||||
|
updatedStatus.lastStatusChange = currentTime;
|
||||||
|
return {
|
||||||
|
updatedStatus,
|
||||||
|
transition: 'recovered',
|
||||||
|
previousStatus,
|
||||||
|
downtimeSeconds: Math.round((currentTime - previousStatus.unreachableSince) / 1000),
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
if (previousStatus.powerStatus !== polledStatus.powerStatus) {
|
||||||
|
updatedStatus.lastStatusChange = currentTime;
|
||||||
|
return {
|
||||||
|
updatedStatus,
|
||||||
|
transition: 'powerStatusChange',
|
||||||
|
previousStatus,
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
return {
|
||||||
|
updatedStatus,
|
||||||
|
transition: 'none',
|
||||||
|
previousStatus: currentStatus,
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
export function buildFailedUpsPollSnapshot(
|
||||||
|
ups: IUpsIdentity,
|
||||||
|
currentStatus: IUpsStatus | undefined,
|
||||||
|
currentTime: number,
|
||||||
|
): IFailedUpsPollSnapshot {
|
||||||
|
const previousStatus = ensureUpsStatus(currentStatus, ups, currentTime);
|
||||||
|
const failures = Math.min(
|
||||||
|
previousStatus.consecutiveFailures + 1,
|
||||||
|
NETWORK.MAX_CONSECUTIVE_FAILURES,
|
||||||
|
);
|
||||||
|
|
||||||
|
if (
|
||||||
|
failures >= NETWORK.CONSECUTIVE_FAILURE_THRESHOLD &&
|
||||||
|
previousStatus.powerStatus !== 'unreachable'
|
||||||
|
) {
|
||||||
|
return {
|
||||||
|
updatedStatus: {
|
||||||
|
...previousStatus,
|
||||||
|
consecutiveFailures: failures,
|
||||||
|
powerStatus: 'unreachable',
|
||||||
|
unreachableSince: currentTime,
|
||||||
|
lastStatusChange: currentTime,
|
||||||
|
},
|
||||||
|
transition: 'unreachable',
|
||||||
|
failures,
|
||||||
|
previousStatus,
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
return {
|
||||||
|
updatedStatus: {
|
||||||
|
...previousStatus,
|
||||||
|
consecutiveFailures: failures,
|
||||||
|
},
|
||||||
|
transition: 'none',
|
||||||
|
failures,
|
||||||
|
previousStatus: currentStatus,
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
export function hasThresholdViolation(
|
||||||
|
powerStatus: IProtocolUpsStatus['powerStatus'],
|
||||||
|
batteryCapacity: number,
|
||||||
|
batteryRuntime: number,
|
||||||
|
actions: IActionConfig[] | undefined,
|
||||||
|
): boolean {
|
||||||
|
if (powerStatus !== 'onBattery' || !actions || actions.length === 0) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
for (const actionConfig of actions) {
|
||||||
|
if (
|
||||||
|
actionConfig.thresholds &&
|
||||||
|
(batteryCapacity < actionConfig.thresholds.battery ||
|
||||||
|
batteryRuntime < actionConfig.thresholds.runtime)
|
||||||
|
) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return false;
|
||||||
|
}
|
||||||
@@ -0,0 +1,38 @@
|
|||||||
|
export interface IUpsIdentity {
|
||||||
|
id: string;
|
||||||
|
name: string;
|
||||||
|
}
|
||||||
|
|
||||||
|
export interface IUpsStatus {
|
||||||
|
id: string;
|
||||||
|
name: string;
|
||||||
|
powerStatus: 'online' | 'onBattery' | 'unknown' | 'unreachable';
|
||||||
|
batteryCapacity: number;
|
||||||
|
batteryRuntime: number;
|
||||||
|
outputLoad: number;
|
||||||
|
outputPower: number;
|
||||||
|
outputVoltage: number;
|
||||||
|
outputCurrent: number;
|
||||||
|
lastStatusChange: number;
|
||||||
|
lastCheckTime: number;
|
||||||
|
consecutiveFailures: number;
|
||||||
|
unreachableSince: number;
|
||||||
|
}
|
||||||
|
|
||||||
|
export function createInitialUpsStatus(ups: IUpsIdentity, now: number = Date.now()): IUpsStatus {
|
||||||
|
return {
|
||||||
|
id: ups.id,
|
||||||
|
name: ups.name,
|
||||||
|
powerStatus: 'unknown',
|
||||||
|
batteryCapacity: 100,
|
||||||
|
batteryRuntime: 999,
|
||||||
|
outputLoad: 0,
|
||||||
|
outputPower: 0,
|
||||||
|
outputVoltage: 0,
|
||||||
|
outputCurrent: 0,
|
||||||
|
lastStatusChange: now,
|
||||||
|
lastCheckTime: 0,
|
||||||
|
consecutiveFailures: 0,
|
||||||
|
unreachableSince: 0,
|
||||||
|
};
|
||||||
|
}
|
||||||
@@ -0,0 +1,269 @@
|
|||||||
|
/**
|
||||||
|
* UPSD/NIS (Network UPS Tools) TCP client
|
||||||
|
*
|
||||||
|
* Connects to a NUT upsd server via TCP and queries UPS variables
|
||||||
|
* using the NUT network protocol (RFC-style line protocol).
|
||||||
|
*
|
||||||
|
* Protocol format:
|
||||||
|
* Request: GET VAR <upsname> <varname>\n
|
||||||
|
* Response: VAR <upsname> <varname> "<value>"\n
|
||||||
|
* Logout: LOGOUT\n
|
||||||
|
*/
|
||||||
|
|
||||||
|
import * as net from 'node:net';
|
||||||
|
import { logger } from '../logger.ts';
|
||||||
|
import { UPSD } from '../constants.ts';
|
||||||
|
import type { IUpsdConfig } from './types.ts';
|
||||||
|
import type { IUpsStatus } from '../snmp/types.ts';
|
||||||
|
|
||||||
|
/**
|
||||||
|
* NupstUpsd - TCP client for the NUT UPSD protocol
|
||||||
|
*/
|
||||||
|
export class NupstUpsd {
|
||||||
|
private debug = false;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enable debug logging
|
||||||
|
*/
|
||||||
|
public enableDebug(): void {
|
||||||
|
this.debug = true;
|
||||||
|
logger.info('UPSD debug mode enabled');
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the current UPS status via UPSD protocol
|
||||||
|
* @param config UPSD connection configuration
|
||||||
|
* @returns UPS status matching the IUpsStatus interface
|
||||||
|
*/
|
||||||
|
public async getUpsStatus(config: IUpsdConfig): Promise<IUpsStatus> {
|
||||||
|
const host = config.host || '127.0.0.1';
|
||||||
|
const port = config.port || UPSD.DEFAULT_PORT;
|
||||||
|
const upsName = config.upsName || UPSD.DEFAULT_UPS_NAME;
|
||||||
|
const timeout = config.timeout || UPSD.DEFAULT_TIMEOUT_MS;
|
||||||
|
|
||||||
|
if (this.debug) {
|
||||||
|
logger.dim('---------------------------------------');
|
||||||
|
logger.dim('Getting UPS status via UPSD protocol:');
|
||||||
|
logger.dim(` Host: ${host}:${port}`);
|
||||||
|
logger.dim(` UPS Name: ${upsName}`);
|
||||||
|
logger.dim(` Timeout: ${timeout}ms`);
|
||||||
|
logger.dim('---------------------------------------');
|
||||||
|
}
|
||||||
|
|
||||||
|
// Variables to query from NUT
|
||||||
|
const varsToQuery = [
|
||||||
|
'ups.status',
|
||||||
|
'battery.charge',
|
||||||
|
'battery.runtime',
|
||||||
|
'ups.load',
|
||||||
|
'ups.realpower',
|
||||||
|
'output.voltage',
|
||||||
|
'output.current',
|
||||||
|
];
|
||||||
|
|
||||||
|
const values = new Map<string, string>();
|
||||||
|
|
||||||
|
// Open a TCP connection, query all variables, then logout
|
||||||
|
const conn = await this.connect(host, port, timeout);
|
||||||
|
|
||||||
|
try {
|
||||||
|
// Authenticate if credentials provided
|
||||||
|
if (config.username && config.password) {
|
||||||
|
await this.sendCommand(conn, `USERNAME ${config.username}`, timeout);
|
||||||
|
await this.sendCommand(conn, `PASSWORD ${config.password}`, timeout);
|
||||||
|
}
|
||||||
|
|
||||||
|
// Query each variable
|
||||||
|
for (const varName of varsToQuery) {
|
||||||
|
const value = await this.safeGetVar(conn, upsName, varName, timeout);
|
||||||
|
if (value !== null) {
|
||||||
|
values.set(varName, value);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Logout gracefully
|
||||||
|
try {
|
||||||
|
await this.sendCommand(conn, 'LOGOUT', timeout);
|
||||||
|
} catch (_e) {
|
||||||
|
// Ignore logout errors
|
||||||
|
}
|
||||||
|
} finally {
|
||||||
|
conn.destroy();
|
||||||
|
}
|
||||||
|
|
||||||
|
// Map NUT variables to IUpsStatus
|
||||||
|
const powerStatus = this.parsePowerStatus(values.get('ups.status') || '');
|
||||||
|
const batteryCapacity = parseFloat(values.get('battery.charge') || '0');
|
||||||
|
const batteryRuntimeSeconds = parseFloat(values.get('battery.runtime') || '0');
|
||||||
|
const batteryRuntime = Math.floor(batteryRuntimeSeconds / 60); // NUT reports seconds, convert to minutes
|
||||||
|
const outputLoad = parseFloat(values.get('ups.load') || '0');
|
||||||
|
const outputPower = parseFloat(values.get('ups.realpower') || '0');
|
||||||
|
const outputVoltage = parseFloat(values.get('output.voltage') || '0');
|
||||||
|
const outputCurrent = parseFloat(values.get('output.current') || '0');
|
||||||
|
|
||||||
|
const result: IUpsStatus = {
|
||||||
|
powerStatus,
|
||||||
|
batteryCapacity: isNaN(batteryCapacity) ? 0 : batteryCapacity,
|
||||||
|
batteryRuntime: isNaN(batteryRuntime) ? 0 : batteryRuntime,
|
||||||
|
outputLoad: isNaN(outputLoad) ? 0 : outputLoad,
|
||||||
|
outputPower: isNaN(outputPower) ? 0 : outputPower,
|
||||||
|
outputVoltage: isNaN(outputVoltage) ? 0 : outputVoltage,
|
||||||
|
outputCurrent: isNaN(outputCurrent) ? 0 : outputCurrent,
|
||||||
|
raw: Object.fromEntries(values),
|
||||||
|
};
|
||||||
|
|
||||||
|
if (this.debug) {
|
||||||
|
logger.dim('---------------------------------------');
|
||||||
|
logger.dim('UPSD status result:');
|
||||||
|
logger.dim(` Power Status: ${result.powerStatus}`);
|
||||||
|
logger.dim(` Battery Capacity: ${result.batteryCapacity}%`);
|
||||||
|
logger.dim(` Battery Runtime: ${result.batteryRuntime} minutes`);
|
||||||
|
logger.dim(` Output Load: ${result.outputLoad}%`);
|
||||||
|
logger.dim(` Output Power: ${result.outputPower} watts`);
|
||||||
|
logger.dim(` Output Voltage: ${result.outputVoltage} volts`);
|
||||||
|
logger.dim(` Output Current: ${result.outputCurrent} amps`);
|
||||||
|
logger.dim('---------------------------------------');
|
||||||
|
}
|
||||||
|
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Open a TCP connection to the UPSD server
|
||||||
|
*/
|
||||||
|
private connect(host: string, port: number, timeout: number): Promise<net.Socket> {
|
||||||
|
return new Promise((resolve, reject) => {
|
||||||
|
const socket = net.createConnection({ host, port }, () => {
|
||||||
|
if (this.debug) {
|
||||||
|
logger.dim(`Connected to UPSD at ${host}:${port}`);
|
||||||
|
}
|
||||||
|
resolve(socket);
|
||||||
|
});
|
||||||
|
|
||||||
|
socket.setTimeout(timeout);
|
||||||
|
socket.on('timeout', () => {
|
||||||
|
socket.destroy();
|
||||||
|
reject(new Error(`UPSD connection timed out after ${timeout}ms`));
|
||||||
|
});
|
||||||
|
socket.on('error', (err) => {
|
||||||
|
reject(new Error(`UPSD connection error: ${err.message}`));
|
||||||
|
});
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Send a command and read the response line
|
||||||
|
*/
|
||||||
|
private sendCommand(socket: net.Socket, command: string, timeout: number): Promise<string> {
|
||||||
|
return new Promise((resolve, reject) => {
|
||||||
|
let responseData = '';
|
||||||
|
const timer = setTimeout(() => {
|
||||||
|
cleanup();
|
||||||
|
reject(new Error(`UPSD command timed out: ${command}`));
|
||||||
|
}, timeout);
|
||||||
|
|
||||||
|
const decoder = new TextDecoder();
|
||||||
|
const onData = (data: Uint8Array) => {
|
||||||
|
responseData += decoder.decode(data, { stream: true });
|
||||||
|
// Look for newline to indicate end of response
|
||||||
|
const newlineIdx = responseData.indexOf('\n');
|
||||||
|
if (newlineIdx !== -1) {
|
||||||
|
cleanup();
|
||||||
|
const line = responseData.substring(0, newlineIdx).trim();
|
||||||
|
if (this.debug) {
|
||||||
|
logger.dim(`UPSD << ${line}`);
|
||||||
|
}
|
||||||
|
resolve(line);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
const onError = (err: Error) => {
|
||||||
|
cleanup();
|
||||||
|
reject(err);
|
||||||
|
};
|
||||||
|
|
||||||
|
const cleanup = () => {
|
||||||
|
clearTimeout(timer);
|
||||||
|
socket.removeListener('data', onData);
|
||||||
|
socket.removeListener('error', onError);
|
||||||
|
};
|
||||||
|
|
||||||
|
socket.on('data', onData);
|
||||||
|
socket.on('error', onError);
|
||||||
|
|
||||||
|
if (this.debug) {
|
||||||
|
logger.dim(`UPSD >> ${command}`);
|
||||||
|
}
|
||||||
|
socket.write(command + '\n');
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Safely get a single NUT variable, returning null on error
|
||||||
|
*/
|
||||||
|
private async safeGetVar(
|
||||||
|
socket: net.Socket,
|
||||||
|
upsName: string,
|
||||||
|
varName: string,
|
||||||
|
timeout: number,
|
||||||
|
): Promise<string | null> {
|
||||||
|
try {
|
||||||
|
const response = await this.sendCommand(
|
||||||
|
socket,
|
||||||
|
`GET VAR ${upsName} ${varName}`,
|
||||||
|
timeout,
|
||||||
|
);
|
||||||
|
|
||||||
|
// Expected response: VAR <upsname> <varname> "<value>"
|
||||||
|
// Also handle: ERR ... for unsupported variables
|
||||||
|
if (response.startsWith('ERR')) {
|
||||||
|
if (this.debug) {
|
||||||
|
logger.dim(`UPSD variable ${varName} not available: ${response}`);
|
||||||
|
}
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
|
||||||
|
// Parse: VAR ups battery.charge "100"
|
||||||
|
const match = response.match(/^VAR\s+\S+\s+\S+\s+"(.*)"/);
|
||||||
|
if (match) {
|
||||||
|
return match[1];
|
||||||
|
}
|
||||||
|
|
||||||
|
// Some implementations don't quote the value
|
||||||
|
const parts = response.split(/\s+/);
|
||||||
|
if (parts.length >= 4 && parts[0] === 'VAR') {
|
||||||
|
return parts.slice(3).join(' ').replace(/^"/, '').replace(/"$/, '');
|
||||||
|
}
|
||||||
|
|
||||||
|
if (this.debug) {
|
||||||
|
logger.dim(`UPSD unexpected response for ${varName}: ${response}`);
|
||||||
|
}
|
||||||
|
return null;
|
||||||
|
} catch (error) {
|
||||||
|
if (this.debug) {
|
||||||
|
logger.dim(
|
||||||
|
`UPSD error getting ${varName}: ${error instanceof Error ? error.message : String(error)}`,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Parse NUT ups.status tokens into a power status
|
||||||
|
* NUT status tokens: OL (online), OB (on battery), LB (low battery),
|
||||||
|
* HB (high battery), RB (replace battery), CHRG (charging), etc.
|
||||||
|
*/
|
||||||
|
private parsePowerStatus(statusString: string): 'online' | 'onBattery' | 'unknown' {
|
||||||
|
const tokens = statusString.trim().split(/\s+/);
|
||||||
|
|
||||||
|
if (tokens.includes('OB')) {
|
||||||
|
return 'onBattery';
|
||||||
|
}
|
||||||
|
if (tokens.includes('OL')) {
|
||||||
|
return 'online';
|
||||||
|
}
|
||||||
|
|
||||||
|
return 'unknown';
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,7 @@
|
|||||||
|
/**
|
||||||
|
* UPSD/NIS protocol module
|
||||||
|
* Re-exports public types and classes
|
||||||
|
*/
|
||||||
|
|
||||||
|
export type { IUpsdConfig } from './types.ts';
|
||||||
|
export { NupstUpsd } from './client.ts';
|
||||||
@@ -0,0 +1,21 @@
|
|||||||
|
/**
|
||||||
|
* Type definitions for UPSD/NIS (Network UPS Tools) protocol module
|
||||||
|
*/
|
||||||
|
|
||||||
|
/**
|
||||||
|
* UPSD connection configuration
|
||||||
|
*/
|
||||||
|
export interface IUpsdConfig {
|
||||||
|
/** UPSD server host (default: 127.0.0.1) */
|
||||||
|
host: string;
|
||||||
|
/** UPSD server port (default: 3493) */
|
||||||
|
port: number;
|
||||||
|
/** NUT device name (default: 'ups') */
|
||||||
|
upsName: string;
|
||||||
|
/** Connection timeout in milliseconds (default: 5000) */
|
||||||
|
timeout: number;
|
||||||
|
/** Optional username for authentication */
|
||||||
|
username?: string;
|
||||||
|
/** Optional password for authentication */
|
||||||
|
password?: string;
|
||||||
|
}
|
||||||
@@ -1,15 +0,0 @@
|
|||||||
{
|
|
||||||
"compilerOptions": {
|
|
||||||
"experimentalDecorators": true,
|
|
||||||
"emitDecoratorMetadata": true,
|
|
||||||
"useDefineForClassFields": false,
|
|
||||||
"target": "ES2022",
|
|
||||||
"module": "NodeNext",
|
|
||||||
"moduleResolution": "NodeNext",
|
|
||||||
"esModuleInterop": true,
|
|
||||||
"verbatimModuleSyntax": true
|
|
||||||
},
|
|
||||||
"exclude": [
|
|
||||||
"dist_*/**/*.d.ts"
|
|
||||||
]
|
|
||||||
}
|
|
||||||
Reference in New Issue
Block a user